From 6822ae36172ef542120a3edf05f714fe71fa9bb2 Mon Sep 17 00:00:00 2001 From: "Oscar J. Rodriguez B" <josuer08@gmail.com> Date: Tue, 10 Sep 2019 10:06:02 -0400 Subject: [PATCH] commit inicial --- Resources in use.md | 20 + adminlte | 0 bootstrapbootswatch | 0 ejsexpressnode | 0 node_modules/.bin/mime | 1 + node_modules/accepts/HISTORY.md | 236 + node_modules/accepts/LICENSE | 23 + node_modules/accepts/README.md | 142 + node_modules/accepts/index.js | 238 + node_modules/accepts/package.json | 86 + node_modules/array-flatten/LICENSE | 21 + node_modules/array-flatten/README.md | 43 + node_modules/array-flatten/array-flatten.js | 64 + node_modules/array-flatten/package.json | 64 + node_modules/body-parser/HISTORY.md | 609 ++ node_modules/body-parser/LICENSE | 23 + node_modules/body-parser/README.md | 443 + node_modules/body-parser/index.js | 157 + node_modules/body-parser/lib/read.js | 181 + node_modules/body-parser/lib/types/json.js | 230 + node_modules/body-parser/lib/types/raw.js | 101 + node_modules/body-parser/lib/types/text.js | 121 + .../body-parser/lib/types/urlencoded.js | 284 + node_modules/body-parser/package.json | 91 + node_modules/bytes/History.md | 87 + node_modules/bytes/LICENSE | 23 + node_modules/bytes/Readme.md | 126 + node_modules/bytes/index.js | 162 + node_modules/bytes/package.json | 84 + node_modules/content-disposition/HISTORY.md | 55 + node_modules/content-disposition/LICENSE | 22 + node_modules/content-disposition/README.md | 148 + node_modules/content-disposition/index.js | 458 + node_modules/content-disposition/package.json | 79 + node_modules/content-type/HISTORY.md | 24 + node_modules/content-type/LICENSE | 22 + node_modules/content-type/README.md | 92 + node_modules/content-type/index.js | 222 + node_modules/content-type/package.json | 76 + node_modules/cookie-signature/.npmignore | 4 + node_modules/cookie-signature/History.md | 38 + node_modules/cookie-signature/Readme.md | 42 + node_modules/cookie-signature/index.js | 51 + node_modules/cookie-signature/package.json | 57 + node_modules/cookie/HISTORY.md | 123 + node_modules/cookie/LICENSE | 24 + node_modules/cookie/README.md | 253 + node_modules/cookie/index.js | 198 + node_modules/cookie/package.json | 78 + node_modules/debug/.coveralls.yml | 1 + node_modules/debug/.eslintrc | 11 + node_modules/debug/.npmignore | 9 + node_modules/debug/.travis.yml | 14 + node_modules/debug/CHANGELOG.md | 362 + node_modules/debug/LICENSE | 19 + node_modules/debug/Makefile | 50 + node_modules/debug/README.md | 312 + node_modules/debug/component.json | 19 + node_modules/debug/karma.conf.js | 70 + node_modules/debug/node.js | 1 + node_modules/debug/package.json | 91 + node_modules/debug/src/browser.js | 185 + node_modules/debug/src/debug.js | 202 + node_modules/debug/src/index.js | 10 + node_modules/debug/src/inspector-log.js | 15 + node_modules/debug/src/node.js | 248 + node_modules/depd/History.md | 96 + node_modules/depd/LICENSE | 22 + node_modules/depd/Readme.md | 280 + node_modules/depd/index.js | 522 ++ node_modules/depd/lib/browser/index.js | 77 + .../depd/lib/compat/callsite-tostring.js | 103 + .../depd/lib/compat/event-listener-count.js | 22 + node_modules/depd/lib/compat/index.js | 79 + node_modules/depd/package.json | 79 + node_modules/destroy/LICENSE | 22 + node_modules/destroy/README.md | 60 + node_modules/destroy/index.js | 75 + node_modules/destroy/package.json | 71 + node_modules/ee-first/LICENSE | 22 + node_modules/ee-first/README.md | 80 + node_modules/ee-first/index.js | 95 + node_modules/ee-first/package.json | 63 + node_modules/ejs/Jakefile | 70 + node_modules/ejs/LICENSE | 202 + node_modules/ejs/README.md | 271 + node_modules/ejs/ejs.js | 1588 ++++ node_modules/ejs/ejs.min.js | 1 + node_modules/ejs/lib/ejs.js | 953 ++ node_modules/ejs/lib/utils.js | 167 + node_modules/ejs/package.json | 80 + node_modules/encodeurl/HISTORY.md | 14 + node_modules/encodeurl/LICENSE | 22 + node_modules/encodeurl/README.md | 128 + node_modules/encodeurl/index.js | 60 + node_modules/encodeurl/package.json | 78 + node_modules/escape-html/LICENSE | 24 + node_modules/escape-html/Readme.md | 43 + node_modules/escape-html/index.js | 78 + node_modules/escape-html/package.json | 59 + node_modules/etag/HISTORY.md | 83 + node_modules/etag/LICENSE | 22 + node_modules/etag/README.md | 159 + node_modules/etag/index.js | 131 + node_modules/etag/package.json | 86 + node_modules/express/History.md | 3477 ++++++++ node_modules/express/LICENSE | 24 + node_modules/express/Readme.md | 155 + node_modules/express/index.js | 11 + node_modules/express/lib/application.js | 644 ++ node_modules/express/lib/express.js | 116 + node_modules/express/lib/middleware/init.js | 43 + node_modules/express/lib/middleware/query.js | 47 + node_modules/express/lib/request.js | 525 ++ node_modules/express/lib/response.js | 1142 +++ node_modules/express/lib/router/index.js | 662 ++ node_modules/express/lib/router/layer.js | 181 + node_modules/express/lib/router/route.js | 216 + node_modules/express/lib/utils.js | 306 + node_modules/express/lib/view.js | 182 + node_modules/express/package.json | 154 + node_modules/finalhandler/HISTORY.md | 187 + node_modules/finalhandler/LICENSE | 22 + node_modules/finalhandler/README.md | 148 + node_modules/finalhandler/index.js | 331 + node_modules/finalhandler/package.json | 80 + node_modules/forwarded/HISTORY.md | 16 + node_modules/forwarded/LICENSE | 22 + node_modules/forwarded/README.md | 57 + node_modules/forwarded/index.js | 76 + node_modules/forwarded/package.json | 78 + node_modules/fresh/HISTORY.md | 70 + node_modules/fresh/LICENSE | 23 + node_modules/fresh/README.md | 119 + node_modules/fresh/index.js | 137 + node_modules/fresh/package.json | 90 + node_modules/http-errors/HISTORY.md | 149 + node_modules/http-errors/LICENSE | 23 + node_modules/http-errors/README.md | 163 + node_modules/http-errors/index.js | 266 + node_modules/http-errors/package.json | 93 + node_modules/iconv-lite/Changelog.md | 162 + node_modules/iconv-lite/LICENSE | 21 + node_modules/iconv-lite/README.md | 156 + .../iconv-lite/encodings/dbcs-codec.js | 555 ++ .../iconv-lite/encodings/dbcs-data.js | 176 + node_modules/iconv-lite/encodings/index.js | 22 + node_modules/iconv-lite/encodings/internal.js | 188 + .../iconv-lite/encodings/sbcs-codec.js | 72 + .../encodings/sbcs-data-generated.js | 451 + .../iconv-lite/encodings/sbcs-data.js | 174 + .../encodings/tables/big5-added.json | 122 + .../iconv-lite/encodings/tables/cp936.json | 264 + .../iconv-lite/encodings/tables/cp949.json | 273 + .../iconv-lite/encodings/tables/cp950.json | 177 + .../iconv-lite/encodings/tables/eucjp.json | 182 + .../encodings/tables/gb18030-ranges.json | 1 + .../encodings/tables/gbk-added.json | 55 + .../iconv-lite/encodings/tables/shiftjis.json | 125 + node_modules/iconv-lite/encodings/utf16.js | 177 + node_modules/iconv-lite/encodings/utf7.js | 290 + node_modules/iconv-lite/lib/bom-handling.js | 52 + node_modules/iconv-lite/lib/extend-node.js | 217 + node_modules/iconv-lite/lib/index.d.ts | 24 + node_modules/iconv-lite/lib/index.js | 153 + node_modules/iconv-lite/lib/streams.js | 121 + node_modules/iconv-lite/package.json | 77 + node_modules/inherits/LICENSE | 16 + node_modules/inherits/README.md | 42 + node_modules/inherits/inherits.js | 7 + node_modules/inherits/inherits_browser.js | 23 + node_modules/inherits/package.json | 61 + node_modules/ipaddr.js/LICENSE | 19 + node_modules/ipaddr.js/README.md | 233 + node_modules/ipaddr.js/ipaddr.min.js | 1 + node_modules/ipaddr.js/lib/ipaddr.js | 673 ++ node_modules/ipaddr.js/lib/ipaddr.js.d.ts | 71 + node_modules/ipaddr.js/package.json | 69 + node_modules/media-typer/HISTORY.md | 22 + node_modules/media-typer/LICENSE | 22 + node_modules/media-typer/README.md | 81 + node_modules/media-typer/index.js | 270 + node_modules/media-typer/package.json | 61 + node_modules/merge-descriptors/HISTORY.md | 21 + node_modules/merge-descriptors/LICENSE | 23 + node_modules/merge-descriptors/README.md | 48 + node_modules/merge-descriptors/index.js | 60 + node_modules/merge-descriptors/package.json | 69 + node_modules/methods/HISTORY.md | 29 + node_modules/methods/LICENSE | 24 + node_modules/methods/README.md | 51 + node_modules/methods/index.js | 69 + node_modules/methods/package.json | 79 + node_modules/mime-db/HISTORY.md | 417 + node_modules/mime-db/LICENSE | 22 + node_modules/mime-db/README.md | 94 + node_modules/mime-db/db.json | 7834 +++++++++++++++++ node_modules/mime-db/index.js | 11 + node_modules/mime-db/package.json | 101 + node_modules/mime-types/HISTORY.md | 308 + node_modules/mime-types/LICENSE | 23 + node_modules/mime-types/README.md | 113 + node_modules/mime-types/index.js | 188 + node_modules/mime-types/package.json | 87 + node_modules/mime/.npmignore | 0 node_modules/mime/CHANGELOG.md | 164 + node_modules/mime/LICENSE | 21 + node_modules/mime/README.md | 90 + node_modules/mime/cli.js | 8 + node_modules/mime/mime.js | 108 + node_modules/mime/package.json | 73 + node_modules/mime/src/build.js | 53 + node_modules/mime/src/test.js | 60 + node_modules/mime/types.json | 1 + node_modules/ms/index.js | 152 + node_modules/ms/license.md | 21 + node_modules/ms/package.json | 69 + node_modules/ms/readme.md | 51 + node_modules/negotiator/HISTORY.md | 103 + node_modules/negotiator/LICENSE | 24 + node_modules/negotiator/README.md | 203 + node_modules/negotiator/index.js | 124 + node_modules/negotiator/lib/charset.js | 169 + node_modules/negotiator/lib/encoding.js | 184 + node_modules/negotiator/lib/language.js | 179 + node_modules/negotiator/lib/mediaType.js | 294 + node_modules/negotiator/package.json | 84 + node_modules/on-finished/HISTORY.md | 88 + node_modules/on-finished/LICENSE | 23 + node_modules/on-finished/README.md | 154 + node_modules/on-finished/index.js | 196 + node_modules/on-finished/package.json | 73 + node_modules/parseurl/HISTORY.md | 58 + node_modules/parseurl/LICENSE | 24 + node_modules/parseurl/README.md | 133 + node_modules/parseurl/index.js | 158 + node_modules/parseurl/package.json | 81 + node_modules/path-to-regexp/History.md | 36 + node_modules/path-to-regexp/LICENSE | 21 + node_modules/path-to-regexp/Readme.md | 35 + node_modules/path-to-regexp/index.js | 129 + node_modules/path-to-regexp/package.json | 59 + node_modules/proxy-addr/HISTORY.md | 150 + node_modules/proxy-addr/LICENSE | 22 + node_modules/proxy-addr/README.md | 155 + node_modules/proxy-addr/index.js | 327 + node_modules/proxy-addr/package.json | 82 + node_modules/qs/.editorconfig | 30 + node_modules/qs/.eslintignore | 1 + node_modules/qs/.eslintrc | 21 + node_modules/qs/CHANGELOG.md | 256 + node_modules/qs/LICENSE | 28 + node_modules/qs/README.md | 570 ++ node_modules/qs/dist/qs.js | 782 ++ node_modules/qs/lib/formats.js | 18 + node_modules/qs/lib/index.js | 11 + node_modules/qs/lib/parse.js | 242 + node_modules/qs/lib/stringify.js | 269 + node_modules/qs/lib/utils.js | 230 + node_modules/qs/package.json | 87 + node_modules/qs/test/.eslintrc | 17 + node_modules/qs/test/index.js | 7 + node_modules/qs/test/parse.js | 676 ++ node_modules/qs/test/stringify.js | 679 ++ node_modules/qs/test/utils.js | 136 + node_modules/range-parser/HISTORY.md | 56 + node_modules/range-parser/LICENSE | 23 + node_modules/range-parser/README.md | 84 + node_modules/range-parser/index.js | 162 + node_modules/range-parser/package.json | 91 + node_modules/raw-body/HISTORY.md | 270 + node_modules/raw-body/LICENSE | 22 + node_modules/raw-body/README.md | 219 + node_modules/raw-body/index.d.ts | 87 + node_modules/raw-body/index.js | 286 + node_modules/raw-body/package.json | 90 + node_modules/safe-buffer/LICENSE | 21 + node_modules/safe-buffer/README.md | 584 ++ node_modules/safe-buffer/index.d.ts | 187 + node_modules/safe-buffer/index.js | 62 + node_modules/safe-buffer/package.json | 63 + node_modules/safer-buffer/LICENSE | 21 + node_modules/safer-buffer/Porting-Buffer.md | 268 + node_modules/safer-buffer/Readme.md | 156 + node_modules/safer-buffer/dangerous.js | 58 + node_modules/safer-buffer/package.json | 60 + node_modules/safer-buffer/safer.js | 77 + node_modules/safer-buffer/tests.js | 406 + node_modules/send/HISTORY.md | 496 ++ node_modules/send/LICENSE | 23 + node_modules/send/README.md | 329 + node_modules/send/index.js | 1129 +++ node_modules/send/node_modules/ms/index.js | 162 + node_modules/send/node_modules/ms/license.md | 21 + .../send/node_modules/ms/package.json | 69 + node_modules/send/node_modules/ms/readme.md | 60 + node_modules/send/package.json | 106 + node_modules/serve-static/HISTORY.md | 451 + node_modules/serve-static/LICENSE | 25 + node_modules/serve-static/README.md | 259 + node_modules/serve-static/index.js | 210 + node_modules/serve-static/package.json | 77 + node_modules/setprototypeof/LICENSE | 13 + node_modules/setprototypeof/README.md | 31 + node_modules/setprototypeof/index.d.ts | 2 + node_modules/setprototypeof/index.js | 17 + node_modules/setprototypeof/package.json | 64 + node_modules/setprototypeof/test/index.js | 24 + node_modules/statuses/HISTORY.md | 65 + node_modules/statuses/LICENSE | 23 + node_modules/statuses/README.md | 127 + node_modules/statuses/codes.json | 66 + node_modules/statuses/index.js | 113 + node_modules/statuses/package.json | 90 + node_modules/toidentifier/LICENSE | 21 + node_modules/toidentifier/README.md | 61 + node_modules/toidentifier/index.js | 30 + node_modules/toidentifier/package.json | 76 + node_modules/type-is/HISTORY.md | 259 + node_modules/type-is/LICENSE | 23 + node_modules/type-is/README.md | 170 + node_modules/type-is/index.js | 266 + node_modules/type-is/package.json | 85 + node_modules/unpipe/HISTORY.md | 4 + node_modules/unpipe/LICENSE | 22 + node_modules/unpipe/README.md | 43 + node_modules/unpipe/index.js | 69 + node_modules/unpipe/package.json | 63 + node_modules/utils-merge/.npmignore | 9 + node_modules/utils-merge/LICENSE | 20 + node_modules/utils-merge/README.md | 34 + node_modules/utils-merge/index.js | 23 + node_modules/utils-merge/package.json | 66 + node_modules/vary/HISTORY.md | 39 + node_modules/vary/LICENSE | 22 + node_modules/vary/README.md | 101 + node_modules/vary/index.js | 149 + node_modules/vary/package.json | 78 + package-lock.json | 379 + package.json | 17 + partials/footer.ejs | 2 + partials/head.ejs | 9 + partials/header.ejs | 7 + src/index.js | 25 + src/routes/index.js | 69 + src/views/flex.ejs | 196 + src/views/index.ejs | 170 + src/views/web.ejs | 34 + styles/main.css | 47 + 349 files changed, 57488 insertions(+) create mode 100644 Resources in use.md create mode 100644 adminlte create mode 100644 bootstrapbootswatch create mode 100644 ejsexpressnode create mode 120000 node_modules/.bin/mime create mode 100644 node_modules/accepts/HISTORY.md create mode 100644 node_modules/accepts/LICENSE create mode 100644 node_modules/accepts/README.md create mode 100644 node_modules/accepts/index.js create mode 100644 node_modules/accepts/package.json create mode 100644 node_modules/array-flatten/LICENSE create mode 100644 node_modules/array-flatten/README.md create mode 100644 node_modules/array-flatten/array-flatten.js create mode 100644 node_modules/array-flatten/package.json create mode 100644 node_modules/body-parser/HISTORY.md create mode 100644 node_modules/body-parser/LICENSE create mode 100644 node_modules/body-parser/README.md create mode 100644 node_modules/body-parser/index.js create mode 100644 node_modules/body-parser/lib/read.js create mode 100644 node_modules/body-parser/lib/types/json.js create mode 100644 node_modules/body-parser/lib/types/raw.js create mode 100644 node_modules/body-parser/lib/types/text.js create mode 100644 node_modules/body-parser/lib/types/urlencoded.js create mode 100644 node_modules/body-parser/package.json create mode 100644 node_modules/bytes/History.md create mode 100644 node_modules/bytes/LICENSE create mode 100644 node_modules/bytes/Readme.md create mode 100644 node_modules/bytes/index.js create mode 100644 node_modules/bytes/package.json create mode 100644 node_modules/content-disposition/HISTORY.md create mode 100644 node_modules/content-disposition/LICENSE create mode 100644 node_modules/content-disposition/README.md create mode 100644 node_modules/content-disposition/index.js create mode 100644 node_modules/content-disposition/package.json create mode 100644 node_modules/content-type/HISTORY.md create mode 100644 node_modules/content-type/LICENSE create mode 100644 node_modules/content-type/README.md create mode 100644 node_modules/content-type/index.js create mode 100644 node_modules/content-type/package.json create mode 100644 node_modules/cookie-signature/.npmignore create mode 100644 node_modules/cookie-signature/History.md create mode 100644 node_modules/cookie-signature/Readme.md create mode 100644 node_modules/cookie-signature/index.js create mode 100644 node_modules/cookie-signature/package.json create mode 100644 node_modules/cookie/HISTORY.md create mode 100644 node_modules/cookie/LICENSE create mode 100644 node_modules/cookie/README.md create mode 100644 node_modules/cookie/index.js create mode 100644 node_modules/cookie/package.json create mode 100644 node_modules/debug/.coveralls.yml create mode 100644 node_modules/debug/.eslintrc create mode 100644 node_modules/debug/.npmignore create mode 100644 node_modules/debug/.travis.yml create mode 100644 node_modules/debug/CHANGELOG.md create mode 100644 node_modules/debug/LICENSE create mode 100644 node_modules/debug/Makefile create mode 100644 node_modules/debug/README.md create mode 100644 node_modules/debug/component.json create mode 100644 node_modules/debug/karma.conf.js create mode 100644 node_modules/debug/node.js create mode 100644 node_modules/debug/package.json create mode 100644 node_modules/debug/src/browser.js create mode 100644 node_modules/debug/src/debug.js create mode 100644 node_modules/debug/src/index.js create mode 100644 node_modules/debug/src/inspector-log.js create mode 100644 node_modules/debug/src/node.js create mode 100644 node_modules/depd/History.md create mode 100644 node_modules/depd/LICENSE create mode 100644 node_modules/depd/Readme.md create mode 100644 node_modules/depd/index.js create mode 100644 node_modules/depd/lib/browser/index.js create mode 100644 node_modules/depd/lib/compat/callsite-tostring.js create mode 100644 node_modules/depd/lib/compat/event-listener-count.js create mode 100644 node_modules/depd/lib/compat/index.js create mode 100644 node_modules/depd/package.json create mode 100644 node_modules/destroy/LICENSE create mode 100644 node_modules/destroy/README.md create mode 100644 node_modules/destroy/index.js create mode 100644 node_modules/destroy/package.json create mode 100644 node_modules/ee-first/LICENSE create mode 100644 node_modules/ee-first/README.md create mode 100644 node_modules/ee-first/index.js create mode 100644 node_modules/ee-first/package.json create mode 100644 node_modules/ejs/Jakefile create mode 100644 node_modules/ejs/LICENSE create mode 100644 node_modules/ejs/README.md create mode 100644 node_modules/ejs/ejs.js create mode 100644 node_modules/ejs/ejs.min.js create mode 100755 node_modules/ejs/lib/ejs.js create mode 100644 node_modules/ejs/lib/utils.js create mode 100644 node_modules/ejs/package.json create mode 100644 node_modules/encodeurl/HISTORY.md create mode 100644 node_modules/encodeurl/LICENSE create mode 100644 node_modules/encodeurl/README.md create mode 100644 node_modules/encodeurl/index.js create mode 100644 node_modules/encodeurl/package.json create mode 100644 node_modules/escape-html/LICENSE create mode 100644 node_modules/escape-html/Readme.md create mode 100644 node_modules/escape-html/index.js create mode 100644 node_modules/escape-html/package.json create mode 100644 node_modules/etag/HISTORY.md create mode 100644 node_modules/etag/LICENSE create mode 100644 node_modules/etag/README.md create mode 100644 node_modules/etag/index.js create mode 100644 node_modules/etag/package.json create mode 100644 node_modules/express/History.md create mode 100644 node_modules/express/LICENSE create mode 100644 node_modules/express/Readme.md create mode 100644 node_modules/express/index.js create mode 100644 node_modules/express/lib/application.js create mode 100644 node_modules/express/lib/express.js create mode 100644 node_modules/express/lib/middleware/init.js create mode 100644 node_modules/express/lib/middleware/query.js create mode 100644 node_modules/express/lib/request.js create mode 100644 node_modules/express/lib/response.js create mode 100644 node_modules/express/lib/router/index.js create mode 100644 node_modules/express/lib/router/layer.js create mode 100644 node_modules/express/lib/router/route.js create mode 100644 node_modules/express/lib/utils.js create mode 100644 node_modules/express/lib/view.js create mode 100644 node_modules/express/package.json create mode 100644 node_modules/finalhandler/HISTORY.md create mode 100644 node_modules/finalhandler/LICENSE create mode 100644 node_modules/finalhandler/README.md create mode 100644 node_modules/finalhandler/index.js create mode 100644 node_modules/finalhandler/package.json create mode 100644 node_modules/forwarded/HISTORY.md create mode 100644 node_modules/forwarded/LICENSE create mode 100644 node_modules/forwarded/README.md create mode 100644 node_modules/forwarded/index.js create mode 100644 node_modules/forwarded/package.json create mode 100644 node_modules/fresh/HISTORY.md create mode 100644 node_modules/fresh/LICENSE create mode 100644 node_modules/fresh/README.md create mode 100644 node_modules/fresh/index.js create mode 100644 node_modules/fresh/package.json create mode 100644 node_modules/http-errors/HISTORY.md create mode 100644 node_modules/http-errors/LICENSE create mode 100644 node_modules/http-errors/README.md create mode 100644 node_modules/http-errors/index.js create mode 100644 node_modules/http-errors/package.json create mode 100644 node_modules/iconv-lite/Changelog.md create mode 100644 node_modules/iconv-lite/LICENSE create mode 100644 node_modules/iconv-lite/README.md create mode 100644 node_modules/iconv-lite/encodings/dbcs-codec.js create mode 100644 node_modules/iconv-lite/encodings/dbcs-data.js create mode 100644 node_modules/iconv-lite/encodings/index.js create mode 100644 node_modules/iconv-lite/encodings/internal.js create mode 100644 node_modules/iconv-lite/encodings/sbcs-codec.js create mode 100644 node_modules/iconv-lite/encodings/sbcs-data-generated.js create mode 100644 node_modules/iconv-lite/encodings/sbcs-data.js create mode 100644 node_modules/iconv-lite/encodings/tables/big5-added.json create mode 100644 node_modules/iconv-lite/encodings/tables/cp936.json create mode 100644 node_modules/iconv-lite/encodings/tables/cp949.json create mode 100644 node_modules/iconv-lite/encodings/tables/cp950.json create mode 100644 node_modules/iconv-lite/encodings/tables/eucjp.json create mode 100644 node_modules/iconv-lite/encodings/tables/gb18030-ranges.json create mode 100644 node_modules/iconv-lite/encodings/tables/gbk-added.json create mode 100644 node_modules/iconv-lite/encodings/tables/shiftjis.json create mode 100644 node_modules/iconv-lite/encodings/utf16.js create mode 100644 node_modules/iconv-lite/encodings/utf7.js create mode 100644 node_modules/iconv-lite/lib/bom-handling.js create mode 100644 node_modules/iconv-lite/lib/extend-node.js create mode 100644 node_modules/iconv-lite/lib/index.d.ts create mode 100644 node_modules/iconv-lite/lib/index.js create mode 100644 node_modules/iconv-lite/lib/streams.js create mode 100644 node_modules/iconv-lite/package.json create mode 100644 node_modules/inherits/LICENSE create mode 100644 node_modules/inherits/README.md create mode 100644 node_modules/inherits/inherits.js create mode 100644 node_modules/inherits/inherits_browser.js create mode 100644 node_modules/inherits/package.json create mode 100644 node_modules/ipaddr.js/LICENSE create mode 100644 node_modules/ipaddr.js/README.md create mode 100644 node_modules/ipaddr.js/ipaddr.min.js create mode 100644 node_modules/ipaddr.js/lib/ipaddr.js create mode 100644 node_modules/ipaddr.js/lib/ipaddr.js.d.ts create mode 100644 node_modules/ipaddr.js/package.json create mode 100644 node_modules/media-typer/HISTORY.md create mode 100644 node_modules/media-typer/LICENSE create mode 100644 node_modules/media-typer/README.md create mode 100644 node_modules/media-typer/index.js create mode 100644 node_modules/media-typer/package.json create mode 100644 node_modules/merge-descriptors/HISTORY.md create mode 100644 node_modules/merge-descriptors/LICENSE create mode 100644 node_modules/merge-descriptors/README.md create mode 100644 node_modules/merge-descriptors/index.js create mode 100644 node_modules/merge-descriptors/package.json create mode 100644 node_modules/methods/HISTORY.md create mode 100644 node_modules/methods/LICENSE create mode 100644 node_modules/methods/README.md create mode 100644 node_modules/methods/index.js create mode 100644 node_modules/methods/package.json create mode 100644 node_modules/mime-db/HISTORY.md create mode 100644 node_modules/mime-db/LICENSE create mode 100644 node_modules/mime-db/README.md create mode 100644 node_modules/mime-db/db.json create mode 100644 node_modules/mime-db/index.js create mode 100644 node_modules/mime-db/package.json create mode 100644 node_modules/mime-types/HISTORY.md create mode 100644 node_modules/mime-types/LICENSE create mode 100644 node_modules/mime-types/README.md create mode 100644 node_modules/mime-types/index.js create mode 100644 node_modules/mime-types/package.json create mode 100644 node_modules/mime/.npmignore create mode 100644 node_modules/mime/CHANGELOG.md create mode 100644 node_modules/mime/LICENSE create mode 100644 node_modules/mime/README.md create mode 100755 node_modules/mime/cli.js create mode 100644 node_modules/mime/mime.js create mode 100644 node_modules/mime/package.json create mode 100755 node_modules/mime/src/build.js create mode 100644 node_modules/mime/src/test.js create mode 100644 node_modules/mime/types.json create mode 100644 node_modules/ms/index.js create mode 100644 node_modules/ms/license.md create mode 100644 node_modules/ms/package.json create mode 100644 node_modules/ms/readme.md create mode 100644 node_modules/negotiator/HISTORY.md create mode 100644 node_modules/negotiator/LICENSE create mode 100644 node_modules/negotiator/README.md create mode 100644 node_modules/negotiator/index.js create mode 100644 node_modules/negotiator/lib/charset.js create mode 100644 node_modules/negotiator/lib/encoding.js create mode 100644 node_modules/negotiator/lib/language.js create mode 100644 node_modules/negotiator/lib/mediaType.js create mode 100644 node_modules/negotiator/package.json create mode 100644 node_modules/on-finished/HISTORY.md create mode 100644 node_modules/on-finished/LICENSE create mode 100644 node_modules/on-finished/README.md create mode 100644 node_modules/on-finished/index.js create mode 100644 node_modules/on-finished/package.json create mode 100644 node_modules/parseurl/HISTORY.md create mode 100644 node_modules/parseurl/LICENSE create mode 100644 node_modules/parseurl/README.md create mode 100644 node_modules/parseurl/index.js create mode 100644 node_modules/parseurl/package.json create mode 100644 node_modules/path-to-regexp/History.md create mode 100644 node_modules/path-to-regexp/LICENSE create mode 100644 node_modules/path-to-regexp/Readme.md create mode 100644 node_modules/path-to-regexp/index.js create mode 100644 node_modules/path-to-regexp/package.json create mode 100644 node_modules/proxy-addr/HISTORY.md create mode 100644 node_modules/proxy-addr/LICENSE create mode 100644 node_modules/proxy-addr/README.md create mode 100644 node_modules/proxy-addr/index.js create mode 100644 node_modules/proxy-addr/package.json create mode 100644 node_modules/qs/.editorconfig create mode 100644 node_modules/qs/.eslintignore create mode 100644 node_modules/qs/.eslintrc create mode 100644 node_modules/qs/CHANGELOG.md create mode 100644 node_modules/qs/LICENSE create mode 100644 node_modules/qs/README.md create mode 100644 node_modules/qs/dist/qs.js create mode 100644 node_modules/qs/lib/formats.js create mode 100644 node_modules/qs/lib/index.js create mode 100644 node_modules/qs/lib/parse.js create mode 100644 node_modules/qs/lib/stringify.js create mode 100644 node_modules/qs/lib/utils.js create mode 100644 node_modules/qs/package.json create mode 100644 node_modules/qs/test/.eslintrc create mode 100644 node_modules/qs/test/index.js create mode 100644 node_modules/qs/test/parse.js create mode 100644 node_modules/qs/test/stringify.js create mode 100644 node_modules/qs/test/utils.js create mode 100644 node_modules/range-parser/HISTORY.md create mode 100644 node_modules/range-parser/LICENSE create mode 100644 node_modules/range-parser/README.md create mode 100644 node_modules/range-parser/index.js create mode 100644 node_modules/range-parser/package.json create mode 100644 node_modules/raw-body/HISTORY.md create mode 100644 node_modules/raw-body/LICENSE create mode 100644 node_modules/raw-body/README.md create mode 100644 node_modules/raw-body/index.d.ts create mode 100644 node_modules/raw-body/index.js create mode 100644 node_modules/raw-body/package.json create mode 100644 node_modules/safe-buffer/LICENSE create mode 100644 node_modules/safe-buffer/README.md create mode 100644 node_modules/safe-buffer/index.d.ts create mode 100644 node_modules/safe-buffer/index.js create mode 100644 node_modules/safe-buffer/package.json create mode 100644 node_modules/safer-buffer/LICENSE create mode 100644 node_modules/safer-buffer/Porting-Buffer.md create mode 100644 node_modules/safer-buffer/Readme.md create mode 100644 node_modules/safer-buffer/dangerous.js create mode 100644 node_modules/safer-buffer/package.json create mode 100644 node_modules/safer-buffer/safer.js create mode 100644 node_modules/safer-buffer/tests.js create mode 100644 node_modules/send/HISTORY.md create mode 100644 node_modules/send/LICENSE create mode 100644 node_modules/send/README.md create mode 100644 node_modules/send/index.js create mode 100644 node_modules/send/node_modules/ms/index.js create mode 100644 node_modules/send/node_modules/ms/license.md create mode 100644 node_modules/send/node_modules/ms/package.json create mode 100644 node_modules/send/node_modules/ms/readme.md create mode 100644 node_modules/send/package.json create mode 100644 node_modules/serve-static/HISTORY.md create mode 100644 node_modules/serve-static/LICENSE create mode 100644 node_modules/serve-static/README.md create mode 100644 node_modules/serve-static/index.js create mode 100644 node_modules/serve-static/package.json create mode 100644 node_modules/setprototypeof/LICENSE create mode 100644 node_modules/setprototypeof/README.md create mode 100644 node_modules/setprototypeof/index.d.ts create mode 100644 node_modules/setprototypeof/index.js create mode 100644 node_modules/setprototypeof/package.json create mode 100644 node_modules/setprototypeof/test/index.js create mode 100644 node_modules/statuses/HISTORY.md create mode 100644 node_modules/statuses/LICENSE create mode 100644 node_modules/statuses/README.md create mode 100644 node_modules/statuses/codes.json create mode 100644 node_modules/statuses/index.js create mode 100644 node_modules/statuses/package.json create mode 100644 node_modules/toidentifier/LICENSE create mode 100644 node_modules/toidentifier/README.md create mode 100644 node_modules/toidentifier/index.js create mode 100644 node_modules/toidentifier/package.json create mode 100644 node_modules/type-is/HISTORY.md create mode 100644 node_modules/type-is/LICENSE create mode 100644 node_modules/type-is/README.md create mode 100644 node_modules/type-is/index.js create mode 100644 node_modules/type-is/package.json create mode 100644 node_modules/unpipe/HISTORY.md create mode 100644 node_modules/unpipe/LICENSE create mode 100644 node_modules/unpipe/README.md create mode 100644 node_modules/unpipe/index.js create mode 100644 node_modules/unpipe/package.json create mode 100644 node_modules/utils-merge/.npmignore create mode 100644 node_modules/utils-merge/LICENSE create mode 100644 node_modules/utils-merge/README.md create mode 100644 node_modules/utils-merge/index.js create mode 100644 node_modules/utils-merge/package.json create mode 100644 node_modules/vary/HISTORY.md create mode 100644 node_modules/vary/LICENSE create mode 100644 node_modules/vary/README.md create mode 100644 node_modules/vary/index.js create mode 100644 node_modules/vary/package.json create mode 100644 package-lock.json create mode 100644 package.json create mode 100644 partials/footer.ejs create mode 100644 partials/head.ejs create mode 100644 partials/header.ejs create mode 100644 src/index.js create mode 100644 src/routes/index.js create mode 100644 src/views/flex.ejs create mode 100644 src/views/index.ejs create mode 100644 src/views/web.ejs create mode 100644 styles/main.css diff --git a/Resources in use.md b/Resources in use.md new file mode 100644 index 0000000..7a14333 --- /dev/null +++ b/Resources in use.md @@ -0,0 +1,20 @@ +# Resources in use + ++ [ ] [Bootstrap](https://getbootstrap.com/) nuestra plantilla de estilos principal + ++ [ ] [ExpressJS](https://expressjs.com/) como un enrutador de vistas + ++ [ ] [JQuery](https://jquery.com/) ~~Aun no en uso~~ Es para poder hacer ciertas funciones de forma mas rápida. + ++ [ ] [popper JS](https://popper.js.org/) Un manejador de popUps + ++ [ ] [AdminLTE](https://adminlte.io/) Es una web con miles de elementos prehechos para dashboards + ++ [ ] [Bootswatch](https://bootswatch.com/) Es una web con miles de plantillas basadas en bootstrap + ++ [ ] [EJS](https://ejs.co/) Embedded JavaScript templating, es un motor de vistas para **HTML _Dinámico_** + ++ [ ] [Node.Js](https://nodejs.org/) Es un servidor en base javascript + +# Posible resources + diff --git a/adminlte b/adminlte new file mode 100644 index 0000000..e69de29 diff --git a/bootstrapbootswatch b/bootstrapbootswatch new file mode 100644 index 0000000..e69de29 diff --git a/ejsexpressnode b/ejsexpressnode new file mode 100644 index 0000000..e69de29 diff --git a/node_modules/.bin/mime b/node_modules/.bin/mime new file mode 120000 index 0000000..fbb7ee0 --- /dev/null +++ b/node_modules/.bin/mime @@ -0,0 +1 @@ +../mime/cli.js \ No newline at end of file diff --git a/node_modules/accepts/HISTORY.md b/node_modules/accepts/HISTORY.md new file mode 100644 index 0000000..0bf0417 --- /dev/null +++ b/node_modules/accepts/HISTORY.md @@ -0,0 +1,236 @@ +1.3.7 / 2019-04-29 +================== + + * deps: negotiator@0.6.2 + - Fix sorting charset, encoding, and language with extra parameters + +1.3.6 / 2019-04-28 +================== + + * deps: mime-types@~2.1.24 + - deps: mime-db@~1.40.0 + +1.3.5 / 2018-02-28 +================== + + * deps: mime-types@~2.1.18 + - deps: mime-db@~1.33.0 + +1.3.4 / 2017-08-22 +================== + + * deps: mime-types@~2.1.16 + - deps: mime-db@~1.29.0 + +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/node_modules/accepts/LICENSE b/node_modules/accepts/LICENSE new file mode 100644 index 0000000..0616607 --- /dev/null +++ b/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong <me@jongleberry.com> +Copyright (c) 2015 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/accepts/README.md b/node_modules/accepts/README.md new file mode 100644 index 0000000..66a2f54 --- /dev/null +++ b/node_modules/accepts/README.md @@ -0,0 +1,142 @@ +# accepts + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). +Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` + as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install accepts +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app (req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch (accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('<b>hello, world!</b>') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master +[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master +[node-version-image]: https://badgen.net/npm/node/accepts +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/accepts +[npm-url]: https://npmjs.org/package/accepts +[npm-version-image]: https://badgen.net/npm/v/accepts +[travis-image]: https://badgen.net/travis/jshttp/accepts/master +[travis-url]: https://travis-ci.org/jshttp/accepts diff --git a/node_modules/accepts/index.js b/node_modules/accepts/index.js new file mode 100644 index 0000000..e9b2f63 --- /dev/null +++ b/node_modules/accepts/index.js @@ -0,0 +1,238 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts (req) { + if (!(this instanceof Accepts)) { + return new Accepts(req) + } + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + // no accept header, return first given type + if (!this.headers.accept) { + return types[0] + } + + var mimes = types.map(extToMime) + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)) + var first = accepts[0] + + return first + ? types[mimes.indexOf(first)] + : false +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime (type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime (type) { + return typeof type === 'string' +} diff --git a/node_modules/accepts/package.json b/node_modules/accepts/package.json new file mode 100644 index 0000000..e2d6aed --- /dev/null +++ b/node_modules/accepts/package.json @@ -0,0 +1,86 @@ +{ + "_from": "accepts@~1.3.7", + "_id": "accepts@1.3.7", + "_inBundle": false, + "_integrity": "sha512-Il80Qs2WjYlJIBNzNkK6KYqlVMTbZLXgHx2oT0pU/fjRHyEp+PEfEPY0R3WCwAGVOtauxh1hOxNgIf5bv7dQpA==", + "_location": "/accepts", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "accepts@~1.3.7", + "name": "accepts", + "escapedName": "accepts", + "rawSpec": "~1.3.7", + "saveSpec": null, + "fetchSpec": "~1.3.7" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.7.tgz", + "_shasum": "531bc726517a3b2b41f850021c6cc15eaab507cd", + "_spec": "accepts@~1.3.7", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/accepts/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "mime-types": "~2.1.24", + "negotiator": "0.6.2" + }, + "deprecated": false, + "description": "Higher-level content negotiation", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "mocha": "6.1.4", + "nyc": "14.0.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/accepts#readme", + "keywords": [ + "content", + "negotiation", + "accept", + "accepts" + ], + "license": "MIT", + "name": "accepts", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/accepts.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test" + }, + "version": "1.3.7" +} diff --git a/node_modules/array-flatten/LICENSE b/node_modules/array-flatten/LICENSE new file mode 100644 index 0000000..983fbe8 --- /dev/null +++ b/node_modules/array-flatten/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/array-flatten/README.md b/node_modules/array-flatten/README.md new file mode 100644 index 0000000..91fa5b6 --- /dev/null +++ b/node_modules/array-flatten/README.md @@ -0,0 +1,43 @@ +# Array Flatten + +[![NPM version][npm-image]][npm-url] +[![NPM downloads][downloads-image]][downloads-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] + +> Flatten an array of nested arrays into a single flat array. Accepts an optional depth. + +## Installation + +``` +npm install array-flatten --save +``` + +## Usage + +```javascript +var flatten = require('array-flatten') + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9]) +//=> [1, 2, 3, 4, 5, 6, 7, 8, 9] + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2) +//=> [1, 2, 3, [4, [5], 6], 7, 8, 9] + +(function () { + flatten(arguments) //=> [1, 2, 3] +})(1, [2, 3]) +``` + +## License + +MIT + +[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat +[npm-url]: https://npmjs.org/package/array-flatten +[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat +[downloads-url]: https://npmjs.org/package/array-flatten +[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat +[travis-url]: https://travis-ci.org/blakeembrey/array-flatten +[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat +[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master diff --git a/node_modules/array-flatten/array-flatten.js b/node_modules/array-flatten/array-flatten.js new file mode 100644 index 0000000..089117b --- /dev/null +++ b/node_modules/array-flatten/array-flatten.js @@ -0,0 +1,64 @@ +'use strict' + +/** + * Expose `arrayFlatten`. + */ +module.exports = arrayFlatten + +/** + * Recursive flatten function with depth. + * + * @param {Array} array + * @param {Array} result + * @param {Number} depth + * @return {Array} + */ +function flattenWithDepth (array, result, depth) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (depth > 0 && Array.isArray(value)) { + flattenWithDepth(value, result, depth - 1) + } else { + result.push(value) + } + } + + return result +} + +/** + * Recursive flatten function. Omitting depth is slightly faster. + * + * @param {Array} array + * @param {Array} result + * @return {Array} + */ +function flattenForever (array, result) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (Array.isArray(value)) { + flattenForever(value, result) + } else { + result.push(value) + } + } + + return result +} + +/** + * Flatten an array, with the ability to define a depth. + * + * @param {Array} array + * @param {Number} depth + * @return {Array} + */ +function arrayFlatten (array, depth) { + if (depth == null) { + return flattenForever(array, []) + } + + return flattenWithDepth(array, [], depth) +} diff --git a/node_modules/array-flatten/package.json b/node_modules/array-flatten/package.json new file mode 100644 index 0000000..d86873f --- /dev/null +++ b/node_modules/array-flatten/package.json @@ -0,0 +1,64 @@ +{ + "_from": "array-flatten@1.1.1", + "_id": "array-flatten@1.1.1", + "_inBundle": false, + "_integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=", + "_location": "/array-flatten", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "array-flatten@1.1.1", + "name": "array-flatten", + "escapedName": "array-flatten", + "rawSpec": "1.1.1", + "saveSpec": null, + "fetchSpec": "1.1.1" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "_shasum": "9a5f699051b1e7073328f2a008968b64ea2955d2", + "_spec": "array-flatten@1.1.1", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Blake Embrey", + "email": "hello@blakeembrey.com", + "url": "http://blakeembrey.me" + }, + "bugs": { + "url": "https://github.com/blakeembrey/array-flatten/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Flatten an array of nested arrays into a single flat array", + "devDependencies": { + "istanbul": "^0.3.13", + "mocha": "^2.2.4", + "pre-commit": "^1.0.7", + "standard": "^3.7.3" + }, + "files": [ + "array-flatten.js", + "LICENSE" + ], + "homepage": "https://github.com/blakeembrey/array-flatten", + "keywords": [ + "array", + "flatten", + "arguments", + "depth" + ], + "license": "MIT", + "main": "array-flatten.js", + "name": "array-flatten", + "repository": { + "type": "git", + "url": "git://github.com/blakeembrey/array-flatten.git" + }, + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "version": "1.1.1" +} diff --git a/node_modules/body-parser/HISTORY.md b/node_modules/body-parser/HISTORY.md new file mode 100644 index 0000000..a1d3fbf --- /dev/null +++ b/node_modules/body-parser/HISTORY.md @@ -0,0 +1,609 @@ +1.19.0 / 2019-04-25 +=================== + + * deps: bytes@3.1.0 + - Add petabyte (`pb`) support + * deps: http-errors@1.7.2 + - Set constructor name when possible + - deps: setprototypeof@1.1.1 + - deps: statuses@'>= 1.5.0 < 2' + * deps: iconv-lite@0.4.24 + - Added encoding MIK + * deps: qs@6.7.0 + - Fix parsing array brackets after index + * deps: raw-body@2.4.0 + - deps: bytes@3.1.0 + - deps: http-errors@1.7.2 + - deps: iconv-lite@0.4.24 + * deps: type-is@~1.6.17 + - deps: mime-types@~2.1.24 + - perf: prevent internal `throw` on invalid type + +1.18.3 / 2018-05-14 +=================== + + * Fix stack trace for strict json parse error + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: http-errors@~1.6.3 + - deps: depd@~1.1.2 + - deps: setprototypeof@1.1.0 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.23 + - Fix loading encoding with year appended + - Fix deprecation warnings on Node.js 10+ + * deps: qs@6.5.2 + * deps: raw-body@2.3.3 + - deps: http-errors@1.6.3 + - deps: iconv-lite@0.4.23 + * deps: type-is@~1.6.16 + - deps: mime-types@~2.1.18 + +1.18.2 / 2017-09-22 +=================== + + * deps: debug@2.6.9 + * perf: remove argument reassignment + +1.18.1 / 2017-09-12 +=================== + + * deps: content-type@~1.0.4 + - perf: remove argument reassignment + - perf: skip parameter parsing when no parameters + * deps: iconv-lite@0.4.19 + - Fix ISO-8859-1 regression + - Update Windows-1255 + * deps: qs@6.5.1 + - Fix parsing & compacting very deep objects + * deps: raw-body@2.3.2 + - deps: iconv-lite@0.4.19 + +1.18.0 / 2017-09-08 +=================== + + * Fix JSON strict violation error to match native parse error + * Include the `body` property on verify errors + * Include the `type` property on all generated errors + * Use `http-errors` to set status code on errors + * deps: bytes@3.0.0 + * deps: debug@2.6.8 + * deps: depd@~1.1.1 + - Remove unnecessary `Buffer` loading + * deps: http-errors@~1.6.2 + - deps: depd@1.1.1 + * deps: iconv-lite@0.4.18 + - Add support for React Native + - Add a warning if not loaded as utf-8 + - Fix CESU-8 decoding in Node.js 8 + - Improve speed of ISO-8859-1 encoding + * deps: qs@6.5.0 + * deps: raw-body@2.3.1 + - Use `http-errors` for standard emitted errors + - deps: bytes@3.0.0 + - deps: iconv-lite@0.4.18 + - perf: skip buffer decoding on overage chunk + * perf: prevent internal `throw` when missing charset + +1.17.2 / 2017-05-17 +=================== + + * deps: debug@2.6.7 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@2.0.0 + * deps: type-is@~1.6.15 + - deps: mime-types@~2.1.15 + +1.17.1 / 2017-03-06 +=================== + + * deps: qs@6.4.0 + - Fix regression parsing keys starting with `[` + +1.17.0 / 2017-03-01 +=================== + + * deps: http-errors@~1.6.1 + - Make `message` property enumerable for `HttpError`s + - deps: setprototypeof@1.0.3 + * deps: qs@6.3.1 + - Fix compacting nested arrays + +1.16.1 / 2017-02-10 +=================== + + * deps: debug@2.6.1 + - Fix deprecation messages in WebStorm and other editors + - Undeprecate `DEBUG_FD` set to `1` or `2` + +1.16.0 / 2017-01-17 +=================== + + * deps: debug@2.6.0 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: http-errors@~1.5.1 + - deps: inherits@2.0.3 + - deps: setprototypeof@1.0.2 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.15 + - Added encoding MS-31J + - Added encoding MS-932 + - Added encoding MS-936 + - Added encoding MS-949 + - Added encoding MS-950 + - Fix GBK/GB18030 handling of Euro character + * deps: qs@6.2.1 + - Fix array parsing from skipping empty values + * deps: raw-body@~2.2.0 + - deps: iconv-lite@0.4.15 + * deps: type-is@~1.6.14 + - deps: mime-types@~2.1.13 + +1.15.2 / 2016-06-19 +=================== + + * deps: bytes@2.4.0 + * deps: content-type@~1.0.2 + - perf: enable strict mode + * deps: http-errors@~1.5.0 + - Use `setprototypeof` module to replace `__proto__` setting + - deps: statuses@'>= 1.3.0 < 2' + - perf: enable strict mode + * deps: qs@6.2.0 + * deps: raw-body@~2.1.7 + - deps: bytes@2.4.0 + - perf: remove double-cleanup on happy path + * deps: type-is@~1.6.13 + - deps: mime-types@~2.1.11 + +1.15.1 / 2016-05-05 +=================== + + * deps: bytes@2.3.0 + - Drop partial bytes on all parsed units + - Fix parsing byte string that looks like hex + * deps: raw-body@~2.1.6 + - deps: bytes@2.3.0 + * deps: type-is@~1.6.12 + - deps: mime-types@~2.1.10 + +1.15.0 / 2016-02-10 +=================== + + * deps: http-errors@~1.4.0 + - Add `HttpError` export, for `err instanceof createError.HttpError` + - deps: inherits@2.0.1 + - deps: statuses@'>= 1.2.1 < 2' + * deps: qs@6.1.0 + * deps: type-is@~1.6.11 + - deps: mime-types@~2.1.9 + +1.14.2 / 2015-12-16 +=================== + + * deps: bytes@2.2.0 + * deps: iconv-lite@0.4.13 + * deps: qs@5.2.0 + * deps: raw-body@~2.1.5 + - deps: bytes@2.2.0 + - deps: iconv-lite@0.4.13 + * deps: type-is@~1.6.10 + - deps: mime-types@~2.1.8 + +1.14.1 / 2015-09-27 +=================== + + * Fix issue where invalid charset results in 400 when `verify` used + * deps: iconv-lite@0.4.12 + - Fix CESU-8 decoding in Node.js 4.x + * deps: raw-body@~2.1.4 + - Fix masking critical errors from `iconv-lite` + - deps: iconv-lite@0.4.12 + * deps: type-is@~1.6.9 + - deps: mime-types@~2.1.7 + +1.14.0 / 2015-09-16 +=================== + + * Fix JSON strict parse error to match syntax errors + * Provide static `require` analysis in `urlencoded` parser + * deps: depd@~1.1.0 + - Support web browser loading + * deps: qs@5.1.0 + * deps: raw-body@~2.1.3 + - Fix sync callback when attaching data listener causes sync read + * deps: type-is@~1.6.8 + - Fix type error when given invalid type to match against + - deps: mime-types@~2.1.6 + +1.13.3 / 2015-07-31 +=================== + + * deps: type-is@~1.6.6 + - deps: mime-types@~2.1.4 + +1.13.2 / 2015-07-05 +=================== + + * deps: iconv-lite@0.4.11 + * deps: qs@4.0.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix user-visible incompatibilities from 3.1.0 + - Fix various parsing edge cases + * deps: raw-body@~2.1.2 + - Fix error stack traces to skip `makeError` + - deps: iconv-lite@0.4.11 + * deps: type-is@~1.6.4 + - deps: mime-types@~2.1.2 + - perf: enable strict mode + - perf: remove argument reassignment + +1.13.1 / 2015-06-16 +=================== + + * deps: qs@2.4.2 + - Downgraded from 3.1.0 because of user-visible incompatibilities + +1.13.0 / 2015-06-14 +=================== + + * Add `statusCode` property on `Error`s, in addition to `status` + * Change `type` default to `application/json` for JSON parser + * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser + * Provide static `require` analysis + * Use the `http-errors` module to generate errors + * deps: bytes@2.1.0 + - Slight optimizations + * deps: iconv-lite@0.4.10 + - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails + - Leading BOM is now removed when decoding + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * deps: qs@3.1.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix various parsing edge cases + - Parsed object now has `null` prototype + * deps: raw-body@~2.1.1 + - Use `unpipe` module for unpiping requests + - deps: iconv-lite@0.4.10 + * deps: type-is@~1.6.3 + - deps: mime-types@~2.1.1 + - perf: reduce try block size + - perf: remove bitwise operations + * perf: enable strict mode + * perf: remove argument reassignment + * perf: remove delete call + +1.12.4 / 2015-05-10 +=================== + + * deps: debug@~2.2.0 + * deps: qs@2.4.2 + - Fix allowing parameters like `constructor` + * deps: on-finished@~2.2.1 + * deps: raw-body@~2.0.1 + - Fix a false-positive when unpiping in Node.js 0.8 + - deps: bytes@2.0.1 + * deps: type-is@~1.6.2 + - deps: mime-types@~2.0.11 + +1.12.3 / 2015-04-15 +=================== + + * Slight efficiency improvement when not debugging + * deps: depd@~1.0.1 + * deps: iconv-lite@0.4.8 + - Add encoding alias UNICODE-1-1-UTF-7 + * deps: raw-body@1.3.4 + - Fix hanging callback if request aborts during read + - deps: iconv-lite@0.4.8 + +1.12.2 / 2015-03-16 +=================== + + * deps: qs@2.4.1 + - Fix error when parameter `hasOwnProperty` is present + +1.12.1 / 2015-03-15 +=================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: type-is@~1.6.1 + - deps: mime-types@~2.0.10 + +1.12.0 / 2015-02-13 +=================== + + * add `debug` messages + * accept a function for the `type` option + * use `content-type` to parse `Content-Type` headers + * deps: iconv-lite@0.4.7 + - Gracefully support enumerables on `Object.prototype` + * deps: raw-body@1.3.3 + - deps: iconv-lite@0.4.7 + * deps: type-is@~1.6.0 + - fix argument reassignment + - fix false-positives in `hasBody` `Transfer-Encoding` check + - support wildcard for both type and subtype (`*/*`) + - deps: mime-types@~2.0.9 + +1.11.0 / 2015-01-30 +=================== + + * make internal `extended: true` depth limit infinity + * deps: type-is@~1.5.6 + - deps: mime-types@~2.0.8 + +1.10.2 / 2015-01-20 +=================== + + * deps: iconv-lite@0.4.6 + - Fix rare aliases of single-byte encodings + * deps: raw-body@1.3.2 + - deps: iconv-lite@0.4.6 + +1.10.1 / 2015-01-01 +=================== + + * deps: on-finished@~2.2.0 + * deps: type-is@~1.5.5 + - deps: mime-types@~2.0.7 + +1.10.0 / 2014-12-02 +=================== + + * make internal `extended: true` array limit dynamic + +1.9.3 / 2014-11-21 +================== + + * deps: iconv-lite@0.4.5 + - Fix Windows-31J and X-SJIS encoding support + * deps: qs@2.3.3 + - Fix `arrayLimit` behavior + * deps: raw-body@1.3.1 + - deps: iconv-lite@0.4.5 + * deps: type-is@~1.5.3 + - deps: mime-types@~2.0.3 + +1.9.2 / 2014-10-27 +================== + + * deps: qs@2.3.2 + - Fix parsing of mixed objects and values + +1.9.1 / 2014-10-22 +================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + * deps: qs@2.3.0 + - Fix parsing of mixed implicit and explicit arrays + * deps: type-is@~1.5.2 + - deps: mime-types@~2.0.2 + +1.9.0 / 2014-09-24 +================== + + * include the charset in "unsupported charset" error message + * include the encoding in "unsupported content encoding" error message + * deps: depd@~1.0.0 + +1.8.4 / 2014-09-23 +================== + + * fix content encoding to be case-insensitive + +1.8.3 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + +1.8.2 / 2014-09-15 +================== + + * deps: depd@0.4.5 + +1.8.1 / 2014-09-07 +================== + + * deps: media-typer@0.3.0 + * deps: type-is@~1.5.1 + +1.8.0 / 2014-09-05 +================== + + * make empty-body-handling consistent between chunked requests + - empty `json` produces `{}` + - empty `raw` produces `new Buffer(0)` + - empty `text` produces `''` + - empty `urlencoded` produces `{}` + * deps: qs@2.2.3 + - Fix issue where first empty value in array is discarded + * deps: type-is@~1.5.0 + - fix `hasbody` to be true for `content-length: 0` + +1.7.0 / 2014-09-01 +================== + + * add `parameterLimit` option to `urlencoded` parser + * change `urlencoded` extended array limit to 100 + * respond with 413 when over `parameterLimit` in `urlencoded` + +1.6.7 / 2014-08-29 +================== + + * deps: qs@2.2.2 + - Remove unnecessary cloning + +1.6.6 / 2014-08-27 +================== + + * deps: qs@2.2.0 + - Array parsing fix + - Performance improvements + +1.6.5 / 2014-08-16 +================== + + * deps: on-finished@2.1.0 + +1.6.4 / 2014-08-14 +================== + + * deps: qs@1.2.2 + +1.6.3 / 2014-08-10 +================== + + * deps: qs@1.2.1 + +1.6.2 / 2014-08-07 +================== + + * deps: qs@1.2.0 + - Fix parsing array of objects + +1.6.1 / 2014-08-06 +================== + + * deps: qs@1.1.0 + - Accept urlencoded square brackets + - Accept empty values in implicit array notation + +1.6.0 / 2014-08-05 +================== + + * deps: qs@1.0.2 + - Complete rewrite + - Limits array length to 20 + - Limits object depth to 5 + - Limits parameters to 1,000 + +1.5.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +1.5.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +1.5.0 / 2014-07-20 +================== + + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + * deps: raw-body@1.3.0 + - deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + - Fix `Cannot switch to old mode now` error on Node.js 0.10+ + * deps: type-is@~1.3.2 + +1.4.3 / 2014-06-19 +================== + + * deps: type-is@1.3.1 + - fix global variable leak + +1.4.2 / 2014-06-19 +================== + + * deps: type-is@1.3.0 + - improve type parsing + +1.4.1 / 2014-06-19 +================== + + * fix urlencoded extended deprecation message + +1.4.0 / 2014-06-19 +================== + + * add `text` parser + * add `raw` parser + * check accepted charset in content-type (accepts utf-8) + * check accepted encoding in content-encoding (accepts identity) + * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed + * deprecate `urlencoded()` without provided `extended` option + * lazy-load urlencoded parsers + * parsers split into files for reduced mem usage + * support gzip and deflate bodies + - set `inflate: false` to turn off + * deps: raw-body@1.2.2 + - Support all encodings from `iconv-lite` + +1.3.1 / 2014-06-11 +================== + + * deps: type-is@1.2.1 + - Switch dependency from mime to mime-types@1.0.0 + +1.3.0 / 2014-05-31 +================== + + * add `extended` option to urlencoded parser + +1.2.2 / 2014-05-27 +================== + + * deps: raw-body@1.1.6 + - assert stream encoding on node.js 0.8 + - assert stream encoding on node.js < 0.10.6 + - deps: bytes@1 + +1.2.1 / 2014-05-26 +================== + + * invoke `next(err)` after request fully read + - prevents hung responses and socket hang ups + +1.2.0 / 2014-05-11 +================== + + * add `verify` option + * deps: type-is@1.2.0 + - support suffix matching + +1.1.2 / 2014-05-11 +================== + + * improve json parser speed + +1.1.1 / 2014-05-11 +================== + + * fix repeated limit parsing with every request + +1.1.0 / 2014-05-10 +================== + + * add `type` option + * deps: pin for safety and consistency + +1.0.2 / 2014-04-14 +================== + + * use `type-is` module + +1.0.1 / 2014-03-20 +================== + + * lower default limits to 100kb diff --git a/node_modules/body-parser/LICENSE b/node_modules/body-parser/LICENSE new file mode 100644 index 0000000..386b7b6 --- /dev/null +++ b/node_modules/body-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong <me@jongleberry.com> +Copyright (c) 2014-2015 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/body-parser/README.md b/node_modules/body-parser/README.md new file mode 100644 index 0000000..aba6297 --- /dev/null +++ b/node_modules/body-parser/README.md @@ -0,0 +1,443 @@ +# body-parser + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Node.js body parsing middleware. + +Parse incoming request bodies in a middleware before your handlers, available +under the `req.body` property. + +**Note** As `req.body`'s shape is based on user-controlled input, all +properties and values in this object are untrusted and should be validated +before trusting. For example, `req.body.foo.toString()` may fail in multiple +ways, for example the `foo` property may not be there or may not be a string, +and `toString` may not be a function and instead a string or other user input. + +[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/). + +_This does not handle multipart bodies_, due to their complex and typically +large nature. For multipart bodies, you may be interested in the following +modules: + + * [busboy](https://www.npmjs.org/package/busboy#readme) and + [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme) + * [multiparty](https://www.npmjs.org/package/multiparty#readme) and + [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme) + * [formidable](https://www.npmjs.org/package/formidable#readme) + * [multer](https://www.npmjs.org/package/multer#readme) + +This module provides the following parsers: + + * [JSON body parser](#bodyparserjsonoptions) + * [Raw body parser](#bodyparserrawoptions) + * [Text body parser](#bodyparsertextoptions) + * [URL-encoded form body parser](#bodyparserurlencodedoptions) + +Other body parsers you might be interested in: + +- [body](https://www.npmjs.org/package/body#readme) +- [co-body](https://www.npmjs.org/package/co-body#readme) + +## Installation + +```sh +$ npm install body-parser +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var bodyParser = require('body-parser') +``` + +The `bodyParser` object exposes various factories to create middlewares. All +middlewares will populate the `req.body` property with the parsed body when +the `Content-Type` request header matches the `type` option, or an empty +object (`{}`) if there was no body to parse, the `Content-Type` was not matched, +or an error occurred. + +The various errors returned by this module are described in the +[errors section](#errors). + +### bodyParser.json([options]) + +Returns middleware that only parses `json` and only looks at requests where +the `Content-Type` header matches the `type` option. This parser accepts any +Unicode encoding of the body and supports automatic inflation of `gzip` and +`deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). + +#### Options + +The `json` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### reviver + +The `reviver` option is passed directly to `JSON.parse` as the second +argument. You can find more information on this argument +[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter). + +##### strict + +When set to `true`, will only accept arrays and objects; when `false` will +accept anything `JSON.parse` accepts. Defaults to `true`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not a +function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `json`), a mime type (like `application/json`), or +a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a truthy +value. Defaults to `application/json`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.raw([options]) + +Returns middleware that parses all bodies as a `Buffer` and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a `Buffer` object +of the body. + +#### Options + +The `raw` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. +If not a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this +can be an extension name (like `bin`), a mime type (like +`application/octet-stream`), or a mime type with a wildcard (like `*/*` or +`application/*`). If a function, the `type` option is called as `fn(req)` +and the request is parsed if it returns a truthy value. Defaults to +`application/octet-stream`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.text([options]) + +Returns middleware that parses all bodies as a string and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` string containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a string of the +body. + +#### Options + +The `text` function takes an optional `options` object that may contain any of +the following keys: + +##### defaultCharset + +Specify the default character set for the text content if the charset is not +specified in the `Content-Type` header of the request. Defaults to `utf-8`. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `txt`), a mime type (like `text/plain`), or a mime +type with a wildcard (like `*/*` or `text/*`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a +truthy value. Defaults to `text/plain`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.urlencoded([options]) + +Returns middleware that only parses `urlencoded` bodies and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser accepts only UTF-8 encoding of the body and supports automatic +inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This object will contain +key-value pairs, where the value can be a string or array (when `extended` is +`false`), or any type (when `extended` is `true`). + +#### Options + +The `urlencoded` function takes an optional `options` object that may contain +any of the following keys: + +##### extended + +The `extended` option allows to choose between parsing the URL-encoded data +with the `querystring` library (when `false`) or the `qs` library (when +`true`). The "extended" syntax allows for rich objects and arrays to be +encoded into the URL-encoded format, allowing for a JSON-like experience +with URL-encoded. For more information, please +[see the qs library](https://www.npmjs.org/package/qs#readme). + +Defaults to `true`, but using the default has been deprecated. Please +research into the difference between `qs` and `querystring` and choose the +appropriate setting. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### parameterLimit + +The `parameterLimit` option controls the maximum number of parameters that +are allowed in the URL-encoded data. If a request contains more parameters +than this value, a 413 will be returned to the client. Defaults to `1000`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `urlencoded`), a mime type (like +`application/x-www-form-urlencoded`), or a mime type with a wildcard (like +`*/x-www-form-urlencoded`). If a function, the `type` option is called as +`fn(req)` and the request is parsed if it returns a truthy value. Defaults +to `application/x-www-form-urlencoded`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +## Errors + +The middlewares provided by this module create errors depending on the error +condition during parsing. The errors will typically have a `status`/`statusCode` +property that contains the suggested HTTP response code, an `expose` property +to determine if the `message` property should be displayed to the client, a +`type` property to determine the type of error without matching against the +`message`, and a `body` property containing the read body, if available. + +The following are the common errors emitted, though any error can come through +for various reasons. + +### content encoding unsupported + +This error will occur when the request had a `Content-Encoding` header that +contained an encoding but the "inflation" option was set to `false`. The +`status` property is set to `415`, the `type` property is set to +`'encoding.unsupported'`, and the `charset` property will be set to the +encoding that is unsupported. + +### request aborted + +This error will occur when the request is aborted by the client before reading +the body has finished. The `received` property will be set to the number of +bytes received before the request was aborted and the `expected` property is +set to the number of expected bytes. The `status` property is set to `400` +and `type` property is set to `'request.aborted'`. + +### request entity too large + +This error will occur when the request body's size is larger than the "limit" +option. The `limit` property will be set to the byte limit and the `length` +property will be set to the request body's length. The `status` property is +set to `413` and the `type` property is set to `'entity.too.large'`. + +### request size did not match content length + +This error will occur when the request's length did not match the length from +the `Content-Length` header. This typically occurs when the request is malformed, +typically when the `Content-Length` header was calculated based on characters +instead of bytes. The `status` property is set to `400` and the `type` property +is set to `'request.size.invalid'`. + +### stream encoding should not be set + +This error will occur when something called the `req.setEncoding` method prior +to this middleware. This module operates directly on bytes only and you cannot +call `req.setEncoding` when using this module. The `status` property is set to +`500` and the `type` property is set to `'stream.encoding.set'`. + +### too many parameters + +This error will occur when the content of the request exceeds the configured +`parameterLimit` for the `urlencoded` parser. The `status` property is set to +`413` and the `type` property is set to `'parameters.too.many'`. + +### unsupported charset "BOGUS" + +This error will occur when the request had a charset parameter in the +`Content-Type` header, but the `iconv-lite` module does not support it OR the +parser does not support it. The charset is contained in the message as well +as in the `charset` property. The `status` property is set to `415`, the +`type` property is set to `'charset.unsupported'`, and the `charset` property +is set to the charset that is unsupported. + +### unsupported content encoding "bogus" + +This error will occur when the request had a `Content-Encoding` header that +contained an unsupported encoding. The encoding is contained in the message +as well as in the `encoding` property. The `status` property is set to `415`, +the `type` property is set to `'encoding.unsupported'`, and the `encoding` +property is set to the encoding that is unsupported. + +## Examples + +### Express/Connect top-level generic + +This example demonstrates adding a generic JSON and URL-encoded parser as a +top-level middleware, which will parse the bodies of all incoming requests. +This is the simplest setup. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse application/x-www-form-urlencoded +app.use(bodyParser.urlencoded({ extended: false })) + +// parse application/json +app.use(bodyParser.json()) + +app.use(function (req, res) { + res.setHeader('Content-Type', 'text/plain') + res.write('you posted:\n') + res.end(JSON.stringify(req.body, null, 2)) +}) +``` + +### Express route-specific + +This example demonstrates adding body parsers specifically to the routes that +need them. In general, this is the most recommended way to use body-parser with +Express. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// create application/json parser +var jsonParser = bodyParser.json() + +// create application/x-www-form-urlencoded parser +var urlencodedParser = bodyParser.urlencoded({ extended: false }) + +// POST /login gets urlencoded bodies +app.post('/login', urlencodedParser, function (req, res) { + res.send('welcome, ' + req.body.username) +}) + +// POST /api/users gets JSON bodies +app.post('/api/users', jsonParser, function (req, res) { + // create user in req.body +}) +``` + +### Change accepted type for parsers + +All the parsers accept a `type` option which allows you to change the +`Content-Type` that the middleware will parse. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse various different custom JSON types as JSON +app.use(bodyParser.json({ type: 'application/*+json' })) + +// parse some custom thing into a Buffer +app.use(bodyParser.raw({ type: 'application/vnd.custom-type' })) + +// parse an HTML body into a string +app.use(bodyParser.text({ type: 'text/html' })) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/body-parser.svg +[npm-url]: https://npmjs.org/package/body-parser +[travis-image]: https://img.shields.io/travis/expressjs/body-parser/master.svg +[travis-url]: https://travis-ci.org/expressjs/body-parser +[coveralls-image]: https://img.shields.io/coveralls/expressjs/body-parser/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master +[downloads-image]: https://img.shields.io/npm/dm/body-parser.svg +[downloads-url]: https://npmjs.org/package/body-parser diff --git a/node_modules/body-parser/index.js b/node_modules/body-parser/index.js new file mode 100644 index 0000000..93c3a1f --- /dev/null +++ b/node_modules/body-parser/index.js @@ -0,0 +1,157 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var deprecate = require('depd')('body-parser') + +/** + * Cache of loaded parsers. + * @private + */ + +var parsers = Object.create(null) + +/** + * @typedef Parsers + * @type {function} + * @property {function} json + * @property {function} raw + * @property {function} text + * @property {function} urlencoded + */ + +/** + * Module exports. + * @type {Parsers} + */ + +exports = module.exports = deprecate.function(bodyParser, + 'bodyParser: use individual json/urlencoded middlewares') + +/** + * JSON parser. + * @public + */ + +Object.defineProperty(exports, 'json', { + configurable: true, + enumerable: true, + get: createParserGetter('json') +}) + +/** + * Raw parser. + * @public + */ + +Object.defineProperty(exports, 'raw', { + configurable: true, + enumerable: true, + get: createParserGetter('raw') +}) + +/** + * Text parser. + * @public + */ + +Object.defineProperty(exports, 'text', { + configurable: true, + enumerable: true, + get: createParserGetter('text') +}) + +/** + * URL-encoded parser. + * @public + */ + +Object.defineProperty(exports, 'urlencoded', { + configurable: true, + enumerable: true, + get: createParserGetter('urlencoded') +}) + +/** + * Create a middleware to parse json and urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @deprecated + * @public + */ + +function bodyParser (options) { + var opts = {} + + // exclude type option + if (options) { + for (var prop in options) { + if (prop !== 'type') { + opts[prop] = options[prop] + } + } + } + + var _urlencoded = exports.urlencoded(opts) + var _json = exports.json(opts) + + return function bodyParser (req, res, next) { + _json(req, res, function (err) { + if (err) return next(err) + _urlencoded(req, res, next) + }) + } +} + +/** + * Create a getter for loading a parser. + * @private + */ + +function createParserGetter (name) { + return function get () { + return loadParser(name) + } +} + +/** + * Load a parser module. + * @private + */ + +function loadParser (parserName) { + var parser = parsers[parserName] + + if (parser !== undefined) { + return parser + } + + // this uses a switch for static require analysis + switch (parserName) { + case 'json': + parser = require('./lib/types/json') + break + case 'raw': + parser = require('./lib/types/raw') + break + case 'text': + parser = require('./lib/types/text') + break + case 'urlencoded': + parser = require('./lib/types/urlencoded') + break + } + + // store to prevent invoking require() + return (parsers[parserName] = parser) +} diff --git a/node_modules/body-parser/lib/read.js b/node_modules/body-parser/lib/read.js new file mode 100644 index 0000000..c102609 --- /dev/null +++ b/node_modules/body-parser/lib/read.js @@ -0,0 +1,181 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var createError = require('http-errors') +var getBody = require('raw-body') +var iconv = require('iconv-lite') +var onFinished = require('on-finished') +var zlib = require('zlib') + +/** + * Module exports. + */ + +module.exports = read + +/** + * Read a request into a buffer and parse. + * + * @param {object} req + * @param {object} res + * @param {function} next + * @param {function} parse + * @param {function} debug + * @param {object} options + * @private + */ + +function read (req, res, next, parse, debug, options) { + var length + var opts = options + var stream + + // flag as parsed + req._body = true + + // read options + var encoding = opts.encoding !== null + ? opts.encoding + : null + var verify = opts.verify + + try { + // get the content stream + stream = contentstream(req, debug, opts.inflate) + length = stream.length + stream.length = undefined + } catch (err) { + return next(err) + } + + // set raw-body options + opts.length = length + opts.encoding = verify + ? null + : encoding + + // assert charset is supported + if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) { + return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + })) + } + + // read body + debug('read body') + getBody(stream, opts, function (error, body) { + if (error) { + var _error + + if (error.type === 'encoding.unsupported') { + // echo back charset + _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + }) + } else { + // set status code on error + _error = createError(400, error) + } + + // read off entire request + stream.resume() + onFinished(req, function onfinished () { + next(createError(400, _error)) + }) + return + } + + // verify + if (verify) { + try { + debug('verify body') + verify(req, res, body, encoding) + } catch (err) { + next(createError(403, err, { + body: body, + type: err.type || 'entity.verify.failed' + })) + return + } + } + + // parse + var str = body + try { + debug('parse body') + str = typeof body !== 'string' && encoding !== null + ? iconv.decode(body, encoding) + : body + req.body = parse(str) + } catch (err) { + next(createError(400, err, { + body: str, + type: err.type || 'entity.parse.failed' + })) + return + } + + next() + }) +} + +/** + * Get the content stream of the request. + * + * @param {object} req + * @param {function} debug + * @param {boolean} [inflate=true] + * @return {object} + * @api private + */ + +function contentstream (req, debug, inflate) { + var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase() + var length = req.headers['content-length'] + var stream + + debug('content-encoding "%s"', encoding) + + if (inflate === false && encoding !== 'identity') { + throw createError(415, 'content encoding unsupported', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + switch (encoding) { + case 'deflate': + stream = zlib.createInflate() + debug('inflate body') + req.pipe(stream) + break + case 'gzip': + stream = zlib.createGunzip() + debug('gunzip body') + req.pipe(stream) + break + case 'identity': + stream = req + stream.length = length + break + default: + throw createError(415, 'unsupported content encoding "' + encoding + '"', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + return stream +} diff --git a/node_modules/body-parser/lib/types/json.js b/node_modules/body-parser/lib/types/json.js new file mode 100644 index 0000000..2971dc1 --- /dev/null +++ b/node_modules/body-parser/lib/types/json.js @@ -0,0 +1,230 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:json') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = json + +/** + * RegExp to match the first non-space in a string. + * + * Allowed whitespace is defined in RFC 7159: + * + * ws = *( + * %x20 / ; Space + * %x09 / ; Horizontal tab + * %x0A / ; Line feed or New line + * %x0D ) ; Carriage return + */ + +var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*(.)/ // eslint-disable-line no-control-regex + +/** + * Create a middleware to parse JSON bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function json (options) { + var opts = options || {} + + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var inflate = opts.inflate !== false + var reviver = opts.reviver + var strict = opts.strict !== false + var type = opts.type || 'application/json' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + if (body.length === 0) { + // special-case empty json body, as it's a common client-side mistake + // TODO: maybe make this configurable or part of "strict" option + return {} + } + + if (strict) { + var first = firstchar(body) + + if (first !== '{' && first !== '[') { + debug('strict violation') + throw createStrictSyntaxError(body, first) + } + } + + try { + debug('parse json') + return JSON.parse(body, reviver) + } catch (e) { + throw normalizeJsonSyntaxError(e, { + message: e.message, + stack: e.stack + }) + } + } + + return function jsonParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset per RFC 7159 sec 8.1 + var charset = getCharset(req) || 'utf-8' + if (charset.substr(0, 4) !== 'utf-') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Create strict violation syntax error matching native error. + * + * @param {string} str + * @param {string} char + * @return {Error} + * @private + */ + +function createStrictSyntaxError (str, char) { + var index = str.indexOf(char) + var partial = str.substring(0, index) + '#' + + try { + JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation') + } catch (e) { + return normalizeJsonSyntaxError(e, { + message: e.message.replace('#', char), + stack: e.stack + }) + } +} + +/** + * Get the first non-whitespace character in a string. + * + * @param {string} str + * @return {function} + * @private + */ + +function firstchar (str) { + return FIRST_CHAR_REGEXP.exec(str)[1] +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Normalize a SyntaxError for JSON.parse. + * + * @param {SyntaxError} error + * @param {object} obj + * @return {SyntaxError} + */ + +function normalizeJsonSyntaxError (error, obj) { + var keys = Object.getOwnPropertyNames(error) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + if (key !== 'stack' && key !== 'message') { + delete error[key] + } + } + + // replace stack before message for Node.js 0.10 and below + error.stack = obj.stack.replace(error.message, obj.message) + error.message = obj.message + + return error +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/lib/types/raw.js b/node_modules/body-parser/lib/types/raw.js new file mode 100644 index 0000000..f5d1b67 --- /dev/null +++ b/node_modules/body-parser/lib/types/raw.js @@ -0,0 +1,101 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var debug = require('debug')('body-parser:raw') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = raw + +/** + * Create a middleware to parse raw bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function raw (options) { + var opts = options || {} + + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/octet-stream' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function rawParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // read + read(req, res, next, parse, debug, { + encoding: null, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/lib/types/text.js b/node_modules/body-parser/lib/types/text.js new file mode 100644 index 0000000..083a009 --- /dev/null +++ b/node_modules/body-parser/lib/types/text.js @@ -0,0 +1,121 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var debug = require('debug')('body-parser:text') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = text + +/** + * Create a middleware to parse text bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function text (options) { + var opts = options || {} + + var defaultCharset = opts.defaultCharset || 'utf-8' + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'text/plain' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function textParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // get charset + var charset = getCharset(req) || defaultCharset + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/lib/types/urlencoded.js b/node_modules/body-parser/lib/types/urlencoded.js new file mode 100644 index 0000000..b2ca8f1 --- /dev/null +++ b/node_modules/body-parser/lib/types/urlencoded.js @@ -0,0 +1,284 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:urlencoded') +var deprecate = require('depd')('body-parser') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = urlencoded + +/** + * Cache of parser modules. + */ + +var parsers = Object.create(null) + +/** + * Create a middleware to parse urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function urlencoded (options) { + var opts = options || {} + + // notice because option default will flip in next major + if (opts.extended === undefined) { + deprecate('undefined extended: provide extended option') + } + + var extended = opts.extended !== false + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/x-www-form-urlencoded' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate query parser + var queryparse = extended + ? extendedparser(opts) + : simpleparser(opts) + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + return body.length + ? queryparse(body) + : {} + } + + return function urlencodedParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset + var charset = getCharset(req) || 'utf-8' + if (charset !== 'utf-8') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + debug: debug, + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the extended query parser. + * + * @param {object} options + */ + +function extendedparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('qs') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + var arrayLimit = Math.max(100, paramCount) + + debug('parse extended urlencoding') + return parse(body, { + allowPrototypes: true, + arrayLimit: arrayLimit, + depth: Infinity, + parameterLimit: parameterLimit + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Count the number of parameters, stopping once limit reached + * + * @param {string} body + * @param {number} limit + * @api private + */ + +function parameterCount (body, limit) { + var count = 0 + var index = 0 + + while ((index = body.indexOf('&', index)) !== -1) { + count++ + index++ + + if (count === limit) { + return undefined + } + } + + return count +} + +/** + * Get parser for module name dynamically. + * + * @param {string} name + * @return {function} + * @api private + */ + +function parser (name) { + var mod = parsers[name] + + if (mod !== undefined) { + return mod.parse + } + + // this uses a switch for static require analysis + switch (name) { + case 'qs': + mod = require('qs') + break + case 'querystring': + mod = require('querystring') + break + } + + // store to prevent invoking require() + parsers[name] = mod + + return mod.parse +} + +/** + * Get the simple query parser. + * + * @param {object} options + */ + +function simpleparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('querystring') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + debug('parse urlencoding') + return parse(body, undefined, undefined, { maxKeys: parameterLimit }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/node_modules/body-parser/package.json b/node_modules/body-parser/package.json new file mode 100644 index 0000000..49bbe73 --- /dev/null +++ b/node_modules/body-parser/package.json @@ -0,0 +1,91 @@ +{ + "_from": "body-parser@1.19.0", + "_id": "body-parser@1.19.0", + "_inBundle": false, + "_integrity": "sha512-dhEPs72UPbDnAQJ9ZKMNTP6ptJaionhP5cBb541nXPlW60Jepo9RV/a4fX4XWW9CuFNK22krhrj1+rgzifNCsw==", + "_location": "/body-parser", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "body-parser@1.19.0", + "name": "body-parser", + "escapedName": "body-parser", + "rawSpec": "1.19.0", + "saveSpec": null, + "fetchSpec": "1.19.0" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.19.0.tgz", + "_shasum": "96b2709e57c9c4e09a6fd66a8fd979844f69f08a", + "_spec": "body-parser@1.19.0", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "bugs": { + "url": "https://github.com/expressjs/body-parser/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "bytes": "3.1.0", + "content-type": "~1.0.4", + "debug": "2.6.9", + "depd": "~1.1.2", + "http-errors": "1.7.2", + "iconv-lite": "0.4.24", + "on-finished": "~2.3.0", + "qs": "6.7.0", + "raw-body": "2.4.0", + "type-is": "~1.6.17" + }, + "deprecated": false, + "description": "Node.js body parsing middleware", + "devDependencies": { + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "methods": "1.1.2", + "mocha": "6.1.4", + "safe-buffer": "5.1.2", + "supertest": "4.0.2" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "lib/", + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/expressjs/body-parser#readme", + "license": "MIT", + "name": "body-parser", + "repository": { + "type": "git", + "url": "git+https://github.com/expressjs/body-parser.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --require test/support/env --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --require test/support/env --reporter spec --check-leaks test/" + }, + "version": "1.19.0" +} diff --git a/node_modules/bytes/History.md b/node_modules/bytes/History.md new file mode 100644 index 0000000..cf6a5bb --- /dev/null +++ b/node_modules/bytes/History.md @@ -0,0 +1,87 @@ +3.1.0 / 2019-01-22 +================== + + * Add petabyte (`pb`) support + +3.0.0 / 2017-08-31 +================== + + * Change "kB" to "KB" in format output + * Remove support for Node.js 0.6 + * Remove support for ComponentJS + +2.5.0 / 2017-03-24 +================== + + * Add option "unit" + +2.4.0 / 2016-06-01 +================== + + * Add option "unitSeparator" + +2.3.0 / 2016-02-15 +================== + + * Drop partial bytes on all parsed units + * Fix non-finite numbers to `.format` to return `null` + * Fix parsing byte string that looks like hex + * perf: hoist regular expressions + +2.2.0 / 2015-11-13 +================== + + * add option "decimalPlaces" + * add option "fixedDecimals" + +2.1.0 / 2015-05-21 +================== + + * add `.format` export + * add `.parse` export + +2.0.2 / 2015-05-20 +================== + + * remove map recreation + * remove unnecessary object construction + +2.0.1 / 2015-05-07 +================== + + * fix browserify require + * remove node.extend dependency + +2.0.0 / 2015-04-12 +================== + + * add option "case" + * add option "thousandsSeparator" + * return "null" on invalid parse input + * support proper round-trip: bytes(bytes(num)) === num + * units no longer case sensitive when parsing + +1.0.0 / 2014-05-05 +================== + + * add negative support. fixes #6 + +0.3.0 / 2014-03-19 +================== + + * added terabyte support + +0.2.1 / 2013-04-01 +================== + + * add .component + +0.2.0 / 2012-10-28 +================== + + * bytes(200).should.eql('200b') + +0.1.0 / 2012-07-04 +================== + + * add bytes to string conversion [yields] diff --git a/node_modules/bytes/LICENSE b/node_modules/bytes/LICENSE new file mode 100644 index 0000000..63e95a9 --- /dev/null +++ b/node_modules/bytes/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2015 Jed Watson <jed.watson@me.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/bytes/Readme.md b/node_modules/bytes/Readme.md new file mode 100644 index 0000000..6ad1ec6 --- /dev/null +++ b/node_modules/bytes/Readme.md @@ -0,0 +1,126 @@ +# Bytes utility + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install bytes +``` + +## Usage + +```js +var bytes = require('bytes'); +``` + +#### bytes.format(number value, [options]): stringï½null + +Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is + rounded. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number` | Value in bytes | +| options | `Object` | Conversion options | + +**Options** + +| Property | Type | Description | +|-------------------|--------|-----------------------------------------------------------------------------------------| +| decimalPlaces | `number`ï½`null` | Maximum number of decimal places to include in output. Default value to `2`. | +| fixedDecimals | `boolean`ï½`null` | Whether to always display the maximum number of decimal places. Default value to `false` | +| thousandsSeparator | `string`ï½`null` | Example of values: `' '`, `','` and `.`... Default value to `''`. | +| unit | `string`ï½`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). | +| unitSeparator | `string`ï½`null` | Separator to use between number and unit. Default value to `''`. | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`ï½`null` | Return null upon error. String value otherwise. | + +**Example** + +```js +bytes(1024); +// output: '1KB' + +bytes(1000); +// output: '1000B' + +bytes(1000, {thousandsSeparator: ' '}); +// output: '1 000B' + +bytes(1024 * 1.7, {decimalPlaces: 0}); +// output: '2KB' + +bytes(1024, {unitSeparator: ' '}); +// output: '1 KB' + +``` + +#### bytes.parse(stringï½number value): numberï½null + +Parse the string value into an integer in bytes. If no unit is given, or `value` +is a number, it is assumed the value is in bytes. + +Supported units and abbreviations are as follows and are case-insensitive: + + * `b` for bytes + * `kb` for kilobytes + * `mb` for megabytes + * `gb` for gigabytes + * `tb` for terabytes + * `pb` for petabytes + +The units are in powers of two, not ten. This means 1kb = 1024b according to this parser. + +**Arguments** + +| Name | Type | Description | +|---------------|--------|--------------------| +| value | `string`ï½`number` | String to parse, or number in bytes. | + +**Returns** + +| Name | Type | Description | +|---------|-------------|-------------------------| +| results | `number`ï½`null` | Return null upon error. Value in bytes otherwise. | + +**Example** + +```js +bytes('1KB'); +// output: 1024 + +bytes('1024'); +// output: 1024 + +bytes(1024); +// output: 1KB +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master +[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master +[downloads-image]: https://badgen.net/npm/dm/bytes +[downloads-url]: https://npmjs.org/package/bytes +[npm-image]: https://badgen.net/npm/node/bytes +[npm-url]: https://npmjs.org/package/bytes +[travis-image]: https://badgen.net/travis/visionmedia/bytes.js/master +[travis-url]: https://travis-ci.org/visionmedia/bytes.js diff --git a/node_modules/bytes/index.js b/node_modules/bytes/index.js new file mode 100644 index 0000000..4975bfb --- /dev/null +++ b/node_modules/bytes/index.js @@ -0,0 +1,162 @@ +/*! + * bytes + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015 Jed Watson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = bytes; +module.exports.format = format; +module.exports.parse = parse; + +/** + * Module variables. + * @private + */ + +var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g; + +var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/; + +var map = { + b: 1, + kb: 1 << 10, + mb: 1 << 20, + gb: 1 << 30, + tb: Math.pow(1024, 4), + pb: Math.pow(1024, 5), +}; + +var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i; + +/** + * Convert the given value in bytes into a string or parse to string to an integer in bytes. + * + * @param {string|number} value + * @param {{ + * case: [string], + * decimalPlaces: [number] + * fixedDecimals: [boolean] + * thousandsSeparator: [string] + * unitSeparator: [string] + * }} [options] bytes options. + * + * @returns {string|number|null} + */ + +function bytes(value, options) { + if (typeof value === 'string') { + return parse(value); + } + + if (typeof value === 'number') { + return format(value, options); + } + + return null; +} + +/** + * Format the given value in bytes into a string. + * + * If the value is negative, it is kept as such. If it is a float, + * it is rounded. + * + * @param {number} value + * @param {object} [options] + * @param {number} [options.decimalPlaces=2] + * @param {number} [options.fixedDecimals=false] + * @param {string} [options.thousandsSeparator=] + * @param {string} [options.unit=] + * @param {string} [options.unitSeparator=] + * + * @returns {string|null} + * @public + */ + +function format(value, options) { + if (!Number.isFinite(value)) { + return null; + } + + var mag = Math.abs(value); + var thousandsSeparator = (options && options.thousandsSeparator) || ''; + var unitSeparator = (options && options.unitSeparator) || ''; + var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2; + var fixedDecimals = Boolean(options && options.fixedDecimals); + var unit = (options && options.unit) || ''; + + if (!unit || !map[unit.toLowerCase()]) { + if (mag >= map.pb) { + unit = 'PB'; + } else if (mag >= map.tb) { + unit = 'TB'; + } else if (mag >= map.gb) { + unit = 'GB'; + } else if (mag >= map.mb) { + unit = 'MB'; + } else if (mag >= map.kb) { + unit = 'KB'; + } else { + unit = 'B'; + } + } + + var val = value / map[unit.toLowerCase()]; + var str = val.toFixed(decimalPlaces); + + if (!fixedDecimals) { + str = str.replace(formatDecimalsRegExp, '$1'); + } + + if (thousandsSeparator) { + str = str.replace(formatThousandsRegExp, thousandsSeparator); + } + + return str + unitSeparator + unit; +} + +/** + * Parse the string value into an integer in bytes. + * + * If no unit is given, it is assumed the value is in bytes. + * + * @param {number|string} val + * + * @returns {number|null} + * @public + */ + +function parse(val) { + if (typeof val === 'number' && !isNaN(val)) { + return val; + } + + if (typeof val !== 'string') { + return null; + } + + // Test if the string passed is valid + var results = parseRegExp.exec(val); + var floatValue; + var unit = 'b'; + + if (!results) { + // Nothing could be extracted from the given string + floatValue = parseInt(val, 10); + unit = 'b' + } else { + // Retrieve the value and the unit + floatValue = parseFloat(results[1]); + unit = results[4].toLowerCase(); + } + + return Math.floor(map[unit] * floatValue); +} diff --git a/node_modules/bytes/package.json b/node_modules/bytes/package.json new file mode 100644 index 0000000..46a61a3 --- /dev/null +++ b/node_modules/bytes/package.json @@ -0,0 +1,84 @@ +{ + "_from": "bytes@3.1.0", + "_id": "bytes@3.1.0", + "_inBundle": false, + "_integrity": "sha512-zauLjrfCG+xvoyaqLoV8bLVXXNGC4JqlxFCutSDWA6fJrTo2ZuvLYTqZ7aHBLZSMOopbzwv8f+wZcVzfVTI2Dg==", + "_location": "/bytes", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "bytes@3.1.0", + "name": "bytes", + "escapedName": "bytes", + "rawSpec": "3.1.0", + "saveSpec": null, + "fetchSpec": "3.1.0" + }, + "_requiredBy": [ + "/body-parser", + "/raw-body" + ], + "_resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.0.tgz", + "_shasum": "f6cf7933a360e0588fa9fde85651cdc7f805d1f6", + "_spec": "bytes@3.1.0", + "_where": "/home/josuer08/Documents/web/node_modules/body-parser", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + }, + "bugs": { + "url": "https://github.com/visionmedia/bytes.js/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Jed Watson", + "email": "jed.watson@me.com" + }, + { + "name": "Théo FIDRY", + "email": "theo.fidry@gmail.com" + } + ], + "deprecated": false, + "description": "Utility to parse a string bytes to bytes and vice-versa", + "devDependencies": { + "eslint": "5.12.1", + "mocha": "5.2.0", + "nyc": "13.1.0" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "History.md", + "LICENSE", + "Readme.md", + "index.js" + ], + "homepage": "https://github.com/visionmedia/bytes.js#readme", + "keywords": [ + "byte", + "bytes", + "utility", + "parse", + "parser", + "convert", + "converter" + ], + "license": "MIT", + "name": "bytes", + "repository": { + "type": "git", + "url": "git+https://github.com/visionmedia/bytes.js.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --check-leaks --reporter spec", + "test-ci": "nyc --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "version": "3.1.0" +} diff --git a/node_modules/content-disposition/HISTORY.md b/node_modules/content-disposition/HISTORY.md new file mode 100644 index 0000000..63a3d08 --- /dev/null +++ b/node_modules/content-disposition/HISTORY.md @@ -0,0 +1,55 @@ +0.5.3 / 2018-12-17 +================== + + * Use `safe-buffer` for improved Buffer API + +0.5.2 / 2016-12-08 +================== + + * Fix `parse` to accept any linear whitespace character + +0.5.1 / 2016-01-17 +================== + + * perf: enable strict mode + +0.5.0 / 2014-10-11 +================== + + * Add `parse` function + +0.4.0 / 2014-09-21 +================== + + * Expand non-Unicode `filename` to the full ISO-8859-1 charset + +0.3.0 / 2014-09-20 +================== + + * Add `fallback` option + * Add `type` option + +0.2.0 / 2014-09-19 +================== + + * Reduce ambiguity of file names with hex escape in buggy browsers + +0.1.2 / 2014-09-19 +================== + + * Fix periodic invalid Unicode filename header + +0.1.1 / 2014-09-19 +================== + + * Fix invalid characters appearing in `filename*` parameter + +0.1.0 / 2014-09-18 +================== + + * Make the `filename` argument optional + +0.0.0 / 2014-09-18 +================== + + * Initial release diff --git a/node_modules/content-disposition/LICENSE b/node_modules/content-disposition/LICENSE new file mode 100644 index 0000000..84441fb --- /dev/null +++ b/node_modules/content-disposition/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/content-disposition/README.md b/node_modules/content-disposition/README.md new file mode 100644 index 0000000..eebef13 --- /dev/null +++ b/node_modules/content-disposition/README.md @@ -0,0 +1,148 @@ +# content-disposition + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create and parse HTTP `Content-Disposition` header + +## Installation + +```sh +$ npm install content-disposition +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var contentDisposition = require('content-disposition') +``` + +### contentDisposition(filename, options) + +Create an attachment `Content-Disposition` header value using the given file name, +if supplied. The `filename` is optional and if no file name is desired, but you +want to specify `options`, set `filename` to `undefined`. + +<!-- eslint-disable no-undef --> + +```js +res.setHeader('Content-Disposition', contentDisposition('â« maths.pdf')) +``` + +**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this +header through a means different from `setHeader` in Node.js, you'll want to specify +the `'binary'` encoding in Node.js. + +#### Options + +`contentDisposition` accepts these properties in the options object. + +##### fallback + +If the `filename` option is outside ISO-8859-1, then the file name is actually +stored in a supplemental field for clients that support Unicode file names and +a ISO-8859-1 version of the file name is automatically generated. + +This specifies the ISO-8859-1 file name to override the automatic generation or +disables the generation all together, defaults to `true`. + + - A string will specify the ISO-8859-1 file name to use in place of automatic + generation. + - `false` will disable including a ISO-8859-1 file name and only include the + Unicode version (unless the file name is already ISO-8859-1). + - `true` will enable automatic generation if the file name is outside ISO-8859-1. + +If the `filename` option is ISO-8859-1 and this option is specified and has a +different value, then the `filename` option is encoded in the extended field +and this set as the fallback field, even though they are both ISO-8859-1. + +##### type + +Specifies the disposition type, defaults to `"attachment"`. This can also be +`"inline"`, or any other value (all values except inline are treated like +`attachment`, but can convey additional information if both parties agree to +it). The type is normalized to lower-case. + +### contentDisposition.parse(string) + +<!-- eslint-disable no-undef, no-unused-vars --> + +```js +var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt') +``` + +Parse a `Content-Disposition` header string. This automatically handles extended +("Unicode") parameters by decoding them and providing them under the standard +parameter name. This will return an object with the following properties (examples +are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`): + + - `type`: The disposition type (always lower case). Example: `'attachment'` + + - `parameters`: An object of the parameters in the disposition (name of parameter + always lower case and extended versions replace non-extended versions). Example: + `{filename: "⬠rates.txt"}` + +## Examples + +### Send a file for download + +```js +var contentDisposition = require('content-disposition') +var destroy = require('destroy') +var fs = require('fs') +var http = require('http') +var onFinished = require('on-finished') + +var filePath = '/path/to/public/plans.pdf' + +http.createServer(function onRequest (req, res) { + // set headers + res.setHeader('Content-Type', 'application/pdf') + res.setHeader('Content-Disposition', contentDisposition(filePath)) + + // send file + var stream = fs.createReadStream(filePath) + stream.pipe(res) + onFinished(res, function () { + destroy(stream) + }) +}) +``` + +## Testing + +```sh +$ npm test +``` + +## References + +- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616] +- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987] +- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266] +- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231] + +[rfc-2616]: https://tools.ietf.org/html/rfc2616 +[rfc-5987]: https://tools.ietf.org/html/rfc5987 +[rfc-6266]: https://tools.ietf.org/html/rfc6266 +[tc-2231]: http://greenbytes.de/tech/tc2231/ + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/content-disposition.svg +[npm-url]: https://npmjs.org/package/content-disposition +[node-version-image]: https://img.shields.io/node/v/content-disposition.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/jshttp/content-disposition.svg +[travis-url]: https://travis-ci.org/jshttp/content-disposition +[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg +[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master +[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg +[downloads-url]: https://npmjs.org/package/content-disposition diff --git a/node_modules/content-disposition/index.js b/node_modules/content-disposition/index.js new file mode 100644 index 0000000..3092a4d --- /dev/null +++ b/node_modules/content-disposition/index.js @@ -0,0 +1,458 @@ +/*! + * content-disposition + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = contentDisposition +module.exports.parse = parse + +/** + * Module dependencies. + * @private + */ + +var basename = require('path').basename +var Buffer = require('safe-buffer').Buffer + +/** + * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%") + * @private + */ + +var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex + +/** + * RegExp to match percent encoding escape. + * @private + */ + +var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/ +var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g + +/** + * RegExp to match non-latin1 characters. + * @private + */ + +var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g + +/** + * RegExp to match quoted-pair in RFC 2616 + * + * quoted-pair = "\" CHAR + * CHAR = <any US-ASCII character (octets 0 - 127)> + * @private + */ + +var QESC_REGEXP = /\\([\u0000-\u007f])/g // eslint-disable-line no-control-regex + +/** + * RegExp to match chars that must be quoted-pair in RFC 2616 + * @private + */ + +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp for various RFC 2616 grammar + * + * parameter = token "=" ( token | quoted-string ) + * token = 1*<any CHAR except CTLs or separators> + * separators = "(" | ")" | "<" | ">" | "@" + * | "," | ";" | ":" | "\" | <"> + * | "/" | "[" | "]" | "?" | "=" + * | "{" | "}" | SP | HT + * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> ) + * qdtext = <any TEXT except <">> + * quoted-pair = "\" CHAR + * CHAR = <any US-ASCII character (octets 0 - 127)> + * TEXT = <any OCTET except CTLs, but including LWS> + * LWS = [CRLF] 1*( SP | HT ) + * CRLF = CR LF + * CR = <US-ASCII CR, carriage return (13)> + * LF = <US-ASCII LF, linefeed (10)> + * SP = <US-ASCII SP, space (32)> + * HT = <US-ASCII HT, horizontal-tab (9)> + * CTL = <any US-ASCII control character (octets 0 - 31) and DEL (127)> + * OCTET = <any 8-bit sequence of data> + * @private + */ + +var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex +var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/ +var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/ + +/** + * RegExp for various RFC 5987 grammar + * + * ext-value = charset "'" [ language ] "'" value-chars + * charset = "UTF-8" / "ISO-8859-1" / mime-charset + * mime-charset = 1*mime-charsetc + * mime-charsetc = ALPHA / DIGIT + * / "!" / "#" / "$" / "%" / "&" + * / "+" / "-" / "^" / "_" / "`" + * / "{" / "}" / "~" + * language = ( 2*3ALPHA [ extlang ] ) + * / 4ALPHA + * / 5*8ALPHA + * extlang = *3( "-" 3ALPHA ) + * value-chars = *( pct-encoded / attr-char ) + * pct-encoded = "%" HEXDIG HEXDIG + * attr-char = ALPHA / DIGIT + * / "!" / "#" / "$" / "&" / "+" / "-" / "." + * / "^" / "_" / "`" / "|" / "~" + * @private + */ + +var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/ + +/** + * RegExp for various RFC 6266 grammar + * + * disposition-type = "inline" | "attachment" | disp-ext-type + * disp-ext-type = token + * disposition-parm = filename-parm | disp-ext-parm + * filename-parm = "filename" "=" value + * | "filename*" "=" ext-value + * disp-ext-parm = token "=" value + * | ext-token "=" ext-value + * ext-token = <the characters in token, followed by "*"> + * @private + */ + +var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex + +/** + * Create an attachment Content-Disposition header. + * + * @param {string} [filename] + * @param {object} [options] + * @param {string} [options.type=attachment] + * @param {string|boolean} [options.fallback=true] + * @return {string} + * @public + */ + +function contentDisposition (filename, options) { + var opts = options || {} + + // get type + var type = opts.type || 'attachment' + + // get parameters + var params = createparams(filename, opts.fallback) + + // format into string + return format(new ContentDisposition(type, params)) +} + +/** + * Create parameters object from filename and fallback. + * + * @param {string} [filename] + * @param {string|boolean} [fallback=true] + * @return {object} + * @private + */ + +function createparams (filename, fallback) { + if (filename === undefined) { + return + } + + var params = {} + + if (typeof filename !== 'string') { + throw new TypeError('filename must be a string') + } + + // fallback defaults to true + if (fallback === undefined) { + fallback = true + } + + if (typeof fallback !== 'string' && typeof fallback !== 'boolean') { + throw new TypeError('fallback must be a string or boolean') + } + + if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) { + throw new TypeError('fallback must be ISO-8859-1 string') + } + + // restrict to file base name + var name = basename(filename) + + // determine if name is suitable for quoted string + var isQuotedString = TEXT_REGEXP.test(name) + + // generate fallback name + var fallbackName = typeof fallback !== 'string' + ? fallback && getlatin1(name) + : basename(fallback) + var hasFallback = typeof fallbackName === 'string' && fallbackName !== name + + // set extended filename parameter + if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) { + params['filename*'] = name + } + + // set filename parameter + if (isQuotedString || hasFallback) { + params.filename = hasFallback + ? fallbackName + : name + } + + return params +} + +/** + * Format object to Content-Disposition header. + * + * @param {object} obj + * @param {string} obj.type + * @param {object} [obj.parameters] + * @return {string} + * @private + */ + +function format (obj) { + var parameters = obj.parameters + var type = obj.type + + if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + // start with normalized type + var string = String(type).toLowerCase() + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + var val = param.substr(-1) === '*' + ? ustring(parameters[param]) + : qstring(parameters[param]) + + string += '; ' + param + '=' + val + } + } + + return string +} + +/** + * Decode a RFC 6987 field value (gracefully). + * + * @param {string} str + * @return {string} + * @private + */ + +function decodefield (str) { + var match = EXT_VALUE_REGEXP.exec(str) + + if (!match) { + throw new TypeError('invalid extended field value') + } + + var charset = match[1].toLowerCase() + var encoded = match[2] + var value + + // to binary string + var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode) + + switch (charset) { + case 'iso-8859-1': + value = getlatin1(binary) + break + case 'utf-8': + value = Buffer.from(binary, 'binary').toString('utf8') + break + default: + throw new TypeError('unsupported charset in extended field') + } + + return value +} + +/** + * Get ISO-8859-1 version of string. + * + * @param {string} val + * @return {string} + * @private + */ + +function getlatin1 (val) { + // simple Unicode -> ISO-8859-1 transformation + return String(val).replace(NON_LATIN1_REGEXP, '?') +} + +/** + * Parse Content-Disposition header string. + * + * @param {string} string + * @return {object} + * @public + */ + +function parse (string) { + if (!string || typeof string !== 'string') { + throw new TypeError('argument string is required') + } + + var match = DISPOSITION_TYPE_REGEXP.exec(string) + + if (!match) { + throw new TypeError('invalid type format') + } + + // normalize type + var index = match[0].length + var type = match[1].toLowerCase() + + var key + var names = [] + var params = {} + var value + + // calculate index to start at + index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';' + ? index - 1 + : index + + // match parameters + while ((match = PARAM_REGEXP.exec(string))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (names.indexOf(key) !== -1) { + throw new TypeError('invalid duplicate parameter') + } + + names.push(key) + + if (key.indexOf('*') + 1 === key.length) { + // decode extended value + key = key.slice(0, -1) + value = decodefield(value) + + // overwrite existing value + params[key] = value + continue + } + + if (typeof params[key] === 'string') { + continue + } + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(QESC_REGEXP, '$1') + } + + params[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + return new ContentDisposition(type, params) +} + +/** + * Percent decode a single character. + * + * @param {string} str + * @param {string} hex + * @return {string} + * @private + */ + +function pdecode (str, hex) { + return String.fromCharCode(parseInt(hex, 16)) +} + +/** + * Percent encode a single character. + * + * @param {string} char + * @return {string} + * @private + */ + +function pencode (char) { + return '%' + String(char) + .charCodeAt(0) + .toString(16) + .toUpperCase() +} + +/** + * Quote a string for HTTP. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring (val) { + var str = String(val) + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Encode a Unicode string for HTTP (RFC 5987). + * + * @param {string} val + * @return {string} + * @private + */ + +function ustring (val) { + var str = String(val) + + // percent encode as UTF-8 + var encoded = encodeURIComponent(str) + .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode) + + return 'UTF-8\'\'' + encoded +} + +/** + * Class for parsed Content-Disposition header for v8 optimization + * + * @public + * @param {string} type + * @param {object} parameters + * @constructor + */ + +function ContentDisposition (type, parameters) { + this.type = type + this.parameters = parameters +} diff --git a/node_modules/content-disposition/package.json b/node_modules/content-disposition/package.json new file mode 100644 index 0000000..bd1d7c3 --- /dev/null +++ b/node_modules/content-disposition/package.json @@ -0,0 +1,79 @@ +{ + "_from": "content-disposition@0.5.3", + "_id": "content-disposition@0.5.3", + "_inBundle": false, + "_integrity": "sha512-ExO0774ikEObIAEV9kDo50o+79VCUdEB6n6lzKgGwupcVeRlhrj3qGAfwq8G6uBJjkqLrhT0qEYFcWng8z1z0g==", + "_location": "/content-disposition", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "content-disposition@0.5.3", + "name": "content-disposition", + "escapedName": "content-disposition", + "rawSpec": "0.5.3", + "saveSpec": null, + "fetchSpec": "0.5.3" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.3.tgz", + "_shasum": "e130caf7e7279087c5616c2007d0485698984fbd", + "_spec": "content-disposition@0.5.3", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/content-disposition/issues" + }, + "bundleDependencies": false, + "dependencies": { + "safe-buffer": "5.1.2" + }, + "deprecated": false, + "description": "Create and parse Content-Disposition header", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "5.10.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.14.0", + "eslint-plugin-markdown": "1.0.0-rc.1", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "5.2.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/content-disposition#readme", + "keywords": [ + "content-disposition", + "http", + "rfc6266", + "res" + ], + "license": "MIT", + "name": "content-disposition", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/content-disposition.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.5.3" +} diff --git a/node_modules/content-type/HISTORY.md b/node_modules/content-type/HISTORY.md new file mode 100644 index 0000000..8f5cb70 --- /dev/null +++ b/node_modules/content-type/HISTORY.md @@ -0,0 +1,24 @@ +1.0.4 / 2017-09-11 +================== + + * perf: skip parameter parsing when no parameters + +1.0.3 / 2017-09-10 +================== + + * perf: remove argument reassignment + +1.0.2 / 2016-05-09 +================== + + * perf: enable strict mode + +1.0.1 / 2015-02-13 +================== + + * Improve missing `Content-Type` header error message + +1.0.0 / 2015-02-01 +================== + + * Initial implementation, derived from `media-typer@0.3.0` diff --git a/node_modules/content-type/LICENSE b/node_modules/content-type/LICENSE new file mode 100644 index 0000000..34b1a2d --- /dev/null +++ b/node_modules/content-type/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/content-type/README.md b/node_modules/content-type/README.md new file mode 100644 index 0000000..3ed6741 --- /dev/null +++ b/node_modules/content-type/README.md @@ -0,0 +1,92 @@ +# content-type + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create and parse HTTP Content-Type header according to RFC 7231 + +## Installation + +```sh +$ npm install content-type +``` + +## API + +```js +var contentType = require('content-type') +``` + +### contentType.parse(string) + +```js +var obj = contentType.parse('image/svg+xml; charset=utf-8') +``` + +Parse a content type string. This will return an object with the following +properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (the type and subtype, always lower case). + Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of parameter + always lower case). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the string is missing or invalid. + +### contentType.parse(req) + +```js +var obj = contentType.parse(req) +``` + +Parse the `content-type` header from the given `req`. Short-cut for +`contentType.parse(req.headers['content-type'])`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.parse(res) + +```js +var obj = contentType.parse(res) +``` + +Parse the `content-type` header set on the given `res`. Short-cut for +`contentType.parse(res.getHeader('content-type'))`. + +Throws a `TypeError` if the `Content-Type` header is missing or invalid. + +### contentType.format(obj) + +```js +var str = contentType.format({type: 'image/svg+xml'}) +``` + +Format an object into a content type string. This will return a string of the +content type for the given object with the following properties (examples are +shown that produce the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'` + + - `parameters`: An object of the parameters in the media type (name of the + parameter will be lower-cased). Example: `{charset: 'utf-8'}` + +Throws a `TypeError` if the object contains an invalid type or parameter names. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/content-type.svg +[npm-url]: https://npmjs.org/package/content-type +[node-version-image]: https://img.shields.io/node/v/content-type.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/content-type/master.svg +[travis-url]: https://travis-ci.org/jshttp/content-type +[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-type/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/content-type +[downloads-image]: https://img.shields.io/npm/dm/content-type.svg +[downloads-url]: https://npmjs.org/package/content-type diff --git a/node_modules/content-type/index.js b/node_modules/content-type/index.js new file mode 100644 index 0000000..6ce03f2 --- /dev/null +++ b/node_modules/content-type/index.js @@ -0,0 +1,222 @@ +/*! + * content-type + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1 + * + * parameter = token "=" ( token / quoted-string ) + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE + * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text + * obs-text = %x80-FF + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + */ +var PARAM_REGEXP = /; *([!#$%&'*+.^_`|~0-9A-Za-z-]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'*+.^_`|~0-9A-Za-z-]+) */g +var TEXT_REGEXP = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/ +var TOKEN_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+$/ + +/** + * RegExp to match quoted-pair in RFC 7230 sec 3.2.6 + * + * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text ) + * obs-text = %x80-FF + */ +var QESC_REGEXP = /\\([\u000b\u0020-\u00ff])/g + +/** + * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6 + */ +var QUOTE_REGEXP = /([\\"])/g + +/** + * RegExp to match type in RFC 7231 sec 3.1.1.1 + * + * media-type = type "/" subtype + * type = token + * subtype = token + */ +var TYPE_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+\/[!#$%&'*+.^_`|~0-9A-Za-z-]+$/ + +/** + * Module exports. + * @public + */ + +exports.format = format +exports.parse = parse + +/** + * Format object to media type. + * + * @param {object} obj + * @return {string} + * @public + */ + +function format (obj) { + if (!obj || typeof obj !== 'object') { + throw new TypeError('argument obj is required') + } + + var parameters = obj.parameters + var type = obj.type + + if (!type || !TYPE_REGEXP.test(type)) { + throw new TypeError('invalid type') + } + + var string = type + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + if (!TOKEN_REGEXP.test(param)) { + throw new TypeError('invalid parameter name') + } + + string += '; ' + param + '=' + qstring(parameters[param]) + } + } + + return string +} + +/** + * Parse media type to object. + * + * @param {string|object} string + * @return {Object} + * @public + */ + +function parse (string) { + if (!string) { + throw new TypeError('argument string is required') + } + + // support req/res-like objects as argument + var header = typeof string === 'object' + ? getcontenttype(string) + : string + + if (typeof header !== 'string') { + throw new TypeError('argument string is required to be a string') + } + + var index = header.indexOf(';') + var type = index !== -1 + ? header.substr(0, index).trim() + : header.trim() + + if (!TYPE_REGEXP.test(type)) { + throw new TypeError('invalid media type') + } + + var obj = new ContentType(type.toLowerCase()) + + // parse parameters + if (index !== -1) { + var key + var match + var value + + PARAM_REGEXP.lastIndex = index + + while ((match = PARAM_REGEXP.exec(header))) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(QESC_REGEXP, '$1') + } + + obj.parameters[key] = value + } + + if (index !== header.length) { + throw new TypeError('invalid parameter format') + } + } + + return obj +} + +/** + * Get content-type from req/res objects. + * + * @param {object} + * @return {Object} + * @private + */ + +function getcontenttype (obj) { + var header + + if (typeof obj.getHeader === 'function') { + // res-like + header = obj.getHeader('content-type') + } else if (typeof obj.headers === 'object') { + // req-like + header = obj.headers && obj.headers['content-type'] + } + + if (typeof header !== 'string') { + throw new TypeError('content-type header is missing from object') + } + + return header +} + +/** + * Quote a string if necessary. + * + * @param {string} val + * @return {string} + * @private + */ + +function qstring (val) { + var str = String(val) + + // no need to quote tokens + if (TOKEN_REGEXP.test(str)) { + return str + } + + if (str.length > 0 && !TEXT_REGEXP.test(str)) { + throw new TypeError('invalid parameter value') + } + + return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"' +} + +/** + * Class to represent a content type. + * @private + */ +function ContentType (type) { + this.parameters = Object.create(null) + this.type = type +} diff --git a/node_modules/content-type/package.json b/node_modules/content-type/package.json new file mode 100644 index 0000000..229f6bc --- /dev/null +++ b/node_modules/content-type/package.json @@ -0,0 +1,76 @@ +{ + "_from": "content-type@~1.0.4", + "_id": "content-type@1.0.4", + "_inBundle": false, + "_integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==", + "_location": "/content-type", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "content-type@~1.0.4", + "name": "content-type", + "escapedName": "content-type", + "rawSpec": "~1.0.4", + "saveSpec": null, + "fetchSpec": "~1.0.4" + }, + "_requiredBy": [ + "/body-parser", + "/express" + ], + "_resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.4.tgz", + "_shasum": "e138cc75e040c727b1966fe5e5f8c9aee256fe3b", + "_spec": "content-type@~1.0.4", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/content-type/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Create and parse HTTP Content-Type header", + "devDependencies": { + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.7.0", + "eslint-plugin-node": "5.1.1", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "~1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/content-type#readme", + "keywords": [ + "content-type", + "http", + "req", + "res", + "rfc7231" + ], + "license": "MIT", + "name": "content-type", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/content-type.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "1.0.4" +} diff --git a/node_modules/cookie-signature/.npmignore b/node_modules/cookie-signature/.npmignore new file mode 100644 index 0000000..f1250e5 --- /dev/null +++ b/node_modules/cookie-signature/.npmignore @@ -0,0 +1,4 @@ +support +test +examples +*.sock diff --git a/node_modules/cookie-signature/History.md b/node_modules/cookie-signature/History.md new file mode 100644 index 0000000..78513cc --- /dev/null +++ b/node_modules/cookie-signature/History.md @@ -0,0 +1,38 @@ +1.0.6 / 2015-02-03 +================== + +* use `npm test` instead of `make test` to run tests +* clearer assertion messages when checking input + + +1.0.5 / 2014-09-05 +================== + +* add license to package.json + +1.0.4 / 2014-06-25 +================== + + * corrected avoidance of timing attacks (thanks @tenbits!) + +1.0.3 / 2014-01-28 +================== + + * [incorrect] fix for timing attacks + +1.0.2 / 2014-01-28 +================== + + * fix missing repository warning + * fix typo in test + +1.0.1 / 2013-04-15 +================== + + * Revert "Changed underlying HMAC algo. to sha512." + * Revert "Fix for timing attacks on MAC verification." + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/cookie-signature/Readme.md b/node_modules/cookie-signature/Readme.md new file mode 100644 index 0000000..2559e84 --- /dev/null +++ b/node_modules/cookie-signature/Readme.md @@ -0,0 +1,42 @@ + +# cookie-signature + + Sign and unsign cookies. + +## Example + +```js +var cookie = require('cookie-signature'); + +var val = cookie.sign('hello', 'tobiiscool'); +val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI'); + +var val = cookie.sign('hello', 'tobiiscool'); +cookie.unsign(val, 'tobiiscool').should.equal('hello'); +cookie.unsign(val, 'luna').should.be.false; +``` + +## License + +(The MIT License) + +Copyright (c) 2012 LearnBoost <tj@learnboost.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/cookie-signature/index.js b/node_modules/cookie-signature/index.js new file mode 100644 index 0000000..b8c9463 --- /dev/null +++ b/node_modules/cookie-signature/index.js @@ -0,0 +1,51 @@ +/** + * Module dependencies. + */ + +var crypto = require('crypto'); + +/** + * Sign the given `val` with `secret`. + * + * @param {String} val + * @param {String} secret + * @return {String} + * @api private + */ + +exports.sign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + return val + '.' + crypto + .createHmac('sha256', secret) + .update(val) + .digest('base64') + .replace(/\=+$/, ''); +}; + +/** + * Unsign and decode the given `val` with `secret`, + * returning `false` if the signature is invalid. + * + * @param {String} val + * @param {String} secret + * @return {String|Boolean} + * @api private + */ + +exports.unsign = function(val, secret){ + if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided."); + if ('string' != typeof secret) throw new TypeError("Secret string must be provided."); + var str = val.slice(0, val.lastIndexOf('.')) + , mac = exports.sign(str, secret); + + return sha1(mac) == sha1(val) ? str : false; +}; + +/** + * Private + */ + +function sha1(str){ + return crypto.createHash('sha1').update(str).digest('hex'); +} diff --git a/node_modules/cookie-signature/package.json b/node_modules/cookie-signature/package.json new file mode 100644 index 0000000..9edea15 --- /dev/null +++ b/node_modules/cookie-signature/package.json @@ -0,0 +1,57 @@ +{ + "_from": "cookie-signature@1.0.6", + "_id": "cookie-signature@1.0.6", + "_inBundle": false, + "_integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=", + "_location": "/cookie-signature", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "cookie-signature@1.0.6", + "name": "cookie-signature", + "escapedName": "cookie-signature", + "rawSpec": "1.0.6", + "saveSpec": null, + "fetchSpec": "1.0.6" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "_shasum": "e303a882b342cc3ee8ca513a79999734dab3ae2c", + "_spec": "cookie-signature@1.0.6", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@learnboost.com" + }, + "bugs": { + "url": "https://github.com/visionmedia/node-cookie-signature/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "Sign and unsign cookies", + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "homepage": "https://github.com/visionmedia/node-cookie-signature#readme", + "keywords": [ + "cookie", + "sign", + "unsign" + ], + "license": "MIT", + "main": "index", + "name": "cookie-signature", + "repository": { + "type": "git", + "url": "git+https://github.com/visionmedia/node-cookie-signature.git" + }, + "scripts": { + "test": "mocha --require should --reporter spec" + }, + "version": "1.0.6" +} diff --git a/node_modules/cookie/HISTORY.md b/node_modules/cookie/HISTORY.md new file mode 100644 index 0000000..da2bf24 --- /dev/null +++ b/node_modules/cookie/HISTORY.md @@ -0,0 +1,123 @@ +0.4.0 / 2019-05-15 +================== + + * Add `SameSite=None` support + +0.3.1 / 2016-05-26 +================== + + * Fix `sameSite: true` to work with draft-7 clients + - `true` now sends `SameSite=Strict` instead of `SameSite` + +0.3.0 / 2016-05-26 +================== + + * Add `sameSite` option + - Replaces `firstPartyOnly` option, never implemented by browsers + * Improve error message when `encode` is not a function + * Improve error message when `expires` is not a `Date` + +0.2.4 / 2016-05-20 +================== + + * perf: enable strict mode + * perf: use for loop in parse + * perf: use string concatination for serialization + +0.2.3 / 2015-10-25 +================== + + * Fix cookie `Max-Age` to never be a floating point number + +0.2.2 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.2.1 / 2015-09-17 +================== + + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.2.0 / 2015-08-13 +================== + + * Add `firstPartyOnly` option + * Throw better error for invalid argument to parse + * perf: hoist regular expression + +0.1.5 / 2015-09-17 +================== + + * Fix regression when setting empty cookie value + - Ease the new restriction, which is just basic header-level validation + * Fix typo in invalid value errors + +0.1.4 / 2015-09-17 +================== + + * Throw better error for invalid argument to parse + * Throw on invalid values provided to `serialize` + - Ensures the resulting string is a valid HTTP header value + +0.1.3 / 2015-05-19 +================== + + * Reduce the scope of try-catch deopt + * Remove argument reassignments + +0.1.2 / 2014-04-16 +================== + + * Remove unnecessary files from npm package + +0.1.1 / 2014-02-23 +================== + + * Fix bad parse when cookie value contained a comma + * Fix support for `maxAge` of `0` + +0.1.0 / 2013-05-01 +================== + + * Add `decode` option + * Add `encode` option + +0.0.6 / 2013-04-08 +================== + + * Ignore cookie parts missing `=` + +0.0.5 / 2012-10-29 +================== + + * Return raw cookie value if value unescape errors + +0.0.4 / 2012-06-21 +================== + + * Use encode/decodeURIComponent for cookie encoding/decoding + - Improve server/client interoperability + +0.0.3 / 2012-06-06 +================== + + * Only escape special characters per the cookie RFC + +0.0.2 / 2012-06-01 +================== + + * Fix `maxAge` option to not throw error + +0.0.1 / 2012-05-28 +================== + + * Add more tests + +0.0.0 / 2012-05-28 +================== + + * Initial release diff --git a/node_modules/cookie/LICENSE b/node_modules/cookie/LICENSE new file mode 100644 index 0000000..058b6b4 --- /dev/null +++ b/node_modules/cookie/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Roman Shtylman <shtylman@gmail.com> +Copyright (c) 2015 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/cookie/README.md b/node_modules/cookie/README.md new file mode 100644 index 0000000..857fb77 --- /dev/null +++ b/node_modules/cookie/README.md @@ -0,0 +1,253 @@ +# cookie + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Basic HTTP cookie parser and serializer for HTTP servers. + +## Installation + +```sh +$ npm install cookie +``` + +## API + +```js +var cookie = require('cookie'); +``` + +### cookie.parse(str, options) + +Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs. +The `str` argument is the string representing a `Cookie` header value and `options` is an +optional object containing additional parsing options. + +```js +var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2'); +// { foo: 'bar', equation: 'E=mc^2' } +``` + +#### Options + +`cookie.parse` accepts these properties in the options object. + +##### decode + +Specifies a function that will be used to decode a cookie's value. Since the value of a cookie +has a limited character set (and must be a simple string), this function can be used to decode +a previously-encoded cookie value into a JavaScript string or other object. + +The default function is the global `decodeURIComponent`, which will decode any URL-encoded +sequences into their byte representations. + +**note** if an error is thrown from this function, the original, non-decoded cookie value will +be returned as the cookie's value. + +### cookie.serialize(name, value, options) + +Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the +name for the cookie, the `value` argument is the value to set the cookie to, and the `options` +argument is an optional object containing additional serialization options. + +```js +var setCookie = cookie.serialize('foo', 'bar'); +// foo=bar +``` + +#### Options + +`cookie.serialize` accepts these properties in the options object. + +##### domain + +Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no +domain is set, and most clients will consider the cookie to apply to only the current domain. + +##### encode + +Specifies a function that will be used to encode a cookie's value. Since value of a cookie +has a limited character set (and must be a simple string), this function can be used to encode +a value into a string suited for a cookie's value. + +The default function is the global `encodeURIComponent`, which will encode a JavaScript string +into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range. + +##### expires + +Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1]. +By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and +will delete it on a condition like exiting a web browser application. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### httpOnly + +Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy, +the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not allow client-side +JavaScript to see the cookie in `document.cookie`. + +##### maxAge + +Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2]. +The given number will be converted to an integer by rounding down. By default, no maximum age is set. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### path + +Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path +is considered the ["default path"][rfc-6265-5.1.4]. + +##### sameSite + +Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-03-4.1.2.7]. + + - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + - `false` will not set the `SameSite` attribute. + - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement. + - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie. + - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + +More information about the different enforcement levels can be found in +[the specification][rfc-6265bis-03-4.1.2.7]. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### secure + +Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy, +the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to +the server in the future if the browser does not have an HTTPS connection. + +## Example + +The following example uses this module in conjunction with the Node.js core HTTP server +to prompt a user for their name and display it back on future visits. + +```js +var cookie = require('cookie'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var url = require('url'); + +function onRequest(req, res) { + // Parse the query string + var query = url.parse(req.url, true, true).query; + + if (query && query.name) { + // Set a new cookie with the name + res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), { + httpOnly: true, + maxAge: 60 * 60 * 24 * 7 // 1 week + })); + + // Redirect back after setting cookie + res.statusCode = 302; + res.setHeader('Location', req.headers.referer || '/'); + res.end(); + return; + } + + // Parse the cookies on the request + var cookies = cookie.parse(req.headers.cookie || ''); + + // Get the visitor name set in the cookie + var name = cookies.name; + + res.setHeader('Content-Type', 'text/html; charset=UTF-8'); + + if (name) { + res.write('<p>Welcome back, <b>' + escapeHtml(name) + '</b>!</p>'); + } else { + res.write('<p>Hello, new visitor!</p>'); + } + + res.write('<form method="GET">'); + res.write('<input placeholder="enter your name" name="name"> <input type="submit" value="Set Name">'); + res.end('</form>'); +} + +http.createServer(onRequest).listen(3000); +``` + +## Testing + +```sh +$ npm test +``` + +## Benchmark + +``` +$ npm run bench + +> cookie@0.3.1 bench cookie +> node benchmark/index.js + + http_parser@2.8.0 + node@6.14.2 + v8@5.1.281.111 + uv@1.16.1 + zlib@1.2.11 + ares@1.10.1-DEV + icu@58.2 + modules@48 + napi@3 + openssl@1.0.2o + +> node benchmark/parse.js + + cookie.parse + + 6 tests completed. + + simple x 1,200,691 ops/sec ±1.12% (189 runs sampled) + decode x 1,012,994 ops/sec ±0.97% (186 runs sampled) + unquote x 1,074,174 ops/sec ±2.43% (186 runs sampled) + duplicates x 438,424 ops/sec ±2.17% (184 runs sampled) + 10 cookies x 147,154 ops/sec ±1.01% (186 runs sampled) + 100 cookies x 14,274 ops/sec ±1.07% (187 runs sampled) +``` + +## References + +- [RFC 6265: HTTP State Management Mechanism][rfc-6265] +- [Same-site Cookies][rfc-6265bis-03-4.1.2.7] + +[rfc-6265bis-03-4.1.2.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-03#section-4.1.2.7 +[rfc-6265]: https://tools.ietf.org/html/rfc6265 +[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4 +[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1 +[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2 +[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3 +[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4 +[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5 +[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6 +[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3 + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master +[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master +[node-version-image]: https://badgen.net/npm/node/cookie +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/cookie +[npm-url]: https://npmjs.org/package/cookie +[npm-version-image]: https://badgen.net/npm/v/cookie +[travis-image]: https://badgen.net/travis/jshttp/cookie/master +[travis-url]: https://travis-ci.org/jshttp/cookie diff --git a/node_modules/cookie/index.js b/node_modules/cookie/index.js new file mode 100644 index 0000000..16f56c0 --- /dev/null +++ b/node_modules/cookie/index.js @@ -0,0 +1,198 @@ +/*! + * cookie + * Copyright(c) 2012-2014 Roman Shtylman + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +exports.parse = parse; +exports.serialize = serialize; + +/** + * Module variables. + * @private + */ + +var decode = decodeURIComponent; +var encode = encodeURIComponent; +var pairSplitRegExp = /; */; + +/** + * RegExp to match field-content in RFC 7230 sec 3.2 + * + * field-content = field-vchar [ 1*( SP / HTAB ) field-vchar ] + * field-vchar = VCHAR / obs-text + * obs-text = %x80-FF + */ + +var fieldContentRegExp = /^[\u0009\u0020-\u007e\u0080-\u00ff]+$/; + +/** + * Parse a cookie header. + * + * Parse the given cookie header string into an object + * The object has the various cookies as keys(names) => values + * + * @param {string} str + * @param {object} [options] + * @return {object} + * @public + */ + +function parse(str, options) { + if (typeof str !== 'string') { + throw new TypeError('argument str must be a string'); + } + + var obj = {} + var opt = options || {}; + var pairs = str.split(pairSplitRegExp); + var dec = opt.decode || decode; + + for (var i = 0; i < pairs.length; i++) { + var pair = pairs[i]; + var eq_idx = pair.indexOf('='); + + // skip things that don't look like key=value + if (eq_idx < 0) { + continue; + } + + var key = pair.substr(0, eq_idx).trim() + var val = pair.substr(++eq_idx, pair.length).trim(); + + // quoted values + if ('"' == val[0]) { + val = val.slice(1, -1); + } + + // only assign once + if (undefined == obj[key]) { + obj[key] = tryDecode(val, dec); + } + } + + return obj; +} + +/** + * Serialize data into a cookie header. + * + * Serialize the a name value pair into a cookie string suitable for + * http headers. An optional options object specified cookie parameters. + * + * serialize('foo', 'bar', { httpOnly: true }) + * => "foo=bar; httpOnly" + * + * @param {string} name + * @param {string} val + * @param {object} [options] + * @return {string} + * @public + */ + +function serialize(name, val, options) { + var opt = options || {}; + var enc = opt.encode || encode; + + if (typeof enc !== 'function') { + throw new TypeError('option encode is invalid'); + } + + if (!fieldContentRegExp.test(name)) { + throw new TypeError('argument name is invalid'); + } + + var value = enc(val); + + if (value && !fieldContentRegExp.test(value)) { + throw new TypeError('argument val is invalid'); + } + + var str = name + '=' + value; + + if (null != opt.maxAge) { + var maxAge = opt.maxAge - 0; + if (isNaN(maxAge)) throw new Error('maxAge should be a Number'); + str += '; Max-Age=' + Math.floor(maxAge); + } + + if (opt.domain) { + if (!fieldContentRegExp.test(opt.domain)) { + throw new TypeError('option domain is invalid'); + } + + str += '; Domain=' + opt.domain; + } + + if (opt.path) { + if (!fieldContentRegExp.test(opt.path)) { + throw new TypeError('option path is invalid'); + } + + str += '; Path=' + opt.path; + } + + if (opt.expires) { + if (typeof opt.expires.toUTCString !== 'function') { + throw new TypeError('option expires is invalid'); + } + + str += '; Expires=' + opt.expires.toUTCString(); + } + + if (opt.httpOnly) { + str += '; HttpOnly'; + } + + if (opt.secure) { + str += '; Secure'; + } + + if (opt.sameSite) { + var sameSite = typeof opt.sameSite === 'string' + ? opt.sameSite.toLowerCase() : opt.sameSite; + + switch (sameSite) { + case true: + str += '; SameSite=Strict'; + break; + case 'lax': + str += '; SameSite=Lax'; + break; + case 'strict': + str += '; SameSite=Strict'; + break; + case 'none': + str += '; SameSite=None'; + break; + default: + throw new TypeError('option sameSite is invalid'); + } + } + + return str; +} + +/** + * Try decoding a string using a decoding function. + * + * @param {string} str + * @param {function} decode + * @private + */ + +function tryDecode(str, decode) { + try { + return decode(str); + } catch (e) { + return str; + } +} diff --git a/node_modules/cookie/package.json b/node_modules/cookie/package.json new file mode 100644 index 0000000..db14cd9 --- /dev/null +++ b/node_modules/cookie/package.json @@ -0,0 +1,78 @@ +{ + "_from": "cookie@0.4.0", + "_id": "cookie@0.4.0", + "_inBundle": false, + "_integrity": "sha512-+Hp8fLp57wnUSt0tY0tHEXh4voZRDnoIrZPqlo3DPiI4y9lwg/jqx+1Om94/W6ZaPDOUbnjOt/99w66zk+l1Xg==", + "_location": "/cookie", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "cookie@0.4.0", + "name": "cookie", + "escapedName": "cookie", + "rawSpec": "0.4.0", + "saveSpec": null, + "fetchSpec": "0.4.0" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/cookie/-/cookie-0.4.0.tgz", + "_shasum": "beb437e7022b3b6d49019d088665303ebe9c14ba", + "_spec": "cookie@0.4.0", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Roman Shtylman", + "email": "shtylman@gmail.com" + }, + "bugs": { + "url": "https://github.com/jshttp/cookie/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "HTTP server cookie parsing and serialization", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "5.16.0", + "eslint-plugin-markdown": "1.0.0", + "istanbul": "0.4.5", + "mocha": "6.1.4" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/cookie#readme", + "keywords": [ + "cookie", + "cookies" + ], + "license": "MIT", + "name": "cookie", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/cookie.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "version": "node scripts/version-history.js && git add HISTORY.md" + }, + "version": "0.4.0" +} diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml new file mode 100644 index 0000000..20a7068 --- /dev/null +++ b/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc new file mode 100644 index 0000000..8a37ae2 --- /dev/null +++ b/node_modules/debug/.eslintrc @@ -0,0 +1,11 @@ +{ + "env": { + "browser": true, + "node": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore new file mode 100644 index 0000000..5f60eec --- /dev/null +++ b/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml new file mode 100644 index 0000000..6c6090c --- /dev/null +++ b/node_modules/debug/.travis.yml @@ -0,0 +1,14 @@ + +language: node_js +node_js: + - "6" + - "5" + - "4" + +install: + - make node_modules + +script: + - make lint + - make test + - make coveralls diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md new file mode 100644 index 0000000..eadaa18 --- /dev/null +++ b/node_modules/debug/CHANGELOG.md @@ -0,0 +1,362 @@ + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE new file mode 100644 index 0000000..658c933 --- /dev/null +++ b/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile new file mode 100644 index 0000000..584da8b --- /dev/null +++ b/node_modules/debug/Makefile @@ -0,0 +1,50 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +.FORCE: + +install: node_modules + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +lint: .FORCE + eslint browser.js debug.js index.js node.js + +test-node: .FORCE + istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + +test-browser: .FORCE + mkdir -p dist + + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + + karma start --single-run + rimraf dist + +test: .FORCE + concurrently \ + "make test-node" \ + "make test-browser" + +coveralls: + cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +.PHONY: all install clean distclean diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md new file mode 100644 index 0000000..f67be6b --- /dev/null +++ b/node_modules/debug/README.md @@ -0,0 +1,312 @@ +# debug +[](https://travis-ci.org/visionmedia/debug) [](https://coveralls.io/github/visionmedia/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers) +[](#sponsors) + + + +A tiny node.js debugging utility modelled after node core's debugging technique. + +**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)** + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + +  + +  + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + + Note that PowerShell uses different syntax to set environment variables. + + ```cmd + $env:DEBUG = "*,-not_this" + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + +  + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + +  + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Environment Variables + + When running through Node.js, you can set a few environment variables that will + change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + + __Note:__ The environment variables beginning with `DEBUG_` end up being + converted into an Options object that gets used with `%o`/`%O` formatters. + See the Node.js documentation for + [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) + for the complete list. + +## Formatters + + + Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + +### Custom formatters + + You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// â¦elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + +## Browser support + You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), + or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), + if you don't want to build it yourself. + + Debug's enable state is currently persisted by `localStorage`. + Consider the situation shown below where you have `worker:a` and `worker:b`, + and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + +  + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + +<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a> + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + +<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a> + +## License + +(The MIT License) + +Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/debug/component.json b/node_modules/debug/component.json new file mode 100644 index 0000000..9de2641 --- /dev/null +++ b/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.6.9", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "src/browser.js", + "scripts": [ + "src/browser.js", + "src/debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/node_modules/debug/karma.conf.js b/node_modules/debug/karma.conf.js new file mode 100644 index 0000000..103a82d --- /dev/null +++ b/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js new file mode 100644 index 0000000..7fc36fe --- /dev/null +++ b/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json new file mode 100644 index 0000000..70b520d --- /dev/null +++ b/node_modules/debug/package.json @@ -0,0 +1,91 @@ +{ + "_from": "debug@2.6.9", + "_id": "debug@2.6.9", + "_inBundle": false, + "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "_location": "/debug", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "debug@2.6.9", + "name": "debug", + "escapedName": "debug", + "rawSpec": "2.6.9", + "saveSpec": null, + "fetchSpec": "2.6.9" + }, + "_requiredBy": [ + "/body-parser", + "/express", + "/finalhandler", + "/send" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "_shasum": "5d128515df134ff327e90a4c93f4e077a536341f", + "_spec": "debug@2.6.9", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "bundleDependencies": false, + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + }, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "rhyneandrew@gmail.com" + } + ], + "dependencies": { + "ms": "2.0.0" + }, + "deprecated": false, + "description": "small debugging utility", + "devDependencies": { + "browserify": "9.0.3", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "homepage": "https://github.com/visionmedia/debug#readme", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./src/index.js", + "name": "debug", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "version": "2.6.9" +} diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js new file mode 100644 index 0000000..7106924 --- /dev/null +++ b/node_modules/debug/src/browser.js @@ -0,0 +1,185 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js new file mode 100644 index 0000000..6a5e3fc --- /dev/null +++ b/node_modules/debug/src/debug.js @@ -0,0 +1,202 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + return debug; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js new file mode 100644 index 0000000..e12cf4d --- /dev/null +++ b/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process !== 'undefined' && process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/debug/src/inspector-log.js b/node_modules/debug/src/inspector-log.js new file mode 100644 index 0000000..60ea6c0 --- /dev/null +++ b/node_modules/debug/src/inspector-log.js @@ -0,0 +1,15 @@ +module.exports = inspectorLog; + +// black hole +const nullStream = new (require('stream').Writable)(); +nullStream._write = () => {}; + +/** + * Outputs a `console.log()` to the Node.js Inspector console *only*. + */ +function inspectorLog() { + const stdout = console._stdout; + console._stdout = nullStream; + console.log.apply(console, arguments); + console._stdout = stdout; +} diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js new file mode 100644 index 0000000..b15109c --- /dev/null +++ b/node_modules/debug/src/node.js @@ -0,0 +1,248 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; + +if (1 !== fd && 2 !== fd) { + util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')() +} + +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n').map(function(str) { + return str.trim() + }).join(' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to `stream`. + */ + +function log() { + return stream.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/node_modules/depd/History.md b/node_modules/depd/History.md new file mode 100644 index 0000000..507ecb8 --- /dev/null +++ b/node_modules/depd/History.md @@ -0,0 +1,96 @@ +1.1.2 / 2018-01-11 +================== + + * perf: remove argument reassignment + * Support Node.js 0.6 to 9.x + +1.1.1 / 2017-07-27 +================== + + * Remove unnecessary `Buffer` loading + * Support Node.js 0.6 to 8.x + +1.1.0 / 2015-09-14 +================== + + * Enable strict mode in more places + * Support io.js 3.x + * Support io.js 2.x + * Support web browser loading + - Requires bundler like Browserify or webpack + +1.0.1 / 2015-04-07 +================== + + * Fix `TypeError`s when under `'use strict'` code + * Fix useless type name on auto-generated messages + * Support io.js 1.x + * Support Node.js 0.12 + +1.0.0 / 2014-09-17 +================== + + * No changes + +0.4.5 / 2014-09-09 +================== + + * Improve call speed to functions using the function wrapper + * Support Node.js 0.6 + +0.4.4 / 2014-07-27 +================== + + * Work-around v8 generating empty stack traces + +0.4.3 / 2014-07-26 +================== + + * Fix exception when global `Error.stackTraceLimit` is too low + +0.4.2 / 2014-07-19 +================== + + * Correct call site for wrapped functions and properties + +0.4.1 / 2014-07-19 +================== + + * Improve automatic message generation for function properties + +0.4.0 / 2014-07-19 +================== + + * Add `TRACE_DEPRECATION` environment variable + * Remove non-standard grey color from color output + * Support `--no-deprecation` argument + * Support `--trace-deprecation` argument + * Support `deprecate.property(fn, prop, message)` + +0.3.0 / 2014-06-16 +================== + + * Add `NO_DEPRECATION` environment variable + +0.2.0 / 2014-06-15 +================== + + * Add `deprecate.property(obj, prop, message)` + * Remove `supports-color` dependency for node.js 0.8 + +0.1.0 / 2014-06-15 +================== + + * Add `deprecate.function(fn, message)` + * Add `process.on('deprecation', fn)` emitter + * Automatically generate message when omitted from `deprecate()` + +0.0.1 / 2014-06-15 +================== + + * Fix warning for dynamic calls at singe call site + +0.0.0 / 2014-06-15 +================== + + * Initial implementation diff --git a/node_modules/depd/LICENSE b/node_modules/depd/LICENSE new file mode 100644 index 0000000..84441fb --- /dev/null +++ b/node_modules/depd/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/depd/Readme.md b/node_modules/depd/Readme.md new file mode 100644 index 0000000..7790670 --- /dev/null +++ b/node_modules/depd/Readme.md @@ -0,0 +1,280 @@ +# depd + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Deprecate all the things + +> With great modules comes great responsibility; mark things deprecated! + +## Install + +This module is installed directly using `npm`: + +```sh +$ npm install depd +``` + +This module can also be bundled with systems like +[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/), +though by default this module will alter it's API to no longer display or +track deprecations. + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var deprecate = require('depd')('my-module') +``` + +This library allows you to display deprecation messages to your users. +This library goes above and beyond with deprecation warnings by +introspection of the call stack (but only the bits that it is interested +in). + +Instead of just warning on the first invocation of a deprecated +function and never again, this module will warn on the first invocation +of a deprecated function per unique call site, making it ideal to alert +users of all deprecated uses across the code base, rather than just +whatever happens to execute first. + +The deprecation warnings from this module also include the file and line +information for the call into the module that the deprecated function was +in. + +**NOTE** this library has a similar interface to the `debug` module, and +this module uses the calling file to get the boundary for the call stacks, +so you should always create a new `deprecate` object in each file and not +within some central file. + +### depd(namespace) + +Create a new deprecate function that uses the given namespace name in the +messages and will display the call site prior to the stack entering the +file this function was called from. It is highly suggested you use the +name of your module as the namespace. + +### deprecate(message) + +Call this function from deprecated code to display a deprecation message. +This message will appear once per unique caller site. Caller site is the +first call site in the stack in a different file from the caller of this +function. + +If the message is omitted, a message is generated for you based on the site +of the `deprecate()` call and will display the name of the function called, +similar to the name displayed in a stack trace. + +### deprecate.function(fn, message) + +Call this function to wrap a given function in a deprecation message on any +call to the function. An optional message can be supplied to provide a custom +message. + +### deprecate.property(obj, prop, message) + +Call this function to wrap a given property on object in a deprecation message +on any accessing or setting of the property. An optional message can be supplied +to provide a custom message. + +The method must be called on the object where the property belongs (not +inherited from the prototype). + +If the property is a data descriptor, it will be converted to an accessor +descriptor in order to display the deprecation message. + +### process.on('deprecation', fn) + +This module will allow easy capturing of deprecation errors by emitting the +errors as the type "deprecation" on the global `process`. If there are no +listeners for this type, the errors are written to STDERR as normal, but if +there are any listeners, nothing will be written to STDERR and instead only +emitted. From there, you can write the errors in a different format or to a +logging source. + +The error represents the deprecation and is emitted only once with the same +rules as writing to STDERR. The error has the following properties: + + - `message` - This is the message given by the library + - `name` - This is always `'DeprecationError'` + - `namespace` - This is the namespace the deprecation came from + - `stack` - This is the stack of the call to the deprecated thing + +Example `error.stack` output: + +``` +DeprecationError: my-cool-module deprecated oldfunction + at Object.<anonymous> ([eval]-wrapper:6:22) + at Module._compile (module.js:456:26) + at evalScript (node.js:532:25) + at startup (node.js:80:7) + at node.js:902:3 +``` + +### process.env.NO_DEPRECATION + +As a user of modules that are deprecated, the environment variable `NO_DEPRECATION` +is provided as a quick solution to silencing deprecation warnings from being +output. The format of this is similar to that of `DEBUG`: + +```sh +$ NO_DEPRECATION=my-module,othermod node app.js +``` + +This will suppress deprecations from being output for "my-module" and "othermod". +The value is a list of comma-separated namespaces. To suppress every warning +across all namespaces, use the value `*` for a namespace. + +Providing the argument `--no-deprecation` to the `node` executable will suppress +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not suppress the deperecations given to any "deprecation" +event listeners, just the output to STDERR. + +### process.env.TRACE_DEPRECATION + +As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION` +is provided as a solution to getting more detailed location information in deprecation +warnings by including the entire stack trace. The format of this is the same as +`NO_DEPRECATION`: + +```sh +$ TRACE_DEPRECATION=my-module,othermod node app.js +``` + +This will include stack traces for deprecations being output for "my-module" and +"othermod". The value is a list of comma-separated namespaces. To trace every +warning across all namespaces, use the value `*` for a namespace. + +Providing the argument `--trace-deprecation` to the `node` executable will trace +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`. + +## Display + + + +When a user calls a function in your library that you mark deprecated, they +will see the following written to STDERR (in the given colors, similar colors +and layout to the `debug` module): + +``` +bright cyan bright yellow +| | reset cyan +| | | | +â¼ â¼ â¼ â¼ +my-cool-module deprecated oldfunction [eval]-wrapper:6:22 +â² â² â² â² +| | | | +namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +If the user redirects their STDERR to a file or somewhere that does not support +colors, they see (similar layout to the `debug` module): + +``` +Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22 +â² â² â² â² â² +| | | | | +timestamp of message namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +## Examples + +### Deprecating all calls to a function + +This will display a deprecated message about "oldfunction" being deprecated +from "my-module" on STDERR. + +```js +var deprecate = require('depd')('my-cool-module') + +// message automatically derived from function name +// Object.oldfunction +exports.oldfunction = deprecate.function(function oldfunction () { + // all calls to function are deprecated +}) + +// specific message +exports.oldfunction = deprecate.function(function () { + // all calls to function are deprecated +}, 'oldfunction') +``` + +### Conditionally deprecating a function call + +This will display a deprecated message about "weirdfunction" being deprecated +from "my-module" on STDERR when called with less than 2 arguments. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } +} +``` + +When calling `deprecate` as a function, the warning is counted per call site +within your own module, so you can display different deprecations depending +on different situations and the users will still get all the warnings: + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } else if (typeof arguments[0] !== 'string') { + // calls with non-string first argument are deprecated + deprecate('weirdfunction non-string first arg') + } +} +``` + +### Deprecating property access + +This will display a deprecated message about "oldprop" being deprecated +from "my-module" on STDERR when accessed. A deprecation will be displayed +when setting the value and when getting the value. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.oldprop = 'something' + +// message automatically derives from property name +deprecate.property(exports, 'oldprop') + +// explicit message +deprecate.property(exports, 'oldprop', 'oldprop >= 0.10') +``` + +## License + +[MIT](LICENSE) + +[npm-version-image]: https://img.shields.io/npm/v/depd.svg +[npm-downloads-image]: https://img.shields.io/npm/dm/depd.svg +[npm-url]: https://npmjs.org/package/depd +[travis-image]: https://img.shields.io/travis/dougwilson/nodejs-depd/master.svg?label=linux +[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd +[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/nodejs-depd/master.svg?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd +[coveralls-image]: https://img.shields.io/coveralls/dougwilson/nodejs-depd/master.svg +[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master +[node-image]: https://img.shields.io/node/v/depd.svg +[node-url]: https://nodejs.org/en/download/ diff --git a/node_modules/depd/index.js b/node_modules/depd/index.js new file mode 100644 index 0000000..d758d3c --- /dev/null +++ b/node_modules/depd/index.js @@ -0,0 +1,522 @@ +/*! + * depd + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var callSiteToString = require('./lib/compat').callSiteToString +var eventListenerCount = require('./lib/compat').eventListenerCount +var relative = require('path').relative + +/** + * Module exports. + */ + +module.exports = depd + +/** + * Get the path to base files on. + */ + +var basePath = process.cwd() + +/** + * Determine if namespace is contained in the string. + */ + +function containsNamespace (str, namespace) { + var vals = str.split(/[ ,]+/) + var ns = String(namespace).toLowerCase() + + for (var i = 0; i < vals.length; i++) { + var val = vals[i] + + // namespace contained + if (val && (val === '*' || val.toLowerCase() === ns)) { + return true + } + } + + return false +} + +/** + * Convert a data descriptor to accessor descriptor. + */ + +function convertDataDescriptorToAccessor (obj, prop, message) { + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + var value = descriptor.value + + descriptor.get = function getter () { return value } + + if (descriptor.writable) { + descriptor.set = function setter (val) { return (value = val) } + } + + delete descriptor.value + delete descriptor.writable + + Object.defineProperty(obj, prop, descriptor) + + return descriptor +} + +/** + * Create arguments string to keep arity. + */ + +function createArgumentsString (arity) { + var str = '' + + for (var i = 0; i < arity; i++) { + str += ', arg' + i + } + + return str.substr(2) +} + +/** + * Create stack string from stack. + */ + +function createStackString (stack) { + var str = this.name + ': ' + this.namespace + + if (this.message) { + str += ' deprecated ' + this.message + } + + for (var i = 0; i < stack.length; i++) { + str += '\n at ' + callSiteToString(stack[i]) + } + + return str +} + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + var stack = getStack() + var site = callSiteLocation(stack[1]) + var file = site[0] + + function deprecate (message) { + // call to self as log + log.call(deprecate, message) + } + + deprecate._file = file + deprecate._ignored = isignored(namespace) + deprecate._namespace = namespace + deprecate._traced = istraced(namespace) + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Determine if namespace is ignored. + */ + +function isignored (namespace) { + /* istanbul ignore next: tested in a child processs */ + if (process.noDeprecation) { + // --no-deprecation support + return true + } + + var str = process.env.NO_DEPRECATION || '' + + // namespace ignored + return containsNamespace(str, namespace) +} + +/** + * Determine if namespace is traced. + */ + +function istraced (namespace) { + /* istanbul ignore next: tested in a child processs */ + if (process.traceDeprecation) { + // --trace-deprecation support + return true + } + + var str = process.env.TRACE_DEPRECATION || '' + + // namespace traced + return containsNamespace(str, namespace) +} + +/** + * Display deprecation message. + */ + +function log (message, site) { + var haslisteners = eventListenerCount(process, 'deprecation') !== 0 + + // abort early if no destination + if (!haslisteners && this._ignored) { + return + } + + var caller + var callFile + var callSite + var depSite + var i = 0 + var seen = false + var stack = getStack() + var file = this._file + + if (site) { + // provided site + depSite = site + callSite = callSiteLocation(stack[1]) + callSite.name = depSite.name + file = callSite[0] + } else { + // get call site + i = 2 + depSite = callSiteLocation(stack[i]) + callSite = depSite + } + + // get caller of deprecated thing in relation to file + for (; i < stack.length; i++) { + caller = callSiteLocation(stack[i]) + callFile = caller[0] + + if (callFile === file) { + seen = true + } else if (callFile === this._file) { + file = this._file + } else if (seen) { + break + } + } + + var key = caller + ? depSite.join(':') + '__' + caller.join(':') + : undefined + + if (key !== undefined && key in this._warned) { + // already warned + return + } + + this._warned[key] = true + + // generate automatic message from call site + var msg = message + if (!msg) { + msg = callSite === depSite || !callSite.name + ? defaultMessage(depSite) + : defaultMessage(callSite) + } + + // emit deprecation if listeners exist + if (haslisteners) { + var err = DeprecationError(this._namespace, msg, stack.slice(i)) + process.emit('deprecation', err) + return + } + + // format and write message + var format = process.stderr.isTTY + ? formatColor + : formatPlain + var output = format.call(this, msg, caller, stack.slice(i)) + process.stderr.write(output + '\n', 'utf8') +} + +/** + * Get call site location as array. + */ + +function callSiteLocation (callSite) { + var file = callSite.getFileName() || '<anonymous>' + var line = callSite.getLineNumber() + var colm = callSite.getColumnNumber() + + if (callSite.isEval()) { + file = callSite.getEvalOrigin() + ', ' + file + } + + var site = [file, line, colm] + + site.callSite = callSite + site.name = callSite.getFunctionName() + + return site +} + +/** + * Generate a default message from the site. + */ + +function defaultMessage (site) { + var callSite = site.callSite + var funcName = site.name + + // make useful anonymous name + if (!funcName) { + funcName = '<anonymous@' + formatLocation(site) + '>' + } + + var context = callSite.getThis() + var typeName = context && callSite.getTypeName() + + // ignore useless type name + if (typeName === 'Object') { + typeName = undefined + } + + // make useful type name + if (typeName === 'Function') { + typeName = context.name || typeName + } + + return typeName && callSite.getMethodName() + ? typeName + '.' + funcName + : funcName +} + +/** + * Format deprecation message without color. + */ + +function formatPlain (msg, caller, stack) { + var timestamp = new Date().toUTCString() + + var formatted = timestamp + + ' ' + this._namespace + + ' deprecated ' + msg + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n at ' + callSiteToString(stack[i]) + } + + return formatted + } + + if (caller) { + formatted += ' at ' + formatLocation(caller) + } + + return formatted +} + +/** + * Format deprecation message with color. + */ + +function formatColor (msg, caller, stack) { + var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan + ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow + ' \x1b[0m' + msg + '\x1b[39m' // reset + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n \x1b[36mat ' + callSiteToString(stack[i]) + '\x1b[39m' // cyan + } + + return formatted + } + + if (caller) { + formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan + } + + return formatted +} + +/** + * Format call site location. + */ + +function formatLocation (callSite) { + return relative(basePath, callSite[0]) + + ':' + callSite[1] + + ':' + callSite[2] +} + +/** + * Get the stack as array of call sites. + */ + +function getStack () { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = Math.max(10, limit) + + // capture the stack + Error.captureStackTrace(obj) + + // slice this function off the top + var stack = obj.stack.slice(1) + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack +} + +/** + * Capture call site stack from v8. + */ + +function prepareObjectStackTrace (obj, stack) { + return stack +} + +/** + * Return a wrapped function in a deprecation message. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + var args = createArgumentsString(fn.length) + var deprecate = this // eslint-disable-line no-unused-vars + var stack = getStack() + var site = callSiteLocation(stack[1]) + + site.name = fn.name + + // eslint-disable-next-line no-eval + var deprecatedfn = eval('(function (' + args + ') {\n' + + '"use strict"\n' + + 'log.call(deprecate, message, site)\n' + + 'return fn.apply(this, arguments)\n' + + '})') + + return deprecatedfn +} + +/** + * Wrap property in a deprecation message. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } + + var deprecate = this + var stack = getStack() + var site = callSiteLocation(stack[1]) + + // set site name + site.name = prop + + // convert data descriptor + if ('value' in descriptor) { + descriptor = convertDataDescriptorToAccessor(obj, prop, message) + } + + var get = descriptor.get + var set = descriptor.set + + // wrap getter + if (typeof get === 'function') { + descriptor.get = function getter () { + log.call(deprecate, message, site) + return get.apply(this, arguments) + } + } + + // wrap setter + if (typeof set === 'function') { + descriptor.set = function setter () { + log.call(deprecate, message, site) + return set.apply(this, arguments) + } + } + + Object.defineProperty(obj, prop, descriptor) +} + +/** + * Create DeprecationError for deprecation + */ + +function DeprecationError (namespace, message, stack) { + var error = new Error() + var stackString + + Object.defineProperty(error, 'constructor', { + value: DeprecationError + }) + + Object.defineProperty(error, 'message', { + configurable: true, + enumerable: false, + value: message, + writable: true + }) + + Object.defineProperty(error, 'name', { + enumerable: false, + configurable: true, + value: 'DeprecationError', + writable: true + }) + + Object.defineProperty(error, 'namespace', { + configurable: true, + enumerable: false, + value: namespace, + writable: true + }) + + Object.defineProperty(error, 'stack', { + configurable: true, + enumerable: false, + get: function () { + if (stackString !== undefined) { + return stackString + } + + // prepare stack trace + return (stackString = createStackString.call(this, stack)) + }, + set: function setter (val) { + stackString = val + } + }) + + return error +} diff --git a/node_modules/depd/lib/browser/index.js b/node_modules/depd/lib/browser/index.js new file mode 100644 index 0000000..6be45cc --- /dev/null +++ b/node_modules/depd/lib/browser/index.js @@ -0,0 +1,77 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = depd + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + function deprecate (message) { + // no-op in browser + } + + deprecate._file = undefined + deprecate._ignored = true + deprecate._namespace = namespace + deprecate._traced = false + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Return a wrapped function in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + return fn +} + +/** + * Wrap property in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } +} diff --git a/node_modules/depd/lib/compat/callsite-tostring.js b/node_modules/depd/lib/compat/callsite-tostring.js new file mode 100644 index 0000000..73186dc --- /dev/null +++ b/node_modules/depd/lib/compat/callsite-tostring.js @@ -0,0 +1,103 @@ +/*! + * depd + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = callSiteToString + +/** + * Format a CallSite file location to a string. + */ + +function callSiteFileLocation (callSite) { + var fileName + var fileLocation = '' + + if (callSite.isNative()) { + fileLocation = 'native' + } else if (callSite.isEval()) { + fileName = callSite.getScriptNameOrSourceURL() + if (!fileName) { + fileLocation = callSite.getEvalOrigin() + } + } else { + fileName = callSite.getFileName() + } + + if (fileName) { + fileLocation += fileName + + var lineNumber = callSite.getLineNumber() + if (lineNumber != null) { + fileLocation += ':' + lineNumber + + var columnNumber = callSite.getColumnNumber() + if (columnNumber) { + fileLocation += ':' + columnNumber + } + } + } + + return fileLocation || 'unknown source' +} + +/** + * Format a CallSite to a string. + */ + +function callSiteToString (callSite) { + var addSuffix = true + var fileLocation = callSiteFileLocation(callSite) + var functionName = callSite.getFunctionName() + var isConstructor = callSite.isConstructor() + var isMethodCall = !(callSite.isToplevel() || isConstructor) + var line = '' + + if (isMethodCall) { + var methodName = callSite.getMethodName() + var typeName = getConstructorName(callSite) + + if (functionName) { + if (typeName && functionName.indexOf(typeName) !== 0) { + line += typeName + '.' + } + + line += functionName + + if (methodName && functionName.lastIndexOf('.' + methodName) !== functionName.length - methodName.length - 1) { + line += ' [as ' + methodName + ']' + } + } else { + line += typeName + '.' + (methodName || '<anonymous>') + } + } else if (isConstructor) { + line += 'new ' + (functionName || '<anonymous>') + } else if (functionName) { + line += functionName + } else { + addSuffix = false + line += fileLocation + } + + if (addSuffix) { + line += ' (' + fileLocation + ')' + } + + return line +} + +/** + * Get constructor name of reviver. + */ + +function getConstructorName (obj) { + var receiver = obj.receiver + return (receiver.constructor && receiver.constructor.name) || null +} diff --git a/node_modules/depd/lib/compat/event-listener-count.js b/node_modules/depd/lib/compat/event-listener-count.js new file mode 100644 index 0000000..3a8925d --- /dev/null +++ b/node_modules/depd/lib/compat/event-listener-count.js @@ -0,0 +1,22 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = eventListenerCount + +/** + * Get the count of listeners on an event emitter of a specific type. + */ + +function eventListenerCount (emitter, type) { + return emitter.listeners(type).length +} diff --git a/node_modules/depd/lib/compat/index.js b/node_modules/depd/lib/compat/index.js new file mode 100644 index 0000000..955b333 --- /dev/null +++ b/node_modules/depd/lib/compat/index.js @@ -0,0 +1,79 @@ +/*! + * depd + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var EventEmitter = require('events').EventEmitter + +/** + * Module exports. + * @public + */ + +lazyProperty(module.exports, 'callSiteToString', function callSiteToString () { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + function prepareObjectStackTrace (obj, stack) { + return stack + } + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = 2 + + // capture the stack + Error.captureStackTrace(obj) + + // slice the stack + var stack = obj.stack.slice() + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack[0].toString ? toString : require('./callsite-tostring') +}) + +lazyProperty(module.exports, 'eventListenerCount', function eventListenerCount () { + return EventEmitter.listenerCount || require('./event-listener-count') +}) + +/** + * Define a lazy property. + */ + +function lazyProperty (obj, prop, getter) { + function get () { + var val = getter() + + Object.defineProperty(obj, prop, { + configurable: true, + enumerable: true, + value: val + }) + + return val + } + + Object.defineProperty(obj, prop, { + configurable: true, + enumerable: true, + get: get + }) +} + +/** + * Call toString() on the obj + */ + +function toString (obj) { + return obj.toString() +} diff --git a/node_modules/depd/package.json b/node_modules/depd/package.json new file mode 100644 index 0000000..ae387e6 --- /dev/null +++ b/node_modules/depd/package.json @@ -0,0 +1,79 @@ +{ + "_from": "depd@~1.1.2", + "_id": "depd@1.1.2", + "_inBundle": false, + "_integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=", + "_location": "/depd", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "depd@~1.1.2", + "name": "depd", + "escapedName": "depd", + "rawSpec": "~1.1.2", + "saveSpec": null, + "fetchSpec": "~1.1.2" + }, + "_requiredBy": [ + "/body-parser", + "/express", + "/http-errors", + "/send" + ], + "_resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz", + "_shasum": "9bcd52e14c097763e749b274c4346ed2e560b5a9", + "_spec": "depd@~1.1.2", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "browser": "lib/browser/index.js", + "bugs": { + "url": "https://github.com/dougwilson/nodejs-depd/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Deprecate all the things", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "3.19.0", + "eslint-config-standard": "7.1.0", + "eslint-plugin-markdown": "1.0.0-beta.7", + "eslint-plugin-promise": "3.6.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "~1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "lib/", + "History.md", + "LICENSE", + "index.js", + "Readme.md" + ], + "homepage": "https://github.com/dougwilson/nodejs-depd#readme", + "keywords": [ + "deprecate", + "deprecated" + ], + "license": "MIT", + "name": "depd", + "repository": { + "type": "git", + "url": "git+https://github.com/dougwilson/nodejs-depd.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --no-exit test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/" + }, + "version": "1.1.2" +} diff --git a/node_modules/destroy/LICENSE b/node_modules/destroy/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/node_modules/destroy/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/destroy/README.md b/node_modules/destroy/README.md new file mode 100644 index 0000000..6474bc3 --- /dev/null +++ b/node_modules/destroy/README.md @@ -0,0 +1,60 @@ +# Destroy + +[![NPM version][npm-image]][npm-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] +[![Gittip][gittip-image]][gittip-url] + +Destroy a stream. + +This module is meant to ensure a stream gets destroyed, handling different APIs +and Node.js bugs. + +## API + +```js +var destroy = require('destroy') +``` + +### destroy(stream) + +Destroy the given stream. In most cases, this is identical to a simple +`stream.destroy()` call. The rules are as follows for a given stream: + + 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()` + and add a listener to the `open` event to call `stream.close()` if it is + fired. This is for a Node.js bug that will leak a file descriptor if + `.destroy()` is called before `open`. + 2. If the `stream` is not an instance of `Stream`, then nothing happens. + 3. If the `stream` has a `.destroy()` method, then call it. + +The function returns the `stream` passed in as the argument. + +## Example + +```js +var destroy = require('destroy') + +var fs = require('fs') +var stream = fs.createReadStream('package.json') + +// ... and later +destroy(stream) +``` + +[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square +[npm-url]: https://npmjs.org/package/destroy +[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square +[github-url]: https://github.com/stream-utils/destroy/tags +[travis-image]: https://img.shields.io/travis/stream-utils/destroy.svg?style=flat-square +[travis-url]: https://travis-ci.org/stream-utils/destroy +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master +[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/destroy +[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square +[gittip-url]: https://www.gittip.com/jonathanong/ diff --git a/node_modules/destroy/index.js b/node_modules/destroy/index.js new file mode 100644 index 0000000..6da2d26 --- /dev/null +++ b/node_modules/destroy/index.js @@ -0,0 +1,75 @@ +/*! + * destroy + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var ReadStream = require('fs').ReadStream +var Stream = require('stream') + +/** + * Module exports. + * @public + */ + +module.exports = destroy + +/** + * Destroy a stream. + * + * @param {object} stream + * @public + */ + +function destroy(stream) { + if (stream instanceof ReadStream) { + return destroyReadStream(stream) + } + + if (!(stream instanceof Stream)) { + return stream + } + + if (typeof stream.destroy === 'function') { + stream.destroy() + } + + return stream +} + +/** + * Destroy a ReadStream. + * + * @param {object} stream + * @private + */ + +function destroyReadStream(stream) { + stream.destroy() + + if (typeof stream.close === 'function') { + // node.js core bug work-around + stream.on('open', onOpenClose) + } + + return stream +} + +/** + * On open handler to close stream. + * @private + */ + +function onOpenClose() { + if (typeof this.fd === 'number') { + // actually close down the fd + this.close() + } +} diff --git a/node_modules/destroy/package.json b/node_modules/destroy/package.json new file mode 100644 index 0000000..4859be7 --- /dev/null +++ b/node_modules/destroy/package.json @@ -0,0 +1,71 @@ +{ + "_from": "destroy@~1.0.4", + "_id": "destroy@1.0.4", + "_inBundle": false, + "_integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=", + "_location": "/destroy", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "destroy@~1.0.4", + "name": "destroy", + "escapedName": "destroy", + "rawSpec": "~1.0.4", + "saveSpec": null, + "fetchSpec": "~1.0.4" + }, + "_requiredBy": [ + "/send" + ], + "_resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz", + "_shasum": "978857442c44749e4206613e37946205826abd80", + "_spec": "destroy@~1.0.4", + "_where": "/home/josuer08/Documents/web/node_modules/send", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/stream-utils/destroy/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "destroy a stream if possible", + "devDependencies": { + "istanbul": "0.4.2", + "mocha": "2.3.4" + }, + "files": [ + "index.js", + "LICENSE" + ], + "homepage": "https://github.com/stream-utils/destroy#readme", + "keywords": [ + "stream", + "streams", + "destroy", + "cleanup", + "leak", + "fd" + ], + "license": "MIT", + "name": "destroy", + "repository": { + "type": "git", + "url": "git+https://github.com/stream-utils/destroy.git" + }, + "scripts": { + "test": "mocha --reporter spec", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot" + }, + "version": "1.0.4" +} diff --git a/node_modules/ee-first/LICENSE b/node_modules/ee-first/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/node_modules/ee-first/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/ee-first/README.md b/node_modules/ee-first/README.md new file mode 100644 index 0000000..cbd2478 --- /dev/null +++ b/node_modules/ee-first/README.md @@ -0,0 +1,80 @@ +# EE First + +[![NPM version][npm-image]][npm-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] +[![Gittip][gittip-image]][gittip-url] + +Get the first event in a set of event emitters and event pairs, +then clean up after itself. + +## Install + +```sh +$ npm install ee-first +``` + +## API + +```js +var first = require('ee-first') +``` + +### first(arr, listener) + +Invoke `listener` on the first event from the list specified in `arr`. `arr` is +an array of arrays, with each array in the format `[ee, ...event]`. `listener` +will be called only once, the first time any of the given events are emitted. If +`error` is one of the listened events, then if that fires first, the `listener` +will be given the `err` argument. + +The `listener` is invoked as `listener(err, ee, event, args)`, where `err` is the +first argument emitted from an `error` event, if applicable; `ee` is the event +emitter that fired; `event` is the string event name that fired; and `args` is an +array of the arguments that were emitted on the event. + +```js +var ee1 = new EventEmitter() +var ee2 = new EventEmitter() + +first([ + [ee1, 'close', 'end', 'error'], + [ee2, 'error'] +], function (err, ee, event, args) { + // listener invoked +}) +``` + +#### .cancel() + +The group of listeners can be cancelled before being invoked and have all the event +listeners removed from the underlying event emitters. + +```js +var thunk = first([ + [ee1, 'close', 'end', 'error'], + [ee2, 'error'] +], function (err, ee, event, args) { + // listener invoked +}) + +// cancel and clean up +thunk.cancel() +``` + +[npm-image]: https://img.shields.io/npm/v/ee-first.svg?style=flat-square +[npm-url]: https://npmjs.org/package/ee-first +[github-tag]: http://img.shields.io/github/tag/jonathanong/ee-first.svg?style=flat-square +[github-url]: https://github.com/jonathanong/ee-first/tags +[travis-image]: https://img.shields.io/travis/jonathanong/ee-first.svg?style=flat-square +[travis-url]: https://travis-ci.org/jonathanong/ee-first +[coveralls-image]: https://img.shields.io/coveralls/jonathanong/ee-first.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/jonathanong/ee-first?branch=master +[license-image]: http://img.shields.io/npm/l/ee-first.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/ee-first.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/ee-first +[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square +[gittip-url]: https://www.gittip.com/jonathanong/ diff --git a/node_modules/ee-first/index.js b/node_modules/ee-first/index.js new file mode 100644 index 0000000..501287c --- /dev/null +++ b/node_modules/ee-first/index.js @@ -0,0 +1,95 @@ +/*! + * ee-first + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = first + +/** + * Get the first event in a set of event emitters and event pairs. + * + * @param {array} stuff + * @param {function} done + * @public + */ + +function first(stuff, done) { + if (!Array.isArray(stuff)) + throw new TypeError('arg must be an array of [ee, events...] arrays') + + var cleanups = [] + + for (var i = 0; i < stuff.length; i++) { + var arr = stuff[i] + + if (!Array.isArray(arr) || arr.length < 2) + throw new TypeError('each array member must be [ee, events...]') + + var ee = arr[0] + + for (var j = 1; j < arr.length; j++) { + var event = arr[j] + var fn = listener(event, callback) + + // listen to the event + ee.on(event, fn) + // push this listener to the list of cleanups + cleanups.push({ + ee: ee, + event: event, + fn: fn, + }) + } + } + + function callback() { + cleanup() + done.apply(null, arguments) + } + + function cleanup() { + var x + for (var i = 0; i < cleanups.length; i++) { + x = cleanups[i] + x.ee.removeListener(x.event, x.fn) + } + } + + function thunk(fn) { + done = fn + } + + thunk.cancel = cleanup + + return thunk +} + +/** + * Create the event listener. + * @private + */ + +function listener(event, done) { + return function onevent(arg1) { + var args = new Array(arguments.length) + var ee = this + var err = event === 'error' + ? arg1 + : null + + // copy args to prevent arguments escaping scope + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i] + } + + done(err, ee, event, args) + } +} diff --git a/node_modules/ee-first/package.json b/node_modules/ee-first/package.json new file mode 100644 index 0000000..293a75a --- /dev/null +++ b/node_modules/ee-first/package.json @@ -0,0 +1,63 @@ +{ + "_from": "ee-first@1.1.1", + "_id": "ee-first@1.1.1", + "_inBundle": false, + "_integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=", + "_location": "/ee-first", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ee-first@1.1.1", + "name": "ee-first", + "escapedName": "ee-first", + "rawSpec": "1.1.1", + "saveSpec": null, + "fetchSpec": "1.1.1" + }, + "_requiredBy": [ + "/on-finished" + ], + "_resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "_shasum": "590c61156b0ae2f4f0255732a158b266bc56b21d", + "_spec": "ee-first@1.1.1", + "_where": "/home/josuer08/Documents/web/node_modules/on-finished", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/jonathanong/ee-first/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "return the first event in a set of ee/event pairs", + "devDependencies": { + "istanbul": "0.3.9", + "mocha": "2.2.5" + }, + "files": [ + "index.js", + "LICENSE" + ], + "homepage": "https://github.com/jonathanong/ee-first#readme", + "license": "MIT", + "name": "ee-first", + "repository": { + "type": "git", + "url": "git+https://github.com/jonathanong/ee-first.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.1" +} diff --git a/node_modules/ejs/Jakefile b/node_modules/ejs/Jakefile new file mode 100644 index 0000000..225e3eb --- /dev/null +++ b/node_modules/ejs/Jakefile @@ -0,0 +1,70 @@ +var fs = require('fs'); +var execSync = require('child_process').execSync; +var exec = function (cmd) { + execSync(cmd, {stdio: 'inherit'}); +}; + +/* global jake, task, desc, publishTask */ + +task('build', ['lint', 'clean', 'browserify', 'minify'], function () { + console.log('Build completed.'); +}); + +desc('Cleans browerified/minified files and package files'); +task('clean', ['clobber'], function () { + jake.rmRf('./ejs.js'); + jake.rmRf('./ejs.min.js'); + console.log('Cleaned up compiled files.'); +}); + +desc('Lints the source code'); +task('lint', function () { + exec('./node_modules/.bin/eslint "**/*.js" Jakefile'); + console.log('Linting completed.'); +}); + +task('browserify', function () { + exec('./node_modules/browserify/bin/cmd.js --standalone ejs lib/ejs.js > ejs.js'); + console.log('Browserification completed.'); +}); + +task('minify', function () { + exec('./node_modules/uglify-js/bin/uglifyjs ejs.js > ejs.min.js'); + console.log('Minification completed.'); +}); + +task('doc', function (dev) { + jake.rmRf('out'); + var p = dev ? '-p' : ''; + exec('./node_modules/.bin/jsdoc ' + p + ' -c jsdoc.json lib/* docs/jsdoc/*'); + console.log('Documentation generated.'); +}); + +task('docPublish', ['doc'], function () { + fs.writeFileSync('out/CNAME', 'api.ejs.co'); + console.log('Pushing docs to gh-pages...'); + exec('./node_modules/.bin/git-directory-deploy --directory out/'); + console.log('Docs published to gh-pages.'); +}); + +task('test', ['lint'], function () { + exec('./node_modules/.bin/mocha'); +}); + +publishTask('ejs', ['build'], function () { + this.packageFiles.include([ + 'Jakefile', + 'README.md', + 'LICENSE', + 'package.json', + 'ejs.js', + 'ejs.min.js', + 'lib/**' + ]); +}); + +jake.Task.publish.on('complete', function () { + console.log('Updating hosted docs...'); + console.log('If this fails, run jake docPublish to re-try.'); + jake.Task.docPublish.invoke(); +}); diff --git a/node_modules/ejs/LICENSE b/node_modules/ejs/LICENSE new file mode 100644 index 0000000..d645695 --- /dev/null +++ b/node_modules/ejs/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/node_modules/ejs/README.md b/node_modules/ejs/README.md new file mode 100644 index 0000000..19c063f --- /dev/null +++ b/node_modules/ejs/README.md @@ -0,0 +1,271 @@ +# EJS + +Embedded JavaScript templates + +[](https://travis-ci.org/mde/ejs) +[](https://david-dm.org/mde/ejs?type=dev) +[](https://snyk.io/test/npm/ejs) + +## Installation + +```bash +$ npm install ejs +``` + +## Features + + * Control flow with `<% %>` + * Escaped output with `<%= %>` (escape function configurable) + * Unescaped raw output with `<%- %>` + * Newline-trim mode ('newline slurping') with `-%>` ending tag + * Whitespace-trim mode (slurp all whitespace) for control flow with `<%_ _%>` + * Custom delimiters (e.g., use `<? ?>` instead of `<% %>`) + * Includes + * Client-side support + * Static caching of intermediate JavaScript + * Static caching of templates + * Complies with the [Express](http://expressjs.com) view system + +## Example + +```html +<% if (user) { %> + <h2><%= user.name %></h2> +<% } %> +``` + +Try EJS online at: https://ionicabizau.github.io/ejs-playground/. + +## Usage + +```javascript +let template = ejs.compile(str, options); +template(data); +// => Rendered HTML string + +ejs.render(str, data, options); +// => Rendered HTML string + +ejs.renderFile(filename, data, options, function(err, str){ + // str => Rendered HTML string +}); +``` + +It is also possible to use `ejs.render(dataAndOptions);` where you pass +everything in a single object. In that case, you'll end up with local variables +for all the passed options. However, be aware that your code could break if we +add an option with the same name as one of your data object's properties. +Therefore, we do not recommend using this shortcut. + +## Options + + - `cache` Compiled functions are cached, requires `filename` + - `filename` The name of the file being rendered. Not required if you + are using `renderFile()`. Used by `cache` to key caches, and for includes. + - `root` Set project root for includes with an absolute path (/file.ejs). + - `context` Function execution context + - `compileDebug` When `false` no debug instrumentation is compiled + - `client` When `true`, compiles a function that can be rendered + in the browser without needing to load the EJS Runtime + ([ejs.min.js](https://github.com/mde/ejs/releases/latest)). + - `delimiter` Character to use with angle brackets for open/close + - `debug` Output generated function body + - `strict` When set to `true`, generated function is in strict mode + - `_with` Whether or not to use `with() {}` constructs. If `false` + then the locals will be stored in the `locals` object. Set to `false` in strict mode. + - `localsName` Name to use for the object storing local variables when not using + `with` Defaults to `locals` + - `rmWhitespace` Remove all safe-to-remove whitespace, including leading + and trailing whitespace. It also enables a safer version of `-%>` line + slurping for all scriptlet tags (it does not strip new lines of tags in + the middle of a line). + - `escape` The escaping function used with `<%=` construct. It is + used in rendering and is `.toString()`ed in the generation of client functions. + (By default escapes XML). + - `outputFunctionName` Set to a string (e.g., 'echo' or 'print') for a function to print + output inside scriptlet tags. + - `async` When `true`, EJS will use an async function for rendering. (Depends + on async/await support in the JS runtime. + +This project uses [JSDoc](http://usejsdoc.org/). For the full public API +documentation, clone the repository and run `npm run doc`. This will run JSDoc +with the proper options and output the documentation to `out/`. If you want +the both the public & private API docs, run `npm run devdoc` instead. + +## Tags + + - `<%` 'Scriptlet' tag, for control-flow, no output + - `<%_` 'Whitespace Slurping' Scriptlet tag, strips all whitespace before it + - `<%=` Outputs the value into the template (escaped) + - `<%-` Outputs the unescaped value into the template + - `<%#` Comment tag, no execution, no output + - `<%%` Outputs a literal '<%' + - `%%>` Outputs a literal '%>' + - `%>` Plain ending tag + - `-%>` Trim-mode ('newline slurp') tag, trims following newline + - `_%>` 'Whitespace Slurping' ending tag, removes all whitespace after it + +For the full syntax documentation, please see [docs/syntax.md](https://github.com/mde/ejs/blob/master/docs/syntax.md). + +## Includes + +Includes either have to be an absolute path, or, if not, are assumed as +relative to the template with the `include` call. For example if you are +including `./views/user/show.ejs` from `./views/users.ejs` you would +use `<%- include('user/show') %>`. + +You must specify the `filename` option for the template with the `include` +call unless you are using `renderFile()`. + +You'll likely want to use the raw output tag (`<%-`) with your include to avoid +double-escaping the HTML output. + +```html +<ul> + <% users.forEach(function(user){ %> + <%- include('user/show', {user: user}) %> + <% }); %> +</ul> +``` + +Includes are inserted at runtime, so you can use variables for the path in the +`include` call (for example `<%- include(somePath) %>`). Variables in your +top-level data object are available to all your includes, but local variables +need to be passed down. + +NOTE: Include preprocessor directives (`<% include user/show %>`) are +still supported. + +## Custom delimiters + +Custom delimiters can be applied on a per-template basis, or globally: + +```javascript +let ejs = require('ejs'), + users = ['geddy', 'neil', 'alex']; + +// Just one template +ejs.render('<?= users.join(" | "); ?>', {users: users}, {delimiter: '?'}); +// => 'geddy | neil | alex' + +// Or globally +ejs.delimiter = '$'; +ejs.render('<$= users.join(" | "); $>', {users: users}); +// => 'geddy | neil | alex' +``` + +## Caching + +EJS ships with a basic in-process cache for caching the intermediate JavaScript +functions used to render templates. It's easy to plug in LRU caching using +Node's `lru-cache` library: + +```javascript +let ejs = require('ejs'), + LRU = require('lru-cache'); +ejs.cache = LRU(100); // LRU cache with 100-item limit +``` + +If you want to clear the EJS cache, call `ejs.clearCache`. If you're using the +LRU cache and need a different limit, simple reset `ejs.cache` to a new instance +of the LRU. + +## Custom file loader + +The default file loader is `fs.readFileSync`, if you want to customize it, you can set ejs.fileLoader. + +```javascript +let ejs = require('ejs'); +let myFileLoad = function (filePath) { + return 'myFileLoad: ' + fs.readFileSync(filePath); +}; + +ejs.fileLoader = myFileLoad; +``` + +With this feature, you can preprocess the template before reading it. + +## Layouts + +EJS does not specifically support blocks, but layouts can be implemented by +including headers and footers, like so: + + +```html +<%- include('header') -%> +<h1> + Title +</h1> +<p> + My page +</p> +<%- include('footer') -%> +``` + +## Client-side support + +Go to the [Latest Release](https://github.com/mde/ejs/releases/latest), download +`./ejs.js` or `./ejs.min.js`. Alternately, you can compile it yourself by cloning +the repository and running `jake build` (or `$(npm bin)/jake build` if jake is +not installed globally). + +Include one of these files on your page, and `ejs` should be available globally. + +### Example + +```html +<div id="output"></div> +<script src="ejs.min.js"></script> +<script> + let people = ['geddy', 'neil', 'alex'], + html = ejs.render('<%= people.join(", "); %>', {people: people}); + // With jQuery: + $('#output').html(html); + // Vanilla JS: + document.getElementById('output').innerHTML = html; +</script> +``` + +### Caveats + +Most of EJS will work as expected; however, there are a few things to note: + +1. Obviously, since you do not have access to the filesystem, `ejs.renderFile()` won't work. +2. For the same reason, `include`s do not work unless you use an `include callback`. Here is an example: + ```javascript + let str = "Hello <%= include('file', {person: 'John'}); %>", + fn = ejs.compile(str, {client: true}); + + fn(data, null, function(path, d){ // include callback + // path -> 'file' + // d -> {person: 'John'} + // Put your code here + // Return the contents of file as a string + }); // returns rendered string + ``` + +See the [examples folder](https://github.com/mde/ejs/tree/master/examples) for more details. + +### IDE Integration with Syntax Highlighting + +VSCode:Javascript EJS by *DigitalBrainstem* + +## Related projects + +There are a number of implementations of EJS: + + * TJ's implementation, the v1 of this library: https://github.com/tj/ejs + * Jupiter Consulting's EJS: http://www.embeddedjs.com/ + * EJS Embedded JavaScript Framework on Google Code: https://code.google.com/p/embeddedjavascript/ + * Sam Stephenson's Ruby implementation: https://rubygems.org/gems/ejs + * Erubis, an ERB implementation which also runs JavaScript: http://www.kuwata-lab.com/erubis/users-guide.04.html#lang-javascript + * DigitalBrainstem EJS Language support: https://github.com/Digitalbrainstem/ejs-grammar + +## License + +Licensed under the Apache License, Version 2.0 +(<http://www.apache.org/licenses/LICENSE-2.0>) + +- - - +EJS Embedded JavaScript templates copyright 2112 +mde@fleegix.org. diff --git a/node_modules/ejs/ejs.js b/node_modules/ejs/ejs.js new file mode 100644 index 0000000..f0e5930 --- /dev/null +++ b/node_modules/ejs/ejs.js @@ -0,0 +1,1588 @@ +(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.ejs = f()}})(function(){var define,module,exports;return (function(){function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s}return e})()({1:[function(require,module,exports){ +/* + * EJS Embedded JavaScript templates + * Copyright 2112 Matthew Eernisse (mde@fleegix.org) + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * +*/ + +'use strict'; + +/** + * @file Embedded JavaScript templating engine. {@link http://ejs.co} + * @author Matthew Eernisse <mde@fleegix.org> + * @author Tiancheng "Timothy" Gu <timothygu99@gmail.com> + * @project EJS + * @license {@link http://www.apache.org/licenses/LICENSE-2.0 Apache License, Version 2.0} + */ + +/** + * EJS internal functions. + * + * Technically this "module" lies in the same file as {@link module:ejs}, for + * the sake of organization all the private functions re grouped into this + * module. + * + * @module ejs-internal + * @private + */ + +/** + * Embedded JavaScript templating engine. + * + * @module ejs + * @public + */ + +var fs = require('fs'); +var path = require('path'); +var utils = require('./utils'); + +var scopeOptionWarned = false; +var _VERSION_STRING = require('../package.json').version; +var _DEFAULT_OPEN_DELIMITER = '<'; +var _DEFAULT_CLOSE_DELIMITER = '>'; +var _DEFAULT_DELIMITER = '%'; +var _DEFAULT_LOCALS_NAME = 'locals'; +var _NAME = 'ejs'; +var _REGEX_STRING = '(<%%|%%>|<%=|<%-|<%_|<%#|<%|%>|-%>|_%>)'; +var _OPTS_PASSABLE_WITH_DATA = ['delimiter', 'scope', 'context', 'debug', 'compileDebug', + 'client', '_with', 'rmWhitespace', 'strict', 'filename', 'async']; +// We don't allow 'cache' option to be passed in the data obj for +// the normal `render` call, but this is where Express 2 & 3 put it +// so we make an exception for `renderFile` +var _OPTS_PASSABLE_WITH_DATA_EXPRESS = _OPTS_PASSABLE_WITH_DATA.concat('cache'); +var _BOM = /^\uFEFF/; + +/** + * EJS template function cache. This can be a LRU object from lru-cache NPM + * module. By default, it is {@link module:utils.cache}, a simple in-process + * cache that grows continuously. + * + * @type {Cache} + */ + +exports.cache = utils.cache; + +/** + * Custom file loader. Useful for template preprocessing or restricting access + * to a certain part of the filesystem. + * + * @type {fileLoader} + */ + +exports.fileLoader = fs.readFileSync; + +/** + * Name of the object containing the locals. + * + * This variable is overridden by {@link Options}`.localsName` if it is not + * `undefined`. + * + * @type {String} + * @public + */ + +exports.localsName = _DEFAULT_LOCALS_NAME; + +/** + * Promise implementation -- defaults to the native implementation if available + * This is mostly just for testability + * + * @type {Function} + * @public + */ + +exports.promiseImpl = (new Function('return this;'))().Promise; + +/** + * Get the path to the included file from the parent file path and the + * specified path. + * + * @param {String} name specified path + * @param {String} filename parent file path + * @param {Boolean} isDir parent file path whether is directory + * @return {String} + */ +exports.resolveInclude = function(name, filename, isDir) { + var dirname = path.dirname; + var extname = path.extname; + var resolve = path.resolve; + var includePath = resolve(isDir ? filename : dirname(filename), name); + var ext = extname(name); + if (!ext) { + includePath += '.ejs'; + } + return includePath; +}; + +/** + * Get the path to the included file by Options + * + * @param {String} path specified path + * @param {Options} options compilation options + * @return {String} + */ +function getIncludePath(path, options) { + var includePath; + var filePath; + var views = options.views; + var match = /^[A-Za-z]+:\\|^\//.exec(path); + + // Abs path + if (match && match.length) { + includePath = exports.resolveInclude(path.replace(/^\/*/,''), options.root || '/', true); + } + // Relative paths + else { + // Look relative to a passed filename first + if (options.filename) { + filePath = exports.resolveInclude(path, options.filename); + if (fs.existsSync(filePath)) { + includePath = filePath; + } + } + // Then look in any views directories + if (!includePath) { + if (Array.isArray(views) && views.some(function (v) { + filePath = exports.resolveInclude(path, v, true); + return fs.existsSync(filePath); + })) { + includePath = filePath; + } + } + if (!includePath) { + throw new Error('Could not find the include file "' + + options.escapeFunction(path) + '"'); + } + } + return includePath; +} + +/** + * Get the template from a string or a file, either compiled on-the-fly or + * read from cache (if enabled), and cache the template if needed. + * + * If `template` is not set, the file specified in `options.filename` will be + * read. + * + * If `options.cache` is true, this function reads the file from + * `options.filename` so it must be set prior to calling this function. + * + * @memberof module:ejs-internal + * @param {Options} options compilation options + * @param {String} [template] template source + * @return {(TemplateFunction|ClientFunction)} + * Depending on the value of `options.client`, either type might be returned. + * @static + */ + +function handleCache(options, template) { + var func; + var filename = options.filename; + var hasTemplate = arguments.length > 1; + + if (options.cache) { + if (!filename) { + throw new Error('cache option requires a filename'); + } + func = exports.cache.get(filename); + if (func) { + return func; + } + if (!hasTemplate) { + template = fileLoader(filename).toString().replace(_BOM, ''); + } + } + else if (!hasTemplate) { + // istanbul ignore if: should not happen at all + if (!filename) { + throw new Error('Internal EJS error: no file name or template ' + + 'provided'); + } + template = fileLoader(filename).toString().replace(_BOM, ''); + } + func = exports.compile(template, options); + if (options.cache) { + exports.cache.set(filename, func); + } + return func; +} + +/** + * Try calling handleCache with the given options and data and call the + * callback with the result. If an error occurs, call the callback with + * the error. Used by renderFile(). + * + * @memberof module:ejs-internal + * @param {Options} options compilation options + * @param {Object} data template data + * @param {RenderFileCallback} cb callback + * @static + */ + +function tryHandleCache(options, data, cb) { + var result; + if (!cb) { + if (typeof exports.promiseImpl == 'function') { + return new exports.promiseImpl(function (resolve, reject) { + try { + result = handleCache(options)(data); + resolve(result); + } + catch (err) { + reject(err); + } + }); + } + else { + throw new Error('Please provide a callback function'); + } + } + else { + try { + result = handleCache(options)(data); + } + catch (err) { + return cb(err); + } + + cb(null, result); + } +} + +/** + * fileLoader is independent + * + * @param {String} filePath ejs file path. + * @return {String} The contents of the specified file. + * @static + */ + +function fileLoader(filePath){ + return exports.fileLoader(filePath); +} + +/** + * Get the template function. + * + * If `options.cache` is `true`, then the template is cached. + * + * @memberof module:ejs-internal + * @param {String} path path for the specified file + * @param {Options} options compilation options + * @return {(TemplateFunction|ClientFunction)} + * Depending on the value of `options.client`, either type might be returned + * @static + */ + +function includeFile(path, options) { + var opts = utils.shallowCopy({}, options); + opts.filename = getIncludePath(path, opts); + return handleCache(opts); +} + +/** + * Get the JavaScript source of an included file. + * + * @memberof module:ejs-internal + * @param {String} path path for the specified file + * @param {Options} options compilation options + * @return {Object} + * @static + */ + +function includeSource(path, options) { + var opts = utils.shallowCopy({}, options); + var includePath; + var template; + includePath = getIncludePath(path, opts); + template = fileLoader(includePath).toString().replace(_BOM, ''); + opts.filename = includePath; + var templ = new Template(template, opts); + templ.generateSource(); + return { + source: templ.source, + filename: includePath, + template: template + }; +} + +/** + * Re-throw the given `err` in context to the `str` of ejs, `filename`, and + * `lineno`. + * + * @implements RethrowCallback + * @memberof module:ejs-internal + * @param {Error} err Error object + * @param {String} str EJS source + * @param {String} filename file name of the EJS file + * @param {String} lineno line number of the error + * @static + */ + +function rethrow(err, str, flnm, lineno, esc){ + var lines = str.split('\n'); + var start = Math.max(lineno - 3, 0); + var end = Math.min(lines.length, lineno + 3); + var filename = esc(flnm); // eslint-disable-line + // Error context + var context = lines.slice(start, end).map(function (line, i){ + var curr = i + start + 1; + return (curr == lineno ? ' >> ' : ' ') + + curr + + '| ' + + line; + }).join('\n'); + + // Alter exception message + err.path = filename; + err.message = (filename || 'ejs') + ':' + + lineno + '\n' + + context + '\n\n' + + err.message; + + throw err; +} + +function stripSemi(str){ + return str.replace(/;(\s*$)/, '$1'); +} + +/** + * Compile the given `str` of ejs into a template function. + * + * @param {String} template EJS template + * + * @param {Options} opts compilation options + * + * @return {(TemplateFunction|ClientFunction)} + * Depending on the value of `opts.client`, either type might be returned. + * Note that the return type of the function also depends on the value of `opts.async`. + * @public + */ + +exports.compile = function compile(template, opts) { + var templ; + + // v1 compat + // 'scope' is 'context' + // FIXME: Remove this in a future version + if (opts && opts.scope) { + if (!scopeOptionWarned){ + console.warn('`scope` option is deprecated and will be removed in EJS 3'); + scopeOptionWarned = true; + } + if (!opts.context) { + opts.context = opts.scope; + } + delete opts.scope; + } + templ = new Template(template, opts); + return templ.compile(); +}; + +/** + * Render the given `template` of ejs. + * + * If you would like to include options but not data, you need to explicitly + * call this function with `data` being an empty object or `null`. + * + * @param {String} template EJS template + * @param {Object} [data={}] template data + * @param {Options} [opts={}] compilation and rendering options + * @return {(String|Promise<String>)} + * Return value type depends on `opts.async`. + * @public + */ + +exports.render = function (template, d, o) { + var data = d || {}; + var opts = o || {}; + + // No options object -- if there are optiony names + // in the data, copy them to options + if (arguments.length == 2) { + utils.shallowCopyFromList(opts, data, _OPTS_PASSABLE_WITH_DATA); + } + + return handleCache(opts, template)(data); +}; + +/** + * Render an EJS file at the given `path` and callback `cb(err, str)`. + * + * If you would like to include options but not data, you need to explicitly + * call this function with `data` being an empty object or `null`. + * + * @param {String} path path to the EJS file + * @param {Object} [data={}] template data + * @param {Options} [opts={}] compilation and rendering options + * @param {RenderFileCallback} cb callback + * @public + */ + +exports.renderFile = function () { + var args = Array.prototype.slice.call(arguments); + var filename = args.shift(); + var cb; + var opts = {filename: filename}; + var data; + var viewOpts; + + // Do we have a callback? + if (typeof arguments[arguments.length - 1] == 'function') { + cb = args.pop(); + } + // Do we have data/opts? + if (args.length) { + // Should always have data obj + data = args.shift(); + // Normal passed opts (data obj + opts obj) + if (args.length) { + // Use shallowCopy so we don't pollute passed in opts obj with new vals + utils.shallowCopy(opts, args.pop()); + } + // Special casing for Express (settings + opts-in-data) + else { + // Express 3 and 4 + if (data.settings) { + // Pull a few things from known locations + if (data.settings.views) { + opts.views = data.settings.views; + } + if (data.settings['view cache']) { + opts.cache = true; + } + // Undocumented after Express 2, but still usable, esp. for + // items that are unsafe to be passed along with data, like `root` + viewOpts = data.settings['view options']; + if (viewOpts) { + utils.shallowCopy(opts, viewOpts); + } + } + // Express 2 and lower, values set in app.locals, or people who just + // want to pass options in their data. NOTE: These values will override + // anything previously set in settings or settings['view options'] + utils.shallowCopyFromList(opts, data, _OPTS_PASSABLE_WITH_DATA_EXPRESS); + } + opts.filename = filename; + } + else { + data = {}; + } + + return tryHandleCache(opts, data, cb); +}; + +/** + * Clear intermediate JavaScript cache. Calls {@link Cache#reset}. + * @public + */ + +/** + * EJS template class + * @public + */ +exports.Template = Template; + +exports.clearCache = function () { + exports.cache.reset(); +}; + +function Template(text, opts) { + opts = opts || {}; + var options = {}; + this.templateText = text; + this.mode = null; + this.truncate = false; + this.currentLine = 1; + this.source = ''; + this.dependencies = []; + options.client = opts.client || false; + options.escapeFunction = opts.escape || opts.escapeFunction || utils.escapeXML; + options.compileDebug = opts.compileDebug !== false; + options.debug = !!opts.debug; + options.filename = opts.filename; + options.openDelimiter = opts.openDelimiter || exports.openDelimiter || _DEFAULT_OPEN_DELIMITER; + options.closeDelimiter = opts.closeDelimiter || exports.closeDelimiter || _DEFAULT_CLOSE_DELIMITER; + options.delimiter = opts.delimiter || exports.delimiter || _DEFAULT_DELIMITER; + options.strict = opts.strict || false; + options.context = opts.context; + options.cache = opts.cache || false; + options.rmWhitespace = opts.rmWhitespace; + options.root = opts.root; + options.outputFunctionName = opts.outputFunctionName; + options.localsName = opts.localsName || exports.localsName || _DEFAULT_LOCALS_NAME; + options.views = opts.views; + options.async = opts.async; + + if (options.strict) { + options._with = false; + } + else { + options._with = typeof opts._with != 'undefined' ? opts._with : true; + } + + this.opts = options; + + this.regex = this.createRegex(); +} + +Template.modes = { + EVAL: 'eval', + ESCAPED: 'escaped', + RAW: 'raw', + COMMENT: 'comment', + LITERAL: 'literal' +}; + +Template.prototype = { + createRegex: function () { + var str = _REGEX_STRING; + var delim = utils.escapeRegExpChars(this.opts.delimiter); + var open = utils.escapeRegExpChars(this.opts.openDelimiter); + var close = utils.escapeRegExpChars(this.opts.closeDelimiter); + str = str.replace(/%/g, delim) + .replace(/</g, open) + .replace(/>/g, close); + return new RegExp(str); + }, + + compile: function () { + var src; + var fn; + var opts = this.opts; + var prepended = ''; + var appended = ''; + var escapeFn = opts.escapeFunction; + var ctor; + + if (!this.source) { + this.generateSource(); + prepended += ' var __output = [], __append = __output.push.bind(__output);' + '\n'; + if (opts.outputFunctionName) { + prepended += ' var ' + opts.outputFunctionName + ' = __append;' + '\n'; + } + if (opts._with !== false) { + prepended += ' with (' + opts.localsName + ' || {}) {' + '\n'; + appended += ' }' + '\n'; + } + appended += ' return __output.join("");' + '\n'; + this.source = prepended + this.source + appended; + } + + if (opts.compileDebug) { + src = 'var __line = 1' + '\n' + + ' , __lines = ' + JSON.stringify(this.templateText) + '\n' + + ' , __filename = ' + (opts.filename ? + JSON.stringify(opts.filename) : 'undefined') + ';' + '\n' + + 'try {' + '\n' + + this.source + + '} catch (e) {' + '\n' + + ' rethrow(e, __lines, __filename, __line, escapeFn);' + '\n' + + '}' + '\n'; + } + else { + src = this.source; + } + + if (opts.client) { + src = 'escapeFn = escapeFn || ' + escapeFn.toString() + ';' + '\n' + src; + if (opts.compileDebug) { + src = 'rethrow = rethrow || ' + rethrow.toString() + ';' + '\n' + src; + } + } + + if (opts.strict) { + src = '"use strict";\n' + src; + } + if (opts.debug) { + console.log(src); + } + + try { + if (opts.async) { + // Have to use generated function for this, since in envs without support, + // it breaks in parsing + try { + ctor = (new Function('return (async function(){}).constructor;'))(); + } + catch(e) { + if (e instanceof SyntaxError) { + throw new Error('This environment does not support async/await'); + } + else { + throw e; + } + } + } + else { + ctor = Function; + } + fn = new ctor(opts.localsName + ', escapeFn, include, rethrow', src); + } + catch(e) { + // istanbul ignore else + if (e instanceof SyntaxError) { + if (opts.filename) { + e.message += ' in ' + opts.filename; + } + e.message += ' while compiling ejs\n\n'; + e.message += 'If the above error is not helpful, you may want to try EJS-Lint:\n'; + e.message += 'https://github.com/RyanZim/EJS-Lint'; + if (!e.async) { + e.message += '\n'; + e.message += 'Or, if you meant to create an async function, pass async: true as an option.'; + } + } + throw e; + } + + if (opts.client) { + fn.dependencies = this.dependencies; + return fn; + } + + // Return a callable function which will execute the function + // created by the source-code, with the passed data as locals + // Adds a local `include` function which allows full recursive include + var returnedFn = function (data) { + var include = function (path, includeData) { + var d = utils.shallowCopy({}, data); + if (includeData) { + d = utils.shallowCopy(d, includeData); + } + return includeFile(path, opts)(d); + }; + return fn.apply(opts.context, [data || {}, escapeFn, include, rethrow]); + }; + returnedFn.dependencies = this.dependencies; + return returnedFn; + }, + + generateSource: function () { + var opts = this.opts; + + if (opts.rmWhitespace) { + // Have to use two separate replace here as `^` and `$` operators don't + // work well with `\r` and empty lines don't work well with the `m` flag. + this.templateText = + this.templateText.replace(/[\r\n]+/g, '\n').replace(/^\s+|\s+$/gm, ''); + } + + // Slurp spaces and tabs before <%_ and after _%> + this.templateText = + this.templateText.replace(/[ \t]*<%_/gm, '<%_').replace(/_%>[ \t]*/gm, '_%>'); + + var self = this; + var matches = this.parseTemplateText(); + var d = this.opts.delimiter; + var o = this.opts.openDelimiter; + var c = this.opts.closeDelimiter; + + if (matches && matches.length) { + matches.forEach(function (line, index) { + var opening; + var closing; + var include; + var includeOpts; + var includeObj; + var includeSrc; + // If this is an opening tag, check for closing tags + // FIXME: May end up with some false positives here + // Better to store modes as k/v with openDelimiter + delimiter as key + // Then this can simply check against the map + if ( line.indexOf(o + d) === 0 // If it is a tag + && line.indexOf(o + d + d) !== 0) { // and is not escaped + closing = matches[index + 2]; + if (!(closing == d + c || closing == '-' + d + c || closing == '_' + d + c)) { + throw new Error('Could not find matching close tag for "' + line + '".'); + } + } + // HACK: backward-compat `include` preprocessor directives + if ((include = line.match(/^\s*include\s+(\S+)/))) { + opening = matches[index - 1]; + // Must be in EVAL or RAW mode + if (opening && (opening == o + d || opening == o + d + '-' || opening == o + d + '_')) { + includeOpts = utils.shallowCopy({}, self.opts); + includeObj = includeSource(include[1], includeOpts); + if (self.opts.compileDebug) { + includeSrc = + ' ; (function(){' + '\n' + + ' var __line = 1' + '\n' + + ' , __lines = ' + JSON.stringify(includeObj.template) + '\n' + + ' , __filename = ' + JSON.stringify(includeObj.filename) + ';' + '\n' + + ' try {' + '\n' + + includeObj.source + + ' } catch (e) {' + '\n' + + ' rethrow(e, __lines, __filename, __line, escapeFn);' + '\n' + + ' }' + '\n' + + ' ; }).call(this)' + '\n'; + }else{ + includeSrc = ' ; (function(){' + '\n' + includeObj.source + + ' ; }).call(this)' + '\n'; + } + self.source += includeSrc; + self.dependencies.push(exports.resolveInclude(include[1], + includeOpts.filename)); + return; + } + } + self.scanLine(line); + }); + } + + }, + + parseTemplateText: function () { + var str = this.templateText; + var pat = this.regex; + var result = pat.exec(str); + var arr = []; + var firstPos; + + while (result) { + firstPos = result.index; + + if (firstPos !== 0) { + arr.push(str.substring(0, firstPos)); + str = str.slice(firstPos); + } + + arr.push(result[0]); + str = str.slice(result[0].length); + result = pat.exec(str); + } + + if (str) { + arr.push(str); + } + + return arr; + }, + + _addOutput: function (line) { + if (this.truncate) { + // Only replace single leading linebreak in the line after + // -%> tag -- this is the single, trailing linebreak + // after the tag that the truncation mode replaces + // Handle Win / Unix / old Mac linebreaks -- do the \r\n + // combo first in the regex-or + line = line.replace(/^(?:\r\n|\r|\n)/, ''); + this.truncate = false; + } + if (!line) { + return line; + } + + // Preserve literal slashes + line = line.replace(/\\/g, '\\\\'); + + // Convert linebreaks + line = line.replace(/\n/g, '\\n'); + line = line.replace(/\r/g, '\\r'); + + // Escape double-quotes + // - this will be the delimiter during execution + line = line.replace(/"/g, '\\"'); + this.source += ' ; __append("' + line + '")' + '\n'; + }, + + scanLine: function (line) { + var self = this; + var d = this.opts.delimiter; + var o = this.opts.openDelimiter; + var c = this.opts.closeDelimiter; + var newLineCount = 0; + + newLineCount = (line.split('\n').length - 1); + + switch (line) { + case o + d: + case o + d + '_': + this.mode = Template.modes.EVAL; + break; + case o + d + '=': + this.mode = Template.modes.ESCAPED; + break; + case o + d + '-': + this.mode = Template.modes.RAW; + break; + case o + d + '#': + this.mode = Template.modes.COMMENT; + break; + case o + d + d: + this.mode = Template.modes.LITERAL; + this.source += ' ; __append("' + line.replace(o + d + d, o + d) + '")' + '\n'; + break; + case d + d + c: + this.mode = Template.modes.LITERAL; + this.source += ' ; __append("' + line.replace(d + d + c, d + c) + '")' + '\n'; + break; + case d + c: + case '-' + d + c: + case '_' + d + c: + if (this.mode == Template.modes.LITERAL) { + this._addOutput(line); + } + + this.mode = null; + this.truncate = line.indexOf('-') === 0 || line.indexOf('_') === 0; + break; + default: + // In script mode, depends on type of tag + if (this.mode) { + // If '//' is found without a line break, add a line break. + switch (this.mode) { + case Template.modes.EVAL: + case Template.modes.ESCAPED: + case Template.modes.RAW: + if (line.lastIndexOf('//') > line.lastIndexOf('\n')) { + line += '\n'; + } + } + switch (this.mode) { + // Just executing code + case Template.modes.EVAL: + this.source += ' ; ' + line + '\n'; + break; + // Exec, esc, and output + case Template.modes.ESCAPED: + this.source += ' ; __append(escapeFn(' + stripSemi(line) + '))' + '\n'; + break; + // Exec and output + case Template.modes.RAW: + this.source += ' ; __append(' + stripSemi(line) + ')' + '\n'; + break; + case Template.modes.COMMENT: + // Do nothing + break; + // Literal <%% mode, append as raw output + case Template.modes.LITERAL: + this._addOutput(line); + break; + } + } + // In string mode, just add the output + else { + this._addOutput(line); + } + } + + if (self.opts.compileDebug && newLineCount) { + this.currentLine += newLineCount; + this.source += ' ; __line = ' + this.currentLine + '\n'; + } + } +}; + +/** + * Escape characters reserved in XML. + * + * This is simply an export of {@link module:utils.escapeXML}. + * + * If `markup` is `undefined` or `null`, the empty string is returned. + * + * @param {String} markup Input string + * @return {String} Escaped string + * @public + * @func + * */ +exports.escapeXML = utils.escapeXML; + +/** + * Express.js support. + * + * This is an alias for {@link module:ejs.renderFile}, in order to support + * Express.js out-of-the-box. + * + * @func + */ + +exports.__express = exports.renderFile; + +// Add require support +/* istanbul ignore else */ +if (require.extensions) { + require.extensions['.ejs'] = function (module, flnm) { + var filename = flnm || /* istanbul ignore next */ module.filename; + var options = { + filename: filename, + client: true + }; + var template = fileLoader(filename).toString(); + var fn = exports.compile(template, options); + module._compile('module.exports = ' + fn.toString() + ';', filename); + }; +} + +/** + * Version of EJS. + * + * @readonly + * @type {String} + * @public + */ + +exports.VERSION = _VERSION_STRING; + +/** + * Name for detection of EJS. + * + * @readonly + * @type {String} + * @public + */ + +exports.name = _NAME; + +/* istanbul ignore if */ +if (typeof window != 'undefined') { + window.ejs = exports; +} + +},{"../package.json":6,"./utils":2,"fs":3,"path":4}],2:[function(require,module,exports){ +/* + * EJS Embedded JavaScript templates + * Copyright 2112 Matthew Eernisse (mde@fleegix.org) + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * +*/ + +/** + * Private utility functions + * @module utils + * @private + */ + +'use strict'; + +var regExpChars = /[|\\{}()[\]^$+*?.]/g; + +/** + * Escape characters reserved in regular expressions. + * + * If `string` is `undefined` or `null`, the empty string is returned. + * + * @param {String} string Input string + * @return {String} Escaped string + * @static + * @private + */ +exports.escapeRegExpChars = function (string) { + // istanbul ignore if + if (!string) { + return ''; + } + return String(string).replace(regExpChars, '\\$&'); +}; + +var _ENCODE_HTML_RULES = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + "'": ''' +}; +var _MATCH_HTML = /[&<>'"]/g; + +function encode_char(c) { + return _ENCODE_HTML_RULES[c] || c; +} + +/** + * Stringified version of constants used by {@link module:utils.escapeXML}. + * + * It is used in the process of generating {@link ClientFunction}s. + * + * @readonly + * @type {String} + */ + +var escapeFuncStr = + 'var _ENCODE_HTML_RULES = {\n' ++ ' "&": "&"\n' ++ ' , "<": "<"\n' ++ ' , ">": ">"\n' ++ ' , \'"\': """\n' ++ ' , "\'": "'"\n' ++ ' }\n' ++ ' , _MATCH_HTML = /[&<>\'"]/g;\n' ++ 'function encode_char(c) {\n' ++ ' return _ENCODE_HTML_RULES[c] || c;\n' ++ '};\n'; + +/** + * Escape characters reserved in XML. + * + * If `markup` is `undefined` or `null`, the empty string is returned. + * + * @implements {EscapeCallback} + * @param {String} markup Input string + * @return {String} Escaped string + * @static + * @private + */ + +exports.escapeXML = function (markup) { + return markup == undefined + ? '' + : String(markup) + .replace(_MATCH_HTML, encode_char); +}; +exports.escapeXML.toString = function () { + return Function.prototype.toString.call(this) + ';\n' + escapeFuncStr; +}; + +/** + * Naive copy of properties from one object to another. + * Does not recurse into non-scalar properties + * Does not check to see if the property has a value before copying + * + * @param {Object} to Destination object + * @param {Object} from Source object + * @return {Object} Destination object + * @static + * @private + */ +exports.shallowCopy = function (to, from) { + from = from || {}; + for (var p in from) { + to[p] = from[p]; + } + return to; +}; + +/** + * Naive copy of a list of key names, from one object to another. + * Only copies property if it is actually defined + * Does not recurse into non-scalar properties + * + * @param {Object} to Destination object + * @param {Object} from Source object + * @param {Array} list List of properties to copy + * @return {Object} Destination object + * @static + * @private + */ +exports.shallowCopyFromList = function (to, from, list) { + for (var i = 0; i < list.length; i++) { + var p = list[i]; + if (typeof from[p] != 'undefined') { + to[p] = from[p]; + } + } + return to; +}; + +/** + * Simple in-process cache implementation. Does not implement limits of any + * sort. + * + * @implements Cache + * @static + * @private + */ +exports.cache = { + _data: {}, + set: function (key, val) { + this._data[key] = val; + }, + get: function (key) { + return this._data[key]; + }, + remove: function (key) { + delete this._data[key]; + }, + reset: function () { + this._data = {}; + } +}; + +},{}],3:[function(require,module,exports){ + +},{}],4:[function(require,module,exports){ +(function (process){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// resolves . and .. elements in a path array with directory names there +// must be no slashes, empty elements, or device names (c:\) in the array +// (so also no leading and trailing slashes - it does not distinguish +// relative and absolute paths) +function normalizeArray(parts, allowAboveRoot) { + // if the path tries to go above the root, `up` ends up > 0 + var up = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var last = parts[i]; + if (last === '.') { + parts.splice(i, 1); + } else if (last === '..') { + parts.splice(i, 1); + up++; + } else if (up) { + parts.splice(i, 1); + up--; + } + } + + // if the path is allowed to go above the root, restore leading ..s + if (allowAboveRoot) { + for (; up--; up) { + parts.unshift('..'); + } + } + + return parts; +} + +// Split a filename into [root, dir, basename, ext], unix version +// 'root' is just a slash, or nothing. +var splitPathRe = + /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; +var splitPath = function(filename) { + return splitPathRe.exec(filename).slice(1); +}; + +// path.resolve([from ...], to) +// posix version +exports.resolve = function() { + var resolvedPath = '', + resolvedAbsolute = false; + + for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path = (i >= 0) ? arguments[i] : process.cwd(); + + // Skip empty and invalid entries + if (typeof path !== 'string') { + throw new TypeError('Arguments to path.resolve must be strings'); + } else if (!path) { + continue; + } + + resolvedPath = path + '/' + resolvedPath; + resolvedAbsolute = path.charAt(0) === '/'; + } + + // At this point the path should be resolved to a full absolute path, but + // handle relative paths to be safe (might happen when process.cwd() fails) + + // Normalize the path + resolvedPath = normalizeArray(filter(resolvedPath.split('/'), function(p) { + return !!p; + }), !resolvedAbsolute).join('/'); + + return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; +}; + +// path.normalize(path) +// posix version +exports.normalize = function(path) { + var isAbsolute = exports.isAbsolute(path), + trailingSlash = substr(path, -1) === '/'; + + // Normalize the path + path = normalizeArray(filter(path.split('/'), function(p) { + return !!p; + }), !isAbsolute).join('/'); + + if (!path && !isAbsolute) { + path = '.'; + } + if (path && trailingSlash) { + path += '/'; + } + + return (isAbsolute ? '/' : '') + path; +}; + +// posix version +exports.isAbsolute = function(path) { + return path.charAt(0) === '/'; +}; + +// posix version +exports.join = function() { + var paths = Array.prototype.slice.call(arguments, 0); + return exports.normalize(filter(paths, function(p, index) { + if (typeof p !== 'string') { + throw new TypeError('Arguments to path.join must be strings'); + } + return p; + }).join('/')); +}; + + +// path.relative(from, to) +// posix version +exports.relative = function(from, to) { + from = exports.resolve(from).substr(1); + to = exports.resolve(to).substr(1); + + function trim(arr) { + var start = 0; + for (; start < arr.length; start++) { + if (arr[start] !== '') break; + } + + var end = arr.length - 1; + for (; end >= 0; end--) { + if (arr[end] !== '') break; + } + + if (start > end) return []; + return arr.slice(start, end - start + 1); + } + + var fromParts = trim(from.split('/')); + var toParts = trim(to.split('/')); + + var length = Math.min(fromParts.length, toParts.length); + var samePartsLength = length; + for (var i = 0; i < length; i++) { + if (fromParts[i] !== toParts[i]) { + samePartsLength = i; + break; + } + } + + var outputParts = []; + for (var i = samePartsLength; i < fromParts.length; i++) { + outputParts.push('..'); + } + + outputParts = outputParts.concat(toParts.slice(samePartsLength)); + + return outputParts.join('/'); +}; + +exports.sep = '/'; +exports.delimiter = ':'; + +exports.dirname = function(path) { + var result = splitPath(path), + root = result[0], + dir = result[1]; + + if (!root && !dir) { + // No dirname whatsoever + return '.'; + } + + if (dir) { + // It has a dirname, strip trailing slash + dir = dir.substr(0, dir.length - 1); + } + + return root + dir; +}; + + +exports.basename = function(path, ext) { + var f = splitPath(path)[2]; + // TODO: make this comparison case-insensitive on windows? + if (ext && f.substr(-1 * ext.length) === ext) { + f = f.substr(0, f.length - ext.length); + } + return f; +}; + + +exports.extname = function(path) { + return splitPath(path)[3]; +}; + +function filter (xs, f) { + if (xs.filter) return xs.filter(f); + var res = []; + for (var i = 0; i < xs.length; i++) { + if (f(xs[i], i, xs)) res.push(xs[i]); + } + return res; +} + +// String.prototype.substr - negative index don't work in IE8 +var substr = 'ab'.substr(-1) === 'b' + ? function (str, start, len) { return str.substr(start, len) } + : function (str, start, len) { + if (start < 0) start = str.length + start; + return str.substr(start, len); + } +; + +}).call(this,require('_process')) +},{"_process":5}],5:[function(require,module,exports){ +// shim for using process in browser +var process = module.exports = {}; + +// cached from whatever global is present so that test runners that stub it +// don't break things. But we need to wrap it in a try catch in case it is +// wrapped in strict mode code which doesn't define any globals. It's inside a +// function because try/catches deoptimize in certain engines. + +var cachedSetTimeout; +var cachedClearTimeout; + +function defaultSetTimout() { + throw new Error('setTimeout has not been defined'); +} +function defaultClearTimeout () { + throw new Error('clearTimeout has not been defined'); +} +(function () { + try { + if (typeof setTimeout === 'function') { + cachedSetTimeout = setTimeout; + } else { + cachedSetTimeout = defaultSetTimout; + } + } catch (e) { + cachedSetTimeout = defaultSetTimout; + } + try { + if (typeof clearTimeout === 'function') { + cachedClearTimeout = clearTimeout; + } else { + cachedClearTimeout = defaultClearTimeout; + } + } catch (e) { + cachedClearTimeout = defaultClearTimeout; + } +} ()) +function runTimeout(fun) { + if (cachedSetTimeout === setTimeout) { + //normal enviroments in sane situations + return setTimeout(fun, 0); + } + // if setTimeout wasn't available but was latter defined + if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) { + cachedSetTimeout = setTimeout; + return setTimeout(fun, 0); + } + try { + // when when somebody has screwed with setTimeout but no I.E. maddness + return cachedSetTimeout(fun, 0); + } catch(e){ + try { + // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally + return cachedSetTimeout.call(null, fun, 0); + } catch(e){ + // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error + return cachedSetTimeout.call(this, fun, 0); + } + } + + +} +function runClearTimeout(marker) { + if (cachedClearTimeout === clearTimeout) { + //normal enviroments in sane situations + return clearTimeout(marker); + } + // if clearTimeout wasn't available but was latter defined + if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) { + cachedClearTimeout = clearTimeout; + return clearTimeout(marker); + } + try { + // when when somebody has screwed with setTimeout but no I.E. maddness + return cachedClearTimeout(marker); + } catch (e){ + try { + // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally + return cachedClearTimeout.call(null, marker); + } catch (e){ + // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error. + // Some versions of I.E. have different rules for clearTimeout vs setTimeout + return cachedClearTimeout.call(this, marker); + } + } + + + +} +var queue = []; +var draining = false; +var currentQueue; +var queueIndex = -1; + +function cleanUpNextTick() { + if (!draining || !currentQueue) { + return; + } + draining = false; + if (currentQueue.length) { + queue = currentQueue.concat(queue); + } else { + queueIndex = -1; + } + if (queue.length) { + drainQueue(); + } +} + +function drainQueue() { + if (draining) { + return; + } + var timeout = runTimeout(cleanUpNextTick); + draining = true; + + var len = queue.length; + while(len) { + currentQueue = queue; + queue = []; + while (++queueIndex < len) { + if (currentQueue) { + currentQueue[queueIndex].run(); + } + } + queueIndex = -1; + len = queue.length; + } + currentQueue = null; + draining = false; + runClearTimeout(timeout); +} + +process.nextTick = function (fun) { + var args = new Array(arguments.length - 1); + if (arguments.length > 1) { + for (var i = 1; i < arguments.length; i++) { + args[i - 1] = arguments[i]; + } + } + queue.push(new Item(fun, args)); + if (queue.length === 1 && !draining) { + runTimeout(drainQueue); + } +}; + +// v8 likes predictible objects +function Item(fun, array) { + this.fun = fun; + this.array = array; +} +Item.prototype.run = function () { + this.fun.apply(null, this.array); +}; +process.title = 'browser'; +process.browser = true; +process.env = {}; +process.argv = []; +process.version = ''; // empty string to avoid regexp issues +process.versions = {}; + +function noop() {} + +process.on = noop; +process.addListener = noop; +process.once = noop; +process.off = noop; +process.removeListener = noop; +process.removeAllListeners = noop; +process.emit = noop; +process.prependListener = noop; +process.prependOnceListener = noop; + +process.listeners = function (name) { return [] } + +process.binding = function (name) { + throw new Error('process.binding is not supported'); +}; + +process.cwd = function () { return '/' }; +process.chdir = function (dir) { + throw new Error('process.chdir is not supported'); +}; +process.umask = function() { return 0; }; + +},{}],6:[function(require,module,exports){ +module.exports={ + "name": "ejs", + "description": "Embedded JavaScript templates", + "keywords": [ + "template", + "engine", + "ejs" + ], + "version": "2.6.1", + "author": "Matthew Eernisse <mde@fleegix.org> (http://fleegix.org)", + "contributors": [ + "Timothy Gu <timothygu99@gmail.com> (https://timothygu.github.io)" + ], + "license": "Apache-2.0", + "main": "./lib/ejs.js", + "repository": { + "type": "git", + "url": "git://github.com/mde/ejs.git" + }, + "bugs": "https://github.com/mde/ejs/issues", + "homepage": "https://github.com/mde/ejs", + "dependencies": {}, + "devDependencies": { + "browserify": "^13.1.1", + "eslint": "^4.14.0", + "git-directory-deploy": "^1.5.1", + "istanbul": "~0.4.3", + "jake": "^8.0.16", + "jsdoc": "^3.4.0", + "lru-cache": "^4.0.1", + "mocha": "^5.0.5", + "uglify-js": "^3.3.16" + }, + "engines": { + "node": ">=0.10.0" + }, + "scripts": { + "test": "jake test", + "lint": "eslint \"**/*.js\" Jakefile", + "coverage": "istanbul cover node_modules/mocha/bin/_mocha", + "doc": "jake doc", + "devdoc": "jake doc[dev]" + } +} + +},{}]},{},[1])(1) +}); diff --git a/node_modules/ejs/ejs.min.js b/node_modules/ejs/ejs.min.js new file mode 100644 index 0000000..3645a8c --- /dev/null +++ b/node_modules/ejs/ejs.min.js @@ -0,0 +1 @@ +(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.ejs=f()}})(function(){var define,module,exports;return function(){function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s}return e}()({1:[function(require,module,exports){"use strict";var fs=require("fs");var path=require("path");var utils=require("./utils");var scopeOptionWarned=false;var _VERSION_STRING=require("../package.json").version;var _DEFAULT_OPEN_DELIMITER="<";var _DEFAULT_CLOSE_DELIMITER=">";var _DEFAULT_DELIMITER="%";var _DEFAULT_LOCALS_NAME="locals";var _NAME="ejs";var _REGEX_STRING="(<%%|%%>|<%=|<%-|<%_|<%#|<%|%>|-%>|_%>)";var _OPTS_PASSABLE_WITH_DATA=["delimiter","scope","context","debug","compileDebug","client","_with","rmWhitespace","strict","filename","async"];var _OPTS_PASSABLE_WITH_DATA_EXPRESS=_OPTS_PASSABLE_WITH_DATA.concat("cache");var _BOM=/^\uFEFF/;exports.cache=utils.cache;exports.fileLoader=fs.readFileSync;exports.localsName=_DEFAULT_LOCALS_NAME;exports.promiseImpl=new Function("return this;")().Promise;exports.resolveInclude=function(name,filename,isDir){var dirname=path.dirname;var extname=path.extname;var resolve=path.resolve;var includePath=resolve(isDir?filename:dirname(filename),name);var ext=extname(name);if(!ext){includePath+=".ejs"}return includePath};function getIncludePath(path,options){var includePath;var filePath;var views=options.views;var match=/^[A-Za-z]+:\\|^\//.exec(path);if(match&&match.length){includePath=exports.resolveInclude(path.replace(/^\/*/,""),options.root||"/",true)}else{if(options.filename){filePath=exports.resolveInclude(path,options.filename);if(fs.existsSync(filePath)){includePath=filePath}}if(!includePath){if(Array.isArray(views)&&views.some(function(v){filePath=exports.resolveInclude(path,v,true);return fs.existsSync(filePath)})){includePath=filePath}}if(!includePath){throw new Error('Could not find the include file "'+options.escapeFunction(path)+'"')}}return includePath}function handleCache(options,template){var func;var filename=options.filename;var hasTemplate=arguments.length>1;if(options.cache){if(!filename){throw new Error("cache option requires a filename")}func=exports.cache.get(filename);if(func){return func}if(!hasTemplate){template=fileLoader(filename).toString().replace(_BOM,"")}}else if(!hasTemplate){if(!filename){throw new Error("Internal EJS error: no file name or template "+"provided")}template=fileLoader(filename).toString().replace(_BOM,"")}func=exports.compile(template,options);if(options.cache){exports.cache.set(filename,func)}return func}function tryHandleCache(options,data,cb){var result;if(!cb){if(typeof exports.promiseImpl=="function"){return new exports.promiseImpl(function(resolve,reject){try{result=handleCache(options)(data);resolve(result)}catch(err){reject(err)}})}else{throw new Error("Please provide a callback function")}}else{try{result=handleCache(options)(data)}catch(err){return cb(err)}cb(null,result)}}function fileLoader(filePath){return exports.fileLoader(filePath)}function includeFile(path,options){var opts=utils.shallowCopy({},options);opts.filename=getIncludePath(path,opts);return handleCache(opts)}function includeSource(path,options){var opts=utils.shallowCopy({},options);var includePath;var template;includePath=getIncludePath(path,opts);template=fileLoader(includePath).toString().replace(_BOM,"");opts.filename=includePath;var templ=new Template(template,opts);templ.generateSource();return{source:templ.source,filename:includePath,template:template}}function rethrow(err,str,flnm,lineno,esc){var lines=str.split("\n");var start=Math.max(lineno-3,0);var end=Math.min(lines.length,lineno+3);var filename=esc(flnm);var context=lines.slice(start,end).map(function(line,i){var curr=i+start+1;return(curr==lineno?" >> ":" ")+curr+"| "+line}).join("\n");err.path=filename;err.message=(filename||"ejs")+":"+lineno+"\n"+context+"\n\n"+err.message;throw err}function stripSemi(str){return str.replace(/;(\s*$)/,"$1")}exports.compile=function compile(template,opts){var templ;if(opts&&opts.scope){if(!scopeOptionWarned){console.warn("`scope` option is deprecated and will be removed in EJS 3");scopeOptionWarned=true}if(!opts.context){opts.context=opts.scope}delete opts.scope}templ=new Template(template,opts);return templ.compile()};exports.render=function(template,d,o){var data=d||{};var opts=o||{};if(arguments.length==2){utils.shallowCopyFromList(opts,data,_OPTS_PASSABLE_WITH_DATA)}return handleCache(opts,template)(data)};exports.renderFile=function(){var args=Array.prototype.slice.call(arguments);var filename=args.shift();var cb;var opts={filename:filename};var data;var viewOpts;if(typeof arguments[arguments.length-1]=="function"){cb=args.pop()}if(args.length){data=args.shift();if(args.length){utils.shallowCopy(opts,args.pop())}else{if(data.settings){if(data.settings.views){opts.views=data.settings.views}if(data.settings["view cache"]){opts.cache=true}viewOpts=data.settings["view options"];if(viewOpts){utils.shallowCopy(opts,viewOpts)}}utils.shallowCopyFromList(opts,data,_OPTS_PASSABLE_WITH_DATA_EXPRESS)}opts.filename=filename}else{data={}}return tryHandleCache(opts,data,cb)};exports.Template=Template;exports.clearCache=function(){exports.cache.reset()};function Template(text,opts){opts=opts||{};var options={};this.templateText=text;this.mode=null;this.truncate=false;this.currentLine=1;this.source="";this.dependencies=[];options.client=opts.client||false;options.escapeFunction=opts.escape||opts.escapeFunction||utils.escapeXML;options.compileDebug=opts.compileDebug!==false;options.debug=!!opts.debug;options.filename=opts.filename;options.openDelimiter=opts.openDelimiter||exports.openDelimiter||_DEFAULT_OPEN_DELIMITER;options.closeDelimiter=opts.closeDelimiter||exports.closeDelimiter||_DEFAULT_CLOSE_DELIMITER;options.delimiter=opts.delimiter||exports.delimiter||_DEFAULT_DELIMITER;options.strict=opts.strict||false;options.context=opts.context;options.cache=opts.cache||false;options.rmWhitespace=opts.rmWhitespace;options.root=opts.root;options.outputFunctionName=opts.outputFunctionName;options.localsName=opts.localsName||exports.localsName||_DEFAULT_LOCALS_NAME;options.views=opts.views;options.async=opts.async;if(options.strict){options._with=false}else{options._with=typeof opts._with!="undefined"?opts._with:true}this.opts=options;this.regex=this.createRegex()}Template.modes={EVAL:"eval",ESCAPED:"escaped",RAW:"raw",COMMENT:"comment",LITERAL:"literal"};Template.prototype={createRegex:function(){var str=_REGEX_STRING;var delim=utils.escapeRegExpChars(this.opts.delimiter);var open=utils.escapeRegExpChars(this.opts.openDelimiter);var close=utils.escapeRegExpChars(this.opts.closeDelimiter);str=str.replace(/%/g,delim).replace(/</g,open).replace(/>/g,close);return new RegExp(str)},compile:function(){var src;var fn;var opts=this.opts;var prepended="";var appended="";var escapeFn=opts.escapeFunction;var ctor;if(!this.source){this.generateSource();prepended+=" var __output = [], __append = __output.push.bind(__output);"+"\n";if(opts.outputFunctionName){prepended+=" var "+opts.outputFunctionName+" = __append;"+"\n"}if(opts._with!==false){prepended+=" with ("+opts.localsName+" || {}) {"+"\n";appended+=" }"+"\n"}appended+=' return __output.join("");'+"\n";this.source=prepended+this.source+appended}if(opts.compileDebug){src="var __line = 1"+"\n"+" , __lines = "+JSON.stringify(this.templateText)+"\n"+" , __filename = "+(opts.filename?JSON.stringify(opts.filename):"undefined")+";"+"\n"+"try {"+"\n"+this.source+"} catch (e) {"+"\n"+" rethrow(e, __lines, __filename, __line, escapeFn);"+"\n"+"}"+"\n"}else{src=this.source}if(opts.client){src="escapeFn = escapeFn || "+escapeFn.toString()+";"+"\n"+src;if(opts.compileDebug){src="rethrow = rethrow || "+rethrow.toString()+";"+"\n"+src}}if(opts.strict){src='"use strict";\n'+src}if(opts.debug){console.log(src)}try{if(opts.async){try{ctor=new Function("return (async function(){}).constructor;")()}catch(e){if(e instanceof SyntaxError){throw new Error("This environment does not support async/await")}else{throw e}}}else{ctor=Function}fn=new ctor(opts.localsName+", escapeFn, include, rethrow",src)}catch(e){if(e instanceof SyntaxError){if(opts.filename){e.message+=" in "+opts.filename}e.message+=" while compiling ejs\n\n";e.message+="If the above error is not helpful, you may want to try EJS-Lint:\n";e.message+="https://github.com/RyanZim/EJS-Lint";if(!e.async){e.message+="\n";e.message+="Or, if you meant to create an async function, pass async: true as an option."}}throw e}if(opts.client){fn.dependencies=this.dependencies;return fn}var returnedFn=function(data){var include=function(path,includeData){var d=utils.shallowCopy({},data);if(includeData){d=utils.shallowCopy(d,includeData)}return includeFile(path,opts)(d)};return fn.apply(opts.context,[data||{},escapeFn,include,rethrow])};returnedFn.dependencies=this.dependencies;return returnedFn},generateSource:function(){var opts=this.opts;if(opts.rmWhitespace){this.templateText=this.templateText.replace(/[\r\n]+/g,"\n").replace(/^\s+|\s+$/gm,"")}this.templateText=this.templateText.replace(/[ \t]*<%_/gm,"<%_").replace(/_%>[ \t]*/gm,"_%>");var self=this;var matches=this.parseTemplateText();var d=this.opts.delimiter;var o=this.opts.openDelimiter;var c=this.opts.closeDelimiter;if(matches&&matches.length){matches.forEach(function(line,index){var opening;var closing;var include;var includeOpts;var includeObj;var includeSrc;if(line.indexOf(o+d)===0&&line.indexOf(o+d+d)!==0){closing=matches[index+2];if(!(closing==d+c||closing=="-"+d+c||closing=="_"+d+c)){throw new Error('Could not find matching close tag for "'+line+'".')}}if(include=line.match(/^\s*include\s+(\S+)/)){opening=matches[index-1];if(opening&&(opening==o+d||opening==o+d+"-"||opening==o+d+"_")){includeOpts=utils.shallowCopy({},self.opts);includeObj=includeSource(include[1],includeOpts);if(self.opts.compileDebug){includeSrc=" ; (function(){"+"\n"+" var __line = 1"+"\n"+" , __lines = "+JSON.stringify(includeObj.template)+"\n"+" , __filename = "+JSON.stringify(includeObj.filename)+";"+"\n"+" try {"+"\n"+includeObj.source+" } catch (e) {"+"\n"+" rethrow(e, __lines, __filename, __line, escapeFn);"+"\n"+" }"+"\n"+" ; }).call(this)"+"\n"}else{includeSrc=" ; (function(){"+"\n"+includeObj.source+" ; }).call(this)"+"\n"}self.source+=includeSrc;self.dependencies.push(exports.resolveInclude(include[1],includeOpts.filename));return}}self.scanLine(line)})}},parseTemplateText:function(){var str=this.templateText;var pat=this.regex;var result=pat.exec(str);var arr=[];var firstPos;while(result){firstPos=result.index;if(firstPos!==0){arr.push(str.substring(0,firstPos));str=str.slice(firstPos)}arr.push(result[0]);str=str.slice(result[0].length);result=pat.exec(str)}if(str){arr.push(str)}return arr},_addOutput:function(line){if(this.truncate){line=line.replace(/^(?:\r\n|\r|\n)/,"");this.truncate=false}if(!line){return line}line=line.replace(/\\/g,"\\\\");line=line.replace(/\n/g,"\\n");line=line.replace(/\r/g,"\\r");line=line.replace(/"/g,'\\"');this.source+=' ; __append("'+line+'")'+"\n"},scanLine:function(line){var self=this;var d=this.opts.delimiter;var o=this.opts.openDelimiter;var c=this.opts.closeDelimiter;var newLineCount=0;newLineCount=line.split("\n").length-1;switch(line){case o+d:case o+d+"_":this.mode=Template.modes.EVAL;break;case o+d+"=":this.mode=Template.modes.ESCAPED;break;case o+d+"-":this.mode=Template.modes.RAW;break;case o+d+"#":this.mode=Template.modes.COMMENT;break;case o+d+d:this.mode=Template.modes.LITERAL;this.source+=' ; __append("'+line.replace(o+d+d,o+d)+'")'+"\n";break;case d+d+c:this.mode=Template.modes.LITERAL;this.source+=' ; __append("'+line.replace(d+d+c,d+c)+'")'+"\n";break;case d+c:case"-"+d+c:case"_"+d+c:if(this.mode==Template.modes.LITERAL){this._addOutput(line)}this.mode=null;this.truncate=line.indexOf("-")===0||line.indexOf("_")===0;break;default:if(this.mode){switch(this.mode){case Template.modes.EVAL:case Template.modes.ESCAPED:case Template.modes.RAW:if(line.lastIndexOf("//")>line.lastIndexOf("\n")){line+="\n"}}switch(this.mode){case Template.modes.EVAL:this.source+=" ; "+line+"\n";break;case Template.modes.ESCAPED:this.source+=" ; __append(escapeFn("+stripSemi(line)+"))"+"\n";break;case Template.modes.RAW:this.source+=" ; __append("+stripSemi(line)+")"+"\n";break;case Template.modes.COMMENT:break;case Template.modes.LITERAL:this._addOutput(line);break}}else{this._addOutput(line)}}if(self.opts.compileDebug&&newLineCount){this.currentLine+=newLineCount;this.source+=" ; __line = "+this.currentLine+"\n"}}};exports.escapeXML=utils.escapeXML;exports.__express=exports.renderFile;if(require.extensions){require.extensions[".ejs"]=function(module,flnm){var filename=flnm||module.filename;var options={filename:filename,client:true};var template=fileLoader(filename).toString();var fn=exports.compile(template,options);module._compile("module.exports = "+fn.toString()+";",filename)}}exports.VERSION=_VERSION_STRING;exports.name=_NAME;if(typeof window!="undefined"){window.ejs=exports}},{"../package.json":6,"./utils":2,fs:3,path:4}],2:[function(require,module,exports){"use strict";var regExpChars=/[|\\{}()[\]^$+*?.]/g;exports.escapeRegExpChars=function(string){if(!string){return""}return String(string).replace(regExpChars,"\\$&")};var _ENCODE_HTML_RULES={"&":"&","<":"<",">":">",'"':""","'":"'"};var _MATCH_HTML=/[&<>'"]/g;function encode_char(c){return _ENCODE_HTML_RULES[c]||c}var escapeFuncStr="var _ENCODE_HTML_RULES = {\n"+' "&": "&"\n'+' , "<": "<"\n'+' , ">": ">"\n'+' , \'"\': """\n'+' , "\'": "'"\n'+" }\n"+" , _MATCH_HTML = /[&<>'\"]/g;\n"+"function encode_char(c) {\n"+" return _ENCODE_HTML_RULES[c] || c;\n"+"};\n";exports.escapeXML=function(markup){return markup==undefined?"":String(markup).replace(_MATCH_HTML,encode_char)};exports.escapeXML.toString=function(){return Function.prototype.toString.call(this)+";\n"+escapeFuncStr};exports.shallowCopy=function(to,from){from=from||{};for(var p in from){to[p]=from[p]}return to};exports.shallowCopyFromList=function(to,from,list){for(var i=0;i<list.length;i++){var p=list[i];if(typeof from[p]!="undefined"){to[p]=from[p]}}return to};exports.cache={_data:{},set:function(key,val){this._data[key]=val},get:function(key){return this._data[key]},remove:function(key){delete this._data[key]},reset:function(){this._data={}}}},{}],3:[function(require,module,exports){},{}],4:[function(require,module,exports){(function(process){function normalizeArray(parts,allowAboveRoot){var up=0;for(var i=parts.length-1;i>=0;i--){var last=parts[i];if(last==="."){parts.splice(i,1)}else if(last===".."){parts.splice(i,1);up++}else if(up){parts.splice(i,1);up--}}if(allowAboveRoot){for(;up--;up){parts.unshift("..")}}return parts}var splitPathRe=/^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;var splitPath=function(filename){return splitPathRe.exec(filename).slice(1)};exports.resolve=function(){var resolvedPath="",resolvedAbsolute=false;for(var i=arguments.length-1;i>=-1&&!resolvedAbsolute;i--){var path=i>=0?arguments[i]:process.cwd();if(typeof path!=="string"){throw new TypeError("Arguments to path.resolve must be strings")}else if(!path){continue}resolvedPath=path+"/"+resolvedPath;resolvedAbsolute=path.charAt(0)==="/"}resolvedPath=normalizeArray(filter(resolvedPath.split("/"),function(p){return!!p}),!resolvedAbsolute).join("/");return(resolvedAbsolute?"/":"")+resolvedPath||"."};exports.normalize=function(path){var isAbsolute=exports.isAbsolute(path),trailingSlash=substr(path,-1)==="/";path=normalizeArray(filter(path.split("/"),function(p){return!!p}),!isAbsolute).join("/");if(!path&&!isAbsolute){path="."}if(path&&trailingSlash){path+="/"}return(isAbsolute?"/":"")+path};exports.isAbsolute=function(path){return path.charAt(0)==="/"};exports.join=function(){var paths=Array.prototype.slice.call(arguments,0);return exports.normalize(filter(paths,function(p,index){if(typeof p!=="string"){throw new TypeError("Arguments to path.join must be strings")}return p}).join("/"))};exports.relative=function(from,to){from=exports.resolve(from).substr(1);to=exports.resolve(to).substr(1);function trim(arr){var start=0;for(;start<arr.length;start++){if(arr[start]!=="")break}var end=arr.length-1;for(;end>=0;end--){if(arr[end]!=="")break}if(start>end)return[];return arr.slice(start,end-start+1)}var fromParts=trim(from.split("/"));var toParts=trim(to.split("/"));var length=Math.min(fromParts.length,toParts.length);var samePartsLength=length;for(var i=0;i<length;i++){if(fromParts[i]!==toParts[i]){samePartsLength=i;break}}var outputParts=[];for(var i=samePartsLength;i<fromParts.length;i++){outputParts.push("..")}outputParts=outputParts.concat(toParts.slice(samePartsLength));return outputParts.join("/")};exports.sep="/";exports.delimiter=":";exports.dirname=function(path){var result=splitPath(path),root=result[0],dir=result[1];if(!root&&!dir){return"."}if(dir){dir=dir.substr(0,dir.length-1)}return root+dir};exports.basename=function(path,ext){var f=splitPath(path)[2];if(ext&&f.substr(-1*ext.length)===ext){f=f.substr(0,f.length-ext.length)}return f};exports.extname=function(path){return splitPath(path)[3]};function filter(xs,f){if(xs.filter)return xs.filter(f);var res=[];for(var i=0;i<xs.length;i++){if(f(xs[i],i,xs))res.push(xs[i])}return res}var substr="ab".substr(-1)==="b"?function(str,start,len){return str.substr(start,len)}:function(str,start,len){if(start<0)start=str.length+start;return str.substr(start,len)}}).call(this,require("_process"))},{_process:5}],5:[function(require,module,exports){var process=module.exports={};var cachedSetTimeout;var cachedClearTimeout;function defaultSetTimout(){throw new Error("setTimeout has not been defined")}function defaultClearTimeout(){throw new Error("clearTimeout has not been defined")}(function(){try{if(typeof setTimeout==="function"){cachedSetTimeout=setTimeout}else{cachedSetTimeout=defaultSetTimout}}catch(e){cachedSetTimeout=defaultSetTimout}try{if(typeof clearTimeout==="function"){cachedClearTimeout=clearTimeout}else{cachedClearTimeout=defaultClearTimeout}}catch(e){cachedClearTimeout=defaultClearTimeout}})();function runTimeout(fun){if(cachedSetTimeout===setTimeout){return setTimeout(fun,0)}if((cachedSetTimeout===defaultSetTimout||!cachedSetTimeout)&&setTimeout){cachedSetTimeout=setTimeout;return setTimeout(fun,0)}try{return cachedSetTimeout(fun,0)}catch(e){try{return cachedSetTimeout.call(null,fun,0)}catch(e){return cachedSetTimeout.call(this,fun,0)}}}function runClearTimeout(marker){if(cachedClearTimeout===clearTimeout){return clearTimeout(marker)}if((cachedClearTimeout===defaultClearTimeout||!cachedClearTimeout)&&clearTimeout){cachedClearTimeout=clearTimeout;return clearTimeout(marker)}try{return cachedClearTimeout(marker)}catch(e){try{return cachedClearTimeout.call(null,marker)}catch(e){return cachedClearTimeout.call(this,marker)}}}var queue=[];var draining=false;var currentQueue;var queueIndex=-1;function cleanUpNextTick(){if(!draining||!currentQueue){return}draining=false;if(currentQueue.length){queue=currentQueue.concat(queue)}else{queueIndex=-1}if(queue.length){drainQueue()}}function drainQueue(){if(draining){return}var timeout=runTimeout(cleanUpNextTick);draining=true;var len=queue.length;while(len){currentQueue=queue;queue=[];while(++queueIndex<len){if(currentQueue){currentQueue[queueIndex].run()}}queueIndex=-1;len=queue.length}currentQueue=null;draining=false;runClearTimeout(timeout)}process.nextTick=function(fun){var args=new Array(arguments.length-1);if(arguments.length>1){for(var i=1;i<arguments.length;i++){args[i-1]=arguments[i]}}queue.push(new Item(fun,args));if(queue.length===1&&!draining){runTimeout(drainQueue)}};function Item(fun,array){this.fun=fun;this.array=array}Item.prototype.run=function(){this.fun.apply(null,this.array)};process.title="browser";process.browser=true;process.env={};process.argv=[];process.version="";process.versions={};function noop(){}process.on=noop;process.addListener=noop;process.once=noop;process.off=noop;process.removeListener=noop;process.removeAllListeners=noop;process.emit=noop;process.prependListener=noop;process.prependOnceListener=noop;process.listeners=function(name){return[]};process.binding=function(name){throw new Error("process.binding is not supported")};process.cwd=function(){return"/"};process.chdir=function(dir){throw new Error("process.chdir is not supported")};process.umask=function(){return 0}},{}],6:[function(require,module,exports){module.exports={name:"ejs",description:"Embedded JavaScript templates",keywords:["template","engine","ejs"],version:"2.6.1",author:"Matthew Eernisse <mde@fleegix.org> (http://fleegix.org)",contributors:["Timothy Gu <timothygu99@gmail.com> (https://timothygu.github.io)"],license:"Apache-2.0",main:"./lib/ejs.js",repository:{type:"git",url:"git://github.com/mde/ejs.git"},bugs:"https://github.com/mde/ejs/issues",homepage:"https://github.com/mde/ejs",dependencies:{},devDependencies:{browserify:"^13.1.1",eslint:"^4.14.0","git-directory-deploy":"^1.5.1",istanbul:"~0.4.3",jake:"^8.0.16",jsdoc:"^3.4.0","lru-cache":"^4.0.1",mocha:"^5.0.5","uglify-js":"^3.3.16"},engines:{node:">=0.10.0"},scripts:{test:"jake test",lint:'eslint "**/*.js" Jakefile',coverage:"istanbul cover node_modules/mocha/bin/_mocha",doc:"jake doc",devdoc:"jake doc[dev]"}}},{}]},{},[1])(1)}); diff --git a/node_modules/ejs/lib/ejs.js b/node_modules/ejs/lib/ejs.js new file mode 100755 index 0000000..e8fa21b --- /dev/null +++ b/node_modules/ejs/lib/ejs.js @@ -0,0 +1,953 @@ +/* + * EJS Embedded JavaScript templates + * Copyright 2112 Matthew Eernisse (mde@fleegix.org) + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * +*/ + +'use strict'; + +/** + * @file Embedded JavaScript templating engine. {@link http://ejs.co} + * @author Matthew Eernisse <mde@fleegix.org> + * @author Tiancheng "Timothy" Gu <timothygu99@gmail.com> + * @project EJS + * @license {@link http://www.apache.org/licenses/LICENSE-2.0 Apache License, Version 2.0} + */ + +/** + * EJS internal functions. + * + * Technically this "module" lies in the same file as {@link module:ejs}, for + * the sake of organization all the private functions re grouped into this + * module. + * + * @module ejs-internal + * @private + */ + +/** + * Embedded JavaScript templating engine. + * + * @module ejs + * @public + */ + +var fs = require('fs'); +var path = require('path'); +var utils = require('./utils'); + +var scopeOptionWarned = false; +var _VERSION_STRING = require('../package.json').version; +var _DEFAULT_OPEN_DELIMITER = '<'; +var _DEFAULT_CLOSE_DELIMITER = '>'; +var _DEFAULT_DELIMITER = '%'; +var _DEFAULT_LOCALS_NAME = 'locals'; +var _NAME = 'ejs'; +var _REGEX_STRING = '(<%%|%%>|<%=|<%-|<%_|<%#|<%|%>|-%>|_%>)'; +var _OPTS_PASSABLE_WITH_DATA = ['delimiter', 'scope', 'context', 'debug', 'compileDebug', + 'client', '_with', 'rmWhitespace', 'strict', 'filename', 'async']; +// We don't allow 'cache' option to be passed in the data obj for +// the normal `render` call, but this is where Express 2 & 3 put it +// so we make an exception for `renderFile` +var _OPTS_PASSABLE_WITH_DATA_EXPRESS = _OPTS_PASSABLE_WITH_DATA.concat('cache'); +var _BOM = /^\uFEFF/; + +/** + * EJS template function cache. This can be a LRU object from lru-cache NPM + * module. By default, it is {@link module:utils.cache}, a simple in-process + * cache that grows continuously. + * + * @type {Cache} + */ + +exports.cache = utils.cache; + +/** + * Custom file loader. Useful for template preprocessing or restricting access + * to a certain part of the filesystem. + * + * @type {fileLoader} + */ + +exports.fileLoader = fs.readFileSync; + +/** + * Name of the object containing the locals. + * + * This variable is overridden by {@link Options}`.localsName` if it is not + * `undefined`. + * + * @type {String} + * @public + */ + +exports.localsName = _DEFAULT_LOCALS_NAME; + +/** + * Promise implementation -- defaults to the native implementation if available + * This is mostly just for testability + * + * @type {Function} + * @public + */ + +exports.promiseImpl = (new Function('return this;'))().Promise; + +/** + * Get the path to the included file from the parent file path and the + * specified path. + * + * @param {String} name specified path + * @param {String} filename parent file path + * @param {Boolean} isDir parent file path whether is directory + * @return {String} + */ +exports.resolveInclude = function(name, filename, isDir) { + var dirname = path.dirname; + var extname = path.extname; + var resolve = path.resolve; + var includePath = resolve(isDir ? filename : dirname(filename), name); + var ext = extname(name); + if (!ext) { + includePath += '.ejs'; + } + return includePath; +}; + +/** + * Get the path to the included file by Options + * + * @param {String} path specified path + * @param {Options} options compilation options + * @return {String} + */ +function getIncludePath(path, options) { + var includePath; + var filePath; + var views = options.views; + var match = /^[A-Za-z]+:\\|^\//.exec(path); + + // Abs path + if (match && match.length) { + includePath = exports.resolveInclude(path.replace(/^\/*/,''), options.root || '/', true); + } + // Relative paths + else { + // Look relative to a passed filename first + if (options.filename) { + filePath = exports.resolveInclude(path, options.filename); + if (fs.existsSync(filePath)) { + includePath = filePath; + } + } + // Then look in any views directories + if (!includePath) { + if (Array.isArray(views) && views.some(function (v) { + filePath = exports.resolveInclude(path, v, true); + return fs.existsSync(filePath); + })) { + includePath = filePath; + } + } + if (!includePath) { + throw new Error('Could not find the include file "' + + options.escapeFunction(path) + '"'); + } + } + return includePath; +} + +/** + * Get the template from a string or a file, either compiled on-the-fly or + * read from cache (if enabled), and cache the template if needed. + * + * If `template` is not set, the file specified in `options.filename` will be + * read. + * + * If `options.cache` is true, this function reads the file from + * `options.filename` so it must be set prior to calling this function. + * + * @memberof module:ejs-internal + * @param {Options} options compilation options + * @param {String} [template] template source + * @return {(TemplateFunction|ClientFunction)} + * Depending on the value of `options.client`, either type might be returned. + * @static + */ + +function handleCache(options, template) { + var func; + var filename = options.filename; + var hasTemplate = arguments.length > 1; + + if (options.cache) { + if (!filename) { + throw new Error('cache option requires a filename'); + } + func = exports.cache.get(filename); + if (func) { + return func; + } + if (!hasTemplate) { + template = fileLoader(filename).toString().replace(_BOM, ''); + } + } + else if (!hasTemplate) { + // istanbul ignore if: should not happen at all + if (!filename) { + throw new Error('Internal EJS error: no file name or template ' + + 'provided'); + } + template = fileLoader(filename).toString().replace(_BOM, ''); + } + func = exports.compile(template, options); + if (options.cache) { + exports.cache.set(filename, func); + } + return func; +} + +/** + * Try calling handleCache with the given options and data and call the + * callback with the result. If an error occurs, call the callback with + * the error. Used by renderFile(). + * + * @memberof module:ejs-internal + * @param {Options} options compilation options + * @param {Object} data template data + * @param {RenderFileCallback} cb callback + * @static + */ + +function tryHandleCache(options, data, cb) { + var result; + if (!cb) { + if (typeof exports.promiseImpl == 'function') { + return new exports.promiseImpl(function (resolve, reject) { + try { + result = handleCache(options)(data); + resolve(result); + } + catch (err) { + reject(err); + } + }); + } + else { + throw new Error('Please provide a callback function'); + } + } + else { + try { + result = handleCache(options)(data); + } + catch (err) { + return cb(err); + } + + cb(null, result); + } +} + +/** + * fileLoader is independent + * + * @param {String} filePath ejs file path. + * @return {String} The contents of the specified file. + * @static + */ + +function fileLoader(filePath){ + return exports.fileLoader(filePath); +} + +/** + * Get the template function. + * + * If `options.cache` is `true`, then the template is cached. + * + * @memberof module:ejs-internal + * @param {String} path path for the specified file + * @param {Options} options compilation options + * @return {(TemplateFunction|ClientFunction)} + * Depending on the value of `options.client`, either type might be returned + * @static + */ + +function includeFile(path, options) { + var opts = utils.shallowCopy({}, options); + opts.filename = getIncludePath(path, opts); + return handleCache(opts); +} + +/** + * Get the JavaScript source of an included file. + * + * @memberof module:ejs-internal + * @param {String} path path for the specified file + * @param {Options} options compilation options + * @return {Object} + * @static + */ + +function includeSource(path, options) { + var opts = utils.shallowCopy({}, options); + var includePath; + var template; + includePath = getIncludePath(path, opts); + template = fileLoader(includePath).toString().replace(_BOM, ''); + opts.filename = includePath; + var templ = new Template(template, opts); + templ.generateSource(); + return { + source: templ.source, + filename: includePath, + template: template + }; +} + +/** + * Re-throw the given `err` in context to the `str` of ejs, `filename`, and + * `lineno`. + * + * @implements RethrowCallback + * @memberof module:ejs-internal + * @param {Error} err Error object + * @param {String} str EJS source + * @param {String} filename file name of the EJS file + * @param {String} lineno line number of the error + * @static + */ + +function rethrow(err, str, flnm, lineno, esc){ + var lines = str.split('\n'); + var start = Math.max(lineno - 3, 0); + var end = Math.min(lines.length, lineno + 3); + var filename = esc(flnm); // eslint-disable-line + // Error context + var context = lines.slice(start, end).map(function (line, i){ + var curr = i + start + 1; + return (curr == lineno ? ' >> ' : ' ') + + curr + + '| ' + + line; + }).join('\n'); + + // Alter exception message + err.path = filename; + err.message = (filename || 'ejs') + ':' + + lineno + '\n' + + context + '\n\n' + + err.message; + + throw err; +} + +function stripSemi(str){ + return str.replace(/;(\s*$)/, '$1'); +} + +/** + * Compile the given `str` of ejs into a template function. + * + * @param {String} template EJS template + * + * @param {Options} opts compilation options + * + * @return {(TemplateFunction|ClientFunction)} + * Depending on the value of `opts.client`, either type might be returned. + * Note that the return type of the function also depends on the value of `opts.async`. + * @public + */ + +exports.compile = function compile(template, opts) { + var templ; + + // v1 compat + // 'scope' is 'context' + // FIXME: Remove this in a future version + if (opts && opts.scope) { + if (!scopeOptionWarned){ + console.warn('`scope` option is deprecated and will be removed in EJS 3'); + scopeOptionWarned = true; + } + if (!opts.context) { + opts.context = opts.scope; + } + delete opts.scope; + } + templ = new Template(template, opts); + return templ.compile(); +}; + +/** + * Render the given `template` of ejs. + * + * If you would like to include options but not data, you need to explicitly + * call this function with `data` being an empty object or `null`. + * + * @param {String} template EJS template + * @param {Object} [data={}] template data + * @param {Options} [opts={}] compilation and rendering options + * @return {(String|Promise<String>)} + * Return value type depends on `opts.async`. + * @public + */ + +exports.render = function (template, d, o) { + var data = d || {}; + var opts = o || {}; + + // No options object -- if there are optiony names + // in the data, copy them to options + if (arguments.length == 2) { + utils.shallowCopyFromList(opts, data, _OPTS_PASSABLE_WITH_DATA); + } + + return handleCache(opts, template)(data); +}; + +/** + * Render an EJS file at the given `path` and callback `cb(err, str)`. + * + * If you would like to include options but not data, you need to explicitly + * call this function with `data` being an empty object or `null`. + * + * @param {String} path path to the EJS file + * @param {Object} [data={}] template data + * @param {Options} [opts={}] compilation and rendering options + * @param {RenderFileCallback} cb callback + * @public + */ + +exports.renderFile = function () { + var args = Array.prototype.slice.call(arguments); + var filename = args.shift(); + var cb; + var opts = {filename: filename}; + var data; + var viewOpts; + + // Do we have a callback? + if (typeof arguments[arguments.length - 1] == 'function') { + cb = args.pop(); + } + // Do we have data/opts? + if (args.length) { + // Should always have data obj + data = args.shift(); + // Normal passed opts (data obj + opts obj) + if (args.length) { + // Use shallowCopy so we don't pollute passed in opts obj with new vals + utils.shallowCopy(opts, args.pop()); + } + // Special casing for Express (settings + opts-in-data) + else { + // Express 3 and 4 + if (data.settings) { + // Pull a few things from known locations + if (data.settings.views) { + opts.views = data.settings.views; + } + if (data.settings['view cache']) { + opts.cache = true; + } + // Undocumented after Express 2, but still usable, esp. for + // items that are unsafe to be passed along with data, like `root` + viewOpts = data.settings['view options']; + if (viewOpts) { + utils.shallowCopy(opts, viewOpts); + } + } + // Express 2 and lower, values set in app.locals, or people who just + // want to pass options in their data. NOTE: These values will override + // anything previously set in settings or settings['view options'] + utils.shallowCopyFromList(opts, data, _OPTS_PASSABLE_WITH_DATA_EXPRESS); + } + opts.filename = filename; + } + else { + data = {}; + } + + return tryHandleCache(opts, data, cb); +}; + +/** + * Clear intermediate JavaScript cache. Calls {@link Cache#reset}. + * @public + */ + +/** + * EJS template class + * @public + */ +exports.Template = Template; + +exports.clearCache = function () { + exports.cache.reset(); +}; + +function Template(text, opts) { + opts = opts || {}; + var options = {}; + this.templateText = text; + this.mode = null; + this.truncate = false; + this.currentLine = 1; + this.source = ''; + this.dependencies = []; + options.client = opts.client || false; + options.escapeFunction = opts.escape || opts.escapeFunction || utils.escapeXML; + options.compileDebug = opts.compileDebug !== false; + options.debug = !!opts.debug; + options.filename = opts.filename; + options.openDelimiter = opts.openDelimiter || exports.openDelimiter || _DEFAULT_OPEN_DELIMITER; + options.closeDelimiter = opts.closeDelimiter || exports.closeDelimiter || _DEFAULT_CLOSE_DELIMITER; + options.delimiter = opts.delimiter || exports.delimiter || _DEFAULT_DELIMITER; + options.strict = opts.strict || false; + options.context = opts.context; + options.cache = opts.cache || false; + options.rmWhitespace = opts.rmWhitespace; + options.root = opts.root; + options.outputFunctionName = opts.outputFunctionName; + options.localsName = opts.localsName || exports.localsName || _DEFAULT_LOCALS_NAME; + options.views = opts.views; + options.async = opts.async; + + if (options.strict) { + options._with = false; + } + else { + options._with = typeof opts._with != 'undefined' ? opts._with : true; + } + + this.opts = options; + + this.regex = this.createRegex(); +} + +Template.modes = { + EVAL: 'eval', + ESCAPED: 'escaped', + RAW: 'raw', + COMMENT: 'comment', + LITERAL: 'literal' +}; + +Template.prototype = { + createRegex: function () { + var str = _REGEX_STRING; + var delim = utils.escapeRegExpChars(this.opts.delimiter); + var open = utils.escapeRegExpChars(this.opts.openDelimiter); + var close = utils.escapeRegExpChars(this.opts.closeDelimiter); + str = str.replace(/%/g, delim) + .replace(/</g, open) + .replace(/>/g, close); + return new RegExp(str); + }, + + compile: function () { + var src; + var fn; + var opts = this.opts; + var prepended = ''; + var appended = ''; + var escapeFn = opts.escapeFunction; + var ctor; + + if (!this.source) { + this.generateSource(); + prepended += ' var __output = [], __append = __output.push.bind(__output);' + '\n'; + if (opts.outputFunctionName) { + prepended += ' var ' + opts.outputFunctionName + ' = __append;' + '\n'; + } + if (opts._with !== false) { + prepended += ' with (' + opts.localsName + ' || {}) {' + '\n'; + appended += ' }' + '\n'; + } + appended += ' return __output.join("");' + '\n'; + this.source = prepended + this.source + appended; + } + + if (opts.compileDebug) { + src = 'var __line = 1' + '\n' + + ' , __lines = ' + JSON.stringify(this.templateText) + '\n' + + ' , __filename = ' + (opts.filename ? + JSON.stringify(opts.filename) : 'undefined') + ';' + '\n' + + 'try {' + '\n' + + this.source + + '} catch (e) {' + '\n' + + ' rethrow(e, __lines, __filename, __line, escapeFn);' + '\n' + + '}' + '\n'; + } + else { + src = this.source; + } + + if (opts.client) { + src = 'escapeFn = escapeFn || ' + escapeFn.toString() + ';' + '\n' + src; + if (opts.compileDebug) { + src = 'rethrow = rethrow || ' + rethrow.toString() + ';' + '\n' + src; + } + } + + if (opts.strict) { + src = '"use strict";\n' + src; + } + if (opts.debug) { + console.log(src); + } + + try { + if (opts.async) { + // Have to use generated function for this, since in envs without support, + // it breaks in parsing + try { + ctor = (new Function('return (async function(){}).constructor;'))(); + } + catch(e) { + if (e instanceof SyntaxError) { + throw new Error('This environment does not support async/await'); + } + else { + throw e; + } + } + } + else { + ctor = Function; + } + fn = new ctor(opts.localsName + ', escapeFn, include, rethrow', src); + } + catch(e) { + // istanbul ignore else + if (e instanceof SyntaxError) { + if (opts.filename) { + e.message += ' in ' + opts.filename; + } + e.message += ' while compiling ejs\n\n'; + e.message += 'If the above error is not helpful, you may want to try EJS-Lint:\n'; + e.message += 'https://github.com/RyanZim/EJS-Lint'; + if (!e.async) { + e.message += '\n'; + e.message += 'Or, if you meant to create an async function, pass async: true as an option.'; + } + } + throw e; + } + + if (opts.client) { + fn.dependencies = this.dependencies; + return fn; + } + + // Return a callable function which will execute the function + // created by the source-code, with the passed data as locals + // Adds a local `include` function which allows full recursive include + var returnedFn = function (data) { + var include = function (path, includeData) { + var d = utils.shallowCopy({}, data); + if (includeData) { + d = utils.shallowCopy(d, includeData); + } + return includeFile(path, opts)(d); + }; + return fn.apply(opts.context, [data || {}, escapeFn, include, rethrow]); + }; + returnedFn.dependencies = this.dependencies; + return returnedFn; + }, + + generateSource: function () { + var opts = this.opts; + + if (opts.rmWhitespace) { + // Have to use two separate replace here as `^` and `$` operators don't + // work well with `\r` and empty lines don't work well with the `m` flag. + this.templateText = + this.templateText.replace(/[\r\n]+/g, '\n').replace(/^\s+|\s+$/gm, ''); + } + + // Slurp spaces and tabs before <%_ and after _%> + this.templateText = + this.templateText.replace(/[ \t]*<%_/gm, '<%_').replace(/_%>[ \t]*/gm, '_%>'); + + var self = this; + var matches = this.parseTemplateText(); + var d = this.opts.delimiter; + var o = this.opts.openDelimiter; + var c = this.opts.closeDelimiter; + + if (matches && matches.length) { + matches.forEach(function (line, index) { + var opening; + var closing; + var include; + var includeOpts; + var includeObj; + var includeSrc; + // If this is an opening tag, check for closing tags + // FIXME: May end up with some false positives here + // Better to store modes as k/v with openDelimiter + delimiter as key + // Then this can simply check against the map + if ( line.indexOf(o + d) === 0 // If it is a tag + && line.indexOf(o + d + d) !== 0) { // and is not escaped + closing = matches[index + 2]; + if (!(closing == d + c || closing == '-' + d + c || closing == '_' + d + c)) { + throw new Error('Could not find matching close tag for "' + line + '".'); + } + } + // HACK: backward-compat `include` preprocessor directives + if ((include = line.match(/^\s*include\s+(\S+)/))) { + opening = matches[index - 1]; + // Must be in EVAL or RAW mode + if (opening && (opening == o + d || opening == o + d + '-' || opening == o + d + '_')) { + includeOpts = utils.shallowCopy({}, self.opts); + includeObj = includeSource(include[1], includeOpts); + if (self.opts.compileDebug) { + includeSrc = + ' ; (function(){' + '\n' + + ' var __line = 1' + '\n' + + ' , __lines = ' + JSON.stringify(includeObj.template) + '\n' + + ' , __filename = ' + JSON.stringify(includeObj.filename) + ';' + '\n' + + ' try {' + '\n' + + includeObj.source + + ' } catch (e) {' + '\n' + + ' rethrow(e, __lines, __filename, __line, escapeFn);' + '\n' + + ' }' + '\n' + + ' ; }).call(this)' + '\n'; + }else{ + includeSrc = ' ; (function(){' + '\n' + includeObj.source + + ' ; }).call(this)' + '\n'; + } + self.source += includeSrc; + self.dependencies.push(exports.resolveInclude(include[1], + includeOpts.filename)); + return; + } + } + self.scanLine(line); + }); + } + + }, + + parseTemplateText: function () { + var str = this.templateText; + var pat = this.regex; + var result = pat.exec(str); + var arr = []; + var firstPos; + + while (result) { + firstPos = result.index; + + if (firstPos !== 0) { + arr.push(str.substring(0, firstPos)); + str = str.slice(firstPos); + } + + arr.push(result[0]); + str = str.slice(result[0].length); + result = pat.exec(str); + } + + if (str) { + arr.push(str); + } + + return arr; + }, + + _addOutput: function (line) { + if (this.truncate) { + // Only replace single leading linebreak in the line after + // -%> tag -- this is the single, trailing linebreak + // after the tag that the truncation mode replaces + // Handle Win / Unix / old Mac linebreaks -- do the \r\n + // combo first in the regex-or + line = line.replace(/^(?:\r\n|\r|\n)/, ''); + this.truncate = false; + } + if (!line) { + return line; + } + + // Preserve literal slashes + line = line.replace(/\\/g, '\\\\'); + + // Convert linebreaks + line = line.replace(/\n/g, '\\n'); + line = line.replace(/\r/g, '\\r'); + + // Escape double-quotes + // - this will be the delimiter during execution + line = line.replace(/"/g, '\\"'); + this.source += ' ; __append("' + line + '")' + '\n'; + }, + + scanLine: function (line) { + var self = this; + var d = this.opts.delimiter; + var o = this.opts.openDelimiter; + var c = this.opts.closeDelimiter; + var newLineCount = 0; + + newLineCount = (line.split('\n').length - 1); + + switch (line) { + case o + d: + case o + d + '_': + this.mode = Template.modes.EVAL; + break; + case o + d + '=': + this.mode = Template.modes.ESCAPED; + break; + case o + d + '-': + this.mode = Template.modes.RAW; + break; + case o + d + '#': + this.mode = Template.modes.COMMENT; + break; + case o + d + d: + this.mode = Template.modes.LITERAL; + this.source += ' ; __append("' + line.replace(o + d + d, o + d) + '")' + '\n'; + break; + case d + d + c: + this.mode = Template.modes.LITERAL; + this.source += ' ; __append("' + line.replace(d + d + c, d + c) + '")' + '\n'; + break; + case d + c: + case '-' + d + c: + case '_' + d + c: + if (this.mode == Template.modes.LITERAL) { + this._addOutput(line); + } + + this.mode = null; + this.truncate = line.indexOf('-') === 0 || line.indexOf('_') === 0; + break; + default: + // In script mode, depends on type of tag + if (this.mode) { + // If '//' is found without a line break, add a line break. + switch (this.mode) { + case Template.modes.EVAL: + case Template.modes.ESCAPED: + case Template.modes.RAW: + if (line.lastIndexOf('//') > line.lastIndexOf('\n')) { + line += '\n'; + } + } + switch (this.mode) { + // Just executing code + case Template.modes.EVAL: + this.source += ' ; ' + line + '\n'; + break; + // Exec, esc, and output + case Template.modes.ESCAPED: + this.source += ' ; __append(escapeFn(' + stripSemi(line) + '))' + '\n'; + break; + // Exec and output + case Template.modes.RAW: + this.source += ' ; __append(' + stripSemi(line) + ')' + '\n'; + break; + case Template.modes.COMMENT: + // Do nothing + break; + // Literal <%% mode, append as raw output + case Template.modes.LITERAL: + this._addOutput(line); + break; + } + } + // In string mode, just add the output + else { + this._addOutput(line); + } + } + + if (self.opts.compileDebug && newLineCount) { + this.currentLine += newLineCount; + this.source += ' ; __line = ' + this.currentLine + '\n'; + } + } +}; + +/** + * Escape characters reserved in XML. + * + * This is simply an export of {@link module:utils.escapeXML}. + * + * If `markup` is `undefined` or `null`, the empty string is returned. + * + * @param {String} markup Input string + * @return {String} Escaped string + * @public + * @func + * */ +exports.escapeXML = utils.escapeXML; + +/** + * Express.js support. + * + * This is an alias for {@link module:ejs.renderFile}, in order to support + * Express.js out-of-the-box. + * + * @func + */ + +exports.__express = exports.renderFile; + +// Add require support +/* istanbul ignore else */ +if (require.extensions) { + require.extensions['.ejs'] = function (module, flnm) { + var filename = flnm || /* istanbul ignore next */ module.filename; + var options = { + filename: filename, + client: true + }; + var template = fileLoader(filename).toString(); + var fn = exports.compile(template, options); + module._compile('module.exports = ' + fn.toString() + ';', filename); + }; +} + +/** + * Version of EJS. + * + * @readonly + * @type {String} + * @public + */ + +exports.VERSION = _VERSION_STRING; + +/** + * Name for detection of EJS. + * + * @readonly + * @type {String} + * @public + */ + +exports.name = _NAME; + +/* istanbul ignore if */ +if (typeof window != 'undefined') { + window.ejs = exports; +} diff --git a/node_modules/ejs/lib/utils.js b/node_modules/ejs/lib/utils.js new file mode 100644 index 0000000..b73e807 --- /dev/null +++ b/node_modules/ejs/lib/utils.js @@ -0,0 +1,167 @@ +/* + * EJS Embedded JavaScript templates + * Copyright 2112 Matthew Eernisse (mde@fleegix.org) + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * +*/ + +/** + * Private utility functions + * @module utils + * @private + */ + +'use strict'; + +var regExpChars = /[|\\{}()[\]^$+*?.]/g; + +/** + * Escape characters reserved in regular expressions. + * + * If `string` is `undefined` or `null`, the empty string is returned. + * + * @param {String} string Input string + * @return {String} Escaped string + * @static + * @private + */ +exports.escapeRegExpChars = function (string) { + // istanbul ignore if + if (!string) { + return ''; + } + return String(string).replace(regExpChars, '\\$&'); +}; + +var _ENCODE_HTML_RULES = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + "'": ''' +}; +var _MATCH_HTML = /[&<>'"]/g; + +function encode_char(c) { + return _ENCODE_HTML_RULES[c] || c; +} + +/** + * Stringified version of constants used by {@link module:utils.escapeXML}. + * + * It is used in the process of generating {@link ClientFunction}s. + * + * @readonly + * @type {String} + */ + +var escapeFuncStr = + 'var _ENCODE_HTML_RULES = {\n' ++ ' "&": "&"\n' ++ ' , "<": "<"\n' ++ ' , ">": ">"\n' ++ ' , \'"\': """\n' ++ ' , "\'": "'"\n' ++ ' }\n' ++ ' , _MATCH_HTML = /[&<>\'"]/g;\n' ++ 'function encode_char(c) {\n' ++ ' return _ENCODE_HTML_RULES[c] || c;\n' ++ '};\n'; + +/** + * Escape characters reserved in XML. + * + * If `markup` is `undefined` or `null`, the empty string is returned. + * + * @implements {EscapeCallback} + * @param {String} markup Input string + * @return {String} Escaped string + * @static + * @private + */ + +exports.escapeXML = function (markup) { + return markup == undefined + ? '' + : String(markup) + .replace(_MATCH_HTML, encode_char); +}; +exports.escapeXML.toString = function () { + return Function.prototype.toString.call(this) + ';\n' + escapeFuncStr; +}; + +/** + * Naive copy of properties from one object to another. + * Does not recurse into non-scalar properties + * Does not check to see if the property has a value before copying + * + * @param {Object} to Destination object + * @param {Object} from Source object + * @return {Object} Destination object + * @static + * @private + */ +exports.shallowCopy = function (to, from) { + from = from || {}; + for (var p in from) { + to[p] = from[p]; + } + return to; +}; + +/** + * Naive copy of a list of key names, from one object to another. + * Only copies property if it is actually defined + * Does not recurse into non-scalar properties + * + * @param {Object} to Destination object + * @param {Object} from Source object + * @param {Array} list List of properties to copy + * @return {Object} Destination object + * @static + * @private + */ +exports.shallowCopyFromList = function (to, from, list) { + for (var i = 0; i < list.length; i++) { + var p = list[i]; + if (typeof from[p] != 'undefined') { + to[p] = from[p]; + } + } + return to; +}; + +/** + * Simple in-process cache implementation. Does not implement limits of any + * sort. + * + * @implements Cache + * @static + * @private + */ +exports.cache = { + _data: {}, + set: function (key, val) { + this._data[key] = val; + }, + get: function (key) { + return this._data[key]; + }, + remove: function (key) { + delete this._data[key]; + }, + reset: function () { + this._data = {}; + } +}; diff --git a/node_modules/ejs/package.json b/node_modules/ejs/package.json new file mode 100644 index 0000000..2be08d0 --- /dev/null +++ b/node_modules/ejs/package.json @@ -0,0 +1,80 @@ +{ + "_from": "ejs", + "_id": "ejs@2.6.2", + "_inBundle": false, + "_integrity": "sha512-PcW2a0tyTuPHz3tWyYqtK6r1fZ3gp+3Sop8Ph+ZYN81Ob5rwmbHEzaqs10N3BEsaGTkh/ooniXK+WwszGlc2+Q==", + "_location": "/ejs", + "_phantomChildren": {}, + "_requested": { + "type": "tag", + "registry": true, + "raw": "ejs", + "name": "ejs", + "escapedName": "ejs", + "rawSpec": "", + "saveSpec": null, + "fetchSpec": "latest" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "https://registry.npmjs.org/ejs/-/ejs-2.6.2.tgz", + "_shasum": "3a32c63d1cd16d11266cd4703b14fec4e74ab4f6", + "_spec": "ejs", + "_where": "/home/josuer08/Documents/web", + "author": { + "name": "Matthew Eernisse", + "email": "mde@fleegix.org", + "url": "http://fleegix.org" + }, + "bugs": { + "url": "https://github.com/mde/ejs/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Timothy Gu", + "email": "timothygu99@gmail.com", + "url": "https://timothygu.github.io" + } + ], + "dependencies": {}, + "deprecated": false, + "description": "Embedded JavaScript templates", + "devDependencies": { + "browserify": "^13.1.1", + "eslint": "^4.14.0", + "git-directory-deploy": "^1.5.1", + "istanbul": "~0.4.3", + "jake": "^8.0.16", + "jsdoc": "^3.4.0", + "lru-cache": "^4.0.1", + "mocha": "^5.0.5", + "uglify-js": "^3.3.16" + }, + "engines": { + "node": ">=0.10.0" + }, + "homepage": "https://github.com/mde/ejs", + "keywords": [ + "template", + "engine", + "ejs" + ], + "license": "Apache-2.0", + "main": "./lib/ejs.js", + "name": "ejs", + "repository": { + "type": "git", + "url": "git://github.com/mde/ejs.git" + }, + "scripts": { + "coverage": "istanbul cover node_modules/mocha/bin/_mocha", + "devdoc": "jake doc[dev]", + "doc": "jake doc", + "lint": "eslint \"**/*.js\" Jakefile", + "test": "jake test" + }, + "version": "2.6.2" +} diff --git a/node_modules/encodeurl/HISTORY.md b/node_modules/encodeurl/HISTORY.md new file mode 100644 index 0000000..41313b2 --- /dev/null +++ b/node_modules/encodeurl/HISTORY.md @@ -0,0 +1,14 @@ +1.0.2 / 2018-01-21 +================== + + * Fix encoding `%` as last character + +1.0.1 / 2016-06-09 +================== + + * Fix encoding unpaired surrogates at start/end of string + +1.0.0 / 2016-06-08 +================== + + * Initial release diff --git a/node_modules/encodeurl/LICENSE b/node_modules/encodeurl/LICENSE new file mode 100644 index 0000000..8812229 --- /dev/null +++ b/node_modules/encodeurl/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/encodeurl/README.md b/node_modules/encodeurl/README.md new file mode 100644 index 0000000..127c5a0 --- /dev/null +++ b/node_modules/encodeurl/README.md @@ -0,0 +1,128 @@ +# encodeurl + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Encode a URL to a percent-encoded form, excluding already-encoded sequences + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install encodeurl +``` + +## API + +```js +var encodeUrl = require('encodeurl') +``` + +### encodeUrl(url) + +Encode a URL to a percent-encoded form, excluding already-encoded sequences. + +This function will take an already-encoded URL and encode all the non-URL +code points (as UTF-8 byte sequences). This function will not encode the +"%" character unless it is not part of a valid sequence (`%20` will be +left as-is, but `%foo` will be encoded as `%25foo`). + +This encode is meant to be "safe" and does not throw errors. It will try as +hard as it can to properly encode the given URL, including replacing any raw, +unpaired surrogate pairs with the Unicode replacement character prior to +encoding. + +This function is _similar_ to the intrinsic function `encodeURI`, except it +will not encode the `%` character if that is part of a valid sequence, will +not encode `[` and `]` (for IPv6 hostnames) and will replace raw, unpaired +surrogate pairs with the Unicode replacement character (instead of throwing). + +## Examples + +### Encode a URL containing user-controled data + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') + +http.createServer(function onRequest (req, res) { + // get encoded form of inbound url + var url = encodeUrl(req.url) + + // create html message + var body = '<p>Location ' + escapeHtml(url) + ' not found</p>' + + // send a 404 + res.statusCode = 404 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.end(body, 'utf-8') +}) +``` + +### Encode a URL for use in a header field + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var url = require('url') + +http.createServer(function onRequest (req, res) { + // parse inbound url + var href = url.parse(req) + + // set new host for redirect + href.host = 'localhost' + href.protocol = 'https:' + href.slashes = true + + // create location header + var location = encodeUrl(url.format(href)) + + // create html message + var body = '<p>Redirecting to new site: ' + escapeHtml(location) + '</p>' + + // send a 301 + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.setHeader('Location', location) + res.end(body, 'utf-8') +}) +``` + +## Testing + +```sh +$ npm test +$ npm run lint +``` + +## References + +- [RFC 3986: Uniform Resource Identifier (URI): Generic Syntax][rfc-3986] +- [WHATWG URL Living Standard][whatwg-url] + +[rfc-3986]: https://tools.ietf.org/html/rfc3986 +[whatwg-url]: https://url.spec.whatwg.org/ + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/encodeurl.svg +[npm-url]: https://npmjs.org/package/encodeurl +[node-version-image]: https://img.shields.io/node/v/encodeurl.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/pillarjs/encodeurl.svg +[travis-url]: https://travis-ci.org/pillarjs/encodeurl +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/encodeurl.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/encodeurl?branch=master +[downloads-image]: https://img.shields.io/npm/dm/encodeurl.svg +[downloads-url]: https://npmjs.org/package/encodeurl diff --git a/node_modules/encodeurl/index.js b/node_modules/encodeurl/index.js new file mode 100644 index 0000000..fc4906c --- /dev/null +++ b/node_modules/encodeurl/index.js @@ -0,0 +1,60 @@ +/*! + * encodeurl + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = encodeUrl + +/** + * RegExp to match non-URL code points, *after* encoding (i.e. not including "%") + * and including invalid escape sequences. + * @private + */ + +var ENCODE_CHARS_REGEXP = /(?:[^\x21\x25\x26-\x3B\x3D\x3F-\x5B\x5D\x5F\x61-\x7A\x7E]|%(?:[^0-9A-Fa-f]|[0-9A-Fa-f][^0-9A-Fa-f]|$))+/g + +/** + * RegExp to match unmatched surrogate pair. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REGEXP = /(^|[^\uD800-\uDBFF])[\uDC00-\uDFFF]|[\uD800-\uDBFF]([^\uDC00-\uDFFF]|$)/g + +/** + * String to replace unmatched surrogate pair with. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REPLACE = '$1\uFFFD$2' + +/** + * Encode a URL to a percent-encoded form, excluding already-encoded sequences. + * + * This function will take an already-encoded URL and encode all the non-URL + * code points. This function will not encode the "%" character unless it is + * not part of a valid sequence (`%20` will be left as-is, but `%foo` will + * be encoded as `%25foo`). + * + * This encode is meant to be "safe" and does not throw errors. It will try as + * hard as it can to properly encode the given URL, including replacing any raw, + * unpaired surrogate pairs with the Unicode replacement character prior to + * encoding. + * + * @param {string} url + * @return {string} + * @public + */ + +function encodeUrl (url) { + return String(url) + .replace(UNMATCHED_SURROGATE_PAIR_REGEXP, UNMATCHED_SURROGATE_PAIR_REPLACE) + .replace(ENCODE_CHARS_REGEXP, encodeURI) +} diff --git a/node_modules/encodeurl/package.json b/node_modules/encodeurl/package.json new file mode 100644 index 0000000..b2efd54 --- /dev/null +++ b/node_modules/encodeurl/package.json @@ -0,0 +1,78 @@ +{ + "_from": "encodeurl@~1.0.2", + "_id": "encodeurl@1.0.2", + "_inBundle": false, + "_integrity": "sha1-rT/0yG7C0CkyL1oCw6mmBslbP1k=", + "_location": "/encodeurl", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "encodeurl@~1.0.2", + "name": "encodeurl", + "escapedName": "encodeurl", + "rawSpec": "~1.0.2", + "saveSpec": null, + "fetchSpec": "~1.0.2" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/send", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "_shasum": "ad3ff4c86ec2d029322f5a02c3a9a606c95b3f59", + "_spec": "encodeurl@~1.0.2", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "bugs": { + "url": "https://github.com/pillarjs/encodeurl/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "Encode a URL to a percent-encoded form, excluding already-encoded sequences", + "devDependencies": { + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.8.0", + "eslint-plugin-node": "5.2.1", + "eslint-plugin-promise": "3.6.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "2.5.3" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/pillarjs/encodeurl#readme", + "keywords": [ + "encode", + "encodeurl", + "url" + ], + "license": "MIT", + "name": "encodeurl", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/encodeurl.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.0.2" +} diff --git a/node_modules/escape-html/LICENSE b/node_modules/escape-html/LICENSE new file mode 100644 index 0000000..2e70de9 --- /dev/null +++ b/node_modules/escape-html/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2013 TJ Holowaychuk +Copyright (c) 2015 Andreas Lubbe +Copyright (c) 2015 Tiancheng "Timothy" Gu + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/escape-html/Readme.md b/node_modules/escape-html/Readme.md new file mode 100644 index 0000000..653d9ea --- /dev/null +++ b/node_modules/escape-html/Readme.md @@ -0,0 +1,43 @@ + +# escape-html + + Escape string for use in HTML + +## Example + +```js +var escape = require('escape-html'); +var html = escape('foo & bar'); +// -> foo & bar +``` + +## Benchmark + +``` +$ npm run-script bench + +> escape-html@1.0.3 bench nodejs-escape-html +> node benchmark/index.js + + + http_parser@1.0 + node@0.10.33 + v8@3.14.5.9 + ares@1.9.0-DEV + uv@0.10.29 + zlib@1.2.3 + modules@11 + openssl@1.0.1j + + 1 test completed. + 2 tests completed. + 3 tests completed. + + no special characters x 19,435,271 ops/sec ±0.85% (187 runs sampled) + single special character x 6,132,421 ops/sec ±0.67% (194 runs sampled) + many special characters x 3,175,826 ops/sec ±0.65% (193 runs sampled) +``` + +## License + + MIT \ No newline at end of file diff --git a/node_modules/escape-html/index.js b/node_modules/escape-html/index.js new file mode 100644 index 0000000..bf9e226 --- /dev/null +++ b/node_modules/escape-html/index.js @@ -0,0 +1,78 @@ +/*! + * escape-html + * Copyright(c) 2012-2013 TJ Holowaychuk + * Copyright(c) 2015 Andreas Lubbe + * Copyright(c) 2015 Tiancheng "Timothy" Gu + * MIT Licensed + */ + +'use strict'; + +/** + * Module variables. + * @private + */ + +var matchHtmlRegExp = /["'&<>]/; + +/** + * Module exports. + * @public + */ + +module.exports = escapeHtml; + +/** + * Escape special characters in the given string of html. + * + * @param {string} string The string to escape for inserting into HTML + * @return {string} + * @public + */ + +function escapeHtml(string) { + var str = '' + string; + var match = matchHtmlRegExp.exec(str); + + if (!match) { + return str; + } + + var escape; + var html = ''; + var index = 0; + var lastIndex = 0; + + for (index = match.index; index < str.length; index++) { + switch (str.charCodeAt(index)) { + case 34: // " + escape = '"'; + break; + case 38: // & + escape = '&'; + break; + case 39: // ' + escape = '''; + break; + case 60: // < + escape = '<'; + break; + case 62: // > + escape = '>'; + break; + default: + continue; + } + + if (lastIndex !== index) { + html += str.substring(lastIndex, index); + } + + lastIndex = index + 1; + html += escape; + } + + return lastIndex !== index + ? html + str.substring(lastIndex, index) + : html; +} diff --git a/node_modules/escape-html/package.json b/node_modules/escape-html/package.json new file mode 100644 index 0000000..dc1fa2a --- /dev/null +++ b/node_modules/escape-html/package.json @@ -0,0 +1,59 @@ +{ + "_from": "escape-html@~1.0.3", + "_id": "escape-html@1.0.3", + "_inBundle": false, + "_integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=", + "_location": "/escape-html", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "escape-html@~1.0.3", + "name": "escape-html", + "escapedName": "escape-html", + "rawSpec": "~1.0.3", + "saveSpec": null, + "fetchSpec": "~1.0.3" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/send", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "_shasum": "0258eae4d3d0c0974de1c169188ef0051d1d1988", + "_spec": "escape-html@~1.0.3", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "bugs": { + "url": "https://github.com/component/escape-html/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Escape string for use in HTML", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "1.0.0" + }, + "files": [ + "LICENSE", + "Readme.md", + "index.js" + ], + "homepage": "https://github.com/component/escape-html#readme", + "keywords": [ + "escape", + "html", + "utility" + ], + "license": "MIT", + "name": "escape-html", + "repository": { + "type": "git", + "url": "git+https://github.com/component/escape-html.git" + }, + "scripts": { + "bench": "node benchmark/index.js" + }, + "version": "1.0.3" +} diff --git a/node_modules/etag/HISTORY.md b/node_modules/etag/HISTORY.md new file mode 100644 index 0000000..222b293 --- /dev/null +++ b/node_modules/etag/HISTORY.md @@ -0,0 +1,83 @@ +1.8.1 / 2017-09-12 +================== + + * perf: replace regular expression with substring + +1.8.0 / 2017-02-18 +================== + + * Use SHA1 instead of MD5 for ETag hashing + - Improves performance for larger entities + - Works with FIPS 140-2 OpenSSL configuration + +1.7.0 / 2015-06-08 +================== + + * Always include entity length in ETags for hash length extensions + * Generate non-Stats ETags using MD5 only (no longer CRC32) + * Improve stat performance by removing hashing + * Remove base64 padding in ETags to shorten + * Use MD5 instead of MD4 in weak ETags over 1KB + +1.6.0 / 2015-05-10 +================== + + * Improve support for JXcore + * Remove requirement of `atime` in the stats object + * Support "fake" stats objects in environments without `fs` + +1.5.1 / 2014-11-19 +================== + + * deps: crc@3.2.1 + - Minor fixes + +1.5.0 / 2014-10-14 +================== + + * Improve string performance + * Slightly improve speed for weak ETags over 1KB + +1.4.0 / 2014-09-21 +================== + + * Support "fake" stats objects + * Support Node.js 0.6 + +1.3.1 / 2014-09-14 +================== + + * Use the (new and improved) `crc` for crc32 + +1.3.0 / 2014-08-29 +================== + + * Default strings to strong ETags + * Improve speed for weak ETags over 1KB + +1.2.1 / 2014-08-29 +================== + + * Use the (much faster) `buffer-crc32` for crc32 + +1.2.0 / 2014-08-24 +================== + + * Add support for file stat objects + +1.1.0 / 2014-08-24 +================== + + * Add fast-path for empty entity + * Add weak ETag generation + * Shrink size of generated ETags + +1.0.1 / 2014-08-24 +================== + + * Fix behavior of string containing Unicode + +1.0.0 / 2014-05-18 +================== + + * Initial release diff --git a/node_modules/etag/LICENSE b/node_modules/etag/LICENSE new file mode 100644 index 0000000..cab251c --- /dev/null +++ b/node_modules/etag/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/etag/README.md b/node_modules/etag/README.md new file mode 100644 index 0000000..09c2169 --- /dev/null +++ b/node_modules/etag/README.md @@ -0,0 +1,159 @@ +# etag + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create simple HTTP ETags + +This module generates HTTP ETags (as defined in RFC 7232) for use in +HTTP responses. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install etag +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var etag = require('etag') +``` + +### etag(entity, [options]) + +Generate a strong ETag for the given entity. This should be the complete +body of the entity. Strings, `Buffer`s, and `fs.Stats` are accepted. By +default, a strong ETag is generated except for `fs.Stats`, which will +generate a weak ETag (this can be overwritten by `options.weak`). + +<!-- eslint-disable no-undef --> + +```js +res.setHeader('ETag', etag(body)) +``` + +#### Options + +`etag` accepts these properties in the options object. + +##### weak + +Specifies if the generated ETag will include the weak validator mark (that +is, the leading `W/`). The actual entity tag is the same. The default value +is `false`, unless the `entity` is `fs.Stats`, in which case it is `true`. + +## Testing + +```sh +$ npm test +``` + +## Benchmark + +```bash +$ npm run-script bench + +> etag@1.8.1 bench nodejs-etag +> node benchmark/index.js + + http_parser@2.7.0 + node@6.11.1 + v8@5.1.281.103 + uv@1.11.0 + zlib@1.2.11 + ares@1.10.1-DEV + icu@58.2 + modules@48 + openssl@1.0.2k + +> node benchmark/body0-100b.js + + 100B body + + 4 tests completed. + + buffer - strong x 258,647 ops/sec ±1.07% (180 runs sampled) + buffer - weak x 263,812 ops/sec ±0.61% (184 runs sampled) + string - strong x 259,955 ops/sec ±1.19% (185 runs sampled) + string - weak x 264,356 ops/sec ±1.09% (184 runs sampled) + +> node benchmark/body1-1kb.js + + 1KB body + + 4 tests completed. + + buffer - strong x 189,018 ops/sec ±1.12% (182 runs sampled) + buffer - weak x 190,586 ops/sec ±0.81% (186 runs sampled) + string - strong x 144,272 ops/sec ±0.96% (188 runs sampled) + string - weak x 145,380 ops/sec ±1.43% (187 runs sampled) + +> node benchmark/body2-5kb.js + + 5KB body + + 4 tests completed. + + buffer - strong x 92,435 ops/sec ±0.42% (188 runs sampled) + buffer - weak x 92,373 ops/sec ±0.58% (189 runs sampled) + string - strong x 48,850 ops/sec ±0.56% (186 runs sampled) + string - weak x 49,380 ops/sec ±0.56% (190 runs sampled) + +> node benchmark/body3-10kb.js + + 10KB body + + 4 tests completed. + + buffer - strong x 55,989 ops/sec ±0.93% (188 runs sampled) + buffer - weak x 56,148 ops/sec ±0.55% (190 runs sampled) + string - strong x 27,345 ops/sec ±0.43% (188 runs sampled) + string - weak x 27,496 ops/sec ±0.45% (190 runs sampled) + +> node benchmark/body4-100kb.js + + 100KB body + + 4 tests completed. + + buffer - strong x 7,083 ops/sec ±0.22% (190 runs sampled) + buffer - weak x 7,115 ops/sec ±0.26% (191 runs sampled) + string - strong x 3,068 ops/sec ±0.34% (190 runs sampled) + string - weak x 3,096 ops/sec ±0.35% (190 runs sampled) + +> node benchmark/stats.js + + stat + + 4 tests completed. + + real - strong x 871,642 ops/sec ±0.34% (189 runs sampled) + real - weak x 867,613 ops/sec ±0.39% (190 runs sampled) + fake - strong x 401,051 ops/sec ±0.40% (189 runs sampled) + fake - weak x 400,100 ops/sec ±0.47% (188 runs sampled) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/etag.svg +[npm-url]: https://npmjs.org/package/etag +[node-version-image]: https://img.shields.io/node/v/etag.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/etag/master.svg +[travis-url]: https://travis-ci.org/jshttp/etag +[coveralls-image]: https://img.shields.io/coveralls/jshttp/etag/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/etag?branch=master +[downloads-image]: https://img.shields.io/npm/dm/etag.svg +[downloads-url]: https://npmjs.org/package/etag diff --git a/node_modules/etag/index.js b/node_modules/etag/index.js new file mode 100644 index 0000000..2a585c9 --- /dev/null +++ b/node_modules/etag/index.js @@ -0,0 +1,131 @@ +/*! + * etag + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = etag + +/** + * Module dependencies. + * @private + */ + +var crypto = require('crypto') +var Stats = require('fs').Stats + +/** + * Module variables. + * @private + */ + +var toString = Object.prototype.toString + +/** + * Generate an entity tag. + * + * @param {Buffer|string} entity + * @return {string} + * @private + */ + +function entitytag (entity) { + if (entity.length === 0) { + // fast-path empty + return '"0-2jmj7l5rSw0yVb/vlWAYkK/YBwk"' + } + + // compute hash of entity + var hash = crypto + .createHash('sha1') + .update(entity, 'utf8') + .digest('base64') + .substring(0, 27) + + // compute length of entity + var len = typeof entity === 'string' + ? Buffer.byteLength(entity, 'utf8') + : entity.length + + return '"' + len.toString(16) + '-' + hash + '"' +} + +/** + * Create a simple ETag. + * + * @param {string|Buffer|Stats} entity + * @param {object} [options] + * @param {boolean} [options.weak] + * @return {String} + * @public + */ + +function etag (entity, options) { + if (entity == null) { + throw new TypeError('argument entity is required') + } + + // support fs.Stats object + var isStats = isstats(entity) + var weak = options && typeof options.weak === 'boolean' + ? options.weak + : isStats + + // validate argument + if (!isStats && typeof entity !== 'string' && !Buffer.isBuffer(entity)) { + throw new TypeError('argument entity must be string, Buffer, or fs.Stats') + } + + // generate entity tag + var tag = isStats + ? stattag(entity) + : entitytag(entity) + + return weak + ? 'W/' + tag + : tag +} + +/** + * Determine if object is a Stats object. + * + * @param {object} obj + * @return {boolean} + * @api private + */ + +function isstats (obj) { + // genuine fs.Stats + if (typeof Stats === 'function' && obj instanceof Stats) { + return true + } + + // quack quack + return obj && typeof obj === 'object' && + 'ctime' in obj && toString.call(obj.ctime) === '[object Date]' && + 'mtime' in obj && toString.call(obj.mtime) === '[object Date]' && + 'ino' in obj && typeof obj.ino === 'number' && + 'size' in obj && typeof obj.size === 'number' +} + +/** + * Generate a tag for a stat. + * + * @param {object} stat + * @return {string} + * @private + */ + +function stattag (stat) { + var mtime = stat.mtime.getTime().toString(16) + var size = stat.size.toString(16) + + return '"' + size + '-' + mtime + '"' +} diff --git a/node_modules/etag/package.json b/node_modules/etag/package.json new file mode 100644 index 0000000..5555f0d --- /dev/null +++ b/node_modules/etag/package.json @@ -0,0 +1,86 @@ +{ + "_from": "etag@~1.8.1", + "_id": "etag@1.8.1", + "_inBundle": false, + "_integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=", + "_location": "/etag", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "etag@~1.8.1", + "name": "etag", + "escapedName": "etag", + "rawSpec": "~1.8.1", + "saveSpec": null, + "fetchSpec": "~1.8.1" + }, + "_requiredBy": [ + "/express", + "/send" + ], + "_resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "_shasum": "41ae2eeb65efa62268aebfea83ac7d79299b0887", + "_spec": "etag@~1.8.1", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/etag/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "David Björklund", + "email": "david.bjorklund@gmail.com" + } + ], + "deprecated": false, + "description": "Create simple HTTP ETags", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.7.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-node": "5.1.1", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5", + "safe-buffer": "5.1.1", + "seedrandom": "2.4.3" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/etag#readme", + "keywords": [ + "etag", + "http", + "res" + ], + "license": "MIT", + "name": "etag", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/etag.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.8.1" +} diff --git a/node_modules/express/History.md b/node_modules/express/History.md new file mode 100644 index 0000000..6e62a6d --- /dev/null +++ b/node_modules/express/History.md @@ -0,0 +1,3477 @@ +4.17.1 / 2019-05-25 +=================== + + * Revert "Improve error message for `null`/`undefined` to `res.status`" + +4.17.0 / 2019-05-16 +=================== + + * Add `express.raw` to parse bodies into `Buffer` + * Add `express.text` to parse bodies into string + * Improve error message for non-strings to `res.sendFile` + * Improve error message for `null`/`undefined` to `res.status` + * Support multiple hosts in `X-Forwarded-Host` + * deps: accepts@~1.3.7 + * deps: body-parser@1.19.0 + - Add encoding MIK + - Add petabyte (`pb`) support + - Fix parsing array brackets after index + - deps: bytes@3.1.0 + - deps: http-errors@1.7.2 + - deps: iconv-lite@0.4.24 + - deps: qs@6.7.0 + - deps: raw-body@2.4.0 + - deps: type-is@~1.6.17 + * deps: content-disposition@0.5.3 + * deps: cookie@0.4.0 + - Add `SameSite=None` support + * deps: finalhandler@~1.1.2 + - Set stricter `Content-Security-Policy` header + - deps: parseurl@~1.3.3 + - deps: statuses@~1.5.0 + * deps: parseurl@~1.3.3 + * deps: proxy-addr@~2.0.5 + - deps: ipaddr.js@1.9.0 + * deps: qs@6.7.0 + - Fix parsing array brackets after index + * deps: range-parser@~1.2.1 + * deps: send@0.17.1 + - Set stricter CSP header in redirect & error responses + - deps: http-errors@~1.7.2 + - deps: mime@1.6.0 + - deps: ms@2.1.1 + - deps: range-parser@~1.2.1 + - deps: statuses@~1.5.0 + - perf: remove redundant `path.normalize` call + * deps: serve-static@1.14.1 + - Set stricter CSP header in redirect response + - deps: parseurl@~1.3.3 + - deps: send@0.17.1 + * deps: setprototypeof@1.1.1 + * deps: statuses@~1.5.0 + - Add `103 Early Hints` + * deps: type-is@~1.6.18 + - deps: mime-types@~2.1.24 + - perf: prevent internal `throw` on invalid type + +4.16.4 / 2018-10-10 +=================== + + * Fix issue where `"Request aborted"` may be logged in `res.sendfile` + * Fix JSDoc for `Router` constructor + * deps: body-parser@1.18.3 + - Fix deprecation warnings on Node.js 10+ + - Fix stack trace for strict json parse error + - deps: depd@~1.1.2 + - deps: http-errors@~1.6.3 + - deps: iconv-lite@0.4.23 + - deps: qs@6.5.2 + - deps: raw-body@2.3.3 + - deps: type-is@~1.6.16 + * deps: proxy-addr@~2.0.4 + - deps: ipaddr.js@1.8.0 + * deps: qs@6.5.2 + * deps: safe-buffer@5.1.2 + +4.16.3 / 2018-03-12 +=================== + + * deps: accepts@~1.3.5 + - deps: mime-types@~2.1.18 + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: encodeurl@~1.0.2 + - Fix encoding `%` as last character + * deps: finalhandler@1.1.1 + - Fix 404 output for bad / missing pathnames + - deps: encodeurl@~1.0.2 + - deps: statuses@~1.4.0 + * deps: proxy-addr@~2.0.3 + - deps: ipaddr.js@1.6.0 + * deps: send@0.16.2 + - Fix incorrect end tag in default error & redirects + - deps: depd@~1.1.2 + - deps: encodeurl@~1.0.2 + - deps: statuses@~1.4.0 + * deps: serve-static@1.13.2 + - Fix incorrect end tag in redirects + - deps: encodeurl@~1.0.2 + - deps: send@0.16.2 + * deps: statuses@~1.4.0 + * deps: type-is@~1.6.16 + - deps: mime-types@~2.1.18 + +4.16.2 / 2017-10-09 +=================== + + * Fix `TypeError` in `res.send` when given `Buffer` and `ETag` header set + * perf: skip parsing of entire `X-Forwarded-Proto` header + +4.16.1 / 2017-09-29 +=================== + + * deps: send@0.16.1 + * deps: serve-static@1.13.1 + - Fix regression when `root` is incorrectly set to a file + - deps: send@0.16.1 + +4.16.0 / 2017-09-28 +=================== + + * Add `"json escape"` setting for `res.json` and `res.jsonp` + * Add `express.json` and `express.urlencoded` to parse bodies + * Add `options` argument to `res.download` + * Improve error message when autoloading invalid view engine + * Improve error messages when non-function provided as middleware + * Skip `Buffer` encoding when not generating ETag for small response + * Use `safe-buffer` for improved Buffer API + * deps: accepts@~1.3.4 + - deps: mime-types@~2.1.16 + * deps: content-type@~1.0.4 + - perf: remove argument reassignment + - perf: skip parameter parsing when no parameters + * deps: etag@~1.8.1 + - perf: replace regular expression with substring + * deps: finalhandler@1.1.0 + - Use `res.headersSent` when available + * deps: parseurl@~1.3.2 + - perf: reduce overhead for full URLs + - perf: unroll the "fast-path" `RegExp` + * deps: proxy-addr@~2.0.2 + - Fix trimming leading / trailing OWS in `X-Forwarded-For` + - deps: forwarded@~0.1.2 + - deps: ipaddr.js@1.5.2 + - perf: reduce overhead when no `X-Forwarded-For` header + * deps: qs@6.5.1 + - Fix parsing & compacting very deep objects + * deps: send@0.16.0 + - Add 70 new types for file extensions + - Add `immutable` option + - Fix missing `</html>` in default error & redirects + - Set charset as "UTF-8" for .js and .json + - Use instance methods on steam to check for listeners + - deps: mime@1.4.1 + - perf: improve path validation speed + * deps: serve-static@1.13.0 + - Add 70 new types for file extensions + - Add `immutable` option + - Set charset as "UTF-8" for .js and .json + - deps: send@0.16.0 + * deps: setprototypeof@1.1.0 + * deps: utils-merge@1.0.1 + * deps: vary@~1.1.2 + - perf: improve header token parsing speed + * perf: re-use options object when generating ETags + * perf: remove dead `.charset` set in `res.jsonp` + +4.15.5 / 2017-09-24 +=================== + + * deps: debug@2.6.9 + * deps: finalhandler@~1.0.6 + - deps: debug@2.6.9 + - deps: parseurl@~1.3.2 + * deps: fresh@0.5.2 + - Fix handling of modified headers with invalid dates + - perf: improve ETag match loop + - perf: improve `If-None-Match` token parsing + * deps: send@0.15.6 + - Fix handling of modified headers with invalid dates + - deps: debug@2.6.9 + - deps: etag@~1.8.1 + - deps: fresh@0.5.2 + - perf: improve `If-Match` token parsing + * deps: serve-static@1.12.6 + - deps: parseurl@~1.3.2 + - deps: send@0.15.6 + - perf: improve slash collapsing + +4.15.4 / 2017-08-06 +=================== + + * deps: debug@2.6.8 + * deps: depd@~1.1.1 + - Remove unnecessary `Buffer` loading + * deps: finalhandler@~1.0.4 + - deps: debug@2.6.8 + * deps: proxy-addr@~1.1.5 + - Fix array argument being altered + - deps: ipaddr.js@1.4.0 + * deps: qs@6.5.0 + * deps: send@0.15.4 + - deps: debug@2.6.8 + - deps: depd@~1.1.1 + - deps: http-errors@~1.6.2 + * deps: serve-static@1.12.4 + - deps: send@0.15.4 + +4.15.3 / 2017-05-16 +=================== + + * Fix error when `res.set` cannot add charset to `Content-Type` + * deps: debug@2.6.7 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@2.0.0 + * deps: finalhandler@~1.0.3 + - Fix missing `</html>` in HTML document + - deps: debug@2.6.7 + * deps: proxy-addr@~1.1.4 + - deps: ipaddr.js@1.3.0 + * deps: send@0.15.3 + - deps: debug@2.6.7 + - deps: ms@2.0.0 + * deps: serve-static@1.12.3 + - deps: send@0.15.3 + * deps: type-is@~1.6.15 + - deps: mime-types@~2.1.15 + * deps: vary@~1.1.1 + - perf: hoist regular expression + +4.15.2 / 2017-03-06 +=================== + + * deps: qs@6.4.0 + - Fix regression parsing keys starting with `[` + +4.15.1 / 2017-03-05 +=================== + + * deps: send@0.15.1 + - Fix issue when `Date.parse` does not return `NaN` on invalid date + - Fix strict violation in broken environments + * deps: serve-static@1.12.1 + - Fix issue when `Date.parse` does not return `NaN` on invalid date + - deps: send@0.15.1 + +4.15.0 / 2017-03-01 +=================== + + * Add debug message when loading view engine + * Add `next("router")` to exit from router + * Fix case where `router.use` skipped requests routes did not + * Remove usage of `res._headers` private field + - Improves compatibility with Node.js 8 nightly + * Skip routing when `req.url` is not set + * Use `%o` in path debug to tell types apart + * Use `Object.create` to setup request & response prototypes + * Use `setprototypeof` module to replace `__proto__` setting + * Use `statuses` instead of `http` module for status messages + * deps: debug@2.6.1 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable set to `3` or higher + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: etag@~1.8.0 + - Use SHA1 instead of MD5 for ETag hashing + - Works with FIPS 140-2 OpenSSL configuration + * deps: finalhandler@~1.0.0 + - Fix exception when `err` cannot be converted to a string + - Fully URL-encode the pathname in the 404 + - Only include the pathname in the 404 message + - Send complete HTML document + - Set `Content-Security-Policy: default-src 'self'` header + - deps: debug@2.6.1 + * deps: fresh@0.5.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - perf: delay reading header values until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove duplicate conditional + - perf: remove unnecessary boolean coercions + - perf: skip checking modified time if ETag check failed + - perf: skip parsing `If-None-Match` when no `ETag` header + - perf: use `Date.parse` instead of `new Date` + * deps: qs@6.3.1 + - Fix array parsing from skipping empty values + - Fix compacting nested arrays + * deps: send@0.15.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - Remove usage of `res._headers` private field + - Support `If-Match` and `If-Unmodified-Since` headers + - Use `res.getHeaderNames()` when available + - Use `res.headersSent` when available + - deps: debug@2.6.1 + - deps: etag@~1.8.0 + - deps: fresh@0.5.0 + - deps: http-errors@~1.6.1 + * deps: serve-static@1.12.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - Remove usage of `res._headers` private field + - Send complete HTML document in redirect response + - Set default CSP header in redirect response + - Support `If-Match` and `If-Unmodified-Since` headers + - Use `res.getHeaderNames()` when available + - Use `res.headersSent` when available + - deps: send@0.15.0 + * perf: add fast match path for `*` route + * perf: improve `req.ips` performance + +4.14.1 / 2017-01-28 +=================== + + * deps: content-disposition@0.5.2 + * deps: finalhandler@0.5.1 + - Fix exception when `err.headers` is not an object + - deps: statuses@~1.3.1 + - perf: hoist regular expressions + - perf: remove duplicate validation path + * deps: proxy-addr@~1.1.3 + - deps: ipaddr.js@1.2.0 + * deps: send@0.14.2 + - deps: http-errors@~1.5.1 + - deps: ms@0.7.2 + - deps: statuses@~1.3.1 + * deps: serve-static@~1.11.2 + - deps: send@0.14.2 + * deps: type-is@~1.6.14 + - deps: mime-types@~2.1.13 + +4.14.0 / 2016-06-16 +=================== + + * Add `acceptRanges` option to `res.sendFile`/`res.sendfile` + * Add `cacheControl` option to `res.sendFile`/`res.sendfile` + * Add `options` argument to `req.range` + - Includes the `combine` option + * Encode URL in `res.location`/`res.redirect` if not already encoded + * Fix some redirect handling in `res.sendFile`/`res.sendfile` + * Fix Windows absolute path check using forward slashes + * Improve error with invalid arguments to `req.get()` + * Improve performance for `res.json`/`res.jsonp` in most cases + * Improve `Range` header handling in `res.sendFile`/`res.sendfile` + * deps: accepts@~1.3.3 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Many performance improvements + - deps: mime-types@~2.1.11 + - deps: negotiator@0.6.1 + * deps: content-type@~1.0.2 + - perf: enable strict mode + * deps: cookie@0.3.1 + - Add `sameSite` option + - Fix cookie `Max-Age` to never be a floating point number + - Improve error message when `encode` is not a function + - Improve error message when `expires` is not a `Date` + - Throw better error for invalid argument to parse + - Throw on invalid values provided to `serialize` + - perf: enable strict mode + - perf: hoist regular expression + - perf: use for loop in parse + - perf: use string concatenation for serialization + * deps: finalhandler@0.5.0 + - Change invalid or non-numeric status code to 500 + - Overwrite status message to match set status code + - Prefer `err.statusCode` if `err.status` is invalid + - Set response headers from `err.headers` object + - Use `statuses` instead of `http` module for status messages + * deps: proxy-addr@~1.1.2 + - Fix accepting various invalid netmasks + - Fix IPv6-mapped IPv4 validation edge cases + - IPv4 netmasks must be contiguous + - IPv6 addresses cannot be used as a netmask + - deps: ipaddr.js@1.1.1 + * deps: qs@6.2.0 + - Add `decoder` option in `parse` function + * deps: range-parser@~1.2.0 + - Add `combine` option to combine overlapping ranges + - Fix incorrectly returning -1 when there is at least one valid range + - perf: remove internal function + * deps: send@0.14.1 + - Add `acceptRanges` option + - Add `cacheControl` option + - Attempt to combine multiple ranges into single range + - Correctly inherit from `Stream` class + - Fix `Content-Range` header in 416 responses when using `start`/`end` options + - Fix `Content-Range` header missing from default 416 responses + - Fix redirect error when `path` contains raw non-URL characters + - Fix redirect when `path` starts with multiple forward slashes + - Ignore non-byte `Range` headers + - deps: http-errors@~1.5.0 + - deps: range-parser@~1.2.0 + - deps: statuses@~1.3.0 + - perf: remove argument reassignment + * deps: serve-static@~1.11.1 + - Add `acceptRanges` option + - Add `cacheControl` option + - Attempt to combine multiple ranges into single range + - Fix redirect error when `req.url` contains raw non-URL characters + - Ignore non-byte `Range` headers + - Use status code 301 for redirects + - deps: send@0.14.1 + * deps: type-is@~1.6.13 + - Fix type error when given invalid type to match against + - deps: mime-types@~2.1.11 + * deps: vary@~1.1.0 + - Only accept valid field names in the `field` argument + * perf: use strict equality when possible + +4.13.4 / 2016-01-21 +=================== + + * deps: content-disposition@0.5.1 + - perf: enable strict mode + * deps: cookie@0.1.5 + - Throw on invalid values provided to `serialize` + * deps: depd@~1.1.0 + - Support web browser loading + - perf: enable strict mode + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + * deps: finalhandler@0.4.1 + - deps: escape-html@~1.0.3 + * deps: merge-descriptors@1.0.1 + - perf: enable strict mode + * deps: methods@~1.1.2 + - perf: enable strict mode + * deps: parseurl@~1.3.1 + - perf: enable strict mode + * deps: proxy-addr@~1.0.10 + - deps: ipaddr.js@1.0.5 + - perf: enable strict mode + * deps: range-parser@~1.0.3 + - perf: enable strict mode + * deps: send@0.13.1 + - deps: depd@~1.1.0 + - deps: destroy@~1.0.4 + - deps: escape-html@~1.0.3 + - deps: range-parser@~1.0.3 + * deps: serve-static@~1.10.2 + - deps: escape-html@~1.0.3 + - deps: parseurl@~1.3.0 + - deps: send@0.13.1 + +4.13.3 / 2015-08-02 +=================== + + * Fix infinite loop condition using `mergeParams: true` + * Fix inner numeric indices incorrectly altering parent `req.params` + +4.13.2 / 2015-07-31 +=================== + + * deps: accepts@~1.2.12 + - deps: mime-types@~2.1.4 + * deps: array-flatten@1.1.1 + - perf: enable strict mode + * deps: path-to-regexp@0.1.7 + - Fix regression with escaped round brackets and matching groups + * deps: type-is@~1.6.6 + - deps: mime-types@~2.1.4 + +4.13.1 / 2015-07-05 +=================== + + * deps: accepts@~1.2.10 + - deps: mime-types@~2.1.2 + * deps: qs@4.0.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix various parsing edge cases + * deps: type-is@~1.6.4 + - deps: mime-types@~2.1.2 + - perf: enable strict mode + - perf: remove argument reassignment + +4.13.0 / 2015-06-20 +=================== + + * Add settings to debug output + * Fix `res.format` error when only `default` provided + * Fix issue where `next('route')` in `app.param` would incorrectly skip values + * Fix hiding platform issues with `decodeURIComponent` + - Only `URIError`s are a 400 + * Fix using `*` before params in routes + * Fix using capture groups before params in routes + * Simplify `res.cookie` to call `res.append` + * Use `array-flatten` module for flattening arrays + * deps: accepts@~1.2.9 + - deps: mime-types@~2.1.1 + - perf: avoid argument reassignment & argument slice + - perf: avoid negotiator recursive construction + - perf: enable strict mode + - perf: remove unnecessary bitwise operator + * deps: cookie@0.1.3 + - perf: deduce the scope of try-catch deopt + - perf: remove argument reassignments + * deps: escape-html@1.0.2 + * deps: etag@~1.7.0 + - Always include entity length in ETags for hash length extensions + - Generate non-Stats ETags using MD5 only (no longer CRC32) + - Improve stat performance by removing hashing + - Improve support for JXcore + - Remove base64 padding in ETags to shorten + - Support "fake" stats objects in environments without fs + - Use MD5 instead of MD4 in weak ETags over 1KB + * deps: finalhandler@0.4.0 + - Fix a false-positive when unpiping in Node.js 0.8 + - Support `statusCode` property on `Error` objects + - Use `unpipe` module for unpiping requests + - deps: escape-html@1.0.2 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove argument reassignment + * deps: fresh@0.3.0 + - Add weak `ETag` matching support + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * deps: path-to-regexp@0.1.6 + * deps: send@0.13.0 + - Allow Node.js HTTP server to set `Date` response header + - Fix incorrectly removing `Content-Location` on 304 response + - Improve the default redirect response headers + - Send appropriate headers on default error response + - Use `http-errors` for standard emitted errors + - Use `statuses` instead of `http` module for status messages + - deps: escape-html@1.0.2 + - deps: etag@~1.7.0 + - deps: fresh@0.3.0 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove unnecessary array allocations + * deps: serve-static@~1.10.0 + - Add `fallthrough` option + - Fix reading options from options prototype + - Improve the default redirect response headers + - Malformed URLs now `next()` instead of 400 + - deps: escape-html@1.0.2 + - deps: send@0.13.0 + - perf: enable strict mode + - perf: remove argument reassignment + * deps: type-is@~1.6.3 + - deps: mime-types@~2.1.1 + - perf: reduce try block size + - perf: remove bitwise operations + * perf: enable strict mode + * perf: isolate `app.render` try block + * perf: remove argument reassignments in application + * perf: remove argument reassignments in request prototype + * perf: remove argument reassignments in response prototype + * perf: remove argument reassignments in routing + * perf: remove argument reassignments in `View` + * perf: skip attempting to decode zero length string + * perf: use saved reference to `http.STATUS_CODES` + +4.12.4 / 2015-05-17 +=================== + + * deps: accepts@~1.2.7 + - deps: mime-types@~2.0.11 + - deps: negotiator@0.5.3 + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: depd@~1.0.1 + * deps: etag@~1.6.0 + - Improve support for JXcore + - Support "fake" stats objects in environments without `fs` + * deps: finalhandler@0.3.6 + - deps: debug@~2.2.0 + - deps: on-finished@~2.2.1 + * deps: on-finished@~2.2.1 + - Fix `isFinished(req)` when data buffered + * deps: proxy-addr@~1.0.8 + - deps: ipaddr.js@1.0.1 + * deps: qs@2.4.2 + - Fix allowing parameters like `constructor` + * deps: send@0.12.3 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: etag@~1.6.0 + - deps: ms@0.7.1 + - deps: on-finished@~2.2.1 + * deps: serve-static@~1.9.3 + - deps: send@0.12.3 + * deps: type-is@~1.6.2 + - deps: mime-types@~2.0.11 + +4.12.3 / 2015-03-17 +=================== + + * deps: accepts@~1.2.5 + - deps: mime-types@~2.0.10 + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: finalhandler@0.3.4 + - deps: debug@~2.1.3 + * deps: proxy-addr@~1.0.7 + - deps: ipaddr.js@0.1.9 + * deps: qs@2.4.1 + - Fix error when parameter `hasOwnProperty` is present + * deps: send@0.12.2 + - Throw errors early for invalid `extensions` or `index` options + - deps: debug@~2.1.3 + * deps: serve-static@~1.9.2 + - deps: send@0.12.2 + * deps: type-is@~1.6.1 + - deps: mime-types@~2.0.10 + +4.12.2 / 2015-03-02 +=================== + + * Fix regression where `"Request aborted"` is logged using `res.sendFile` + +4.12.1 / 2015-03-01 +=================== + + * Fix constructing application with non-configurable prototype properties + * Fix `ECONNRESET` errors from `res.sendFile` usage + * Fix `req.host` when using "trust proxy" hops count + * Fix `req.protocol`/`req.secure` when using "trust proxy" hops count + * Fix wrong `code` on aborted connections from `res.sendFile` + * deps: merge-descriptors@1.0.0 + +4.12.0 / 2015-02-23 +=================== + + * Fix `"trust proxy"` setting to inherit when app is mounted + * Generate `ETag`s for all request responses + - No longer restricted to only responses for `GET` and `HEAD` requests + * Use `content-type` to parse `Content-Type` headers + * deps: accepts@~1.2.4 + - Fix preference sorting to be stable for long acceptable lists + - deps: mime-types@~2.0.9 + - deps: negotiator@0.5.1 + * deps: cookie-signature@1.0.6 + * deps: send@0.12.1 + - Always read the stat size from the file + - Fix mutating passed-in `options` + - deps: mime@1.3.4 + * deps: serve-static@~1.9.1 + - deps: send@0.12.1 + * deps: type-is@~1.6.0 + - fix argument reassignment + - fix false-positives in `hasBody` `Transfer-Encoding` check + - support wildcard for both type and subtype (`*/*`) + - deps: mime-types@~2.0.9 + +4.11.2 / 2015-02-01 +=================== + + * Fix `res.redirect` double-calling `res.end` for `HEAD` requests + * deps: accepts@~1.2.3 + - deps: mime-types@~2.0.8 + * deps: proxy-addr@~1.0.6 + - deps: ipaddr.js@0.1.8 + * deps: type-is@~1.5.6 + - deps: mime-types@~2.0.8 + +4.11.1 / 2015-01-20 +=================== + + * deps: send@0.11.1 + - Fix root path disclosure + * deps: serve-static@~1.8.1 + - Fix redirect loop in Node.js 0.11.14 + - Fix root path disclosure + - deps: send@0.11.1 + +4.11.0 / 2015-01-13 +=================== + + * Add `res.append(field, val)` to append headers + * Deprecate leading `:` in `name` for `app.param(name, fn)` + * Deprecate `req.param()` -- use `req.params`, `req.body`, or `req.query` instead + * Deprecate `app.param(fn)` + * Fix `OPTIONS` responses to include the `HEAD` method properly + * Fix `res.sendFile` not always detecting aborted connection + * Match routes iteratively to prevent stack overflows + * deps: accepts@~1.2.2 + - deps: mime-types@~2.0.7 + - deps: negotiator@0.5.0 + * deps: send@0.11.0 + - deps: debug@~2.1.1 + - deps: etag@~1.5.1 + - deps: ms@0.7.0 + - deps: on-finished@~2.2.0 + * deps: serve-static@~1.8.0 + - deps: send@0.11.0 + +4.10.8 / 2015-01-13 +=================== + + * Fix crash from error within `OPTIONS` response handler + * deps: proxy-addr@~1.0.5 + - deps: ipaddr.js@0.1.6 + +4.10.7 / 2015-01-04 +=================== + + * Fix `Allow` header for `OPTIONS` to not contain duplicate methods + * Fix incorrect "Request aborted" for `res.sendFile` when `HEAD` or 304 + * deps: debug@~2.1.1 + * deps: finalhandler@0.3.3 + - deps: debug@~2.1.1 + - deps: on-finished@~2.2.0 + * deps: methods@~1.1.1 + * deps: on-finished@~2.2.0 + * deps: serve-static@~1.7.2 + - Fix potential open redirect when mounted at root + * deps: type-is@~1.5.5 + - deps: mime-types@~2.0.7 + +4.10.6 / 2014-12-12 +=================== + + * Fix exception in `req.fresh`/`req.stale` without response headers + +4.10.5 / 2014-12-10 +=================== + + * Fix `res.send` double-calling `res.end` for `HEAD` requests + * deps: accepts@~1.1.4 + - deps: mime-types@~2.0.4 + * deps: type-is@~1.5.4 + - deps: mime-types@~2.0.4 + +4.10.4 / 2014-11-24 +=================== + + * Fix `res.sendfile` logging standard write errors + +4.10.3 / 2014-11-23 +=================== + + * Fix `res.sendFile` logging standard write errors + * deps: etag@~1.5.1 + * deps: proxy-addr@~1.0.4 + - deps: ipaddr.js@0.1.5 + * deps: qs@2.3.3 + - Fix `arrayLimit` behavior + +4.10.2 / 2014-11-09 +=================== + + * Correctly invoke async router callback asynchronously + * deps: accepts@~1.1.3 + - deps: mime-types@~2.0.3 + * deps: type-is@~1.5.3 + - deps: mime-types@~2.0.3 + +4.10.1 / 2014-10-28 +=================== + + * Fix handling of URLs containing `://` in the path + * deps: qs@2.3.2 + - Fix parsing of mixed objects and values + +4.10.0 / 2014-10-23 +=================== + + * Add support for `app.set('views', array)` + - Views are looked up in sequence in array of directories + * Fix `res.send(status)` to mention `res.sendStatus(status)` + * Fix handling of invalid empty URLs + * Use `content-disposition` module for `res.attachment`/`res.download` + - Sends standards-compliant `Content-Disposition` header + - Full Unicode support + * Use `path.resolve` in view lookup + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + * deps: etag@~1.5.0 + - Improve string performance + - Slightly improve speed for weak ETags over 1KB + * deps: finalhandler@0.3.2 + - Terminate in progress response only on error + - Use `on-finished` to determine request status + - deps: debug@~2.1.0 + - deps: on-finished@~2.1.1 + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + * deps: qs@2.3.0 + - Fix parsing of mixed implicit and explicit arrays + * deps: send@0.10.1 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: etag@~1.5.0 + - deps: on-finished@~2.1.1 + * deps: serve-static@~1.7.1 + - deps: send@0.10.1 + +4.9.8 / 2014-10-17 +================== + + * Fix `res.redirect` body when redirect status specified + * deps: accepts@~1.1.2 + - Fix error when media type has invalid parameter + - deps: negotiator@0.4.9 + +4.9.7 / 2014-10-10 +================== + + * Fix using same param name in array of paths + +4.9.6 / 2014-10-08 +================== + + * deps: accepts@~1.1.1 + - deps: mime-types@~2.0.2 + - deps: negotiator@0.4.8 + * deps: serve-static@~1.6.4 + - Fix redirect loop when index file serving disabled + * deps: type-is@~1.5.2 + - deps: mime-types@~2.0.2 + +4.9.5 / 2014-09-24 +================== + + * deps: etag@~1.4.0 + * deps: proxy-addr@~1.0.3 + - Use `forwarded` npm module + * deps: send@0.9.3 + - deps: etag@~1.4.0 + * deps: serve-static@~1.6.3 + - deps: send@0.9.3 + +4.9.4 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + +4.9.3 / 2014-09-18 +================== + + * deps: proxy-addr@~1.0.2 + - Fix a global leak when multiple subnets are trusted + - deps: ipaddr.js@0.1.3 + +4.9.2 / 2014-09-17 +================== + + * Fix regression for empty string `path` in `app.use` + * Fix `router.use` to accept array of middleware without path + * Improve error message for bad `app.use` arguments + +4.9.1 / 2014-09-16 +================== + + * Fix `app.use` to accept array of middleware without path + * deps: depd@0.4.5 + * deps: etag@~1.3.1 + * deps: send@0.9.2 + - deps: depd@0.4.5 + - deps: etag@~1.3.1 + - deps: range-parser@~1.0.2 + * deps: serve-static@~1.6.2 + - deps: send@0.9.2 + +4.9.0 / 2014-09-08 +================== + + * Add `res.sendStatus` + * Invoke callback for sendfile when client aborts + - Applies to `res.sendFile`, `res.sendfile`, and `res.download` + - `err` will be populated with request aborted error + * Support IP address host in `req.subdomains` + * Use `etag` to generate `ETag` headers + * deps: accepts@~1.1.0 + - update `mime-types` + * deps: cookie-signature@1.0.5 + * deps: debug@~2.0.0 + * deps: finalhandler@0.2.0 + - Set `X-Content-Type-Options: nosniff` header + - deps: debug@~2.0.0 + * deps: fresh@0.2.4 + * deps: media-typer@0.3.0 + - Throw error when parameter format invalid on parse + * deps: qs@2.2.3 + - Fix issue where first empty value in array is discarded + * deps: range-parser@~1.0.2 + * deps: send@0.9.1 + - Add `lastModified` option + - Use `etag` to generate `ETag` header + - deps: debug@~2.0.0 + - deps: fresh@0.2.4 + * deps: serve-static@~1.6.1 + - Add `lastModified` option + - deps: send@0.9.1 + * deps: type-is@~1.5.1 + - fix `hasbody` to be true for `content-length: 0` + - deps: media-typer@0.3.0 + - deps: mime-types@~2.0.1 + * deps: vary@~1.0.0 + - Accept valid `Vary` header string as `field` + +4.8.8 / 2014-09-04 +================== + + * deps: send@0.8.5 + - Fix a path traversal issue when using `root` + - Fix malicious path detection for empty string path + * deps: serve-static@~1.5.4 + - deps: send@0.8.5 + +4.8.7 / 2014-08-29 +================== + + * deps: qs@2.2.2 + - Remove unnecessary cloning + +4.8.6 / 2014-08-27 +================== + + * deps: qs@2.2.0 + - Array parsing fix + - Performance improvements + +4.8.5 / 2014-08-18 +================== + + * deps: send@0.8.3 + - deps: destroy@1.0.3 + - deps: on-finished@2.1.0 + * deps: serve-static@~1.5.3 + - deps: send@0.8.3 + +4.8.4 / 2014-08-14 +================== + + * deps: qs@1.2.2 + * deps: send@0.8.2 + - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + * deps: serve-static@~1.5.2 + - deps: send@0.8.2 + +4.8.3 / 2014-08-10 +================== + + * deps: parseurl@~1.3.0 + * deps: qs@1.2.1 + * deps: serve-static@~1.5.1 + - Fix parsing of weird `req.originalUrl` values + - deps: parseurl@~1.3.0 + - deps: utils-merge@1.0.0 + +4.8.2 / 2014-08-07 +================== + + * deps: qs@1.2.0 + - Fix parsing array of objects + +4.8.1 / 2014-08-06 +================== + + * fix incorrect deprecation warnings on `res.download` + * deps: qs@1.1.0 + - Accept urlencoded square brackets + - Accept empty values in implicit array notation + +4.8.0 / 2014-08-05 +================== + + * add `res.sendFile` + - accepts a file system path instead of a URL + - requires an absolute path or `root` option specified + * deprecate `res.sendfile` -- use `res.sendFile` instead + * support mounted app as any argument to `app.use()` + * deps: qs@1.0.2 + - Complete rewrite + - Limits array length to 20 + - Limits object depth to 5 + - Limits parameters to 1,000 + * deps: send@0.8.1 + - Add `extensions` option + * deps: serve-static@~1.5.0 + - Add `extensions` option + - deps: send@0.8.1 + +4.7.4 / 2014-08-04 +================== + + * fix `res.sendfile` regression for serving directory index files + * deps: send@0.7.4 + - Fix incorrect 403 on Windows and Node.js 0.11 + - Fix serving index files without root dir + * deps: serve-static@~1.4.4 + - deps: send@0.7.4 + +4.7.3 / 2014-08-04 +================== + + * deps: send@0.7.3 + - Fix incorrect 403 on Windows and Node.js 0.11 + * deps: serve-static@~1.4.3 + - Fix incorrect 403 on Windows and Node.js 0.11 + - deps: send@0.7.3 + +4.7.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + * deps: send@0.7.2 + - deps: depd@0.4.4 + * deps: serve-static@~1.4.2 + +4.7.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + * deps: send@0.7.1 + - deps: depd@0.4.3 + * deps: serve-static@~1.4.1 + +4.7.0 / 2014-07-25 +================== + + * fix `req.protocol` for proxy-direct connections + * configurable query parser with `app.set('query parser', parser)` + - `app.set('query parser', 'extended')` parse with "qs" module + - `app.set('query parser', 'simple')` parse with "querystring" core module + - `app.set('query parser', false)` disable query string parsing + - `app.set('query parser', true)` enable simple parsing + * deprecate `res.json(status, obj)` -- use `res.status(status).json(obj)` instead + * deprecate `res.jsonp(status, obj)` -- use `res.status(status).jsonp(obj)` instead + * deprecate `res.send(status, body)` -- use `res.status(status).send(body)` instead + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: finalhandler@0.1.0 + - Respond after request fully read + - deps: debug@1.0.4 + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * deps: send@0.7.0 + - Add `dotfiles` option + - Cap `maxAge` value to 1 year + - deps: debug@1.0.4 + - deps: depd@0.4.2 + * deps: serve-static@~1.4.0 + - deps: parseurl@~1.2.0 + - deps: send@0.7.0 + * perf: prevent multiple `Buffer` creation in `res.send` + +4.6.1 / 2014-07-12 +================== + + * fix `subapp.mountpath` regression for `app.use(subapp)` + +4.6.0 / 2014-07-11 +================== + + * accept multiple callbacks to `app.use()` + * add explicit "Rosetta Flash JSONP abuse" protection + - previous versions are not vulnerable; this is just explicit protection + * catch errors in multiple `req.param(name, fn)` handlers + * deprecate `res.redirect(url, status)` -- use `res.redirect(status, url)` instead + * fix `res.send(status, num)` to send `num` as json (not error) + * remove unnecessary escaping when `res.jsonp` returns JSON response + * support non-string `path` in `app.use(path, fn)` + - supports array of paths + - supports `RegExp` + * router: fix optimization on router exit + * router: refactor location of `try` blocks + * router: speed up standard `app.use(fn)` + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + * deps: finalhandler@0.0.3 + - deps: debug@1.0.3 + * deps: methods@1.1.0 + - add `CONNECT` + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + * deps: path-to-regexp@0.1.3 + * deps: send@0.6.0 + - deps: debug@1.0.3 + * deps: serve-static@~1.3.2 + - deps: parseurl@~1.1.3 + - deps: send@0.6.0 + * perf: fix arguments reassign deopt in some `res` methods + +4.5.1 / 2014-07-06 +================== + + * fix routing regression when altering `req.method` + +4.5.0 / 2014-07-04 +================== + + * add deprecation message to non-plural `req.accepts*` + * add deprecation message to `res.send(body, status)` + * add deprecation message to `res.vary()` + * add `headers` option to `res.sendfile` + - use to set headers on successful file transfer + * add `mergeParams` option to `Router` + - merges `req.params` from parent routes + * add `req.hostname` -- correct name for what `req.host` returns + * deprecate things with `depd` module + * deprecate `req.host` -- use `req.hostname` instead + * fix behavior when handling request without routes + * fix handling when `route.all` is only route + * invoke `router.param()` only when route matches + * restore `req.params` after invoking router + * use `finalhandler` for final response handling + * use `media-typer` to alter content-type charset + * deps: accepts@~1.0.7 + * deps: send@0.5.0 + - Accept string for `maxage` (converted by `ms`) + - Include link in default redirect response + * deps: serve-static@~1.3.0 + - Accept string for `maxAge` (converted by `ms`) + - Add `setHeaders` option + - Include HTML link in redirect response + - deps: send@0.5.0 + * deps: type-is@~1.3.2 + +4.4.5 / 2014-06-26 +================== + + * deps: cookie-signature@1.0.4 + - fix for timing attacks + +4.4.4 / 2014-06-20 +================== + + * fix `res.attachment` Unicode filenames in Safari + * fix "trim prefix" debug message in `express:router` + * deps: accepts@~1.0.5 + * deps: buffer-crc32@0.2.3 + +4.4.3 / 2014-06-11 +================== + + * fix persistence of modified `req.params[name]` from `app.param()` + * deps: accepts@1.0.3 + - deps: negotiator@0.4.6 + * deps: debug@1.0.2 + * deps: send@0.4.3 + - Do not throw uncatchable error on file open race condition + - Use `escape-html` for HTML escaping + - deps: debug@1.0.2 + - deps: finished@1.2.2 + - deps: fresh@0.2.2 + * deps: serve-static@1.2.3 + - Do not throw uncatchable error on file open race condition + - deps: send@0.4.3 + +4.4.2 / 2014-06-09 +================== + + * fix catching errors from top-level handlers + * use `vary` module for `res.vary` + * deps: debug@1.0.1 + * deps: proxy-addr@1.0.1 + * deps: send@0.4.2 + - fix "event emitter leak" warnings + - deps: debug@1.0.1 + - deps: finished@1.2.1 + * deps: serve-static@1.2.2 + - fix "event emitter leak" warnings + - deps: send@0.4.2 + * deps: type-is@1.2.1 + +4.4.1 / 2014-06-02 +================== + + * deps: methods@1.0.1 + * deps: send@0.4.1 + - Send `max-age` in `Cache-Control` in correct format + * deps: serve-static@1.2.1 + - use `escape-html` for escaping + - deps: send@0.4.1 + +4.4.0 / 2014-05-30 +================== + + * custom etag control with `app.set('etag', val)` + - `app.set('etag', function(body, encoding){ return '"etag"' })` custom etag generation + - `app.set('etag', 'weak')` weak tag + - `app.set('etag', 'strong')` strong etag + - `app.set('etag', false)` turn off + - `app.set('etag', true)` standard etag + * mark `res.send` ETag as weak and reduce collisions + * update accepts to 1.0.2 + - Fix interpretation when header not in request + * update send to 0.4.0 + - Calculate ETag with md5 for reduced collisions + - Ignore stream errors after request ends + - deps: debug@0.8.1 + * update serve-static to 1.2.0 + - Calculate ETag with md5 for reduced collisions + - Ignore stream errors after request ends + - deps: send@0.4.0 + +4.3.2 / 2014-05-28 +================== + + * fix handling of errors from `router.param()` callbacks + +4.3.1 / 2014-05-23 +================== + + * revert "fix behavior of multiple `app.VERB` for the same path" + - this caused a regression in the order of route execution + +4.3.0 / 2014-05-21 +================== + + * add `req.baseUrl` to access the path stripped from `req.url` in routes + * fix behavior of multiple `app.VERB` for the same path + * fix issue routing requests among sub routers + * invoke `router.param()` only when necessary instead of every match + * proper proxy trust with `app.set('trust proxy', trust)` + - `app.set('trust proxy', 1)` trust first hop + - `app.set('trust proxy', 'loopback')` trust loopback addresses + - `app.set('trust proxy', '10.0.0.1')` trust single IP + - `app.set('trust proxy', '10.0.0.1/16')` trust subnet + - `app.set('trust proxy', '10.0.0.1, 10.0.0.2')` trust list + - `app.set('trust proxy', false)` turn off + - `app.set('trust proxy', true)` trust everything + * set proper `charset` in `Content-Type` for `res.send` + * update type-is to 1.2.0 + - support suffix matching + +4.2.0 / 2014-05-11 +================== + + * deprecate `app.del()` -- use `app.delete()` instead + * deprecate `res.json(obj, status)` -- use `res.json(status, obj)` instead + - the edge-case `res.json(status, num)` requires `res.status(status).json(num)` + * deprecate `res.jsonp(obj, status)` -- use `res.jsonp(status, obj)` instead + - the edge-case `res.jsonp(status, num)` requires `res.status(status).jsonp(num)` + * fix `req.next` when inside router instance + * include `ETag` header in `HEAD` requests + * keep previous `Content-Type` for `res.jsonp` + * support PURGE method + - add `app.purge` + - add `router.purge` + - include PURGE in `app.all` + * update debug to 0.8.0 + - add `enable()` method + - change from stderr to stdout + * update methods to 1.0.0 + - add PURGE + +4.1.2 / 2014-05-08 +================== + + * fix `req.host` for IPv6 literals + * fix `res.jsonp` error if callback param is object + +4.1.1 / 2014-04-27 +================== + + * fix package.json to reflect supported node version + +4.1.0 / 2014-04-24 +================== + + * pass options from `res.sendfile` to `send` + * preserve casing of headers in `res.header` and `res.set` + * support unicode file names in `res.attachment` and `res.download` + * update accepts to 1.0.1 + - deps: negotiator@0.4.0 + * update cookie to 0.1.2 + - Fix for maxAge == 0 + - made compat with expires field + * update send to 0.3.0 + - Accept API options in options object + - Coerce option types + - Control whether to generate etags + - Default directory access to 403 when index disabled + - Fix sending files with dots without root set + - Include file path in etag + - Make "Can't set headers after they are sent." catchable + - Send full entity-body for multi range requests + - Set etags to "weak" + - Support "If-Range" header + - Support multiple index paths + - deps: mime@1.2.11 + * update serve-static to 1.1.0 + - Accept options directly to `send` module + - Resolve relative paths at middleware setup + - Use parseurl to parse the URL from request + - deps: send@0.3.0 + * update type-is to 1.1.0 + - add non-array values support + - add `multipart` as a shorthand + +4.0.0 / 2014-04-09 +================== + + * remove: + - node 0.8 support + - connect and connect's patches except for charset handling + - express(1) - moved to [express-generator](https://github.com/expressjs/generator) + - `express.createServer()` - it has been deprecated for a long time. Use `express()` + - `app.configure` - use logic in your own app code + - `app.router` - is removed + - `req.auth` - use `basic-auth` instead + - `req.accepted*` - use `req.accepts*()` instead + - `res.location` - relative URL resolution is removed + - `res.charset` - include the charset in the content type when using `res.set()` + - all bundled middleware except `static` + * change: + - `app.route` -> `app.mountpath` when mounting an express app in another express app + - `json spaces` no longer enabled by default in development + - `req.accepts*` -> `req.accepts*s` - i.e. `req.acceptsEncoding` -> `req.acceptsEncodings` + - `req.params` is now an object instead of an array + - `res.locals` is no longer a function. It is a plain js object. Treat it as such. + - `res.headerSent` -> `res.headersSent` to match node.js ServerResponse object + * refactor: + - `req.accepts*` with [accepts](https://github.com/expressjs/accepts) + - `req.is` with [type-is](https://github.com/expressjs/type-is) + - [path-to-regexp](https://github.com/component/path-to-regexp) + * add: + - `app.router()` - returns the app Router instance + - `app.route()` - Proxy to the app's `Router#route()` method to create a new route + - Router & Route - public API + +3.21.2 / 2015-07-31 +=================== + + * deps: connect@2.30.2 + - deps: body-parser@~1.13.3 + - deps: compression@~1.5.2 + - deps: errorhandler@~1.4.2 + - deps: method-override@~2.3.5 + - deps: serve-index@~1.7.2 + - deps: type-is@~1.6.6 + - deps: vhost@~3.0.1 + * deps: vary@~1.0.1 + - Fix setting empty header from empty `field` + - perf: enable strict mode + - perf: remove argument reassignments + +3.21.1 / 2015-07-05 +=================== + + * deps: basic-auth@~1.0.3 + * deps: connect@2.30.1 + - deps: body-parser@~1.13.2 + - deps: compression@~1.5.1 + - deps: errorhandler@~1.4.1 + - deps: morgan@~1.6.1 + - deps: pause@0.1.0 + - deps: qs@4.0.0 + - deps: serve-index@~1.7.1 + - deps: type-is@~1.6.4 + +3.21.0 / 2015-06-18 +=================== + + * deps: basic-auth@1.0.2 + - perf: enable strict mode + - perf: hoist regular expression + - perf: parse with regular expressions + - perf: remove argument reassignment + * deps: connect@2.30.0 + - deps: body-parser@~1.13.1 + - deps: bytes@2.1.0 + - deps: compression@~1.5.0 + - deps: cookie@0.1.3 + - deps: cookie-parser@~1.3.5 + - deps: csurf@~1.8.3 + - deps: errorhandler@~1.4.0 + - deps: express-session@~1.11.3 + - deps: finalhandler@0.4.0 + - deps: fresh@0.3.0 + - deps: morgan@~1.6.0 + - deps: serve-favicon@~2.3.0 + - deps: serve-index@~1.7.0 + - deps: serve-static@~1.10.0 + - deps: type-is@~1.6.3 + * deps: cookie@0.1.3 + - perf: deduce the scope of try-catch deopt + - perf: remove argument reassignments + * deps: escape-html@1.0.2 + * deps: etag@~1.7.0 + - Always include entity length in ETags for hash length extensions + - Generate non-Stats ETags using MD5 only (no longer CRC32) + - Improve stat performance by removing hashing + - Improve support for JXcore + - Remove base64 padding in ETags to shorten + - Support "fake" stats objects in environments without fs + - Use MD5 instead of MD4 in weak ETags over 1KB + * deps: fresh@0.3.0 + - Add weak `ETag` matching support + * deps: mkdirp@0.5.1 + - Work in global strict mode + * deps: send@0.13.0 + - Allow Node.js HTTP server to set `Date` response header + - Fix incorrectly removing `Content-Location` on 304 response + - Improve the default redirect response headers + - Send appropriate headers on default error response + - Use `http-errors` for standard emitted errors + - Use `statuses` instead of `http` module for status messages + - deps: escape-html@1.0.2 + - deps: etag@~1.7.0 + - deps: fresh@0.3.0 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove unnecessary array allocations + +3.20.3 / 2015-05-17 +=================== + + * deps: connect@2.29.2 + - deps: body-parser@~1.12.4 + - deps: compression@~1.4.4 + - deps: connect-timeout@~1.6.2 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: errorhandler@~1.3.6 + - deps: finalhandler@0.3.6 + - deps: method-override@~2.3.3 + - deps: morgan@~1.5.3 + - deps: qs@2.4.2 + - deps: response-time@~2.3.1 + - deps: serve-favicon@~2.2.1 + - deps: serve-index@~1.6.4 + - deps: serve-static@~1.9.3 + - deps: type-is@~1.6.2 + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: depd@~1.0.1 + * deps: proxy-addr@~1.0.8 + - deps: ipaddr.js@1.0.1 + * deps: send@0.12.3 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: etag@~1.6.0 + - deps: ms@0.7.1 + - deps: on-finished@~2.2.1 + +3.20.2 / 2015-03-16 +=================== + + * deps: connect@2.29.1 + - deps: body-parser@~1.12.2 + - deps: compression@~1.4.3 + - deps: connect-timeout@~1.6.1 + - deps: debug@~2.1.3 + - deps: errorhandler@~1.3.5 + - deps: express-session@~1.10.4 + - deps: finalhandler@0.3.4 + - deps: method-override@~2.3.2 + - deps: morgan@~1.5.2 + - deps: qs@2.4.1 + - deps: serve-index@~1.6.3 + - deps: serve-static@~1.9.2 + - deps: type-is@~1.6.1 + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: merge-descriptors@1.0.0 + * deps: proxy-addr@~1.0.7 + - deps: ipaddr.js@0.1.9 + * deps: send@0.12.2 + - Throw errors early for invalid `extensions` or `index` options + - deps: debug@~2.1.3 + +3.20.1 / 2015-02-28 +=================== + + * Fix `req.host` when using "trust proxy" hops count + * Fix `req.protocol`/`req.secure` when using "trust proxy" hops count + +3.20.0 / 2015-02-18 +=================== + + * Fix `"trust proxy"` setting to inherit when app is mounted + * Generate `ETag`s for all request responses + - No longer restricted to only responses for `GET` and `HEAD` requests + * Use `content-type` to parse `Content-Type` headers + * deps: connect@2.29.0 + - Use `content-type` to parse `Content-Type` headers + - deps: body-parser@~1.12.0 + - deps: compression@~1.4.1 + - deps: connect-timeout@~1.6.0 + - deps: cookie-parser@~1.3.4 + - deps: cookie-signature@1.0.6 + - deps: csurf@~1.7.0 + - deps: errorhandler@~1.3.4 + - deps: express-session@~1.10.3 + - deps: http-errors@~1.3.1 + - deps: response-time@~2.3.0 + - deps: serve-index@~1.6.2 + - deps: serve-static@~1.9.1 + - deps: type-is@~1.6.0 + * deps: cookie-signature@1.0.6 + * deps: send@0.12.1 + - Always read the stat size from the file + - Fix mutating passed-in `options` + - deps: mime@1.3.4 + +3.19.2 / 2015-02-01 +=================== + + * deps: connect@2.28.3 + - deps: compression@~1.3.1 + - deps: csurf@~1.6.6 + - deps: errorhandler@~1.3.3 + - deps: express-session@~1.10.2 + - deps: serve-index@~1.6.1 + - deps: type-is@~1.5.6 + * deps: proxy-addr@~1.0.6 + - deps: ipaddr.js@0.1.8 + +3.19.1 / 2015-01-20 +=================== + + * deps: connect@2.28.2 + - deps: body-parser@~1.10.2 + - deps: serve-static@~1.8.1 + * deps: send@0.11.1 + - Fix root path disclosure + +3.19.0 / 2015-01-09 +=================== + + * Fix `OPTIONS` responses to include the `HEAD` method property + * Use `readline` for prompt in `express(1)` + * deps: commander@2.6.0 + * deps: connect@2.28.1 + - deps: body-parser@~1.10.1 + - deps: compression@~1.3.0 + - deps: connect-timeout@~1.5.0 + - deps: csurf@~1.6.4 + - deps: debug@~2.1.1 + - deps: errorhandler@~1.3.2 + - deps: express-session@~1.10.1 + - deps: finalhandler@0.3.3 + - deps: method-override@~2.3.1 + - deps: morgan@~1.5.1 + - deps: serve-favicon@~2.2.0 + - deps: serve-index@~1.6.0 + - deps: serve-static@~1.8.0 + - deps: type-is@~1.5.5 + * deps: debug@~2.1.1 + * deps: methods@~1.1.1 + * deps: proxy-addr@~1.0.5 + - deps: ipaddr.js@0.1.6 + * deps: send@0.11.0 + - deps: debug@~2.1.1 + - deps: etag@~1.5.1 + - deps: ms@0.7.0 + - deps: on-finished@~2.2.0 + +3.18.6 / 2014-12-12 +=================== + + * Fix exception in `req.fresh`/`req.stale` without response headers + +3.18.5 / 2014-12-11 +=================== + + * deps: connect@2.27.6 + - deps: compression@~1.2.2 + - deps: express-session@~1.9.3 + - deps: http-errors@~1.2.8 + - deps: serve-index@~1.5.3 + - deps: type-is@~1.5.4 + +3.18.4 / 2014-11-23 +=================== + + * deps: connect@2.27.4 + - deps: body-parser@~1.9.3 + - deps: compression@~1.2.1 + - deps: errorhandler@~1.2.3 + - deps: express-session@~1.9.2 + - deps: qs@2.3.3 + - deps: serve-favicon@~2.1.7 + - deps: serve-static@~1.5.1 + - deps: type-is@~1.5.3 + * deps: etag@~1.5.1 + * deps: proxy-addr@~1.0.4 + - deps: ipaddr.js@0.1.5 + +3.18.3 / 2014-11-09 +=================== + + * deps: connect@2.27.3 + - Correctly invoke async callback asynchronously + - deps: csurf@~1.6.3 + +3.18.2 / 2014-10-28 +=================== + + * deps: connect@2.27.2 + - Fix handling of URLs containing `://` in the path + - deps: body-parser@~1.9.2 + - deps: qs@2.3.2 + +3.18.1 / 2014-10-22 +=================== + + * Fix internal `utils.merge` deprecation warnings + * deps: connect@2.27.1 + - deps: body-parser@~1.9.1 + - deps: express-session@~1.9.1 + - deps: finalhandler@0.3.2 + - deps: morgan@~1.4.1 + - deps: qs@2.3.0 + - deps: serve-static@~1.7.1 + * deps: send@0.10.1 + - deps: on-finished@~2.1.1 + +3.18.0 / 2014-10-17 +=================== + + * Use `content-disposition` module for `res.attachment`/`res.download` + - Sends standards-compliant `Content-Disposition` header + - Full Unicode support + * Use `etag` module to generate `ETag` headers + * deps: connect@2.27.0 + - Use `http-errors` module for creating errors + - Use `utils-merge` module for merging objects + - deps: body-parser@~1.9.0 + - deps: compression@~1.2.0 + - deps: connect-timeout@~1.4.0 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: express-session@~1.9.0 + - deps: finalhandler@0.3.1 + - deps: method-override@~2.3.0 + - deps: morgan@~1.4.0 + - deps: response-time@~2.2.0 + - deps: serve-favicon@~2.1.6 + - deps: serve-index@~1.5.0 + - deps: serve-static@~1.7.0 + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + * deps: send@0.10.0 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: etag@~1.5.0 + +3.17.8 / 2014-10-15 +=================== + + * deps: connect@2.26.6 + - deps: compression@~1.1.2 + - deps: csurf@~1.6.2 + - deps: errorhandler@~1.2.2 + +3.17.7 / 2014-10-08 +=================== + + * deps: connect@2.26.5 + - Fix accepting non-object arguments to `logger` + - deps: serve-static@~1.6.4 + +3.17.6 / 2014-10-02 +=================== + + * deps: connect@2.26.4 + - deps: morgan@~1.3.2 + - deps: type-is@~1.5.2 + +3.17.5 / 2014-09-24 +=================== + + * deps: connect@2.26.3 + - deps: body-parser@~1.8.4 + - deps: serve-favicon@~2.1.5 + - deps: serve-static@~1.6.3 + * deps: proxy-addr@~1.0.3 + - Use `forwarded` npm module + * deps: send@0.9.3 + - deps: etag@~1.4.0 + +3.17.4 / 2014-09-19 +=================== + + * deps: connect@2.26.2 + - deps: body-parser@~1.8.3 + - deps: qs@2.2.4 + +3.17.3 / 2014-09-18 +=================== + + * deps: proxy-addr@~1.0.2 + - Fix a global leak when multiple subnets are trusted + - deps: ipaddr.js@0.1.3 + +3.17.2 / 2014-09-15 +=================== + + * Use `crc` instead of `buffer-crc32` for speed + * deps: connect@2.26.1 + - deps: body-parser@~1.8.2 + - deps: depd@0.4.5 + - deps: express-session@~1.8.2 + - deps: morgan@~1.3.1 + - deps: serve-favicon@~2.1.3 + - deps: serve-static@~1.6.2 + * deps: depd@0.4.5 + * deps: send@0.9.2 + - deps: depd@0.4.5 + - deps: etag@~1.3.1 + - deps: range-parser@~1.0.2 + +3.17.1 / 2014-09-08 +=================== + + * Fix error in `req.subdomains` on empty host + +3.17.0 / 2014-09-08 +=================== + + * Support `X-Forwarded-Host` in `req.subdomains` + * Support IP address host in `req.subdomains` + * deps: connect@2.26.0 + - deps: body-parser@~1.8.1 + - deps: compression@~1.1.0 + - deps: connect-timeout@~1.3.0 + - deps: cookie-parser@~1.3.3 + - deps: cookie-signature@1.0.5 + - deps: csurf@~1.6.1 + - deps: debug@~2.0.0 + - deps: errorhandler@~1.2.0 + - deps: express-session@~1.8.1 + - deps: finalhandler@0.2.0 + - deps: fresh@0.2.4 + - deps: media-typer@0.3.0 + - deps: method-override@~2.2.0 + - deps: morgan@~1.3.0 + - deps: qs@2.2.3 + - deps: serve-favicon@~2.1.3 + - deps: serve-index@~1.2.1 + - deps: serve-static@~1.6.1 + - deps: type-is@~1.5.1 + - deps: vhost@~3.0.0 + * deps: cookie-signature@1.0.5 + * deps: debug@~2.0.0 + * deps: fresh@0.2.4 + * deps: media-typer@0.3.0 + - Throw error when parameter format invalid on parse + * deps: range-parser@~1.0.2 + * deps: send@0.9.1 + - Add `lastModified` option + - Use `etag` to generate `ETag` header + - deps: debug@~2.0.0 + - deps: fresh@0.2.4 + * deps: vary@~1.0.0 + - Accept valid `Vary` header string as `field` + +3.16.10 / 2014-09-04 +==================== + + * deps: connect@2.25.10 + - deps: serve-static@~1.5.4 + * deps: send@0.8.5 + - Fix a path traversal issue when using `root` + - Fix malicious path detection for empty string path + +3.16.9 / 2014-08-29 +=================== + + * deps: connect@2.25.9 + - deps: body-parser@~1.6.7 + - deps: qs@2.2.2 + +3.16.8 / 2014-08-27 +=================== + + * deps: connect@2.25.8 + - deps: body-parser@~1.6.6 + - deps: csurf@~1.4.1 + - deps: qs@2.2.0 + +3.16.7 / 2014-08-18 +=================== + + * deps: connect@2.25.7 + - deps: body-parser@~1.6.5 + - deps: express-session@~1.7.6 + - deps: morgan@~1.2.3 + - deps: serve-static@~1.5.3 + * deps: send@0.8.3 + - deps: destroy@1.0.3 + - deps: on-finished@2.1.0 + +3.16.6 / 2014-08-14 +=================== + + * deps: connect@2.25.6 + - deps: body-parser@~1.6.4 + - deps: qs@1.2.2 + - deps: serve-static@~1.5.2 + * deps: send@0.8.2 + - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + +3.16.5 / 2014-08-11 +=================== + + * deps: connect@2.25.5 + - Fix backwards compatibility in `logger` + +3.16.4 / 2014-08-10 +=================== + + * Fix original URL parsing in `res.location` + * deps: connect@2.25.4 + - Fix `query` middleware breaking with argument + - deps: body-parser@~1.6.3 + - deps: compression@~1.0.11 + - deps: connect-timeout@~1.2.2 + - deps: express-session@~1.7.5 + - deps: method-override@~2.1.3 + - deps: on-headers@~1.0.0 + - deps: parseurl@~1.3.0 + - deps: qs@1.2.1 + - deps: response-time@~2.0.1 + - deps: serve-index@~1.1.6 + - deps: serve-static@~1.5.1 + * deps: parseurl@~1.3.0 + +3.16.3 / 2014-08-07 +=================== + + * deps: connect@2.25.3 + - deps: multiparty@3.3.2 + +3.16.2 / 2014-08-07 +=================== + + * deps: connect@2.25.2 + - deps: body-parser@~1.6.2 + - deps: qs@1.2.0 + +3.16.1 / 2014-08-06 +=================== + + * deps: connect@2.25.1 + - deps: body-parser@~1.6.1 + - deps: qs@1.1.0 + +3.16.0 / 2014-08-05 +=================== + + * deps: connect@2.25.0 + - deps: body-parser@~1.6.0 + - deps: compression@~1.0.10 + - deps: csurf@~1.4.0 + - deps: express-session@~1.7.4 + - deps: qs@1.0.2 + - deps: serve-static@~1.5.0 + * deps: send@0.8.1 + - Add `extensions` option + +3.15.3 / 2014-08-04 +=================== + + * fix `res.sendfile` regression for serving directory index files + * deps: connect@2.24.3 + - deps: serve-index@~1.1.5 + - deps: serve-static@~1.4.4 + * deps: send@0.7.4 + - Fix incorrect 403 on Windows and Node.js 0.11 + - Fix serving index files without root dir + +3.15.2 / 2014-07-27 +=================== + + * deps: connect@2.24.2 + - deps: body-parser@~1.5.2 + - deps: depd@0.4.4 + - deps: express-session@~1.7.2 + - deps: morgan@~1.2.2 + - deps: serve-static@~1.4.2 + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + * deps: send@0.7.2 + - deps: depd@0.4.4 + +3.15.1 / 2014-07-26 +=================== + + * deps: connect@2.24.1 + - deps: body-parser@~1.5.1 + - deps: depd@0.4.3 + - deps: express-session@~1.7.1 + - deps: morgan@~1.2.1 + - deps: serve-index@~1.1.4 + - deps: serve-static@~1.4.1 + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + * deps: send@0.7.1 + - deps: depd@0.4.3 + +3.15.0 / 2014-07-22 +=================== + + * Fix `req.protocol` for proxy-direct connections + * Pass options from `res.sendfile` to `send` + * deps: connect@2.24.0 + - deps: body-parser@~1.5.0 + - deps: compression@~1.0.9 + - deps: connect-timeout@~1.2.1 + - deps: debug@1.0.4 + - deps: depd@0.4.2 + - deps: express-session@~1.7.0 + - deps: finalhandler@0.1.0 + - deps: method-override@~2.1.2 + - deps: morgan@~1.2.0 + - deps: multiparty@3.3.1 + - deps: parseurl@~1.2.0 + - deps: serve-static@~1.4.0 + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * deps: send@0.7.0 + - Add `dotfiles` option + - Cap `maxAge` value to 1 year + - deps: debug@1.0.4 + - deps: depd@0.4.2 + +3.14.0 / 2014-07-11 +=================== + + * add explicit "Rosetta Flash JSONP abuse" protection + - previous versions are not vulnerable; this is just explicit protection + * deprecate `res.redirect(url, status)` -- use `res.redirect(status, url)` instead + * fix `res.send(status, num)` to send `num` as json (not error) + * remove unnecessary escaping when `res.jsonp` returns JSON response + * deps: basic-auth@1.0.0 + - support empty password + - support empty username + * deps: connect@2.23.0 + - deps: debug@1.0.3 + - deps: express-session@~1.6.4 + - deps: method-override@~2.1.0 + - deps: parseurl@~1.1.3 + - deps: serve-static@~1.3.1 + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + * deps: methods@1.1.0 + - add `CONNECT` + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + +3.13.0 / 2014-07-03 +=================== + + * add deprecation message to `app.configure` + * add deprecation message to `req.auth` + * use `basic-auth` to parse `Authorization` header + * deps: connect@2.22.0 + - deps: csurf@~1.3.0 + - deps: express-session@~1.6.1 + - deps: multiparty@3.3.0 + - deps: serve-static@~1.3.0 + * deps: send@0.5.0 + - Accept string for `maxage` (converted by `ms`) + - Include link in default redirect response + +3.12.1 / 2014-06-26 +=================== + + * deps: connect@2.21.1 + - deps: cookie-parser@1.3.2 + - deps: cookie-signature@1.0.4 + - deps: express-session@~1.5.2 + - deps: type-is@~1.3.2 + * deps: cookie-signature@1.0.4 + - fix for timing attacks + +3.12.0 / 2014-06-21 +=================== + + * use `media-typer` to alter content-type charset + * deps: connect@2.21.0 + - deprecate `connect(middleware)` -- use `app.use(middleware)` instead + - deprecate `connect.createServer()` -- use `connect()` instead + - fix `res.setHeader()` patch to work with with get -> append -> set pattern + - deps: compression@~1.0.8 + - deps: errorhandler@~1.1.1 + - deps: express-session@~1.5.0 + - deps: serve-index@~1.1.3 + +3.11.0 / 2014-06-19 +=================== + + * deprecate things with `depd` module + * deps: buffer-crc32@0.2.3 + * deps: connect@2.20.2 + - deprecate `verify` option to `json` -- use `body-parser` npm module instead + - deprecate `verify` option to `urlencoded` -- use `body-parser` npm module instead + - deprecate things with `depd` module + - use `finalhandler` for final response handling + - use `media-typer` to parse `content-type` for charset + - deps: body-parser@1.4.3 + - deps: connect-timeout@1.1.1 + - deps: cookie-parser@1.3.1 + - deps: csurf@1.2.2 + - deps: errorhandler@1.1.0 + - deps: express-session@1.4.0 + - deps: multiparty@3.2.9 + - deps: serve-index@1.1.2 + - deps: type-is@1.3.1 + - deps: vhost@2.0.0 + +3.10.5 / 2014-06-11 +=================== + + * deps: connect@2.19.6 + - deps: body-parser@1.3.1 + - deps: compression@1.0.7 + - deps: debug@1.0.2 + - deps: serve-index@1.1.1 + - deps: serve-static@1.2.3 + * deps: debug@1.0.2 + * deps: send@0.4.3 + - Do not throw uncatchable error on file open race condition + - Use `escape-html` for HTML escaping + - deps: debug@1.0.2 + - deps: finished@1.2.2 + - deps: fresh@0.2.2 + +3.10.4 / 2014-06-09 +=================== + + * deps: connect@2.19.5 + - fix "event emitter leak" warnings + - deps: csurf@1.2.1 + - deps: debug@1.0.1 + - deps: serve-static@1.2.2 + - deps: type-is@1.2.1 + * deps: debug@1.0.1 + * deps: send@0.4.2 + - fix "event emitter leak" warnings + - deps: finished@1.2.1 + - deps: debug@1.0.1 + +3.10.3 / 2014-06-05 +=================== + + * use `vary` module for `res.vary` + * deps: connect@2.19.4 + - deps: errorhandler@1.0.2 + - deps: method-override@2.0.2 + - deps: serve-favicon@2.0.1 + * deps: debug@1.0.0 + +3.10.2 / 2014-06-03 +=================== + + * deps: connect@2.19.3 + - deps: compression@1.0.6 + +3.10.1 / 2014-06-03 +=================== + + * deps: connect@2.19.2 + - deps: compression@1.0.4 + * deps: proxy-addr@1.0.1 + +3.10.0 / 2014-06-02 +=================== + + * deps: connect@2.19.1 + - deprecate `methodOverride()` -- use `method-override` npm module instead + - deps: body-parser@1.3.0 + - deps: method-override@2.0.1 + - deps: multiparty@3.2.8 + - deps: response-time@2.0.0 + - deps: serve-static@1.2.1 + * deps: methods@1.0.1 + * deps: send@0.4.1 + - Send `max-age` in `Cache-Control` in correct format + +3.9.0 / 2014-05-30 +================== + + * custom etag control with `app.set('etag', val)` + - `app.set('etag', function(body, encoding){ return '"etag"' })` custom etag generation + - `app.set('etag', 'weak')` weak tag + - `app.set('etag', 'strong')` strong etag + - `app.set('etag', false)` turn off + - `app.set('etag', true)` standard etag + * Include ETag in HEAD requests + * mark `res.send` ETag as weak and reduce collisions + * update connect to 2.18.0 + - deps: compression@1.0.3 + - deps: serve-index@1.1.0 + - deps: serve-static@1.2.0 + * update send to 0.4.0 + - Calculate ETag with md5 for reduced collisions + - Ignore stream errors after request ends + - deps: debug@0.8.1 + +3.8.1 / 2014-05-27 +================== + + * update connect to 2.17.3 + - deps: body-parser@1.2.2 + - deps: express-session@1.2.1 + - deps: method-override@1.0.2 + +3.8.0 / 2014-05-21 +================== + + * keep previous `Content-Type` for `res.jsonp` + * set proper `charset` in `Content-Type` for `res.send` + * update connect to 2.17.1 + - fix `res.charset` appending charset when `content-type` has one + - deps: express-session@1.2.0 + - deps: morgan@1.1.1 + - deps: serve-index@1.0.3 + +3.7.0 / 2014-05-18 +================== + + * proper proxy trust with `app.set('trust proxy', trust)` + - `app.set('trust proxy', 1)` trust first hop + - `app.set('trust proxy', 'loopback')` trust loopback addresses + - `app.set('trust proxy', '10.0.0.1')` trust single IP + - `app.set('trust proxy', '10.0.0.1/16')` trust subnet + - `app.set('trust proxy', '10.0.0.1, 10.0.0.2')` trust list + - `app.set('trust proxy', false)` turn off + - `app.set('trust proxy', true)` trust everything + * update connect to 2.16.2 + - deprecate `res.headerSent` -- use `res.headersSent` + - deprecate `res.on("header")` -- use on-headers module instead + - fix edge-case in `res.appendHeader` that would append in wrong order + - json: use body-parser + - urlencoded: use body-parser + - dep: bytes@1.0.0 + - dep: cookie-parser@1.1.0 + - dep: csurf@1.2.0 + - dep: express-session@1.1.0 + - dep: method-override@1.0.1 + +3.6.0 / 2014-05-09 +================== + + * deprecate `app.del()` -- use `app.delete()` instead + * deprecate `res.json(obj, status)` -- use `res.json(status, obj)` instead + - the edge-case `res.json(status, num)` requires `res.status(status).json(num)` + * deprecate `res.jsonp(obj, status)` -- use `res.jsonp(status, obj)` instead + - the edge-case `res.jsonp(status, num)` requires `res.status(status).jsonp(num)` + * support PURGE method + - add `app.purge` + - add `router.purge` + - include PURGE in `app.all` + * update connect to 2.15.0 + * Add `res.appendHeader` + * Call error stack even when response has been sent + * Patch `res.headerSent` to return Boolean + * Patch `res.headersSent` for node.js 0.8 + * Prevent default 404 handler after response sent + * dep: compression@1.0.2 + * dep: connect-timeout@1.1.0 + * dep: debug@^0.8.0 + * dep: errorhandler@1.0.1 + * dep: express-session@1.0.4 + * dep: morgan@1.0.1 + * dep: serve-favicon@2.0.0 + * dep: serve-index@1.0.2 + * update debug to 0.8.0 + * add `enable()` method + * change from stderr to stdout + * update methods to 1.0.0 + - add PURGE + * update mkdirp to 0.5.0 + +3.5.3 / 2014-05-08 +================== + + * fix `req.host` for IPv6 literals + * fix `res.jsonp` error if callback param is object + +3.5.2 / 2014-04-24 +================== + + * update connect to 2.14.5 + * update cookie to 0.1.2 + * update mkdirp to 0.4.0 + * update send to 0.3.0 + +3.5.1 / 2014-03-25 +================== + + * pin less-middleware in generated app + +3.5.0 / 2014-03-06 +================== + + * bump deps + +3.4.8 / 2014-01-13 +================== + + * prevent incorrect automatic OPTIONS responses #1868 @dpatti + * update binary and examples for jade 1.0 #1876 @yossi, #1877 @reqshark, #1892 @matheusazzi + * throw 400 in case of malformed paths @rlidwka + +3.4.7 / 2013-12-10 +================== + + * update connect + +3.4.6 / 2013-12-01 +================== + + * update connect (raw-body) + +3.4.5 / 2013-11-27 +================== + + * update connect + * res.location: remove leading ./ #1802 @kapouer + * res.redirect: fix `res.redirect('toString') #1829 @michaelficarra + * res.send: always send ETag when content-length > 0 + * router: add Router.all() method + +3.4.4 / 2013-10-29 +================== + + * update connect + * update supertest + * update methods + * express(1): replace bodyParser() with urlencoded() and json() #1795 @chirag04 + +3.4.3 / 2013-10-23 +================== + + * update connect + +3.4.2 / 2013-10-18 +================== + + * update connect + * downgrade commander + +3.4.1 / 2013-10-15 +================== + + * update connect + * update commander + * jsonp: check if callback is a function + * router: wrap encodeURIComponent in a try/catch #1735 (@lxe) + * res.format: now includes charset @1747 (@sorribas) + * res.links: allow multiple calls @1746 (@sorribas) + +3.4.0 / 2013-09-07 +================== + + * add res.vary(). Closes #1682 + * update connect + +3.3.8 / 2013-09-02 +================== + + * update connect + +3.3.7 / 2013-08-28 +================== + + * update connect + +3.3.6 / 2013-08-27 +================== + + * Revert "remove charset from json responses. Closes #1631" (causes issues in some clients) + * add: req.accepts take an argument list + +3.3.4 / 2013-07-08 +================== + + * update send and connect + +3.3.3 / 2013-07-04 +================== + + * update connect + +3.3.2 / 2013-07-03 +================== + + * update connect + * update send + * remove .version export + +3.3.1 / 2013-06-27 +================== + + * update connect + +3.3.0 / 2013-06-26 +================== + + * update connect + * add support for multiple X-Forwarded-Proto values. Closes #1646 + * change: remove charset from json responses. Closes #1631 + * change: return actual booleans from req.accept* functions + * fix jsonp callback array throw + +3.2.6 / 2013-06-02 +================== + + * update connect + +3.2.5 / 2013-05-21 +================== + + * update connect + * update node-cookie + * add: throw a meaningful error when there is no default engine + * change generation of ETags with res.send() to GET requests only. Closes #1619 + +3.2.4 / 2013-05-09 +================== + + * fix `req.subdomains` when no Host is present + * fix `req.host` when no Host is present, return undefined + +3.2.3 / 2013-05-07 +================== + + * update connect / qs + +3.2.2 / 2013-05-03 +================== + + * update qs + +3.2.1 / 2013-04-29 +================== + + * add app.VERB() paths array deprecation warning + * update connect + * update qs and remove all ~ semver crap + * fix: accept number as value of Signed Cookie + +3.2.0 / 2013-04-15 +================== + + * add "view" constructor setting to override view behaviour + * add req.acceptsEncoding(name) + * add req.acceptedEncodings + * revert cookie signature change causing session race conditions + * fix sorting of Accept values of the same quality + +3.1.2 / 2013-04-12 +================== + + * add support for custom Accept parameters + * update cookie-signature + +3.1.1 / 2013-04-01 +================== + + * add X-Forwarded-Host support to `req.host` + * fix relative redirects + * update mkdirp + * update buffer-crc32 + * remove legacy app.configure() method from app template. + +3.1.0 / 2013-01-25 +================== + + * add support for leading "." in "view engine" setting + * add array support to `res.set()` + * add node 0.8.x to travis.yml + * add "subdomain offset" setting for tweaking `req.subdomains` + * add `res.location(url)` implementing `res.redirect()`-like setting of Location + * use app.get() for x-powered-by setting for inheritance + * fix colons in passwords for `req.auth` + +3.0.6 / 2013-01-04 +================== + + * add http verb methods to Router + * update connect + * fix mangling of the `res.cookie()` options object + * fix jsonp whitespace escape. Closes #1132 + +3.0.5 / 2012-12-19 +================== + + * add throwing when a non-function is passed to a route + * fix: explicitly remove Transfer-Encoding header from 204 and 304 responses + * revert "add 'etag' option" + +3.0.4 / 2012-12-05 +================== + + * add 'etag' option to disable `res.send()` Etags + * add escaping of urls in text/plain in `res.redirect()` + for old browsers interpreting as html + * change crc32 module for a more liberal license + * update connect + +3.0.3 / 2012-11-13 +================== + + * update connect + * update cookie module + * fix cookie max-age + +3.0.2 / 2012-11-08 +================== + + * add OPTIONS to cors example. Closes #1398 + * fix route chaining regression. Closes #1397 + +3.0.1 / 2012-11-01 +================== + + * update connect + +3.0.0 / 2012-10-23 +================== + + * add `make clean` + * add "Basic" check to req.auth + * add `req.auth` test coverage + * add cb && cb(payload) to `res.jsonp()`. Closes #1374 + * add backwards compat for `res.redirect()` status. Closes #1336 + * add support for `res.json()` to retain previously defined Content-Types. Closes #1349 + * update connect + * change `res.redirect()` to utilize a pathname-relative Location again. Closes #1382 + * remove non-primitive string support for `res.send()` + * fix view-locals example. Closes #1370 + * fix route-separation example + +3.0.0rc5 / 2012-09-18 +================== + + * update connect + * add redis search example + * add static-files example + * add "x-powered-by" setting (`app.disable('x-powered-by')`) + * add "application/octet-stream" redirect Accept test case. Closes #1317 + +3.0.0rc4 / 2012-08-30 +================== + + * add `res.jsonp()`. Closes #1307 + * add "verbose errors" option to error-pages example + * add another route example to express(1) so people are not so confused + * add redis online user activity tracking example + * update connect dep + * fix etag quoting. Closes #1310 + * fix error-pages 404 status + * fix jsonp callback char restrictions + * remove old OPTIONS default response + +3.0.0rc3 / 2012-08-13 +================== + + * update connect dep + * fix signed cookies to work with `connect.cookieParser()` ("s:" prefix was missing) [tnydwrds] + * fix `res.render()` clobbering of "locals" + +3.0.0rc2 / 2012-08-03 +================== + + * add CORS example + * update connect dep + * deprecate `.createServer()` & remove old stale examples + * fix: escape `res.redirect()` link + * fix vhost example + +3.0.0rc1 / 2012-07-24 +================== + + * add more examples to view-locals + * add scheme-relative redirects (`res.redirect("//foo.com")`) support + * update cookie dep + * update connect dep + * update send dep + * fix `express(1)` -h flag, use -H for hogan. Closes #1245 + * fix `res.sendfile()` socket error handling regression + +3.0.0beta7 / 2012-07-16 +================== + + * update connect dep for `send()` root normalization regression + +3.0.0beta6 / 2012-07-13 +================== + + * add `err.view` property for view errors. Closes #1226 + * add "jsonp callback name" setting + * add support for "/foo/:bar*" non-greedy matches + * change `res.sendfile()` to use `send()` module + * change `res.send` to use "response-send" module + * remove `app.locals.use` and `res.locals.use`, use regular middleware + +3.0.0beta5 / 2012-07-03 +================== + + * add "make check" support + * add route-map example + * add `res.json(obj, status)` support back for BC + * add "methods" dep, remove internal methods module + * update connect dep + * update auth example to utilize cores pbkdf2 + * updated tests to use "supertest" + +3.0.0beta4 / 2012-06-25 +================== + + * Added `req.auth` + * Added `req.range(size)` + * Added `res.links(obj)` + * Added `res.send(body, status)` support back for backwards compat + * Added `.default()` support to `res.format()` + * Added 2xx / 304 check to `req.fresh` + * Revert "Added + support to the router" + * Fixed `res.send()` freshness check, respect res.statusCode + +3.0.0beta3 / 2012-06-15 +================== + + * Added hogan `--hjs` to express(1) [nullfirm] + * Added another example to content-negotiation + * Added `fresh` dep + * Changed: `res.send()` always checks freshness + * Fixed: expose connects mime module. Closes #1165 + +3.0.0beta2 / 2012-06-06 +================== + + * Added `+` support to the router + * Added `req.host` + * Changed `req.param()` to check route first + * Update connect dep + +3.0.0beta1 / 2012-06-01 +================== + + * Added `res.format()` callback to override default 406 behaviour + * Fixed `res.redirect()` 406. Closes #1154 + +3.0.0alpha5 / 2012-05-30 +================== + + * Added `req.ip` + * Added `{ signed: true }` option to `res.cookie()` + * Removed `res.signedCookie()` + * Changed: dont reverse `req.ips` + * Fixed "trust proxy" setting check for `req.ips` + +3.0.0alpha4 / 2012-05-09 +================== + + * Added: allow `[]` in jsonp callback. Closes #1128 + * Added `PORT` env var support in generated template. Closes #1118 [benatkin] + * Updated: connect 2.2.2 + +3.0.0alpha3 / 2012-05-04 +================== + + * Added public `app.routes`. Closes #887 + * Added _view-locals_ example + * Added _mvc_ example + * Added `res.locals.use()`. Closes #1120 + * Added conditional-GET support to `res.send()` + * Added: coerce `res.set()` values to strings + * Changed: moved `static()` in generated apps below router + * Changed: `res.send()` only set ETag when not previously set + * Changed connect 2.2.1 dep + * Changed: `make test` now runs unit / acceptance tests + * Fixed req/res proto inheritance + +3.0.0alpha2 / 2012-04-26 +================== + + * Added `make benchmark` back + * Added `res.send()` support for `String` objects + * Added client-side data exposing example + * Added `res.header()` and `req.header()` aliases for BC + * Added `express.createServer()` for BC + * Perf: memoize parsed urls + * Perf: connect 2.2.0 dep + * Changed: make `expressInit()` middleware self-aware + * Fixed: use app.get() for all core settings + * Fixed redis session example + * Fixed session example. Closes #1105 + * Fixed generated express dep. Closes #1078 + +3.0.0alpha1 / 2012-04-15 +================== + + * Added `app.locals.use(callback)` + * Added `app.locals` object + * Added `app.locals(obj)` + * Added `res.locals` object + * Added `res.locals(obj)` + * Added `res.format()` for content-negotiation + * Added `app.engine()` + * Added `res.cookie()` JSON cookie support + * Added "trust proxy" setting + * Added `req.subdomains` + * Added `req.protocol` + * Added `req.secure` + * Added `req.path` + * Added `req.ips` + * Added `req.fresh` + * Added `req.stale` + * Added comma-delimited / array support for `req.accepts()` + * Added debug instrumentation + * Added `res.set(obj)` + * Added `res.set(field, value)` + * Added `res.get(field)` + * Added `app.get(setting)`. Closes #842 + * Added `req.acceptsLanguage()` + * Added `req.acceptsCharset()` + * Added `req.accepted` + * Added `req.acceptedLanguages` + * Added `req.acceptedCharsets` + * Added "json replacer" setting + * Added "json spaces" setting + * Added X-Forwarded-Proto support to `res.redirect()`. Closes #92 + * Added `--less` support to express(1) + * Added `express.response` prototype + * Added `express.request` prototype + * Added `express.application` prototype + * Added `app.path()` + * Added `app.render()` + * Added `res.type()` to replace `res.contentType()` + * Changed: `res.redirect()` to add relative support + * Changed: enable "jsonp callback" by default + * Changed: renamed "case sensitive routes" to "case sensitive routing" + * Rewrite of all tests with mocha + * Removed "root" setting + * Removed `res.redirect('home')` support + * Removed `req.notify()` + * Removed `app.register()` + * Removed `app.redirect()` + * Removed `app.is()` + * Removed `app.helpers()` + * Removed `app.dynamicHelpers()` + * Fixed `res.sendfile()` with non-GET. Closes #723 + * Fixed express(1) public dir for windows. Closes #866 + +2.5.9/ 2012-04-02 +================== + + * Added support for PURGE request method [pbuyle] + * Fixed `express(1)` generated app `app.address()` before `listening` [mmalecki] + +2.5.8 / 2012-02-08 +================== + + * Update mkdirp dep. Closes #991 + +2.5.7 / 2012-02-06 +================== + + * Fixed `app.all` duplicate DELETE requests [mscdex] + +2.5.6 / 2012-01-13 +================== + + * Updated hamljs dev dep. Closes #953 + +2.5.5 / 2012-01-08 +================== + + * Fixed: set `filename` on cached templates [matthewleon] + +2.5.4 / 2012-01-02 +================== + + * Fixed `express(1)` eol on 0.4.x. Closes #947 + +2.5.3 / 2011-12-30 +================== + + * Fixed `req.is()` when a charset is present + +2.5.2 / 2011-12-10 +================== + + * Fixed: express(1) LF -> CRLF for windows + +2.5.1 / 2011-11-17 +================== + + * Changed: updated connect to 1.8.x + * Removed sass.js support from express(1) + +2.5.0 / 2011-10-24 +================== + + * Added ./routes dir for generated app by default + * Added npm install reminder to express(1) app gen + * Added 0.5.x support + * Removed `make test-cov` since it wont work with node 0.5.x + * Fixed express(1) public dir for windows. Closes #866 + +2.4.7 / 2011-10-05 +================== + + * Added mkdirp to express(1). Closes #795 + * Added simple _json-config_ example + * Added shorthand for the parsed request's pathname via `req.path` + * Changed connect dep to 1.7.x to fix npm issue... + * Fixed `res.redirect()` __HEAD__ support. [reported by xerox] + * Fixed `req.flash()`, only escape args + * Fixed absolute path checking on windows. Closes #829 [reported by andrewpmckenzie] + +2.4.6 / 2011-08-22 +================== + + * Fixed multiple param callback regression. Closes #824 [reported by TroyGoode] + +2.4.5 / 2011-08-19 +================== + + * Added support for routes to handle errors. Closes #809 + * Added `app.routes.all()`. Closes #803 + * Added "basepath" setting to work in conjunction with reverse proxies etc. + * Refactored `Route` to use a single array of callbacks + * Added support for multiple callbacks for `app.param()`. Closes #801 +Closes #805 + * Changed: removed .call(self) for route callbacks + * Dependency: `qs >= 0.3.1` + * Fixed `res.redirect()` on windows due to `join()` usage. Closes #808 + +2.4.4 / 2011-08-05 +================== + + * Fixed `res.header()` intention of a set, even when `undefined` + * Fixed `*`, value no longer required + * Fixed `res.send(204)` support. Closes #771 + +2.4.3 / 2011-07-14 +================== + + * Added docs for `status` option special-case. Closes #739 + * Fixed `options.filename`, exposing the view path to template engines + +2.4.2. / 2011-07-06 +================== + + * Revert "removed jsonp stripping" for XSS + +2.4.1 / 2011-07-06 +================== + + * Added `res.json()` JSONP support. Closes #737 + * Added _extending-templates_ example. Closes #730 + * Added "strict routing" setting for trailing slashes + * Added support for multiple envs in `app.configure()` calls. Closes #735 + * Changed: `res.send()` using `res.json()` + * Changed: when cookie `path === null` don't default it + * Changed; default cookie path to "home" setting. Closes #731 + * Removed _pids/logs_ creation from express(1) + +2.4.0 / 2011-06-28 +================== + + * Added chainable `res.status(code)` + * Added `res.json()`, an explicit version of `res.send(obj)` + * Added simple web-service example + +2.3.12 / 2011-06-22 +================== + + * \#express is now on freenode! come join! + * Added `req.get(field, param)` + * Added links to Japanese documentation, thanks @hideyukisaito! + * Added; the `express(1)` generated app outputs the env + * Added `content-negotiation` example + * Dependency: connect >= 1.5.1 < 2.0.0 + * Fixed view layout bug. Closes #720 + * Fixed; ignore body on 304. Closes #701 + +2.3.11 / 2011-06-04 +================== + + * Added `npm test` + * Removed generation of dummy test file from `express(1)` + * Fixed; `express(1)` adds express as a dep + * Fixed; prune on `prepublish` + +2.3.10 / 2011-05-27 +================== + + * Added `req.route`, exposing the current route + * Added _package.json_ generation support to `express(1)` + * Fixed call to `app.param()` function for optional params. Closes #682 + +2.3.9 / 2011-05-25 +================== + + * Fixed bug-ish with `../' in `res.partial()` calls + +2.3.8 / 2011-05-24 +================== + + * Fixed `app.options()` + +2.3.7 / 2011-05-23 +================== + + * Added route `Collection`, ex: `app.get('/user/:id').remove();` + * Added support for `app.param(fn)` to define param logic + * Removed `app.param()` support for callback with return value + * Removed module.parent check from express(1) generated app. Closes #670 + * Refactored router. Closes #639 + +2.3.6 / 2011-05-20 +================== + + * Changed; using devDependencies instead of git submodules + * Fixed redis session example + * Fixed markdown example + * Fixed view caching, should not be enabled in development + +2.3.5 / 2011-05-20 +================== + + * Added export `.view` as alias for `.View` + +2.3.4 / 2011-05-08 +================== + + * Added `./examples/say` + * Fixed `res.sendfile()` bug preventing the transfer of files with spaces + +2.3.3 / 2011-05-03 +================== + + * Added "case sensitive routes" option. + * Changed; split methods supported per rfc [slaskis] + * Fixed route-specific middleware when using the same callback function several times + +2.3.2 / 2011-04-27 +================== + + * Fixed view hints + +2.3.1 / 2011-04-26 +================== + + * Added `app.match()` as `app.match.all()` + * Added `app.lookup()` as `app.lookup.all()` + * Added `app.remove()` for `app.remove.all()` + * Added `app.remove.VERB()` + * Fixed template caching collision issue. Closes #644 + * Moved router over from connect and started refactor + +2.3.0 / 2011-04-25 +================== + + * Added options support to `res.clearCookie()` + * Added `res.helpers()` as alias of `res.locals()` + * Added; json defaults to UTF-8 with `res.send()`. Closes #632. [Daniel * Dependency `connect >= 1.4.0` + * Changed; auto set Content-Type in res.attachement [Aaron Heckmann] + * Renamed "cache views" to "view cache". Closes #628 + * Fixed caching of views when using several apps. Closes #637 + * Fixed gotcha invoking `app.param()` callbacks once per route middleware. +Closes #638 + * Fixed partial lookup precedence. Closes #631 +Shaw] + +2.2.2 / 2011-04-12 +================== + + * Added second callback support for `res.download()` connection errors + * Fixed `filename` option passing to template engine + +2.2.1 / 2011-04-04 +================== + + * Added `layout(path)` helper to change the layout within a view. Closes #610 + * Fixed `partial()` collection object support. + Previously only anything with `.length` would work. + When `.length` is present one must still be aware of holes, + however now `{ collection: {foo: 'bar'}}` is valid, exposes + `keyInCollection` and `keysInCollection`. + + * Performance improved with better view caching + * Removed `request` and `response` locals + * Changed; errorHandler page title is now `Express` instead of `Connect` + +2.2.0 / 2011-03-30 +================== + + * Added `app.lookup.VERB()`, ex `app.lookup.put('/user/:id')`. Closes #606 + * Added `app.match.VERB()`, ex `app.match.put('/user/12')`. Closes #606 + * Added `app.VERB(path)` as alias of `app.lookup.VERB()`. + * Dependency `connect >= 1.2.0` + +2.1.1 / 2011-03-29 +================== + + * Added; expose `err.view` object when failing to locate a view + * Fixed `res.partial()` call `next(err)` when no callback is given [reported by aheckmann] + * Fixed; `res.send(undefined)` responds with 204 [aheckmann] + +2.1.0 / 2011-03-24 +================== + + * Added `<root>/_?<name>` partial lookup support. Closes #447 + * Added `request`, `response`, and `app` local variables + * Added `settings` local variable, containing the app's settings + * Added `req.flash()` exception if `req.session` is not available + * Added `res.send(bool)` support (json response) + * Fixed stylus example for latest version + * Fixed; wrap try/catch around `res.render()` + +2.0.0 / 2011-03-17 +================== + + * Fixed up index view path alternative. + * Changed; `res.locals()` without object returns the locals + +2.0.0rc3 / 2011-03-17 +================== + + * Added `res.locals(obj)` to compliment `res.local(key, val)` + * Added `res.partial()` callback support + * Fixed recursive error reporting issue in `res.render()` + +2.0.0rc2 / 2011-03-17 +================== + + * Changed; `partial()` "locals" are now optional + * Fixed `SlowBuffer` support. Closes #584 [reported by tyrda01] + * Fixed .filename view engine option [reported by drudge] + * Fixed blog example + * Fixed `{req,res}.app` reference when mounting [Ben Weaver] + +2.0.0rc / 2011-03-14 +================== + + * Fixed; expose `HTTPSServer` constructor + * Fixed express(1) default test charset. Closes #579 [reported by secoif] + * Fixed; default charset to utf-8 instead of utf8 for lame IE [reported by NickP] + +2.0.0beta3 / 2011-03-09 +================== + + * Added support for `res.contentType()` literal + The original `res.contentType('.json')`, + `res.contentType('application/json')`, and `res.contentType('json')` + will work now. + * Added `res.render()` status option support back + * Added charset option for `res.render()` + * Added `.charset` support (via connect 1.0.4) + * Added view resolution hints when in development and a lookup fails + * Added layout lookup support relative to the page view. + For example while rendering `./views/user/index.jade` if you create + `./views/user/layout.jade` it will be used in favour of the root layout. + * Fixed `res.redirect()`. RFC states absolute url [reported by unlink] + * Fixed; default `res.send()` string charset to utf8 + * Removed `Partial` constructor (not currently used) + +2.0.0beta2 / 2011-03-07 +================== + + * Added res.render() `.locals` support back to aid in migration process + * Fixed flash example + +2.0.0beta / 2011-03-03 +================== + + * Added HTTPS support + * Added `res.cookie()` maxAge support + * Added `req.header()` _Referrer_ / _Referer_ special-case, either works + * Added mount support for `res.redirect()`, now respects the mount-point + * Added `union()` util, taking place of `merge(clone())` combo + * Added stylus support to express(1) generated app + * Added secret to session middleware used in examples and generated app + * Added `res.local(name, val)` for progressive view locals + * Added default param support to `req.param(name, default)` + * Added `app.disabled()` and `app.enabled()` + * Added `app.register()` support for omitting leading ".", either works + * Added `res.partial()`, using the same interface as `partial()` within a view. Closes #539 + * Added `app.param()` to map route params to async/sync logic + * Added; aliased `app.helpers()` as `app.locals()`. Closes #481 + * Added extname with no leading "." support to `res.contentType()` + * Added `cache views` setting, defaulting to enabled in "production" env + * Added index file partial resolution, eg: partial('user') may try _views/user/index.jade_. + * Added `req.accepts()` support for extensions + * Changed; `res.download()` and `res.sendfile()` now utilize Connect's + static file server `connect.static.send()`. + * Changed; replaced `connect.utils.mime()` with npm _mime_ module + * Changed; allow `req.query` to be pre-defined (via middleware or other parent + * Changed view partial resolution, now relative to parent view + * Changed view engine signature. no longer `engine.render(str, options, callback)`, now `engine.compile(str, options) -> Function`, the returned function accepts `fn(locals)`. + * Fixed `req.param()` bug returning Array.prototype methods. Closes #552 + * Fixed; using `Stream#pipe()` instead of `sys.pump()` in `res.sendfile()` + * Fixed; using _qs_ module instead of _querystring_ + * Fixed; strip unsafe chars from jsonp callbacks + * Removed "stream threshold" setting + +1.0.8 / 2011-03-01 +================== + + * Allow `req.query` to be pre-defined (via middleware or other parent app) + * "connect": ">= 0.5.0 < 1.0.0". Closes #547 + * Removed the long deprecated __EXPRESS_ENV__ support + +1.0.7 / 2011-02-07 +================== + + * Fixed `render()` setting inheritance. + Mounted apps would not inherit "view engine" + +1.0.6 / 2011-02-07 +================== + + * Fixed `view engine` setting bug when period is in dirname + +1.0.5 / 2011-02-05 +================== + + * Added secret to generated app `session()` call + +1.0.4 / 2011-02-05 +================== + + * Added `qs` dependency to _package.json_ + * Fixed namespaced `require()`s for latest connect support + +1.0.3 / 2011-01-13 +================== + + * Remove unsafe characters from JSONP callback names [Ryan Grove] + +1.0.2 / 2011-01-10 +================== + + * Removed nested require, using `connect.router` + +1.0.1 / 2010-12-29 +================== + + * Fixed for middleware stacked via `createServer()` + previously the `foo` middleware passed to `createServer(foo)` + would not have access to Express methods such as `res.send()` + or props like `req.query` etc. + +1.0.0 / 2010-11-16 +================== + + * Added; deduce partial object names from the last segment. + For example by default `partial('forum/post', postObject)` will + give you the _post_ object, providing a meaningful default. + * Added http status code string representation to `res.redirect()` body + * Added; `res.redirect()` supporting _text/plain_ and _text/html_ via __Accept__. + * Added `req.is()` to aid in content negotiation + * Added partial local inheritance [suggested by masylum]. Closes #102 + providing access to parent template locals. + * Added _-s, --session[s]_ flag to express(1) to add session related middleware + * Added _--template_ flag to express(1) to specify the + template engine to use. + * Added _--css_ flag to express(1) to specify the + stylesheet engine to use (or just plain css by default). + * Added `app.all()` support [thanks aheckmann] + * Added partial direct object support. + You may now `partial('user', user)` providing the "user" local, + vs previously `partial('user', { object: user })`. + * Added _route-separation_ example since many people question ways + to do this with CommonJS modules. Also view the _blog_ example for + an alternative. + * Performance; caching view path derived partial object names + * Fixed partial local inheritance precedence. [reported by Nick Poulden] Closes #454 + * Fixed jsonp support; _text/javascript_ as per mailinglist discussion + +1.0.0rc4 / 2010-10-14 +================== + + * Added _NODE_ENV_ support, _EXPRESS_ENV_ is deprecated and will be removed in 1.0.0 + * Added route-middleware support (very helpful, see the [docs](http://expressjs.com/guide.html#Route-Middleware)) + * Added _jsonp callback_ setting to enable/disable jsonp autowrapping [Dav Glass] + * Added callback query check on response.send to autowrap JSON objects for simple webservice implementations [Dav Glass] + * Added `partial()` support for array-like collections. Closes #434 + * Added support for swappable querystring parsers + * Added session usage docs. Closes #443 + * Added dynamic helper caching. Closes #439 [suggested by maritz] + * Added authentication example + * Added basic Range support to `res.sendfile()` (and `res.download()` etc) + * Changed; `express(1)` generated app using 2 spaces instead of 4 + * Default env to "development" again [aheckmann] + * Removed _context_ option is no more, use "scope" + * Fixed; exposing _./support_ libs to examples so they can run without installs + * Fixed mvc example + +1.0.0rc3 / 2010-09-20 +================== + + * Added confirmation for `express(1)` app generation. Closes #391 + * Added extending of flash formatters via `app.flashFormatters` + * Added flash formatter support. Closes #411 + * Added streaming support to `res.sendfile()` using `sys.pump()` when >= "stream threshold" + * Added _stream threshold_ setting for `res.sendfile()` + * Added `res.send()` __HEAD__ support + * Added `res.clearCookie()` + * Added `res.cookie()` + * Added `res.render()` headers option + * Added `res.redirect()` response bodies + * Added `res.render()` status option support. Closes #425 [thanks aheckmann] + * Fixed `res.sendfile()` responding with 403 on malicious path + * Fixed `res.download()` bug; when an error occurs remove _Content-Disposition_ + * Fixed; mounted apps settings now inherit from parent app [aheckmann] + * Fixed; stripping Content-Length / Content-Type when 204 + * Fixed `res.send()` 204. Closes #419 + * Fixed multiple _Set-Cookie_ headers via `res.header()`. Closes #402 + * Fixed bug messing with error handlers when `listenFD()` is called instead of `listen()`. [thanks guillermo] + + +1.0.0rc2 / 2010-08-17 +================== + + * Added `app.register()` for template engine mapping. Closes #390 + * Added `res.render()` callback support as second argument (no options) + * Added callback support to `res.download()` + * Added callback support for `res.sendfile()` + * Added support for middleware access via `express.middlewareName()` vs `connect.middlewareName()` + * Added "partials" setting to docs + * Added default expresso tests to `express(1)` generated app. Closes #384 + * Fixed `res.sendfile()` error handling, defer via `next()` + * Fixed `res.render()` callback when a layout is used [thanks guillermo] + * Fixed; `make install` creating ~/.node_libraries when not present + * Fixed issue preventing error handlers from being defined anywhere. Closes #387 + +1.0.0rc / 2010-07-28 +================== + + * Added mounted hook. Closes #369 + * Added connect dependency to _package.json_ + + * Removed "reload views" setting and support code + development env never caches, production always caches. + + * Removed _param_ in route callbacks, signature is now + simply (req, res, next), previously (req, res, params, next). + Use _req.params_ for path captures, _req.query_ for GET params. + + * Fixed "home" setting + * Fixed middleware/router precedence issue. Closes #366 + * Fixed; _configure()_ callbacks called immediately. Closes #368 + +1.0.0beta2 / 2010-07-23 +================== + + * Added more examples + * Added; exporting `Server` constructor + * Added `Server#helpers()` for view locals + * Added `Server#dynamicHelpers()` for dynamic view locals. Closes #349 + * Added support for absolute view paths + * Added; _home_ setting defaults to `Server#route` for mounted apps. Closes #363 + * Added Guillermo Rauch to the contributor list + * Added support for "as" for non-collection partials. Closes #341 + * Fixed _install.sh_, ensuring _~/.node_libraries_ exists. Closes #362 [thanks jf] + * Fixed `res.render()` exceptions, now passed to `next()` when no callback is given [thanks guillermo] + * Fixed instanceof `Array` checks, now `Array.isArray()` + * Fixed express(1) expansion of public dirs. Closes #348 + * Fixed middleware precedence. Closes #345 + * Fixed view watcher, now async [thanks aheckmann] + +1.0.0beta / 2010-07-15 +================== + + * Re-write + - much faster + - much lighter + - Check [ExpressJS.com](http://expressjs.com) for migration guide and updated docs + +0.14.0 / 2010-06-15 +================== + + * Utilize relative requires + * Added Static bufferSize option [aheckmann] + * Fixed caching of view and partial subdirectories [aheckmann] + * Fixed mime.type() comments now that ".ext" is not supported + * Updated haml submodule + * Updated class submodule + * Removed bin/express + +0.13.0 / 2010-06-01 +================== + + * Added node v0.1.97 compatibility + * Added support for deleting cookies via Request#cookie('key', null) + * Updated haml submodule + * Fixed not-found page, now using using charset utf-8 + * Fixed show-exceptions page, now using using charset utf-8 + * Fixed view support due to fs.readFile Buffers + * Changed; mime.type() no longer accepts ".type" due to node extname() changes + +0.12.0 / 2010-05-22 +================== + + * Added node v0.1.96 compatibility + * Added view `helpers` export which act as additional local variables + * Updated haml submodule + * Changed ETag; removed inode, modified time only + * Fixed LF to CRLF for setting multiple cookies + * Fixed cookie compilation; values are now urlencoded + * Fixed cookies parsing; accepts quoted values and url escaped cookies + +0.11.0 / 2010-05-06 +================== + + * Added support for layouts using different engines + - this.render('page.html.haml', { layout: 'super-cool-layout.html.ejs' }) + - this.render('page.html.haml', { layout: 'foo' }) // assumes 'foo.html.haml' + - this.render('page.html.haml', { layout: false }) // no layout + * Updated ext submodule + * Updated haml submodule + * Fixed EJS partial support by passing along the context. Issue #307 + +0.10.1 / 2010-05-03 +================== + + * Fixed binary uploads. + +0.10.0 / 2010-04-30 +================== + + * Added charset support via Request#charset (automatically assigned to 'UTF-8' when respond()'s + encoding is set to 'utf8' or 'utf-8'. + * Added "encoding" option to Request#render(). Closes #299 + * Added "dump exceptions" setting, which is enabled by default. + * Added simple ejs template engine support + * Added error response support for text/plain, application/json. Closes #297 + * Added callback function param to Request#error() + * Added Request#sendHead() + * Added Request#stream() + * Added support for Request#respond(304, null) for empty response bodies + * Added ETag support to Request#sendfile() + * Added options to Request#sendfile(), passed to fs.createReadStream() + * Added filename arg to Request#download() + * Performance enhanced due to pre-reversing plugins so that plugins.reverse() is not called on each request + * Performance enhanced by preventing several calls to toLowerCase() in Router#match() + * Changed; Request#sendfile() now streams + * Changed; Renamed Request#halt() to Request#respond(). Closes #289 + * Changed; Using sys.inspect() instead of JSON.encode() for error output + * Changed; run() returns the http.Server instance. Closes #298 + * Changed; Defaulting Server#host to null (INADDR_ANY) + * Changed; Logger "common" format scale of 0.4f + * Removed Logger "request" format + * Fixed; Catching ENOENT in view caching, preventing error when "views/partials" is not found + * Fixed several issues with http client + * Fixed Logger Content-Length output + * Fixed bug preventing Opera from retaining the generated session id. Closes #292 + +0.9.0 / 2010-04-14 +================== + + * Added DSL level error() route support + * Added DSL level notFound() route support + * Added Request#error() + * Added Request#notFound() + * Added Request#render() callback function. Closes #258 + * Added "max upload size" setting + * Added "magic" variables to collection partials (\_\_index\_\_, \_\_length\_\_, \_\_isFirst\_\_, \_\_isLast\_\_). Closes #254 + * Added [haml.js](http://github.com/visionmedia/haml.js) submodule; removed haml-js + * Added callback function support to Request#halt() as 3rd/4th arg + * Added preprocessing of route param wildcards using param(). Closes #251 + * Added view partial support (with collections etc) + * Fixed bug preventing falsey params (such as ?page=0). Closes #286 + * Fixed setting of multiple cookies. Closes #199 + * Changed; view naming convention is now NAME.TYPE.ENGINE (for example page.html.haml) + * Changed; session cookie is now httpOnly + * Changed; Request is no longer global + * Changed; Event is no longer global + * Changed; "sys" module is no longer global + * Changed; moved Request#download to Static plugin where it belongs + * Changed; Request instance created before body parsing. Closes #262 + * Changed; Pre-caching views in memory when "cache view contents" is enabled. Closes #253 + * Changed; Pre-caching view partials in memory when "cache view partials" is enabled + * Updated support to node --version 0.1.90 + * Updated dependencies + * Removed set("session cookie") in favour of use(Session, { cookie: { ... }}) + * Removed utils.mixin(); use Object#mergeDeep() + +0.8.0 / 2010-03-19 +================== + + * Added coffeescript example app. Closes #242 + * Changed; cache api now async friendly. Closes #240 + * Removed deprecated 'express/static' support. Use 'express/plugins/static' + +0.7.6 / 2010-03-19 +================== + + * Added Request#isXHR. Closes #229 + * Added `make install` (for the executable) + * Added `express` executable for setting up simple app templates + * Added "GET /public/*" to Static plugin, defaulting to <root>/public + * Added Static plugin + * Fixed; Request#render() only calls cache.get() once + * Fixed; Namespacing View caches with "view:" + * Fixed; Namespacing Static caches with "static:" + * Fixed; Both example apps now use the Static plugin + * Fixed set("views"). Closes #239 + * Fixed missing space for combined log format + * Deprecated Request#sendfile() and 'express/static' + * Removed Server#running + +0.7.5 / 2010-03-16 +================== + + * Added Request#flash() support without args, now returns all flashes + * Updated ext submodule + +0.7.4 / 2010-03-16 +================== + + * Fixed session reaper + * Changed; class.js replacing js-oo Class implementation (quite a bit faster, no browser cruft) + +0.7.3 / 2010-03-16 +================== + + * Added package.json + * Fixed requiring of haml / sass due to kiwi removal + +0.7.2 / 2010-03-16 +================== + + * Fixed GIT submodules (HAH!) + +0.7.1 / 2010-03-16 +================== + + * Changed; Express now using submodules again until a PM is adopted + * Changed; chat example using millisecond conversions from ext + +0.7.0 / 2010-03-15 +================== + + * Added Request#pass() support (finds the next matching route, or the given path) + * Added Logger plugin (default "common" format replaces CommonLogger) + * Removed Profiler plugin + * Removed CommonLogger plugin + +0.6.0 / 2010-03-11 +================== + + * Added seed.yml for kiwi package management support + * Added HTTP client query string support when method is GET. Closes #205 + + * Added support for arbitrary view engines. + For example "foo.engine.html" will now require('engine'), + the exports from this module are cached after the first require(). + + * Added async plugin support + + * Removed usage of RESTful route funcs as http client + get() etc, use http.get() and friends + + * Removed custom exceptions + +0.5.0 / 2010-03-10 +================== + + * Added ext dependency (library of js extensions) + * Removed extname() / basename() utils. Use path module + * Removed toArray() util. Use arguments.values + * Removed escapeRegexp() util. Use RegExp.escape() + * Removed process.mixin() dependency. Use utils.mixin() + * Removed Collection + * Removed ElementCollection + * Shameless self promotion of ebook "Advanced JavaScript" (http://dev-mag.com) ;) + +0.4.0 / 2010-02-11 +================== + + * Added flash() example to sample upload app + * Added high level restful http client module (express/http) + * Changed; RESTful route functions double as HTTP clients. Closes #69 + * Changed; throwing error when routes are added at runtime + * Changed; defaulting render() context to the current Request. Closes #197 + * Updated haml submodule + +0.3.0 / 2010-02-11 +================== + + * Updated haml / sass submodules. Closes #200 + * Added flash message support. Closes #64 + * Added accepts() now allows multiple args. fixes #117 + * Added support for plugins to halt. Closes #189 + * Added alternate layout support. Closes #119 + * Removed Route#run(). Closes #188 + * Fixed broken specs due to use(Cookie) missing + +0.2.1 / 2010-02-05 +================== + + * Added "plot" format option for Profiler (for gnuplot processing) + * Added request number to Profiler plugin + * Fixed binary encoding for multipart file uploads, was previously defaulting to UTF8 + * Fixed issue with routes not firing when not files are present. Closes #184 + * Fixed process.Promise -> events.Promise + +0.2.0 / 2010-02-03 +================== + + * Added parseParam() support for name[] etc. (allows for file inputs with "multiple" attr) Closes #180 + * Added Both Cache and Session option "reapInterval" may be "reapEvery". Closes #174 + * Added expiration support to cache api with reaper. Closes #133 + * Added cache Store.Memory#reap() + * Added Cache; cache api now uses first class Cache instances + * Added abstract session Store. Closes #172 + * Changed; cache Memory.Store#get() utilizing Collection + * Renamed MemoryStore -> Store.Memory + * Fixed use() of the same plugin several time will always use latest options. Closes #176 + +0.1.0 / 2010-02-03 +================== + + * Changed; Hooks (before / after) pass request as arg as well as evaluated in their context + * Updated node support to 0.1.27 Closes #169 + * Updated dirname(__filename) -> __dirname + * Updated libxmljs support to v0.2.0 + * Added session support with memory store / reaping + * Added quick uid() helper + * Added multi-part upload support + * Added Sass.js support / submodule + * Added production env caching view contents and static files + * Added static file caching. Closes #136 + * Added cache plugin with memory stores + * Added support to StaticFile so that it works with non-textual files. + * Removed dirname() helper + * Removed several globals (now their modules must be required) + +0.0.2 / 2010-01-10 +================== + + * Added view benchmarks; currently haml vs ejs + * Added Request#attachment() specs. Closes #116 + * Added use of node's parseQuery() util. Closes #123 + * Added `make init` for submodules + * Updated Haml + * Updated sample chat app to show messages on load + * Updated libxmljs parseString -> parseHtmlString + * Fixed `make init` to work with older versions of git + * Fixed specs can now run independent specs for those who can't build deps. Closes #127 + * Fixed issues introduced by the node url module changes. Closes 126. + * Fixed two assertions failing due to Collection#keys() returning strings + * Fixed faulty Collection#toArray() spec due to keys() returning strings + * Fixed `make test` now builds libxmljs.node before testing + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/express/LICENSE b/node_modules/express/LICENSE new file mode 100644 index 0000000..aa927e4 --- /dev/null +++ b/node_modules/express/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2009-2014 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2013-2014 Roman Shtylman <shtylman+expressjs@gmail.com> +Copyright (c) 2014-2015 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/express/Readme.md b/node_modules/express/Readme.md new file mode 100644 index 0000000..1f91297 --- /dev/null +++ b/node_modules/express/Readme.md @@ -0,0 +1,155 @@ +[](http://expressjs.com/) + + Fast, unopinionated, minimalist web framework for [node](http://nodejs.org). + + [![NPM Version][npm-image]][npm-url] + [![NPM Downloads][downloads-image]][downloads-url] + [![Linux Build][travis-image]][travis-url] + [![Windows Build][appveyor-image]][appveyor-url] + [![Test Coverage][coveralls-image]][coveralls-url] + +```js +const express = require('express') +const app = express() + +app.get('/', function (req, res) { + res.send('Hello World') +}) + +app.listen(3000) +``` + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). + +Before installing, [download and install Node.js](https://nodejs.org/en/download/). +Node.js 0.10 or higher is required. + +Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install express +``` + +Follow [our installing guide](http://expressjs.com/en/starter/installing.html) +for more information. + +## Features + + * Robust routing + * Focus on high performance + * Super-high test coverage + * HTTP helpers (redirection, caching, etc) + * View system supporting 14+ template engines + * Content negotiation + * Executable for generating applications quickly + +## Docs & Community + + * [Website and Documentation](http://expressjs.com/) - [[website repo](https://github.com/expressjs/expressjs.com)] + * [#express](https://webchat.freenode.net/?channels=express) on freenode IRC + * [GitHub Organization](https://github.com/expressjs) for Official Middleware & Modules + * Visit the [Wiki](https://github.com/expressjs/express/wiki) + * [Google Group](https://groups.google.com/group/express-js) for discussion + * [Gitter](https://gitter.im/expressjs/express) for support and discussion + +**PROTIP** Be sure to read [Migrating from 3.x to 4.x](https://github.com/expressjs/express/wiki/Migrating-from-3.x-to-4.x) as well as [New features in 4.x](https://github.com/expressjs/express/wiki/New-features-in-4.x). + +### Security Issues + +If you discover a security vulnerability in Express, please see [Security Policies and Procedures](Security.md). + +## Quick Start + + The quickest way to get started with express is to utilize the executable [`express(1)`](https://github.com/expressjs/generator) to generate an application as shown below: + + Install the executable. The executable's major version will match Express's: + +```bash +$ npm install -g express-generator@4 +``` + + Create the app: + +```bash +$ express /tmp/foo && cd /tmp/foo +``` + + Install dependencies: + +```bash +$ npm install +``` + + Start the server: + +```bash +$ npm start +``` + + View the website at: http://localhost:3000 + +## Philosophy + + The Express philosophy is to provide small, robust tooling for HTTP servers, making + it a great solution for single page applications, web sites, hybrids, or public + HTTP APIs. + + Express does not force you to use any specific ORM or template engine. With support for over + 14 template engines via [Consolidate.js](https://github.com/tj/consolidate.js), + you can quickly craft your perfect framework. + +## Examples + + To view the examples, clone the Express repo and install the dependencies: + +```bash +$ git clone git://github.com/expressjs/express.git --depth 1 +$ cd express +$ npm install +``` + + Then run whichever example you want: + +```bash +$ node examples/content-negotiation +``` + +## Tests + + To run the test suite, first install the dependencies, then run `npm test`: + +```bash +$ npm install +$ npm test +``` + +## Contributing + +[Contributing Guide](Contributing.md) + +## People + +The original author of Express is [TJ Holowaychuk](https://github.com/tj) + +The current lead maintainer is [Douglas Christopher Wilson](https://github.com/dougwilson) + +[List of all contributors](https://github.com/expressjs/express/graphs/contributors) + +## License + + [MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/express.svg +[npm-url]: https://npmjs.org/package/express +[downloads-image]: https://img.shields.io/npm/dm/express.svg +[downloads-url]: https://npmjs.org/package/express +[travis-image]: https://img.shields.io/travis/expressjs/express/master.svg?label=linux +[travis-url]: https://travis-ci.org/expressjs/express +[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/express/master.svg?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/express +[coveralls-image]: https://img.shields.io/coveralls/expressjs/express/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/express?branch=master diff --git a/node_modules/express/index.js b/node_modules/express/index.js new file mode 100644 index 0000000..d219b0c --- /dev/null +++ b/node_modules/express/index.js @@ -0,0 +1,11 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +module.exports = require('./lib/express'); diff --git a/node_modules/express/lib/application.js b/node_modules/express/lib/application.js new file mode 100644 index 0000000..91f77d2 --- /dev/null +++ b/node_modules/express/lib/application.js @@ -0,0 +1,644 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var finalhandler = require('finalhandler'); +var Router = require('./router'); +var methods = require('methods'); +var middleware = require('./middleware/init'); +var query = require('./middleware/query'); +var debug = require('debug')('express:application'); +var View = require('./view'); +var http = require('http'); +var compileETag = require('./utils').compileETag; +var compileQueryParser = require('./utils').compileQueryParser; +var compileTrust = require('./utils').compileTrust; +var deprecate = require('depd')('express'); +var flatten = require('array-flatten'); +var merge = require('utils-merge'); +var resolve = require('path').resolve; +var setPrototypeOf = require('setprototypeof') +var slice = Array.prototype.slice; + +/** + * Application prototype. + */ + +var app = exports = module.exports = {}; + +/** + * Variable for trust proxy inheritance back-compat + * @private + */ + +var trustProxyDefaultSymbol = '@@symbol:trust_proxy_default'; + +/** + * Initialize the server. + * + * - setup default configuration + * - setup default middleware + * - setup route reflection methods + * + * @private + */ + +app.init = function init() { + this.cache = {}; + this.engines = {}; + this.settings = {}; + + this.defaultConfiguration(); +}; + +/** + * Initialize application configuration. + * @private + */ + +app.defaultConfiguration = function defaultConfiguration() { + var env = process.env.NODE_ENV || 'development'; + + // default settings + this.enable('x-powered-by'); + this.set('etag', 'weak'); + this.set('env', env); + this.set('query parser', 'extended'); + this.set('subdomain offset', 2); + this.set('trust proxy', false); + + // trust proxy inherit back-compat + Object.defineProperty(this.settings, trustProxyDefaultSymbol, { + configurable: true, + value: true + }); + + debug('booting in %s mode', env); + + this.on('mount', function onmount(parent) { + // inherit trust proxy + if (this.settings[trustProxyDefaultSymbol] === true + && typeof parent.settings['trust proxy fn'] === 'function') { + delete this.settings['trust proxy']; + delete this.settings['trust proxy fn']; + } + + // inherit protos + setPrototypeOf(this.request, parent.request) + setPrototypeOf(this.response, parent.response) + setPrototypeOf(this.engines, parent.engines) + setPrototypeOf(this.settings, parent.settings) + }); + + // setup locals + this.locals = Object.create(null); + + // top-most app is mounted at / + this.mountpath = '/'; + + // default locals + this.locals.settings = this.settings; + + // default configuration + this.set('view', View); + this.set('views', resolve('views')); + this.set('jsonp callback name', 'callback'); + + if (env === 'production') { + this.enable('view cache'); + } + + Object.defineProperty(this, 'router', { + get: function() { + throw new Error('\'app.router\' is deprecated!\nPlease see the 3.x to 4.x migration guide for details on how to update your app.'); + } + }); +}; + +/** + * lazily adds the base router if it has not yet been added. + * + * We cannot add the base router in the defaultConfiguration because + * it reads app settings which might be set after that has run. + * + * @private + */ +app.lazyrouter = function lazyrouter() { + if (!this._router) { + this._router = new Router({ + caseSensitive: this.enabled('case sensitive routing'), + strict: this.enabled('strict routing') + }); + + this._router.use(query(this.get('query parser fn'))); + this._router.use(middleware.init(this)); + } +}; + +/** + * Dispatch a req, res pair into the application. Starts pipeline processing. + * + * If no callback is provided, then default error handlers will respond + * in the event of an error bubbling through the stack. + * + * @private + */ + +app.handle = function handle(req, res, callback) { + var router = this._router; + + // final handler + var done = callback || finalhandler(req, res, { + env: this.get('env'), + onerror: logerror.bind(this) + }); + + // no routes + if (!router) { + debug('no routes defined on app'); + done(); + return; + } + + router.handle(req, res, done); +}; + +/** + * Proxy `Router#use()` to add middleware to the app router. + * See Router#use() documentation for details. + * + * If the _fn_ parameter is an express app, then it will be + * mounted at the _route_ specified. + * + * @public + */ + +app.use = function use(fn) { + var offset = 0; + var path = '/'; + + // default path to '/' + // disambiguate app.use([fn]) + if (typeof fn !== 'function') { + var arg = fn; + + while (Array.isArray(arg) && arg.length !== 0) { + arg = arg[0]; + } + + // first arg is the path + if (typeof arg !== 'function') { + offset = 1; + path = fn; + } + } + + var fns = flatten(slice.call(arguments, offset)); + + if (fns.length === 0) { + throw new TypeError('app.use() requires a middleware function') + } + + // setup router + this.lazyrouter(); + var router = this._router; + + fns.forEach(function (fn) { + // non-express app + if (!fn || !fn.handle || !fn.set) { + return router.use(path, fn); + } + + debug('.use app under %s', path); + fn.mountpath = path; + fn.parent = this; + + // restore .app property on req and res + router.use(path, function mounted_app(req, res, next) { + var orig = req.app; + fn.handle(req, res, function (err) { + setPrototypeOf(req, orig.request) + setPrototypeOf(res, orig.response) + next(err); + }); + }); + + // mounted an app + fn.emit('mount', this); + }, this); + + return this; +}; + +/** + * Proxy to the app `Router#route()` + * Returns a new `Route` instance for the _path_. + * + * Routes are isolated middleware stacks for specific paths. + * See the Route api docs for details. + * + * @public + */ + +app.route = function route(path) { + this.lazyrouter(); + return this._router.route(path); +}; + +/** + * Register the given template engine callback `fn` + * as `ext`. + * + * By default will `require()` the engine based on the + * file extension. For example if you try to render + * a "foo.ejs" file Express will invoke the following internally: + * + * app.engine('ejs', require('ejs').__express); + * + * For engines that do not provide `.__express` out of the box, + * or if you wish to "map" a different extension to the template engine + * you may use this method. For example mapping the EJS template engine to + * ".html" files: + * + * app.engine('html', require('ejs').renderFile); + * + * In this case EJS provides a `.renderFile()` method with + * the same signature that Express expects: `(path, options, callback)`, + * though note that it aliases this method as `ejs.__express` internally + * so if you're using ".ejs" extensions you dont need to do anything. + * + * Some template engines do not follow this convention, the + * [Consolidate.js](https://github.com/tj/consolidate.js) + * library was created to map all of node's popular template + * engines to follow this convention, thus allowing them to + * work seamlessly within Express. + * + * @param {String} ext + * @param {Function} fn + * @return {app} for chaining + * @public + */ + +app.engine = function engine(ext, fn) { + if (typeof fn !== 'function') { + throw new Error('callback function required'); + } + + // get file extension + var extension = ext[0] !== '.' + ? '.' + ext + : ext; + + // store engine + this.engines[extension] = fn; + + return this; +}; + +/** + * Proxy to `Router#param()` with one added api feature. The _name_ parameter + * can be an array of names. + * + * See the Router#param() docs for more details. + * + * @param {String|Array} name + * @param {Function} fn + * @return {app} for chaining + * @public + */ + +app.param = function param(name, fn) { + this.lazyrouter(); + + if (Array.isArray(name)) { + for (var i = 0; i < name.length; i++) { + this.param(name[i], fn); + } + + return this; + } + + this._router.param(name, fn); + + return this; +}; + +/** + * Assign `setting` to `val`, or return `setting`'s value. + * + * app.set('foo', 'bar'); + * app.set('foo'); + * // => "bar" + * + * Mounted servers inherit their parent server's settings. + * + * @param {String} setting + * @param {*} [val] + * @return {Server} for chaining + * @public + */ + +app.set = function set(setting, val) { + if (arguments.length === 1) { + // app.get(setting) + return this.settings[setting]; + } + + debug('set "%s" to %o', setting, val); + + // set value + this.settings[setting] = val; + + // trigger matched settings + switch (setting) { + case 'etag': + this.set('etag fn', compileETag(val)); + break; + case 'query parser': + this.set('query parser fn', compileQueryParser(val)); + break; + case 'trust proxy': + this.set('trust proxy fn', compileTrust(val)); + + // trust proxy inherit back-compat + Object.defineProperty(this.settings, trustProxyDefaultSymbol, { + configurable: true, + value: false + }); + + break; + } + + return this; +}; + +/** + * Return the app's absolute pathname + * based on the parent(s) that have + * mounted it. + * + * For example if the application was + * mounted as "/admin", which itself + * was mounted as "/blog" then the + * return value would be "/blog/admin". + * + * @return {String} + * @private + */ + +app.path = function path() { + return this.parent + ? this.parent.path() + this.mountpath + : ''; +}; + +/** + * Check if `setting` is enabled (truthy). + * + * app.enabled('foo') + * // => false + * + * app.enable('foo') + * app.enabled('foo') + * // => true + * + * @param {String} setting + * @return {Boolean} + * @public + */ + +app.enabled = function enabled(setting) { + return Boolean(this.set(setting)); +}; + +/** + * Check if `setting` is disabled. + * + * app.disabled('foo') + * // => true + * + * app.enable('foo') + * app.disabled('foo') + * // => false + * + * @param {String} setting + * @return {Boolean} + * @public + */ + +app.disabled = function disabled(setting) { + return !this.set(setting); +}; + +/** + * Enable `setting`. + * + * @param {String} setting + * @return {app} for chaining + * @public + */ + +app.enable = function enable(setting) { + return this.set(setting, true); +}; + +/** + * Disable `setting`. + * + * @param {String} setting + * @return {app} for chaining + * @public + */ + +app.disable = function disable(setting) { + return this.set(setting, false); +}; + +/** + * Delegate `.VERB(...)` calls to `router.VERB(...)`. + */ + +methods.forEach(function(method){ + app[method] = function(path){ + if (method === 'get' && arguments.length === 1) { + // app.get(setting) + return this.set(path); + } + + this.lazyrouter(); + + var route = this._router.route(path); + route[method].apply(route, slice.call(arguments, 1)); + return this; + }; +}); + +/** + * Special-cased "all" method, applying the given route `path`, + * middleware, and callback to _every_ HTTP method. + * + * @param {String} path + * @param {Function} ... + * @return {app} for chaining + * @public + */ + +app.all = function all(path) { + this.lazyrouter(); + + var route = this._router.route(path); + var args = slice.call(arguments, 1); + + for (var i = 0; i < methods.length; i++) { + route[methods[i]].apply(route, args); + } + + return this; +}; + +// del -> delete alias + +app.del = deprecate.function(app.delete, 'app.del: Use app.delete instead'); + +/** + * Render the given view `name` name with `options` + * and a callback accepting an error and the + * rendered template string. + * + * Example: + * + * app.render('email', { name: 'Tobi' }, function(err, html){ + * // ... + * }) + * + * @param {String} name + * @param {Object|Function} options or fn + * @param {Function} callback + * @public + */ + +app.render = function render(name, options, callback) { + var cache = this.cache; + var done = callback; + var engines = this.engines; + var opts = options; + var renderOptions = {}; + var view; + + // support callback function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + // merge app.locals + merge(renderOptions, this.locals); + + // merge options._locals + if (opts._locals) { + merge(renderOptions, opts._locals); + } + + // merge options + merge(renderOptions, opts); + + // set .cache unless explicitly provided + if (renderOptions.cache == null) { + renderOptions.cache = this.enabled('view cache'); + } + + // primed cache + if (renderOptions.cache) { + view = cache[name]; + } + + // view + if (!view) { + var View = this.get('view'); + + view = new View(name, { + defaultEngine: this.get('view engine'), + root: this.get('views'), + engines: engines + }); + + if (!view.path) { + var dirs = Array.isArray(view.root) && view.root.length > 1 + ? 'directories "' + view.root.slice(0, -1).join('", "') + '" or "' + view.root[view.root.length - 1] + '"' + : 'directory "' + view.root + '"' + var err = new Error('Failed to lookup view "' + name + '" in views ' + dirs); + err.view = view; + return done(err); + } + + // prime the cache + if (renderOptions.cache) { + cache[name] = view; + } + } + + // render + tryRender(view, renderOptions, done); +}; + +/** + * Listen for connections. + * + * A node `http.Server` is returned, with this + * application (which is a `Function`) as its + * callback. If you wish to create both an HTTP + * and HTTPS server you may do so with the "http" + * and "https" modules as shown here: + * + * var http = require('http') + * , https = require('https') + * , express = require('express') + * , app = express(); + * + * http.createServer(app).listen(80); + * https.createServer({ ... }, app).listen(443); + * + * @return {http.Server} + * @public + */ + +app.listen = function listen() { + var server = http.createServer(this); + return server.listen.apply(server, arguments); +}; + +/** + * Log error using console.error. + * + * @param {Error} err + * @private + */ + +function logerror(err) { + /* istanbul ignore next */ + if (this.get('env') !== 'test') console.error(err.stack || err.toString()); +} + +/** + * Try rendering a view. + * @private + */ + +function tryRender(view, options, callback) { + try { + view.render(options, callback); + } catch (err) { + callback(err); + } +} diff --git a/node_modules/express/lib/express.js b/node_modules/express/lib/express.js new file mode 100644 index 0000000..d188a16 --- /dev/null +++ b/node_modules/express/lib/express.js @@ -0,0 +1,116 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + */ + +var bodyParser = require('body-parser') +var EventEmitter = require('events').EventEmitter; +var mixin = require('merge-descriptors'); +var proto = require('./application'); +var Route = require('./router/route'); +var Router = require('./router'); +var req = require('./request'); +var res = require('./response'); + +/** + * Expose `createApplication()`. + */ + +exports = module.exports = createApplication; + +/** + * Create an express application. + * + * @return {Function} + * @api public + */ + +function createApplication() { + var app = function(req, res, next) { + app.handle(req, res, next); + }; + + mixin(app, EventEmitter.prototype, false); + mixin(app, proto, false); + + // expose the prototype that will get set on requests + app.request = Object.create(req, { + app: { configurable: true, enumerable: true, writable: true, value: app } + }) + + // expose the prototype that will get set on responses + app.response = Object.create(res, { + app: { configurable: true, enumerable: true, writable: true, value: app } + }) + + app.init(); + return app; +} + +/** + * Expose the prototypes. + */ + +exports.application = proto; +exports.request = req; +exports.response = res; + +/** + * Expose constructors. + */ + +exports.Route = Route; +exports.Router = Router; + +/** + * Expose middleware + */ + +exports.json = bodyParser.json +exports.query = require('./middleware/query'); +exports.raw = bodyParser.raw +exports.static = require('serve-static'); +exports.text = bodyParser.text +exports.urlencoded = bodyParser.urlencoded + +/** + * Replace removed middleware with an appropriate error message. + */ + +var removedMiddlewares = [ + 'bodyParser', + 'compress', + 'cookieSession', + 'session', + 'logger', + 'cookieParser', + 'favicon', + 'responseTime', + 'errorHandler', + 'timeout', + 'methodOverride', + 'vhost', + 'csrf', + 'directory', + 'limit', + 'multipart', + 'staticCache' +] + +removedMiddlewares.forEach(function (name) { + Object.defineProperty(exports, name, { + get: function () { + throw new Error('Most middleware (like ' + name + ') is no longer bundled with Express and must be installed separately. Please see https://github.com/senchalabs/connect#middleware.'); + }, + configurable: true + }); +}); diff --git a/node_modules/express/lib/middleware/init.js b/node_modules/express/lib/middleware/init.js new file mode 100644 index 0000000..dfd0427 --- /dev/null +++ b/node_modules/express/lib/middleware/init.js @@ -0,0 +1,43 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var setPrototypeOf = require('setprototypeof') + +/** + * Initialization middleware, exposing the + * request and response to each other, as well + * as defaulting the X-Powered-By header field. + * + * @param {Function} app + * @return {Function} + * @api private + */ + +exports.init = function(app){ + return function expressInit(req, res, next){ + if (app.enabled('x-powered-by')) res.setHeader('X-Powered-By', 'Express'); + req.res = res; + res.req = req; + req.next = next; + + setPrototypeOf(req, app.request) + setPrototypeOf(res, app.response) + + res.locals = res.locals || Object.create(null); + + next(); + }; +}; + diff --git a/node_modules/express/lib/middleware/query.js b/node_modules/express/lib/middleware/query.js new file mode 100644 index 0000000..7e91669 --- /dev/null +++ b/node_modules/express/lib/middleware/query.js @@ -0,0 +1,47 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + */ + +var merge = require('utils-merge') +var parseUrl = require('parseurl'); +var qs = require('qs'); + +/** + * @param {Object} options + * @return {Function} + * @api public + */ + +module.exports = function query(options) { + var opts = merge({}, options) + var queryparse = qs.parse; + + if (typeof options === 'function') { + queryparse = options; + opts = undefined; + } + + if (opts !== undefined && opts.allowPrototypes === undefined) { + // back-compat for qs module + opts.allowPrototypes = true; + } + + return function query(req, res, next){ + if (!req.query) { + var val = parseUrl(req).query; + req.query = queryparse(val, opts); + } + + next(); + }; +}; diff --git a/node_modules/express/lib/request.js b/node_modules/express/lib/request.js new file mode 100644 index 0000000..a9400ef --- /dev/null +++ b/node_modules/express/lib/request.js @@ -0,0 +1,525 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var accepts = require('accepts'); +var deprecate = require('depd')('express'); +var isIP = require('net').isIP; +var typeis = require('type-is'); +var http = require('http'); +var fresh = require('fresh'); +var parseRange = require('range-parser'); +var parse = require('parseurl'); +var proxyaddr = require('proxy-addr'); + +/** + * Request prototype. + * @public + */ + +var req = Object.create(http.IncomingMessage.prototype) + +/** + * Module exports. + * @public + */ + +module.exports = req + +/** + * Return request header. + * + * The `Referrer` header field is special-cased, + * both `Referrer` and `Referer` are interchangeable. + * + * Examples: + * + * req.get('Content-Type'); + * // => "text/plain" + * + * req.get('content-type'); + * // => "text/plain" + * + * req.get('Something'); + * // => undefined + * + * Aliased as `req.header()`. + * + * @param {String} name + * @return {String} + * @public + */ + +req.get = +req.header = function header(name) { + if (!name) { + throw new TypeError('name argument is required to req.get'); + } + + if (typeof name !== 'string') { + throw new TypeError('name must be a string to req.get'); + } + + var lc = name.toLowerCase(); + + switch (lc) { + case 'referer': + case 'referrer': + return this.headers.referrer + || this.headers.referer; + default: + return this.headers[lc]; + } +}; + +/** + * To do: update docs. + * + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single MIME type string + * such as "application/json", an extension name + * such as "json", a comma-delimited list such as "json, html, text/plain", + * an argument list such as `"json", "html", "text/plain"`, + * or an array `["json", "html", "text/plain"]`. When a list + * or array is given, the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * req.accepts('html'); + * // => "html" + * + * // Accept: text/*, application/json + * req.accepts('html'); + * // => "html" + * req.accepts('text/html'); + * // => "text/html" + * req.accepts('json, text'); + * // => "json" + * req.accepts('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * req.accepts('image/png'); + * req.accepts('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * req.accepts(['html', 'json']); + * req.accepts('html', 'json'); + * req.accepts('html, json'); + * // => "json" + * + * @param {String|Array} type(s) + * @return {String|Array|Boolean} + * @public + */ + +req.accepts = function(){ + var accept = accepts(this); + return accept.types.apply(accept, arguments); +}; + +/** + * Check if the given `encoding`s are accepted. + * + * @param {String} ...encoding + * @return {String|Array} + * @public + */ + +req.acceptsEncodings = function(){ + var accept = accepts(this); + return accept.encodings.apply(accept, arguments); +}; + +req.acceptsEncoding = deprecate.function(req.acceptsEncodings, + 'req.acceptsEncoding: Use acceptsEncodings instead'); + +/** + * Check if the given `charset`s are acceptable, + * otherwise you should respond with 406 "Not Acceptable". + * + * @param {String} ...charset + * @return {String|Array} + * @public + */ + +req.acceptsCharsets = function(){ + var accept = accepts(this); + return accept.charsets.apply(accept, arguments); +}; + +req.acceptsCharset = deprecate.function(req.acceptsCharsets, + 'req.acceptsCharset: Use acceptsCharsets instead'); + +/** + * Check if the given `lang`s are acceptable, + * otherwise you should respond with 406 "Not Acceptable". + * + * @param {String} ...lang + * @return {String|Array} + * @public + */ + +req.acceptsLanguages = function(){ + var accept = accepts(this); + return accept.languages.apply(accept, arguments); +}; + +req.acceptsLanguage = deprecate.function(req.acceptsLanguages, + 'req.acceptsLanguage: Use acceptsLanguages instead'); + +/** + * Parse Range header field, capping to the given `size`. + * + * Unspecified ranges such as "0-" require knowledge of your resource length. In + * the case of a byte range this is of course the total number of bytes. If the + * Range header field is not given `undefined` is returned, `-1` when unsatisfiable, + * and `-2` when syntactically invalid. + * + * When ranges are returned, the array has a "type" property which is the type of + * range that is required (most commonly, "bytes"). Each array element is an object + * with a "start" and "end" property for the portion of the range. + * + * The "combine" option can be set to `true` and overlapping & adjacent ranges + * will be combined into a single range. + * + * NOTE: remember that ranges are inclusive, so for example "Range: users=0-3" + * should respond with 4 users when available, not 3. + * + * @param {number} size + * @param {object} [options] + * @param {boolean} [options.combine=false] + * @return {number|array} + * @public + */ + +req.range = function range(size, options) { + var range = this.get('Range'); + if (!range) return; + return parseRange(size, range, options); +}; + +/** + * Return the value of param `name` when present or `defaultValue`. + * + * - Checks route placeholders, ex: _/user/:id_ + * - Checks body params, ex: id=12, {"id":12} + * - Checks query string params, ex: ?id=12 + * + * To utilize request bodies, `req.body` + * should be an object. This can be done by using + * the `bodyParser()` middleware. + * + * @param {String} name + * @param {Mixed} [defaultValue] + * @return {String} + * @public + */ + +req.param = function param(name, defaultValue) { + var params = this.params || {}; + var body = this.body || {}; + var query = this.query || {}; + + var args = arguments.length === 1 + ? 'name' + : 'name, default'; + deprecate('req.param(' + args + '): Use req.params, req.body, or req.query instead'); + + if (null != params[name] && params.hasOwnProperty(name)) return params[name]; + if (null != body[name]) return body[name]; + if (null != query[name]) return query[name]; + + return defaultValue; +}; + +/** + * Check if the incoming request contains the "Content-Type" + * header field, and it contains the give mime `type`. + * + * Examples: + * + * // With Content-Type: text/html; charset=utf-8 + * req.is('html'); + * req.is('text/html'); + * req.is('text/*'); + * // => true + * + * // When Content-Type is application/json + * req.is('json'); + * req.is('application/json'); + * req.is('application/*'); + * // => true + * + * req.is('html'); + * // => false + * + * @param {String|Array} types... + * @return {String|false|null} + * @public + */ + +req.is = function is(types) { + var arr = types; + + // support flattened arguments + if (!Array.isArray(types)) { + arr = new Array(arguments.length); + for (var i = 0; i < arr.length; i++) { + arr[i] = arguments[i]; + } + } + + return typeis(this, arr); +}; + +/** + * Return the protocol string "http" or "https" + * when requested with TLS. When the "trust proxy" + * setting trusts the socket address, the + * "X-Forwarded-Proto" header field will be trusted + * and used if present. + * + * If you're running behind a reverse proxy that + * supplies https for you this may be enabled. + * + * @return {String} + * @public + */ + +defineGetter(req, 'protocol', function protocol(){ + var proto = this.connection.encrypted + ? 'https' + : 'http'; + var trust = this.app.get('trust proxy fn'); + + if (!trust(this.connection.remoteAddress, 0)) { + return proto; + } + + // Note: X-Forwarded-Proto is normally only ever a + // single value, but this is to be safe. + var header = this.get('X-Forwarded-Proto') || proto + var index = header.indexOf(',') + + return index !== -1 + ? header.substring(0, index).trim() + : header.trim() +}); + +/** + * Short-hand for: + * + * req.protocol === 'https' + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'secure', function secure(){ + return this.protocol === 'https'; +}); + +/** + * Return the remote address from the trusted proxy. + * + * The is the remote address on the socket unless + * "trust proxy" is set. + * + * @return {String} + * @public + */ + +defineGetter(req, 'ip', function ip(){ + var trust = this.app.get('trust proxy fn'); + return proxyaddr(this, trust); +}); + +/** + * When "trust proxy" is set, trusted proxy addresses + client. + * + * For example if the value were "client, proxy1, proxy2" + * you would receive the array `["client", "proxy1", "proxy2"]` + * where "proxy2" is the furthest down-stream and "proxy1" and + * "proxy2" were trusted. + * + * @return {Array} + * @public + */ + +defineGetter(req, 'ips', function ips() { + var trust = this.app.get('trust proxy fn'); + var addrs = proxyaddr.all(this, trust); + + // reverse the order (to farthest -> closest) + // and remove socket address + addrs.reverse().pop() + + return addrs +}); + +/** + * Return subdomains as an array. + * + * Subdomains are the dot-separated parts of the host before the main domain of + * the app. By default, the domain of the app is assumed to be the last two + * parts of the host. This can be changed by setting "subdomain offset". + * + * For example, if the domain is "tobi.ferrets.example.com": + * If "subdomain offset" is not set, req.subdomains is `["ferrets", "tobi"]`. + * If "subdomain offset" is 3, req.subdomains is `["tobi"]`. + * + * @return {Array} + * @public + */ + +defineGetter(req, 'subdomains', function subdomains() { + var hostname = this.hostname; + + if (!hostname) return []; + + var offset = this.app.get('subdomain offset'); + var subdomains = !isIP(hostname) + ? hostname.split('.').reverse() + : [hostname]; + + return subdomains.slice(offset); +}); + +/** + * Short-hand for `url.parse(req.url).pathname`. + * + * @return {String} + * @public + */ + +defineGetter(req, 'path', function path() { + return parse(this).pathname; +}); + +/** + * Parse the "Host" header field to a hostname. + * + * When the "trust proxy" setting trusts the socket + * address, the "X-Forwarded-Host" header field will + * be trusted. + * + * @return {String} + * @public + */ + +defineGetter(req, 'hostname', function hostname(){ + var trust = this.app.get('trust proxy fn'); + var host = this.get('X-Forwarded-Host'); + + if (!host || !trust(this.connection.remoteAddress, 0)) { + host = this.get('Host'); + } else if (host.indexOf(',') !== -1) { + // Note: X-Forwarded-Host is normally only ever a + // single value, but this is to be safe. + host = host.substring(0, host.indexOf(',')).trimRight() + } + + if (!host) return; + + // IPv6 literal support + var offset = host[0] === '[' + ? host.indexOf(']') + 1 + : 0; + var index = host.indexOf(':', offset); + + return index !== -1 + ? host.substring(0, index) + : host; +}); + +// TODO: change req.host to return host in next major + +defineGetter(req, 'host', deprecate.function(function host(){ + return this.hostname; +}, 'req.host: Use req.hostname instead')); + +/** + * Check if the request is fresh, aka + * Last-Modified and/or the ETag + * still match. + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'fresh', function(){ + var method = this.method; + var res = this.res + var status = res.statusCode + + // GET or HEAD for weak freshness validation only + if ('GET' !== method && 'HEAD' !== method) return false; + + // 2xx or 304 as per rfc2616 14.26 + if ((status >= 200 && status < 300) || 304 === status) { + return fresh(this.headers, { + 'etag': res.get('ETag'), + 'last-modified': res.get('Last-Modified') + }) + } + + return false; +}); + +/** + * Check if the request is stale, aka + * "Last-Modified" and / or the "ETag" for the + * resource has changed. + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'stale', function stale(){ + return !this.fresh; +}); + +/** + * Check if the request was an _XMLHttpRequest_. + * + * @return {Boolean} + * @public + */ + +defineGetter(req, 'xhr', function xhr(){ + var val = this.get('X-Requested-With') || ''; + return val.toLowerCase() === 'xmlhttprequest'; +}); + +/** + * Helper function for creating a getter on an object. + * + * @param {Object} obj + * @param {String} name + * @param {Function} getter + * @private + */ +function defineGetter(obj, name, getter) { + Object.defineProperty(obj, name, { + configurable: true, + enumerable: true, + get: getter + }); +} diff --git a/node_modules/express/lib/response.js b/node_modules/express/lib/response.js new file mode 100644 index 0000000..c9f08cd --- /dev/null +++ b/node_modules/express/lib/response.js @@ -0,0 +1,1142 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var Buffer = require('safe-buffer').Buffer +var contentDisposition = require('content-disposition'); +var deprecate = require('depd')('express'); +var encodeUrl = require('encodeurl'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var isAbsolute = require('./utils').isAbsolute; +var onFinished = require('on-finished'); +var path = require('path'); +var statuses = require('statuses') +var merge = require('utils-merge'); +var sign = require('cookie-signature').sign; +var normalizeType = require('./utils').normalizeType; +var normalizeTypes = require('./utils').normalizeTypes; +var setCharset = require('./utils').setCharset; +var cookie = require('cookie'); +var send = require('send'); +var extname = path.extname; +var mime = send.mime; +var resolve = path.resolve; +var vary = require('vary'); + +/** + * Response prototype. + * @public + */ + +var res = Object.create(http.ServerResponse.prototype) + +/** + * Module exports. + * @public + */ + +module.exports = res + +/** + * Module variables. + * @private + */ + +var charsetRegExp = /;\s*charset\s*=/; + +/** + * Set status `code`. + * + * @param {Number} code + * @return {ServerResponse} + * @public + */ + +res.status = function status(code) { + this.statusCode = code; + return this; +}; + +/** + * Set Link header field with the given `links`. + * + * Examples: + * + * res.links({ + * next: 'http://api.example.com/users?page=2', + * last: 'http://api.example.com/users?page=5' + * }); + * + * @param {Object} links + * @return {ServerResponse} + * @public + */ + +res.links = function(links){ + var link = this.get('Link') || ''; + if (link) link += ', '; + return this.set('Link', link + Object.keys(links).map(function(rel){ + return '<' + links[rel] + '>; rel="' + rel + '"'; + }).join(', ')); +}; + +/** + * Send a response. + * + * Examples: + * + * res.send(Buffer.from('wahoo')); + * res.send({ some: 'json' }); + * res.send('<p>some html</p>'); + * + * @param {string|number|boolean|object|Buffer} body + * @public + */ + +res.send = function send(body) { + var chunk = body; + var encoding; + var req = this.req; + var type; + + // settings + var app = this.app; + + // allow status / body + if (arguments.length === 2) { + // res.send(body, status) backwards compat + if (typeof arguments[0] !== 'number' && typeof arguments[1] === 'number') { + deprecate('res.send(body, status): Use res.status(status).send(body) instead'); + this.statusCode = arguments[1]; + } else { + deprecate('res.send(status, body): Use res.status(status).send(body) instead'); + this.statusCode = arguments[0]; + chunk = arguments[1]; + } + } + + // disambiguate res.send(status) and res.send(status, num) + if (typeof chunk === 'number' && arguments.length === 1) { + // res.send(status) will set status message as text string + if (!this.get('Content-Type')) { + this.type('txt'); + } + + deprecate('res.send(status): Use res.sendStatus(status) instead'); + this.statusCode = chunk; + chunk = statuses[chunk] + } + + switch (typeof chunk) { + // string defaulting to html + case 'string': + if (!this.get('Content-Type')) { + this.type('html'); + } + break; + case 'boolean': + case 'number': + case 'object': + if (chunk === null) { + chunk = ''; + } else if (Buffer.isBuffer(chunk)) { + if (!this.get('Content-Type')) { + this.type('bin'); + } + } else { + return this.json(chunk); + } + break; + } + + // write strings in utf-8 + if (typeof chunk === 'string') { + encoding = 'utf8'; + type = this.get('Content-Type'); + + // reflect this in content-type + if (typeof type === 'string') { + this.set('Content-Type', setCharset(type, 'utf-8')); + } + } + + // determine if ETag should be generated + var etagFn = app.get('etag fn') + var generateETag = !this.get('ETag') && typeof etagFn === 'function' + + // populate Content-Length + var len + if (chunk !== undefined) { + if (Buffer.isBuffer(chunk)) { + // get length of Buffer + len = chunk.length + } else if (!generateETag && chunk.length < 1000) { + // just calculate length when no ETag + small chunk + len = Buffer.byteLength(chunk, encoding) + } else { + // convert chunk to Buffer and calculate + chunk = Buffer.from(chunk, encoding) + encoding = undefined; + len = chunk.length + } + + this.set('Content-Length', len); + } + + // populate ETag + var etag; + if (generateETag && len !== undefined) { + if ((etag = etagFn(chunk, encoding))) { + this.set('ETag', etag); + } + } + + // freshness + if (req.fresh) this.statusCode = 304; + + // strip irrelevant headers + if (204 === this.statusCode || 304 === this.statusCode) { + this.removeHeader('Content-Type'); + this.removeHeader('Content-Length'); + this.removeHeader('Transfer-Encoding'); + chunk = ''; + } + + if (req.method === 'HEAD') { + // skip body for HEAD + this.end(); + } else { + // respond + this.end(chunk, encoding); + } + + return this; +}; + +/** + * Send JSON response. + * + * Examples: + * + * res.json(null); + * res.json({ user: 'tj' }); + * + * @param {string|number|boolean|object} obj + * @public + */ + +res.json = function json(obj) { + var val = obj; + + // allow status / body + if (arguments.length === 2) { + // res.json(body, status) backwards compat + if (typeof arguments[1] === 'number') { + deprecate('res.json(obj, status): Use res.status(status).json(obj) instead'); + this.statusCode = arguments[1]; + } else { + deprecate('res.json(status, obj): Use res.status(status).json(obj) instead'); + this.statusCode = arguments[0]; + val = arguments[1]; + } + } + + // settings + var app = this.app; + var escape = app.get('json escape') + var replacer = app.get('json replacer'); + var spaces = app.get('json spaces'); + var body = stringify(val, replacer, spaces, escape) + + // content-type + if (!this.get('Content-Type')) { + this.set('Content-Type', 'application/json'); + } + + return this.send(body); +}; + +/** + * Send JSON response with JSONP callback support. + * + * Examples: + * + * res.jsonp(null); + * res.jsonp({ user: 'tj' }); + * + * @param {string|number|boolean|object} obj + * @public + */ + +res.jsonp = function jsonp(obj) { + var val = obj; + + // allow status / body + if (arguments.length === 2) { + // res.json(body, status) backwards compat + if (typeof arguments[1] === 'number') { + deprecate('res.jsonp(obj, status): Use res.status(status).json(obj) instead'); + this.statusCode = arguments[1]; + } else { + deprecate('res.jsonp(status, obj): Use res.status(status).jsonp(obj) instead'); + this.statusCode = arguments[0]; + val = arguments[1]; + } + } + + // settings + var app = this.app; + var escape = app.get('json escape') + var replacer = app.get('json replacer'); + var spaces = app.get('json spaces'); + var body = stringify(val, replacer, spaces, escape) + var callback = this.req.query[app.get('jsonp callback name')]; + + // content-type + if (!this.get('Content-Type')) { + this.set('X-Content-Type-Options', 'nosniff'); + this.set('Content-Type', 'application/json'); + } + + // fixup callback + if (Array.isArray(callback)) { + callback = callback[0]; + } + + // jsonp + if (typeof callback === 'string' && callback.length !== 0) { + this.set('X-Content-Type-Options', 'nosniff'); + this.set('Content-Type', 'text/javascript'); + + // restrict callback charset + callback = callback.replace(/[^\[\]\w$.]/g, ''); + + // replace chars not allowed in JavaScript that are in JSON + body = body + .replace(/\u2028/g, '\\u2028') + .replace(/\u2029/g, '\\u2029'); + + // the /**/ is a specific security mitigation for "Rosetta Flash JSONP abuse" + // the typeof check is just to reduce client error noise + body = '/**/ typeof ' + callback + ' === \'function\' && ' + callback + '(' + body + ');'; + } + + return this.send(body); +}; + +/** + * Send given HTTP status code. + * + * Sets the response status to `statusCode` and the body of the + * response to the standard description from node's http.STATUS_CODES + * or the statusCode number if no description. + * + * Examples: + * + * res.sendStatus(200); + * + * @param {number} statusCode + * @public + */ + +res.sendStatus = function sendStatus(statusCode) { + var body = statuses[statusCode] || String(statusCode) + + this.statusCode = statusCode; + this.type('txt'); + + return this.send(body); +}; + +/** + * Transfer the file at the given `path`. + * + * Automatically sets the _Content-Type_ response header field. + * The callback `callback(err)` is invoked when the transfer is complete + * or when an error occurs. Be sure to check `res.sentHeader` + * if you wish to attempt responding, as the header and some data + * may have already been transferred. + * + * Options: + * + * - `maxAge` defaulting to 0 (can be string converted by `ms`) + * - `root` root directory for relative filenames + * - `headers` object of headers to serve with file + * - `dotfiles` serve dotfiles, defaulting to false; can be `"allow"` to send them + * + * Other options are passed along to `send`. + * + * Examples: + * + * The following example illustrates how `res.sendFile()` may + * be used as an alternative for the `static()` middleware for + * dynamic situations. The code backing `res.sendFile()` is actually + * the same code, so HTTP cache support etc is identical. + * + * app.get('/user/:uid/photos/:file', function(req, res){ + * var uid = req.params.uid + * , file = req.params.file; + * + * req.user.mayViewFilesFrom(uid, function(yes){ + * if (yes) { + * res.sendFile('/uploads/' + uid + '/' + file); + * } else { + * res.send(403, 'Sorry! you cant see that.'); + * } + * }); + * }); + * + * @public + */ + +res.sendFile = function sendFile(path, options, callback) { + var done = callback; + var req = this.req; + var res = this; + var next = req.next; + var opts = options || {}; + + if (!path) { + throw new TypeError('path argument is required to res.sendFile'); + } + + if (typeof path !== 'string') { + throw new TypeError('path must be a string to res.sendFile') + } + + // support function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + if (!opts.root && !isAbsolute(path)) { + throw new TypeError('path must be absolute or specify root to res.sendFile'); + } + + // create file stream + var pathname = encodeURI(path); + var file = send(req, pathname, opts); + + // transfer + sendfile(res, file, opts, function (err) { + if (done) return done(err); + if (err && err.code === 'EISDIR') return next(); + + // next() all but write errors + if (err && err.code !== 'ECONNABORTED' && err.syscall !== 'write') { + next(err); + } + }); +}; + +/** + * Transfer the file at the given `path`. + * + * Automatically sets the _Content-Type_ response header field. + * The callback `callback(err)` is invoked when the transfer is complete + * or when an error occurs. Be sure to check `res.sentHeader` + * if you wish to attempt responding, as the header and some data + * may have already been transferred. + * + * Options: + * + * - `maxAge` defaulting to 0 (can be string converted by `ms`) + * - `root` root directory for relative filenames + * - `headers` object of headers to serve with file + * - `dotfiles` serve dotfiles, defaulting to false; can be `"allow"` to send them + * + * Other options are passed along to `send`. + * + * Examples: + * + * The following example illustrates how `res.sendfile()` may + * be used as an alternative for the `static()` middleware for + * dynamic situations. The code backing `res.sendfile()` is actually + * the same code, so HTTP cache support etc is identical. + * + * app.get('/user/:uid/photos/:file', function(req, res){ + * var uid = req.params.uid + * , file = req.params.file; + * + * req.user.mayViewFilesFrom(uid, function(yes){ + * if (yes) { + * res.sendfile('/uploads/' + uid + '/' + file); + * } else { + * res.send(403, 'Sorry! you cant see that.'); + * } + * }); + * }); + * + * @public + */ + +res.sendfile = function (path, options, callback) { + var done = callback; + var req = this.req; + var res = this; + var next = req.next; + var opts = options || {}; + + // support function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + // create file stream + var file = send(req, path, opts); + + // transfer + sendfile(res, file, opts, function (err) { + if (done) return done(err); + if (err && err.code === 'EISDIR') return next(); + + // next() all but write errors + if (err && err.code !== 'ECONNABORTED' && err.syscall !== 'write') { + next(err); + } + }); +}; + +res.sendfile = deprecate.function(res.sendfile, + 'res.sendfile: Use res.sendFile instead'); + +/** + * Transfer the file at the given `path` as an attachment. + * + * Optionally providing an alternate attachment `filename`, + * and optional callback `callback(err)`. The callback is invoked + * when the data transfer is complete, or when an error has + * ocurred. Be sure to check `res.headersSent` if you plan to respond. + * + * Optionally providing an `options` object to use with `res.sendFile()`. + * This function will set the `Content-Disposition` header, overriding + * any `Content-Disposition` header passed as header options in order + * to set the attachment and filename. + * + * This method uses `res.sendFile()`. + * + * @public + */ + +res.download = function download (path, filename, options, callback) { + var done = callback; + var name = filename; + var opts = options || null + + // support function as second or third arg + if (typeof filename === 'function') { + done = filename; + name = null; + opts = null + } else if (typeof options === 'function') { + done = options + opts = null + } + + // set Content-Disposition when file is sent + var headers = { + 'Content-Disposition': contentDisposition(name || path) + }; + + // merge user-provided headers + if (opts && opts.headers) { + var keys = Object.keys(opts.headers) + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + if (key.toLowerCase() !== 'content-disposition') { + headers[key] = opts.headers[key] + } + } + } + + // merge user-provided options + opts = Object.create(opts) + opts.headers = headers + + // Resolve the full path for sendFile + var fullPath = resolve(path); + + // send file + return this.sendFile(fullPath, opts, done) +}; + +/** + * Set _Content-Type_ response header with `type` through `mime.lookup()` + * when it does not contain "/", or set the Content-Type to `type` otherwise. + * + * Examples: + * + * res.type('.html'); + * res.type('html'); + * res.type('json'); + * res.type('application/json'); + * res.type('png'); + * + * @param {String} type + * @return {ServerResponse} for chaining + * @public + */ + +res.contentType = +res.type = function contentType(type) { + var ct = type.indexOf('/') === -1 + ? mime.lookup(type) + : type; + + return this.set('Content-Type', ct); +}; + +/** + * Respond to the Acceptable formats using an `obj` + * of mime-type callbacks. + * + * This method uses `req.accepted`, an array of + * acceptable types ordered by their quality values. + * When "Accept" is not present the _first_ callback + * is invoked, otherwise the first match is used. When + * no match is performed the server responds with + * 406 "Not Acceptable". + * + * Content-Type is set for you, however if you choose + * you may alter this within the callback using `res.type()` + * or `res.set('Content-Type', ...)`. + * + * res.format({ + * 'text/plain': function(){ + * res.send('hey'); + * }, + * + * 'text/html': function(){ + * res.send('<p>hey</p>'); + * }, + * + * 'appliation/json': function(){ + * res.send({ message: 'hey' }); + * } + * }); + * + * In addition to canonicalized MIME types you may + * also use extnames mapped to these types: + * + * res.format({ + * text: function(){ + * res.send('hey'); + * }, + * + * html: function(){ + * res.send('<p>hey</p>'); + * }, + * + * json: function(){ + * res.send({ message: 'hey' }); + * } + * }); + * + * By default Express passes an `Error` + * with a `.status` of 406 to `next(err)` + * if a match is not made. If you provide + * a `.default` callback it will be invoked + * instead. + * + * @param {Object} obj + * @return {ServerResponse} for chaining + * @public + */ + +res.format = function(obj){ + var req = this.req; + var next = req.next; + + var fn = obj.default; + if (fn) delete obj.default; + var keys = Object.keys(obj); + + var key = keys.length > 0 + ? req.accepts(keys) + : false; + + this.vary("Accept"); + + if (key) { + this.set('Content-Type', normalizeType(key).value); + obj[key](req, this, next); + } else if (fn) { + fn(); + } else { + var err = new Error('Not Acceptable'); + err.status = err.statusCode = 406; + err.types = normalizeTypes(keys).map(function(o){ return o.value }); + next(err); + } + + return this; +}; + +/** + * Set _Content-Disposition_ header to _attachment_ with optional `filename`. + * + * @param {String} filename + * @return {ServerResponse} + * @public + */ + +res.attachment = function attachment(filename) { + if (filename) { + this.type(extname(filename)); + } + + this.set('Content-Disposition', contentDisposition(filename)); + + return this; +}; + +/** + * Append additional header `field` with value `val`. + * + * Example: + * + * res.append('Link', ['<http://localhost/>', '<http://localhost:3000/>']); + * res.append('Set-Cookie', 'foo=bar; Path=/; HttpOnly'); + * res.append('Warning', '199 Miscellaneous warning'); + * + * @param {String} field + * @param {String|Array} val + * @return {ServerResponse} for chaining + * @public + */ + +res.append = function append(field, val) { + var prev = this.get(field); + var value = val; + + if (prev) { + // concat the new and prev vals + value = Array.isArray(prev) ? prev.concat(val) + : Array.isArray(val) ? [prev].concat(val) + : [prev, val]; + } + + return this.set(field, value); +}; + +/** + * Set header `field` to `val`, or pass + * an object of header fields. + * + * Examples: + * + * res.set('Foo', ['bar', 'baz']); + * res.set('Accept', 'application/json'); + * res.set({ Accept: 'text/plain', 'X-API-Key': 'tobi' }); + * + * Aliased as `res.header()`. + * + * @param {String|Object} field + * @param {String|Array} val + * @return {ServerResponse} for chaining + * @public + */ + +res.set = +res.header = function header(field, val) { + if (arguments.length === 2) { + var value = Array.isArray(val) + ? val.map(String) + : String(val); + + // add charset to content-type + if (field.toLowerCase() === 'content-type') { + if (Array.isArray(value)) { + throw new TypeError('Content-Type cannot be set to an Array'); + } + if (!charsetRegExp.test(value)) { + var charset = mime.charsets.lookup(value.split(';')[0]); + if (charset) value += '; charset=' + charset.toLowerCase(); + } + } + + this.setHeader(field, value); + } else { + for (var key in field) { + this.set(key, field[key]); + } + } + return this; +}; + +/** + * Get value for header `field`. + * + * @param {String} field + * @return {String} + * @public + */ + +res.get = function(field){ + return this.getHeader(field); +}; + +/** + * Clear cookie `name`. + * + * @param {String} name + * @param {Object} [options] + * @return {ServerResponse} for chaining + * @public + */ + +res.clearCookie = function clearCookie(name, options) { + var opts = merge({ expires: new Date(1), path: '/' }, options); + + return this.cookie(name, '', opts); +}; + +/** + * Set cookie `name` to `value`, with the given `options`. + * + * Options: + * + * - `maxAge` max-age in milliseconds, converted to `expires` + * - `signed` sign the cookie + * - `path` defaults to "/" + * + * Examples: + * + * // "Remember Me" for 15 minutes + * res.cookie('rememberme', '1', { expires: new Date(Date.now() + 900000), httpOnly: true }); + * + * // same as above + * res.cookie('rememberme', '1', { maxAge: 900000, httpOnly: true }) + * + * @param {String} name + * @param {String|Object} value + * @param {Object} [options] + * @return {ServerResponse} for chaining + * @public + */ + +res.cookie = function (name, value, options) { + var opts = merge({}, options); + var secret = this.req.secret; + var signed = opts.signed; + + if (signed && !secret) { + throw new Error('cookieParser("secret") required for signed cookies'); + } + + var val = typeof value === 'object' + ? 'j:' + JSON.stringify(value) + : String(value); + + if (signed) { + val = 's:' + sign(val, secret); + } + + if ('maxAge' in opts) { + opts.expires = new Date(Date.now() + opts.maxAge); + opts.maxAge /= 1000; + } + + if (opts.path == null) { + opts.path = '/'; + } + + this.append('Set-Cookie', cookie.serialize(name, String(val), opts)); + + return this; +}; + +/** + * Set the location header to `url`. + * + * The given `url` can also be "back", which redirects + * to the _Referrer_ or _Referer_ headers or "/". + * + * Examples: + * + * res.location('/foo/bar').; + * res.location('http://example.com'); + * res.location('../login'); + * + * @param {String} url + * @return {ServerResponse} for chaining + * @public + */ + +res.location = function location(url) { + var loc = url; + + // "back" is an alias for the referrer + if (url === 'back') { + loc = this.req.get('Referrer') || '/'; + } + + // set location + return this.set('Location', encodeUrl(loc)); +}; + +/** + * Redirect to the given `url` with optional response `status` + * defaulting to 302. + * + * The resulting `url` is determined by `res.location()`, so + * it will play nicely with mounted apps, relative paths, + * `"back"` etc. + * + * Examples: + * + * res.redirect('/foo/bar'); + * res.redirect('http://example.com'); + * res.redirect(301, 'http://example.com'); + * res.redirect('../login'); // /blog/post/1 -> /blog/login + * + * @public + */ + +res.redirect = function redirect(url) { + var address = url; + var body; + var status = 302; + + // allow status / url + if (arguments.length === 2) { + if (typeof arguments[0] === 'number') { + status = arguments[0]; + address = arguments[1]; + } else { + deprecate('res.redirect(url, status): Use res.redirect(status, url) instead'); + status = arguments[1]; + } + } + + // Set location header + address = this.location(address).get('Location'); + + // Support text/{plain,html} by default + this.format({ + text: function(){ + body = statuses[status] + '. Redirecting to ' + address + }, + + html: function(){ + var u = escapeHtml(address); + body = '<p>' + statuses[status] + '. Redirecting to <a href="' + u + '">' + u + '</a></p>' + }, + + default: function(){ + body = ''; + } + }); + + // Respond + this.statusCode = status; + this.set('Content-Length', Buffer.byteLength(body)); + + if (this.req.method === 'HEAD') { + this.end(); + } else { + this.end(body); + } +}; + +/** + * Add `field` to Vary. If already present in the Vary set, then + * this call is simply ignored. + * + * @param {Array|String} field + * @return {ServerResponse} for chaining + * @public + */ + +res.vary = function(field){ + // checks for back-compat + if (!field || (Array.isArray(field) && !field.length)) { + deprecate('res.vary(): Provide a field name'); + return this; + } + + vary(this, field); + + return this; +}; + +/** + * Render `view` with the given `options` and optional callback `fn`. + * When a callback function is given a response will _not_ be made + * automatically, otherwise a response of _200_ and _text/html_ is given. + * + * Options: + * + * - `cache` boolean hinting to the engine it should cache + * - `filename` filename of the view being rendered + * + * @public + */ + +res.render = function render(view, options, callback) { + var app = this.req.app; + var done = callback; + var opts = options || {}; + var req = this.req; + var self = this; + + // support callback function as second arg + if (typeof options === 'function') { + done = options; + opts = {}; + } + + // merge res.locals + opts._locals = self.locals; + + // default callback to respond + done = done || function (err, str) { + if (err) return req.next(err); + self.send(str); + }; + + // render + app.render(view, opts, done); +}; + +// pipe the send file stream +function sendfile(res, file, options, callback) { + var done = false; + var streaming; + + // request aborted + function onaborted() { + if (done) return; + done = true; + + var err = new Error('Request aborted'); + err.code = 'ECONNABORTED'; + callback(err); + } + + // directory + function ondirectory() { + if (done) return; + done = true; + + var err = new Error('EISDIR, read'); + err.code = 'EISDIR'; + callback(err); + } + + // errors + function onerror(err) { + if (done) return; + done = true; + callback(err); + } + + // ended + function onend() { + if (done) return; + done = true; + callback(); + } + + // file + function onfile() { + streaming = false; + } + + // finished + function onfinish(err) { + if (err && err.code === 'ECONNRESET') return onaborted(); + if (err) return onerror(err); + if (done) return; + + setImmediate(function () { + if (streaming !== false && !done) { + onaborted(); + return; + } + + if (done) return; + done = true; + callback(); + }); + } + + // streaming + function onstream() { + streaming = true; + } + + file.on('directory', ondirectory); + file.on('end', onend); + file.on('error', onerror); + file.on('file', onfile); + file.on('stream', onstream); + onFinished(res, onfinish); + + if (options.headers) { + // set headers on successful transfer + file.on('headers', function headers(res) { + var obj = options.headers; + var keys = Object.keys(obj); + + for (var i = 0; i < keys.length; i++) { + var k = keys[i]; + res.setHeader(k, obj[k]); + } + }); + } + + // pipe + file.pipe(res); +} + +/** + * Stringify JSON, like JSON.stringify, but v8 optimized, with the + * ability to escape characters that can trigger HTML sniffing. + * + * @param {*} value + * @param {function} replaces + * @param {number} spaces + * @param {boolean} escape + * @returns {string} + * @private + */ + +function stringify (value, replacer, spaces, escape) { + // v8 checks arguments.length for optimizing simple call + // https://bugs.chromium.org/p/v8/issues/detail?id=4730 + var json = replacer || spaces + ? JSON.stringify(value, replacer, spaces) + : JSON.stringify(value); + + if (escape) { + json = json.replace(/[<>&]/g, function (c) { + switch (c.charCodeAt(0)) { + case 0x3c: + return '\\u003c' + case 0x3e: + return '\\u003e' + case 0x26: + return '\\u0026' + /* istanbul ignore next: unreachable default */ + default: + return c + } + }) + } + + return json +} diff --git a/node_modules/express/lib/router/index.js b/node_modules/express/lib/router/index.js new file mode 100644 index 0000000..69e6d38 --- /dev/null +++ b/node_modules/express/lib/router/index.js @@ -0,0 +1,662 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var Route = require('./route'); +var Layer = require('./layer'); +var methods = require('methods'); +var mixin = require('utils-merge'); +var debug = require('debug')('express:router'); +var deprecate = require('depd')('express'); +var flatten = require('array-flatten'); +var parseUrl = require('parseurl'); +var setPrototypeOf = require('setprototypeof') + +/** + * Module variables. + * @private + */ + +var objectRegExp = /^\[object (\S+)\]$/; +var slice = Array.prototype.slice; +var toString = Object.prototype.toString; + +/** + * Initialize a new `Router` with the given `options`. + * + * @param {Object} [options] + * @return {Router} which is an callable function + * @public + */ + +var proto = module.exports = function(options) { + var opts = options || {}; + + function router(req, res, next) { + router.handle(req, res, next); + } + + // mixin Router class functions + setPrototypeOf(router, proto) + + router.params = {}; + router._params = []; + router.caseSensitive = opts.caseSensitive; + router.mergeParams = opts.mergeParams; + router.strict = opts.strict; + router.stack = []; + + return router; +}; + +/** + * Map the given param placeholder `name`(s) to the given callback. + * + * Parameter mapping is used to provide pre-conditions to routes + * which use normalized placeholders. For example a _:user_id_ parameter + * could automatically load a user's information from the database without + * any additional code, + * + * The callback uses the same signature as middleware, the only difference + * being that the value of the placeholder is passed, in this case the _id_ + * of the user. Once the `next()` function is invoked, just like middleware + * it will continue on to execute the route, or subsequent parameter functions. + * + * Just like in middleware, you must either respond to the request or call next + * to avoid stalling the request. + * + * app.param('user_id', function(req, res, next, id){ + * User.find(id, function(err, user){ + * if (err) { + * return next(err); + * } else if (!user) { + * return next(new Error('failed to load user')); + * } + * req.user = user; + * next(); + * }); + * }); + * + * @param {String} name + * @param {Function} fn + * @return {app} for chaining + * @public + */ + +proto.param = function param(name, fn) { + // param logic + if (typeof name === 'function') { + deprecate('router.param(fn): Refactor to use path params'); + this._params.push(name); + return; + } + + // apply param functions + var params = this._params; + var len = params.length; + var ret; + + if (name[0] === ':') { + deprecate('router.param(' + JSON.stringify(name) + ', fn): Use router.param(' + JSON.stringify(name.substr(1)) + ', fn) instead'); + name = name.substr(1); + } + + for (var i = 0; i < len; ++i) { + if (ret = params[i](name, fn)) { + fn = ret; + } + } + + // ensure we end up with a + // middleware function + if ('function' !== typeof fn) { + throw new Error('invalid param() call for ' + name + ', got ' + fn); + } + + (this.params[name] = this.params[name] || []).push(fn); + return this; +}; + +/** + * Dispatch a req, res into the router. + * @private + */ + +proto.handle = function handle(req, res, out) { + var self = this; + + debug('dispatching %s %s', req.method, req.url); + + var idx = 0; + var protohost = getProtohost(req.url) || '' + var removed = ''; + var slashAdded = false; + var paramcalled = {}; + + // store options for OPTIONS request + // only used if OPTIONS request + var options = []; + + // middleware and routes + var stack = self.stack; + + // manage inter-router variables + var parentParams = req.params; + var parentUrl = req.baseUrl || ''; + var done = restore(out, req, 'baseUrl', 'next', 'params'); + + // setup next layer + req.next = next; + + // for options requests, respond with a default if nothing else responds + if (req.method === 'OPTIONS') { + done = wrap(done, function(old, err) { + if (err || options.length === 0) return old(err); + sendOptionsResponse(res, options, old); + }); + } + + // setup basic req values + req.baseUrl = parentUrl; + req.originalUrl = req.originalUrl || req.url; + + next(); + + function next(err) { + var layerError = err === 'route' + ? null + : err; + + // remove added slash + if (slashAdded) { + req.url = req.url.substr(1); + slashAdded = false; + } + + // restore altered req.url + if (removed.length !== 0) { + req.baseUrl = parentUrl; + req.url = protohost + removed + req.url.substr(protohost.length); + removed = ''; + } + + // signal to exit router + if (layerError === 'router') { + setImmediate(done, null) + return + } + + // no more matching layers + if (idx >= stack.length) { + setImmediate(done, layerError); + return; + } + + // get pathname of request + var path = getPathname(req); + + if (path == null) { + return done(layerError); + } + + // find next matching layer + var layer; + var match; + var route; + + while (match !== true && idx < stack.length) { + layer = stack[idx++]; + match = matchLayer(layer, path); + route = layer.route; + + if (typeof match !== 'boolean') { + // hold on to layerError + layerError = layerError || match; + } + + if (match !== true) { + continue; + } + + if (!route) { + // process non-route handlers normally + continue; + } + + if (layerError) { + // routes do not match with a pending error + match = false; + continue; + } + + var method = req.method; + var has_method = route._handles_method(method); + + // build up automatic options response + if (!has_method && method === 'OPTIONS') { + appendMethods(options, route._options()); + } + + // don't even bother matching route + if (!has_method && method !== 'HEAD') { + match = false; + continue; + } + } + + // no match + if (match !== true) { + return done(layerError); + } + + // store route for dispatch on change + if (route) { + req.route = route; + } + + // Capture one-time layer values + req.params = self.mergeParams + ? mergeParams(layer.params, parentParams) + : layer.params; + var layerPath = layer.path; + + // this should be done for the layer + self.process_params(layer, paramcalled, req, res, function (err) { + if (err) { + return next(layerError || err); + } + + if (route) { + return layer.handle_request(req, res, next); + } + + trim_prefix(layer, layerError, layerPath, path); + }); + } + + function trim_prefix(layer, layerError, layerPath, path) { + if (layerPath.length !== 0) { + // Validate path breaks on a path separator + var c = path[layerPath.length] + if (c && c !== '/' && c !== '.') return next(layerError) + + // Trim off the part of the url that matches the route + // middleware (.use stuff) needs to have the path stripped + debug('trim prefix (%s) from url %s', layerPath, req.url); + removed = layerPath; + req.url = protohost + req.url.substr(protohost.length + removed.length); + + // Ensure leading slash + if (!protohost && req.url[0] !== '/') { + req.url = '/' + req.url; + slashAdded = true; + } + + // Setup base URL (no trailing slash) + req.baseUrl = parentUrl + (removed[removed.length - 1] === '/' + ? removed.substring(0, removed.length - 1) + : removed); + } + + debug('%s %s : %s', layer.name, layerPath, req.originalUrl); + + if (layerError) { + layer.handle_error(layerError, req, res, next); + } else { + layer.handle_request(req, res, next); + } + } +}; + +/** + * Process any parameters for the layer. + * @private + */ + +proto.process_params = function process_params(layer, called, req, res, done) { + var params = this.params; + + // captured parameters from the layer, keys and values + var keys = layer.keys; + + // fast track + if (!keys || keys.length === 0) { + return done(); + } + + var i = 0; + var name; + var paramIndex = 0; + var key; + var paramVal; + var paramCallbacks; + var paramCalled; + + // process params in order + // param callbacks can be async + function param(err) { + if (err) { + return done(err); + } + + if (i >= keys.length ) { + return done(); + } + + paramIndex = 0; + key = keys[i++]; + name = key.name; + paramVal = req.params[name]; + paramCallbacks = params[name]; + paramCalled = called[name]; + + if (paramVal === undefined || !paramCallbacks) { + return param(); + } + + // param previously called with same value or error occurred + if (paramCalled && (paramCalled.match === paramVal + || (paramCalled.error && paramCalled.error !== 'route'))) { + // restore value + req.params[name] = paramCalled.value; + + // next param + return param(paramCalled.error); + } + + called[name] = paramCalled = { + error: null, + match: paramVal, + value: paramVal + }; + + paramCallback(); + } + + // single param callbacks + function paramCallback(err) { + var fn = paramCallbacks[paramIndex++]; + + // store updated value + paramCalled.value = req.params[key.name]; + + if (err) { + // store error + paramCalled.error = err; + param(err); + return; + } + + if (!fn) return param(); + + try { + fn(req, res, paramCallback, paramVal, key.name); + } catch (e) { + paramCallback(e); + } + } + + param(); +}; + +/** + * Use the given middleware function, with optional path, defaulting to "/". + * + * Use (like `.all`) will run for any http METHOD, but it will not add + * handlers for those methods so OPTIONS requests will not consider `.use` + * functions even if they could respond. + * + * The other difference is that _route_ path is stripped and not visible + * to the handler function. The main effect of this feature is that mounted + * handlers can operate without any code changes regardless of the "prefix" + * pathname. + * + * @public + */ + +proto.use = function use(fn) { + var offset = 0; + var path = '/'; + + // default path to '/' + // disambiguate router.use([fn]) + if (typeof fn !== 'function') { + var arg = fn; + + while (Array.isArray(arg) && arg.length !== 0) { + arg = arg[0]; + } + + // first arg is the path + if (typeof arg !== 'function') { + offset = 1; + path = fn; + } + } + + var callbacks = flatten(slice.call(arguments, offset)); + + if (callbacks.length === 0) { + throw new TypeError('Router.use() requires a middleware function') + } + + for (var i = 0; i < callbacks.length; i++) { + var fn = callbacks[i]; + + if (typeof fn !== 'function') { + throw new TypeError('Router.use() requires a middleware function but got a ' + gettype(fn)) + } + + // add the middleware + debug('use %o %s', path, fn.name || '<anonymous>') + + var layer = new Layer(path, { + sensitive: this.caseSensitive, + strict: false, + end: false + }, fn); + + layer.route = undefined; + + this.stack.push(layer); + } + + return this; +}; + +/** + * Create a new Route for the given path. + * + * Each route contains a separate middleware stack and VERB handlers. + * + * See the Route api documentation for details on adding handlers + * and middleware to routes. + * + * @param {String} path + * @return {Route} + * @public + */ + +proto.route = function route(path) { + var route = new Route(path); + + var layer = new Layer(path, { + sensitive: this.caseSensitive, + strict: this.strict, + end: true + }, route.dispatch.bind(route)); + + layer.route = route; + + this.stack.push(layer); + return route; +}; + +// create Router#VERB functions +methods.concat('all').forEach(function(method){ + proto[method] = function(path){ + var route = this.route(path) + route[method].apply(route, slice.call(arguments, 1)); + return this; + }; +}); + +// append methods to a list of methods +function appendMethods(list, addition) { + for (var i = 0; i < addition.length; i++) { + var method = addition[i]; + if (list.indexOf(method) === -1) { + list.push(method); + } + } +} + +// get pathname of request +function getPathname(req) { + try { + return parseUrl(req).pathname; + } catch (err) { + return undefined; + } +} + +// Get get protocol + host for a URL +function getProtohost(url) { + if (typeof url !== 'string' || url.length === 0 || url[0] === '/') { + return undefined + } + + var searchIndex = url.indexOf('?') + var pathLength = searchIndex !== -1 + ? searchIndex + : url.length + var fqdnIndex = url.substr(0, pathLength).indexOf('://') + + return fqdnIndex !== -1 + ? url.substr(0, url.indexOf('/', 3 + fqdnIndex)) + : undefined +} + +// get type for error message +function gettype(obj) { + var type = typeof obj; + + if (type !== 'object') { + return type; + } + + // inspect [[Class]] for objects + return toString.call(obj) + .replace(objectRegExp, '$1'); +} + +/** + * Match path to a layer. + * + * @param {Layer} layer + * @param {string} path + * @private + */ + +function matchLayer(layer, path) { + try { + return layer.match(path); + } catch (err) { + return err; + } +} + +// merge params with parent params +function mergeParams(params, parent) { + if (typeof parent !== 'object' || !parent) { + return params; + } + + // make copy of parent for base + var obj = mixin({}, parent); + + // simple non-numeric merging + if (!(0 in params) || !(0 in parent)) { + return mixin(obj, params); + } + + var i = 0; + var o = 0; + + // determine numeric gaps + while (i in params) { + i++; + } + + while (o in parent) { + o++; + } + + // offset numeric indices in params before merge + for (i--; i >= 0; i--) { + params[i + o] = params[i]; + + // create holes for the merge when necessary + if (i < o) { + delete params[i]; + } + } + + return mixin(obj, params); +} + +// restore obj props after function +function restore(fn, obj) { + var props = new Array(arguments.length - 2); + var vals = new Array(arguments.length - 2); + + for (var i = 0; i < props.length; i++) { + props[i] = arguments[i + 2]; + vals[i] = obj[props[i]]; + } + + return function () { + // restore vals + for (var i = 0; i < props.length; i++) { + obj[props[i]] = vals[i]; + } + + return fn.apply(this, arguments); + }; +} + +// send an OPTIONS response +function sendOptionsResponse(res, options, next) { + try { + var body = options.join(','); + res.set('Allow', body); + res.send(body); + } catch (err) { + next(err); + } +} + +// wrap a function +function wrap(old, fn) { + return function proxy() { + var args = new Array(arguments.length + 1); + + args[0] = old; + for (var i = 0, len = arguments.length; i < len; i++) { + args[i + 1] = arguments[i]; + } + + fn.apply(this, args); + }; +} diff --git a/node_modules/express/lib/router/layer.js b/node_modules/express/lib/router/layer.js new file mode 100644 index 0000000..4dc8e86 --- /dev/null +++ b/node_modules/express/lib/router/layer.js @@ -0,0 +1,181 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var pathRegexp = require('path-to-regexp'); +var debug = require('debug')('express:router:layer'); + +/** + * Module variables. + * @private + */ + +var hasOwnProperty = Object.prototype.hasOwnProperty; + +/** + * Module exports. + * @public + */ + +module.exports = Layer; + +function Layer(path, options, fn) { + if (!(this instanceof Layer)) { + return new Layer(path, options, fn); + } + + debug('new %o', path) + var opts = options || {}; + + this.handle = fn; + this.name = fn.name || '<anonymous>'; + this.params = undefined; + this.path = undefined; + this.regexp = pathRegexp(path, this.keys = [], opts); + + // set fast path flags + this.regexp.fast_star = path === '*' + this.regexp.fast_slash = path === '/' && opts.end === false +} + +/** + * Handle the error for the layer. + * + * @param {Error} error + * @param {Request} req + * @param {Response} res + * @param {function} next + * @api private + */ + +Layer.prototype.handle_error = function handle_error(error, req, res, next) { + var fn = this.handle; + + if (fn.length !== 4) { + // not a standard error handler + return next(error); + } + + try { + fn(error, req, res, next); + } catch (err) { + next(err); + } +}; + +/** + * Handle the request for the layer. + * + * @param {Request} req + * @param {Response} res + * @param {function} next + * @api private + */ + +Layer.prototype.handle_request = function handle(req, res, next) { + var fn = this.handle; + + if (fn.length > 3) { + // not a standard request handler + return next(); + } + + try { + fn(req, res, next); + } catch (err) { + next(err); + } +}; + +/** + * Check if this route matches `path`, if so + * populate `.params`. + * + * @param {String} path + * @return {Boolean} + * @api private + */ + +Layer.prototype.match = function match(path) { + var match + + if (path != null) { + // fast path non-ending match for / (any path matches) + if (this.regexp.fast_slash) { + this.params = {} + this.path = '' + return true + } + + // fast path for * (everything matched in a param) + if (this.regexp.fast_star) { + this.params = {'0': decode_param(path)} + this.path = path + return true + } + + // match the path + match = this.regexp.exec(path) + } + + if (!match) { + this.params = undefined; + this.path = undefined; + return false; + } + + // store values + this.params = {}; + this.path = match[0] + + var keys = this.keys; + var params = this.params; + + for (var i = 1; i < match.length; i++) { + var key = keys[i - 1]; + var prop = key.name; + var val = decode_param(match[i]) + + if (val !== undefined || !(hasOwnProperty.call(params, prop))) { + params[prop] = val; + } + } + + return true; +}; + +/** + * Decode param value. + * + * @param {string} val + * @return {string} + * @private + */ + +function decode_param(val) { + if (typeof val !== 'string' || val.length === 0) { + return val; + } + + try { + return decodeURIComponent(val); + } catch (err) { + if (err instanceof URIError) { + err.message = 'Failed to decode param \'' + val + '\''; + err.status = err.statusCode = 400; + } + + throw err; + } +} diff --git a/node_modules/express/lib/router/route.js b/node_modules/express/lib/router/route.js new file mode 100644 index 0000000..178df0d --- /dev/null +++ b/node_modules/express/lib/router/route.js @@ -0,0 +1,216 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var debug = require('debug')('express:router:route'); +var flatten = require('array-flatten'); +var Layer = require('./layer'); +var methods = require('methods'); + +/** + * Module variables. + * @private + */ + +var slice = Array.prototype.slice; +var toString = Object.prototype.toString; + +/** + * Module exports. + * @public + */ + +module.exports = Route; + +/** + * Initialize `Route` with the given `path`, + * + * @param {String} path + * @public + */ + +function Route(path) { + this.path = path; + this.stack = []; + + debug('new %o', path) + + // route handlers for various http methods + this.methods = {}; +} + +/** + * Determine if the route handles a given method. + * @private + */ + +Route.prototype._handles_method = function _handles_method(method) { + if (this.methods._all) { + return true; + } + + var name = method.toLowerCase(); + + if (name === 'head' && !this.methods['head']) { + name = 'get'; + } + + return Boolean(this.methods[name]); +}; + +/** + * @return {Array} supported HTTP methods + * @private + */ + +Route.prototype._options = function _options() { + var methods = Object.keys(this.methods); + + // append automatic head + if (this.methods.get && !this.methods.head) { + methods.push('head'); + } + + for (var i = 0; i < methods.length; i++) { + // make upper case + methods[i] = methods[i].toUpperCase(); + } + + return methods; +}; + +/** + * dispatch req, res into this route + * @private + */ + +Route.prototype.dispatch = function dispatch(req, res, done) { + var idx = 0; + var stack = this.stack; + if (stack.length === 0) { + return done(); + } + + var method = req.method.toLowerCase(); + if (method === 'head' && !this.methods['head']) { + method = 'get'; + } + + req.route = this; + + next(); + + function next(err) { + // signal to exit route + if (err && err === 'route') { + return done(); + } + + // signal to exit router + if (err && err === 'router') { + return done(err) + } + + var layer = stack[idx++]; + if (!layer) { + return done(err); + } + + if (layer.method && layer.method !== method) { + return next(err); + } + + if (err) { + layer.handle_error(err, req, res, next); + } else { + layer.handle_request(req, res, next); + } + } +}; + +/** + * Add a handler for all HTTP verbs to this route. + * + * Behaves just like middleware and can respond or call `next` + * to continue processing. + * + * You can use multiple `.all` call to add multiple handlers. + * + * function check_something(req, res, next){ + * next(); + * }; + * + * function validate_user(req, res, next){ + * next(); + * }; + * + * route + * .all(validate_user) + * .all(check_something) + * .get(function(req, res, next){ + * res.send('hello world'); + * }); + * + * @param {function} handler + * @return {Route} for chaining + * @api public + */ + +Route.prototype.all = function all() { + var handles = flatten(slice.call(arguments)); + + for (var i = 0; i < handles.length; i++) { + var handle = handles[i]; + + if (typeof handle !== 'function') { + var type = toString.call(handle); + var msg = 'Route.all() requires a callback function but got a ' + type + throw new TypeError(msg); + } + + var layer = Layer('/', {}, handle); + layer.method = undefined; + + this.methods._all = true; + this.stack.push(layer); + } + + return this; +}; + +methods.forEach(function(method){ + Route.prototype[method] = function(){ + var handles = flatten(slice.call(arguments)); + + for (var i = 0; i < handles.length; i++) { + var handle = handles[i]; + + if (typeof handle !== 'function') { + var type = toString.call(handle); + var msg = 'Route.' + method + '() requires a callback function but got a ' + type + throw new Error(msg); + } + + debug('%s %o', method, this.path) + + var layer = Layer('/', {}, handle); + layer.method = method; + + this.methods[method] = true; + this.stack.push(layer); + } + + return this; + }; +}); diff --git a/node_modules/express/lib/utils.js b/node_modules/express/lib/utils.js new file mode 100644 index 0000000..bd81ac7 --- /dev/null +++ b/node_modules/express/lib/utils.js @@ -0,0 +1,306 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @api private + */ + +var Buffer = require('safe-buffer').Buffer +var contentDisposition = require('content-disposition'); +var contentType = require('content-type'); +var deprecate = require('depd')('express'); +var flatten = require('array-flatten'); +var mime = require('send').mime; +var etag = require('etag'); +var proxyaddr = require('proxy-addr'); +var qs = require('qs'); +var querystring = require('querystring'); + +/** + * Return strong ETag for `body`. + * + * @param {String|Buffer} body + * @param {String} [encoding] + * @return {String} + * @api private + */ + +exports.etag = createETagGenerator({ weak: false }) + +/** + * Return weak ETag for `body`. + * + * @param {String|Buffer} body + * @param {String} [encoding] + * @return {String} + * @api private + */ + +exports.wetag = createETagGenerator({ weak: true }) + +/** + * Check if `path` looks absolute. + * + * @param {String} path + * @return {Boolean} + * @api private + */ + +exports.isAbsolute = function(path){ + if ('/' === path[0]) return true; + if (':' === path[1] && ('\\' === path[2] || '/' === path[2])) return true; // Windows device path + if ('\\\\' === path.substring(0, 2)) return true; // Microsoft Azure absolute path +}; + +/** + * Flatten the given `arr`. + * + * @param {Array} arr + * @return {Array} + * @api private + */ + +exports.flatten = deprecate.function(flatten, + 'utils.flatten: use array-flatten npm module instead'); + +/** + * Normalize the given `type`, for example "html" becomes "text/html". + * + * @param {String} type + * @return {Object} + * @api private + */ + +exports.normalizeType = function(type){ + return ~type.indexOf('/') + ? acceptParams(type) + : { value: mime.lookup(type), params: {} }; +}; + +/** + * Normalize `types`, for example "html" becomes "text/html". + * + * @param {Array} types + * @return {Array} + * @api private + */ + +exports.normalizeTypes = function(types){ + var ret = []; + + for (var i = 0; i < types.length; ++i) { + ret.push(exports.normalizeType(types[i])); + } + + return ret; +}; + +/** + * Generate Content-Disposition header appropriate for the filename. + * non-ascii filenames are urlencoded and a filename* parameter is added + * + * @param {String} filename + * @return {String} + * @api private + */ + +exports.contentDisposition = deprecate.function(contentDisposition, + 'utils.contentDisposition: use content-disposition npm module instead'); + +/** + * Parse accept params `str` returning an + * object with `.value`, `.quality` and `.params`. + * also includes `.originalIndex` for stable sorting + * + * @param {String} str + * @return {Object} + * @api private + */ + +function acceptParams(str, index) { + var parts = str.split(/ *; */); + var ret = { value: parts[0], quality: 1, params: {}, originalIndex: index }; + + for (var i = 1; i < parts.length; ++i) { + var pms = parts[i].split(/ *= */); + if ('q' === pms[0]) { + ret.quality = parseFloat(pms[1]); + } else { + ret.params[pms[0]] = pms[1]; + } + } + + return ret; +} + +/** + * Compile "etag" value to function. + * + * @param {Boolean|String|Function} val + * @return {Function} + * @api private + */ + +exports.compileETag = function(val) { + var fn; + + if (typeof val === 'function') { + return val; + } + + switch (val) { + case true: + fn = exports.wetag; + break; + case false: + break; + case 'strong': + fn = exports.etag; + break; + case 'weak': + fn = exports.wetag; + break; + default: + throw new TypeError('unknown value for etag function: ' + val); + } + + return fn; +} + +/** + * Compile "query parser" value to function. + * + * @param {String|Function} val + * @return {Function} + * @api private + */ + +exports.compileQueryParser = function compileQueryParser(val) { + var fn; + + if (typeof val === 'function') { + return val; + } + + switch (val) { + case true: + fn = querystring.parse; + break; + case false: + fn = newObject; + break; + case 'extended': + fn = parseExtendedQueryString; + break; + case 'simple': + fn = querystring.parse; + break; + default: + throw new TypeError('unknown value for query parser function: ' + val); + } + + return fn; +} + +/** + * Compile "proxy trust" value to function. + * + * @param {Boolean|String|Number|Array|Function} val + * @return {Function} + * @api private + */ + +exports.compileTrust = function(val) { + if (typeof val === 'function') return val; + + if (val === true) { + // Support plain true/false + return function(){ return true }; + } + + if (typeof val === 'number') { + // Support trusting hop count + return function(a, i){ return i < val }; + } + + if (typeof val === 'string') { + // Support comma-separated values + val = val.split(/ *, */); + } + + return proxyaddr.compile(val || []); +} + +/** + * Set the charset in a given Content-Type string. + * + * @param {String} type + * @param {String} charset + * @return {String} + * @api private + */ + +exports.setCharset = function setCharset(type, charset) { + if (!type || !charset) { + return type; + } + + // parse type + var parsed = contentType.parse(type); + + // set charset + parsed.parameters.charset = charset; + + // format type + return contentType.format(parsed); +}; + +/** + * Create an ETag generator function, generating ETags with + * the given options. + * + * @param {object} options + * @return {function} + * @private + */ + +function createETagGenerator (options) { + return function generateETag (body, encoding) { + var buf = !Buffer.isBuffer(body) + ? Buffer.from(body, encoding) + : body + + return etag(buf, options) + } +} + +/** + * Parse an extended query string with qs. + * + * @return {Object} + * @private + */ + +function parseExtendedQueryString(str) { + return qs.parse(str, { + allowPrototypes: true + }); +} + +/** + * Return new empty object. + * + * @return {Object} + * @api private + */ + +function newObject() { + return {}; +} diff --git a/node_modules/express/lib/view.js b/node_modules/express/lib/view.js new file mode 100644 index 0000000..cf101ca --- /dev/null +++ b/node_modules/express/lib/view.js @@ -0,0 +1,182 @@ +/*! + * express + * Copyright(c) 2009-2013 TJ Holowaychuk + * Copyright(c) 2013 Roman Shtylman + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var debug = require('debug')('express:view'); +var path = require('path'); +var fs = require('fs'); + +/** + * Module variables. + * @private + */ + +var dirname = path.dirname; +var basename = path.basename; +var extname = path.extname; +var join = path.join; +var resolve = path.resolve; + +/** + * Module exports. + * @public + */ + +module.exports = View; + +/** + * Initialize a new `View` with the given `name`. + * + * Options: + * + * - `defaultEngine` the default template engine name + * - `engines` template engine require() cache + * - `root` root path for view lookup + * + * @param {string} name + * @param {object} options + * @public + */ + +function View(name, options) { + var opts = options || {}; + + this.defaultEngine = opts.defaultEngine; + this.ext = extname(name); + this.name = name; + this.root = opts.root; + + if (!this.ext && !this.defaultEngine) { + throw new Error('No default engine was specified and no extension was provided.'); + } + + var fileName = name; + + if (!this.ext) { + // get extension from default engine name + this.ext = this.defaultEngine[0] !== '.' + ? '.' + this.defaultEngine + : this.defaultEngine; + + fileName += this.ext; + } + + if (!opts.engines[this.ext]) { + // load engine + var mod = this.ext.substr(1) + debug('require "%s"', mod) + + // default engine export + var fn = require(mod).__express + + if (typeof fn !== 'function') { + throw new Error('Module "' + mod + '" does not provide a view engine.') + } + + opts.engines[this.ext] = fn + } + + // store loaded engine + this.engine = opts.engines[this.ext]; + + // lookup path + this.path = this.lookup(fileName); +} + +/** + * Lookup view by the given `name` + * + * @param {string} name + * @private + */ + +View.prototype.lookup = function lookup(name) { + var path; + var roots = [].concat(this.root); + + debug('lookup "%s"', name); + + for (var i = 0; i < roots.length && !path; i++) { + var root = roots[i]; + + // resolve the path + var loc = resolve(root, name); + var dir = dirname(loc); + var file = basename(loc); + + // resolve the file + path = this.resolve(dir, file); + } + + return path; +}; + +/** + * Render with the given options. + * + * @param {object} options + * @param {function} callback + * @private + */ + +View.prototype.render = function render(options, callback) { + debug('render "%s"', this.path); + this.engine(this.path, options, callback); +}; + +/** + * Resolve the file within the given directory. + * + * @param {string} dir + * @param {string} file + * @private + */ + +View.prototype.resolve = function resolve(dir, file) { + var ext = this.ext; + + // <path>.<ext> + var path = join(dir, file); + var stat = tryStat(path); + + if (stat && stat.isFile()) { + return path; + } + + // <path>/index.<ext> + path = join(dir, basename(file, ext), 'index' + ext); + stat = tryStat(path); + + if (stat && stat.isFile()) { + return path; + } +}; + +/** + * Return a stat, maybe. + * + * @param {string} path + * @return {fs.Stats} + * @private + */ + +function tryStat(path) { + debug('stat "%s"', path); + + try { + return fs.statSync(path); + } catch (e) { + return undefined; + } +} diff --git a/node_modules/express/package.json b/node_modules/express/package.json new file mode 100644 index 0000000..3652003 --- /dev/null +++ b/node_modules/express/package.json @@ -0,0 +1,154 @@ +{ + "_from": "express", + "_id": "express@4.17.1", + "_inBundle": false, + "_integrity": "sha512-mHJ9O79RqluphRrcw2X/GTh3k9tVv8YcoyY4Kkh4WDMUYKRZUq0h1o0w2rrrxBqM7VoeUVqgb27xlEMXTnYt4g==", + "_location": "/express", + "_phantomChildren": {}, + "_requested": { + "type": "tag", + "registry": true, + "raw": "express", + "name": "express", + "escapedName": "express", + "rawSpec": "", + "saveSpec": null, + "fetchSpec": "latest" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "https://registry.npmjs.org/express/-/express-4.17.1.tgz", + "_shasum": "4491fc38605cf51f8629d39c2b5d026f98a4c134", + "_spec": "express", + "_where": "/home/josuer08/Documents/web", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "bugs": { + "url": "https://github.com/expressjs/express/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Aaron Heckmann", + "email": "aaron.heckmann+github@gmail.com" + }, + { + "name": "Ciaran Jessup", + "email": "ciaranj@gmail.com" + }, + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Guillermo Rauch", + "email": "rauchg@gmail.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com" + }, + { + "name": "Roman Shtylman", + "email": "shtylman+expressjs@gmail.com" + }, + { + "name": "Young Jae Sim", + "email": "hanul@hanul.me" + } + ], + "dependencies": { + "accepts": "~1.3.7", + "array-flatten": "1.1.1", + "body-parser": "1.19.0", + "content-disposition": "0.5.3", + "content-type": "~1.0.4", + "cookie": "0.4.0", + "cookie-signature": "1.0.6", + "debug": "2.6.9", + "depd": "~1.1.2", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "finalhandler": "~1.1.2", + "fresh": "0.5.2", + "merge-descriptors": "1.0.1", + "methods": "~1.1.2", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "path-to-regexp": "0.1.7", + "proxy-addr": "~2.0.5", + "qs": "6.7.0", + "range-parser": "~1.2.1", + "safe-buffer": "5.1.2", + "send": "0.17.1", + "serve-static": "1.14.1", + "setprototypeof": "1.1.1", + "statuses": "~1.5.0", + "type-is": "~1.6.18", + "utils-merge": "1.0.1", + "vary": "~1.1.2" + }, + "deprecated": false, + "description": "Fast, unopinionated, minimalist web framework", + "devDependencies": { + "after": "0.8.2", + "connect-redis": "3.4.1", + "cookie-parser": "~1.4.4", + "cookie-session": "1.3.3", + "ejs": "2.6.1", + "eslint": "2.13.1", + "express-session": "1.16.1", + "hbs": "4.0.4", + "istanbul": "0.4.5", + "marked": "0.6.2", + "method-override": "3.0.0", + "mocha": "5.2.0", + "morgan": "1.9.1", + "multiparty": "4.2.1", + "pbkdf2-password": "1.2.1", + "should": "13.2.3", + "supertest": "3.3.0", + "vhost": "~3.0.2" + }, + "engines": { + "node": ">= 0.10.0" + }, + "files": [ + "LICENSE", + "History.md", + "Readme.md", + "index.js", + "lib/" + ], + "homepage": "http://expressjs.com/", + "keywords": [ + "express", + "framework", + "sinatra", + "web", + "rest", + "restful", + "router", + "app", + "api" + ], + "license": "MIT", + "name": "express", + "repository": { + "type": "git", + "url": "git+https://github.com/expressjs/express.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --require test/support/env --reporter spec --bail --check-leaks test/ test/acceptance/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --require test/support/env --reporter spec --check-leaks test/ test/acceptance/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --require test/support/env --reporter dot --check-leaks test/ test/acceptance/", + "test-tap": "mocha --require test/support/env --reporter tap --check-leaks test/ test/acceptance/" + }, + "version": "4.17.1" +} diff --git a/node_modules/finalhandler/HISTORY.md b/node_modules/finalhandler/HISTORY.md new file mode 100644 index 0000000..920c35e --- /dev/null +++ b/node_modules/finalhandler/HISTORY.md @@ -0,0 +1,187 @@ +1.1.2 / 2019-05-09 +================== + + * Set stricter `Content-Security-Policy` header + * deps: parseurl@~1.3.3 + * deps: statuses@~1.5.0 + +1.1.1 / 2018-03-06 +================== + + * Fix 404 output for bad / missing pathnames + * deps: encodeurl@~1.0.2 + - Fix encoding `%` as last character + * deps: statuses@~1.4.0 + +1.1.0 / 2017-09-24 +================== + + * Use `res.headersSent` when available + +1.0.6 / 2017-09-22 +================== + + * deps: debug@2.6.9 + +1.0.5 / 2017-09-15 +================== + + * deps: parseurl@~1.3.2 + - perf: reduce overhead for full URLs + - perf: unroll the "fast-path" `RegExp` + +1.0.4 / 2017-08-03 +================== + + * deps: debug@2.6.8 + +1.0.3 / 2017-05-16 +================== + + * deps: debug@2.6.7 + - deps: ms@2.0.0 + +1.0.2 / 2017-04-22 +================== + + * deps: debug@2.6.4 + - deps: ms@0.7.3 + +1.0.1 / 2017-03-21 +================== + + * Fix missing `</html>` in HTML document + * deps: debug@2.6.3 + - Fix: `DEBUG_MAX_ARRAY_LENGTH` + +1.0.0 / 2017-02-15 +================== + + * Fix exception when `err` cannot be converted to a string + * Fully URL-encode the pathname in the 404 message + * Only include the pathname in the 404 message + * Send complete HTML document + * Set `Content-Security-Policy: default-src 'self'` header + * deps: debug@2.6.1 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable set to `3` or higher + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + +0.5.1 / 2016-11-12 +================== + + * Fix exception when `err.headers` is not an object + * deps: statuses@~1.3.1 + * perf: hoist regular expressions + * perf: remove duplicate validation path + +0.5.0 / 2016-06-15 +================== + + * Change invalid or non-numeric status code to 500 + * Overwrite status message to match set status code + * Prefer `err.statusCode` if `err.status` is invalid + * Set response headers from `err.headers` object + * Use `statuses` instead of `http` module for status messages + - Includes all defined status messages + +0.4.1 / 2015-12-02 +================== + + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + +0.4.0 / 2015-06-14 +================== + + * Fix a false-positive when unpiping in Node.js 0.8 + * Support `statusCode` property on `Error` objects + * Use `unpipe` module for unpiping requests + * deps: escape-html@1.0.2 + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * perf: enable strict mode + * perf: remove argument reassignment + +0.3.6 / 2015-05-11 +================== + + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + +0.3.5 / 2015-04-22 +================== + + * deps: on-finished@~2.2.1 + - Fix `isFinished(req)` when data buffered + +0.3.4 / 2015-03-15 +================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + +0.3.3 / 2015-01-01 +================== + + * deps: debug@~2.1.1 + * deps: on-finished@~2.2.0 + +0.3.2 / 2014-10-22 +================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + +0.3.1 / 2014-10-16 +================== + + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + +0.3.0 / 2014-09-17 +================== + + * Terminate in progress response only on error + * Use `on-finished` to determine request status + +0.2.0 / 2014-09-03 +================== + + * Set `X-Content-Type-Options: nosniff` header + * deps: debug@~2.0.0 + +0.1.0 / 2014-07-16 +================== + + * Respond after request fully read + - prevents hung responses and socket hang ups + * deps: debug@1.0.4 + +0.0.3 / 2014-07-11 +================== + + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + +0.0.2 / 2014-06-19 +================== + + * Handle invalid status codes + +0.0.1 / 2014-06-05 +================== + + * deps: debug@1.0.2 + +0.0.0 / 2014-06-05 +================== + + * Extracted from connect/express diff --git a/node_modules/finalhandler/LICENSE b/node_modules/finalhandler/LICENSE new file mode 100644 index 0000000..fb30982 --- /dev/null +++ b/node_modules/finalhandler/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/finalhandler/README.md b/node_modules/finalhandler/README.md new file mode 100644 index 0000000..96327f0 --- /dev/null +++ b/node_modules/finalhandler/README.md @@ -0,0 +1,148 @@ +# finalhandler + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Node.js function to invoke as the final step to respond to HTTP request. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install finalhandler +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var finalhandler = require('finalhandler') +``` + +### finalhandler(req, res, [options]) + +Returns function to be invoked as the final step for the given `req` and `res`. +This function is to be invoked as `fn(err)`. If `err` is falsy, the handler will +write out a 404 response to the `res`. If it is truthy, an error response will +be written out to the `res`. + +When an error is written, the following information is added to the response: + + * The `res.statusCode` is set from `err.status` (or `err.statusCode`). If + this value is outside the 4xx or 5xx range, it will be set to 500. + * The `res.statusMessage` is set according to the status code. + * The body will be the HTML of the status code message if `env` is + `'production'`, otherwise will be `err.stack`. + * Any headers specified in an `err.headers` object. + +The final handler will also unpipe anything from `req` when it is invoked. + +#### options.env + +By default, the environment is determined by `NODE_ENV` variable, but it can be +overridden by this option. + +#### options.onerror + +Provide a function to be called with the `err` when it exists. Can be used for +writing errors to a central location without excessive function generation. Called +as `onerror(err, req, res)`. + +## Examples + +### always 404 + +```js +var finalhandler = require('finalhandler') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + done() +}) + +server.listen(3000) +``` + +### perform simple action + +```js +var finalhandler = require('finalhandler') +var fs = require('fs') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + + fs.readFile('index.html', function (err, buf) { + if (err) return done(err) + res.setHeader('Content-Type', 'text/html') + res.end(buf) + }) +}) + +server.listen(3000) +``` + +### use with middleware-style functions + +```js +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +var serve = serveStatic('public') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + serve(req, res, done) +}) + +server.listen(3000) +``` + +### keep log of all errors + +```js +var finalhandler = require('finalhandler') +var fs = require('fs') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res, { onerror: logerror }) + + fs.readFile('index.html', function (err, buf) { + if (err) return done(err) + res.setHeader('Content-Type', 'text/html') + res.end(buf) + }) +}) + +server.listen(3000) + +function logerror (err) { + console.error(err.stack || err.toString()) +} +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/finalhandler.svg +[npm-url]: https://npmjs.org/package/finalhandler +[node-image]: https://img.shields.io/node/v/finalhandler.svg +[node-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/pillarjs/finalhandler.svg +[travis-url]: https://travis-ci.org/pillarjs/finalhandler +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/finalhandler.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/finalhandler?branch=master +[downloads-image]: https://img.shields.io/npm/dm/finalhandler.svg +[downloads-url]: https://npmjs.org/package/finalhandler diff --git a/node_modules/finalhandler/index.js b/node_modules/finalhandler/index.js new file mode 100644 index 0000000..5673507 --- /dev/null +++ b/node_modules/finalhandler/index.js @@ -0,0 +1,331 @@ +/*! + * finalhandler + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var debug = require('debug')('finalhandler') +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var onFinished = require('on-finished') +var parseUrl = require('parseurl') +var statuses = require('statuses') +var unpipe = require('unpipe') + +/** + * Module variables. + * @private + */ + +var DOUBLE_SPACE_REGEXP = /\x20{2}/g +var NEWLINE_REGEXP = /\n/g + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function (fn) { process.nextTick(fn.bind.apply(fn, arguments)) } +var isFinished = onFinished.isFinished + +/** + * Create a minimal HTML document. + * + * @param {string} message + * @private + */ + +function createHtmlDocument (message) { + var body = escapeHtml(message) + .replace(NEWLINE_REGEXP, '<br>') + .replace(DOUBLE_SPACE_REGEXP, ' ') + + return '<!DOCTYPE html>\n' + + '<html lang="en">\n' + + '<head>\n' + + '<meta charset="utf-8">\n' + + '<title>Error</title>\n' + + '</head>\n' + + '<body>\n' + + '<pre>' + body + '</pre>\n' + + '</body>\n' + + '</html>\n' +} + +/** + * Module exports. + * @public + */ + +module.exports = finalhandler + +/** + * Create a function to handle the final response. + * + * @param {Request} req + * @param {Response} res + * @param {Object} [options] + * @return {Function} + * @public + */ + +function finalhandler (req, res, options) { + var opts = options || {} + + // get environment + var env = opts.env || process.env.NODE_ENV || 'development' + + // get error callback + var onerror = opts.onerror + + return function (err) { + var headers + var msg + var status + + // ignore 404 on in-flight response + if (!err && headersSent(res)) { + debug('cannot 404 after headers sent') + return + } + + // unhandled error + if (err) { + // respect status code from error + status = getErrorStatusCode(err) + + if (status === undefined) { + // fallback to status code on response + status = getResponseStatusCode(res) + } else { + // respect headers from error + headers = getErrorHeaders(err) + } + + // get error message + msg = getErrorMessage(err, status, env) + } else { + // not found + status = 404 + msg = 'Cannot ' + req.method + ' ' + encodeUrl(getResourceName(req)) + } + + debug('default %s', status) + + // schedule onerror callback + if (err && onerror) { + defer(onerror, err, req, res) + } + + // cannot actually respond + if (headersSent(res)) { + debug('cannot %d after headers sent', status) + req.socket.destroy() + return + } + + // send response + send(req, res, status, headers, msg) + } +} + +/** + * Get headers from Error object. + * + * @param {Error} err + * @return {object} + * @private + */ + +function getErrorHeaders (err) { + if (!err.headers || typeof err.headers !== 'object') { + return undefined + } + + var headers = Object.create(null) + var keys = Object.keys(err.headers) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + headers[key] = err.headers[key] + } + + return headers +} + +/** + * Get message from Error object, fallback to status message. + * + * @param {Error} err + * @param {number} status + * @param {string} env + * @return {string} + * @private + */ + +function getErrorMessage (err, status, env) { + var msg + + if (env !== 'production') { + // use err.stack, which typically includes err.message + msg = err.stack + + // fallback to err.toString() when possible + if (!msg && typeof err.toString === 'function') { + msg = err.toString() + } + } + + return msg || statuses[status] +} + +/** + * Get status code from Error object. + * + * @param {Error} err + * @return {number} + * @private + */ + +function getErrorStatusCode (err) { + // check err.status + if (typeof err.status === 'number' && err.status >= 400 && err.status < 600) { + return err.status + } + + // check err.statusCode + if (typeof err.statusCode === 'number' && err.statusCode >= 400 && err.statusCode < 600) { + return err.statusCode + } + + return undefined +} + +/** + * Get resource name for the request. + * + * This is typically just the original pathname of the request + * but will fallback to "resource" is that cannot be determined. + * + * @param {IncomingMessage} req + * @return {string} + * @private + */ + +function getResourceName (req) { + try { + return parseUrl.original(req).pathname + } catch (e) { + return 'resource' + } +} + +/** + * Get status code from response. + * + * @param {OutgoingMessage} res + * @return {number} + * @private + */ + +function getResponseStatusCode (res) { + var status = res.statusCode + + // default status code to 500 if outside valid range + if (typeof status !== 'number' || status < 400 || status > 599) { + status = 500 + } + + return status +} + +/** + * Determine if the response headers have been sent. + * + * @param {object} res + * @returns {boolean} + * @private + */ + +function headersSent (res) { + return typeof res.headersSent !== 'boolean' + ? Boolean(res._header) + : res.headersSent +} + +/** + * Send response. + * + * @param {IncomingMessage} req + * @param {OutgoingMessage} res + * @param {number} status + * @param {object} headers + * @param {string} message + * @private + */ + +function send (req, res, status, headers, message) { + function write () { + // response body + var body = createHtmlDocument(message) + + // response status + res.statusCode = status + res.statusMessage = statuses[status] + + // response headers + setHeaders(res, headers) + + // security headers + res.setHeader('Content-Security-Policy', "default-src 'none'") + res.setHeader('X-Content-Type-Options', 'nosniff') + + // standard headers + res.setHeader('Content-Type', 'text/html; charset=utf-8') + res.setHeader('Content-Length', Buffer.byteLength(body, 'utf8')) + + if (req.method === 'HEAD') { + res.end() + return + } + + res.end(body, 'utf8') + } + + if (isFinished(req)) { + write() + return + } + + // unpipe everything from the request + unpipe(req) + + // flush the request + onFinished(req, write) + req.resume() +} + +/** + * Set response headers from an object. + * + * @param {OutgoingMessage} res + * @param {object} headers + * @private + */ + +function setHeaders (res, headers) { + if (!headers) { + return + } + + var keys = Object.keys(headers) + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + res.setHeader(key, headers[key]) + } +} diff --git a/node_modules/finalhandler/package.json b/node_modules/finalhandler/package.json new file mode 100644 index 0000000..0103bc8 --- /dev/null +++ b/node_modules/finalhandler/package.json @@ -0,0 +1,80 @@ +{ + "_from": "finalhandler@~1.1.2", + "_id": "finalhandler@1.1.2", + "_inBundle": false, + "_integrity": "sha512-aAWcW57uxVNrQZqFXjITpW3sIUQmHGG3qSb9mUah9MgMC4NeWhNOlNjXEYq3HjRAvL6arUviZGGJsBg6z0zsWA==", + "_location": "/finalhandler", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "finalhandler@~1.1.2", + "name": "finalhandler", + "escapedName": "finalhandler", + "rawSpec": "~1.1.2", + "saveSpec": null, + "fetchSpec": "~1.1.2" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.2.tgz", + "_shasum": "b7e7d000ffd11938d0fdb053506f6ebabe9f587d", + "_spec": "finalhandler@~1.1.2", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/pillarjs/finalhandler/issues" + }, + "bundleDependencies": false, + "dependencies": { + "debug": "2.6.9", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "statuses": "~1.5.0", + "unpipe": "~1.0.0" + }, + "deprecated": false, + "description": "Node.js final http responder", + "devDependencies": { + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "6.1.4", + "readable-stream": "2.3.6", + "safe-buffer": "5.1.2", + "supertest": "4.0.2" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/pillarjs/finalhandler#readme", + "license": "MIT", + "name": "finalhandler", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/finalhandler.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "1.1.2" +} diff --git a/node_modules/forwarded/HISTORY.md b/node_modules/forwarded/HISTORY.md new file mode 100644 index 0000000..2599a55 --- /dev/null +++ b/node_modules/forwarded/HISTORY.md @@ -0,0 +1,16 @@ +0.1.2 / 2017-09-14 +================== + + * perf: improve header parsing + * perf: reduce overhead when no `X-Forwarded-For` header + +0.1.1 / 2017-09-10 +================== + + * Fix trimming leading / trailing OWS + * perf: hoist regular expression + +0.1.0 / 2014-09-21 +================== + + * Initial release diff --git a/node_modules/forwarded/LICENSE b/node_modules/forwarded/LICENSE new file mode 100644 index 0000000..84441fb --- /dev/null +++ b/node_modules/forwarded/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/forwarded/README.md b/node_modules/forwarded/README.md new file mode 100644 index 0000000..c776ee5 --- /dev/null +++ b/node_modules/forwarded/README.md @@ -0,0 +1,57 @@ +# forwarded + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Parse HTTP X-Forwarded-For header + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install forwarded +``` + +## API + +```js +var forwarded = require('forwarded') +``` + +### forwarded(req) + +```js +var addresses = forwarded(req) +``` + +Parse the `X-Forwarded-For` header from the request. Returns an array +of the addresses, including the socket address for the `req`, in reverse +order (i.e. index `0` is the socket address and the last index is the +furthest address, typically the end-user). + +## Testing + +```sh +$ npm test +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/forwarded.svg +[npm-url]: https://npmjs.org/package/forwarded +[node-version-image]: https://img.shields.io/node/v/forwarded.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/forwarded/master.svg +[travis-url]: https://travis-ci.org/jshttp/forwarded +[coveralls-image]: https://img.shields.io/coveralls/jshttp/forwarded/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/forwarded?branch=master +[downloads-image]: https://img.shields.io/npm/dm/forwarded.svg +[downloads-url]: https://npmjs.org/package/forwarded diff --git a/node_modules/forwarded/index.js b/node_modules/forwarded/index.js new file mode 100644 index 0000000..7833b3d --- /dev/null +++ b/node_modules/forwarded/index.js @@ -0,0 +1,76 @@ +/*! + * forwarded + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = forwarded + +/** + * Get all addresses in the request, using the `X-Forwarded-For` header. + * + * @param {object} req + * @return {array} + * @public + */ + +function forwarded (req) { + if (!req) { + throw new TypeError('argument req is required') + } + + // simple header parsing + var proxyAddrs = parse(req.headers['x-forwarded-for'] || '') + var socketAddr = req.connection.remoteAddress + var addrs = [socketAddr].concat(proxyAddrs) + + // return all addresses + return addrs +} + +/** + * Parse the X-Forwarded-For header. + * + * @param {string} header + * @private + */ + +function parse (header) { + var end = header.length + var list = [] + var start = header.length + + // gather addresses, backwards + for (var i = header.length - 1; i >= 0; i--) { + switch (header.charCodeAt(i)) { + case 0x20: /* */ + if (start === end) { + start = end = i + } + break + case 0x2c: /* , */ + if (start !== end) { + list.push(header.substring(start, end)) + } + start = end = i + break + default: + start = i + break + } + } + + // final address + if (start !== end) { + list.push(header.substring(start, end)) + } + + return list +} diff --git a/node_modules/forwarded/package.json b/node_modules/forwarded/package.json new file mode 100644 index 0000000..89ae401 --- /dev/null +++ b/node_modules/forwarded/package.json @@ -0,0 +1,78 @@ +{ + "_from": "forwarded@~0.1.2", + "_id": "forwarded@0.1.2", + "_inBundle": false, + "_integrity": "sha1-mMI9qxF1ZXuMBXPozszZGw/xjIQ=", + "_location": "/forwarded", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "forwarded@~0.1.2", + "name": "forwarded", + "escapedName": "forwarded", + "rawSpec": "~0.1.2", + "saveSpec": null, + "fetchSpec": "~0.1.2" + }, + "_requiredBy": [ + "/proxy-addr" + ], + "_resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.2.tgz", + "_shasum": "98c23dab1175657b8c0573e8ceccd91b0ff18c84", + "_spec": "forwarded@~0.1.2", + "_where": "/home/josuer08/Documents/web/node_modules/proxy-addr", + "bugs": { + "url": "https://github.com/jshttp/forwarded/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "deprecated": false, + "description": "Parse HTTP X-Forwarded-For header", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.7.0", + "eslint-plugin-node": "5.1.1", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/forwarded#readme", + "keywords": [ + "x-forwarded-for", + "http", + "req" + ], + "license": "MIT", + "name": "forwarded", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/forwarded.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.1.2" +} diff --git a/node_modules/fresh/HISTORY.md b/node_modules/fresh/HISTORY.md new file mode 100644 index 0000000..4586996 --- /dev/null +++ b/node_modules/fresh/HISTORY.md @@ -0,0 +1,70 @@ +0.5.2 / 2017-09-13 +================== + + * Fix regression matching multiple ETags in `If-None-Match` + * perf: improve `If-None-Match` token parsing + +0.5.1 / 2017-09-11 +================== + + * Fix handling of modified headers with invalid dates + * perf: improve ETag match loop + +0.5.0 / 2017-02-21 +================== + + * Fix incorrect result when `If-None-Match` has both `*` and ETags + * Fix weak `ETag` matching to match spec + * perf: delay reading header values until needed + * perf: skip checking modified time if ETag check failed + * perf: skip parsing `If-None-Match` when no `ETag` header + * perf: use `Date.parse` instead of `new Date` + +0.4.0 / 2017-02-05 +================== + + * Fix false detection of `no-cache` request directive + * perf: enable strict mode + * perf: hoist regular expressions + * perf: remove duplicate conditional + * perf: remove unnecessary boolean coercions + +0.3.0 / 2015-05-12 +================== + + * Add weak `ETag` matching support + +0.2.4 / 2014-09-07 +================== + + * Support Node.js 0.6 + +0.2.3 / 2014-09-07 +================== + + * Move repository to jshttp + +0.2.2 / 2014-02-19 +================== + + * Revert "Fix for blank page on Safari reload" + +0.2.1 / 2014-01-29 +================== + + * Fix for blank page on Safari reload + +0.2.0 / 2013-08-11 +================== + + * Return stale for `Cache-Control: no-cache` + +0.1.0 / 2012-06-15 +================== + + * Add `If-None-Match: *` support + +0.0.1 / 2012-06-10 +================== + + * Initial release diff --git a/node_modules/fresh/LICENSE b/node_modules/fresh/LICENSE new file mode 100644 index 0000000..1434ade --- /dev/null +++ b/node_modules/fresh/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2016-2017 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/fresh/README.md b/node_modules/fresh/README.md new file mode 100644 index 0000000..1c1c680 --- /dev/null +++ b/node_modules/fresh/README.md @@ -0,0 +1,119 @@ +# fresh + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP response freshness testing + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +``` +$ npm install fresh +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var fresh = require('fresh') +``` + +### fresh(reqHeaders, resHeaders) + +Check freshness of the response using request and response headers. + +When the response is still "fresh" in the client's cache `true` is +returned, otherwise `false` is returned to indicate that the client +cache is now stale and the full response should be sent. + +When a client sends the `Cache-Control: no-cache` request header to +indicate an end-to-end reload request, this module will return `false` +to make handling these requests transparent. + +## Known Issues + +This module is designed to only follow the HTTP specifications, not +to work-around all kinda of client bugs (especially since this module +typically does not recieve enough information to understand what the +client actually is). + +There is a known issue that in certain versions of Safari, Safari +will incorrectly make a request that allows this module to validate +freshness of the resource even when Safari does not have a +representation of the resource in the cache. The module +[jumanji](https://www.npmjs.com/package/jumanji) can be used in +an Express application to work-around this issue and also provides +links to further reading on this Safari bug. + +## Example + +### API usage + +<!-- eslint-disable no-redeclare, no-undef --> + +```js +var reqHeaders = { 'if-none-match': '"foo"' } +var resHeaders = { 'etag': '"bar"' } +fresh(reqHeaders, resHeaders) +// => false + +var reqHeaders = { 'if-none-match': '"foo"' } +var resHeaders = { 'etag': '"foo"' } +fresh(reqHeaders, resHeaders) +// => true +``` + +### Using with Node.js http server + +```js +var fresh = require('fresh') +var http = require('http') + +var server = http.createServer(function (req, res) { + // perform server logic + // ... including adding ETag / Last-Modified response headers + + if (isFresh(req, res)) { + // client has a fresh copy of resource + res.statusCode = 304 + res.end() + return + } + + // send the resource + res.statusCode = 200 + res.end('hello, world!') +}) + +function isFresh (req, res) { + return fresh(req.headers, { + 'etag': res.getHeader('ETag'), + 'last-modified': res.getHeader('Last-Modified') + }) +} + +server.listen(3000) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/fresh.svg +[npm-url]: https://npmjs.org/package/fresh +[node-version-image]: https://img.shields.io/node/v/fresh.svg +[node-version-url]: https://nodejs.org/en/ +[travis-image]: https://img.shields.io/travis/jshttp/fresh/master.svg +[travis-url]: https://travis-ci.org/jshttp/fresh +[coveralls-image]: https://img.shields.io/coveralls/jshttp/fresh/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/fresh?branch=master +[downloads-image]: https://img.shields.io/npm/dm/fresh.svg +[downloads-url]: https://npmjs.org/package/fresh diff --git a/node_modules/fresh/index.js b/node_modules/fresh/index.js new file mode 100644 index 0000000..d154f5a --- /dev/null +++ b/node_modules/fresh/index.js @@ -0,0 +1,137 @@ +/*! + * fresh + * Copyright(c) 2012 TJ Holowaychuk + * Copyright(c) 2016-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * RegExp to check for no-cache token in Cache-Control. + * @private + */ + +var CACHE_CONTROL_NO_CACHE_REGEXP = /(?:^|,)\s*?no-cache\s*?(?:,|$)/ + +/** + * Module exports. + * @public + */ + +module.exports = fresh + +/** + * Check freshness of the response using request and response headers. + * + * @param {Object} reqHeaders + * @param {Object} resHeaders + * @return {Boolean} + * @public + */ + +function fresh (reqHeaders, resHeaders) { + // fields + var modifiedSince = reqHeaders['if-modified-since'] + var noneMatch = reqHeaders['if-none-match'] + + // unconditional request + if (!modifiedSince && !noneMatch) { + return false + } + + // Always return stale when Cache-Control: no-cache + // to support end-to-end reload requests + // https://tools.ietf.org/html/rfc2616#section-14.9.4 + var cacheControl = reqHeaders['cache-control'] + if (cacheControl && CACHE_CONTROL_NO_CACHE_REGEXP.test(cacheControl)) { + return false + } + + // if-none-match + if (noneMatch && noneMatch !== '*') { + var etag = resHeaders['etag'] + + if (!etag) { + return false + } + + var etagStale = true + var matches = parseTokenList(noneMatch) + for (var i = 0; i < matches.length; i++) { + var match = matches[i] + if (match === etag || match === 'W/' + etag || 'W/' + match === etag) { + etagStale = false + break + } + } + + if (etagStale) { + return false + } + } + + // if-modified-since + if (modifiedSince) { + var lastModified = resHeaders['last-modified'] + var modifiedStale = !lastModified || !(parseHttpDate(lastModified) <= parseHttpDate(modifiedSince)) + + if (modifiedStale) { + return false + } + } + + return true +} + +/** + * Parse an HTTP Date into a number. + * + * @param {string} date + * @private + */ + +function parseHttpDate (date) { + var timestamp = date && Date.parse(date) + + // istanbul ignore next: guard against date.js Date.parse patching + return typeof timestamp === 'number' + ? timestamp + : NaN +} + +/** + * Parse a HTTP token list. + * + * @param {string} str + * @private + */ + +function parseTokenList (str) { + var end = 0 + var list = [] + var start = 0 + + // gather tokens + for (var i = 0, len = str.length; i < len; i++) { + switch (str.charCodeAt(i)) { + case 0x20: /* */ + if (start === end) { + start = end = i + 1 + } + break + case 0x2c: /* , */ + list.push(str.substring(start, end)) + start = end = i + 1 + break + default: + end = i + 1 + break + } + } + + // final token + list.push(str.substring(start, end)) + + return list +} diff --git a/node_modules/fresh/package.json b/node_modules/fresh/package.json new file mode 100644 index 0000000..8bb712a --- /dev/null +++ b/node_modules/fresh/package.json @@ -0,0 +1,90 @@ +{ + "_from": "fresh@0.5.2", + "_id": "fresh@0.5.2", + "_inBundle": false, + "_integrity": "sha1-PYyt2Q2XZWn6g1qx+OSyOhBWBac=", + "_location": "/fresh", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "fresh@0.5.2", + "name": "fresh", + "escapedName": "fresh", + "rawSpec": "0.5.2", + "saveSpec": null, + "fetchSpec": "0.5.2" + }, + "_requiredBy": [ + "/express", + "/send" + ], + "_resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz", + "_shasum": "3d8cadd90d976569fa835ab1f8e4b23a105605a7", + "_spec": "fresh@0.5.2", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + }, + "bugs": { + "url": "https://github.com/jshttp/fresh/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "deprecated": false, + "description": "HTTP response freshness testing", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.7.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-node": "5.1.1", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "homepage": "https://github.com/jshttp/fresh#readme", + "keywords": [ + "fresh", + "http", + "conditional", + "cache" + ], + "license": "MIT", + "name": "fresh", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/fresh.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.5.2" +} diff --git a/node_modules/http-errors/HISTORY.md b/node_modules/http-errors/HISTORY.md new file mode 100644 index 0000000..efc2d4c --- /dev/null +++ b/node_modules/http-errors/HISTORY.md @@ -0,0 +1,149 @@ +2019-02-18 / 1.7.2 +================== + + * deps: setprototypeof@1.1.1 + +2018-09-08 / 1.7.1 +================== + + * Fix error creating objects in some environments + +2018-07-30 / 1.7.0 +================== + + * Set constructor name when possible + * Use `toidentifier` module to make class names + * deps: statuses@'>= 1.5.0 < 2' + +2018-03-29 / 1.6.3 +================== + + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: setprototypeof@1.1.0 + * deps: statuses@'>= 1.4.0 < 2' + +2017-08-04 / 1.6.2 +================== + + * deps: depd@1.1.1 + - Remove unnecessary `Buffer` loading + +2017-02-20 / 1.6.1 +================== + + * deps: setprototypeof@1.0.3 + - Fix shim for old browsers + +2017-02-14 / 1.6.0 +================== + + * Accept custom 4xx and 5xx status codes in factory + * Add deprecation message to `"I'mateapot"` export + * Deprecate passing status code as anything except first argument in factory + * Deprecate using non-error status codes + * Make `message` property enumerable for `HttpError`s + +2016-11-16 / 1.5.1 +================== + + * deps: inherits@2.0.3 + - Fix issue loading in browser + * deps: setprototypeof@1.0.2 + * deps: statuses@'>= 1.3.1 < 2' + +2016-05-18 / 1.5.0 +================== + + * Support new code `421 Misdirected Request` + * Use `setprototypeof` module to replace `__proto__` setting + * deps: statuses@'>= 1.3.0 < 2' + - Add `421 Misdirected Request` + - perf: enable strict mode + * perf: enable strict mode + +2016-01-28 / 1.4.0 +================== + + * Add `HttpError` export, for `err instanceof createError.HttpError` + * deps: inherits@2.0.1 + * deps: statuses@'>= 1.2.1 < 2' + - Fix message for status 451 + - Remove incorrect nginx status code + +2015-02-02 / 1.3.1 +================== + + * Fix regression where status can be overwritten in `createError` `props` + +2015-02-01 / 1.3.0 +================== + + * Construct errors using defined constructors from `createError` + * Fix error names that are not identifiers + - `createError["I'mateapot"]` is now `createError.ImATeapot` + * Set a meaningful `name` property on constructed errors + +2014-12-09 / 1.2.8 +================== + + * Fix stack trace from exported function + * Remove `arguments.callee` usage + +2014-10-14 / 1.2.7 +================== + + * Remove duplicate line + +2014-10-02 / 1.2.6 +================== + + * Fix `expose` to be `true` for `ClientError` constructor + +2014-09-28 / 1.2.5 +================== + + * deps: statuses@1 + +2014-09-21 / 1.2.4 +================== + + * Fix dependency version to work with old `npm`s + +2014-09-21 / 1.2.3 +================== + + * deps: statuses@~1.1.0 + +2014-09-21 / 1.2.2 +================== + + * Fix publish error + +2014-09-21 / 1.2.1 +================== + + * Support Node.js 0.6 + * Use `inherits` instead of `util` + +2014-09-09 / 1.2.0 +================== + + * Fix the way inheriting functions + * Support `expose` being provided in properties argument + +2014-09-08 / 1.1.0 +================== + + * Default status to 500 + * Support provided `error` to extend + +2014-09-08 / 1.0.1 +================== + + * Fix accepting string message + +2014-09-08 / 1.0.0 +================== + + * Initial release diff --git a/node_modules/http-errors/LICENSE b/node_modules/http-errors/LICENSE new file mode 100644 index 0000000..82af4df --- /dev/null +++ b/node_modules/http-errors/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com +Copyright (c) 2016 Douglas Christopher Wilson doug@somethingdoug.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/http-errors/README.md b/node_modules/http-errors/README.md new file mode 100644 index 0000000..3b25481 --- /dev/null +++ b/node_modules/http-errors/README.md @@ -0,0 +1,163 @@ +# http-errors + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][node-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create HTTP errors for Express, Koa, Connect, etc. with ease. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install http-errors +``` + +## Example + +```js +var createError = require('http-errors') +var express = require('express') +var app = express() + +app.use(function (req, res, next) { + if (!req.user) return next(createError(401, 'Please login to view this page.')) + next() +}) +``` + +## API + +This is the current API, currently extracted from Koa and subject to change. + +### Error Properties + +- `expose` - can be used to signal if `message` should be sent to the client, + defaulting to `false` when `status` >= 500 +- `headers` - can be an object of header names to values to be sent to the + client, defaulting to `undefined`. When defined, the key names should all + be lower-cased +- `message` - the traditional error message, which should be kept short and all + single line +- `status` - the status code of the error, mirroring `statusCode` for general + compatibility +- `statusCode` - the status code of the error, defaulting to `500` + +### createError([status], [message], [properties]) + +Create a new error object with the given message `msg`. +The error object inherits from `createError.HttpError`. + +<!-- eslint-disable no-undef, no-unused-vars --> + +```js +var err = createError(404, 'This video does not exist!') +``` + +- `status: 500` - the status code as a number +- `message` - the message of the error, defaulting to node's text for that status code. +- `properties` - custom properties to attach to the object + +### createError([status], [error], [properties]) + +Extend the given `error` object with `createError.HttpError` +properties. This will not alter the inheritance of the given +`error` object, and the modified `error` object is the +return value. + +<!-- eslint-disable no-redeclare, no-undef, no-unused-vars --> + +```js +fs.readFile('foo.txt', function (err, buf) { + if (err) { + if (err.code === 'ENOENT') { + var httpError = createError(404, err, { expose: false }) + } else { + var httpError = createError(500, err) + } + } +}) +``` + +- `status` - the status code as a number +- `error` - the error object to extend +- `properties` - custom properties to attach to the object + +### new createError\[code || name\](\[msg]\)) + +Create a new error object with the given message `msg`. +The error object inherits from `createError.HttpError`. + +<!-- eslint-disable no-undef, no-unused-vars --> + +```js +var err = new createError.NotFound() +``` + +- `code` - the status code as a number +- `name` - the name of the error as a "bumpy case", i.e. `NotFound` or `InternalServerError`. + +#### List of all constructors + +|Status Code|Constructor Name | +|-----------|-----------------------------| +|400 |BadRequest | +|401 |Unauthorized | +|402 |PaymentRequired | +|403 |Forbidden | +|404 |NotFound | +|405 |MethodNotAllowed | +|406 |NotAcceptable | +|407 |ProxyAuthenticationRequired | +|408 |RequestTimeout | +|409 |Conflict | +|410 |Gone | +|411 |LengthRequired | +|412 |PreconditionFailed | +|413 |PayloadTooLarge | +|414 |URITooLong | +|415 |UnsupportedMediaType | +|416 |RangeNotSatisfiable | +|417 |ExpectationFailed | +|418 |ImATeapot | +|421 |MisdirectedRequest | +|422 |UnprocessableEntity | +|423 |Locked | +|424 |FailedDependency | +|425 |UnorderedCollection | +|426 |UpgradeRequired | +|428 |PreconditionRequired | +|429 |TooManyRequests | +|431 |RequestHeaderFieldsTooLarge | +|451 |UnavailableForLegalReasons | +|500 |InternalServerError | +|501 |NotImplemented | +|502 |BadGateway | +|503 |ServiceUnavailable | +|504 |GatewayTimeout | +|505 |HTTPVersionNotSupported | +|506 |VariantAlsoNegotiates | +|507 |InsufficientStorage | +|508 |LoopDetected | +|509 |BandwidthLimitExceeded | +|510 |NotExtended | +|511 |NetworkAuthenticationRequired| + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/http-errors/master +[coveralls-url]: https://coveralls.io/r/jshttp/http-errors?branch=master +[node-image]: https://badgen.net/npm/node/http-errors +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/http-errors +[npm-url]: https://npmjs.org/package/http-errors +[npm-version-image]: https://badgen.net/npm/v/http-errors +[travis-image]: https://badgen.net/travis/jshttp/http-errors/master +[travis-url]: https://travis-ci.org/jshttp/http-errors diff --git a/node_modules/http-errors/index.js b/node_modules/http-errors/index.js new file mode 100644 index 0000000..10ca4ad --- /dev/null +++ b/node_modules/http-errors/index.js @@ -0,0 +1,266 @@ +/*! + * http-errors + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var deprecate = require('depd')('http-errors') +var setPrototypeOf = require('setprototypeof') +var statuses = require('statuses') +var inherits = require('inherits') +var toIdentifier = require('toidentifier') + +/** + * Module exports. + * @public + */ + +module.exports = createError +module.exports.HttpError = createHttpErrorConstructor() + +// Populate exports for all constructors +populateConstructorExports(module.exports, statuses.codes, module.exports.HttpError) + +/** + * Get the code class of a status code. + * @private + */ + +function codeClass (status) { + return Number(String(status).charAt(0) + '00') +} + +/** + * Create a new HTTP Error. + * + * @returns {Error} + * @public + */ + +function createError () { + // so much arity going on ~_~ + var err + var msg + var status = 500 + var props = {} + for (var i = 0; i < arguments.length; i++) { + var arg = arguments[i] + if (arg instanceof Error) { + err = arg + status = err.status || err.statusCode || status + continue + } + switch (typeof arg) { + case 'string': + msg = arg + break + case 'number': + status = arg + if (i !== 0) { + deprecate('non-first-argument status code; replace with createError(' + arg + ', ...)') + } + break + case 'object': + props = arg + break + } + } + + if (typeof status === 'number' && (status < 400 || status >= 600)) { + deprecate('non-error status code; use only 4xx or 5xx status codes') + } + + if (typeof status !== 'number' || + (!statuses[status] && (status < 400 || status >= 600))) { + status = 500 + } + + // constructor + var HttpError = createError[status] || createError[codeClass(status)] + + if (!err) { + // create error + err = HttpError + ? new HttpError(msg) + : new Error(msg || statuses[status]) + Error.captureStackTrace(err, createError) + } + + if (!HttpError || !(err instanceof HttpError) || err.status !== status) { + // add properties to generic error + err.expose = status < 500 + err.status = err.statusCode = status + } + + for (var key in props) { + if (key !== 'status' && key !== 'statusCode') { + err[key] = props[key] + } + } + + return err +} + +/** + * Create HTTP error abstract base class. + * @private + */ + +function createHttpErrorConstructor () { + function HttpError () { + throw new TypeError('cannot construct abstract class') + } + + inherits(HttpError, Error) + + return HttpError +} + +/** + * Create a constructor for a client error. + * @private + */ + +function createClientErrorConstructor (HttpError, name, code) { + var className = name.match(/Error$/) ? name : name + 'Error' + + function ClientError (message) { + // create the error object + var msg = message != null ? message : statuses[code] + var err = new Error(msg) + + // capture a stack trace to the construction point + Error.captureStackTrace(err, ClientError) + + // adjust the [[Prototype]] + setPrototypeOf(err, ClientError.prototype) + + // redefine the error message + Object.defineProperty(err, 'message', { + enumerable: true, + configurable: true, + value: msg, + writable: true + }) + + // redefine the error name + Object.defineProperty(err, 'name', { + enumerable: false, + configurable: true, + value: className, + writable: true + }) + + return err + } + + inherits(ClientError, HttpError) + nameFunc(ClientError, className) + + ClientError.prototype.status = code + ClientError.prototype.statusCode = code + ClientError.prototype.expose = true + + return ClientError +} + +/** + * Create a constructor for a server error. + * @private + */ + +function createServerErrorConstructor (HttpError, name, code) { + var className = name.match(/Error$/) ? name : name + 'Error' + + function ServerError (message) { + // create the error object + var msg = message != null ? message : statuses[code] + var err = new Error(msg) + + // capture a stack trace to the construction point + Error.captureStackTrace(err, ServerError) + + // adjust the [[Prototype]] + setPrototypeOf(err, ServerError.prototype) + + // redefine the error message + Object.defineProperty(err, 'message', { + enumerable: true, + configurable: true, + value: msg, + writable: true + }) + + // redefine the error name + Object.defineProperty(err, 'name', { + enumerable: false, + configurable: true, + value: className, + writable: true + }) + + return err + } + + inherits(ServerError, HttpError) + nameFunc(ServerError, className) + + ServerError.prototype.status = code + ServerError.prototype.statusCode = code + ServerError.prototype.expose = false + + return ServerError +} + +/** + * Set the name of a function, if possible. + * @private + */ + +function nameFunc (func, name) { + var desc = Object.getOwnPropertyDescriptor(func, 'name') + + if (desc && desc.configurable) { + desc.value = name + Object.defineProperty(func, 'name', desc) + } +} + +/** + * Populate the exports object with constructors for every error class. + * @private + */ + +function populateConstructorExports (exports, codes, HttpError) { + codes.forEach(function forEachCode (code) { + var CodeError + var name = toIdentifier(statuses[code]) + + switch (codeClass(code)) { + case 400: + CodeError = createClientErrorConstructor(HttpError, name, code) + break + case 500: + CodeError = createServerErrorConstructor(HttpError, name, code) + break + } + + if (CodeError) { + // export the constructor + exports[code] = CodeError + exports[name] = CodeError + } + }) + + // backwards-compatibility + exports["I'mateapot"] = deprecate.function(exports.ImATeapot, + '"I\'mateapot"; use "ImATeapot" instead') +} diff --git a/node_modules/http-errors/package.json b/node_modules/http-errors/package.json new file mode 100644 index 0000000..44a7d9c --- /dev/null +++ b/node_modules/http-errors/package.json @@ -0,0 +1,93 @@ +{ + "_from": "http-errors@1.7.2", + "_id": "http-errors@1.7.2", + "_inBundle": false, + "_integrity": "sha512-uUQBt3H/cSIVfch6i1EuPNy/YsRSOUBXTVfZ+yR7Zjez3qjBz6i9+i4zjNaoqcoFVI4lQJ5plg63TvGfRSDCRg==", + "_location": "/http-errors", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "http-errors@1.7.2", + "name": "http-errors", + "escapedName": "http-errors", + "rawSpec": "1.7.2", + "saveSpec": null, + "fetchSpec": "1.7.2" + }, + "_requiredBy": [ + "/body-parser", + "/raw-body", + "/send" + ], + "_resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.7.2.tgz", + "_shasum": "4f5029cf13239f31036e5b2e55292bcfbcc85c8f", + "_spec": "http-errors@1.7.2", + "_where": "/home/josuer08/Documents/web/node_modules/body-parser", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/jshttp/http-errors/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Alan Plum", + "email": "me@pluma.io" + }, + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + } + ], + "dependencies": { + "depd": "~1.1.2", + "inherits": "2.0.3", + "setprototypeof": "1.1.1", + "statuses": ">= 1.5.0 < 2", + "toidentifier": "1.0.0" + }, + "deprecated": false, + "description": "Create HTTP error objects", + "devDependencies": { + "eslint": "5.13.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.16.0", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "5.2.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "index.js", + "HISTORY.md", + "LICENSE", + "README.md" + ], + "homepage": "https://github.com/jshttp/http-errors#readme", + "keywords": [ + "http", + "error" + ], + "license": "MIT", + "name": "http-errors", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/http-errors.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md . && node ./scripts/lint-readme-list.js", + "test": "mocha --reporter spec --bail", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot" + }, + "version": "1.7.2" +} diff --git a/node_modules/iconv-lite/Changelog.md b/node_modules/iconv-lite/Changelog.md new file mode 100644 index 0000000..f252313 --- /dev/null +++ b/node_modules/iconv-lite/Changelog.md @@ -0,0 +1,162 @@ +# 0.4.24 / 2018-08-22 + + * Added MIK encoding (#196, by @Ivan-Kalatchev) + + +# 0.4.23 / 2018-05-07 + + * Fix deprecation warning in Node v10 due to the last usage of `new Buffer` (#185, by @felixbuenemann) + * Switched from NodeBuffer to Buffer in typings (#155 by @felixfbecker, #186 by @larssn) + + +# 0.4.22 / 2018-05-05 + + * Use older semver style for dependencies to be compatible with Node version 0.10 (#182, by @dougwilson) + * Fix tests to accomodate fixes in Node v10 (#182, by @dougwilson) + + +# 0.4.21 / 2018-04-06 + + * Fix encoding canonicalization (#156) + * Fix the paths in the "browser" field in package.json (#174 by @LMLB) + * Removed "contributors" section in package.json - see Git history instead. + + +# 0.4.20 / 2018-04-06 + + * Updated `new Buffer()` usages with recommended replacements as it's being deprecated in Node v10 (#176, #178 by @ChALkeR) + + +# 0.4.19 / 2017-09-09 + + * Fixed iso8859-1 codec regression in handling untranslatable characters (#162, caused by #147) + * Re-generated windows1255 codec, because it was updated in iconv project + * Fixed grammar in error message when iconv-lite is loaded with encoding other than utf8 + + +# 0.4.18 / 2017-06-13 + + * Fixed CESU-8 regression in Node v8. + + +# 0.4.17 / 2017-04-22 + + * Updated typescript definition file to support Angular 2 AoT mode (#153 by @larssn) + + +# 0.4.16 / 2017-04-22 + + * Added support for React Native (#150) + * Changed iso8859-1 encoding to usine internal 'binary' encoding, as it's the same thing (#147 by @mscdex) + * Fixed typo in Readme (#138 by @jiangzhuo) + * Fixed build for Node v6.10+ by making correct version comparison + * Added a warning if iconv-lite is loaded not as utf-8 (see #142) + + +# 0.4.15 / 2016-11-21 + + * Fixed typescript type definition (#137) + + +# 0.4.14 / 2016-11-20 + + * Preparation for v1.0 + * Added Node v6 and latest Node versions to Travis CI test rig + * Deprecated Node v0.8 support + * Typescript typings (@larssn) + * Fix encoding of Euro character in GB 18030 (inspired by @lygstate) + * Add ms prefix to dbcs windows encodings (@rokoroku) + + +# 0.4.13 / 2015-10-01 + + * Fix silly mistake in deprecation notice. + + +# 0.4.12 / 2015-09-26 + + * Node v4 support: + * Added CESU-8 decoding (#106) + * Added deprecation notice for `extendNodeEncodings` + * Added Travis tests for Node v4 and io.js latest (#105 by @Mithgol) + + +# 0.4.11 / 2015-07-03 + + * Added CESU-8 encoding. + + +# 0.4.10 / 2015-05-26 + + * Changed UTF-16 endianness heuristic to take into account any ASCII chars, not + just spaces. This should minimize the importance of "default" endianness. + + +# 0.4.9 / 2015-05-24 + + * Streamlined BOM handling: strip BOM by default, add BOM when encoding if + addBOM: true. Added docs to Readme. + * UTF16 now uses UTF16-LE by default. + * Fixed minor issue with big5 encoding. + * Added io.js testing on Travis; updated node-iconv version to test against. + Now we just skip testing SBCS encodings that node-iconv doesn't support. + * (internal refactoring) Updated codec interface to use classes. + * Use strict mode in all files. + + +# 0.4.8 / 2015-04-14 + + * added alias UNICODE-1-1-UTF-7 for UTF-7 encoding (#94) + + +# 0.4.7 / 2015-02-05 + + * stop official support of Node.js v0.8. Should still work, but no guarantees. + reason: Packages needed for testing are hard to get on Travis CI. + * work in environment where Object.prototype is monkey patched with enumerable + props (#89). + + +# 0.4.6 / 2015-01-12 + + * fix rare aliases of single-byte encodings (thanks @mscdex) + * double the timeout for dbcs tests to make them less flaky on travis + + +# 0.4.5 / 2014-11-20 + + * fix windows-31j and x-sjis encoding support (@nleush) + * minor fix: undefined variable reference when internal error happens + + +# 0.4.4 / 2014-07-16 + + * added encodings UTF-7 (RFC2152) and UTF-7-IMAP (RFC3501 Section 5.1.3) + * fixed streaming base64 encoding + + +# 0.4.3 / 2014-06-14 + + * added encodings UTF-16BE and UTF-16 with BOM + + +# 0.4.2 / 2014-06-12 + + * don't throw exception if `extendNodeEncodings()` is called more than once + + +# 0.4.1 / 2014-06-11 + + * codepage 808 added + + +# 0.4.0 / 2014-06-10 + + * code is rewritten from scratch + * all widespread encodings are supported + * streaming interface added + * browserify compatibility added + * (optional) extend core primitive encodings to make usage even simpler + * moved from vows to mocha as the testing framework + + diff --git a/node_modules/iconv-lite/LICENSE b/node_modules/iconv-lite/LICENSE new file mode 100644 index 0000000..d518d83 --- /dev/null +++ b/node_modules/iconv-lite/LICENSE @@ -0,0 +1,21 @@ +Copyright (c) 2011 Alexander Shtuchkin + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/iconv-lite/README.md b/node_modules/iconv-lite/README.md new file mode 100644 index 0000000..c981c37 --- /dev/null +++ b/node_modules/iconv-lite/README.md @@ -0,0 +1,156 @@ +## Pure JS character encoding conversion [](https://travis-ci.org/ashtuchkin/iconv-lite) + + * Doesn't need native code compilation. Works on Windows and in sandboxed environments like [Cloud9](http://c9.io). + * Used in popular projects like [Express.js (body_parser)](https://github.com/expressjs/body-parser), + [Grunt](http://gruntjs.com/), [Nodemailer](http://www.nodemailer.com/), [Yeoman](http://yeoman.io/) and others. + * Faster than [node-iconv](https://github.com/bnoordhuis/node-iconv) (see below for performance comparison). + * Intuitive encode/decode API + * Streaming support for Node v0.10+ + * [Deprecated] Can extend Node.js primitives (buffers, streams) to support all iconv-lite encodings. + * In-browser usage via [Browserify](https://github.com/substack/node-browserify) (~180k gzip compressed with Buffer shim included). + * Typescript [type definition file](https://github.com/ashtuchkin/iconv-lite/blob/master/lib/index.d.ts) included. + * React Native is supported (need to explicitly `npm install` two more modules: `buffer` and `stream`). + * License: MIT. + +[](https://npmjs.org/packages/iconv-lite/) + +## Usage +### Basic API +```javascript +var iconv = require('iconv-lite'); + +// Convert from an encoded buffer to js string. +str = iconv.decode(Buffer.from([0x68, 0x65, 0x6c, 0x6c, 0x6f]), 'win1251'); + +// Convert from js string to an encoded buffer. +buf = iconv.encode("Sample input string", 'win1251'); + +// Check if encoding is supported +iconv.encodingExists("us-ascii") +``` + +### Streaming API (Node v0.10+) +```javascript + +// Decode stream (from binary stream to js strings) +http.createServer(function(req, res) { + var converterStream = iconv.decodeStream('win1251'); + req.pipe(converterStream); + + converterStream.on('data', function(str) { + console.log(str); // Do something with decoded strings, chunk-by-chunk. + }); +}); + +// Convert encoding streaming example +fs.createReadStream('file-in-win1251.txt') + .pipe(iconv.decodeStream('win1251')) + .pipe(iconv.encodeStream('ucs2')) + .pipe(fs.createWriteStream('file-in-ucs2.txt')); + +// Sugar: all encode/decode streams have .collect(cb) method to accumulate data. +http.createServer(function(req, res) { + req.pipe(iconv.decodeStream('win1251')).collect(function(err, body) { + assert(typeof body == 'string'); + console.log(body); // full request body string + }); +}); +``` + +### [Deprecated] Extend Node.js own encodings +> NOTE: This doesn't work on latest Node versions. See [details](https://github.com/ashtuchkin/iconv-lite/wiki/Node-v4-compatibility). + +```javascript +// After this call all Node basic primitives will understand iconv-lite encodings. +iconv.extendNodeEncodings(); + +// Examples: +buf = new Buffer(str, 'win1251'); +buf.write(str, 'gbk'); +str = buf.toString('latin1'); +assert(Buffer.isEncoding('iso-8859-15')); +Buffer.byteLength(str, 'us-ascii'); + +http.createServer(function(req, res) { + req.setEncoding('big5'); + req.collect(function(err, body) { + console.log(body); + }); +}); + +fs.createReadStream("file.txt", "shift_jis"); + +// External modules are also supported (if they use Node primitives, which they probably do). +request = require('request'); +request({ + url: "http://github.com/", + encoding: "cp932" +}); + +// To remove extensions +iconv.undoExtendNodeEncodings(); +``` + +## Supported encodings + + * All node.js native encodings: utf8, ucs2 / utf16-le, ascii, binary, base64, hex. + * Additional unicode encodings: utf16, utf16-be, utf-7, utf-7-imap. + * All widespread singlebyte encodings: Windows 125x family, ISO-8859 family, + IBM/DOS codepages, Macintosh family, KOI8 family, all others supported by iconv library. + Aliases like 'latin1', 'us-ascii' also supported. + * All widespread multibyte encodings: CP932, CP936, CP949, CP950, GB2312, GBK, GB18030, Big5, Shift_JIS, EUC-JP. + +See [all supported encodings on wiki](https://github.com/ashtuchkin/iconv-lite/wiki/Supported-Encodings). + +Most singlebyte encodings are generated automatically from [node-iconv](https://github.com/bnoordhuis/node-iconv). Thank you Ben Noordhuis and libiconv authors! + +Multibyte encodings are generated from [Unicode.org mappings](http://www.unicode.org/Public/MAPPINGS/) and [WHATWG Encoding Standard mappings](http://encoding.spec.whatwg.org/). Thank you, respective authors! + + +## Encoding/decoding speed + +Comparison with node-iconv module (1000x256kb, on MacBook Pro, Core i5/2.6 GHz, Node v0.12.0). +Note: your results may vary, so please always check on your hardware. + + operation iconv@2.1.4 iconv-lite@0.4.7 + ---------------------------------------------------------- + encode('win1251') ~96 Mb/s ~320 Mb/s + decode('win1251') ~95 Mb/s ~246 Mb/s + +## BOM handling + + * Decoding: BOM is stripped by default, unless overridden by passing `stripBOM: false` in options + (f.ex. `iconv.decode(buf, enc, {stripBOM: false})`). + A callback might also be given as a `stripBOM` parameter - it'll be called if BOM character was actually found. + * If you want to detect UTF-8 BOM when decoding other encodings, use [node-autodetect-decoder-stream](https://github.com/danielgindi/node-autodetect-decoder-stream) module. + * Encoding: No BOM added, unless overridden by `addBOM: true` option. + +## UTF-16 Encodings + +This library supports UTF-16LE, UTF-16BE and UTF-16 encodings. First two are straightforward, but UTF-16 is trying to be +smart about endianness in the following ways: + * Decoding: uses BOM and 'spaces heuristic' to determine input endianness. Default is UTF-16LE, but can be + overridden with `defaultEncoding: 'utf-16be'` option. Strips BOM unless `stripBOM: false`. + * Encoding: uses UTF-16LE and writes BOM by default. Use `addBOM: false` to override. + +## Other notes + +When decoding, be sure to supply a Buffer to decode() method, otherwise [bad things usually happen](https://github.com/ashtuchkin/iconv-lite/wiki/Use-Buffers-when-decoding). +Untranslatable characters are set to � or ?. No transliteration is currently supported. +Node versions 0.10.31 and 0.11.13 are buggy, don't use them (see #65, #77). + +## Testing + +```bash +$ git clone git@github.com:ashtuchkin/iconv-lite.git +$ cd iconv-lite +$ npm install +$ npm test + +$ # To view performance: +$ node test/performance.js + +$ # To view test coverage: +$ npm run coverage +$ open coverage/lcov-report/index.html +``` diff --git a/node_modules/iconv-lite/encodings/dbcs-codec.js b/node_modules/iconv-lite/encodings/dbcs-codec.js new file mode 100644 index 0000000..1fe3e16 --- /dev/null +++ b/node_modules/iconv-lite/encodings/dbcs-codec.js @@ -0,0 +1,555 @@ +"use strict"; +var Buffer = require("safer-buffer").Buffer; + +// Multibyte codec. In this scheme, a character is represented by 1 or more bytes. +// Our codec supports UTF-16 surrogates, extensions for GB18030 and unicode sequences. +// To save memory and loading time, we read table files only when requested. + +exports._dbcs = DBCSCodec; + +var UNASSIGNED = -1, + GB18030_CODE = -2, + SEQ_START = -10, + NODE_START = -1000, + UNASSIGNED_NODE = new Array(0x100), + DEF_CHAR = -1; + +for (var i = 0; i < 0x100; i++) + UNASSIGNED_NODE[i] = UNASSIGNED; + + +// Class DBCSCodec reads and initializes mapping tables. +function DBCSCodec(codecOptions, iconv) { + this.encodingName = codecOptions.encodingName; + if (!codecOptions) + throw new Error("DBCS codec is called without the data.") + if (!codecOptions.table) + throw new Error("Encoding '" + this.encodingName + "' has no data."); + + // Load tables. + var mappingTable = codecOptions.table(); + + + // Decode tables: MBCS -> Unicode. + + // decodeTables is a trie, encoded as an array of arrays of integers. Internal arrays are trie nodes and all have len = 256. + // Trie root is decodeTables[0]. + // Values: >= 0 -> unicode character code. can be > 0xFFFF + // == UNASSIGNED -> unknown/unassigned sequence. + // == GB18030_CODE -> this is the end of a GB18030 4-byte sequence. + // <= NODE_START -> index of the next node in our trie to process next byte. + // <= SEQ_START -> index of the start of a character code sequence, in decodeTableSeq. + this.decodeTables = []; + this.decodeTables[0] = UNASSIGNED_NODE.slice(0); // Create root node. + + // Sometimes a MBCS char corresponds to a sequence of unicode chars. We store them as arrays of integers here. + this.decodeTableSeq = []; + + // Actual mapping tables consist of chunks. Use them to fill up decode tables. + for (var i = 0; i < mappingTable.length; i++) + this._addDecodeChunk(mappingTable[i]); + + this.defaultCharUnicode = iconv.defaultCharUnicode; + + + // Encode tables: Unicode -> DBCS. + + // `encodeTable` is array mapping from unicode char to encoded char. All its values are integers for performance. + // Because it can be sparse, it is represented as array of buckets by 256 chars each. Bucket can be null. + // Values: >= 0 -> it is a normal char. Write the value (if <=256 then 1 byte, if <=65536 then 2 bytes, etc.). + // == UNASSIGNED -> no conversion found. Output a default char. + // <= SEQ_START -> it's an index in encodeTableSeq, see below. The character starts a sequence. + this.encodeTable = []; + + // `encodeTableSeq` is used when a sequence of unicode characters is encoded as a single code. We use a tree of + // objects where keys correspond to characters in sequence and leafs are the encoded dbcs values. A special DEF_CHAR key + // means end of sequence (needed when one sequence is a strict subsequence of another). + // Objects are kept separately from encodeTable to increase performance. + this.encodeTableSeq = []; + + // Some chars can be decoded, but need not be encoded. + var skipEncodeChars = {}; + if (codecOptions.encodeSkipVals) + for (var i = 0; i < codecOptions.encodeSkipVals.length; i++) { + var val = codecOptions.encodeSkipVals[i]; + if (typeof val === 'number') + skipEncodeChars[val] = true; + else + for (var j = val.from; j <= val.to; j++) + skipEncodeChars[j] = true; + } + + // Use decode trie to recursively fill out encode tables. + this._fillEncodeTable(0, 0, skipEncodeChars); + + // Add more encoding pairs when needed. + if (codecOptions.encodeAdd) { + for (var uChar in codecOptions.encodeAdd) + if (Object.prototype.hasOwnProperty.call(codecOptions.encodeAdd, uChar)) + this._setEncodeChar(uChar.charCodeAt(0), codecOptions.encodeAdd[uChar]); + } + + this.defCharSB = this.encodeTable[0][iconv.defaultCharSingleByte.charCodeAt(0)]; + if (this.defCharSB === UNASSIGNED) this.defCharSB = this.encodeTable[0]['?']; + if (this.defCharSB === UNASSIGNED) this.defCharSB = "?".charCodeAt(0); + + + // Load & create GB18030 tables when needed. + if (typeof codecOptions.gb18030 === 'function') { + this.gb18030 = codecOptions.gb18030(); // Load GB18030 ranges. + + // Add GB18030 decode tables. + var thirdByteNodeIdx = this.decodeTables.length; + var thirdByteNode = this.decodeTables[thirdByteNodeIdx] = UNASSIGNED_NODE.slice(0); + + var fourthByteNodeIdx = this.decodeTables.length; + var fourthByteNode = this.decodeTables[fourthByteNodeIdx] = UNASSIGNED_NODE.slice(0); + + for (var i = 0x81; i <= 0xFE; i++) { + var secondByteNodeIdx = NODE_START - this.decodeTables[0][i]; + var secondByteNode = this.decodeTables[secondByteNodeIdx]; + for (var j = 0x30; j <= 0x39; j++) + secondByteNode[j] = NODE_START - thirdByteNodeIdx; + } + for (var i = 0x81; i <= 0xFE; i++) + thirdByteNode[i] = NODE_START - fourthByteNodeIdx; + for (var i = 0x30; i <= 0x39; i++) + fourthByteNode[i] = GB18030_CODE + } +} + +DBCSCodec.prototype.encoder = DBCSEncoder; +DBCSCodec.prototype.decoder = DBCSDecoder; + +// Decoder helpers +DBCSCodec.prototype._getDecodeTrieNode = function(addr) { + var bytes = []; + for (; addr > 0; addr >>= 8) + bytes.push(addr & 0xFF); + if (bytes.length == 0) + bytes.push(0); + + var node = this.decodeTables[0]; + for (var i = bytes.length-1; i > 0; i--) { // Traverse nodes deeper into the trie. + var val = node[bytes[i]]; + + if (val == UNASSIGNED) { // Create new node. + node[bytes[i]] = NODE_START - this.decodeTables.length; + this.decodeTables.push(node = UNASSIGNED_NODE.slice(0)); + } + else if (val <= NODE_START) { // Existing node. + node = this.decodeTables[NODE_START - val]; + } + else + throw new Error("Overwrite byte in " + this.encodingName + ", addr: " + addr.toString(16)); + } + return node; +} + + +DBCSCodec.prototype._addDecodeChunk = function(chunk) { + // First element of chunk is the hex mbcs code where we start. + var curAddr = parseInt(chunk[0], 16); + + // Choose the decoding node where we'll write our chars. + var writeTable = this._getDecodeTrieNode(curAddr); + curAddr = curAddr & 0xFF; + + // Write all other elements of the chunk to the table. + for (var k = 1; k < chunk.length; k++) { + var part = chunk[k]; + if (typeof part === "string") { // String, write as-is. + for (var l = 0; l < part.length;) { + var code = part.charCodeAt(l++); + if (0xD800 <= code && code < 0xDC00) { // Decode surrogate + var codeTrail = part.charCodeAt(l++); + if (0xDC00 <= codeTrail && codeTrail < 0xE000) + writeTable[curAddr++] = 0x10000 + (code - 0xD800) * 0x400 + (codeTrail - 0xDC00); + else + throw new Error("Incorrect surrogate pair in " + this.encodingName + " at chunk " + chunk[0]); + } + else if (0x0FF0 < code && code <= 0x0FFF) { // Character sequence (our own encoding used) + var len = 0xFFF - code + 2; + var seq = []; + for (var m = 0; m < len; m++) + seq.push(part.charCodeAt(l++)); // Simple variation: don't support surrogates or subsequences in seq. + + writeTable[curAddr++] = SEQ_START - this.decodeTableSeq.length; + this.decodeTableSeq.push(seq); + } + else + writeTable[curAddr++] = code; // Basic char + } + } + else if (typeof part === "number") { // Integer, meaning increasing sequence starting with prev character. + var charCode = writeTable[curAddr - 1] + 1; + for (var l = 0; l < part; l++) + writeTable[curAddr++] = charCode++; + } + else + throw new Error("Incorrect type '" + typeof part + "' given in " + this.encodingName + " at chunk " + chunk[0]); + } + if (curAddr > 0xFF) + throw new Error("Incorrect chunk in " + this.encodingName + " at addr " + chunk[0] + ": too long" + curAddr); +} + +// Encoder helpers +DBCSCodec.prototype._getEncodeBucket = function(uCode) { + var high = uCode >> 8; // This could be > 0xFF because of astral characters. + if (this.encodeTable[high] === undefined) + this.encodeTable[high] = UNASSIGNED_NODE.slice(0); // Create bucket on demand. + return this.encodeTable[high]; +} + +DBCSCodec.prototype._setEncodeChar = function(uCode, dbcsCode) { + var bucket = this._getEncodeBucket(uCode); + var low = uCode & 0xFF; + if (bucket[low] <= SEQ_START) + this.encodeTableSeq[SEQ_START-bucket[low]][DEF_CHAR] = dbcsCode; // There's already a sequence, set a single-char subsequence of it. + else if (bucket[low] == UNASSIGNED) + bucket[low] = dbcsCode; +} + +DBCSCodec.prototype._setEncodeSequence = function(seq, dbcsCode) { + + // Get the root of character tree according to first character of the sequence. + var uCode = seq[0]; + var bucket = this._getEncodeBucket(uCode); + var low = uCode & 0xFF; + + var node; + if (bucket[low] <= SEQ_START) { + // There's already a sequence with - use it. + node = this.encodeTableSeq[SEQ_START-bucket[low]]; + } + else { + // There was no sequence object - allocate a new one. + node = {}; + if (bucket[low] !== UNASSIGNED) node[DEF_CHAR] = bucket[low]; // If a char was set before - make it a single-char subsequence. + bucket[low] = SEQ_START - this.encodeTableSeq.length; + this.encodeTableSeq.push(node); + } + + // Traverse the character tree, allocating new nodes as needed. + for (var j = 1; j < seq.length-1; j++) { + var oldVal = node[uCode]; + if (typeof oldVal === 'object') + node = oldVal; + else { + node = node[uCode] = {} + if (oldVal !== undefined) + node[DEF_CHAR] = oldVal + } + } + + // Set the leaf to given dbcsCode. + uCode = seq[seq.length-1]; + node[uCode] = dbcsCode; +} + +DBCSCodec.prototype._fillEncodeTable = function(nodeIdx, prefix, skipEncodeChars) { + var node = this.decodeTables[nodeIdx]; + for (var i = 0; i < 0x100; i++) { + var uCode = node[i]; + var mbCode = prefix + i; + if (skipEncodeChars[mbCode]) + continue; + + if (uCode >= 0) + this._setEncodeChar(uCode, mbCode); + else if (uCode <= NODE_START) + this._fillEncodeTable(NODE_START - uCode, mbCode << 8, skipEncodeChars); + else if (uCode <= SEQ_START) + this._setEncodeSequence(this.decodeTableSeq[SEQ_START - uCode], mbCode); + } +} + + + +// == Encoder ================================================================== + +function DBCSEncoder(options, codec) { + // Encoder state + this.leadSurrogate = -1; + this.seqObj = undefined; + + // Static data + this.encodeTable = codec.encodeTable; + this.encodeTableSeq = codec.encodeTableSeq; + this.defaultCharSingleByte = codec.defCharSB; + this.gb18030 = codec.gb18030; +} + +DBCSEncoder.prototype.write = function(str) { + var newBuf = Buffer.alloc(str.length * (this.gb18030 ? 4 : 3)), + leadSurrogate = this.leadSurrogate, + seqObj = this.seqObj, nextChar = -1, + i = 0, j = 0; + + while (true) { + // 0. Get next character. + if (nextChar === -1) { + if (i == str.length) break; + var uCode = str.charCodeAt(i++); + } + else { + var uCode = nextChar; + nextChar = -1; + } + + // 1. Handle surrogates. + if (0xD800 <= uCode && uCode < 0xE000) { // Char is one of surrogates. + if (uCode < 0xDC00) { // We've got lead surrogate. + if (leadSurrogate === -1) { + leadSurrogate = uCode; + continue; + } else { + leadSurrogate = uCode; + // Double lead surrogate found. + uCode = UNASSIGNED; + } + } else { // We've got trail surrogate. + if (leadSurrogate !== -1) { + uCode = 0x10000 + (leadSurrogate - 0xD800) * 0x400 + (uCode - 0xDC00); + leadSurrogate = -1; + } else { + // Incomplete surrogate pair - only trail surrogate found. + uCode = UNASSIGNED; + } + + } + } + else if (leadSurrogate !== -1) { + // Incomplete surrogate pair - only lead surrogate found. + nextChar = uCode; uCode = UNASSIGNED; // Write an error, then current char. + leadSurrogate = -1; + } + + // 2. Convert uCode character. + var dbcsCode = UNASSIGNED; + if (seqObj !== undefined && uCode != UNASSIGNED) { // We are in the middle of the sequence + var resCode = seqObj[uCode]; + if (typeof resCode === 'object') { // Sequence continues. + seqObj = resCode; + continue; + + } else if (typeof resCode == 'number') { // Sequence finished. Write it. + dbcsCode = resCode; + + } else if (resCode == undefined) { // Current character is not part of the sequence. + + // Try default character for this sequence + resCode = seqObj[DEF_CHAR]; + if (resCode !== undefined) { + dbcsCode = resCode; // Found. Write it. + nextChar = uCode; // Current character will be written too in the next iteration. + + } else { + // TODO: What if we have no default? (resCode == undefined) + // Then, we should write first char of the sequence as-is and try the rest recursively. + // Didn't do it for now because no encoding has this situation yet. + // Currently, just skip the sequence and write current char. + } + } + seqObj = undefined; + } + else if (uCode >= 0) { // Regular character + var subtable = this.encodeTable[uCode >> 8]; + if (subtable !== undefined) + dbcsCode = subtable[uCode & 0xFF]; + + if (dbcsCode <= SEQ_START) { // Sequence start + seqObj = this.encodeTableSeq[SEQ_START-dbcsCode]; + continue; + } + + if (dbcsCode == UNASSIGNED && this.gb18030) { + // Use GB18030 algorithm to find character(s) to write. + var idx = findIdx(this.gb18030.uChars, uCode); + if (idx != -1) { + var dbcsCode = this.gb18030.gbChars[idx] + (uCode - this.gb18030.uChars[idx]); + newBuf[j++] = 0x81 + Math.floor(dbcsCode / 12600); dbcsCode = dbcsCode % 12600; + newBuf[j++] = 0x30 + Math.floor(dbcsCode / 1260); dbcsCode = dbcsCode % 1260; + newBuf[j++] = 0x81 + Math.floor(dbcsCode / 10); dbcsCode = dbcsCode % 10; + newBuf[j++] = 0x30 + dbcsCode; + continue; + } + } + } + + // 3. Write dbcsCode character. + if (dbcsCode === UNASSIGNED) + dbcsCode = this.defaultCharSingleByte; + + if (dbcsCode < 0x100) { + newBuf[j++] = dbcsCode; + } + else if (dbcsCode < 0x10000) { + newBuf[j++] = dbcsCode >> 8; // high byte + newBuf[j++] = dbcsCode & 0xFF; // low byte + } + else { + newBuf[j++] = dbcsCode >> 16; + newBuf[j++] = (dbcsCode >> 8) & 0xFF; + newBuf[j++] = dbcsCode & 0xFF; + } + } + + this.seqObj = seqObj; + this.leadSurrogate = leadSurrogate; + return newBuf.slice(0, j); +} + +DBCSEncoder.prototype.end = function() { + if (this.leadSurrogate === -1 && this.seqObj === undefined) + return; // All clean. Most often case. + + var newBuf = Buffer.alloc(10), j = 0; + + if (this.seqObj) { // We're in the sequence. + var dbcsCode = this.seqObj[DEF_CHAR]; + if (dbcsCode !== undefined) { // Write beginning of the sequence. + if (dbcsCode < 0x100) { + newBuf[j++] = dbcsCode; + } + else { + newBuf[j++] = dbcsCode >> 8; // high byte + newBuf[j++] = dbcsCode & 0xFF; // low byte + } + } else { + // See todo above. + } + this.seqObj = undefined; + } + + if (this.leadSurrogate !== -1) { + // Incomplete surrogate pair - only lead surrogate found. + newBuf[j++] = this.defaultCharSingleByte; + this.leadSurrogate = -1; + } + + return newBuf.slice(0, j); +} + +// Export for testing +DBCSEncoder.prototype.findIdx = findIdx; + + +// == Decoder ================================================================== + +function DBCSDecoder(options, codec) { + // Decoder state + this.nodeIdx = 0; + this.prevBuf = Buffer.alloc(0); + + // Static data + this.decodeTables = codec.decodeTables; + this.decodeTableSeq = codec.decodeTableSeq; + this.defaultCharUnicode = codec.defaultCharUnicode; + this.gb18030 = codec.gb18030; +} + +DBCSDecoder.prototype.write = function(buf) { + var newBuf = Buffer.alloc(buf.length*2), + nodeIdx = this.nodeIdx, + prevBuf = this.prevBuf, prevBufOffset = this.prevBuf.length, + seqStart = -this.prevBuf.length, // idx of the start of current parsed sequence. + uCode; + + if (prevBufOffset > 0) // Make prev buf overlap a little to make it easier to slice later. + prevBuf = Buffer.concat([prevBuf, buf.slice(0, 10)]); + + for (var i = 0, j = 0; i < buf.length; i++) { + var curByte = (i >= 0) ? buf[i] : prevBuf[i + prevBufOffset]; + + // Lookup in current trie node. + var uCode = this.decodeTables[nodeIdx][curByte]; + + if (uCode >= 0) { + // Normal character, just use it. + } + else if (uCode === UNASSIGNED) { // Unknown char. + // TODO: Callback with seq. + //var curSeq = (seqStart >= 0) ? buf.slice(seqStart, i+1) : prevBuf.slice(seqStart + prevBufOffset, i+1 + prevBufOffset); + i = seqStart; // Try to parse again, after skipping first byte of the sequence ('i' will be incremented by 'for' cycle). + uCode = this.defaultCharUnicode.charCodeAt(0); + } + else if (uCode === GB18030_CODE) { + var curSeq = (seqStart >= 0) ? buf.slice(seqStart, i+1) : prevBuf.slice(seqStart + prevBufOffset, i+1 + prevBufOffset); + var ptr = (curSeq[0]-0x81)*12600 + (curSeq[1]-0x30)*1260 + (curSeq[2]-0x81)*10 + (curSeq[3]-0x30); + var idx = findIdx(this.gb18030.gbChars, ptr); + uCode = this.gb18030.uChars[idx] + ptr - this.gb18030.gbChars[idx]; + } + else if (uCode <= NODE_START) { // Go to next trie node. + nodeIdx = NODE_START - uCode; + continue; + } + else if (uCode <= SEQ_START) { // Output a sequence of chars. + var seq = this.decodeTableSeq[SEQ_START - uCode]; + for (var k = 0; k < seq.length - 1; k++) { + uCode = seq[k]; + newBuf[j++] = uCode & 0xFF; + newBuf[j++] = uCode >> 8; + } + uCode = seq[seq.length-1]; + } + else + throw new Error("iconv-lite internal error: invalid decoding table value " + uCode + " at " + nodeIdx + "/" + curByte); + + // Write the character to buffer, handling higher planes using surrogate pair. + if (uCode > 0xFFFF) { + uCode -= 0x10000; + var uCodeLead = 0xD800 + Math.floor(uCode / 0x400); + newBuf[j++] = uCodeLead & 0xFF; + newBuf[j++] = uCodeLead >> 8; + + uCode = 0xDC00 + uCode % 0x400; + } + newBuf[j++] = uCode & 0xFF; + newBuf[j++] = uCode >> 8; + + // Reset trie node. + nodeIdx = 0; seqStart = i+1; + } + + this.nodeIdx = nodeIdx; + this.prevBuf = (seqStart >= 0) ? buf.slice(seqStart) : prevBuf.slice(seqStart + prevBufOffset); + return newBuf.slice(0, j).toString('ucs2'); +} + +DBCSDecoder.prototype.end = function() { + var ret = ''; + + // Try to parse all remaining chars. + while (this.prevBuf.length > 0) { + // Skip 1 character in the buffer. + ret += this.defaultCharUnicode; + var buf = this.prevBuf.slice(1); + + // Parse remaining as usual. + this.prevBuf = Buffer.alloc(0); + this.nodeIdx = 0; + if (buf.length > 0) + ret += this.write(buf); + } + + this.nodeIdx = 0; + return ret; +} + +// Binary search for GB18030. Returns largest i such that table[i] <= val. +function findIdx(table, val) { + if (table[0] > val) + return -1; + + var l = 0, r = table.length; + while (l < r-1) { // always table[l] <= val < table[r] + var mid = l + Math.floor((r-l+1)/2); + if (table[mid] <= val) + l = mid; + else + r = mid; + } + return l; +} + diff --git a/node_modules/iconv-lite/encodings/dbcs-data.js b/node_modules/iconv-lite/encodings/dbcs-data.js new file mode 100644 index 0000000..4b61914 --- /dev/null +++ b/node_modules/iconv-lite/encodings/dbcs-data.js @@ -0,0 +1,176 @@ +"use strict"; + +// Description of supported double byte encodings and aliases. +// Tables are not require()-d until they are needed to speed up library load. +// require()-s are direct to support Browserify. + +module.exports = { + + // == Japanese/ShiftJIS ==================================================== + // All japanese encodings are based on JIS X set of standards: + // JIS X 0201 - Single-byte encoding of ASCII + Â¥ + Kana chars at 0xA1-0xDF. + // JIS X 0208 - Main set of 6879 characters, placed in 94x94 plane, to be encoded by 2 bytes. + // Has several variations in 1978, 1983, 1990 and 1997. + // JIS X 0212 - Supplementary plane of 6067 chars in 94x94 plane. 1990. Effectively dead. + // JIS X 0213 - Extension and modern replacement of 0208 and 0212. Total chars: 11233. + // 2 planes, first is superset of 0208, second - revised 0212. + // Introduced in 2000, revised 2004. Some characters are in Unicode Plane 2 (0x2xxxx) + + // Byte encodings are: + // * Shift_JIS: Compatible with 0201, uses not defined chars in top half as lead bytes for double-byte + // encoding of 0208. Lead byte ranges: 0x81-0x9F, 0xE0-0xEF; Trail byte ranges: 0x40-0x7E, 0x80-0x9E, 0x9F-0xFC. + // Windows CP932 is a superset of Shift_JIS. Some companies added more chars, notably KDDI. + // * EUC-JP: Up to 3 bytes per character. Used mostly on *nixes. + // 0x00-0x7F - lower part of 0201 + // 0x8E, 0xA1-0xDF - upper part of 0201 + // (0xA1-0xFE)x2 - 0208 plane (94x94). + // 0x8F, (0xA1-0xFE)x2 - 0212 plane (94x94). + // * JIS X 208: 7-bit, direct encoding of 0208. Byte ranges: 0x21-0x7E (94 values). Uncommon. + // Used as-is in ISO2022 family. + // * ISO2022-JP: Stateful encoding, with escape sequences to switch between ASCII, + // 0201-1976 Roman, 0208-1978, 0208-1983. + // * ISO2022-JP-1: Adds esc seq for 0212-1990. + // * ISO2022-JP-2: Adds esc seq for GB2313-1980, KSX1001-1992, ISO8859-1, ISO8859-7. + // * ISO2022-JP-3: Adds esc seq for 0201-1976 Kana set, 0213-2000 Planes 1, 2. + // * ISO2022-JP-2004: Adds 0213-2004 Plane 1. + // + // After JIS X 0213 appeared, Shift_JIS-2004, EUC-JISX0213 and ISO2022-JP-2004 followed, with just changing the planes. + // + // Overall, it seems that it's a mess :( http://www8.plala.or.jp/tkubota1/unicode-symbols-map2.html + + 'shiftjis': { + type: '_dbcs', + table: function() { return require('./tables/shiftjis.json') }, + encodeAdd: {'\u00a5': 0x5C, '\u203E': 0x7E}, + encodeSkipVals: [{from: 0xED40, to: 0xF940}], + }, + 'csshiftjis': 'shiftjis', + 'mskanji': 'shiftjis', + 'sjis': 'shiftjis', + 'windows31j': 'shiftjis', + 'ms31j': 'shiftjis', + 'xsjis': 'shiftjis', + 'windows932': 'shiftjis', + 'ms932': 'shiftjis', + '932': 'shiftjis', + 'cp932': 'shiftjis', + + 'eucjp': { + type: '_dbcs', + table: function() { return require('./tables/eucjp.json') }, + encodeAdd: {'\u00a5': 0x5C, '\u203E': 0x7E}, + }, + + // TODO: KDDI extension to Shift_JIS + // TODO: IBM CCSID 942 = CP932, but F0-F9 custom chars and other char changes. + // TODO: IBM CCSID 943 = Shift_JIS = CP932 with original Shift_JIS lower 128 chars. + + + // == Chinese/GBK ========================================================== + // http://en.wikipedia.org/wiki/GBK + // We mostly implement W3C recommendation: https://www.w3.org/TR/encoding/#gbk-encoder + + // Oldest GB2312 (1981, ~7600 chars) is a subset of CP936 + 'gb2312': 'cp936', + 'gb231280': 'cp936', + 'gb23121980': 'cp936', + 'csgb2312': 'cp936', + 'csiso58gb231280': 'cp936', + 'euccn': 'cp936', + + // Microsoft's CP936 is a subset and approximation of GBK. + 'windows936': 'cp936', + 'ms936': 'cp936', + '936': 'cp936', + 'cp936': { + type: '_dbcs', + table: function() { return require('./tables/cp936.json') }, + }, + + // GBK (~22000 chars) is an extension of CP936 that added user-mapped chars and some other. + 'gbk': { + type: '_dbcs', + table: function() { return require('./tables/cp936.json').concat(require('./tables/gbk-added.json')) }, + }, + 'xgbk': 'gbk', + 'isoir58': 'gbk', + + // GB18030 is an algorithmic extension of GBK. + // Main source: https://www.w3.org/TR/encoding/#gbk-encoder + // http://icu-project.org/docs/papers/gb18030.html + // http://source.icu-project.org/repos/icu/data/trunk/charset/data/xml/gb-18030-2000.xml + // http://www.khngai.com/chinese/charmap/tblgbk.php?page=0 + 'gb18030': { + type: '_dbcs', + table: function() { return require('./tables/cp936.json').concat(require('./tables/gbk-added.json')) }, + gb18030: function() { return require('./tables/gb18030-ranges.json') }, + encodeSkipVals: [0x80], + encodeAdd: {'â¬': 0xA2E3}, + }, + + 'chinese': 'gb18030', + + + // == Korean =============================================================== + // EUC-KR, KS_C_5601 and KS X 1001 are exactly the same. + 'windows949': 'cp949', + 'ms949': 'cp949', + '949': 'cp949', + 'cp949': { + type: '_dbcs', + table: function() { return require('./tables/cp949.json') }, + }, + + 'cseuckr': 'cp949', + 'csksc56011987': 'cp949', + 'euckr': 'cp949', + 'isoir149': 'cp949', + 'korean': 'cp949', + 'ksc56011987': 'cp949', + 'ksc56011989': 'cp949', + 'ksc5601': 'cp949', + + + // == Big5/Taiwan/Hong Kong ================================================ + // There are lots of tables for Big5 and cp950. Please see the following links for history: + // http://moztw.org/docs/big5/ http://www.haible.de/bruno/charsets/conversion-tables/Big5.html + // Variations, in roughly number of defined chars: + // * Windows CP 950: Microsoft variant of Big5. Canonical: http://www.unicode.org/Public/MAPPINGS/VENDORS/MICSFT/WINDOWS/CP950.TXT + // * Windows CP 951: Microsoft variant of Big5-HKSCS-2001. Seems to be never public. http://me.abelcheung.org/articles/research/what-is-cp951/ + // * Big5-2003 (Taiwan standard) almost superset of cp950. + // * Unicode-at-on (UAO) / Mozilla 1.8. Falling out of use on the Web. Not supported by other browsers. + // * Big5-HKSCS (-2001, -2004, -2008). Hong Kong standard. + // many unicode code points moved from PUA to Supplementary plane (U+2XXXX) over the years. + // Plus, it has 4 combining sequences. + // Seems that Mozilla refused to support it for 10 yrs. https://bugzilla.mozilla.org/show_bug.cgi?id=162431 https://bugzilla.mozilla.org/show_bug.cgi?id=310299 + // because big5-hkscs is the only encoding to include astral characters in non-algorithmic way. + // Implementations are not consistent within browsers; sometimes labeled as just big5. + // MS Internet Explorer switches from big5 to big5-hkscs when a patch applied. + // Great discussion & recap of what's going on https://bugzilla.mozilla.org/show_bug.cgi?id=912470#c31 + // In the encoder, it might make sense to support encoding old PUA mappings to Big5 bytes seq-s. + // Official spec: http://www.ogcio.gov.hk/en/business/tech_promotion/ccli/terms/doc/2003cmp_2008.txt + // http://www.ogcio.gov.hk/tc/business/tech_promotion/ccli/terms/doc/hkscs-2008-big5-iso.txt + // + // Current understanding of how to deal with Big5(-HKSCS) is in the Encoding Standard, http://encoding.spec.whatwg.org/#big5-encoder + // Unicode mapping (http://www.unicode.org/Public/MAPPINGS/OBSOLETE/EASTASIA/OTHER/BIG5.TXT) is said to be wrong. + + 'windows950': 'cp950', + 'ms950': 'cp950', + '950': 'cp950', + 'cp950': { + type: '_dbcs', + table: function() { return require('./tables/cp950.json') }, + }, + + // Big5 has many variations and is an extension of cp950. We use Encoding Standard's as a consensus. + 'big5': 'big5hkscs', + 'big5hkscs': { + type: '_dbcs', + table: function() { return require('./tables/cp950.json').concat(require('./tables/big5-added.json')) }, + encodeSkipVals: [0xa2cc], + }, + + 'cnbig5': 'big5hkscs', + 'csbig5': 'big5hkscs', + 'xxbig5': 'big5hkscs', +}; diff --git a/node_modules/iconv-lite/encodings/index.js b/node_modules/iconv-lite/encodings/index.js new file mode 100644 index 0000000..e304003 --- /dev/null +++ b/node_modules/iconv-lite/encodings/index.js @@ -0,0 +1,22 @@ +"use strict"; + +// Update this array if you add/rename/remove files in this directory. +// We support Browserify by skipping automatic module discovery and requiring modules directly. +var modules = [ + require("./internal"), + require("./utf16"), + require("./utf7"), + require("./sbcs-codec"), + require("./sbcs-data"), + require("./sbcs-data-generated"), + require("./dbcs-codec"), + require("./dbcs-data"), +]; + +// Put all encoding/alias/codec definitions to single object and export it. +for (var i = 0; i < modules.length; i++) { + var module = modules[i]; + for (var enc in module) + if (Object.prototype.hasOwnProperty.call(module, enc)) + exports[enc] = module[enc]; +} diff --git a/node_modules/iconv-lite/encodings/internal.js b/node_modules/iconv-lite/encodings/internal.js new file mode 100644 index 0000000..05ce38b --- /dev/null +++ b/node_modules/iconv-lite/encodings/internal.js @@ -0,0 +1,188 @@ +"use strict"; +var Buffer = require("safer-buffer").Buffer; + +// Export Node.js internal encodings. + +module.exports = { + // Encodings + utf8: { type: "_internal", bomAware: true}, + cesu8: { type: "_internal", bomAware: true}, + unicode11utf8: "utf8", + + ucs2: { type: "_internal", bomAware: true}, + utf16le: "ucs2", + + binary: { type: "_internal" }, + base64: { type: "_internal" }, + hex: { type: "_internal" }, + + // Codec. + _internal: InternalCodec, +}; + +//------------------------------------------------------------------------------ + +function InternalCodec(codecOptions, iconv) { + this.enc = codecOptions.encodingName; + this.bomAware = codecOptions.bomAware; + + if (this.enc === "base64") + this.encoder = InternalEncoderBase64; + else if (this.enc === "cesu8") { + this.enc = "utf8"; // Use utf8 for decoding. + this.encoder = InternalEncoderCesu8; + + // Add decoder for versions of Node not supporting CESU-8 + if (Buffer.from('eda0bdedb2a9', 'hex').toString() !== 'ð©') { + this.decoder = InternalDecoderCesu8; + this.defaultCharUnicode = iconv.defaultCharUnicode; + } + } +} + +InternalCodec.prototype.encoder = InternalEncoder; +InternalCodec.prototype.decoder = InternalDecoder; + +//------------------------------------------------------------------------------ + +// We use node.js internal decoder. Its signature is the same as ours. +var StringDecoder = require('string_decoder').StringDecoder; + +if (!StringDecoder.prototype.end) // Node v0.8 doesn't have this method. + StringDecoder.prototype.end = function() {}; + + +function InternalDecoder(options, codec) { + StringDecoder.call(this, codec.enc); +} + +InternalDecoder.prototype = StringDecoder.prototype; + + +//------------------------------------------------------------------------------ +// Encoder is mostly trivial + +function InternalEncoder(options, codec) { + this.enc = codec.enc; +} + +InternalEncoder.prototype.write = function(str) { + return Buffer.from(str, this.enc); +} + +InternalEncoder.prototype.end = function() { +} + + +//------------------------------------------------------------------------------ +// Except base64 encoder, which must keep its state. + +function InternalEncoderBase64(options, codec) { + this.prevStr = ''; +} + +InternalEncoderBase64.prototype.write = function(str) { + str = this.prevStr + str; + var completeQuads = str.length - (str.length % 4); + this.prevStr = str.slice(completeQuads); + str = str.slice(0, completeQuads); + + return Buffer.from(str, "base64"); +} + +InternalEncoderBase64.prototype.end = function() { + return Buffer.from(this.prevStr, "base64"); +} + + +//------------------------------------------------------------------------------ +// CESU-8 encoder is also special. + +function InternalEncoderCesu8(options, codec) { +} + +InternalEncoderCesu8.prototype.write = function(str) { + var buf = Buffer.alloc(str.length * 3), bufIdx = 0; + for (var i = 0; i < str.length; i++) { + var charCode = str.charCodeAt(i); + // Naive implementation, but it works because CESU-8 is especially easy + // to convert from UTF-16 (which all JS strings are encoded in). + if (charCode < 0x80) + buf[bufIdx++] = charCode; + else if (charCode < 0x800) { + buf[bufIdx++] = 0xC0 + (charCode >>> 6); + buf[bufIdx++] = 0x80 + (charCode & 0x3f); + } + else { // charCode will always be < 0x10000 in javascript. + buf[bufIdx++] = 0xE0 + (charCode >>> 12); + buf[bufIdx++] = 0x80 + ((charCode >>> 6) & 0x3f); + buf[bufIdx++] = 0x80 + (charCode & 0x3f); + } + } + return buf.slice(0, bufIdx); +} + +InternalEncoderCesu8.prototype.end = function() { +} + +//------------------------------------------------------------------------------ +// CESU-8 decoder is not implemented in Node v4.0+ + +function InternalDecoderCesu8(options, codec) { + this.acc = 0; + this.contBytes = 0; + this.accBytes = 0; + this.defaultCharUnicode = codec.defaultCharUnicode; +} + +InternalDecoderCesu8.prototype.write = function(buf) { + var acc = this.acc, contBytes = this.contBytes, accBytes = this.accBytes, + res = ''; + for (var i = 0; i < buf.length; i++) { + var curByte = buf[i]; + if ((curByte & 0xC0) !== 0x80) { // Leading byte + if (contBytes > 0) { // Previous code is invalid + res += this.defaultCharUnicode; + contBytes = 0; + } + + if (curByte < 0x80) { // Single-byte code + res += String.fromCharCode(curByte); + } else if (curByte < 0xE0) { // Two-byte code + acc = curByte & 0x1F; + contBytes = 1; accBytes = 1; + } else if (curByte < 0xF0) { // Three-byte code + acc = curByte & 0x0F; + contBytes = 2; accBytes = 1; + } else { // Four or more are not supported for CESU-8. + res += this.defaultCharUnicode; + } + } else { // Continuation byte + if (contBytes > 0) { // We're waiting for it. + acc = (acc << 6) | (curByte & 0x3f); + contBytes--; accBytes++; + if (contBytes === 0) { + // Check for overlong encoding, but support Modified UTF-8 (encoding NULL as C0 80) + if (accBytes === 2 && acc < 0x80 && acc > 0) + res += this.defaultCharUnicode; + else if (accBytes === 3 && acc < 0x800) + res += this.defaultCharUnicode; + else + // Actually add character. + res += String.fromCharCode(acc); + } + } else { // Unexpected continuation byte + res += this.defaultCharUnicode; + } + } + } + this.acc = acc; this.contBytes = contBytes; this.accBytes = accBytes; + return res; +} + +InternalDecoderCesu8.prototype.end = function() { + var res = 0; + if (this.contBytes > 0) + res += this.defaultCharUnicode; + return res; +} diff --git a/node_modules/iconv-lite/encodings/sbcs-codec.js b/node_modules/iconv-lite/encodings/sbcs-codec.js new file mode 100644 index 0000000..abac5ff --- /dev/null +++ b/node_modules/iconv-lite/encodings/sbcs-codec.js @@ -0,0 +1,72 @@ +"use strict"; +var Buffer = require("safer-buffer").Buffer; + +// Single-byte codec. Needs a 'chars' string parameter that contains 256 or 128 chars that +// correspond to encoded bytes (if 128 - then lower half is ASCII). + +exports._sbcs = SBCSCodec; +function SBCSCodec(codecOptions, iconv) { + if (!codecOptions) + throw new Error("SBCS codec is called without the data.") + + // Prepare char buffer for decoding. + if (!codecOptions.chars || (codecOptions.chars.length !== 128 && codecOptions.chars.length !== 256)) + throw new Error("Encoding '"+codecOptions.type+"' has incorrect 'chars' (must be of len 128 or 256)"); + + if (codecOptions.chars.length === 128) { + var asciiString = ""; + for (var i = 0; i < 128; i++) + asciiString += String.fromCharCode(i); + codecOptions.chars = asciiString + codecOptions.chars; + } + + this.decodeBuf = Buffer.from(codecOptions.chars, 'ucs2'); + + // Encoding buffer. + var encodeBuf = Buffer.alloc(65536, iconv.defaultCharSingleByte.charCodeAt(0)); + + for (var i = 0; i < codecOptions.chars.length; i++) + encodeBuf[codecOptions.chars.charCodeAt(i)] = i; + + this.encodeBuf = encodeBuf; +} + +SBCSCodec.prototype.encoder = SBCSEncoder; +SBCSCodec.prototype.decoder = SBCSDecoder; + + +function SBCSEncoder(options, codec) { + this.encodeBuf = codec.encodeBuf; +} + +SBCSEncoder.prototype.write = function(str) { + var buf = Buffer.alloc(str.length); + for (var i = 0; i < str.length; i++) + buf[i] = this.encodeBuf[str.charCodeAt(i)]; + + return buf; +} + +SBCSEncoder.prototype.end = function() { +} + + +function SBCSDecoder(options, codec) { + this.decodeBuf = codec.decodeBuf; +} + +SBCSDecoder.prototype.write = function(buf) { + // Strings are immutable in JS -> we use ucs2 buffer to speed up computations. + var decodeBuf = this.decodeBuf; + var newBuf = Buffer.alloc(buf.length*2); + var idx1 = 0, idx2 = 0; + for (var i = 0; i < buf.length; i++) { + idx1 = buf[i]*2; idx2 = i*2; + newBuf[idx2] = decodeBuf[idx1]; + newBuf[idx2+1] = decodeBuf[idx1+1]; + } + return newBuf.toString('ucs2'); +} + +SBCSDecoder.prototype.end = function() { +} diff --git a/node_modules/iconv-lite/encodings/sbcs-data-generated.js b/node_modules/iconv-lite/encodings/sbcs-data-generated.js new file mode 100644 index 0000000..9b48236 --- /dev/null +++ b/node_modules/iconv-lite/encodings/sbcs-data-generated.js @@ -0,0 +1,451 @@ +"use strict"; + +// Generated data for sbcs codec. Don't edit manually. Regenerate using generation/gen-sbcs.js script. +module.exports = { + "437": "cp437", + "737": "cp737", + "775": "cp775", + "850": "cp850", + "852": "cp852", + "855": "cp855", + "856": "cp856", + "857": "cp857", + "858": "cp858", + "860": "cp860", + "861": "cp861", + "862": "cp862", + "863": "cp863", + "864": "cp864", + "865": "cp865", + "866": "cp866", + "869": "cp869", + "874": "windows874", + "922": "cp922", + "1046": "cp1046", + "1124": "cp1124", + "1125": "cp1125", + "1129": "cp1129", + "1133": "cp1133", + "1161": "cp1161", + "1162": "cp1162", + "1163": "cp1163", + "1250": "windows1250", + "1251": "windows1251", + "1252": "windows1252", + "1253": "windows1253", + "1254": "windows1254", + "1255": "windows1255", + "1256": "windows1256", + "1257": "windows1257", + "1258": "windows1258", + "28591": "iso88591", + "28592": "iso88592", + "28593": "iso88593", + "28594": "iso88594", + "28595": "iso88595", + "28596": "iso88596", + "28597": "iso88597", + "28598": "iso88598", + "28599": "iso88599", + "28600": "iso885910", + "28601": "iso885911", + "28603": "iso885913", + "28604": "iso885914", + "28605": "iso885915", + "28606": "iso885916", + "windows874": { + "type": "_sbcs", + "chars": "â¬ï¿½ï¿½ï¿½ï¿½â¦ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½âââââ¢ââ�������� à¸à¸à¸à¸à¸ à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸ มยรฤลฦวศษสหฬà¸à¸®à¸¯à¸°à¸±à¸²à¸³à¸´à¸µà¸¶à¸·à¸¸à¸¹à¸ºï¿½ï¿½ï¿½ï¿½à¸¿à¹à¹à¹à¹à¹à¹ à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹ï¿½ï¿½ï¿½ï¿½" + }, + "win874": "windows874", + "cp874": "windows874", + "windows1250": { + "type": "_sbcs", + "chars": "â¬ï¿½â�ââ¦â â¡ï¿½â°Å â¹ÅŤŽŹ�âââââ¢ââ�â¢Å¡âºÅťžź ËËŤĦ§¨©Å«¬Â®Ż°±ËÅÂ´ÂµÂ¶Â·Â¸Ä Å»ĽËľżÅÃÃÄÃĹÄÃÄÃÄÃÄÃÃÄÄÅÅÃÃÅÃÃÅÅ®ÃÅ°ÃÃÅ¢ÃÅáâÄäĺÄçÄéÄëÄÃîÄÄÅÅóôÅö÷ÅůúűüýţË" + }, + "win1250": "windows1250", + "cp1250": "windows1250", + "windows1251": { + "type": "_sbcs", + "chars": "ÐÐâÑââ¦â â¡â¬â°Ðâ¹ÐÐÐÐÑâââââ¢ââ�â¢ÑâºÑÑÑÑ ÐÑФҦ§Ð©Ð«¬Â®Ð°±ÐÑÒµ¶·ÑâÑ»ÑÐ ÑÑÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐРСТУФХЦЧШЩЪЫЬÐЮЯабвгдежзийклмнопÑÑÑÑÑÑ ÑÑÑÑÑÑÑÑÑÑ" + }, + "win1251": "windows1251", + "cp1251": "windows1251", + "windows1252": { + "type": "_sbcs", + "chars": "â¬ï¿½âÆââ¦â â¡Ëâ°Å â¹Å�Ž��âââââ¢ââËâ¢Å¡âºÅ�žŸ ¡¢£¤¥¦§¨©ª«¬Â®¯°±²³´µ¶·¸¹º»¼½¾¿ÃÃÃÃÃà ÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃà áâãäåæçèéêëìÃîïðñòóôõö÷øùúûüýþÿ" + }, + "win1252": "windows1252", + "cp1252": "windows1252", + "windows1253": { + "type": "_sbcs", + "chars": "â¬ï¿½âÆââ¦â â¡ï¿½â°ï¿½â¹ï¿½ï¿½ï¿½ï¿½ï¿½âââââ¢ââ�â¢ï¿½âºï¿½ï¿½ï¿½ï¿½Â ΠΣ¤¥¦§¨©�«¬Â®â°±²³Îµ¶·ÎÎλνÎÎÎÎÎÎÎÎÎÎÎÎÎÎÎÎÎÎΠΡ�ΣΤΥΦΧΨΩΪΫάÎήίΰαβγδεζηθικλμνξοÏÏÏÏÏÏ ÏÏÏÏÏÏÏÏÏ�" + }, + "win1253": "windows1253", + "cp1253": "windows1253", + "windows1254": { + "type": "_sbcs", + "chars": "â¬ï¿½âÆââ¦â â¡Ëâ°Å â¹Å����âââââ¢ââËâ¢Å¡âºÅ��Ÿ ¡¢£¤¥¦§¨©ª«¬Â®¯°±²³´µ¶·¸¹º»¼½¾¿ÃÃÃÃÃà ÃÃÃÃÃÃÃÃÃÃÄÃÃÃÃÃÃÃÃÃÃÃÃÄ°ÅÃà áâãäåæçèéêëìÃîïÄñòóôõö÷øùúûüıÅÿ" + }, + "win1254": "windows1254", + "cp1254": "windows1254", + "windows1255": { + "type": "_sbcs", + "chars": "â¬ï¿½âÆââ¦â â¡Ëâ°ï¿½â¹ï¿½ï¿½ï¿½ï¿½ï¿½âââââ¢ââËâ¢ï¿½âºï¿½ï¿½ï¿½ï¿½Â ¡¢£âªÂ¥Â¦Â§Â¨Â©Ã«¬Â®¯°±²³´µ¶·¸¹÷»¼½¾¿ְֱֲֳִֵֶַָֹֺֻּֽ־ֿ××××װױײ׳״�������××××××××××××××××× ×¡×¢×£×¤×¥×¦×§×¨×©×ªï¿½ï¿½ââ�" + }, + "win1255": "windows1255", + "cp1255": "windows1255", + "windows1256": { + "type": "_sbcs", + "chars": "â¬Ù¾âÆââ¦â â¡Ëâ°Ù¹â¹ÅÚÚÚÚ¯âââââ¢ââÚ©â¢ÚâºÅââں Ø¢£¤¥¦§¨©ھ«¬Â®¯°±²³´µ¶·¸¹Ø»¼½¾ØÛءآأؤإئابةتثجØخدذرزسشصضÃطظعغÙÙÙÙà Ùâ٠ÙÙÙçèéêëÙÙîïÙÙÙÙôÙÙ÷ÙùÙûüââÛ" + }, + "win1256": "windows1256", + "cp1256": "windows1256", + "windows1257": { + "type": "_sbcs", + "chars": "â¬ï¿½â�ââ¦â â¡ï¿½â°ï¿½â¹ï¿½Â¨Ë¸�âââââ¢ââ�â¢ï¿½âºï¿½Â¯Ë� �¢£¤�¦§Ã©Å«¬Â®Ã°±²³´µ¶·ø¹Å»¼½¾æÄÄ®ÄÄÃà ÄÄÄÃŹÄĢĶĪĻŠÅÅ ÃÅÃÃÃŲÅÅŪÃŻŽÃÄ Ä¯ÄÄäåÄÄÄéźÄģķīļšÅÅóÅõö÷ųÅÅūüżžË" + }, + "win1257": "windows1257", + "cp1257": "windows1257", + "windows1258": { + "type": "_sbcs", + "chars": "â¬ï¿½âÆââ¦â â¡Ëâ°ï¿½â¹Å����âââââ¢ââËâ¢ï¿½âºÅ��Ÿ ¡¢£¤¥¦§¨©ª«¬Â®¯°±²³´µ¶·¸¹º»¼½¾¿ÃÃÃÄÃà ÃÃÃÃÃÃÌÃÃÃÄÃÌÃÃÆ ÃÃÃÃÃÃÃƯÌÃà áâÄäåæçèéêëÌÃîïÄṇ̃óôơö÷øùúûüưâ«Ã¿" + }, + "win1258": "windows1258", + "cp1258": "windows1258", + "iso88591": { + "type": "_sbcs", + "chars": " Â ¡¢£¤¥¦§¨©ª«¬Â®¯°±²³´µ¶·¸¹º»¼½¾¿ÃÃÃÃÃà ÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃà áâãäåæçèéêëìÃîïðñòóôõö÷øùúûüýþÿ" + }, + "cp28591": "iso88591", + "iso88592": { + "type": "_sbcs", + "chars": " Â ÄËŤĽÅ§¨ŠÅŤŹÂÅ½Å»Â°Ä ËÅ´ľÅ˸šÅťźËžżÅÃÃÄÃĹÄÃÄÃÄÃÄÃÃÄÄÅÅÃÃÅÃÃÅÅ®ÃÅ°ÃÃÅ¢ÃÅáâÄäĺÄçÄéÄëÄÃîÄÄÅÅóôÅö÷ÅůúűüýţË" + }, + "cp28592": "iso88592", + "iso88593": { + "type": "_sbcs", + "chars": " Â ĦË£¤�Ĥ§¨İÅÄÄ´Â�Ż°ħ²³´µĥ·¸ıÅÄĵ½�żÃÃÃ�ÃÄÄÃÃÃÃÃÃÃÃÃ�ÃÃÃÃÄ ÃÃÄÃÃÃÃŬÅÃà áâ�äÄÄçèéêëìÃîï�ñòóôġö÷ÄùúûüÅÅË" + }, + "cp28593": "iso88593", + "iso88594": { + "type": "_sbcs", + "chars": " Â ÄĸŤĨĻ§¨ŠÄĢŦÂÅ½Â¯Â°Ä ËÅ´ĩļ˸šÄģŧÅžÅÄÃÃÃÃà ÃÄ®ÄÃÄÃÄÃÃĪÄÅ ÅĶÃÃÃÃÃŲÃÃÃŨŪÃÄáâãäåæįÄéÄëÄÃîīÄÅÅķôõö÷øųúûüũūË" + }, + "cp28594": "iso88594", + "iso88595": { + "type": "_sbcs", + "chars": " Â ÐÐÐÐÐ ÐÐÐÐÐÐÐÂÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐРСТУФХЦЧШЩЪЫЬÐЮЯабвгдежзийклмнопÑÑÑÑÑÑ ÑÑÑÑÑÑÑÑÑÑâÑÑÑÑÑÑÑÑÑÑÑѧÑÑ" + }, + "cp28595": "iso88595", + "iso88596": { + "type": "_sbcs", + "chars": " Â ���¤�������ØÂ�������������Ø���Ø�ءآأؤإئابةتثجØخدذرزسشصضطظعغ�����ÙÙÙÙÙÙ ÙÙÙÙÙÙÙÙÙÙÙÙÙ�������������" + }, + "cp28596": "iso88596", + "iso88597": { + "type": "_sbcs", + "chars": " Â ââ£â¬â¯Â¦Â§Â¨Â©ÍºÂ«Â¬Â�â°±²³ÎΠηÎÎλνÎÎÎÎÎÎÎÎÎÎÎÎÎÎÎÎÎÎΠΡ�ΣΤΥΦΧΨΩΪΫάÎήίΰαβγδεζηθικλμνξοÏÏÏÏÏÏ ÏÏÏÏÏÏÏÏÏ�" + }, + "cp28597": "iso88597", + "iso88598": { + "type": "_sbcs", + "chars": " Â �¢£¤¥¦§¨©Ã«¬Â®¯°±²³´µ¶·¸¹÷»¼½¾��������������������������������â××××××××××××××××× ×¡×¢×£×¤×¥×¦×§×¨×©×ªï¿½ï¿½ââ�" + }, + "cp28598": "iso88598", + "iso88599": { + "type": "_sbcs", + "chars": " Â ¡¢£¤¥¦§¨©ª«¬Â®¯°±²³´µ¶·¸¹º»¼½¾¿ÃÃÃÃÃà ÃÃÃÃÃÃÃÃÃÃÄÃÃÃÃÃÃÃÃÃÃÃÃÄ°ÅÃà áâãäåæçèéêëìÃîïÄñòóôõö÷øùúûüıÅÿ" + }, + "cp28599": "iso88599", + "iso885910": { + "type": "_sbcs", + "chars": " Â ÄÄĢĪĨĶ§ĻÄŠŦŽÂŪÅ塀 Äģīĩķ·ļÄšŧžâÅ«ÅÄÃÃÃÃà ÃÄ®ÄÃÄÃÄÃÃÃÃÅ ÅÃÃÃÃŨÃŲÃÃÃÃÃÃÄáâãäåæįÄéÄëÄÃîïðÅÅóôõöũøųúûüýþĸ" + }, + "cp28600": "iso885910", + "iso885911": { + "type": "_sbcs", + "chars": " Â à¸à¸à¸à¸à¸ à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸ มยรฤลฦวศษสหฬà¸à¸®à¸¯à¸°à¸±à¸²à¸³à¸´à¸µà¸¶à¸·à¸¸à¸¹à¸ºï¿½ï¿½ï¿½ï¿½à¸¿à¹à¹à¹à¹à¹à¹ à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹ï¿½ï¿½ï¿½ï¿½" + }, + "cp28601": "iso885911", + "iso885913": { + "type": "_sbcs", + "chars": " Â ⢣¤â¦§Ã©Å«¬Â®Ã°±²³âµ¶·ø¹Å»¼½¾æÄÄ®ÄÄÃà ÄÄÄÃŹÄĢĶĪĻŠÅÅ ÃÅÃÃÃŲÅÅŪÃŻŽÃÄ Ä¯ÄÄäåÄÄÄéźÄģķīļšÅÅóÅõö÷ųÅÅūüżžâ" + }, + "cp28603": "iso885913", + "iso885914": { + "type": "_sbcs", + "chars": " Â á¸á¸Â£ÄÄá¸Â§áºÂ©áºá¸á»²Â®Ÿá¸á¸Ä Ä¡á¹á¹Â¶á¹áºá¹áºá¹ ỳáºáº ṡÃÃÃÃÃà ÃÃÃÃÃÃÃÃÃÃÅ´ÃÃÃÃÃÃṪÃÃÃÃÃÃŶÃà áâãäåæçèéêëìÃîïŵñòóôõöṫøùúûüýŷÿ" + }, + "cp28604": "iso885914", + "iso885915": { + "type": "_sbcs", + "chars": " Â ¡¢£â¬Â¥Å §š©ª«¬Â®¯°±²³Žµ¶·ž¹º»ÅÅŸ¿ÃÃÃÃÃà ÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃÃà áâãäåæçèéêëìÃîïðñòóôõö÷øùúûüýþÿ" + }, + "cp28605": "iso885915", + "iso885916": { + "type": "_sbcs", + "chars": " Â ÄÄ Åâ¬âŠ§š©È«ŹÂźŻ°±ÄŎ⶷žÄÈ»ÅÅŸżÃÃÃÄÃÄÃÃÃÃÃÃÃÃÃÃÄÅÃÃÃÅÃÅÅ°ÃÃÃÃÄÈÃà áâÄäÄæçèéêëìÃîïÄÅòóôÅöÅűùúûüÄÈÿ" + }, + "cp28606": "iso885916", + "cp437": { + "type": "_sbcs", + "chars": "Ãüéâäà åçêëèïîìÃà ÃæÃôöòûùÿÃ⣥â§ÆáÃóúñ꺿⬽¼¡«»âââââ¤â¡â¢âââ£ââââââââ´â¬âââ¼âââââ©â¦â ââ¬â§â¨â¤â¥âââââ«âªâââââââαÃÎÏΣϵÏΦÎΩδâÏεâ©â¡Â±â¥â¤â â¡Ã·â°â·ââ¿Â²â  " + }, + "ibm437": "cp437", + "csibm437": "cp437", + "cp737": { + "type": "_sbcs", + "chars": "ÎÎÎÎÎÎÎÎÎÎÎÎÎÎÎΠΡΣΤΥΦΧΨΩαβγδεζηθικλμνξοÏÏÏÏÏÏ ÏÏÏâââââ¤â¡â¢âââ£ââââââââ´â¬âââ¼âââââ©â¦â ââ¬â§â¨â¤â¥âââââ«âªâââââââÏάÎήÏίÏÏÏÏÎÎÎÎÎÎαâ¥â¤ÎªÎ«Ã·â°â·ââ¿Â²â  " + }, + "ibm737": "cp737", + "csibm737": "cp737", + "cp775": { + "type": "_sbcs", + "chars": "ÄüéÄäģåÄÅÄÅÅīŹÃà ÃæÃÅöĢ¢ÅÅÃÃø£ÃäÄĪ󯿟⦩®¬½¼Å«»âââââ¤ÄÄÄÄâ£âââĮŠâââ´â¬âââ¼Å²Åªâââ©â¦â ââ¬Å½Ä ÄÄÄįšųūžâââââââÃÃÅÅõõÅĶķĻļÅÄÅ â±⾶§÷â°â·¹³²â  " + }, + "ibm775": "cp775", + "csibm775": "cp775", + "cp850": { + "type": "_sbcs", + "chars": "Ãüéâäà åçêëèïîìÃà ÃæÃôöòûùÿÃÃø£ÃÃÆáÃóúñ꺿®¬½¼¡«»âââââ¤ÃÃéâ£ââ⢥âââ´â¬âââ¼Ã£Ãâââ©â¦â ââ¬Â¤Ã°ÃÃÃÃıÃÃÃââââ¦ÃâÃÃÃÃõõþÃÃÃÃýï´Â±â¾¶§÷¸°¨·¹³²â  " + }, + "ibm850": "cp850", + "csibm850": "cp850", + "cp852": { + "type": "_sbcs", + "chars": "ÃüéâäůÄçÅëÅÅîŹÃÄÃĹĺôöĽľÅÅÃÃŤťÅÃÄáÃóúÄÄ Å½Å¾ÄĬźÄÅ«»âââââ¤ÃÃÄÅâ£ââ⯿âââ´â¬âââ¼ÄÄâââ©â¦â ââ¬Â¤ÄÄÄÃÄÅÃÃÄââââŢŮâÃÃÃÅÅÅÅ Å¡ÅÃÅŰýÃţ´ÂËËË˧÷¸°¨ËűÅÅâ  " + }, + "ibm852": "cp852", + "csibm852": "cp852", + "cp855": { + "type": "_sbcs", + "chars": "ÑÐÑÐÑÐÑÐÑÐ ÑÐÑÐÑÐÑÐÑÐÑÐÑÐÑÐÑÐÑЮÑЪаÐбÐÑЦдÐеÐÑФгЫ»âââââ¤Ñ ХиÐâ£âââйÐâââ´â¬âââ¼ÐºÐâââ©â¦â ââ¬Â¤Ð»ÐмÐнÐоÐпââââÐÑâЯÑÐ ÑСÑТÑУжÐвÐÑЬâÂÑЫзÐÑШÑÐÑЩÑЧ§â  " + }, + "ibm855": "cp855", + "csibm855": "cp855", + "cp856": { + "type": "_sbcs", + "chars": "××××××××××××××××× ×¡×¢×£×¤×¥×¦×§×¨×©×ªï¿½Â£ï¿½Ã����������®¬½¼�«»âââââ¤ï¿½ï¿½ï¿½Â©â£ââ⢥âââ´â¬âââ¼ï¿½ï¿½âââ©â¦â ââ¬Â¤ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ââââ¦�â������µ�������¯´Â±â¾¶§÷¸°¨·¹³²â  " + }, + "ibm856": "cp856", + "csibm856": "cp856", + "cp857": { + "type": "_sbcs", + "chars": "Ãüéâäà åçêëèïîıÃà ÃæÃôöòûùİÃÃø£ÃÅÅáÃóúñÃÄÄ¿®¬½¼¡«»âââââ¤ÃÃéâ£ââ⢥âââ´â¬âââ¼Ã£Ãâââ©â¦â ââ¬Â¤ÂºÂªÃÃÃ�ÃÃÃââââ¦ÃâÃÃÃÃõõ�ÃÃÃÃìÿ¯´Â±�¾¶§÷¸°¨·¹³²â  " + }, + "ibm857": "cp857", + "csibm857": "cp857", + "cp858": { + "type": "_sbcs", + "chars": "Ãüéâäà åçêëèïîìÃà ÃæÃôöòûùÿÃÃø£ÃÃÆáÃóúñ꺿®¬½¼¡«»âââââ¤ÃÃéâ£ââ⢥âââ´â¬âââ¼Ã£Ãâââ©â¦â ââ¬Â¤Ã°ÃÃÃÃâ¬ÃÃÃââââ¦ÃâÃÃÃÃõõþÃÃÃÃýï´Â±â¾¶§÷¸°¨·¹³²â  " + }, + "ibm858": "cp858", + "csibm858": "cp858", + "cp860": { + "type": "_sbcs", + "chars": "Ãüéâãà ÃçêÃèÃÃìÃÃÃÃÃôõòÃùÃÃâ£Ãâ§ÃáÃóúñ꺿ì½¼¡«»âââââ¤â¡â¢âââ£ââââââââ´â¬âââ¼âââââ©â¦â ââ¬â§â¨â¤â¥âââââ«âªâââââââαÃÎÏΣϵÏΦÎΩδâÏεâ©â¡Â±â¥â¤â â¡Ã·â°â·ââ¿Â²â  " + }, + "ibm860": "cp860", + "csibm860": "cp860", + "cp861": { + "type": "_sbcs", + "chars": "Ãüéâäà åçêëèÃðÃÃà ÃæÃôöþûÃýÃÃø£Ãâ§ÆáÃóúÃÃÃÿ⬽¼¡«»âââââ¤â¡â¢âââ£ââââââââ´â¬âââ¼âââââ©â¦â ââ¬â§â¨â¤â¥âââââ«âªâââââââαÃÎÏΣϵÏΦÎΩδâÏεâ©â¡Â±â¥â¤â â¡Ã·â°â·ââ¿Â²â  " + }, + "ibm861": "cp861", + "csibm861": "cp861", + "cp862": { + "type": "_sbcs", + "chars": "××××××××××××××××× ×¡×¢×£×¤×¥×¦×§×¨×©×ªÂ¢Â£Â¥â§ÆáÃóúñ꺿⬽¼¡«»âââââ¤â¡â¢âââ£ââââââââ´â¬âââ¼âââââ©â¦â ââ¬â§â¨â¤â¥âââââ«âªâââââââαÃÎÏΣϵÏΦÎΩδâÏεâ©â¡Â±â¥â¤â â¡Ã·â°â·ââ¿Â²â  " + }, + "ibm862": "cp862", + "csibm862": "cp862", + "cp863": { + "type": "_sbcs", + "chars": "ÃüéâÃà ¶çêëèïîâçÃÃÃôÃÃûù¤Ãâ£ÃÃƦ´óú¨¸³¯Ã⬽¼¾«»âââââ¤â¡â¢âââ£ââââââââ´â¬âââ¼âââââ©â¦â ââ¬â§â¨â¤â¥âââââ«âªâââââââαÃÎÏΣϵÏΦÎΩδâÏεâ©â¡Â±â¥â¤â â¡Ã·â°â·ââ¿Â²â  " + }, + "ibm863": "cp863", + "csibm863": "cp863", + "cp864": { + "type": "_sbcs", + "chars": "\u0000\u0001\u0002\u0003\u0004\u0005\u0006\u0007\b\t\n\u000b\f\r\u000e\u000f\u0010\u0011\u0012\u0013\u0014\u0015\u0016\u0017\u0018\u0019\u001a\u001b\u001c\u001d\u001e\u001f !\"#$Ùª&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\\]^_`abcdefghijklmnopqrstuvwxyz{|}~°·ââââââ¼â¤â¬ââ´ââââβâϱ½¼â«»ﻷﻸ��ﻻﻼ� ÂïºÂ£Â¤ïºï¿½ï¿½ïºïºïºïºØïºïº¡ïº¥Ù ١٢٣٤٥٦٧٨٩ï»ØﺱﺵﺹØ¢ïºïºïºïº ï»ïºïºïºïºïºïºïºïº£ïº§ïº©ïº«ïºïº¯ïº³ïº·ïº»ïº¿ï»ï» ï»ï»Â¦Â¬Ã·Ãï»Ùï»ï»ï»ï»ï»£ï»§ï»«ï»ï»¯ï»³ïº½ï»ï»ï»ï»¡ï¹½Ùﻥﻩﻬﻰﻲï»ï»ï»µï»¶ï»ï»ï»±â �" + }, + "ibm864": "cp864", + "csibm864": "cp864", + "cp865": { + "type": "_sbcs", + "chars": "Ãüéâäà åçêëèïîìÃà ÃæÃôöòûùÿÃÃø£Ãâ§ÆáÃóúñ꺿⬽¼¡«¤âââââ¤â¡â¢âââ£ââââââââ´â¬âââ¼âââââ©â¦â ââ¬â§â¨â¤â¥âââââ«âªâââââââαÃÎÏΣϵÏΦÎΩδâÏεâ©â¡Â±â¥â¤â â¡Ã·â°â·ââ¿Â²â  " + }, + "ibm865": "cp865", + "csibm865": "cp865", + "cp866": { + "type": "_sbcs", + "chars": "ÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐРСТУФХЦЧШЩЪЫЬÐЮЯабвгдежзийклмнопâââââ¤â¡â¢âââ£ââââââââ´â¬âââ¼âââââ©â¦â ââ¬â§â¨â¤â¥âââââ«âªâââââââÑÑÑÑÑÑ ÑÑÑÑÑÑÑÑÑÑÐÑÐÑÐÑÐÑ°â·ââ¤â  " + }, + "ibm866": "cp866", + "csibm866": "cp866", + "cp869": { + "type": "_sbcs", + "chars": "������Î�·¬¦ââÎâÎÎΪÎ��ÎΫ©Î²³ά£ÎήίÏÎÏÏÎÎÎÎÎÎνÎΫ»âââââ¤ÎÎÎÎâ£âââÎÎâââ´â¬âââ¼Î Ρâââ©â¦â ââ¬Î£Î¤Î¥Î¦Î§Î¨Î©Î±Î²Î³ââââδεâζηθικλμνξοÏÏÏÏÏÎÂÂ±Ï ÏϧÏΠ°¨ÏÏΰÏâ  " + }, + "ibm869": "cp869", + "csibm869": "cp869", + "cp922": { + "type": "_sbcs", + "chars": " Â ¡¢£¤¥¦§¨©ª«¬Â®â¾Â°Â±Â²Â³Â´ÂµÂ¶Â·Â¸Â¹ÂºÂ»Â¼Â½Â¾Â¿ÃÃÃÃÃà ÃÃÃÃÃÃÃÃÃÃÅ ÃÃÃÃÃÃÃÃÃÃÃÃÃŽÃà áâãäåæçèéêëìÃîïšñòóôõö÷øùúûüýžÿ" + }, + "ibm922": "cp922", + "csibm922": "cp922", + "cp1046": { + "type": "_sbcs", + "chars": "ïºÃ÷ﹱÂâ ââââââﹹﹻﹽﹿﹷïºï»°ï»³ï»²ï»ï»ï»ï»¶ï»¸ï»ºï»¼Â ¤ïºïºïºïºïºïº£ØÂﺧﺳ٠١٢٣٤٥٦٧٨٩ﺷØﺻﺿï»Øï»Ø¡Ø¢Ø£Ø¤Ø¥Ø¦Ø§Ø¨Ø©ØªØ«Ø¬Øخدذرزسشصضطï»Ø¹Øºï»ïºïºïºï»ÙÙÙÙÙÙ ÙÙÙÙÙÙÙÙÙÙÙÙÙï»ï»ï»ï£¼ï»µï»·ï»¹ï»»ï»£ï»§ï»¬ï»©ï¿½" + }, + "ibm1046": "cp1046", + "csibm1046": "cp1046", + "cp1124": { + "type": "_sbcs", + "chars": " Â ÐÐÒÐÐ ÐÐÐÐÐÐÐÂÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐРСТУФХЦЧШЩЪЫЬÐЮЯабвгдежзийклмнопÑÑÑÑÑÑ ÑÑÑÑÑÑÑÑÑÑâÑÑÒÑÑÑÑÑÑÑÑѧÑÑ" + }, + "ibm1124": "cp1124", + "csibm1124": "cp1124", + "cp1125": { + "type": "_sbcs", + "chars": "ÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐРСТУФХЦЧШЩЪЫЬÐЮЯабвгдежзийклмнопâââââ¤â¡â¢âââ£ââââââââ´â¬âââ¼âââââ©â¦â ââ¬â§â¨â¤â¥âââââ«âªâââââââÑÑÑÑÑÑ ÑÑÑÑÑÑÑÑÑÑÐÑÒÒÐÑÐÑÐÑ·ââ¤â  " + }, + "ibm1125": "cp1125", + "csibm1125": "cp1125", + "cp1129": { + "type": "_sbcs", + "chars": " Â ¡¢£¤¥¦§Å©ª«¬Â®¯°±²³Ÿµ¶·Å¹º»¼½¾¿ÃÃÃÄÃà ÃÃÃÃÃÃÌÃÃÃÄÃÌÃÃÆ ÃÃÃÃÃÃÃƯÌÃà áâÄäåæçèéêëÌÃîïÄṇ̃óôơö÷øùúûüưâ«Ã¿" + }, + "ibm1129": "cp1129", + "csibm1129": "cp1129", + "cp1133": { + "type": "_sbcs", + "chars": " Â àºàºàºàºàºàºªàºàºàºàºàºàºàºàºàºàºàºàºàºàº¡àº¢àº£àº¥àº§àº«àºàº®ï¿½ï¿½ï¿½àº¯àº°àº²àº³àº´àºµàº¶àº·àº¸àº¹àº¼àº±àº»àº½ï¿½ï¿½ï¿½à»à»à»à»à»à»à»à»à»à»à»à»ï¿½à»à»â����������������à»à»à»à»à»à»à»à»à»à»ï¿½ï¿½Â¢Â¬Â¦ï¿½" + }, + "ibm1133": "cp1133", + "csibm1133": "cp1133", + "cp1161": { + "type": "_sbcs", + "chars": "��������������������������������à¹à¸à¸à¸à¸à¸ à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸ มยรฤลฦวศษสหฬà¸à¸®à¸¯à¸°à¸±à¸²à¸³à¸´à¸µà¸¶à¸·à¸¸à¸¹à¸ºà¹à¹à¹â¬à¸¿à¹à¹à¹à¹à¹à¹ à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹Â¢Â¬Â¦Â " + }, + "ibm1161": "cp1161", + "csibm1161": "cp1161", + "cp1162": { + "type": "_sbcs", + "chars": "â¬ÂÂÂÂâ¦ÂÂÂÂÂÂÂÂÂÂÂâââââ¢ââ à¸à¸à¸à¸à¸ à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸ มยรฤลฦวศษสหฬà¸à¸®à¸¯à¸°à¸±à¸²à¸³à¸´à¸µà¸¶à¸·à¸¸à¸¹à¸ºï¿½ï¿½ï¿½ï¿½à¸¿à¹à¹à¹à¹à¹à¹ à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹ï¿½ï¿½ï¿½ï¿½" + }, + "ibm1162": "cp1162", + "csibm1162": "cp1162", + "cp1163": { + "type": "_sbcs", + "chars": " Â ¡¢£â¬Â¥Â¦Â§Å©ª«¬Â®¯°±²³Ÿµ¶·Å¹º»¼½¾¿ÃÃÃÄÃà ÃÃÃÃÃÃÌÃÃÃÄÃÌÃÃÆ ÃÃÃÃÃÃÃƯÌÃà áâÄäåæçèéêëÌÃîïÄṇ̃óôơö÷øùúûüưâ«Ã¿" + }, + "ibm1163": "cp1163", + "csibm1163": "cp1163", + "maccroatian": { + "type": "_sbcs", + "chars": "Ãà ÃÃÃÃÃáà âäãåçéèêëÃìîïñóòôöõúùûüâ °¢£§â¢Â¶Ã®Šâ¢Â´Â¨â ŽÃâ±â¤â¥âµâââÅ¡â«ÂªÂºâ¦Å¾Ã¸Â¿Â¡Â¬âÆâÄ«Äâ¦Â ÃÃÃÅÅÄâââââ÷â�©â¤â¹âºÃ»â·âââ°ÃÄÃÄÃÃÃÃÃÃÃÄÃÃÃÃıË˯ÏÃ˸ÃæË" + }, + "maccyrillic": { + "type": "_sbcs", + "chars": "ÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐРСТУФХЦЧШЩЪЫЬÐЮЯâ °¢£§â¢Â¶Ð®©â¢ÐÑâ ÐÑâ±â¤â¥ÑµâÐÐÑÐÑÐÑÐÑÑР¬âÆââ«»â¦Â ÐÑÐÑÑââââââ÷âÐÑÐÑâÐÑÑабвгдежзийклмнопÑÑÑÑÑÑ ÑÑÑÑÑÑÑÑѤ" + }, + "macgreek": { + "type": "_sbcs", + "chars": "ù²Ã³ÃÃΠà âäΨçéèêë£â¢Ã®Ã¯â¢Â½â°Ã´Ã¶Â¦Âùûüâ ÎÎÎÎÎΠî©ΣΪ§â °Îαâ¤â¥Â¥ÎÎÎÎÎÎÎΦΫΨΩάάÎΡâΤ«»â¦Â ΥΧÎÎÅââââââ÷ÎÎÎÎÎήίÏÎÏαβÏδεÏγηιξκλμνοÏÏÏÏÏθÏÏÏÏ Î¶ÏÏÎΰ�" + }, + "maciceland": { + "type": "_sbcs", + "chars": "Ãà ÃÃÃÃÃáà âäãåçéèêëÃìîïñóòôöõúùûü𢣧â¢Â¶Ã®©â¢Â´Â¨â ÃÃâ±â¤â¥Â¥ÂµâââÏâ«ÂªÂºâ¦Ã¦Ã¸Â¿Â¡Â¬âÆââ«»â¦Â ÃÃÃÅÅââââââ÷âÿŸâ¤ÃðÃþý·âââ°ÃÃÃÃÃÃÃÃÃÃÃ�ÃÃÃÃıË˯ËË˸ËËË" + }, + "macroman": { + "type": "_sbcs", + "chars": "Ãà ÃÃÃÃÃáà âäãåçéèêëÃìîïñóòôöõúùûüâ °¢£§â¢Â¶Ã®©â¢Â´Â¨â ÃÃâ±â¤â¥Â¥ÂµâââÏâ«ÂªÂºâ¦Ã¦Ã¸Â¿Â¡Â¬âÆââ«»â¦Â ÃÃÃÅÅââââââ÷âÿŸâ¤â¹âºï¬ï¬â¡Â·âââ°ÃÃÃÃÃÃÃÃÃÃÃ�ÃÃÃÃıË˯ËË˸ËËË" + }, + "macromania": { + "type": "_sbcs", + "chars": "Ãà ÃÃÃÃÃáà âäãåçéèêëÃìîïñóòôöõúùûüâ °¢£§â¢Â¶Ã®©â¢Â´Â¨â ÄÅâ±â¤â¥Â¥ÂµâââÏâ«ÂªÂºâ¦ÄÅ¿¡¬âÆââ«»â¦Â ÃÃÃÅÅââââââ÷âÿŸâ¤â¹âºÅ¢Å£â¡Â·âââ°ÃÃÃÃÃÃÃÃÃÃÃ�ÃÃÃÃıË˯ËË˸ËËË" + }, + "macthai": { + "type": "_sbcs", + "chars": "«»â¦ï¢ï¢ï¢ï¢ï¢ï¢ï¢ï¢ï¢ï¢ââï¢ï¿½â¢ï¢ï¢ï¢ ï¢ï¢ï¢ï¢ï¢ï¢ï¢ï¢ââ� à¸à¸à¸à¸à¸ à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸ มยรฤลฦวศษสหฬà¸à¸®à¸¯à¸°à¸±à¸²à¸³à¸´à¸µà¸¶à¸·à¸¸à¸¹à¸ºï»¿âââ฿à¹à¹à¹à¹à¹à¹ à¹à¹à¹à¹à¹à¹à¹à¹â¢à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹Â®Â©ï¿½ï¿½ï¿½ï¿½" + }, + "macturkish": { + "type": "_sbcs", + "chars": "Ãà ÃÃÃÃÃáà âäãåçéèêëÃìîïñóòôöõúùûüâ °¢£§â¢Â¶Ã®©â¢Â´Â¨â ÃÃâ±â¤â¥Â¥ÂµâââÏâ«ÂªÂºâ¦Ã¦Ã¸Â¿Â¡Â¬âÆââ«»â¦Â ÃÃÃÅÅââââââ÷âÿŸÄÄİıÅÅâ¡Â·âââ°ÃÃÃÃÃÃÃÃÃÃÃ�ÃÃÃÃ�Ë˯ËË˸ËËË" + }, + "macukraine": { + "type": "_sbcs", + "chars": "ÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐРСТУФХЦЧШЩЪЫЬÐЮЯâ °Ò£§â¢Â¶Ð®©â¢ÐÑâ ÐÑâ±â¤â¥ÑµÒÐÐÑÐÑÐÑÐÑÑР¬âÆââ«»â¦Â ÐÑÐÑÑââââââ÷âÐÑÐÑâÐÑÑабвгдежзийклмнопÑÑÑÑÑÑ ÑÑÑÑÑÑÑÑѤ" + }, + "koi8r": { + "type": "_sbcs", + "chars": "ââââââââ¤â¬â´â¼âââââââââ â ââââ¤â¥Â â¡Â°Â²Â·Ã·âââÑââââââââââââââ â¡Ðâ¢â£â¤â¥â¦â§â¨â©âªâ«â¬Â©ÑабÑдеÑÐ³Ñ Ð¸Ð¹ÐºÐ»Ð¼Ð½Ð¾Ð¿ÑÑÑÑÑжвÑÑзÑÑÑÑÑЮÐÐЦÐÐФÐÐ¥ÐÐÐÐÐÐÐÐЯРСТУÐÐЬЫÐШÐЩЧЪ" + }, + "koi8u": { + "type": "_sbcs", + "chars": "ââââââââ¤â¬â´â¼âââââââââ â ââââ¤â¥Â â¡Â°Â²Â·Ã·âââÑÑâÑÑâââââÒââââ â¡ÐÐâ£ÐÐâ¦â§â¨â©âªÒâ¬Â©ÑабÑдеÑÐ³Ñ Ð¸Ð¹ÐºÐ»Ð¼Ð½Ð¾Ð¿ÑÑÑÑÑжвÑÑзÑÑÑÑÑЮÐÐЦÐÐФÐÐ¥ÐÐÐÐÐÐÐÐЯРСТУÐÐЬЫÐШÐЩЧЪ" + }, + "koi8ru": { + "type": "_sbcs", + "chars": "ââââââââ¤â¬â´â¼âââââââââ â ââââ¤â¥Â â¡Â°Â²Â·Ã·âââÑÑâÑÑâââââÒÑâââ â¡ÐÐâ£ÐÐâ¦â§â¨â©âªÒЩÑабÑдеÑÐ³Ñ Ð¸Ð¹ÐºÐ»Ð¼Ð½Ð¾Ð¿ÑÑÑÑÑжвÑÑзÑÑÑÑÑЮÐÐЦÐÐФÐÐ¥ÐÐÐÐÐÐÐÐЯРСТУÐÐЬЫÐШÐЩЧЪ" + }, + "koi8t": { + "type": "_sbcs", + "chars": "ÒÒâÒââ¦â â¡ï¿½â°Ò³â¹Ò²Ò·Ò¶ï¿½Òâââââ¢ââ�â¢ï¿½âºï¿½ï¿½ï¿½ï¿½ï¿½Ó¯Ó®Ñ¤ӣ¦§���«¬Â®�°±²Ð�Ӣ¶·�â�»���©ÑабÑдеÑÐ³Ñ Ð¸Ð¹ÐºÐ»Ð¼Ð½Ð¾Ð¿ÑÑÑÑÑжвÑÑзÑÑÑÑÑЮÐÐЦÐÐФÐÐ¥ÐÐÐÐÐÐÐÐЯРСТУÐÐЬЫÐШÐЩЧЪ" + }, + "armscii8": { + "type": "_sbcs", + "chars": " Â �ÖÖ)(»«â.Õ,-Öâ¦ÕÕÕÔ±Õ¡Ô²Õ¢Ô³Õ£Ô´Õ¤ÔµÕ¥Ô¶Õ¦Ô·Õ§Ô¸Õ¨Ô¹Õ©ÔºÕªÔ»Õ«Ô¼Õ¬Ô½ÕÔ¾Õ®Ô¿Õ¯ÕÕ°ÕÕ±ÕÕ²ÕÕ³ÕÕ´Õ ÕµÕÕ¶ÕÕ·ÕÕ¸ÕÕ¹ÕÕºÕÕ»ÕÕ¼ÕÕ½ÕÕ¾ÕÕ¿ÕÖÕÖÕÖÕÖÕÖÕÖ ÕÖÕ�" + }, + "rk1048": { + "type": "_sbcs", + "chars": "ÐÐâÑââ¦â â¡â¬â°Ðâ¹ÐÒÒºÐÑâââââ¢ââ�â¢ÑâºÑÒһѠҰұÓ¤Ө¦§Ð©Ò«¬Â®Ү°±ÐÑөµ¶·ÑâÒ»ÓÒ¢Ò£Ò¯ÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐРСТУФХЦЧШЩЪЫЬÐЮЯабвгдежзийклмнопÑÑÑÑÑÑ ÑÑÑÑÑÑÑÑÑÑ" + }, + "tcvn": { + "type": "_sbcs", + "chars": "\u0000ÃỤ\u0003ỪỬỮ\u0007\b\t\n\u000b\f\r\u000e\u000f\u0010ỨỰỲỶỸÃá»´\u0018\u0019\u001a\u001b\u001c\u001d\u001e\u001f !\"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\\]^_`abcdefghijklmnopqrstuvwxyz{|}~ÃẢÃÃẠẶẬÃẺẼÃẸá»Ãá»Ä¨Ãá»Ãá»ÃÃá»á»á»á»á» á»á»¢ÃỦŨ ÄÃÃÃÆ Æ¯ÄÄâêôơưÄẰÌÌÌỊ̀à ảãáạẲằẳẵắẴẮẦẨẪẤá»áº·áº§áº©áº«áº¥áºÃ¨á»áº»áº½Ã©áº¹á»á»á» ếá»Ã¬á»á»áº¾á»Ä©Ãá»Ã²á»á»ÃµÃ³á»á»á»á»á»á»á»á»á»¡á»á»£Ã¹á»á»§Å©Ãºá»¥á»«á»á»¯á»©á»±á»³á»·á»¹Ã½á»µá»" + }, + "georgianacademy": { + "type": "_sbcs", + "chars": "ÂÂâÆââ¦â â¡Ëâ°Å â¹ÅÂÂÂÂâââââ¢ââËâ¢Å¡âºÅŸ ¡¢£¤¥¦§¨©ª«¬Â®¯°±²³´µ¶·¸¹º»¼½¾¿ááááááááááááááááá á¡á¢á£á¤á¥á¦á§á¨á©áªá«á¬áá®á¯á°á±á²á³á´áµá¶Ã§Ã¨Ã©ÃªÃ«Ã¬Ãîïðñòóôõö÷øùúûüýþÿ" + }, + "georgianps": { + "type": "_sbcs", + "chars": "ÂÂâÆââ¦â â¡Ëâ°Å â¹ÅÂÂÂÂâââââ¢ââËâ¢Å¡âºÅŸ ¡¢£¤¥¦§¨©ª«¬Â®¯°±²³´µ¶·¸¹º»¼½¾¿áááááááá±ááááááá²áááá á¡á¢á³á£á¤á¥á¦á§á¨á©áªá«á¬áá®á´á¯á°áµÃ¦Ã§Ã¨Ã©ÃªÃ«Ã¬Ãîïðñòóôõö÷øùúûüýþÿ" + }, + "pt154": { + "type": "_sbcs", + "chars": "ÒÒÓ®Òââ¦Ò¶Ò®Ò²Ò¯Ò Ó¢Ò¢ÒÒºÒ¸Òâââââ¢ââÒ³Ò·Ò¡Ó£Ò£Òһҹ ÐÑÐÓ¨ÒҰ§Ð©Ó«¬ӯ®Ò°ұÐÑÒө¶·ÑâÓ»ÑÒªÒ«ÒÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐРСТУФХЦЧШЩЪЫЬÐЮЯабвгдежзийклмнопÑÑÑÑÑÑ ÑÑÑÑÑÑÑÑÑÑ" + }, + "viscii": { + "type": "_sbcs", + "chars": "\u0000\u0001Ẳ\u0003\u0004ẴẪ\u0007\b\t\n\u000b\f\r\u000e\u000f\u0010\u0011\u0012\u0013Ỷ\u0015\u0016\u0017\u0018Ỹ\u001a\u001b\u001c\u001dá»´\u001f !\"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\\]^_`abcdefghijklmnopqrstuvwxyz{|}~ẠẮẰẶẤẦẨẬẼẸẾá»á»á»á»á»á»á»á»á»á»¢á»á»á»á»á»á»á»á»¦Å¨á»¤á»²Ãắằặấầẩáºáº½áº¹áº¿á»á»á» á»á»á»á»á»á» Æ á»á»á»á»á»°á»¨á»ªá»¬Æ¡á»Æ¯ÃÃÃÃẢÄẳẵÃÃÃẺÃÃĨỳÄứÃÃÃạỷừá»ÃÃỹỵÃỡưà áâãảÄữẫèéêẻìÃÄ©á»Äựòóôõá»á»á»¥Ã¹ÃºÅ©á»§Ã½á»£á»®" + }, + "iso646cn": { + "type": "_sbcs", + "chars": "\u0000\u0001\u0002\u0003\u0004\u0005\u0006\u0007\b\t\n\u000b\f\r\u000e\u000f\u0010\u0011\u0012\u0013\u0014\u0015\u0016\u0017\u0018\u0019\u001a\u001b\u001c\u001d\u001e\u001f !\"#Â¥%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\\]^_`abcdefghijklmnopqrstuvwxyz{|}â¾ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½" + }, + "iso646jp": { + "type": "_sbcs", + "chars": "\u0000\u0001\u0002\u0003\u0004\u0005\u0006\u0007\b\t\n\u000b\f\r\u000e\u000f\u0010\u0011\u0012\u0013\u0014\u0015\u0016\u0017\u0018\u0019\u001a\u001b\u001c\u001d\u001e\u001f !\"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[Â¥]^_`abcdefghijklmnopqrstuvwxyz{|}â¾ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½ï¿½" + }, + "hproman8": { + "type": "_sbcs", + "chars": " Â ÃÃÃÃÃÃôË˨ËÃÃâ¤Â¯Ãý°ÃçÃñ¡¿¤£¥§Æ¢âêôûáéóúà èòùäëöüà îÃÃÃ¥ÃøæÃìÃÃÃïÃÃÃÃãÃðÃÃÃÃÃõŠšÃŸÿÃþ·µ¶¾â¼½ªº«â »±�" + }, + "macintosh": { + "type": "_sbcs", + "chars": "Ãà ÃÃÃÃÃáà âäãåçéèêëÃìîïñóòôöõúùûüâ °¢£§â¢Â¶Ã®©â¢Â´Â¨â ÃÃâ±â¤â¥Â¥ÂµâââÏâ«ÂªÂºâ¦Ã¦Ã¸Â¿Â¡Â¬âÆââ«»â¦Â ÃÃÃÅÅââââââ÷âÿŸâ¤â¹âºï¬ï¬â¡Â·âââ°ÃÃÃÃÃÃÃÃÃÃÃ�ÃÃÃÃıË˯ËË˸ËËË" + }, + "ascii": { + "type": "_sbcs", + "chars": "��������������������������������������������������������������������������������������������������������������������������������" + }, + "tis620": { + "type": "_sbcs", + "chars": "���������������������������������à¸à¸à¸à¸à¸ à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸à¸ มยรฤลฦวศษสหฬà¸à¸®à¸¯à¸°à¸±à¸²à¸³à¸´à¸µà¸¶à¸·à¸¸à¸¹à¸ºï¿½ï¿½ï¿½ï¿½à¸¿à¹à¹à¹à¹à¹à¹ à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹à¹ï¿½ï¿½ï¿½ï¿½" + } +} \ No newline at end of file diff --git a/node_modules/iconv-lite/encodings/sbcs-data.js b/node_modules/iconv-lite/encodings/sbcs-data.js new file mode 100644 index 0000000..fdb81a3 --- /dev/null +++ b/node_modules/iconv-lite/encodings/sbcs-data.js @@ -0,0 +1,174 @@ +"use strict"; + +// Manually added data to be used by sbcs codec in addition to generated one. + +module.exports = { + // Not supported by iconv, not sure why. + "10029": "maccenteuro", + "maccenteuro": { + "type": "_sbcs", + "chars": "ÃÄÄÃÄÃÃÃ¡Ä ÄäÄÄÄ鏟ÄÃÄÄÄÄóÄôöõúÄÄüâ °Ä£§â¢Â¶Ã®©â¢Ä¨â ģĮįĪâ¤â¥Ä«Ä¶ââÅĻļĽľĹĺŠÅŬâÅÅâ«»â¦Â ÅÅÃÅÅââââââ÷âÅÅÅÅâ¹âºÅÅÅÅ ââÅ¡ÅÅÃŤťÃŽžŪÃÃÅ«Å®ÃůŰűŲųÃýķŻÅżĢË" + }, + + "808": "cp808", + "ibm808": "cp808", + "cp808": { + "type": "_sbcs", + "chars": "ÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐРСТУФХЦЧШЩЪЫЬÐЮЯабвгдежзийклмнопâââââ¤â¡â¢âââ£ââââââââ´â¬âââ¼âââââ©â¦â ââ¬â§â¨â¤â¥âââââ«âªâââââââÑÑÑÑÑÑ ÑÑÑÑÑÑÑÑÑÑÐÑÐÑÐÑÐÑ°â·âââ¬â  " + }, + + "mik": { + "type": "_sbcs", + "chars": "ÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐÐРСТУФХЦЧШЩЪЫЬÐЮЯабвгдежзийклмнопÑÑÑÑÑÑ ÑÑÑÑÑÑÑÑÑÑââ´â¬âââ¼â£ââââ©â¦â ââ¬ââââââ¤â§âââââââââαÃÎÏΣϵÏΦÎΩδâÏεâ©â¡Â±â¥â¤â â¡Ã·â°â·ââ¿Â²â  " + }, + + // Aliases of generated encodings. + "ascii8bit": "ascii", + "usascii": "ascii", + "ansix34": "ascii", + "ansix341968": "ascii", + "ansix341986": "ascii", + "csascii": "ascii", + "cp367": "ascii", + "ibm367": "ascii", + "isoir6": "ascii", + "iso646us": "ascii", + "iso646irv": "ascii", + "us": "ascii", + + "latin1": "iso88591", + "latin2": "iso88592", + "latin3": "iso88593", + "latin4": "iso88594", + "latin5": "iso88599", + "latin6": "iso885910", + "latin7": "iso885913", + "latin8": "iso885914", + "latin9": "iso885915", + "latin10": "iso885916", + + "csisolatin1": "iso88591", + "csisolatin2": "iso88592", + "csisolatin3": "iso88593", + "csisolatin4": "iso88594", + "csisolatincyrillic": "iso88595", + "csisolatinarabic": "iso88596", + "csisolatingreek" : "iso88597", + "csisolatinhebrew": "iso88598", + "csisolatin5": "iso88599", + "csisolatin6": "iso885910", + + "l1": "iso88591", + "l2": "iso88592", + "l3": "iso88593", + "l4": "iso88594", + "l5": "iso88599", + "l6": "iso885910", + "l7": "iso885913", + "l8": "iso885914", + "l9": "iso885915", + "l10": "iso885916", + + "isoir14": "iso646jp", + "isoir57": "iso646cn", + "isoir100": "iso88591", + "isoir101": "iso88592", + "isoir109": "iso88593", + "isoir110": "iso88594", + "isoir144": "iso88595", + "isoir127": "iso88596", + "isoir126": "iso88597", + "isoir138": "iso88598", + "isoir148": "iso88599", + "isoir157": "iso885910", + "isoir166": "tis620", + "isoir179": "iso885913", + "isoir199": "iso885914", + "isoir203": "iso885915", + "isoir226": "iso885916", + + "cp819": "iso88591", + "ibm819": "iso88591", + + "cyrillic": "iso88595", + + "arabic": "iso88596", + "arabic8": "iso88596", + "ecma114": "iso88596", + "asmo708": "iso88596", + + "greek" : "iso88597", + "greek8" : "iso88597", + "ecma118" : "iso88597", + "elot928" : "iso88597", + + "hebrew": "iso88598", + "hebrew8": "iso88598", + + "turkish": "iso88599", + "turkish8": "iso88599", + + "thai": "iso885911", + "thai8": "iso885911", + + "celtic": "iso885914", + "celtic8": "iso885914", + "isoceltic": "iso885914", + + "tis6200": "tis620", + "tis62025291": "tis620", + "tis62025330": "tis620", + + "10000": "macroman", + "10006": "macgreek", + "10007": "maccyrillic", + "10079": "maciceland", + "10081": "macturkish", + + "cspc8codepage437": "cp437", + "cspc775baltic": "cp775", + "cspc850multilingual": "cp850", + "cspcp852": "cp852", + "cspc862latinhebrew": "cp862", + "cpgr": "cp869", + + "msee": "cp1250", + "mscyrl": "cp1251", + "msansi": "cp1252", + "msgreek": "cp1253", + "msturk": "cp1254", + "mshebr": "cp1255", + "msarab": "cp1256", + "winbaltrim": "cp1257", + + "cp20866": "koi8r", + "20866": "koi8r", + "ibm878": "koi8r", + "cskoi8r": "koi8r", + + "cp21866": "koi8u", + "21866": "koi8u", + "ibm1168": "koi8u", + + "strk10482002": "rk1048", + + "tcvn5712": "tcvn", + "tcvn57121": "tcvn", + + "gb198880": "iso646cn", + "cn": "iso646cn", + + "csiso14jisc6220ro": "iso646jp", + "jisc62201969ro": "iso646jp", + "jp": "iso646jp", + + "cshproman8": "hproman8", + "r8": "hproman8", + "roman8": "hproman8", + "xroman8": "hproman8", + "ibm1051": "hproman8", + + "mac": "macintosh", + "csmacintosh": "macintosh", +}; + diff --git a/node_modules/iconv-lite/encodings/tables/big5-added.json b/node_modules/iconv-lite/encodings/tables/big5-added.json new file mode 100644 index 0000000..3c3d3c2 --- /dev/null +++ b/node_modules/iconv-lite/encodings/tables/big5-added.json @@ -0,0 +1,122 @@ +[ +["8740","ä°ä°²ää¦ä¸ð§§äµ·ä³ð§²±ä³¢ð§³ ã®ä¶ää±ä±ð¤¿ð£ð§ð¦ºð§ä±ðªäää² ð§±¬ä´äª¤ä¡ð¦¬£ç¥ð¥©ð¡©£ð£¸ð£½¡æå»"], +["8767","ç¶å¤ð¨®¹ã·´é´ð§¯¯å¯ð¡µåª¤ã¥ð©º°å«å®·å³¼æ®èð©¥ ç¡ç㡵ð¡µð£ð¦¡ã»¬"], +["87a1","ð¥£ã«µç«¼é¾ð¤ ¡ð¨¤ð£ªð ªð£äèé¾é¯ä¤°èå¢ééç§ç¨²æ 権è¢çç¯ æ稬åéã¦ç𥶹çé¿å³ä¤¯åä±ð£å 穲ð§¥è®ä®ð¦ºäð¥¶ç®®ð¢¼é¿ð¢ð¢ð¢é¿èð£»ä´é¿ä¡ðª·¿æç®é¿"], +["8840","ã",4,"ð ã ð ð ããð 𡿨ãð ããããð ããÄÃÇÃÄÃÄÃÅÃÇÃà¿¿ÃÌẾ࿿ÃÌá»ÃÄáÇà ÉÄéÄèīÃÇìÅóÇòūúÇùÇÇÇ"], +["88a1","Çü࿿êÌế࿿êÌá»ÃªÉ¡ââ"], +["8940","ðª©ð¡ "], +["8943","æ"], +["8946","丽æ»éµé"], +["894c","ð§µæä¼ä¼¨ä¾¨å å ´åå¤å¡å¨å»åååå¢å£°å¤å¤å¤²å¤´å¦å®å®å²åºæ»ææ¾æ æ¡¥æµç¼çµçº¤çº¬çººç»ç»ç»ç¼ç¼·èºèè¯è§è®¾è¯¢è½¦è½§è½®"], +["89a1","çç³¼ç·æ¥ç«å§"], +["89ab","é碸é è¼"], +["89b0","è´è¶ð §§"], +["89b5","èé»ä³é·é¸ä°¾ð©·¶ð§é¸ðª³ã"], +["89c1","æºè¾ç"], +["89c5","ä¤é©¬éªé¾ç¦ð¨¬ð¡·ð 𢫦两äºäºäºäº¿ä»«ä¼·ãä¾½ã¹ååã½ãã¥åå¤ åå¼å äºå¹åå§ãå©ãå°ãåå£ãã²ãåå£å´å¹åå¯åå£å¨ãå¿ã¥ã¿åã "], +["8a40","ð§¶å¥"], +["8a43","ð ±ð ´ð¥«åð¢³ã§¬ð è¹ð¤¶¸ð©¥äð¨¾çºð¢°¸ã¨´äð¨ 𦧲𤷪æ𠵼𠾴ð ³ð¡´æè¹¾ð ºð °ð ½¤ð¢²©ð¨ð¤"], +["8a64","ð µð©©ð¨©ä´ð¤º§ð¢³éª²ã©§ð©´ã¿ãð¥ð©ð§£ð¢µéµ®é "], +["8a76","äð¦¥æ´å£ð¢µð¢¯ð¡·ã§»ð¡¯"], +["8aa1","ð¦ð¦ð§¦ æªð¥ð ±è¹¨ð¢¡ð¨ð ±"], +["8aac","ä ð ©ã¿ºå¡³ð¢¶"], +["8ab2","ð¤ð ¼ð¦ð ½ð ¶å¹ä»äº"], +["8abb","䪴𢩦ð¡èªé£µð ¶æ¹ã§¾ð¢µè·å¡æ¼ã¹"], +["8ac9","ðªð ¸ð¢«ð¢³"], +["8ace","ð¡ð£§ã¦ã¨ð¨ã¸ð¥¹ð¢å𠼱𢲲ð© ã¼æ°½ð¤¸»"], +["8adf","ð§´ð¢ºð¢ðªð¨³ð ¹ºð °´ð¦ ç¾ð¡ð¢ 𢤹ã»ð¥£ð ºð ¾ð ºªã¾ð ¼°ð µð¡ ð ¹"], +["8af6","𠺫𠮩ð µð¡ð¡½ã¿¹ð¢æ²ð ¾"], +["8b40","ð£´ð§¹ð¢¯ð µ¾ð µ¿ð¢±ð¢±ã¨ð ºð¡ð ¼®ðª²ð¦ð¨³ð¨¶ð¨³éªåèå¹"], +["8b55","ð©»é°¦éª¶ð§ð¢·®ç è è¬å°ð¦²è´ãåð¨½é¶ð »ºð ¸ð ¹·ð »»ã𤷫ãð ³å¯ð¢µð¡ð ¸ð ¹¸ð¡¸ð¡ ð¨ð¡ð ¹¹ð¤¹ð¢¶¤å©ð¡ð¡ð¡µð¡¶åð ¸"], +["8ba1","ð§ð¨ð ¾µð ¹»ð¥ ¾ã𠾶ð¡ð¥ðª½ð¤§ð¡ ºð¤ ·ð¨¼å¢å¨ãð¥½ç®²å¨ä 䬬鼧䧧é°é®ð¥´ð£½å»ã²å丨å¤ð¡¯ð¯¡¸éð ä¹äº»ã¾å°£å½å¿ã£ºææµæºæ°µæ°ºç¬ç«ä¸¬ç𤣩ç½ç¤»ç³¹ç½ð¦ªã"], +["8bde","ð¦èèð¦ð¦¥å衤è§ð§¢²è® è´é é¸é¿é¨ð¨¸é¦é¡µé£é£é¥£ð© é±¼é¸é»æ¯ï¤ä¸·ð éæ·é¢"], +["8c40","å»æ·¾ð©±³é¾¦ã·è¢ð¤ ç·å³µä¬ ð¥ã𥴰æ¢ð¨¨²è¾§é¶çæçºð£ðªã²ð¡¦ä¬ç£¤çå®ð¨äæ©£ðªºä£è𠩯稪ð©¥ð¨«ªéçå¤ð¢¾é´ç𨧣龧ç亣俰å¼ä¸¯ä¼é¾¨å´ç¶å¢å£ð¡¶¶åºåºå¿ð¢æ"], +["8ca1","ð£¹æ¤æ©ð£±£æ³¿"], +["8ca7","çð¤ çã»ð¤¨å¬ç¹è®ð¥²¤ð¥çªç¯¬ç³ç¹¬è¸è龩è¢é¾ªèº¹é¾«è¿èé§ é¡é¾¬ð¨¶¹ð¡¿ä±ä¢å¨"], +["8cc9","顨æ«ä¶å½"], +["8cce","è𤥻è¿ð§ä²ð¦µ´åµ»ð¦¬ð¦¾¾é¾é¾®å®é¾¯æ§ç¹æ¹ç§ã¶äð£ð¢ää¶"], +["8ce6","å³ð£¬è«¹å±¸ã´ð£åµ¸é¾²ç äð¤¬ð¡¸£ä±·ã¥¸ãð ¤ð¦±è«ä¾´ð ¹å¦¿è ¬é¡ð©£ºå¼»"], +["8d40","ð ®"], +["8d42","ð¢ð¨¥ää»ð©¹ã¼é¾³ðªµä¸ãä·ð¦±ä ¼ð¨²ð§¿äã£ð¥ä¡ää¶ä±»äµ¶äªã¿ð¤¬ã¡ää½äå´¾åµåµã·¼ã 嶤嶹ã ã ¸å¹åº½å¼¥å¾ã¤ã¤ã¤¿ã¥ææ½å³¥ã¦æ·æ¹æ㦸æ¬ææ¥æ㧸å±"], +["8da1","ã¨æ¢æ»ææã©æå´å¡é¾ãªæ㪽æ¿æ㫲æ㬢æãæ¤æ ãæ¡æ¢ã²ã±ã»æ¤æ¥ç楤æ¦æ¦ 㮼æ§ã¯æ©¥æ©´æ©±æªã¯¬æªã¯²æª«æªµæ«æ«¶æ®æ¯æ¯ªæ±µæ²ªã³æ´æ´æ´¦æ¶ã³¯æ¶¤æ¶±æ¸æ¸æ¸©æºð¨§æº»æ»¢æ»é½¿æ»¨æ»©æ¼¤æ¼´ãµð£½æ¾æ¾¾ãµªãµµç·å²ã¶ç¬ã¶ççç¯ç¿çð ¥äã±ð »"], +["8e40","ð£»å¾ð¦»ç¾ð¥ ã榢𨯩å´ç©ð¥£¡ð©ç©¥ç©½ð¥¦¬çª»çª°ç«ç«çð¦äç«ç«ç«ªä¯å²ð¥°ç¬ç笩ð¥ð¥³¾ç®¢ç¯è𥮴𦱿ç¯è¡ç®ç®¸ð¥´ ã¶ð¥±¥è篺ç°ç°µð¥³ç±ç²ð¤¢ç²¦æ½ð¤¸ç³ç³ç³¦ç±´ç³³ç³µç³"], +["8ea1","繧äð¦¹çµð¦»çç¶ç¶«çµç¶³ç·ð¤ð¦©ç·¤ã´ç·µð¡¹ç·¥ð¨ç¸ð¦¡ð¦ ç¹®çºä«é¬ç¸§ç½ç½ç½ç¤¶ð¦é§¡ç¾ð¦ç¾£ð¡¡ð ¨äð£¦äð¨ºç¿ºð¦è èèè¨è¯ðªð¦³è»è¼è¡ð¢ä¦ð¦¦ð£·£ð¦¨æ¥è§ð¨©èè墰ð¢¶æ±¿ð¦ð¤¾¸æ§ð¡èð¡¡æ©ð¤©¥ð¤ªäºè©ð ¬ð¦©ð£µ¾ä¿¹ð¡½è¢è¢ð¦¬ð¤¦§ð£°ð¡³ð£·¸èªæ¤ð¯¦ä"], +["8f40","èèèð ¸ð¡´ã𣠽ð£è»è¢èð£ºð¦¶£ð¦¬ ð¦®ð£ã¶¿èå¬è ä𦶥è¬èèã¾ð¦»æ©èãð¦¹ð¢»¯è𥯤è±ã·ä¤æª§è𣲵ç¥è¨ð¦®ð¦¹·ð¦¹èèèä èè¤ð¥²äð¥³äè´å«²ð¦ºä§è³äæ¿è"], +["8fa1","ð¨¥ð¨»èð§èð¡ð§ð¯¦²äªè¨ãð¡¢¢å·ð§è¾è±ðª¸è®ð¢°§è±èè å¡è¬æ¡äè¡ è¡ð§ 𣶹ð§¤è¡è¢ä袴袵æè£ ç·ð§è¦è¦è¦¦è¦©è¦§è¦¼ð¨¨¥è§§ð§¤¤ð§ª½èªçé¾èªð§©ç«©ð§¬ºð£¾äð§¬¸ç ¼è¬è¬ð¥°ð¥¥è¬¿èè誩𤩺è®è®èª¯ð¡äè¡è²ð§µð§¶ð¯§ã¥ð§µè³ð§¶ð§¶½è´è´ð¡¤è³çè´ð¤³ã»èµ·"], +["9040","趩ð¨ð¡ð¤¦ã¼ð¨¼ð§ç«§èºèº¶è»éè¼è¼ð¨¥ð¨è¾¥éðªð ©è¾³ä¤ªð¨§ð¨½ð£¶»å»¸ð£¢è¿¹ðªð¨¼ð¨ð¢¥ã¦ð¦»é·ð¨¼ð§ª¾é¡ð¨¬ð¨é¨ð¨éð¨¦é®é½é §ã«°é©é粬𨤳ð¡ºéæ²éé¢ð¥¹é¹ð¨«ð£²ð¨¬ð¥"], +["90a1","ð ´±é¬é«ð¨«¡ð¨¯«çå«ð¨«¢ð¨«¥ä¥¥é𨯬𨰹𨯿é³é躼é é¦é¦é 濶ä¹ð¢ºð¨ð¡¼ð£¸®ä§æ°é»éä ¬é£ð¦»æé¶ç£µð¨« é½å䦡𦲸ð ´ð¦ð©¯ð©¥ð¤«ð¡¤ð£é±èé¶ä¨ä½ä 𤫩çµåééð©éåð©«éé¥åð£·ð£¼ééé±é¾ééé ð¥¬é®çð©³é¿éµð©ð§¥ºä«é ´é ³é¡é¡¦ã¬ð§ µãµð °ð¤ "], +["9140","ð¥é£é¢·é£é£ä«¿ð¦´§ð¡å°é£¡é£¦é£¬é¸é¤¹ð¤¨©ä²ð©¡ð©¤ 駵é¨é¨»é¨é©ð¥¥ãð©±ð©¯é« 髢𩬠髴ä°é¬é¬ð¨å´é¬´ð¦¦¨ã£ð£½ééð©´¾å© ð¡¡£é®ð¤é°é¯¿é°ð©¹¨é·ð©¾·ðªðª«ðª¡ðª£ðªéµ¾é¶ðª´é¸æ¢"], +["91a1","é·ð¢ ðªðª 𡤻ðª³é´¹ðª¹ðª´éºéºéºéº¢ä´´éºªéº¯ð¤¤é»ã 㧥ã´ä¼²ã¾ð¨°«é¼é¼ä®é¤ð¦¶¢é¼é¼é¼¹ååé½ é¦¸ð©é²è¿é½¢é½©ç«é¾çä®¾ð¤¥µð¤¦»ç ·ð¤§¸ð¤ð¤©çð¨¯ð¡£ºç¦ð¨¥¾ð¨¸¶é©é³ð¨©é¬éé𨥬ð¤¹ç㻫ç²ç©çð¤³ð¤¸ç ¾ð¡¯ç£ð¡¢¾ð£ã»ð¡¢ ð¥¯ð¡¸ã¢ð¡»ð¡ ¹ã¡ð¡´ð¡£ð¥½ã£ð¡å𤨥ð¡¾ð¡¨"], +["9240","ð¡ð¡¶èð£¦èèð¤¦ð§ ¥ð£¸±ð¥ð£»»ð§ä´ð£®ð©¦ð¦¼¦æ¹ã³ã°ã·§å¡¬ð¡¤¢æ äð£¿ð¤¡ð¤ð¤ð¦°¡ååð¦±åð ¿ð ®¨ð ¸éð¨¬é仸å«ã ð¤¶äº¼ð ¥ð ¿ä½ä¾ð¥å©¨ð «ð ã¦ð ð ãµä¼©ð 𨺳ð µè«ð äº"], +["92a1","ååä¾¢ä¼ð¤¨ð£ºä½å®å¬åä¿ä¿¥åå¼å å å å 湶ð£ð£¸¹ð£º¿æµ²ð¡¢ð£ºå¨åð äð £ð ð 赺ð¨ªð åå¤ð ¡³å¡é®äºçð¤ð ° 𤦬ð¡¤æ§ð ¸ç¹ã»ççççä®ð¤ª¼ð¤åãçð¤å´ð åð ¯åéé´é¦ååå¿ã¾å£åªð¨©ð¡ºð¡¯ð¡å¨¬å¦¸é婾å«å¨ð¥¥ð¡§³ð¡¡¡ð¤ãµæ´ ç娡ð¥º"], +["9340","åªð¨¯ð é çð¡ç 䥲é𨧻é½ã å°å²å¹å¹ð¡¦ð¡¥¼ð£«®å»åð¡¤ð¡¤ãð¡¢ ãð¡¾ãèªð¨©ð¡¶ºð£²ð¨¦¨å¼å¼ð¡¤§ð¡«å©«ð¡»åèð§½è¡ æ¾ð¢¡ ð¢«å¿ãº¸ð¢¯ð¢¾ð©ð¦½³æð ¾ð ð¢æææµð¢²ð¢´ð¤ð© "], +["93a1","æ±ð¤¥ð¢ªã¨©ð¢¬¢ð£ð©£ªð¢¹¸æ·ðªæ¶æ±æ𤧣𢵧æ¤ð¢²¡æ»æ«æ¥²ã¯´ð£ð£ð¤¦ð£«åð£ ð¡£ð©¿æð£ð£³ã« äð¥ð¨¬¢ð¥ð¡¼ð¥ð¥¥ç£®ð£ð¡ ªð£´ã¤ð£ð£ð¤æ𦴤æ«ä®æ°ð§¡°ð¡·«æ£ð£ð£¡æ𥡲ã£ð£ ºð£¼ã®ð£¢ð£¾çã®æð¤ªæ¢¶æ ã¯æª¾ã¡£ð£ð¤æ¨³æ©æ«æ¬ ð¡¤ææ¢æ©ã¯æ©ºæð£¿ð£²é é²ð¨¯ªð¨«"], +["9440","éð¨ð¨§é§æ¶¥æ¼ð¤§¬æµ§ð£½¿ã¶æ¸ð¤¼å¨½æ¸å¡æ´¤ç¡ç»ð¤ð¤¶ç±çççð¤ð¤¥å ¹ð¤ª¤ð «çºð£»¸ð£ð¤©ð¤¤ð¥¿¡ã¼ãº±ð¤«ð¨°£ð£¼µæ§ã»³çç¼éç·ä𦷪äçã½£ð¤³ð¤´ã½çç³ðªã¬ç¨ð¨«ð¤¦«ð¤¦ã«»"], +["94a1","ã·ð¤©ã»¿ð¤§ 𤣳éºå²é𨫣𡡤åð¥¡ð¥§ç¸ð£²ççç»ð¤ð£ã©ð¤£°ç¸ç㺿𤪺ð¤«äð¤ªð¦®éð¥ç ç¢ç¢ç£çç¥ð§ð¥£äç¦è禥æ¨ð£»ºç¨ºç§´ä ®ð¡¦ä²éµç§±ð µð¤¦ð 𣶺ð¡®ãå«ã°ãªð ð °ç«¢å©ð¢µð¥ª¯ð¥ªå¨ð 磰娪ð¥¯ç«¾ä¹ç±ç±ä𥮳𥺼𥺦ç³ð¤§¹ð¡°ç²ç±¼ç²®æª²ç·ç¸ç·ç½ð¦¡"], +["9540","ð¦ ð§ç¶ð¥ºäªð¦µð ¤æð ð£åð¦ð¦¸ð¤¥¢ç¿ç¬§ð ¬ð¥«©ð¥µç¬ð¥¸é§¦è é©£æ¨ð£¿ã§¢ð¤§·ð¦é¨ð¦ èð§§ð¦³äªè·äèèè ð¦´é£ð¦©è¢è¥ð¦©è𦶧èð§åªä ¿ð¡¡å¬«ð¡¢¡å«¤ð¡£è 蜨ð£¶è ð§¢å¨"], +["95a1","è¡®ä½ è¢è¢¿è£¦è¥¥è¥ð¥è¥ð§ ð§ð¨¯µð¨¯ð¨®ð¨§¹ãºè£äµäã²è¨½è¨ð©å½é«ð¤æç©çð¡¡ éµè²è³©ð§·å¦ç姰ä®ã踪躧ð¤°è¼°è½ä´æ±æ¾»ð¢¡ä¢æ½¹æºð¡é¯©ãµð¤¤¯é»éå±ä¤é»éð¨©ä¢ð¨«¼é§ð¨°ð¨°»è¥è¨«éé§éé𨴴ç ã»ð¤£¿ð¤©ð¤ªã»§ð£¥é𨻧𨹦𨹥ã»ð¤§ð¤©¸ð£¿®çç«ã»¼éð©°"], +["9640","æ¡ä¨ð©ð¥éé¨ð¨¦ð¨°¦ð¨¬¯ð¦¾éºå¬è©ä¤¼ç¹ð¤éé±é¤¸ð ¼¦å·ð¨¯ 𤪲é ð©é¶ð©é¥äð¨ð¤©§ð¨¤é£ð¨© ã¼éªä¤¥è餻é¥ð§¬ã·½é¦ä¯é¦ªé©ð¨¥ð¥£æªé¨¡å«¾é¨¯ð©£±ä®ð©¥é¦¼ä®½ä®é½å¡²ð¡å ¢ð¤¦¸"], +["96a1","ð¡¨ç¡ð¢ð£¶¸æ£ ãµ½é㤧æ ð¢ð¢¥«æé±é±é±»é°µé°é¿é¯ð©¸é®ðªµðª¾é´¡ä²®ð¤é¸ä²°é´ðª´ðªðª³ð©¤¯é¶¥è½ð¦¸ð¦¿ð¦®è¼ä³ð¦¶¤ð¦ºð¦·°è è®ð¦¸ð£ð¦¤ç§¢ð£ð£ä¤ð¤§ãµ¢éé¾éð ¿ç¢¹é·é俤ãé¤ð¥ç ½ç¡ç¢¶ç¡ð¡ð£ð¤¥ãä½²æ¿æ¿ççåð¤µå»å£³åé´åç´ã¯ð¤¬ç«ð¦±ð¤¾å¬¨ð¡µð¨©"], +["9740","æå«å¨ä¼ð¤ã¬ä»ð¨§¼é»é¸ð¡£ð ¼è²ð¦³ð¡ð¤ºð¢°¦ð¤å¦ð£¶·ð¦ç¶¨ð¦ ð¦¤ð¤¦¹ð¤¦ð¨§ºé¥ç¢ã»©ç´ð¨£ð¡¢ã»¡ð¤ª³æ«ç³ç»ã»ð¤¨¾ð¤ªð¡ð¤©¦ð §ð¡¤ð¤§¥çð¤¤ç¥ð¤¥¶éç¦éð ¾é±ð¨«ð¨¨é𨯧ð¥ä¤µð¨ªç «"], +["97a1","ð¤¥ð ³¿å¤ð 𠯫𠲸åç§ð¡ºç·¾ð¡ð¤©ð¡¡ä®éãð¨«ð¤¦å¦°ð¡¢¿ð¡¢ð§åª¡ã¢ð£µã°é婹ð¨ªð¡¡¢é´ã³ð ª´äªã¦å´ãµ©ãµð¡ç µä»ð¨æ¸ð©¤ä«æµð§¹ç§æ²¯ã³ð£¿ð£¸æ¸æ¼ãµ¯ð µçã¼ãäã»ä¡±å§é®ä¤¾è½ð¨°ð¦¯å åãð¡ç¾ð¤¢ð¤©±ð¢¿£ð¡°ð¢½æ¢¹æ¥§ð¡ð£¥ð§¯´ð£ð¨ªð£ð£ºð¤²æ¨ð£ð¦²·è¾ää"], +["9840","𦴦ð¦µð¦²ð¦¿æ¼ð§è½ð¡ºèð¦²ð§ð¡å¦åªð¡³å©¡å©±ð¡¤ ð¤¼ã姯ð¡¼ãçéæð¤¥å©®å¨«ð¤æ¨«ð£»¹ð§¶ð¤ð¤çð¤ð¨§¡ä¾°ð¦´¨å³ð¤ð§¹ð¤½æ¨ð¤ð¡ç¦ç³ð¤©ã¶¥æ³ð¯ ¥ð¤©ç¹¥å§«å´¯ã·³å½ð¤©ð¡ç¶¤è¦"], +["98a1","å 𣫺ð£ð å¾ð £ð ã¿¥ð¡¾ðª¶çð© åµ°çç³ð¨©ð© ä¿ç¿§çç𧫴ç¸ç¹ð¥¶çç㺩ð§¬é¬çµð¤£²ç¡è¶ã»çã»æ²¢å½ççç㻢㻰㻴㻺çã¼ã½ççç²çã½¼ççã¿çã¿ç´ã¿çºð¤½çå£è¦å¡©äçä¹æ¡ä ãçäªä¯å±ç¾ç売ç ç¹ç ä¨ç ¹ç¡ç¡ç¡¦èð¥µç¤³æ 礲ä"], +["9940","äç¦ç¦è¾»ç¨è¾¼ä §çªä²çª¼è¹äç«ç«ä両ç¢ç¬ç»ç°ç°ä äºç±»ç²ä粸äç³è¾çð ³ç·ç·ç·ç·½ç¾®ç¾´çäè è¥ç¬¹è®è±èã·å´ç è·è©äèçªèèç èä㬹è è è "], +["99a1","äå ºè ¼èä¥èäè¥å¯èè¤èäè¦è¶èèè¿ä°èé©æ¦è çµè¤æ£èäè¾è¡è¸èè¸èä»è¯è°è ä·è²èè²è¯é èää袮裿褤è¥è¦ð§¥§è¨©è¨¸èªèª´è±è³è³²è´äå¡è·ä仮踺ååè¹±åµèº°ä ·è»è»¢è»¤è»è»²è¾·è¿è¿è¿é³é§ä¢é£ éä¤é¨éé«é±é®é¿"], +["9a40","é£é«é³é´é½éééä¥ ä¥éº¿éåééé¾ä¥ªéé¹éé¢ä¦§é´é³ä§¥æ 䨤é䨵é²éå䫤æ¨é¢¹ä¬é£±å¡é¤é¤å´é¤é¤·é¥é¥é¥¢ä°é§ ä®é¨¼é¬çªé©é®é¯é¯±é¯´ä±é° ã¯ð¡¯éµé°º"], +["9aa1","黾åé¶é¶½é·é·¼é¶è¾¶é¹»éº¬éº±éº½é»é黢黱黸ç«é½ð ð ·ð æ¤é妬ð å¡éã¹ð ð ð ¶ð¡ºåç ³ð «ð «ð ®¿åªð¯ »ð ¯å𠯻𠰻ð ±ð ±¥ð ±¼æ§ð ²åºð ²µð ³ð ³ð µ¯ð ¶²ð ·æ¥é°¯è¥ð ¸ð ¸ð »ð ¾ð ¼ð ¹³å° ð ¾¼å¸ð¡ð¡ð¡¶æð¡»ð¡ð¡ãð¡¿ð¡ð¡¯ð¡»å¤èð¡£ð¡µð¡¶è®ð¡·ð¡ð¡ð¡ä¹¸ç»ð¡ 𡥪"], +["9b40","ð¡¨ð¡© 𡰪𡱰𡲬ð¡»æð¡»ð¡¼çæ¡ð¢ 槩ãð¢¼ð¢ð¢ºð¢ªð¢¡±ð¢¥è½ð¢¥§ð¢¦ð¢«è¦¥ð¢«¨è¾ ð¢¬é¸ð¢¬¿é¡éª½ð¢±"], +["9b62","ð¢²ð¢²·ð¥¯¨ð¢´ð¢´ð¢¶·ð¢¶ð¢¹ð¢½´ð¢¿ð£³ð£¦ð£ð£å¾±ææ¿ð§©¹ð£§ð£³ç𤦺çð£ð£çºð 墵æ"], +["9ba1","æ¤ð£ª§ð§ð¥¿¢ð£¸ð£º¹ð§¾ð¢ä£äª¸ð¤ð¨ªð¤®ð¤ð¤»ð¤´ð¤ð¤© ð åð å¦ð¡º¨ã®¾ð£³¿ð¤ð¤åð¤´ã¦ð¤¯ð¨¨ð©§ã¢ð¢èð¨é§ð¤ 𤣻ð¤¨çð¤«ð ±¸å¥¥ð¤º¥ð¤¾ð ¹è»ð¥¬åå¿ç ±ð¥ð¥ð£½ð¤ª§å¼ð¥ð¥®ð¦éã³ð¥¿ð§²ð¥äð¥¢ð¥¦ð¥ð¤¤¿ð¥¡å¦ã»ð£æð¥¤ä¼ð¨¥ð¥ª®ð¥®ð¥°ð¡¶å¡ç 澶ð¦ð§°éð¦²ð¤¾è¢ð¦ð¦"], +["9c40","åµð¦¯·è¼¶ð¦ð¡¤è«ªð¤§¶ð¦ð£¿¯ð¦ä¯ð¦¿ð¦µð¢é¥ð¥¡æ娧ð¯£ä¾»å¹ð¤¡ð¦¼ä¹ªð¤¤´éæ¶ð¦²½ã襷ð¦ð¦¡®ð¦ð¦¡çð¦£çð©ð ¨ð¦¤¦éð¦¤¹ç© é·°ð¦§ºé¨¦ð¦¨ãð¦©ð ¡ç¦ð¦¨´ð¦å´¬ð£èð¦®ä𦲤ç»è¡¥ð¦¶®å¢¶"], +["9ca1","ãð¢ð§ð§ã±ð§ð§ é𢠺ð§é°ð§¦ð¤§æ°¹éð§ð »¸è §è£µð¢¤¦ð¨³ð¡±æº¸ð¤¨ªð¡ 㦤ã¹å°ç§£ä¿æ¶ð©²ð©¢¤è¥ð§ð§¡åäð¡ã¦¡ð£¯ð¨¨ð¡ çè¦ð§§ð©¨å©§ä²·ð§¯ð¨¦«ð§§½ð§¨ð§¬ð§µ¦ð¤ ºç祾ð¨æ¾µðªæ¨ð¨å¢ð¦¸é¿æ ¶é𨠯ð¨£ð¦¦µð¡ð£¯ð¨å¶ 𨰰ð¨åé £ð¨¥å¶«ð¤¦æ¾æ§å𤪥ð£¾ã°æ¶ð¨ð¨´ð¨®ð¡¾¡ð¨ "], +["9d40","ð¨ð¨¯ð¨ð¨ð¨¯ð¨ãð¨¨ð¨ªä£ºæ¦ð¨¥ç é𨦸ä²ð¨§§ä𨧨ð¨ð¨¯å§¸ð¨°è¼ð¨¿ ð©¬çð©ð©¼ã··ð© ð¤«è¿çåð©§ð©©ð©°ð©¸ð©²ð©£ð©¥ð©¥ªð©§ð©¨¨ð©¬ð©µð©¶çºð©»¸ð©¼£ä²¤éðªç¢ðª¿ä¶éðªä¶ð ²è¾¾å"], +["9da1","辺ð¢°è¾¹ð¤ªä繿æ½æª±ä»ªã¤ð¨¬¬ð§¢ãºèºð¡µð¨¤ð¨¬ð¨®ð§¨¾ð¦¯ã·«ð§ð£²·ð¥µð¥¥äºð¥ºð¦å¿ð ¹è¸åð£ºð¤²ææð¡¶ð¡¡»æ°åð¥±åð¥ã·ð©¶ä±½å¢åç½ð¥»å¥µð£µè°ä¸ð ¿ªð µð£ºèéµè´ç»é± çç¹é å²è è·å¥è²èè½åªç¥¢ååð ºãå å±æ±ð¨¢ãç´å°åºåå²ð ±ð ²å»ð¥ 𠹶𢱢"], +["9e40","𠺢麫çµåð¡µæéåè³ç¶é ¶æ¼æ¹æ¾å©ð¢é±²ð¢º³åã𠶧å§åååç¦è¸ð¦¢ç±è¶è èè£è¶èð¡ä¬çð¤å®èð¦¢å»ð¢´ð§´¯ð¤£ð§µ³ð¦»ð§¶é °ð¡é𣳼ðª©ð º¬ð »¹ç¦ð¡²¢äð¤¿ð§¿¹ð ¿«äº"], +["9ea1","é±æ𢶠䣳ð¤ 𩵼𠿬ð ¸æ¢ð§£ð ¿"], +["9ead","ð¦ð¡ç£çºéµä¸ä¸ã·å¬æ²²å§ã¬ã§å½ã¥ð¤å¢ð¤®èååªð¥ªð ¥¹"], +["9ec5","ã©ð¢¥ç´ð©º¬ä´é¯ð£³¾ð©¼°ä±ð¤¾©ð©ð©¿è𣶶ð§²ð¦³ð£ æ®ç´¥ð£»·ð£¸¬ã¨ªéåã¹´ãºä©ð ç嫰𠺶硺𧼮墧ä¿å¼é®åµ´çðª´éº 䳡ç¹ã»æð£ð¤²"], +["9ef5","åð¡©å§ð¤¥£ð©¸å´ð§®ãæ±éµ¼"], +["9f40","ç±é¬¹åð¡¬å±æð©ð¦µð§ ¤è𠴨𦴢𤫢𠵱"], +["9f4f","å¾ð¡¼å¶éð¡·éºéç¬é¬å³ç®£æ¨æµé«¿ç¯é¬ªç±¾é¬®ç±ç²é°ç¯¼é¬é¼é°ð¤¤¾é½å³å¯ä¿½éºä¿²å ã¸åå§å妷å¸é鶫è½å©é´é¥éºå¬æ°"], +["9fa1","椬åé°é´ä°»éæ¦å¦çð¡é§å³"], +["9fae","é éé "], +["9fb2","é ð¨ºæ¿ð¦´£æ«åéçºæ ð ¼ç籰𥰡𣳽"], +["9fc1","ð¤¤çé®ä¸ªð ³è¾è¡"], +["9fc9","å±æ§ååºåå·µä»æ°±ð ²ä¼¹åååè¶ã¾å¼ã³"], +["9fdb","æé ¼é¾¥é®é ®é¢´éªºéº¨éºç ºç¬"], +["9fe7","毺è 罸"], +["9feb","å ðªè¹·é½"], +["9ff0","è·è¹é¸è¸æð¨½è¸¨è¹µç«ð¤©·ç¨¾ç£æ³ªè©§ç"], +["a040","ð¨©é¼¦æ³èçðª²ç¡ð¯¡è´ç¢ç±è¬çç±è³«ð¤ª»è¯å¾ºè¢ ä·"], +["a055","𡠻𦸠"], +["a058","詾ð¢"], +["a05b","æ½ç§é«éµé®é®èµ"], +["a063","è è³·ç¬é¡é®°ãç²ä°ç±é¥ð¦ æ ä°éºæ ½"], +["a073","åæ ¯æ¦æ¹æã©æ¢åªð£µæ¤æ ã"], +["a0a1","åµð¨¯è¿ð¨¸¹"], +["a0a6","åð¡µç¤å²é¸ð ¼»ä¥"], +["a0ae","ç¾"], +["a0b0","ç³ð¥¼ç³ç¨è¦è£çµç ç²è¦èæè¢ð§èç°èç¤è¦ð¦çð¦»è©èèèè©è²èç«ç¸èãµæ¦²è¶¦"], +["a0d4","覩ç¨æ¶¹èð¤ç§ã·ç ¶æ¤æã³ç ¢æ·"], +["a0e2","ç½±ð¨¬çæ©ä¾å ã°ð£³ð¥»ð§ð¥±ð¡¥ð¡¾ð©¤ð¦·ð§å³ð¦ð¨¨ð£·ð ®ð¦¡ð¤¼ä¢å¬ð¦é½éº¦ð¦«"], +["a3c0","â",31,"â¡"], +["c6a1","â ",9,"â´",9,"â °",9,"ä¸¶ä¸¿äº äº ååå«å¹å¸å©å¶å¤å®å·â¼³å¹¿å»´å½å½¡æ´æ çç¶è¾µé¶Â¨Ëã½ã¾ãããä»ã ããã¼ï¼»ï¼½â½ã",23], +["c740","ã",58,"ã¡ã¢ã£ã¤"], +["c7a1","ã¥",81,"Ð",5,"ÐÐ",4], +["c840","Ð",26,"Ñж",25,"â§â¸â¹ãð ä¹ð åä"], +["c8a1","é¾°åé¾±ð§"], +["c8cd","¬¦ï¼ï¼ã±ââ¡ããâºâºâºâºâºâºâºâºâºâºâºâº¥âº§âºªâº¬âº®âº¶âº¼âº¾â»â»â»â»â»â»â»â»â»£"], +["c8f5","ÊÉÉÉɵÅøÅÊɪ"], +["f9fe","ï¿"], +["fa40","ð éð 𣿠èäµç¯åµãð¤¥ð¨§¤éð¡§è®ð£³ç ¼ææ𤤳𨦪ð 𦮳ð¡ 侫ð¢å𦴩ð§ªð£ð¤ª±ð¢å©ð ¾å¾¤ð ð æ»ð å½åãºå顬ãè𤦤ð å ð£´å ªð ¯¿ð¢¼ð ¥ð¢°ð ð£³ð¡¦å®è½ð ³ð£²å²å¸"], +["faa1","é´´åååã³å𤪦å³å¢ååè椾ð£å½»åå¦å¼åµååå¹å ç°èå èð¦¬å ð¨«åæ»ð£¾ð ¥ð£¿¬å³å𠯢æ³ð¡¦æ çæ㺪ã£ð¡¨çä¢åå´ð¨«å¾å¿ð¡ð¡ç¦åð¨ªå å«å®ç§ð¥²ã½çåå æ±ä¹å¾å㪫ð ®å 𣿫𢶣å¶ð ±·åç¹å«ææµåð¦ð µ´ååå¤ä¦ð¡ð »ã¶´ð µ"], +["fb40","𨦼ð¢åä³å¯çåå©å ð¡£ð¤ºäð¤µæ³ð¡´å·æð£æ¤æåå磱å±éå¾åå¯åð¨¦ã£ð¡åð¤¥æ±®çåã±ð¦±¾å¦ð¡å ð¡ð¤£å ¦ð¤¯µå¡å¢ªã¡å£ å£ð¡¼å£»å¯¿åðª ð¤¸éã¡å¤æ¢¦ãæ¹"], +["fba1","ð¡¾å¨¤åð¡è å§ð µð¦²ð¦´ªð¡å§ð¡»ð¡²ð¦¶¦æµ±ð¡ ¨ð¡å§¹ð¦¹ 媫婣ã¦ð¤¦©å©·ãåªç¥å«ð¦¾¡ð¢ã¶ ð¡¤ã²ð¡¸åºåå¶æå¼ð§¨ää¡ð å¯æ 𡨴ð¥§ð ¥å¯³å®ä´å° ð¡å°çå°ð¡²¥ð¦¬¨å±ä£å² 峩峯å¶ð¡·¹ð¡¸·å´å´åµð¡º¤å²ºå·è¼ã ð¤¤ð¢ð¢ ³èã ¶ã¯å¸®æªå¹µå¹ºð¤¼ð ³å¦äº·å»å¨ð¡±å¸å»´ð¨"], +["fc40","å»¹å»»ã¢ å»¼æ ¾éå¼ð ð¯¢ã«ä¢®ð¡ºå¼ºð¦¢ð¢å½ð¢±å½£é½ð¦¹®å½²é𨨶徧嶶ãµð¥ð¡½ªð§¸ð¢¨éð 𨨩æ±æ 𡡷㥣ã·ã¹åð¢´ç¥±ã¹ææ¤æ³ð¤¦ð¤¦ð§©ç¤å¡åª æ ¤è¤æ 慈ð¦»æå´ð æ宪𣾷"], +["fca1","ð¢¡æð¨®ð©¥æ㤲ð¢¦ð¢£æ£æ ææð æ ð¡°æð¢¸æ¬ð¤§ã¨æ¸æ¸ð¡ð¡¼ææ¾ð¢¸¶é ð¤ð¥æ¡æ¥é»ã©¦æºã©ææ¼ð¤¨¨ð¤¨£æ ææð£¾æµð¤¥ä¬·æäð¡ ©æ æ£å¿ð£æð£·ð£¸æð£¤ð£¥æð ¹µæ§ð¥¦æ³æ´ð¡¸½ð£±ð¨´ð£ð¥ç 𢣷馤æð¤ð¤¨¡ã¬«æ§ºð£ææ§æ¢ð¤ð©æä©æ ¢æ¹é¼æ ð£¦ð¦¶ æ¡"], +["fd40","ð£¯æ§¡æ¨ð¨«æ¥³æ£ð£æ¤æ¤ã´²ã¨ð£¼ã®æ¬æ¥¡ð¨©ä¼æ¤¶æ¦ã®¡ð è£å槹ð£ð¢ªæ© ð£æªã¯³æ±æ«ð©ã°æ¬ð ¤£æ欵æ´ð¢æºµð£«ð µð¡¥ãå¡ð£æ¯¡ð£»¼æ¯æ°·ð¢ð¤£±ð¦æ±è¦æ±¹ð£¶¼ä 𣶽ð¤¤ð¤¤ð¤¤"], +["fda1","ð£³ã¥ã³«ð ´²é®ð£¹ð¢ç¾æ ·ð¦´¥ð¦¶¡ð¦·«æ¶æµæ¹¼æ¼ð¤¥¿ð¤ 𦹲è³ð¦½´åæ²æ¸è®ð¨¬¡æ¸¯ð£¸¯çð£¾ç§æ¹åªð£æ¿¸ãæ¾ð£¸°æ»ºð¡ð¤½äé°æ½æ½ãµæ½´ð© °ã´»æ¾ð¤ æ¿ð¤ð¤ ð¤¹ð£¿°ð£¾´ð¤¿åð¤ ð¤ ð¤ ð¦çç¾ç§çççççäã·¨ç´çð¤·ç«ç åªç ç ®å²ð¤¥ç é¢ð¤ç¬ð¤ð¤¨§ð¤¨¢çºð¨¯¨ç½ç"], +["fe40","éçå¤éç¤éð¥ ç®ç𤥴梽ççã¹ð£æ æ¼½ççªç«ð¤ £ð¨ «ä£ð¨ ç¨ç®ççªð °ºð¦¨®ççð¤¢ð¡§ð¤¨¤æ£ã 𤦷ð¤¦ð¤§»ç·çæ¤ð¤¨¦ç¹ð ã»çð¢¢ç 𨺲çç¤ç¶è¹ç¬ã°ç´é±æ¨¬çä¥ð¤ª"], +["fea1","ð¤ 𤩹ð¨®åð¨°ð¡¢çð¡¦çç©çð¨»ð¡©å¯ð¨º¬é ççç§ç®ð¤¾ã¼ð¤´çççç´çç¬ççç¯ç¶ð¦µçè¯ã¸ð¦¤ð¦¤ç¡ç¥ç·çð¦¾è¢ð¥ð¥ ½ð¡¸çç¦çæ¯ð¥ çð£¬ç¯ð¨¥¤ð¨¥¨ð¡ç´ç ð¡¶ð¤¨æ£ç¢¯ç£ç£é¥ç¤®ð¥ ç£ç¤´ç¢±ð§è¾¸è¢ð¨¬«ð¦ð¢ç¦è¤æ¤ç¦ð¥¡ç¦ð§¬¹ç¤¼ç¦©æ¸ªð§¦ãº¨ç§ð©ç§"] +] diff --git a/node_modules/iconv-lite/encodings/tables/cp936.json b/node_modules/iconv-lite/encodings/tables/cp936.json new file mode 100644 index 0000000..49ddb9a --- /dev/null +++ b/node_modules/iconv-lite/encodings/tables/cp936.json @@ -0,0 +1,264 @@ +[ +["0","\u0000",127,"â¬"], +["8140","ä¸ä¸ä¸ ä¸ä¸ä¸ä¸ä¸ä¸ 両丣並丩丮丯丱丳丵丷丼ä¹ä¹ä¹ä¹ä¹ä¹ä¹ä¹ä¹ä¹ä¹ä¹¢ä¹£ä¹¤ä¹¥ä¹§ä¹¨ä¹ª",5,"乲乴",9,"乿",6,"äºäº"], +["8180","äºäºäºäºäºäºäºäº£äºªäº¯äº°äº±äº´äº¶äº·äº¸äº¹äº¼äº½äº¾ä»ä»ä»ä»ä»ä»ä»ä»ä» 仢仦仧仩ä»ä»®ä»¯ä»±ä»´ä»¸ä»¹ä»ºä»¼ä»¾ä¼ä¼",6,"ä¼ä¼ä¼",4,"ä¼ä¼ä¼¡ä¼£ä¼¨ä¼©ä¼¬ä¼ä¼®ä¼±ä¼³ä¼µä¼·ä¼¹ä¼»ä¼¾",4,"ä½ä½ ä½",5,"ä½ä½ä½ä½¡ä½¢ä½¦ä½¨ä½ªä½«ä½ä½®ä½±ä½²ä½µä½·ä½¸ä½¹ä½ºä½½ä¾ä¾ä¾ä¾ ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾¡ä¾¢"], +["8240","侤侫ä¾ä¾°",4,"侶",8,"ä¿ä¿ä¿ä¿ä¿ä¿ä¿ä¿ä¿ä¿ä¿",4,"ä¿ä¿ä¿ 俢俤俥俧俫俬俰俲俴俵俶俷俹俻俼俽俿",11], +["8280","åååååååååååå å¢å£å¤å§å«å¯",10,"å»å½å¿ååååå åååååå",4,"åååååå",7,"å¦",5,"å",8,"å¸å¹åºå¼å½ååååååååååå",20,"å¤å¦åªå«å",4,"å³",6,"å¼"], +["8340","å½",17,"å",5,"åååå",10,"å¨å©åªå«å¯å°å±å²å´å¶",4,"å¼",9,"å"], +["8380","ååå",5,"å",13,"å¢",28,"å å å å å å å å å å å å å å ",4,"å £å ¤å ¦å §å ©å ªå ¯å ²å ºå ¾å ¿åååååååååååååååååå¡å£å¦",4,"åå®å´å¸å¹åºå¾å¿åååå åååååå",5], +["8440","ååååååå¢å£å¥",5,"å¬å®å±å²å´å·å¾åå åååååååååååå¡å¢å£å¥å¦å§åªå¬å¯å±å²å´åµå¼å¾å",5,"åååååååå"], +["8480","åååååå å¢å£å¤å¦å¨å«å¬åå®å°å±å³",9,"å¾åå",4,"å",6,"ååå",6,"åå¤å¥å¦å§å®å¯å°å´",9,"ååååå ååååååååååååå",5,"å å¡å¢å£å¥",10,"å±",7,"å»å¼å½åååååååååå"], +["8540","åååååååååå¢å¤å¥å§å¨å©å«å¬åå¯",9,"å¼å½åååååååååååååå¥å¨åªå¬åå²å¶å¹å»å¼å½å¾åååååååå"], +["8580","å",4,"ååååååå å¡å¤å§åªå«å¬åå¯",6,"å·å¸å¹åºå¼å½å¾åå",4,"ååååååååååå¡å¢å§å´åºå¾å¿ååå åååååååå¢å¤å¥åªå°å³å¶å·åºå½å¿åååå ååååååååå",4,"å£å¥å§å©",7,"å´å¹åºå¾å¿ååå ååååååååååååå å¡"], +["8640","å¢å¥å®å°å²åµå¶å·å¹åºå¼å¾åå åååååå ",4,"å«å¬å¯å°å±å´",5,"å»å¾ååååå åå",4,"ååå",5,"ååååå¡å¥å¦"], +["8680","å¨å©å«åå²å´åµå¶å¸å¹åºå»å½ååå ååå",4,"ååååå",4,"åååå å¢å£å¨å©å«å¯",5,"å¹åºå½å¿å åååååååååååååå ",6,"å¨",8,"å²å´å¶å¸åºå¼å¿",4,"åååååååååå",4,"åå å¢å§å©åå®å°å±å´å¶å¸",4,"å¿åååå "], +["8740","åååååå",7,"ååååå å¡å¢å¥å¦å¨å©åªå«å®å¯å°å³åµå·å¸åºå¼å½å¾å",11,"å",4,"ååååå",4], +["8780","å£å¥å¦å§åå®å¯å°å²å³å´åµå·å¸å¹åºå½",7,"å",6,"åååå",14,"å¤",10,"å°",6,"å¸å¹åºå»å½",12,"å",8,"åååååå£å¥",5,"å¬å®å¯å²å³å¶å·å¸å»å¼åååå åå",6], +["8840","å",9,"ååå å¡å¢å¤å¥å¦å§å«å±å²å´",4,"å¼å½å¿åååå ååååå",4,"ååå¢å£å¥å§å¬å®å°å±å²å´åµå¸å¹åºå½å¾å¿å"], +["8880","åååååå",4,"å",6,"ååååå¥å¨åªå¬å¯å°å±å³åµå¶å·å¹",8,"å",6,"ååååååååååå¡å¢å£å¥",7,"å®å°å±å²å³åµå¶å·å»å¼å¾å¿å å å å å å å å å å å å å å å å å å å å å å å ¢å £å ¥",4,"å «",4,"å ±å ²å ³å ´å ¶",7], +["8940","å ¾",5,"å¡ ",6,"å¡å¡å¡å¡å¡å¡å¡å¡å¡",4,"å¡",5,"塦",4,"å¡",16,"å¡¿å¢å¢å¢å¢å¢å¢å¢å¢"], +["8980","å¢",4,"å¢",4,"å¢å¢å¢å¢ ",7,"墪",17,"墽墾墿å£å£å£å£å£",10,"å£å£å£å£",13,"壥",5,"å£å£¯å£±å£²å£´å£µå£·å£¸å£º",7,"å¤å¤ å¤å¤",4,"å¤å¤å¤å¤å¤å¤å¤å¤å¤å¤å¤ 夡夢夣夦夨夬夰夲夳夵夶夻"], +["8a40","夽夾夿å¥å¥å¥ å¥å¥å¥å¥å¥å¥å¥å¥å¥",4,"奡奣奤奦",12,"奵奷奺奻奼奾奿å¦å¦ å¦å¦å¦å¦å¦å¦å¦å¦å¦å¦å¦å¦å¦å¦å¦å¦ 妡妢妦"], +["8a80","妧妬å¦å¦°å¦±å¦³",5,"妺妼妽妿",6,"å§å§å§å§å§å§å§å§å§å§å§å§",4,"姤姦姧姩姪姫å§",11,"姺姼姽姾å¨å¨å¨å¨å¨å¨å¨å¨å¨å¨å¨å¨å¨å¨å¨å¨å¨å¨å¨¡å¨¢å¨¤å¨¦å¨§å¨¨å¨ª",6,"娳娵娷",4,"娽娾娿å©",4,"å©å©å©",9,"å©å©å©å©å©",5], +["8b40","婡婣婤婥婦婨婩婫",8,"婸婹婻婼婽婾åª",17,"åª",6,"åª",13,"媫媬"], +["8b80","åª",4,"媴媶媷媹",4,"媿å«å«",5,"å«å«å«",4,"å«å«å«å«å«å«å«å«å«å«¢å«¤å«¥å«§å«¨å«ªå«¬",4,"嫲",22,"å¬",11,"å¬",25,"嬳嬵嬶嬸",7,"å",6], +["8c40","å",7,"åååå å¡å§å¨å«åå®å¯å²å´å¶å·å¸å¹å»å¼å¾å¿å®å®å®å®å®å®å®å®å®å®å®å®§å®¨å®©å®¬å®å®®å®¯å®±å®²å®·å®ºå®»å®¼å¯å¯å¯å¯å¯å¯å¯å¯å¯å¯"], +["8c80","å¯å¯",8,"å¯ å¯¢å¯£å¯¦å¯§å¯©",4,"寯寱",6,"寽対å°å°å°å° å°å°å°å°å°å°å°å°å°å°å°å°å°å°å° 尡尣尦尨尩尪尫å°å°®å°¯å°°å°²å°³å°µå°¶å°·å±å±å±å±å±å±å±å±å±å±å±å±å±å±å±å±å±å±¢å±¤å±§",6,"å±°å±²",6,"屻屼屽屾å²å²",4,"å²å²å²å²å²å²å²å²å²",4,"岤",4], +["8d40","岪岮岯岰岲岴岶岹岺岻岼岾å³å³å³å³ ",5,"å³",5,"å³",5,"å³",6,"峢峣峧峩峫峬峮峯峱",9,"å³¼",4], +["8d80","å´å´å´ å´",5,"å´",4,"å´å´å´å´å´å´å´å´",4,"崥崨崪崫崬崯",4,"å´µ",7,"å´¿",7,"åµåµåµ",10,"åµåµåµåµ",10,"嵪åµåµ®åµ°åµ±åµ²åµ³åµµ",12,"å¶",21,"å¶å¶å¶å¶å¶å¶ "], +["8e40","嶡",21,"嶸",12,"å·",6,"å·",12,"å·å·å· 巣巤巪巬å·"], +["8e80","巰巵巶巸",4,"å·¿å¸å¸å¸å¸å¸å¸å¸å¸å¸å¸å¸å¸",7,"帨",4,"帯帰帲",4,"帹帺帾帿å¹å¹å¹å¹",5,"å¹",6,"å¹",4,"å¹å¹å¹å¹ å¹£",14,"幵幷幹幾åºåºåºåº åºåºåºåºåºåºåºåºåºåº¡åº¢åº£åº¤åº¨",4,"庮",4,"庴庺庻庼庽庿",6], +["8f40","å»å»å»å»",5,"å»å»å»å»å»å»å»",11,"廩廫",8,"å»µå»¸å»¹å»»å»¼å»½å¼ å¼å¼å¼å¼å¼å¼å¼å¼å¼å¼å¼å¼å¼å¼å¼å¼¡å¼¢å¼£å¼¤"], +["8f80","弨弫弬弮弰弲",6,"弻弽弾弿å½",14,"å½å½å½å½å½å½å½å½å½ 彣彥彧彨彫彮彯彲彴彵彶彸彺彽彾彿å¾å¾å¾å¾å¾å¾å¾å¾å¾å¾å¾å¾å¾å¾å¾ å¾¢",5,"復徫徬徯",5,"徶徸徹徺徻徾",4,"å¿å¿å¿å¿å¿å¿å¿å¿å¿å¿å¿å¿å¿å¿¢å¿£å¿¥å¿¦å¿¨å¿©å¿¬å¿¯å¿°å¿²å¿³å¿´å¿¶å¿·å¿¹å¿ºå¿¼æ"], +["9040","æææææææææææææ¢æ£æ¤æ¬ææ®æ°",4,"æ¶",4,"æ½æ¾ææ",6,"ææææææææææææææ æ¡æ¥æ¦æ®æ±æ²æ´æµæ·æ¾æ"], +["9080","æææ æææææææææææææææææ¡æ¢æ¤æ¥æ§æ©æªæ®æ°æ³æµæ¶æ·æ¹æºæ½",7,"ææææ",4,"æææææææææ¡",4,"æªæ±æ²æµæ·æ¸æ»",4,"ææææ æææææ",4,"æææææææææ¡æ¢æ¥æ¨æ©æªæ¬",18,"æ ",6], +["9140","æ æ æ æ æ æ æ æ æ æ ",6,"æ æ æ æ ¡æ £æ ¤æ ¥æ ¦æ ©",6,"æ ±æ ²æ ³æ ´æ ¶æ ¸",18,"æææ",4,"æ"], +["9180","æ",6,"æ",8,"æªæ«æ",9,"æ¸",5,"æ¿æææ",4,"ææ",4,"ææ",16,"æ§",13,"æ¶",8,"æ",5,"æææææææææ æ£æ¦æ§æ¨æ©æ«ææ¯æ°æ±æ²æµæ¶æ¸",4,"æææ ææ"], +["9240","ææææææææ",6,"æ¤æ¥æ¨æ±æ²æ´æµæ·æ¸æºæ»æ½ææææ ææææ",5,"ææææææ£æ¦æ§æ©æªææ®æ¯æ°æ²æ³æ´æ¶æ·æ¸æºæ¾ææ"], +["9280","ææææææææ æ¡æ¤æªæ«æ°æ²æµæ¸æ¹æºæ»ææææ ææææææææææææææææ¦æ§æ©æ¬ææ®æ°æ±æ³",5,"æ»æ¼æ¾æ¿æææææææææææ",7,"æ æ¤æ¥æ¦æ¨æªæ«æ¬æ¯æ°æ²æ³æ´æµæ¸æ¹æ¼æ½æ¾æ¿ææææ æææææææææ",6,"æ¡æ¤æ¦æ«æ¯æ±æ²æµæ¶æ¹æ»æ½æ¿æ"], +["9340","ææææ ææææææææææ",6,"ææ¢æ¤",4,"æ«æ¬æ®æ¯æ°æ±æ³æµæ·æ¹æºæ»æ¼æ¾æææ",4,"æææææ",5,"æææ¢æ£æ¤"], +["9380","æ¥æ§æ¨æ©æ«æ®",5,"æµ",4,"æ»æ¼æ¾æææææ",6,"æææææ",4,"æ",7,"æ¨æªæ«æ¬æ®",9,"æ»",6,"æææ",8,"æææææææææ",4,"æ¥æ¦æ§æ¨æªæ«æ¯æ±æ²æ³æ´æ¶æ¹æ»æ½æ¾æ¿ææææ",6,"ææææææææ"], +["9440","æææææ æ¡æ£æ¥æ§",24,"æ",7,"æ",7,"æ",4,"æ",8], +["9480","æ¢æ£æ¤æ¦",4,"æ¬ææ°æ±æ²æ³æ·æºæ¼æ½æ",4,"ææææææææææææææææ æ¡æ¤æ¥æ§æ¨æ©æªææ®æ¯æ±æ³æµæ¶æ¸",14,"æææææææææææææææ æ¢æ£æ¦æ¨æªæ¬æ®æ±",7,"æºæ»æ¾æ¿æææææææææææææ",7,"æ¡æ£æ¤æªæ«"], +["9540","æ²æ³æ´æµæ¸æ¹æ»",4,"æææ ææææææææææææææææ¡æ¢æ£æ¤æ¦æ©æªæ«æ¬æ®æ°æ²æ³æ·",4,"æ½æ¿æææ",6,"æææææ"], +["9580","ææææææ æ¢æ£æ¥æ§æ©",4,"æ±æ²æ³æµæ¸æ¹æ»æ¼æ½æ¿ææææ ææææææææææææææ",4,"æ",8,"æ©",4,"æ¯",4,"æµæ¶æ·æ¸æºæ»æ¼æ½æ¿",25,"ææ",7,"æ§æ¨æª",5,"æ±æµæ¶æ¸æºæ»æ½æææ"], +["9640","ææ æææææææææææææææ ",5,"æ§æ©æ®æ°æ²æ³æ¶æ·æ¸æ¹æ»æ¼æ¾æ¿æææ ææææææææ",4,"ææ¢æ£æ¤æ¦æ§æ«æ¬æ®æ±æ´æ¶"], +["9680","æ¸æ¹æºæ»æ½ææææ ææææææææææææææææ æ¡æ¤æ¦æ©æ¬æ®æ±æ²æ´æ¹",7,"ææ ",9,"ææææææ¡æ£æ¤æ¦æ§æ¨æªæ«ææ®æ²æµ",7,"æ¾æ æ æ æ æ æ æ æ æ æ æ ",4,"æ æ æ æ ¢",6,"æ «",6,"æ ´æ µæ ¶æ ºæ »æ ¿æ¡æ¡æ¡æ¡æ¡æ¡",5], +["9740","æ¡æ¡æ¡æ¡æ¡ªæ¡¬",7,"桵桸",8,"æ¢æ¢æ¢",7,"æ¢æ¢æ¢æ¢æ¢æ¢æ¢",9,"梣梤梥梩梪梫梬梮梱梲梴梶梷梸"], +["9780","梹",6,"æ£æ£",5,"æ£æ£æ£æ£æ£æ£æ£æ£æ£æ£æ£æ£",4,"棡棢棤",9,"棯棲棳棴棶棷棸棻棽棾棿æ¤æ¤æ¤æ¤æ¤",4,"æ¤æ¤æ¤æ¤",11,"椡椢椣椥",7,"椮椯椱椲椳椵椶椷椸椺椻椼椾æ¥æ¥æ¥",16,"æ¥æ¥æ¥æ¥æ¥æ¥æ¥"], +["9840","楡楢楤楥楧楨楩楪楬æ¥æ¥¯æ¥°æ¥²",4,"楺楻楽楾楿æ¦æ¦æ¦ æ¦æ¦æ¦æ¦",5,"æ¦æ¦æ¦æ¦æ¦",9,"榩榪榬榮榯榰榲榳榵榶榸榹榺榼榽"], +["9880","榾榿æ§æ§",7,"æ§æ§æ§æ§æ§æ§æ§",5,"æ§æ§æ§æ§¡",11,"槮槯槰槱槳",9,"槾æ¨",9,"æ¨",11,"æ¨",5,"æ¨ æ¨¢",5,"権樫樬æ¨æ¨®æ¨°æ¨²æ¨³æ¨´æ¨¶",6,"樿",4,"æ© æ©æ©",7,"æ©",6,"æ©"], +["9940","æ©",4,"橢橣橤橦",10,"橲",6,"橺橻橽橾橿æªæªæªæª ",8,"æªæª",4,"æª",7,"檡",5], +["9980","檧檨檪æª",114,"欥欦欨",6], +["9a40","欯欰欱欳欴欵欶欸欻欼欽欿æææææ ææææ",11,"æ",7,"æ¨æ©æ«",13,"æºæ½æ¾æ¿æ®æ® æ®"], +["9a80","æ®æ®æ®æ®æ®æ®æ®æ®æ®æ®æ®",4,"殢",7,"殫",7,"殶殸",6,"æ¯æ¯æ¯æ¯",4,"æ¯æ¯æ¯æ¯æ¯æ¯æ¯",4,"毢",7,"毬æ¯æ¯®æ¯°æ¯±æ¯²æ¯´æ¯¶æ¯·æ¯¸æ¯ºæ¯»æ¯¼æ¯¾",6,"æ°",4,"æ°æ°æ°æ°æ°æ°æ° 氣氥氫氬æ°æ°±æ°³æ°¶æ°·æ°¹æ°ºæ°»æ°¼æ°¾æ°¿æ±æ±æ± æ±æ±",4,"æ±æ±æ±æ±æ±"], +["9b40","æ±æ±æ±¢æ±£æ±¥æ±¦æ±§æ±«",4,"汱汳汵汷汸決汻汼汿æ²æ²æ²æ²æ²æ²æ²æ²æ²æ²æ²æ²æ²æ²æ²æ²æ²æ² 沢沨沬沯沰沴沵沶沷沺æ³æ³æ³æ³æ³æ³æ³æ³æ³æ³æ³æ³æ³æ³"], +["9b80","æ³æ³æ³æ³æ³æ³¤æ³¦æ³§æ³©æ³¬æ³æ³²æ³´æ³¹æ³¿æ´æ´æ´æ´ æ´æ´æ´æ´æ´æ´æ´æ´æ´æ´æ´æ´æ´æ´æ´æ´",5,"洦洨洩洬æ´æ´¯æ´°æ´´æ´¶æ´·æ´¸æ´ºæ´¿æµæµæµæµæµæµæµæµæµæµæµæµæµæµ¡æµ¢æµ¤æµ¥æµ§æµ¨æµ«æµ¬æµæµ°æµ±æµ²æµ³æµµæµ¶æµ¹æµºæµ»æµ½",4,"æ¶æ¶æ¶æ¶æ¶æ¶æ¶æ¶æ¶æ¶æ¶",4,"æ¶æ¶¢æ¶¥æ¶¬æ¶æ¶°æ¶±æ¶³æ¶´æ¶¶æ¶·æ¶¹",5,"æ·æ·æ·æ·æ·æ·"], +["9c40","æ·æ·æ·æ·æ·æ·æ·æ·æ·æ·æ·æ·æ·æ·¢æ·£æ·¥æ·§æ·¨æ·©æ·ªæ·æ·¯æ·°æ·²æ·´æ·µæ·¶æ·¸æ·ºæ·½",7,"æ¸æ¸æ¸æ¸æ¸æ¸æ¸æ¸æ¸æ¸æ¸æ¸æ¸æ¸æ¸æ¸¢æ¸¦æ¸§æ¸¨æ¸ªæ¸¬æ¸®æ¸°æ¸±æ¸³æ¸µ"], +["9c80","渶渷渹渻",7,"æ¹ ",7,"æ¹æ¹æ¹æ¹æ¹æ¹æ¹æ¹æ¹æ¹æ¹æ¹ ",10,"湬æ¹æ¹¯",14,"æºæºæºæºæºæºæº",4,"æº",6,"æºæºæºæºæºæº 溡溣溤溦溨溩溫溬æºæº®æº°æº³æºµæº¸æº¹æº¼æº¾æº¿æ»æ»æ»æ» æ»æ»æ»æ»æ»æ»æ»æ»æ»æ»æ»æ»æ»æ»æ»æ»£æ»§æ»ª",5], +["9d40","滰滱滲滳滵滶滷滸滺",7,"æ¼æ¼æ¼ æ¼æ¼æ¼",4,"æ¼æ¼æ¼æ¼",9,"漡漢漣漥漦漧漨漬漮漰漲漴漵漷",6,"漿æ½æ½æ½"], +["9d80","æ½æ½æ½ æ½æ½æ½æ½æ½",9,"æ½æ½æ½æ½æ½æ½ 潡潣潤潥潧",5,"潯潰潱潳潵潶潷潹潻潽",6,"æ¾ æ¾æ¾æ¾æ¾æ¾",12,"æ¾æ¾æ¾æ¾ æ¾¢",4,"澨",10,"澴澵澷澸澺",5,"æ¿æ¿",5,"æ¿",6,"æ¿",10,"æ¿æ¿¢æ¿£æ¿¤æ¿¥"], +["9e40","濦",7,"æ¿°",32,"ç",7,"ç",6,"ç¤",6], +["9e80","ç«",9,"ç¶ç·ç¸çº",17,"ççç",13,"ç",11,"ç®ç±ç²ç³ç´ç·ç¹çºç»ç½ççççççççççççççççççç",12,"ç°ç²ç´çµç¶çºç¾ç¿çç çççç",12,"ç"], +["9f40","çççç ç¡ç¢ç£ç¥çªç®ç°",6,"ç¸çºç»ç¼ç¾",10,"ç",4,"ççççç",10,"ç§",7,"ç²ç³ç´"], +["9f80","çµç·",13,"ç ç ç ç ç ç ç ",12,"ç ç ",4,"ç ¥ç ©",4,"ç ¯ç °ç ±ç ´ç µç ¶ç ·ç ¹ç »ç ¼ç ¾",5,"ç ",4,"çççççççççççç",4,"ç¡",6,"ç©çªç«ç",5,"ç´ç¶ç·ç¸çº",8,"ç",9,"ç",4], +["a040","ç",9,"ç¡ç¢ç£ç¤ç¦ç¨",5,"ç¯",9,"çº",11,"ç",19], +["a080","ççç",9,"ç©ç«çç®ç¯ç²ç³ç´çºç¼ç¾ç",6,"çççççççççççççççç ç£ç¤ç¥ç¨çªç«ç¬çç°ç±ç³ç´ç¶ç·ç¸ç»ç¼ç½ççç ",4,"ççççç",11,"ç ",11,"ç®ç±ç²ç³çµçº",6,"ç ççççççççççççççç"], +["a1a1","ããã·Ë˨ãã âï½ââ¦ââââããã",7,"ãããã±Ã÷â¶â§â¨âââªâ©ââ·ââ¥â¥â âââ«â®â¡âââ½ââ â®â¯â¤â¥ââµâ´ââ°â²â³âï¼Â¤ï¿ ï¿¡â°Â§âââ ââââââ¡â â³â²â»ââââã"], +["a2a1","â °",9], +["a2b1","â",19,"â´",19,"â ",9], +["a2e5","ã ",9], +["a2f1","â ",11], +["a3a1","ï¼ï¼ï¼ï¿¥ï¼ ",88,"ï¿£"], +["a4a1","ã",82], +["a5a1","ã¡",85], +["a6a1","Î",16,"Σ",6], +["a6c1","α",16,"Ï",6], +["a6e0","︵︶︹︺︿ï¹ï¸½ï¸¾ï¹ï¹ï¹ï¹"], +["a6ee","︻︼︷︸︱"], +["a6f4","︳︴"], +["a7a1","Ð",5,"ÐÐ",25], +["a7d1","а",5,"Ñж",25], +["a840","ËËËâââ¥âµâ ââââââââ£ââ¦â§â¿â",35,"â",6], +["a880","â",7,"ââââ¼â½â¢â£â¤â¥ââããã"], +["a8a1","ÄáÇà ÄéÄèīÃÇìÅóÇòūúÇùÇÇÇÇüêÉ"], +["a8bd","ÅÅ"], +["a8c0","É¡"], +["a8c5","ã ",36], +["a940","ã¡",8,"ã£ãããããã¡ããããã︰¬¦"], +["a959","â¡ã±"], +["a95c","â"], +["a960","ã¼ããã½ã¾ãããï¹",9,"ï¹ï¹ï¹ï¹ï¹",8], +["a980","ï¹¢",4,"﹨﹩﹪﹫"], +["a996","ã"], +["a9a4","â",75], +["aa40","çççç¢",5,"çªç«çµç¶ç¹ç½ç¾ç¿ççç",5,"ççççççççççççç ç£ç¤ç¦ç§ç¨çç¯ç°ç²ç³çµç¶çºç»ç¼ç½ç",8], +["aa80","çççççççççççç",7,"ç¡",10,"ç®ç°ç±"], +["ab40","ç²",11,"ç¿",4,"ç ççççççççççççççççççç ç¡ç£",5,"çªç¬çç±ç´çµç¶ç¸ç¹ç¼ç½ç¾ç¿çç",4], +["ab80","çççç",6,"çççççç¡ç¢ç£ç¤ç¦ç¨çªç«ç¬ç®ç¯ç°ç±ç³",4], +["ac40","ç¸",10,"çççççççç",8,"ç",5,"ç£ç¤ç§ç©ç«çç¯ç±ç²ç·",4,"ç½ç¾ç¿çç",11], +["ac80","ç",6,"çççç ",12,"ç®ç¯ç±",4,"ç¸ç¹çº"], +["ad40","ç»ç¼ç½ç¿ççç çççççççç",10,"çç",7,"çª",15,"ç»",12], +["ad80","ç",9,"ç",8,"ççç¡ç¥ç§",6,"ç°ç±ç²"], +["ae40","ç³çµç¸",6,"ççççç ",7,"ççççççççççç ",4,"ç¦ç§çªç®ç´ç¶ç¹ç¼ç½ç¿ççççççççççççççççç"], +["ae80","ç",7,"ç§ç¨ç©ç«",6,"ç³çµç¶ç·çº",4,"ççççç ç"], +["af40","çççççççççççççç¢ç¦",4,"çç¶ç·çºç»ç¿ççççççççççççççççç ç¡ç¥ç©ç¬çç®ç¯ç²ç³çµç¶ç·ç¸çºç»ç½ç¾çççç"], +["af80","çççççççççççççççç¡ç£ç§ç¨ç¬ç®ç¯ç±ç²ç¶ç·ç¹çºç»ç½ççç"], +["b040","ç ",6,"ç",5,"çç",4,"ççç ç¡ç¢ç¤",6,"ç¬çç®ç°",7,"ç¹çºç¼ç¿çççç ççççççççççççç"], +["b080","ç",7,"ç¥",8,"ç¯ç°ç³çµ",9,"çççåé¿åæ¨åååççè¼ç®è¾ç¢ç±ééæ°¨å®ä¿ºææ岸èºæ¡è®æçå¹æç¬ç¿±è¢å²å¥¥ææ¾³èææåå§ç¬å «ç¤å·´æè·é¶æèåé¸ç½¢ç¸ç½æç¾æä½°è´¥æç¨æçæ¬æ³è¬é¢æ¿çæ®æä¼´ç£ååç»é¦å¸®æ¢æ¦èç»æ£ç£ èéåè°¤èèå è¤å¥"], +["b140","ççççççççççççç ",4,"ç¦",7,"ç°ç³çµç¶ç·çºç»ç½ç¿çççç çççç",10,"ççççç¡ç£ç¤ç¥ç§çªç«"], +["b180","ç¬ç®ç°",4,"ç¹ç»ç½ç¾ç¿ççç çç",7,"ç",7,"çèé¹ä¿å ¡é¥±å®æ±æ¥æ´è±¹é²çæ¯ç¢æ²ååè¾èè´é¡åçå¤æ«ç被å¥è¯æ¬ç¬¨å´©ç»·ç泵蹦迸é¼é¼»æ¯éç¬å½¼ç¢§èè½æ¯æ¯æ¯å¸åºç¹éæå¼å¿ è¾å£èé¿ééè¾¹ç¼è´¬æ便åå辨辩辫éæ 彪è表é³æå«çªå½¬ææ¿æ»¨å®¾æå µå°æä¸ç§é¥¼ç³"], +["b240","çççç ç¤ç§ç©çªç",11,"çºç»ç¼çççç",5,"ççç",11,"ç¡ç£ç¤ç¦ç¨ç«çç®ç¯ç±ç²ç´ç¶",4], +["b280","ç¼ç¾ç",12,"ç",8,"çççç",4,"ç¤ç 并ç»è ææ¨éµæ³¢ååæéç®ä¼¯å¸è¶èè渤æ³é©³æååºè¡¥å ä¸å¸æ¥ç°¿é¨ææ¦çè£ææè´¢ç¬è¸©é彩èè¡é¤åèæ®ææ¨ç¿èè±ä»æ²§èæç³æ§½æ¹èåç侧åæµå±è¹æåè¬è¶æ¥ç¢´æ½å¯å²å·®è¯§ææ´è±ºææºèé¦è°ç¼ é²äº§é颤æç"], +["b340","ç¦ç¨çªç¯ç°ç±ç²ç´çµç·ç¹çºç»ç¼ç ",5,"ç ç ç ç ç ç ç ç ç ç ç ç ¡ç ¢ç ¤ç ¨ç ªç «ç ®ç ¯ç ±ç ²ç ³ç µç ¶ç ½ç ¿ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡"], +["b380","ç¡ç¡ç¡",11,"硯",7,"硸硹硺硻硽",6,"åºå°å¸¸é¿å¿è åæç å±å¡è¶ æéæå²æ½®å·¢åµç车æ¯æ¤æ£å½»æ¾é´è£è¾°å°æ¨å¿±æ²éè¶è¡¬æ称åæ©æåä¹ç¨æ©æ¾è¯æ¿ééªç§¤åç´æåæ± è¿å¼é©°è»é½¿ä¾å°ºèµ¤ç¿ æ¥ç½å å²è«å´å® æ½é ¬ç´è¸ç¨ æç¹ä»ç»¸ç ä¸èååºæ©±å¨èºééæ»é¤æ¥"], +["b440","ç¢ç¢ ç¢ç¢ç¢ç¢ç¢ç¢ç¢ç¢ç¢ç¢ç¢ç¢ç¢ç¢ 碢碤碦碨",7,"碵碶碷碸確碻碼碽碿ç£ç£ç£ç£ç£ç£ç£ç£ç£ç£ç£ç£ç£ç£ç£ç£ç£ç£",9], +["b480","磤磥磦磧磩磪磫ç£",4,"磳磵磶磸磹磻",5,"ç¤ç¤ç¤ç¤",6,"ç¡å¨çæ触å¤æ£å·ç©¿æ¤½ä¼ è¹å串ç®çªå¹¢åºé¯åå¹çæ¶é¤åæ¥æ¤¿éåæ·³çº¯è ¢æ³ç»°çµè¨ç£éè¾æ ç·è¯æ¤åºèµæ¬¡èªè±å±åä»ä¸åç²éç°ä¿è¹¿ç¯¡çªæ§å´å¬èçç²¹æ·¬ç¿ æå寸ç£æ®ææªæ«éæè¾¾çç©æ大åæ¹å£æ´å¸¦æ®ä»£è´·è¢å¾ é®"], +["b540","ç¤",5,"ç¤",9,"ç¤",4,"礥",14,"礵",4,"礽礿ç¥ç¥ç¥ç¥ ç¥ç¥",8,"ç¥ç¥ç¥ç¥ç¥¡ç¥£"], +["b580","祤祦祩祪祫祬祮祰",6,"祹祻",4,"ç¦ç¦ç¦ç¦ç¦ç¦ç¦ç¦ç¦ç¦ç¦ç¦ç¦æ è½æ 丹åé¸æ¸èæ¦æ°®ä½æ®æ·¡è¯å¼¹èå½æ¡å è¡æ¡£åæ£è¹åå²ç¥·å¯¼å°ç¨»æ¼éçå¾·å¾ç蹬ç¯ç»ççªå³éå ¤ä½æ»´è¿ªæç¬ç涤ç¿å«¡æµåºå°è第å¸å¼éç¼é¢ ææ»ç¢ç¹å ¸éå«çµä½ç¸åºæ¦å¥ æ·æ®¿ç¢å¼éååæåéè°è·ç¹ç¢è¶è¿è°å "], +["b640","ç¦",6,"ç¦",11,"禨",10,"禴",4,"禼禿ç§ç§ç§ ç§ç§ç§ç§ç§ç§ç§ç§ç§ç§ç§ç§",5,"ç§ ç§¡ç§¢ç§¥ç§¨ç§ª"], +["b680","秬秮秱",6,"秹秺秼秾秿ç¨ç¨ç¨ ç¨ç¨ç¨ç¨ç¨ç¨",4,"ç¨ç¨ç¨ç¨ç¨ç¨ä¸ç¯å®é顶é¼éå®è®¢ä¸¢ä¸å¬è£æå¨æ ä¾æ«å»æ´å ææé¡è±éçé½ç£æ¯çç¬è¯»å µç¹èµæéè度渡å¦ç«¯çé»æ®µæç¼å å é对墩å¨è¹²æ¦é¡¿å¤éç¾éæåå¤å¤ºå躲æµè·ºèµåæ°å è¾å³¨é¹ ä¿é¢è®¹å¨¥æ¶åæ¼éé饿æ©èå¿è³å°é¥µæ´±äº"], +["b740","ç¨ç¨ç¨¡ç¨¢ç¨¤",14,"稴稵稶稸稺稾ç©",5,"ç©",9,"ç©",4,"ç©",16], +["b780","ç©©",6,"穱穲穳穵穻穼穽穾çªçª çªçªçªçªçªçªçªçªçªçªçªçªçªçªçª¡çª¢è´°åç½çä¼ä¹éæ³çè©å¸çªç¿»æ¨ç¾éç¹å¡ç¦åè¿èè´©ç¯é¥æ³åè³æ¹èªæ¿é²å¦¨ä»¿è®¿çººæ¾è²éå¡é£è¥åªè¯½å èºåºæ²¸è´¹è¬é å©æ°å纷åçæ±¾ç²å¥ä»½å¿¿æ¤ç²ªä¸°å°æ«èå³°éé£ç¯ç½é¢å¯ç¼è®½å¥å¤ä½å¦å¤«æ·è¤åµæ¶æè¾å¹ æ°ç¬¦ä¼ä¿æ"], +["b840","窣窤窧窩窪窫窮",4,"窴",10,"ç«",10,"ç«",9,"ç«ç«ç«ç«ç«ç«ç«¡ç«¢ç«¤ç«§",5,"竮竰竱竲竳"], +["b880","ç«´",4,"竻竼竾ç¬ç¬ç¬ç¬ ç¬ç¬ç¬ç¬ç¬ç¬ç¬ç¬ç¬ç¬ç¬ç¬ç¬ç¬ç¬ç¬¡ç¬¢ç¬£ç¬§ç¬©ç¬æµ®æ¶ªç¦è¢±å¼ç«æè¾ ä¿¯éæ§è¯è åºè èµ´å¯è¦èµå¤å ä»éç¶è ¹è´å¯è®£éå¦ç¼åå¶å该æ¹æ¦éçæºå¹²çææç«¿è赶æç§æ¢èµ£ååé¢ç¼¸è纲å²æ¸¯æ ç¯çé«èç¾ç³æé稿åå¥æææ鸽è³çå²é©èæ ¼è¤ééé¬ä¸ªåç»æ ¹è·èæ´åºç¾¹"], +["b940","笯笰笲笴笵笶笷笹笻笽笿",5,"ççççççççççççç¡ç£",10,"ç¯ç°ç³ç´ç¶ç¸çºç¼ç½ç¿ç®ç®ç®ç®ç®",6,"ç®ç®"], +["b980","ç®ç®ç®ç®ç®ç®ç®ç®ç®ç®ç® 箣箤箥箮箯箰箲箳箵箶箷箹",7,"ç¯ç¯ç¯åè¿æ¢å·¥æ»åæé¾ä¾èº¬å ¬å®«å¼å·©æ±æ±è´¡å ±é©å¾æ²èçå¢æè´å¤è¾èåç®ä¼°æ²½å¤å§é¼å¤è骨谷è¡æ 顾åºéå®çå寡æè¤ä¹ææªæ£ºå ³å®å è§ç®¡é¦ç½æ¯çè´¯å 广éç°è§åç¡ å½é¾éºè½¨é¬¼è¯¡ç¸æ¡æ跪贵å½è¾æ»æ£é éå½æ裹è¿å"], +["ba40","ç¯ ç¯ç¯ç¯ç¯ç¯ç¯ç¯ç¯ç¯ç¯",4,"ç¯ç¯ç¯ç¯ç¯ 篢篣篤篧篨篩篫篬ç¯ç¯¯ç¯°ç¯²",4,"篸篹篺篻篽篿",7,"ç°ç°ç°ç°ç°ç°",5,"ç°ç°ç°"], +["ba80","ç°",4,"ç° ",5,"簨簩簫",12,"ç°¹",5,"ç±éª¸å©æµ·æ°¦äº¥å®³éªé £æ¨é¯é©å«æ¶µå¯å½åç½ç¿°æ¼ææ±æ¾æçæ±æ±å¤¯æèªå£å豪毫é好èå·æµ©åµåè·èæ ¸ç¦¾åä½åçè²é河涸赫è¤é¹¤è´ºå¿é»çå¾ç æ¨å¼äº¨æ¨ªè¡¡æè½°åçè¹é¸¿æ´ªå®å¼çº¢å侯ç´å¼åååå¼ä¹å¿½ç壶è«è¡è´çç³æ¹"], +["bb40","ç±",9,"ç±",36,"ç±µ",5,"ç±¾",9], +["bb80","ç²ç²",6,"ç²ç²ç²ç²ç²ç²ç² 粡粣粦粧粨粩粫粬ç²ç²¯ç²°ç²´",4,"粺粻弧èå¬æ¤äºæ²ªæ·è±ååç¾æ»ç»ååè¯æ§å¾ææ·®å欢ç¯æ¡è¿ç¼æ¢æ£å¤çªè±¢ç涣宦幻èæ é»ç£ºèç°§çå°æ¶ç æå¹æè°ç°æ¥è¾å¾½æ¢èåæ¯ææ §åæ æ¦è´¿ç§½ä¼ç©æ±è®³è¯²ç»è¤æå©éæµæ··è±æ´»ä¼ç«è·ææé货祸å»å¾åºæºç¸ç¨½ç§¯ç®"], +["bc40","粿ç³ç³ç³ç³ç³ç³ç³ç³",6,"ç³ç³ç³ç³ç³ç³¡",6,"糩",5,"ç³°",7,"糹糺糼",13,"ç´",5], +["bc80","ç´",14,"紡紣紤紥紦紨紩紪紬ç´ç´®ç´°",6,"è饥迹æ¿è®¥é¸¡å§¬ç»©ç¼åææ£è¾ç±éåæ¥ç¾æ±²å³å«çº§æ¤å èå·±èæåå£ä¼ç¥åæ¸æµå¯å¯è®¡è®°æ¢å¿é å¦ç»§çºªåæ·å¤¹ä½³å®¶å èé¢è´¾ç²é¾å稼价æ¶é©¾å«æ¼çåå°ç¬ºé´ç å ¼è©è°å¥¸ç¼è§æ£æ¬ç¢±ç¡·æ£æ¡ç®ä¿åªåèæ§é´è·µè´±è§é®ç®ä»¶"], +["bd40","ç´·",54,"絯",7], +["bd80","絸",32,"å¥è°å饯æ¸æº 涧建åµå§å°æµæ±çè桨å¥è®²å é ±éèæ¤ç¤ç¦è¶äº¤éæµéªå¨å¼æ é°ç«ä¾¥èç¡è§é¥ºç¼´ç»å¿æé µè½¿è¾å«çªææ¥ç秸è¡é¶æªå«èæ¡æ°æ·ç«ç«æ´ç»è§£å§æèè¥çåä»ç¥è¯«å±å·¾çæ¤éä»æ´¥è¥ç´§é¦ä» è°¨è¿é³æç¦è¿ç¬æµ¸"], +["be40","ç¶",12,"綧",6,"綯",42], +["be80","ç·",32,"å°½å²èå ¢èçæ¶é²¸äº¬æ精粳ç»äºè¦æ¯é¢éå¢æ¬éå¾çéç«ç«åç¯çªæªç©¶çº çéä¹ ç¸ä¹é å©ææ§è¼è åå°±çé æçç½å± 驹èå±åç©ä¸¾æ²®èææ®å·¨å ·è·è¸é¯ä¿±å¥æ§ç¬å§æé¹å¨å¦ç·å·ç»¢æ æ«ææåçµè§å³è¯ç»åèé§ååå³»"], +["bf40","ç·»",62], +["bf80","縺縼",4,"ç¹",4,"ç¹",21,"ä¿ç«£æµé¡éªååå¡å¯å¼æ©æ¥·å¯æ ¨åå ªååç çåº·æ ·ç³ ææ亢çèæ·ç¤é å·èæ¯æ£µç£é¢ç§å£³å³å¯æ¸´å å»å®¢è¯¾è¯åå¦æ³åå空æåæ§æ å£æ£å¯æ¯åçªè¦é ·åºè£¤å¤¸å®æè·¨è¯åç·ä¾©å¿«å®½æ¬¾å¡ççæ¡ç¿ç¶æ·åµäºç岿窥èµå¥éå"], +["c040","ç¹",35,"çº",23,"çºçºçº"], +["c080","纮纴纻纼ç»ç»¤ç»¬ç»¹ç¼ç¼ç¼ç¼·ç¼¹ç¼»",6,"ç½ç½",9,"ç½ç½é¦æ§æºå¤ææå°æ¬æ©å»éåæåè¡è è¾£å¦è±æ¥èµè婪æ æ¦ç¯®éå °æ¾è°°æ½è§æç¼ç滥ç æ¦ç¼å»éæ浪æå³ç¢èä½¬å§¥é ªçæ¶åä¹é·éè¾ç£ç´¯å¡åæè类泪棱æ¥å·å梨çé»ç¯±ç¸ç¦»æ¼çæé鲤礼èèåæ 丽åå±ç ¾åå©åä¾ä¿"], +["c140","ç½ç½ç½ç½ç½ç½ç½ ç½£",4,"罫罬ç½ç½¯ç½°ç½³ç½µç½¶ç½·ç½¸ç½ºç½»ç½¼ç½½ç½¿ç¾ç¾",7,"ç¾ç¾ç¾",4,"ç¾",4,"ç¾ç¾ç¾ 羢羣羥羦羨",6,"ç¾±"], +["c180","ç¾³",4,"羺羻羾ç¿ç¿ç¿ç¿ç¿ç¿ç¿ç¿ç¿ç¿ç¿",4,"ç¿ç¿ç¿",5,"翢翣ç¢ç«ç²æ²¥é¶åçå©ä¿©èè²è¿é°å»ææ¶å¸æè¸é¾æç¼ç»ç²®åæ¢ç²±è¯ä¸¤è¾éæ¾äº®è° æ©èåçç寥辽潦äºæé£å»æåè£çå£çç³æ磷é临é»é³æ·åèµåæç²è±é¶é¾é伶ç¾åçµéµå²é¢å¦ä»¤æºç榴硫é¦çåç¤æµæ³å é¾èå笼窿"], +["c240","翤翧翨翪翫翬ç¿ç¿¯ç¿²ç¿´",6,"翽翾翿èèèèèèèèèèèèèèè¡è£è¤è«",5,"è²è´è¹èºè¼è¾èèèè èèèèèèèèèèè"], +["c280","èè",13,"è«",5,"è²",11,"éåæ¢é楼å¨æç¯æ¼éè¦å¢é¢ åºçæ³å¤èé²éºç¢é²è·¯èµé¹¿æ½ç¦å½éæ®é©´åéä¾£æ 履屡ç¼èæ°¯å¾ç滤绿峦æåªæ»¦åµä¹±æ ç¥æ¡è½®ä¼¦ä»æ²¦çº¶è®ºèèºç½é»é£ç®©éª¡è£¸è½æ´éªç»å¦éº»çç è马éªååå买麦åè¿èçé¦è®æ»¡èæ¼æ ¢æ¼«"], +["c340","è¾èèè èèè",5,"èèèèèè£è¦è§è¨è¬è°è³èµè¶è¸è¹è»è è",4,"è",6,"èèè è¢è£è¦è®èµè·è¹è»è¾è¿èèèèè èèè"], +["c380","èèèèèèèè",12,"èè®è°è³è´èµè·è¹",4,"è¿è°©èè«ç²æ°å¿è½ç«è éæ¯çéå¯èå帽è²è´¸ä¹ç«ææ¢ é ¶éç ¤æ²¡çåªéæ¯ç¾æ§å¯å¦¹åªé¨é·ä»¬èè檬çé°ç梦åç¯éé¡ç³è¿·è°å¼¥ç±³ç§è§ æ³èå¯å¹æ£ç 绵åå åå¨©ç¼ é¢èæçèç§æ¸ºåºå¦èçæ°æ¿ç¿ææ¯é½æè鸣éåå½è°¬æ¸"], +["c440","è ",5,"è è è è è è è è è è ",4,"è ¡è ¢è £è ¤è ¦è ¨è ªè «è ¬è ¯è ²è ³è µè ¶è ·è ¸èè",4,"èèèèèèè",5,"èèè",4,"è¤è¥"], +["c480","è§è©è«",7,"è´",5,"è¼è½è¾è¿èè èèèèè",6,"æ¹è模è磨æ©éæ¹æ«è«å¢¨é»æ²«æ¼ å¯éè°çææç¡äº©å§æ¯å¢æ®å¹åæ æ¨ç®ç¦ç§ç©æ¿åªåé é£å¨çº³æ°ä¹å¥¶èå¥åç·é¾åæ èæ¼é¹æ·å¢é¦å å«©è½å¦®éåªæ³¥å°¼æä½ å¿è »é溺è«æ年碾æµæ»å¿µå¨é ¿é¸å°¿æèå½å®ééæ¶ æ¨æ çåå®"], +["c540","è",14,"è¤è¥è¦è¨è©è«è®",4,"èµ",5,"è½è¿èè",4,"èèèèè",5,"èè è¤è¥è¦è§è©è®è²èºè¼è½è¿"], +["c580","èèèèè èèèèèèè",7,"èèèèèè ",7,"è©æ§æ³çæé®çº½èæµåå¼å¥´åªæ女æèçæªæ¦ç³¯è¯ºå¦æ¬§é¸¥æ®´èåå¶æ²¤åªè¶´ç¬å¸æç¶ææçå¾æ¹æ´¾ææ½çç£ç¼çå¤åä¹åºæèªèæåå¨ç®è¢è·æ³¡å¸èå¹è£´èµéªé 佩æ²å·çç °æ¨ç¹æ¾å½è¬æ£ç¡¼ç¯·è¨æé¹æ§ç¢°å¯ç é¹æ¹æ«åçµæ¯"], +["c640","èªè«è¬èè±èµè¶è·è¸è»è¼èèèè èèèèèèèèèèèèè è¢è£è§è²èµè¶èºè»è¼è¿èèèè èèèèèèèè¢è§è¨è©èªè¬èè®è°è²è³èµè¶è¸"], +["c680","èºè¼",4,"èèèèèèèèèè",9,"è©èªè®è°è²è·è»è½å¤è¾ç²ç®å¹çå»å±è¬ç¯åçéªé£æ¼ç¢ç¥¨æç¥æ¼é¢è´«åèä¹åªè¹èå¹³åç¶è¯å±å¡æ³¼é¢å©ç ´éè¿«ç²åæéºä»èè¡è©è²åæ´åæ®æµ¦è°±æçæ欺æ æ妻ä¸åæ¼ææ²å ¶æ£å¥æ§ç¦å´èé½æç¥ç¥éªèµ·å²ä¹ä¼å¯å¥ç å¨æ°è¿å¼æ±½æ³£è®«æ"], +["c740","è¾è¿èèèè èè",4,"èè",4,"èè¢è°",6,"è¹èºè¾",6,"èèèèèèèèèèèèèèèèèè¡",6,"è¬èè®"], +["c780","è¯èµè»è¾è¿èèèèèèèèèèèèèèèèèèèè¢è£è¤è¦è§è¨è«è¬èæ°æ´½çµæ¦éé åè¿ç¾ä»è°¦ä¹¾é»é±é³åæ½é£æµ è°´å åµæ¬ ææªåè ç¾å¢è·å¼ºæ¢æ©é¹æ²ææ¡¥ç§ä¹ä¾¨å·§éæ¬ç¿å³ä¿çªåèä¸æ¯çªé¦ä¾µäº²ç§¦ç´å¤è¹æ禽å¯æ²é轻氢å¾å¿æ¸ ææ´æ°°æ 顷请åºç¼ç©·ç§ä¸é±çæ±åé æ³ è¶åºèæ²èº¯å±é©±æ¸ "], +["c840","è®è¯è³",4,"èºè»è¼è¾è¿èèè èèèèèè",5,"èèèè",5,"è©",7,"è²",5,"è¹èºè»è¾",7,"èèè"], +["c880","è",6,"è",4,"èèèèè è¢è¤",4,"èªè®è¯è°è²è´è·è¹è»è¼å娶é¾è¶£å»å颧æéæ³å ¨çæ³ç¬å¸å缺çç¸å´é¹æ¦·ç¡®éè£ç¾¤ç¶çåæç¤å£¤æå·è®©é¥¶æ°ç»æ¹ç壬ä»äººå¿é§ä»»è®¤åå¦çº«æä»æ¥æè¸èè£èç溶容ç»åææèè¹è ååºå¦è¾±ä¹³æ±å ¥è¤¥è½¯é®èçéé°æ¶¦è¥å¼±ææ´è¨è ®é³å¡èµä¸å"], +["c940","è½",4,"èèè èèèè",7,"èèèèèèè è¢",12,"è°è±è³èµè¶è·è»è¼è¾èèèè èèèèèèèèèèè"], +["c980","è",4,"èè¡è¢è¤è§",4,"èè®è¯è±",10,"è½è¾èèèä¼æ£æ¡å丧æéªæ«å«çè²æ¶©æ£®å§èç æå¹æ²çº±å»å¥ç çæçè«æå±±å ç ½è¡«éªéæ 赡è³åæ±æç¼®å¢ä¼¤åèµæä¸å°è£³æ¢¢æç¨ç§èåºé¶å°å¨éµç»å¥¢èµèèè赦æå°æ æ¶ç¤¾è®¾ç ·ç³å»ä¼¸èº«æ·±å¨ ç» ç¥æ²å®¡å©¶çè¾æ æ¸å£°çç¥ç²å绳"], +["ca40","è",8,"èèèèèèèèèèèèèèè è¢",8,"è",9,"è¾",4,"èè èèè",10], +["ca80","èèèèèèè",4,"è¥è¦è§è©",8,"è³èµè¶è·è¸è¼è½è¿èèççå©èå£å¸å¤±ç®æ½æ¹¿è¯å°¸è±åç³æ¾æ¶ä»é£èå®è¯å²ç¢ä½¿å±é©¶å§å¼ç¤ºå£«ä¸æ¿äºæèªéå¿æ¯åå¬éä»ä¾é饰æ°å¸æ室è§è¯æ¶æé¦å®å¯¿æå®åç¦å ½è¬æ¢æ¢³æ®æè¾åèæ·ç书èµå°çè¯ææç½²èé»é¼ å±æ¯è¿°æ ææç«å¢ 庶æ°æ¼±"], +["cb40","èèèè",6,"è",10,"è",6,"è¥è¦è§è©è«è¬èè±",5,"è¸èº",6,"è",6,"è",4,"èè"], +["cb80","èè",5,"è",6,"è¥è¦è§è¨èª",14,"æå·èæè¡°ç©å¸ æ æ´éåç½è°æ°´ç¡ç¨å®ç¬é¡ºè说ç¡æçæ¯æå¶æç§å¸ä¸æ»è寺å£å伺似饲巳æ¾è¸æé¢éå®è®¼è¯µæèæå½èé ¥ä¿ç´ éç²å³å¡æº¯å®¿è¯èé ¸èç®è½éé绥é«ç¢å²ç©éé§ç¥åæç¬èæ¢å缩çç´¢éæå¡ä»å®å¥¹å¡"], +["cc40","è¹èºè¼è½è¾è",4,"è",10,"èèèèè",15,"è¨èª",13,"è¹èºè»è½è¾è¿è"], +["cc80","è",11,"èèè",4,"èèèèè è¡è£",7,"çæè¹è¸èèæ¬å°æ³°é 太ææ±°åæè´ªç«æ»©åæªç°æ½è°è°å¦æ¯¯è¢ç¢³æ¢å¹ç汤å¡æªå æ£ èåç³å躺æ·è¶ç«ææ¶æ»ç»¦èæ¡éæ·é¶è®¨å¥ç¹è¤è ¾ç¼èªæ¢¯å踢éæé¢è¹å¼ä½æ¿åææ¶åå±å¤©æ·»å¡«ç°çæ¬èè ææ¡è¿¢çºè·³è´´éå¸å å¬ç"], +["cd40","èè¯è°è²",6,"è",6,"è",4,"èè",5,"è",4,"è¥è¦è«èè®è²è³è·è¸è¹è»",4,"èèèè èèèèèèèèèè"], +["cd80","èè è¡è¢è£è¥è¦è§è¨èªè«è¬è¯èµè¶è·èºè»è¼è½è¿èèè èèèèèèèèèæ±å»·åäºåºæºèéæ¡é ®ç³åé彤童桶æ çç»çå·æ头éå¸ç§çªå¾å¾éæ¶å± ååå æ¹å¢æ¨é¢è ¿è褪éå屯èææè±é¸µé驮驼æ¤å¦¥æå¾æåèæ´¼å¨ç¦è¢æªå¤è±å¼¯æ¹¾ç©é¡½ä¸¸ç·å®ç¢æ½æçæå®å©ä¸è 汪ç亡æç½å¾æºæå¿å¦å¨"], +["ce40","èèèèè è¤è¦è§è¨èªè«è¬èè¯è°è²è³èµè¶è¸è¹èºè¼è½è",6,"èèèèèèèèèèèè",5,"è¡è¢è¦",7,"è¯è±è²è³èµ"], +["ce80","è·è¸è¹èºè¿èèèèèèèèè",4,"èèèè",6,"è ",4,"å·å¾®å±é¦è¿æ¡ å´å¯æ为æ½ç»´èèå§ä¼ä¼ªå°¾çº¬æªèå³çèåéä½æ¸è°å°æ °å«ç温èæé»çº¹å»ç¨³ç´é®å¡ç¿ç®æè涡çªææ¡å§æ¡æ²å·«åé¨ä¹æ±¡è¯¬å±æ è梧å¾å´æ¯æ¦äºæåèä¼ä¾®åæé¾æ¤ç©å¿å¡æ误æçæ西ç¡ç½æ°å»å¸é¡çº"], +["cf40","è¥è¦è§è©èªè®è°è±è²è´è¶è·è¸è¹è»è¼è¾è¿è",4,"èèèè",4,"è",6,"èèèèè¡è¢è£è¤è¦è§è¨è©è«è¬èè¯",9], +["cf80","èºè»è¼è½è¿è è è è ",5,"è ",7,"è è è è è è ",4,"è £ç¨æ¯å¸æèå¤æçç¯æºªæ±çæªè¢å¸ä¹ 媳åé£æ´ç³»éæç»çè¾å£éè¾æå³¡ä¾ çä¸å¦å¤åæé¨å ä»é²çº¤å¸è´¤è¡è·é²æ¶å¼¦å«æ¾é©ç°ç®å¿è ºé¦ 羡宪é·é线ç¸å¢é¶é¦ç®±è¥æ¹ä¹¡ç¿ç¥¥è¯¦æ³å享项巷橡åå象è§ç¡éåå®å£éæ¶å®µæ·æ"], +["d040","è ¤",13,"è ³",5,"è ºè »è ½è ¾è ¿è¡è¡è¡è¡",5,"è¡",5,"è¡è¡è¡è¡",6,"衦衧衪è¡è¡¯è¡±è¡³è¡´è¡µè¡¶è¡¸è¡¹è¡º"], +["d080","衻衼è¢è¢è¢è¢è¢è¢è¢è¢è¢è¢è¢è¢è¢è¢è¢",4,"è¢",4,"袣袥",5,"å°åæ ¡èå¸ç¬ææ¥äºæèéåææºéªæèè°å械å¸è¹ææ³æ³»è°¢å±èªè¯é欣è¾æ°å¿»å¿ä¿¡è¡ æè ¥ç©æºå ´ååå½¢é¢è¡é幸ææ§å§å å¶è¸åæ±¹éçä¼ä¿®ç¾æ½å éç§è¢ç»£å¢æéèåé¡»å¾è®¸èé åæåºçæ¤çµ®å©¿ç»ªç»è½©å§å®£æ¬æç"], +["d140","袬袮袯袰袲",4,"袸袹袺袻袽袾袿è£è£è£è£è£è£è£è£è£è£è£è£è£è£è£è£",4,"è£ è£¡è£¦è£§è£©",6,"裲裵裶裷裺裻製裿è¤è¤è¤",5], +["d180","è¤è¤",4,"è¤è¤",4,"è¤",4,"褢褣褤褦褧褨褩褬è¤è¤®è¤¯è¤±è¤²è¤³è¤µè¤·éç£ç©ç»é´èå¦ç©´éªè¡åç循æ¬è¯¢å¯»é©¯å·¡æ®æ±è®è®¯éè¿ åæ¼é¸¦é¸å丫è½çèå´è¡æ¶¯é åäºè®¶çå½éçæ·¹ç严ç è岩延è¨é¢éç沿å¥æ©ç¼è¡æ¼è³å °çåç éå彦ç°å®´è°éªæ®å¤®é¸¯ç§§æ¨æ¬ä½¯ç¡ç¾æ´é³æ°§ä»°çå »æ ·æ¼¾éè °å¦ç¶"], +["d240","褸",8,"è¥è¥è¥ ",24,"è¥ ",5,"襧",19,"襼"], +["d280","襽襾è¦è¦è¦è¦ è¦",26,"æå°§é¥çªè°£å§å¬èè¯è¦è椰åè¶ç·éå¶ä¹é¡µæä¸å¶æ³è å¤æ¶²ä¸å£¹å»æé±ä¾ä¼è¡£é¢å¤·é移仪è°çæ²å®å§¨å½æ¤ èåå·²ä¹ç£ä»¥èºææé屹亿役èé¸èç«äº¦è£ææ¯ å¿ä¹ç溢诣议è°è¯å¼ç¿¼ç¿ç»èµè«å æ®·é³é´å§»åé¶æ·«å¯ 饮尹å¼é"], +["d340","覢",30,"è§è§è§è§è§è§è§è§è§è§è§è§ 觡觢觤觧觨觩觪觬è§è§®è§°è§±è§²è§´",6], +["d380","觻",4,"è¨",5,"è¨",21,"å°è±æ¨±å©´é¹°åºç¼¨è¹è¤è¥è§èè¿èµ¢çå½±é¢ç¡¬æ åæ¥ä½£èç庸éè¸è¹åæ³³æ¶æ°¸æ¿åç¨å¹½ä¼æ 忧尤ç±é®éç¹æ²¹æ¸¸é æåå³ä½é诱åå¹¼è¿æ·¤äºçæ¦èæèä½ä¿é¾é±¼ææ¸æ¸é äºå¨±é¨ä¸å±¿ç¦¹å®è¯ç¾½çåèéåéå»å³ªå¾¡æ欲ç±è²èª"], +["d440","è¨",31,"訿",8,"è©",21], +["d480","è©",25,"詺",6,"æµ´å¯è£é¢è±«é©é¸³æ¸å¤å å£è¢åæ´è¾åååç¿æºç¼è¿èæ¿æ¨é¢æ°çº¦è¶è·é¥å²³ç²¤ææ¦é èäºé§åé¨å è¿è´é æéµååç ¸ææ ½åç¾å®°è½½åå¨å±ææèµèµèè¬éç³å¿è»æ£æ©æ¾¡è¤èºåªé çç¶ç¥è´£æ©å泽贼æå¢ææ¾èµ æå³æ¸£æ轧"], +["d540","èª",7,"èª",7,"èª",46], +["d580","è«",32,"é¡é¸ç¨æ 榨åä¹ç¸è¯ææå® çªåºå¯¨ç»æ¯¡è©¹ç²æ²¾çæ©è¾å´å±è¸æ å æç«æ¹ç»½æ¨ç« å½°æ¼³å¼ æ涨æä¸å¸è´¦ä»èç´éæææ¾æ²¼èµµç §ç½©å èå¬é®æå²è°è¾è éèè¿æµçæççç §è»è´é侦æç¹è¯éæ¯ééµè¸æ£çå¾ç°äºææ´æ¯æ£æ¿"], +["d640","諤",34,"è¬",27], +["d680","謤謥謧",30,"帧çéè¯èææ¯å±èç¥è¢èæ±ä¹ç»èç´æ¤æ®æ§å¼ä¾åææ¢è¶¾åªæ¨çº¸å¿ææ·è³è´ç½®å¸å³å¶æºç§©ç¨è´¨ççæ»æ²»çªä¸ç å¿ éè¡·ç»ç§è¿é仲ä¼èå¨å·æ´²è¯ç²¥è½´èå¸åç±å®æ¼éª¤ç æ ªèæ±çªè¯¸è¯é竹çç ®æç©å±ä¸»èæ±å©èè´®é¸ç"], +["d740","è",31,"è§",4,"è",25], +["d780","è®",24,"讬讱讻è¯è¯è¯ªè°è°ä½æ³¨ç¥é©»æçªæ½ä¸ç 转æ°èµç¯æ¡©åºè£ å¦æ壮ç¶æ¤é¥è¿½èµå ç¼è°åææåæ¡ç¢èé åçç¼æµå ¹å¨èµå§¿æ»æ·åç´«ä»ç±½æ»åèªæ¸åé¬æ£è¸ªå®ç»¼æ»çºµé¹èµ°å¥æç§è¶³åæç¥è¯ é»ç»é»çºå´éæ罪å°éµæ¨å·¦ä½æåä½å座"], +["d840","è°¸",8,"è±è±è±è± è±è±è±è±",7,"è±è±è±è±è±",5,"è±£",6,"豬",6,"豴豵豶豷豻",6,"è²è²è²è²"], +["d880","è²è²è²",6,"è²è²è²è²",20,"äºä¸å ä¸å»¿å ä¸äºä¸é¬²å¬å©ä¸¨ç¦ºä¸¿åä¹å¤ç»å®æ°åè¤é¦æ¯ç¾é¼ä¸¶äºé¼ä¹ä¹©äºèåå¬åä»ååå£å¥å®é¥èµååµå¦å®å¾èµå¦å£ååååå³å¿åååå¡åè¯å½åååååç½äº»ä»ä»ä»ä»¨ä»¡ä»«ä»ä¼ä»³ä¼¢ä½¤ä»µä¼¥ä¼§ä¼ä¼«ä½ä½§æ¸ä½ä½"], +["d940","è²®",62], +["d980","è³",32,"ä½ä½ä¼²ä¼½ä½¶ä½´ä¾ä¾ä¾ä¾ä½¾ä½»ä¾ªä½¼ä¾¬ä¾ä¿¦ä¿¨ä¿ªä¿ ä¿ä¿£ä¿ä¿ä¿ä¿¸å©å俳å¬åå®å俾ååå¥å¨å¾ååååå¬å»å¥å§å©åºåååå¬å¦å®ååä»æ°½ä½ä½¥ä¿é¾ æ±ç±´å ®å·½é»é¦åå¤å¹åè¨åå«å¤å äº å 亳衮袤亵èè£ç¦å¬´è 羸å«å±å½å¼"], +["da40","è´",14,"è´ èµèµèµèµèµ¥èµ¨èµ©èµªèµ¬èµ®èµ¯èµ±èµ²èµ¸",8,"è¶è¶è¶è¶è¶è¶è¶",4,"è¶è¶è¶",9,"è¶ è¶¡"], +["da80","趢趤",12,"趲趶趷趹趻趽è·è·è·è· è·è·è·è·è·è·è·è·è·ååå¢å¥è® 讦讧讪讴讵讷è¯è¯è¯è¯è¯è¯è¯è¯è¯è¯è¯è¯è¯è¯ 诤诨诩诮诰诳诶诹诼诿è°è°è°è°è°è°è°è°è°è°è°è°è°è°è°è°è° 谡谥谧谪谫谮谯谲谳谵谶å©åºéé¢é¡é±éªé½é¼ééééé§é¬é²é´éééé°ééééé¬é¡é´é³é¶éº"], +["db40","è·è·è·è·è· 跡跢跥跦跧跩è·è·®è·°è·±è·²è·´è·¶è·¼è·¾",6,"è¸è¸è¸è¸è¸è¸è¸è¸è¸è¸è¸",7,"è¸ è¸¡è¸¤",4,"踫è¸è¸°è¸²è¸³è¸´è¸¶è¸·è¸¸è¸»è¸¼è¸¾"], +["db80","踿è¹è¹ è¹è¹",4,"è¹",5,"è¹",11,"蹧蹨蹪蹫蹮蹱é¸é°éé é¾ééééé¦é¢éééé«é¯é¾éé¢éé£é±é¯é¹é é åå¥å¢å¬åå¾å¿ååå°åç®çå»´åµå¼é¬¯å¶å¼çå·¯åå©å¡å¡¾å¢¼å£ å£å©å¬åªå³å¹å®å¯åå»åå©å å«åå¼å»å¨åå¶å³åå¤åå²åå§å´åå åååååå¸å´å¯å¸å¤å"], +["dc40","蹳蹵蹷",4,"蹽蹾èºèºèºèºèºèº",6,"èºèºèºèº",6,"èºèº",11,"èºèº®èº°èº±èº³",6,"躻",7], +["dc80","è»",10,"è»",21,"å å å½åå å å å¡å 塥塬å¢å¢å¢å¢é¦¨é¼æ¿è¹è½è¿èèè¨èèèèèè«è¸è¾è°èèè£èè·è®èèèè©è´è¡èªèèèè¤è¡èè·è¤èèèè´èèèè»èèèèèèè èèèèèèèè¼è´è±èèè¯èèèèèèè èèºè³è¦è¥"], +["dd40","軥",62], +["dd80","輤",32,"è¨èè©è¬èªèè®è°è¸è³è´è èªèèè è¼è¶è©è½è¸è»èèè¨èºè¼èèè¥èå èèèè½èèè¸èèèèèèè¸è¹èªè èè¦è°è¡èèèèè³èèèºèè¸è¼èè©è¶èèè±èèèèè¦è½èèè¿èºè è¡è¹è´èè¥è£èçè¸è°è¹èèº"], +["de40","è½ ",32,"轪è¾è¾è¾è¾è¾ 辡辢辤辥辦辧辪辬è¾è¾®è¾¯è¾²è¾³è¾´è¾µè¾·è¾¸è¾ºè¾»è¾¼è¾¿è¿è¿è¿"], +["de80","è¿",4,"è¿è¿è¿è¿è¿è¿ 迡迣迧迬迯迱迲迴迵迶迺迻迼迾迿éééééééèè»è¿è¼èèè¨è¤èèºç¢èè²è»è¤è¨èèè¹è®èè è¹è·è°èèèè¿è§è è©èè¼å»¾å¼å¤¼å¥è·å¥å¥å¥å尢尥尬尴ææªææ»ææææ®æ¢æ¶æ¹ææææ¶æ±æºææ´ææ¬ææ©æ®æ¼æ²æ¸æ æ¿ææææææ¾æ ææææ ææ¦æ¡ææææ"], +["df40","ééé£é¤é¥é§",5,"é°",4,"é·é¹éºé½é¿ééé éé",4,"ééééééé",5,"é¤é¦é§é©éªé«é¬é¯",4,"é¶",6,"é¾é"], +["df80","éé ééééé",4,"ééééééééé é¤é¥é§é¨é©é«éé²é·é¼é½é¿éæºæ·æ¸ææºææææ¤æ¢ææ¥æ®å¼å¿çå¼åå±å½å©å¨å»åååååååååå¡ååå£å²ååå·å±å¤åååå¶å¦ååååå´åå§å¦ååå²å£åå»å¿ååååå©åªå¤ååååå§å å½åå³å¢å£ååå§åªå§ååµååååå¿åå¼"], +["e040","éééééééééééééééééé é£é¤é¥é©éªé¬é®é°é±é²é³éµé¶é·é¹éºé»é¼é¿éééé ",19,"ééé"], +["e080","ééé é¡é¤",10,"é°é²",6,"éº",8,"é å·ååµå¶å·å³å°ååååå±å¹åååå¾ååå»åå½å¾åååªå·åååå«å¬åå¦ååå¯å¥å²å³ååå¨åµå¤è¾ååååå¤å£å¾åå§ååå¹åå¬åå¢åååååå¤å±å«å»å¼å åå¯åååå¡åµå«å¹å¿ååååå¸å¸å¸å¸å¸±å¸»å¸¼"], +["e140","é é é é é é é é é é é é é é é ¦é §é ¨é «é é ³é ºé »é ¼é",4,"éééééé",6,"é",5,"é¤",5,"é«é¬é°é±é²é³é¶é·é¸é¹é»"], +["e180","é¼",10,"éééé",9,"é",8,"帷å¹å¹å¹å¹å¹¡å²å±ºå²å²å²å²å²å²å²å²å²å²µå²¢å²½å²¬å²«å²±å²£å³å²·å³å³å³¤å³å³¥å´å´å´§å´¦å´®å´¤å´å´å´åµå´¾å´´å´½åµ¬åµåµ¯åµåµ«åµåµåµ©åµ´å¶å¶å¶è±³å¶·å· 彳彷å¾å¾å¾å¾å¾å¾å¾å¾¨å¾å¾µå¾¼è¡¢å½¡çç°ç´ç·ç¸çççççç¨ç¯ç©ç²ç´ç·çç³ççº"], +["e240","é¦",62], +["e280","é¥",32,"ç»ççç¡ççççç¢ç¹ç¥ç¬ç¸ç±çççç ç¬ç¯ç¾è夥飧夤å¤é¥£é¥§",5,"饴饷饽é¦é¦é¦é¦é¦é¦é¦é¦é¦é¦åºåºåºåºåº¥åº 庹庵庾庳èµå»å»å»å»¨å»ªèºå¿å¿å¿å¿æå¿®æ忡忤忾æ æ忪å¿å¿¸ææµæ¦ææææ©æ«ææ¿æ¡æ¸æ¹æ»æºæ"], +["e340","é",45,"éµ",16], +["e380","é",7,"é",24,"æªæ½æææææææææ¬æ»æ±æææææ´æ æ¦ææ£æ´æææ«æ æ µæ¬ææ§æ·ææµå¿é³é©é«é±é³éµé¶é¼é¾ééééééééééééééé丬ç¿ææ°µæ±æ±æ±æ²£æ² æ²æ²æ²æ±¨æ±©æ±´æ±¶æ²æ²©æ³æ³æ²æ³·æ³¸æ³±æ³æ²²æ³ æ³æ³ºæ³«æ³®æ²±æ³æ³¯æ³¾"], +["e440","é¨",5,"é¯",24,"é",31], +["e480","é©",32,"洹洧æ´æµæµæ´æ´æ´æ´æ´«æµæ´®æ´µæ´æµæµæµæ´³æ¶æµ¯æ¶æ¶ æµæ¶æ¶æµæµ 浼浣æ¸æ·æ· æ·æ¸æ¶¿æ· æ¸æ·¦æ·æ·æ¸æ¶«æ¸æ¶®æ¸«æ¹®æ¹æ¹«æº²æ¹æºæ¹æ¹æ¸²æ¸¥æ¹æ»æº±æºæ» æ¼æ»¢æº¥æº§æº½æº»æº·æ»æº´æ»æºæ»æºæ½¢æ½æ½æ¼¤æ¼æ»¹æ¼¯æ¼¶æ½æ½´æ¼ªæ¼æ¼©æ¾æ¾æ¾æ½¸æ½²æ½¼æ½ºæ¿"], +["e540","é",51,"é¿",10], +["e580","é",31,"é«æ¿æ¾§æ¾¹æ¾¶æ¿æ¿¡æ¿®æ¿æ¿ 濯çç£çç¹çµççå®å®å®å®å®¥å®¸ç¯éªæ´å¯¤å¯®è¤°å¯°è¹è¬è¾¶è¿è¿è¿¥è¿®è¿¤è¿©è¿¦è¿³è¿¨é ééé¦éééé¡éµé¶éé¯ééééé¨éé¢éæ¹é´é½ééééå½å½å½å½å°»å«å±å±å±å±£å±¦ç¾¼å¼ªå¼©å¼è´å¼¼é¬»å±®å¦å¦å¦å¦©å¦ªå¦£"], +["e640","é¬",34,"é",27], +["e680","é¬",29,"éééå¦å§å¦«å¦å¦¤å§å¦²å¦¯å§å¦¾å¨ å¨å§å¨å§£å§å§¹å¨å¨å¨²å¨´å¨å¨£å¨å©å©§å©å©å¨¼å©¢å©µè¬åªªåªå©·å©ºåª¾å««åª²å«å«åª¸å« 嫣嫱å«å«¦å«å«å¬å¬å¬å¬²å¬·åå°å°åå¥å³ååå¢é©µé©·é©¸é©ºé©¿é©½éªéªéª éªéªéªéªéªéªéªéªéªéªéªéª 骢骣骥骧çºçº¡çº£çº¥çº¨çº©"], +["e740","é",7,"é",54], +["e780","é",32,"çºçº°çº¾ç»ç»ç»ç»ç»ç»ç»ç»ç»ç»ç» 绡绨绫绮绯绱绲ç¼ç»¶ç»ºç»»ç»¾ç¼ç¼ç¼ç¼ç¼ç¼ç¼ç¼ç¼ç¼ç¼ç¼ç¼ç¼ç¼ç¼¡",6,"缪缫缬ç¼ç¼¯",4,"缵幺ç¿å·ç¾éççç®ç¢ççççç·ç³çççç¥ç顼çç©ç§ççºç²ççªçç¦ç¥ç¨ç°ç®ç¬"], +["e840","é¯",14,"é¿",43,"é¬éé®é¯"], +["e880","é°",20,"ééééééééé¦é»éé çççççççç·çç¾çççççççç¨ç©çç§ççºéªé«é¬æææææ©æ¥ææªæ³ææ§æµæ¨ææææ·æ¼æ°æ ææ æ©æ°æ ææµææ³ææ ææ¸æ¢æ ææ½æ ²æ ³æ¡ æ¡¡æ¡æ¡¢æ¡æ¡¤æ¢æ æ¡æ¡¦æ¡æ¡§æ¡æ ¾æ¡æ¡æ ©æ¢µæ¢æ¡´æ¡·æ¢æ¡«æ£æ¥®æ£¼æ¤æ¤ 棹"], +["e940","é§é³é½éééééé é®é´éµé·",7,"é",42], +["e980","é«",32,"椤棰æ¤æ¤æ¥æ££æ¤æ¥±æ¤¹æ¥ æ¥æ¥æ¦æ¥«æ¦æ¦æ¥¸æ¤´æ§æ¦æ¦æ§æ¦æ¥¦æ¥£æ¥¹æ¦æ¦§æ¦»æ¦«æ¦æ§æ¦±æ§æ§æ§æ¦æ§ æ¦æ§¿æ¨¯æ§æ¨æ¨æ©¥æ§²æ©æ¨¾æª æ©æ©æ¨µæªæ©¹æ¨½æ¨¨æ©æ©¼æªæªæª©æªæª«ç·çæ®æ®æ®æ®æ®æ®æ®æ®æ®æ®¡æ®ªè½«è½è½±è½²è½³è½µè½¶è½¸è½·è½¹è½ºè½¼è½¾è¾è¾è¾è¾è¾"], +["ea40","é",27,"é¬é¿éééééé é£",6,"é«é¬éé¯é°é·é¸é¹éºé¾éééééééééé"], +["ea80","ééééééé é£é¥é¦é«é",4,"é³é¸",12,"éééè¾è¾è¾è¾è¾è»æææææ¢æ¡æ¥æ¤æ¬è§ç¯ç´ç¿çççæ´æ®æ¯æ°æææ²æææç æ·ææ´æ±æ¶æµèææææææ¡ææ·æææ§ææ¾æææ¦æ©è´²è´³è´¶è´»è´½èµèµ èµèµèµèµèµèµèµè§è§è§è§è§è§è§è§ç®ççç¦ç¯ç¾ç¿çççççææ²æ°"], +["eb40","éééééééééé",9,"é¨",7,"é±é²é´éµé·é¸éºé»é¿éééééééééé",9,"é¡",6,"é«"], +["eb80","é¬éé®é°é±é²é´éµé¸éºé»é¼é½é¿ééé ééééééééé",4,"ééé æ¿æèæ¯ªæ¯³æ¯½æ¯µæ¯¹æ° æ°æ°æ°æ°æ°æ°æ°æ°¡æ°©æ°¤æ°ªæ°²æµææ«çççç°è¢åèèèè¼æè½è±è«èè´è·è§è¨è©èªèèèèèèæèè«è±è´èèèè²è¼æèè±è¶èè¬èè²è è è è ´è è è ±è è ©è ¼è ½è è §å¡åªµèèèæ»è£èªèæ¦èè»"], +["ec40","é¡",8,"é«é¬é®é¯é±é³",4,"éºé»é¼é½é¿",18,"ééééééééé£é¤é¦é§é¨éª",7], +["ec80","é²éµé·",4,"é½",7,"é",4,"ééééééééé",4,"èè¦æ¬¤æ¬·æ¬¹æææé£é£é£é£é£é£æ®³å½æ¯è§³æé½ææ¼æææææææççççç»çç·ç«ç±ç¨ççççç¯ç±ç ³ç ç ¨ç ç ²ç ç ¸ç ºçç³çµç¨ç ç çç§ç¹çç¨ç¬çç ¦ç¹æ¾æ½æææ礻ç¥ç¥ç¥ç¥ç¥ç¥ç¥ç¥¢ç¥ç¥ ç¥¯ç¥§ç¥ºç¦ ç¦ç¦ç¦§ç¦³å¿å¿"], +["ed40","ééé¡é¢é¤",6,"é¬é®é°é±é³éµ",46], +["ed80","é¤é¥é¨é®",4,"é´é·",23,"æ¼æææ§æææ£æ«æææ æ©ææææèè¿æ²æ³¶æ·¼ç¶ç¸ç ç ç ç ç æ«ç ç ç ç ¹ç ºç »ç ç ¼ç ¥ç ¬ç £ç ©ç¡ç¡ç¡ç¡ç ¦ç¡ç¡ç¡ç¡ªç¢ç¢ç¢ç¢ç¢ç¢¡ç¢£ç¢²ç¢¹ç¢¥ç£ç£ç£ç£¬ç£²ç¤ 磴ç¤ç¤¤ç¤ç¤´é¾é»¹é»»é»¼ç±ççç¹çççç¢ççç¦çµç¸çççççç¨"], +["ee40","é ",62], +["ee80","é¡",32,"ç¢ç¥ç¿çç½ççççç ç°çµç½çºçççççç²ç¹çç½ç½¡ç½è©ç½¨ç½´ç½±ç½¹ç¾ç½¾çç¥è ²é ééééééééééééééé£é¤é«éªéé¬é¯é°é²é´é¶",4,"é¼é½é¿éé",6,"éééééééééééé é¢é¤é¥é§é¨éª"], +["ef40","顯",5,"é¢é¢é¢é¢é¢é¢£é¢¨",37,"é£é£é£é£é£é£é£é£é£ ",4], +["ef80","飥飦飩",30,"é©é«é®é¯é³é´éµé·é¹é¼é½é¿éééééééééé",4,"éééééé¢éªé«é©é¬é±é²é´é¶é·é¸é¼é¾é¿ééµéé ééééééééééééééééé¡é¢é¤",8,"é¯é±é²é³éºç§ç¬éç§ç§ç§£ç§«ç¨åµç¨ç¨ç¨ç¨"], +["f040","é¤",4,"é¤é¤é¤",28,"餯",26], +["f080","é¥",9,"é¥",12,"饤饦饳饸饹饻饾é¦é¦é¦ç¨¹ç¨·ç©é»é¦¥ç©°ççççç¤çç ç¬é¸ 鸢鸨",4,"鸲鸱鸶鸸鸷鸹鸺鸾é¹é¹é¹é¹é¹é¹é¹é¹é¹é¹é¹é¹é¹é¹é¹é¹é¹é¹£é¹¦",6,"é¹±é¹é¹³çççç çç¬ç£ç³ç´ç¸çç±ç°ççççç£ç¨ç¦ç¤ç«ç§çç±ç¼ç¿ççç çççç¥ççç"], +["f140","é¦é¦é¦",10,"馦馧馩",47], +["f180","é§",32,"çç¼ç¢ç ççç°ç¿çµçç¾ç³çççççç«ç¯ç¿ç«¦ç©¸ç©¹çªçªçªçªçª¦çª 窬窨çªçª³è¡¤è¡©è¡²è¡½è¡¿è¢è¢¢è£è¢·è¢¼è£è£¢è£è££è£¥è£±è¤è£¼è£¨è£¾è£°è¤¡è¤è¤è¤è¤è¤´è¤«è¤¶è¥è¥¦è¥»çè¥ç²ç´çèèèèè è¢è¥è¦è§è©è¨è±èèµèèèèè©è±è¦é¡¸é¢é¢"], +["f240","駺",62], +["f280","騹",32,"é¢é¢é¢é¢é¢é¢é¢é¢é¢é¢¡é¢¢é¢¥é¢¦èèè¬è®è¿èºè¼è»è¨èèè¬èè§è£èªèè©è¶èèµèè°èºè±è¯èèè´è©è±è²èè³èèèè´èèèèèè¸èèèèè£è»èè¥è®èè¾èè´è±è©è·è¿èè¢è½è¾è»è è°èè®èèè£è¼è¤èè¥èè¯è¨è"], +["f340","é©",17,"驲éªéªéªéªéªéªéªéª¦éª©",6,"骲骳骴骵骹骻骽骾骿é«é«é«",4,"é«é«é«é«é«é«é«é«é«é«é«é«é«"], +["f380","é«é«é« 髢髣髤髥髧髨髩髪髬髮髰",8,"髺髼",6,"é¬é¬ é¬èèè èèèè«è¥è¬èµè³èèè½èèèèèªè è®è è è¾è è è ¡è ¹è ¼ç¼¶ç½ç½ç½ è竺竽ç¬ç¬ç¬ç¬ç¬ç¬«ç¬ç笸笪ç¬ç¬®ç¬±ç¬ 笥笤笳笾ç¬ççç çµççç ç®ç»ç¢ç²ç±ç®ç®¦ç®§ç®¸ç®¬ç®ç®¨ç® 箪ç®ç®¢ç®«ç®´ç¯ç¯ç¯ç¯ç¯ç¯¥ç¯¦ç¯ªç°ç¯¾ç¯¼ç°ç°ç°"], +["f440","é¬é¬",5,"é¬é¬é¬é¬",10,"é¬ é¬¡é¬¢é¬¤",10,"鬰鬱鬳",7,"鬽鬾鬿éééééééééé",5], +["f480","é",32,"ç°ç°ªç°¦ç°¸ç±ç±è¾èèèè¬è¡è¡è¢è£èè¯è¨è«è¸è»è³è´è¾èèèèèèè¨è¡¾è¢ è¢è£è£è¥ç¾ç¾ç¾§ç¾¯ç¾°ç¾²ç±¼æç²ç²ç²ç²ç²¢ç²²ç²¼ç²½ç³ç³ç³ç³ç³ç³ ç³ç³¨è®æ¨ç¾¿ç¿ç¿ç¿¥ç¿¡ç¿¦ç¿©ç¿®ç¿³ç³¸çµ·ç¶¦ç¶®ç¹çºéº¸éº´èµ³è¶è¶è¶è¶±èµ§èµè±è±é é é é é ¤"], +["f540","é¼",62], +["f580","é®»",32,"é ¢é ¡é °é ©é ¯é ½é ¾é ²é ´é ¹éé éééé¢é£éªéé®é¯éµé´éºè±é¹¾è¶¸è·«è¸ è¹è¹©è¶µè¶¿è¶¼è¶ºè·è·è·è·è·è·è·è·è·è·¬è··è·¸è·£è·¹è·»è·¤è¸è·½è¸è¸è¸è¸¬è¸®è¸£è¸¯è¸ºè¹è¸¹è¸µè¸½è¸±è¹è¹è¹è¹è¹è¹è¹°è¹¶è¹¼è¹¯è¹´èº èºèºèºèºèºè±¸è²è²è² è²è²æè§è§è§è§"], +["f640","é¯",62], +["f680","é°",32,"觥觫觯訾謦éé©é³é¯ééééééªéé°é¾é¾é¾é¾ ",5,"é¾é»¾é¼é¼é¹é¼é½ééç¿é éé®éé¾éªééé¾é«é±¿é²é² é²é²é²ç¨£é²é²é²é²é²é²é²é²é²é²",5,"é²¥",4,"鲫é²é²®é²°",7,"鲺鲻鲼鲽é³é³ é³é³é³é³"], +["f740","é°¼",62], +["f780","鱻鱽鱾é²é²é²é²é²é²é²é²é²é²é²é²é²é²ªé²¬é²¯é²¹é²¾",4,"é³é³é³é³é³é³é³ 鳡é³",4,"é³é³é³é³é³é³é³é³é³é³¢é¼é éééé¯é«é£é²é´éª±éª°éª·é¹éª¶éªºéª¼é«é«é« é«é«é«é«é éééééé飨é¤é¤®é¥é¥é«é«¡é«¦é«¯é««é«»é«é«¹é¬é¬é¬é¬é¬£éº½éº¾ç¸»éºéºéºéºéºééºéºé»é»é»é» é»é»¢é»©é»§é»¥é»ªé»¯é¼¢é¼¬é¼¯é¼¹é¼·é¼½é¼¾é½"], +["f840","é³£",62], +["f880","é´¢",32], +["f940","éµ",62], +["f980","é¶",32], +["fa40","鶣",62], +["fa80","é·¢",32], +["fb40","é¸",27,"鸤鸧鸮鸰鸴鸻鸼é¹é¹é¹é¹é¹é¹é¹é¹é¹é¹é¹ 鹡鹢鹥鹮鹯鹲鹴",9,"éº"], +["fb80","éºéºéºéº éºéºéºéº",5,"éº",8,"éºéº ",5,"麧麨麩麪"], +["fc40","麫",8,"麵麶麷麹麺麼麿",4,"é» é»é»é»é»é»é»é»é»é»é»é»é»é»é»é»é»¡é»£é»¤é»¦é»¨é»«é»¬é»é»®é»°",8,"黺黽黿",6], +["fc80","é¼",4,"é¼é¼é¼é¼é¼é¼é¼é¼é¼",5,"鼡鼣",8,"é¼é¼®é¼°é¼±"], +["fd40","é¼²",4,"鼸鼺鼼鼿",4,"é½ ",10,"é½",38], +["fd80","é½¹",5,"é¾é¾é¾",11,"é¾é¾é¾é¾¡",4,"郎凉ï¦ï§§ï§±"], +["fe40","ï¨ï¨ï¨ï¨ï¨ï¨ï¨ï¨ï¨ï¨ 﨡﨣﨤﨧﨨﨩"] +] diff --git a/node_modules/iconv-lite/encodings/tables/cp949.json b/node_modules/iconv-lite/encodings/tables/cp949.json new file mode 100644 index 0000000..2022a00 --- /dev/null +++ b/node_modules/iconv-lite/encodings/tables/cp949.json @@ -0,0 +1,273 @@ +[ +["0","\u0000",127], +["8141","ê°ê°ê° ê°ê°",4,"ê°ê°ê°ê°¡ê°¢ê°£ê°¥",6,"갮갲갳갴"], +["8161","갵갶갷갺갻갽갾갿ê±",9,"ê±ê±",5,"ê±"], +["8181","ê±ê±ê±ê±ê±ê±",18,"걲걳걵걶걹걻",4,"ê²ê²ê²ê²ê²ê²ê²ê²ê²ê²",6,"ê²ê²¢",5,"겫ê²ê²®ê²±",6,"겺겾겿ê³ê³ê³ê³ ê³ê³ê³ê³ê³ê³",7,"ê³ê³",7,"곢곣곥곦곩곫ê³ê³®ê³²ê³´ê³·",4,"곾곿ê´ê´ê´ê´ ê´",4,"ê´ê´ê´ê´"], +["8241","ê´ê´ê´ê´ê´ê´ê´ê´ê´ê´ê´¡",7,"괪괫괮",5], +["8261","괶괷괹괺괻괽",6,"êµêµêµ",5,"êµêµêµêµêµêµ"], +["8281","êµ",7,"굢굤",7,"굮굯굱굲굷굸굹굺굾ê¶ê¶",4,"ê¶ê¶ê¶ê¶ê¶ê¶",10,"ê¶",5,"궥",17,"궸",7,"ê·ê·ê· ê·ê·ê·",6,"ê·ê·",7,"ê·ê·ê·ê·¡ê·¢ê·£ê·¥",18], +["8341","귺귻귽귾ê¸",5,"ê¸ê¸ê¸",5,"ê¸",7], +["8361","ê¸",18,"긲긳긵긶긹긻긼"], +["8381","긽긾긿ê¹ê¹ê¹ê¹ê¹ê¹ê¹ê¹ê¹ê¹ê¹ê¹",4,"ê¹ê¹¢ê¹£ê¹¤ê¹¦ê¹§ê¹ªê¹«ê¹ê¹®ê¹¯ê¹±",6,"깺깾",5,"êº",5,"êº",46,"꺿ê»ê»ê»ê» ",6,"ê»ê»",5,"ê»ê»ê»",8], +["8441","껦껧껩껪껬껮",5,"껵껶껷껹껺껻껽",8], +["8461","ê¼ê¼ê¼ê¼ê¼ê¼ê¼ê¼",18], +["8481","꼤",7,"꼮꼯꼱꼳꼵",6,"ê¼¾ê½ê½ê½ ê½ê½ê½",5,"ê½",10,"ê½",5,"꽦",18,"꽺",5,"ê¾ê¾ê¾ê¾ ê¾ê¾ê¾",6,"ê¾ê¾ê¾ê¾",5,"ê¾",26,"꾺꾻꾽꾾"], +["8541","꾿ê¿",5,"ê¿ê¿ê¿",4,"ê¿",6,"ê¿",4], +["8561","ê¿¢",5,"꿪",5,"꿲꿳꿵꿶꿷꿹",6,"ëë"], +["8581","ë ",6,"ëëëëëëë",6,"ë",9,"ë©",26,"ëëëëëëëëëëëëëëë",29,"ë¾ë¿ëëëë ",6,"ëëë",5,"ëëëë£ë¤"], +["8641","ë¥ë¦ë§ëªë°ë²ë¶ë·ë¹ëºë»ë½",6,"ëë",5,"ë"], +["8661","ëëëëë",6,"ë¡ë¢ë£ë¤ë¦",10], +["8681","ë±",22,"ëëëëëëëëëëë",4,"ë¦ë§ë©ëªë«ë",6,"ë¶ëº",5,"ë ë ë ë ë ë ",6,"ë ë ë ë ë ë ë ë ë ë ë ¡",22,"ë ºë »ë ½ë ¾ë ¿ëë",4,"ëëëëëëëëëëëëë"], +["8741","ë",9,"ë©",15], +["8761","ë¹",18,"ëëëëëëë"], +["8781","ë",5,"ëë ",7,"ëªë«ëë®ë¯ë±",7,"ëºë¼ë¾",5,"ëëëëë",6,"ëëë",5,"ë¡",18,"ëµ",6,"ë½",26,"ëëëëëëë¡",6,"ëª",4], +["8841","ë¯",4,"ë¶",5,"ë½",6,"ëëëë",4], +["8861","ëëëëëëë",4,"ë¢ë¤ë§ë¨ë©ë«ëë®ë¯ë±ë²ë³ëµë¶ë·"], +["8881","ë¸",15,"ëëëëëëë",4,"ëëëëë ë¡ë£ë§ë©ëªë°ë±ë²ë¶ë¼ë½ë¾ëëë ëëë",6,"ëë",5,"ë",54,"ëëëëë ë¡ë¢ë£"], +["8941","ë¦ë¨ëªë¬ëë¯ë²ë³ëµë¶ë·ë¹",6,"ëë",5,"ë"], +["8961","ëëëëëë",10,"ë¢",5,"ë©ëªë«ë"], +["8981","ë®",21,"ëëëëëëëëëëëëëëëë¡ë¢ë£ë¥ë¦ë§ë©",18,"ë½",18,"ë",6,"ëëëëëëë¡",6,"ëªë¬",7,"ëµ",15], +["8a41","ë ",10,"ëëëëëë",6,"ë¢ë¤ë¦"], +["8a61","ë§",4,"ë",18,"ëë"], +["8a81","ë",4,"ë",19,"ë",5,"ë¥ë¦ë§ë©ëªë«ë",7,"ë¶ë¸ëº",5,"ëëëë ëëë",6,"ëëëëë",5,"ëëë¡ë¢ë¥ë§",4,"ë®ë°ë²",5,"ë¹",26,"ëëëëë"], +["8b41","ë",5,"ë¦ë«",4,"ë²ë³ëµë¶ë·ë¹",6,"ëë"], +["8b61","ëëëëëëëëëë",6,"ëë¢",8], +["8b81","ë«",52,"ë¢ë£ë¥ë¦ë§ë©ë¬ëë®ë¯ë²ë¶",4,"ë¾ë¿ëëëë ",6,"ëë",5,"ë",18,"ë",18], +["8c41","ë",15,"ëëëëëë",4], +["8c61","ë",6,"ë¦",5,"ë",6,"ëµ",5], +["8c81","ë»",12,"ë",26,"ë¥ë¦ë§ë©",50,"ëëë¡ë¢ë£ë¥",5,"ëë®ë¯ë°ë²",16], +["8d41","ë",16,"ë",8], +["8d61","ë",17,"ë±ë²ë³ëµë¶ë·ë¹ëº"], +["8d81","ë»",4,"ëëëë",33,"ëªë«ëë®ë±",6,"ëºë¼",7,"ë ëëëëëë",6,"ë",9,"ë¡ë¢ë£ë¥ë¦ë§ë©",6,"ë²ë´ë¶",5,"ë¾ë¿ëëëë ",6,"ëëëëëëëë"], +["8e41","ëë¡",6,"ëªë®",5,"ë¶ë·ë¹",8], +["8e61","ë",4,"ëë",19], +["8e81","ë",13,"ë®ë¯ë±ë²ë³ëµ",6,"ë¾ë ",4,"ë ë ë ë ë ë ",6,"ë ë ë ",5,"ë ¦ë §ë ©ë ªë «ë ",6,"ë ¶ë º",5,"ë¡ë¡ë¡ë¡ ",11,"ë¡ë¡",7,"ë¡ë¡ë¡¡ë¡¢ë¡£ë¡¥",6,"롮롰롲",5,"롹롺롻롽",7], +["8f41","ë¢ ",7,"ë¢",17], +["8f61","ë¢ ",7,"뢩",6,"뢱뢲뢳뢵뢶뢷뢹",4], +["8f81","뢾뢿ë£ë£ë£",5,"ë£ë£ë£ë£ë£ë£ë£",7,"ë£ë£ 룢",5,"룪룫ë£ë£®ë£¯ë£±",6,"룺룼룾",5,"ë¤ ",18,"ë¤",6,"뤡",26,"뤾뤿ë¥ë¥ë¥ë¥ ",6,"ë¥ë¥ë¥ë¥",5], +["9041","ë¥ë¥ë¥ë¥ë¥ë¥¡",6,"륪륬륮",5,"륶륷륹륺륻륽"], +["9061","륾",5,"ë¦ë¦ë¦ë¦ë¦",15], +["9081","ë¦",12,"릮릯릱릲릳릵",6,"릾ë§ë§",5,"ë§ë§ë§ë§",4,"ë§ë§ë§ë§ 맢맦맧맩맪맫ë§",6,"맶맻",4,"ë¨",5,"ë¨",11,"ë¨",33,"먺먻먽먾먿ë©ë©ë©ë© ë©"], +["9141","ë©ë©ë©ë©ë©ë©ë©ë©ë©ë©ë©ë©ë©",6,"멦멪",5], +["9161","멲멳멵멶멷멹",9,"ëªëªëªëªëªëª",5], +["9181","ëª",20,"몪ëªëª®ëª¯ëª±ëª³",4,"몺몼몾",5,"ë« ë«ë«ë«",14,"ë«",33,"뫽뫾뫿ë¬ë¬ë¬ë¬ ",7,"ë¬ë¬ë¬",5,"ë¬ë¬ë¬ë¬ë¬ë¬ë¬¡",6], +["9241","묨묪묬",7,"묷묹묺묿",4,"ëëëëëëëë"], +["9261","ëëëëë",7,"ë¢ë¤",7,"ë",4], +["9281","ë²",21,"ë®ë®ë®ë®ë®ë®ë®",18,"뮥뮦뮧뮩뮪뮫ë®",6,"뮵뮶뮸",7,"ë¯ë¯ë¯ë¯ ë¯ë¯ë¯",6,"ë¯ë¯ë¯",35,"믺믻믽믾ë°"], +["9341","ë°",4,"ë°ë°ë°ë°ë°ë°ë°ë° 밡밢밣밦밨밪밫밬밮밯밲밳밵"], +["9361","밶밷밹",6,"ë±ë±ë±ë±ë±ë±ë±ë±ë±",8], +["9381","ë±ë±ë±ë±",37,"ë²ë²ë²ë²ë²ë²",4,"ë²ë²ë²",4,"벢벣벥벦벩",6,"벲벶",5,"벾벿ë³ë³ë³ë³ ",7,"ë³ë³ë³ë³ë³ë³ë³ë³ë³ë³",22,"볷볹볺볻볽"], +["9441","ë³¾",5,"ë´ë´ë´",5,"ë´ë´ë´ë´",8], +["9461","ë´",5,"ë´¥",6,"ë´",12], +["9481","ë´º",5,"ëµ",6,"ëµëµëµëµëµëµ",6,"ëµ",9,"뵥뵦뵧뵩",22,"ë¶ë¶ë¶ ë¶ë¶",4,"ë¶ë¶ë¶ë¶ë¶ë¶ë¶",6,"붥",10,"붱",6,"붹",24], +["9541","ë·ë·ë·ë·ë·ë·ë·ë·",11,"ë·ª",5,"ë·±"], +["9561","뷲뷳뷵뷶뷷뷹",6,"ë¸ë¸ë¸ë¸",5,"ë¸ë¸ë¸ë¸ë¸"], +["9581","ë¸",6,"ë¸ë¸ ",35,"ë¹ë¹ë¹ë¹ë¹ë¹ë¹",4,"ë¹ë¹ë¹ë¹ë¹ë¹ë¹¢ë¹£ë¹¥ë¹¦ë¹§ë¹©ë¹«",4,"빲빶",4,"빾빿ëºëºëºëº ",6,"ëºëº",5,"ëº",13,"뺩",14], +["9641","뺸",23,"ë»ë»"], +["9661","ë»ë»ë»",6,"뻡뻢뻦",5,"ë»",8], +["9681","뻶",10,"ë¼",5,"ë¼",13,"ë¼ë¼",33,"ë½ë½ë½ ë½ë½ë½",6,"ë½ë½ë½ë½",44], +["9741","ë¾",16,"ë¾",8], +["9761","ë¾",17,"ë¾±",7], +["9781","ë¾¹",11,"ë¿",5,"ë¿ë¿ë¿ë¿ë¿ë¿",6,"ë¿ë¿ë¿ ë¿¢",89,"ì½ì¾ì¿"], +["9841","ì",16,"ì",5,"ììì"], +["9861","ìììì¡",6,"ìª",15], +["9881","ìº",21,"ìììììì",6,"ì¢ì¤ì¦",5,"ì®ì±ì²ì·",4,"ì¾ììììììììììì",6,"ìì",5,"ì¦ì§ì©ìªì«ì",6,"ì¶ì¸ìº",5,"ìììì ììì",6,"ììììì",5,"ì¡ì¢ì¥ì¨ì©ìªì«ì®"], +["9941","ì²ì³ì´ìµì·ìºì»ì½ì¾ì¿ì ",6,"ì ì ",5,"ì ì "], +["9961","ì ì ì ì ",6,"ì ¦ì ª",5,"ì ±ì ²ì ³ì µì ¶ì ·ì ¹ì ºì »"], +["9981","ì ¼",8,"ì",5,"ìììììì",4,"ìì ì¢ì£ì¤ì¦ì§ìªì«ìì®ì¯ì±",11,"ì¾",5,"ì ìììììì",6,"ììì",6,"ì¡ì¢ì£ì¥ì¦ì§ì©",6,"ì²ì´",7,"ì¾ì¿ìììì ",6,"ììì",5,"ììììì¡ì¢ì£"], +["9a41","ì¤ì¥ì¦ì§ìªì¬ì®ì°ì³ìµ",16], +["9a61","ììì",6,"ìììììì",6,"ì¡ì¢ì£ì¤ì¦"], +["9a81","ì§",4,"ì®ì¯ì±ì²ì³ìµ",6,"ì¾ìì",5,"ì",5,"ì",6,"ìììì",5,"ì¦ì§ì©ìªì«ì®",5,"ì¶ì¸ìº",33,"ììì¡ì¢ì¥",5,"ì®ì°ì²ì³ì´ìµì·ìºì½ì¾ì¿ì",6,"ìììì"], +["9b41","ììììììììì",6,"ì¦ì§ìª",8], +["9b61","ì³",17,"ì",7], +["9b81","ì",25,"ìªì«ìì®ì¯ì±ì³",4,"ìºì»ì¾",5,"ì ìììììì",50,"ì",22,"ì"], +["9c41","ìììì¡ì£",4,"ìªì«ì¬ì®",5,"ì¶ì·ì¹",5], +["9c61","ì¿",8,"ì",6,"ì",9], +["9c81","ì",8,"ì¥",6,"ìì®ì¯ì±ì²ì³ìµ",6,"ì¾",9,"ì",26,"ì¦ì§ì©ìªì«ì",6,"ì¶ì·ì¸ìº",5,"ì",18,"ì",6,"ì",12], +["9d41","ìª",13,"ì¹ìºì»ì½",8], +["9d61","ì",25], +["9d81","ì ",8,"ìª",5,"ì²ì³ìµì¶ì·ì¹ì»ì¼ì½ì¾ì",9,"ììììììì",6,"ì",10,"ìªì«ìì®ì¯ì±",6,"ìºì¼ì¾",5,"ììììììììììììì¢ì£ì¥ì¦ì§ì©",6,"ì²ì¶",5,"ì¾ì¿ìììì ìììììììììì"], +["9e41","ìììììììì¡",7,"ìª",9,"ì¶"], +["9e61","ì·ìºì¿",4,"ììììììììì",6,"ì¢ì¤ì¦ì§"], +["9e81","ì¨ì©ìªì«ì¯ì±ì²ì³ìµì¸ì¹ìºì»ìììììììììì",6,"ìì",6,"ì¦ì§ì©ìªì«ì¯ì±ì²ì¶ì¸ìºì¼ì½ì¾ì¿ììì ììì",6,"ìì",5,"ììì¡",10,"ìì®ì°ì²",5,"ìºì»ì½ì¾ì¿ì",6,"ììì",5,"ìììììì",6,"ì¦"], +["9f41","ì¨ìª",5,"ì²ì³ìµì¶ì·ì»",4,"ììì",5,"ì"], +["9f61","ììììì",6,"ììì¢",5,"ìªì«ìì®ì¯ì±ì²"], +["9f81","ì³",4,"ìºì»ì¼ì¾",5,"ìììììì",6,"ììì",5,"ì¢ì£ì¥ì¦ì§ì©",6,"ì²ì´ì¶ì¸ì¹ìºì»ì¾ì¿ìììì ",4,"ìììììììììì¡",6,"ì©ìªì¬",7,"ì¶ì·ì¹ìºì»ì¿ììììììììììììì",4,"ì¢ì§",4,"ì®ì¯ì±ì²ì³ìµì¶ì·"], +["a041","ì¸ì¹ìºì»ì¾ì",5,"ììììì",6,"ìììì"], +["a061","ì",5,"ì¥ì¦ì§ì©ìªì«ì",13], +["a081","ì»",4,"ì ì ì ì ì ì ì ",4,"ì ì ì ",4,"ì ì ì ¡ì ¢ì £ì ¥",6,"ì ®ì °ì ²",5,"ì ¹ì ºì »ì ½ì ¾ì ¿ì¡",6,"ì¡ì¡ì¡",5,"ì¡",26,"졲졳졵졶졷졹졻",4,"ì¢ì¢ì¢ì¢ì¢ì¢",5,"ì¢",7,"ì¢ì¢ 좢좣좤"], +["a141","좥좦좧좩",18,"좾좿ì£ì£"], +["a161","ì£ì£ì£ ì£ì£ì£ì£ì£ì£",6,"ì£ì£ì£",5,"죢죣죥"], +["a181","죦",14,"죶",5,"죾죿ì¤ì¤ì¤ì¤",4,"ì¤ããã·â¥â¦Â¨ãÂââ¥ï¼¼â¼ââââããã",9,"±Ã÷â â¤â¥ââ´Â°â²â³ââ«ï¿ ï¿¡ï¿¥âââ â¥ââââ¡â§â»ââ ââââââ¡â â³â²â½â¼âââââãâªâ«ââ½ââµâ«â¬âââââââªâ©â§â¨ï¿¢"], +["a241","ì¤ì¤",5,"ì¤",18], +["a261","ì¤",6,"줵",18], +["a281","ì¥",7,"ì¥ì¥ì¥ì¥ì¥ì¥",6,"쥢쥤",7,"ì¥ì¥®ì¥¯ââââ´ï½ËËËË˸ˡ¿Ëâ®ââ¤ââ°âââ·â¶â¤â â¡â¥â§â£âââ£ââââ¤â¥â¨â§â¦â©â¨ââââ¶â â¡âââââââ©âªâ¬ã¿ãâãâ¢ããâ¡â¬Â®"], +["a341","쥱쥲쥳쥵",6,"쥽",10,"ì¦ì¦ì¦ì¦ì¦"], +["a361","ì¦",6,"ì¦ì¦ì¦",16], +["a381","즯",16,"ì§ì§ì§ ì§ì§ì§",4,"ì§ì§ì§ì§ì§ï¼",58,"₩]",32,"ï¿£"], +["a441","ì§ì§ì§¡ì§£ì§¥ì§¦ì§¨ì§©ì§ªì§«ì§®ì§²",5,"짺짻짽짾짿ì¨ì¨ì¨ì¨"], +["a461","ì¨ ì¨ì¨ì¨ì¨",5,"ì¨ì¨ì¨ì¨",12], +["a481","쨦쨧쨨쨪",28,"ã±",93], +["a541","ì©",4,"ì©ì©ì©ì©ì©ì©",6,"ì©ì©¢",5,"쩩쩪"], +["a561","ì©«",17,"쩾",5,"ìª ìª"], +["a581","ìª",16,"ìª",14,"â °",9], +["a5b0","â ",9], +["a5c1","Î",16,"Σ",6], +["a5e1","α",16,"Ï",6], +["a641","쪨",19,"쪾쪿ì«ì«ì«ì« "], +["a661","ì«",5,"ì«ì«ì«ì«ì«ì«ì«ì«",5,"ì«¡",6], +["a681","쫨쫩쫪쫫ì«",6,"쫵",18,"ì¬ì¬ââââââââ¬â¤â´â¼âââââââ£â³â«â»ââ â¯â¨â·â¿ââ°â¥â¸ââââââââââââ¡â¢â¦â§â©âªââ®â±â²âµâ¶â¹âºâ½â¾âââ",7], +["a741","ì¬",4,"ì¬ì¬ì¬ì¬ì¬ì¬ì¬",6,"쬢",7], +["a761","쬪",22,"ììì"], +["a781","ì ìììììììì",6,"ìììì",5,"ì¥",7,"ãããâããã£ã¤ã¥ã¦ã",9,"ããããããããã§ã¨ã°",9,"ã",4,"ãº",5,"ã",4,"â¦ããããããã ãã®ã¯ãã©ãªã«ã¬ããããããã"], +["a841","ì",10,"ìº",14], +["a861","ì®",18,"ì®",6], +["a881","쮤",19,"쮹",11,"ÃêĦ"], +["a8a6","IJ"], +["a8a8","Ä¿ÅÃźÃŦÅ"], +["a8b1","ã ",27,"â",25,"â ",14,"½â â ¼¾â â â â "], +["a941","ì¯ ",14,"ì¯",10], +["a961","ì¯ ì¯¡ì¯¢ì¯£ì¯¥ì¯¦ì¯¨ì¯ª",18], +["a981","쯽",14,"ì°ì°ì°ì°ì°ì°",6,"ì°ì°ì° 찣찤æÄðħıijĸÅÅøÅÃþŧÅÅã",27,"â",25,"â´",14,"¹²³â´â¿ââââ"], +["aa41","찥찦찪찫ì°ì°¯ì°±",6,"찺찿",4,"ì±ì±ì±ì±ì±ì±ì±"], +["aa61","ì±",4,"ì±ì±",5,"챡챢챣챥챧챩",6,"챱챲"], +["aa81","챳챴챶",29,"ã",82], +["ab41","ì²ì²ì²ì²ì²ì²ì²ì²ì²ì²¡",6,"첪첮",5,"첶첷첹"], +["ab61","첺첻첽",6,"ì³ì³ì³",5,"ì³ì³ì³ì³",5], +["ab81","ì³",8,"ì³¥",6,"ì³ì³®ì³¯ì³±",12,"ã¡",85], +["ac41","쳾쳿ì´ì´",5,"ì´ì´ì´ì´ì´ì´",6,"ì´ì´ì´ì´ì´ "], +["ac61","촡촢촣촥촦촧촩촪촫ì´",11,"ì´º",4], +["ac81","ì´¿",28,"ìµìµìµÐ",5,"ÐÐ",25], +["acd1","а",5,"Ñж",25], +["ad41","쵡쵢쵣쵥",6,"쵮쵰쵲",5,"ìµ¹",7], +["ad61","ì¶",6,"ì¶",10,"ì¶ì¶ì¶ì¶ì¶ì¶ì¶ì¶"], +["ad81","ì¶ ì¶¡ì¶¢ì¶£ì¶¦ì¶¨ì¶ª",5,"춱",18,"ì· "], +["ae41","ì·",5,"ì·ì·ì·ì·",16], +["ae61","ì·¢",5,"췩췪췫ì·ì·®ì·¯ì·±",6,"췺췼췾",4], +["ae81","ì¸ì¸ ì¸ì¸ì¸ì¸ì¸ì¸",6,"ì¸ì¸ì¸ì¸ì¸",5,"츢츣츥츦츧츩츪츫"], +["af41","츬ì¸ì¸®ì¸¯ì¸²ì¸´ì¸¶",19], +["af61","ì¹",13,"ì¹ì¹ì¹ì¹ì¹¢",5,"칪칬"], +["af81","ì¹®",5,"칶칷칹칺칻칽",6,"ìºìºìº",5,"ìºìºìºìºìºìº"], +["b041","ìº",5,"캢캦",5,"캮",12], +["b061","캻",5,"ì»",19], +["b081","ì»",13,"컦컧컩컪ì»",6,"컶컺",5,"ê°ê°ê°ê°ê°ê°ê°ê°",7,"ê°",4,"ê° ê°¤ê°¬ê°ê°¯ê°°ê°±ê°¸ê°¹ê°¼ê±ê±ê±ê±ê±ê±ê±°ê±±ê±´ê±·ê±¸ê±ºê²ê²ê²ê²ê² ê²ê²ê²ê²ê²ê²ê²ê²ê²ê²ê² 겡겨격겪견겯결겸겹겻겼경ê³ê³ê³ê³ê³ê³ê³ 곡곤곧골곪곬곯곰곱곳공곶과곽ê´ê´ê´"], +["b141","ì¼ì¼ì¼ ì¼ì¼ì¼",6,"ì¼ì¼ì¼",5,"ì¼ì¼ì¼ì¼¡ì¼¢ì¼£"], +["b161","ì¼¥",6,"켮켲",5,"ì¼¹",11], +["b181","ì½ ",14,"ì½ì½ì½ì½ì½ì½",6,"콦콨콪콫콬ê´ê´ê´ê´ê´ê´ê´ ê´©ê´¬ê´ê´´ê´µê´¸ê´¼êµêµ êµêµêµêµêµêµ¡êµ£êµ¬êµêµ°êµ³êµ´êµµêµ¶êµ»êµ¼êµ½êµ¿ê¶ê¶ê¶ê¶ê¶ê¶ê¶ê¶ê¶¤ê¶·ê·ê·ê·ê·ê·ê·ê·ê·ê· 귤그극근귿ê¸ê¸ê¸ê¸ê¸ê¸ê¸ê¸°ê¸±ê¸´ê¸·ê¸¸ê¸ºê¹ê¹ê¹ê¹ ê¹ê¹ê¹ê¹ê¹ê¹ê¹ê¹ê¹ê¹ê¹ê¹ 깡깥깨깩깬깰깸"], +["b241","ì½ì½®ì½¯ì½²ì½³ì½µì½¶ì½·ì½¹",6,"ì¾ì¾ì¾ì¾ì¾",5,"ì¾"], +["b261","ì¾",18,"ì¾¢",5,"쾩"], +["b281","쾪",5,"ì¾±",18,"ì¿ ",6,"깹깻깼깽êºêº êºêº¼êº½êº¾ê»ê»ê»ê»ê»ê»ê»ê»ê»ê»ê»¨ê»«ê»ê»´ê»¸ê»¼ê¼ê¼ê¼ê¼ê¼¬ê¼ê¼°ê¼²ê¼´ê¼¼ê¼½ê¼¿ê½ê½ê½ê½ê½ê½ê½ê½ê½¤ê½¥ê½¹ê¾ê¾ê¾ê¾ê¾ê¾ê¾ê¾¸ê¾¹ê¾¼ê¿ê¿ê¿ê¿ê¿ê¿ê¿ê¿ê¿ê¿¨ê¿©ê¿°ê¿±ê¿´ê¿¸ëëëëëëëëë¨ëë ëëëëëëëëë"], +["b341","ì¿",19,"쿢쿣쿥쿦쿧쿩"], +["b361","쿪",5,"쿲쿴쿶",5,"쿽쿾쿿íííí ",5], +["b381","í",5,"í",5,"í",19,"ëë¼ë½ëëëëëëëëëëëë ë¡ë¢ë¨ë©ë«",4,"ë±ë³ë´ëµë¸ë¼ëë ëëëëëëëë ë¥ëëëëëëëëëëëëë£ë¤ë¥ë¨ë¬ë´ëµë·ë¸ë¹ë ë ë ë ë ë ë ë ë ë ë ë ¸ë ¹ë ¼ëëëëëëëëëëëë¨ëëëëë"], +["b441","í®",5,"í¶í·í¹íºí»í½",6,"ííí",5], +["b461","ííííííí",6,"í¡",10,"í®í¯"], +["b481","í±í²í³íµ",6,"í¾í¿íí",18,"ëë¨ë©ë¬ë°ë¹ë»ë½ëë ëëëëëëëë ë´ë¼ëëë ë¨ë©ë´ëµë¼ëë ëëëëëëëë ë¡ë£ë¥ë¦ëªë¬ë°ë´ëëëëëëëëëë¢ë¤ë¥ë¦ë¨ë«",4,"ë³ë´ëµë·",4,"ë¿ëëëëëëëëëëëëëëëëëëë¤ë¥"], +["b541","í",14,"í¦í§í©íªí«í",5], +["b561","í³í¶í¸íº",5,"ííí ííí",5,"íí",4], +["b581","íííí¡í¢í£í¥",6,"í®í²",5,"í¹",11,"ë§ë©ë«ë®ë°ë±ë´ë¸ëëëëë ëëëë ë¡ë¨ë¬ëë ëëëëëëëëëëëë ë¤ë¨ë¼ëëëë ë¨ë©ë«ë´ëëëëë ë¡ë£ë¥ë¬ëëëë¤ë¨ë¬ëµë·ë¹ëëëëëëëë ë£ë¤ë¦ë¬ëë¯ë±ë¸ëëëëëë¤ë¥ë§ë¨ë©ëªë°ë±ë´ë¸"], +["b641","í ",7,"í",17], +["b661","í ",15,"í²í³íµí¶í·í¹í»í¼í½í¾"], +["b681","í¿í í ",5,"í í í í í í ",6,"í í í ¢",5,"í ©í ªí «í ëëëëë ëëëëëëëëë ë¡ë ë¡ë¤ë¨ëªë«ë°ë±ë³ë´ëµë»ë¼ë½ëëëëëëëëë¬ëëëëë¥ë¬ë´ëë¤ë¨ëëë ë¤ë«ë¬ë±ëë°ë´ë¸ëëë ë¨ë©ë¬ë¯ë°ë¸ë¹ë»ëëëëëë ë¤ë¨ë°ë±ë³ëµë¼ë½ëëëëëëëëëë"], +["b741","í ®",13,"í ½",6,"í íííí"], +["b761","í",20,"í¢í£í¥í¦í§"], +["b781","í©",6,"í²í´í¶í·í¸í¹í»í½í¾í¿í",14,"ëëëë ë¨ë©ë«ë¬ëë´ëµë¸ëëë¬ëë°ë´ë¼ë½ë¿ë ë ë ë ë ë ë ë ë ë ë ë ¤ë ¥ë ¨ë ¬ë ´ë µë ·ë ¸ë ¹ë¡ë¡ë¡ë¡ë¡ë¡ë¡ 롤롬ë¡ë¡¯ë¡±ë¡¸ë¡¼ë¢ë¢¨ë¢°ë¢´ë¢¸ë£ë£ë£ë£ ë£ë£ë£ë£ë£ë£¡ë£¨ë£©ë£¬ë£°ë£¸ë£¹ë£»ë£½ë¤ë¤ë¤ 뤼뤽ë¥ë¥ë¥ë¥ë¥ë¥ë¥ë¥ë¥ 륨륩"], +["b841","í",7,"í",17], +["b861","í«",8,"íµí¶í·í¹",13], +["b881","íí",5,"í",24,"륫ë¥ë¥´ë¥µë¥¸ë¥¼ë¦ë¦ ë¦ë¦ë¦ë¦ë¦ë¦¬ë¦ë¦°ë¦´ë¦¼ë¦½ë¦¿ë§ë§ë§ë§ë§",4,"ë§ë§ë§ë§ë§ë§¡ë§£ë§¤ë§¥ë§¨ë§¬ë§´ë§µë§·ë§¸ë§¹ë§ºë¨ë¨ë¨ë¨ë¨¸ë¨¹ë¨¼ë©ë©ë©ë©ë©ë©ë©ë©ë©ë©ë©ë©ë©¤ë©¥ë©§ë©¨ë©©ë©°ë©±ë©´ë©¸ëªëªëª ëªëªëª¨ëª©ëª«ëª¬ëª°ëª²ëª¸ëª¹ëª»ëª½ë«ë«ë«ë«ë«¼"], +["b941","íªí«í®í¯í±í²í³íµ",6,"í¾íí",5,"íííí"], +["b961","í",14,"í",6,"í¥í¦í§í¨"], +["b981","í©",22,"ííí ííííííë¬ë¬ë¬ë¬ë¬ë¬ë¬ë¬ 묩묫무묵묶문묻물묽묾ëë ëëëëëëëë¡ë£ë¬ë®ë®ë®ë®¤ë®¨ë®¬ë®´ë®·ë¯ë¯ë¯ë¯ë¯ë¯¸ë¯¹ë¯¼ë¯¿ë°ë°ë°ë°ë°ë°ë°ë°ë°ë°",4,"ë°",4,"밤밥밧방ë°ë°°ë°±ë°´ë°¸ë±ë±ë±ë±ë± ë±ë±ë±ë±ë±ë²ë² ë²ë²ë²ë²ë²ë²ë²"], +["ba41","ííííííí",5,"íííí¡í¢í£í¥",6,"í"], +["ba61","í®í¯í°í²",5,"íºí»í½í¾íí",4,"íí",5], +["ba81","ííííííííí",6,"í¦",9,"í²í³íµí¶í·í¹íºë²ë²ë² 벡벤벧벨벰벱벳벴벵벼벽ë³ë³ë³ë³ë³ë³ë³ë³ë³ë³´ë³µë³¶ë³¸ë³¼ë´ë´ ë´ë´ë´ë´ë´¤ë´¬ëµëµëµëµëµëµëµëµ¤ëµ¨ë¶ë¶ë¶ë¶ë¶ë¶ë¶ë¶ë¶ë¶ë¶ë¶ë¶ë¶ë¶¤ë¶°ë¶¸ë·ë·ë·ë·ë·©ë·°ë·´ë·¸ë¸ë¸ë¸ ë¸ë¸ë¸ë¸ë¸ë¸ë¸ë¹ë¹ ë¹ë¹ë¹ë¹ë¹ë¹ë¹ë¹ë¹ë¹ 빡빤"], +["bb41","í»",4,"ííí",5,"íííííí",4,"íí¢í£"], +["bb61","í¤í¦í§íªí«íí®í¯í±",6,"íºí¾",5,"íííí"], +["bb81","í",31,"빨빪빰빱빳빴빵빻빼빽ëºëºëºëºëºëºëºëºëºëº¨ë»ë»ë»ë»ë»ë» 뻣뻤뻥뻬ë¼ë¼ë¼ë¼ë¼ë¼ë¼ë¼ë½ë½ë½ë½ë½ë½ë½ë¾ë¾°ë¿ ë¿ë¿ë¿ë¿ë¿ë¿ë¿¡ì¼ìììì ì¨ì©ììììì ì¡ì£ì¥ì¬ìì¯ì°ì³ì´ìµì¶ì¼ì½ì¿ììì ìììììììììì¤"], +["bc41","íª",17,"í¾í¿íííí íí"], +["bc61","íííííí",5,"íííííí¡",6,"íªí¬í®"], +["bc81","í¯",4,"íµí¶í·í¹íºí»í½",6,"ííí",5,"í",5,"ì¥ì¨ì¬ì´ìµì·ì¹ìììììì",4,"ì£ì¤ì¦ì§ì¬ìì¯ì°ì±ì¶ì¸ì¹ì¼ì ì ì ì ì ì ì ì ì ì ì ¤ì ¥ì §ì ¨ì ©ì °ì ´ì ¸ì ìììììììììì¡ì¥ì¨ì©ì¬ì°ì½ììììììì ì¤ì¨ì°ì±ì³ì¼ì½ììììììììììì ì¨ì©ì«ì"], +["bd41","íí",7,"í¢í¤",7,"í®í¯í±í²í³íµí¶í·"], +["bd61","í¸í¹íºí»í¾íí",5,"í",13], +["bd81","í",5,"í",25,"ì¯ì±ì²ì´ìììììì ì¥ì¬ìì°ì´ì¼ì½ì¿ìììììììì¤ì¥ì¨ì¬ìì´ìµì·ì¹ììì ì£ì¤ì«ì¬ìì¯ì±ì¶ì¸ì¹ì»ì¼ììììììììììì¤ì¥ì¨ì©ì ì¨ì©ì¬ì°ì²ì¸ì¹ì¼ì½ììììììììì ì¢ì¨ì©ìì´ìµì¸ììì¤ì¬ì°"], +["be41","í¸",7,"íííí ",14], +["be61","í",7,"íííí¡í¢í£í¥",7,"í®í°í±í²"], +["be81","í³",4,"íºí»í½í¾íí",4,"ííí",5,"í",8,"ì´ì¼ì½ìì¤ì¥ì¨ì¬ì´ìµì¹ìììì¸ì¼ì©ì°ì±ì´ì¸ìºì¿ììììììì¨ì©ì¬ì°ì¸ì¹ì»ì½ìì ììììììììììììììì ì¡ì¤ì¨ì°ì±ì³ì´ìµì¼ì½ìììììììììììì ì©ì´ìµì¸ì¹ì»ì¼ì½ì¾ì",6,"ìì"], +["bf41","í",10,"íª",14], +["bf61","í¹",18,"ííííííí"], +["bf81","í",5,"ííí ",7,"í©íªí«íí®í¯í±",6,"í¹íºí¼ììììì ì¡ì£ì¥ì¬ìì®ì°ì´ì¶ì·ì¼",5,"ì ìììììììììì¤ì¥ì¨ì¬ìì®ì°ì³ì´ìµì·ì¹ì»ìììììììììììì ì¬ì¯ì±ì¸ì¹ì¼ìììììììììì¤ì¥ì§ì©ì°ì±ì´ì¸ì¹ìºìììì ììììììì ì¡ì¨"], +["c041","í¾",5,"í íííííí",6,"íí",5], +["c061","í",25], +["c081","í¸í¹íºí»í¾í¿íííí ",6,"ííí",5,"íííííí¡í¢í£ì©ì¬ì°ì¸ì¹ì½ìì ììììììì ì¡ì¤ì¨ì°ì±ì³ìµì·ì¼ì½ììììììì",7,"ìì ì¨ì«ì´ìµì¸ì¼ì½ì¾ììì ììììììììììììì ì¡ì£ì¤ì¥ì¦ì¬ìì°ì´ì¼ì½ì¿ìììììììììì¤ì¨ì¬ì ì ì ì ì "], +["c141","í¤í¦í§íªí¬í®",5,"í¶í·í¹íºí»í½",6,"ííí"], +["c161","ííííí",19,"í¦í§"], +["c181","í¨",31,"ì ì ì ì ì ì ì ì ì ¤ì ¬ì ì ¯ì ±ì ¸ì ¼ì¡ì¡ì¡ì¡ì¡ì¡ì¡°ì¡±ì¡´ì¡¸ì¡ºì¢ì¢ì¢ì¢ ì¢ì¢ì¢ì¢ì¢ì¢ì¢ì¢ì¢¡ì¢¨ì¢¼ì¢½ì£ì£ì£ì£ì£ì£ì£ì£ 죡죤죵주죽ì¤ì¤ì¤ ì¤ì¤ì¤ì¤ì¤ì¤ì¤¬ì¤´ì¥ì¥ì¥ì¥ì¥ 쥡쥣쥬쥰쥴쥼ì¦ì¦ì¦ì¦ì¦ì¦ì¦ì¦ì§ì§ì§ì§ì§ì§ì§ì§ì§"], +["c241","ííííííí",4,"ííí",5,"í¦í§í©íªí«íí®"], +["c261","í¯",4,"í¶í¸íº",5,"ííí ííí",6,"í"], +["c281","í",5,"íííí¡í¢í£í¥",7,"í®",9,"íºí»ì§ì§ì§ì§ì§ì§ì§ 짢짤짧짬ì§ì§¯ì§°ì§±ì§¸ì§¹ì§¼ì¨ì¨ì¨ì¨ì¨ì¨ì¨ì¨ì¨©ì©ì©ì©ì©ì©ì©ì©ì© 쩡쩨쩽ìªìªìª¼ìª½ì«ì«ì«ì«ì«ì«ì«ì«ì«ì« 쫬쫴ì¬ì¬ì¬ì¬ì¬ 쬡ììììììììì¤ì¸ì¹ì®ì®¸ì¯ì¯¤ì¯§ì¯©ì°ì°ì°ì°ì°ì°ì°¡ì°¢ì°§ì°¨ì°©ì°¬ì°®ì°°ì°¸ì°¹ì°»"], +["c341","í½í¾í¿ííííííííííííííííííí",4], +["c361","í¢",4,"í¨íª",5,"í²í³íµ",11], +["c381","íííí",5,"íííííí",7,"íí í¢",5,"í©íªì°¼ì°½ì°¾ì±ì± ì±ì±ì±ì±ì±ì±ì±ì± 챤챦챨챰챵ì²ì²ì²ì² 첨첩첫첬ì²ì²´ì²µì²¸ì²¼ì³ì³ ì³ì³ì³ì³ì³¤ì³¬ì³°ì´ì´ì´ì´ì´ì´ì´ì´ì´ì´¤ì´¨ì´¬ì´¹ìµìµ 쵤쵬ìµìµ¯ìµ±ìµ¸ì¶ì¶ì¶ì¶ì¶ì¶¤ì¶¥ì¶§ì¶©ì¶°ì·ì·ì·ì·¨ì·¬ì·°ì·¸ì·¹ì·»ì·½ì¸ì¸ì¸ì¸ì¸ì¸ 측츤츨츰츱츳층"], +["c441","í«íí®í¯í±",7,"íºí¼",7,"ííííí"], +["c461","íííííííííí",5,"í¡í¢í£í¥í¦í§í©",4], +["c481","í®í¯í±í²í³í´í¶",5,"í¾í¿íííí ",11,"íííì¹ì¹ì¹ì¹ì¹ 칡침칩칫ì¹ì¹´ì¹µì¹¸ì¹¼ìºìº ìºìºìºìºìºìºìº 캡캣캤캥캬ìºì»ì»¤ì»¥ì»¨ì»«ì»¬ì»´ì»µì»·ì»¸ì»¹ì¼ì¼ì¼ì¼ì¼ì¼ì¼ì¼ì¼ì¼ 켤켬ì¼ì¼¯ì¼°ì¼±ì¼¸ì½ì½ì½ì½ì½¤ì½¥ì½§ì½©ì½°ì½±ì½´ì½¸ì¾ì¾ ì¾ì¾¡ì¾¨ì¾°ì¿ì¿ 쿡쿤쿨쿰쿱쿳쿵쿼íííííí´íµí¸í¼"], +["c541","ííííííííí¡",6,"íªí¬í®",5,"í¶í·í¹"], +["c561","íºí»í½",6,"í ííí",5,"íííí",4], +["c581","íí¢í¤í¦í§í¨íªí«íí®í¯í±í²í³íµ",6,"í¾í¿íí",5,"íííí íííííí í¬íí°í´í¼í½íí¤í¥í¨í¬í´íµí·í¹ííííííííííííí í¤í¬íí¯í°í±í¸íí°í±í´í¸íºí í í í í í í í í í í í í ¡í ¨í ¬í ¼ííí í¡í¤í¨í°í±í³íµíºí¼ííí´í¸íííí¬íí°í´í¼í½í¿ííí"], +["c641","íííí",6,"ííí",5], +["c6a1","í¤ííííííííí í¤í¬í±í¸í¹í¼í¿ííííííííí¤í¥í°í±í´í¸íííí íííííííííí í¡í¥í¨í©í¬í°í¸í¹í»í¼í½íí í¼í½ííííííííííí í¨í©í«íí´í¸í¼íí ííííí¡í£í¬íí°í´í¼í½í¿í"], +["c7a1","íííííí í¤íí¯í¸í¹í¼í¿íííííííí©íííííí¨í¬í°í¸í»í½ííííííí¼í½íííííííííí í¥í¨í©í«íí´íµí¸í¼íí ííííí¥íííííííííí¤í¥í¨í¬í´íµí·í¹ííííííííííí "], +["c8a1","í¤íí¸í¹í¼íí íííííííííí§í©í°í±í´íí ííííííí¡í¨í¬í°í¹í»íí ííííííí í¤í¨í°íµí¼í½ííííííí í¨í©í«íí´íµí¸í¼ííííííííííí í¡í£í¥í©í¬í°í´í¼í½ííííííííí"], +["caa1","伽佳åå¹å å¯åµå¥åå«å®¶ææ¶æ·æ¯æçç稼èèè¡è¢è¨¶è³è·è»»è¿¦é§å»å´åæªæ ¤æ®¼çè覺è§é£ä¾å墾奸姦干幹ææææ¬æ¡¿æ¾çç磵ç¨ç«¿ç°¡èè®è±è««é乫åæ·æ¸´ç¢£ç«èè¤èé¨ååå ªåµææ¾æ¡æ¢ææ©æ¸çç³ç£ç°ç´ºé¯ééé¾"], +["cba1","å£å²¬ç²èééåå å§å²¡å´åº·å¼ºå½æ ·æ±çºçç³ çµ³ç¶±ç¾è è¡èè¥è¬é¼éé±ä»ä»·åå±å¡æ·æ¾æ ¨æ¹æ§ªæ¼ç¥ççç®è¥èï¤é§éå客åï¤ç²³ç¾¹éµå¨å»å± å·¨ææ®ææ§æ¸ ç¬ç¥è·è¸ï¤é½é é¸ä¹¾ä»¶å¥å·¾å»ºææ¥è ±èè¹éµé¨«ä¹åæ°æ¡ååå檢"], +["cca1","ç¼éé»å«æ¯è¿²åæ©æææ ¼æªæ¿è覡éå ç½ç¬ççµ¹ç¹è©è¦è´é£éµæ決æ½çµç¼ºè¨£å ¼æ ç®è¬éé京ä¿åå¾åååå¿å°å¢åºå¾æ ¶æ¬ææ¬æ¯æ»æ´æ¢æ¶ç ç±çç¥çç硬磬ç«ç«¶çµ ç¶èè¿èèè¦è¼éé¡é é ¸é©é¯¨ä¿åå ºå¥å£å±æ¸ææ¡æ¢°"], +["cda1","棨溪çç¸ç£ç¨½ç³»ç¹«ç¹¼è¨èª¡è°¿éé·å¤å©åå±åºå§å¤å°»åº«æ·æ·æ æ²æ æ¯æ§æ²½ç¼çç¾ç¨¿ç¾èè¡èè¦è½è°èè ±è¢´èª¥ï¤è¾é®é顧é«é¼åææ²æ¢ç©è°·éµ å°å¤å´æ梱æ£æ»¾ç¨è¢é¯¤æ±¨ï¤éª¨ä¾å ¬å ±ååå·¥æææ±æ§æ»ç空è£è²¢é串寡ææç"], +["cea1","ç§èèªèª²è·¨ééé¡å»æ§¨è¿éï¤ å å®å¯¬æ £æ£ºæ¬¾çç¯ç管ç½è è§è²«é館å®ææ¬éä¾å å¡å£å»£æ æ´¸ççççè±éå¦æ罫ä¹åå¡å£æªæ§ææ§éå®ç´è±è½äº¤åå¬å¬å¬å¶ å·§æªææ ¡æ©ç¡çç¯çµç¿¹è èèè¼è½éé¤é©é®«ä¸ä¹ ä¹ä»ä¿±å ·å¾"], +["cfa1","åå£å¥åååµå¢å¯å¶å»æ¼æææ¸æ©æ§ææ¯æ¯¬æ±æºç¸çççç¿ç©ç©¶çµ¿èè¼è èè衢謳購è»éé±é¤é¶é§é© 鳩é·é¾åå±èé é«éº´åçªç¾¤è£è»é¡å å±æçªå®®å¼ç©¹çª®è躬å¦å¸å¸å·åæ³æ²æ¬æ·ç·å¥çè¨è¹¶éæºæ«æ½°è©è»é¥ï¤æ·æ¸è²´"], +["d0a1","鬼ï¤å«åå¥æ槻çªç¡ çªºç« ç³¾èµè¦èµ³éµé¨å»åçç èéï¤æ©å ååææ£æ¥µéå å¤å¤ææ¤æ ¹æ§¿ç¾çè¹è«è¦²è¬¹è¿é¥ï¤ä»å¦æææªç´ç¦ç¦½è©è¡¾è¡¿è¥ï¤é¦ä¼åæ¥æ±æ±²ç´çµ¦äºå ¢çè¯ä¼ä¼å ¶ååå¨å»åºå¼å¤å¥å¦å¯å²å´å·±å¹¾å¿æææ£"], +["d1a1","ææææ£æ£æ©æ¬ºæ°£æ±½æ²æ·çç¦çªçç£ç¸ç¿ç¢ç£¯ç¥ç¥ç¥ç¥ºç®ç´ç¶ºç¾èèèè¨èè±èµ·é¡é¤é£¢é¥é¨é¨é©¥éºç·ä½¶åæ®æ¡éå«åºï¤ï¤å¨æ¦ï¤ææ¿ï¤",5,"é£ï¤",4,"諾ï¤ï¤ï¤ï¤æï¤ç ï¤ï¤é£ï¤ ææºå嵐ææ¥ æ¹³ï¤¢ç·ï¤£ï¤¤ï¤¥"], +["d2a1","ç´ï¤¦ï¤§è¡²åå¨ï¤¨",4,"ä¹ï¤å §å¥æ°è冷女年æç§å¿µæ¬ææ»å¯§å¯åªï¤¯å¥´å¼©æ擄櫓爐ç盧",5,"é§ï¤¹",10,"æ¿ï¥ï¥ è¿è¾²æ±ï¥ï¥è ¦ï¥ï¥å°¿ï¥",7,"嫩訥æ»ç´ï¥",5,"è½ï¥ï¥å°¼æ³¥å¿æººå¤è¶"], +["d3a1","丹亶ä½å®åå£å½æ·æ¦æªæ®µæ¹ç端ç°ç·èè¢é²éæ»æ¾¾çºç¸éååæºæææ·¡æ¹æ½æ¾¹ç°èè½èè¦è«èéæ²ççè¸éåå å¡å¹¢æææ£ ç¶ç³è³é»¨ä»£åå®å¤§å°å²±å¸¶å¾ æ´æ¡ç³èºè¢è²¸éé»å® å¾·æ³ååå°åå µå¡å°å± 島å¶åº¦å¾æ¼ææææ¡"], +["d4a1","棹æ«æ·æ¸¡æ»æ¿¤ç¾çç¹ç¦±ç¨»è覩è³è·³è¹éééé½éé¶éæ¯ççç¢ç¨ç£ç¦¿ç¯¤çºè®å¢©ææ¦æ½æ¾æ²ççè±é ä¹çªä»å¬åååæ§æ±æ¡æ£æ´æ½¼ç¼ç³ç«¥è´è£é å æææçç«è³ï¥è±éé 屯èèéé¯éå¾å¶æ©çç»çè¤è¬é§é¨°åæ¶ï¥ç©ç¾ "], +["d5a1","è¿èºè£¸éï¥æ´çç絡è½ï¥é ªé§±ï¥äºåµæ¬æ¬ç¾çèé¸åè¾£åµæ¥æ¬æ¬æ¿«ç±çºè襤覽æèè å»æ浪ç¼ç ç¯èéä¾å´å¾ èå·æ ç¥äº®åå ©åæ¢æ¨ç²®ç²±ç³§è¯è«è¼é侶å·åµåå»¬æ ®æ¾æ æ«æ¿¾ç¤ªèè £é驢驪éºé»åææ·ç礫轢éæææ£æ¼£"], +["d6a1","ç çç·´è¯è®è¼¦é£éå½åå£æ´çè£å»ææ®®æ¿ç°¾çµä»¤ä¼¶å¹ï¥å²ºå¶ºæç²ç¬ç¾ç¿èéé´é¶éé 齡ä¾æ¾§ç¦®é´é·åï¥ æææ«æ½ççç§èèèè·¯è¼ é²é¯é·ºé¹µç¢ç¥¿ç¶ èé鹿éºè«å£å¼æ§ç§çç± è¾å¡ç¨ç¢ç£è³è³è³´é·äºå寮å»æçççèè¼"], +["d7a1","é¼é¬§é¾å£å©å±¢æ¨æ·æ¼ç»ç´¯ç¸·è褸é¤éåææ³æ¦´æµæºççç çç¤ç¡«è¬¬é¡å æ®é¸ä¾å«å´æ·ªç¶¸è¼ªå¾æ æ 率éåèååæ¥ç¨ç¶¾è±éµä¿å©åååå±¥æ§æ梨浬çç¸çç異ç¢ç±¬ç½¹ç¾¸èè£è£¡ééé¢é¯åæ½¾ççèºèºªé£é±éºææ·ç³è¨éç ¬"], +["d8a1","ç«ç¬ ç²æ©çªç²ç¢¼ç£¨é¦¬é麻å¯å¹æ¼ èè«éä¸å娩å·å½æ ¢æ½æ©æ¼æ»¿æ¼«ç£çè¬èè »è¼é¥ é°»åæ¹æ«æ²«è襪éºäº¡å¦å¿å¿æ網ç½èè«è½è¼éå妹åªå¯æ§ææ¢ æ¯ç ¤ç½µè²·è³£éé èè²éé©éº¥åæ°çç²çèåªè¦å ååæ£æ²çç 綿緬é¢éºµæ» "], +["d9a1","èå¥åå½ææ椧æºç¿çèèèé ©éé³´è¢ä¾®ååå§å¸½æ æ¸æ¹æ®æ模æ¯æ¯çç¡çç¸çèè¼è è¬è¬¨è²æ¨æ²ç§ç®ç¦ç©é¶©æ¿æ²å¤¢æ¦èå¯å¢å¦å»ææ´æ³æ¸ºç«ç«èé¨åå·«æ®ææææ«æ æ¥æ¦æ¯ç¡ç·çç¹èèèªèª£è²¿é§éµ¡å¢¨é»ååå»åæ"], +["daa1","汶ç´ç´èèéé¯å¿æ²ç©å³åªå°¾åµå½å¾®æªæ¢¶æ¥£æ¸¼æ¹çç±³ç¾èè¬è¿·é¡é»´å²·æ¶ææ«ææ»æ¼æ°æ³¯ççç·¡éå¯èè¬ååæææ²æ´æ¨¸æ³ççç®ç²ç¸èè¶èè¿«é¹é§ä¼´åååææ¬æææ§æ³®æ½ççç¢ç¤ç¼ç£ç£»ç¤¬çµè¬è è¿é 飯åææ¥æ¸¤æ½"], +["dba1","ç¼è·é±é¢é«®éå£åå妨尨å¹å½·æ¿æ¾æ¹ææææ¦æ»ç£ ç´¡èªèè«è³è¡è訪è¬é¦é²é¾å俳北å¹å¾æææ¯æ¹ççèè裴裵è¤è³ 輩é éªä¼¯ä½°å¸ææ ¢ç½ç¾é幡æ¨ç ©ççªï¥¤ç¹èè©é£ä¼çç½°é¥å¡å¸æ¢µæ°¾æ±æ³ç¯ç¯èæ³çºå»åå£ææªç§ç"], +["dca1","碧èé¢é¹ï¥¥åå¼è®è¾¨è¾¯éå¥ç¥é±é¼ä¸åå µå±å¹·ææºææ£ ç³çç ç§ç«è¼§é¤ é¨ä¿å ¡å ±å¯¶æ®æ¥æ´æ¹ºæ½½ç¤ç«è©è£è¤èè¼ä¼åååå®å¾©æç¦è ¹è¯èè¤è¦è¼¹è¼»é¦¥é°æ¬ä¹¶ä¿¸å¥å°å³¯å³°æ§æ£ç½ç¢ç«ç¸«è¬èé¢éé³³ä¸ä»ä¿¯å åå¯å¦åå 夫婦"], +["dda1","ååµå¯åºï¥¦æ¶æ·æ§æµ®æº¥ç¶ç¬¦ç°¿ç¼¶è è èèèè©è¨è² 賦賻赴趺é¨éééé§é³§ååå©å´å¢³å¥å¥®å¿¿æ¤æ®ææ±¾ççç²ç³ç´è¬è³é°ï¥§ä½å¼å½¿æå´©ææ£ç¡¼ç¹éµ¬ä¸åååªåå¦å©¢åºæ²æææ¹ææ榧æ¯æ¯æ¯æ¯æ²¸ï¥¨çµçºç ç¢ç§ç§ç²ç·ç¿¡è¥"], +["dea1","è¾èè²è裨誹è¬è²»ééé£é¼»å¬å¬ªå½¬æ檳殯æµæ¿±ççç貧è³é »ææ°·èé¨ä¹äºäºä»ä¼ºä¼¼ä½¿ä¿å¿å²å¸åå£å士奢å¨å¯«å¯ºå°å·³å¸«å¾ææ¨ææ¯æ¶æ»æ¢æ»æ²æ³æ¸£çç ç 社ç¥ç¥ ç§ç¯©ç´çµ²èèèèèè£è©è©è¬è³èµ¦è¾éªé£¼é§éºå數æ索"], +["dfa1","ååªå±±æ£æ±çç£çç®èé ¸é°ä¹·æ殺ç è©ä¸ï¥«æ森æ¸èèè¡«æ·æ¾é颯ä¸å·ååååªååå°å³ 常åºåº å»æ³æ¡æ©¡æ¹ç½ççç¸ç¥¥ç®±ç¿è£³è§´è©³è±¡è³éå¡ç½è³½å塞穡索è²ç²çç¥ï¥ç¬å¢ 壻嶼åºåº¶å¾æææ¿ææææ¸æ 棲ççç®çµ®ç·ç½²"], +["e0a1","è¥èè¯è¥¿èªéé¤é»é¼ å¤å¥å¸æææ³ææ±æ· æ½ç³ç¢©èéé«ä»åå åå¬å®£ææ¾ææ¸²ç ½çççç¿ç¬ç¦ªç·ç¹ç¾¨è ºè³è¹èè¬è©µè·£é¸éé¥é¥é®®å¨å±æ¥æ³æ´©æ¸«èè褻è¨èªªéªé½§å¡æ¹æ®²çºè¾è´ééææ¶ç®ï¥®åå§å®¬æ§æºæææç©ç¹ççç¬"], +["e1a1","èè²è ¥èª éä¸å¢æ²æ´ç¨ 笹細說貰å¬å¯å¡å®µå°å°å·¢ææææ梳沼æ¶æº¯çç¤çç¦çççç¬ç¯ ç°«ç´ ç´¹è¬èè訴éé¡éµé·é¶é¨·ä¿å±¬ææ¶ç²çºè¬è´éå«å·½æèé飡çå®ææ¾æ·è¨èª¦éé å·ï¥°çç¢éè¡°éä¿®åå½åå壽å«å®å²«å³å¸¥æ"], +["e2a1","æææææ¶æ¸æ¨¹æ®æ°´æ´æ¼±ç§ç©ç¸çç²ç¦ç¡ç§ç©ç«ªç²¹ç¶ç¶¬ç¹¡ç¾è©è±èèèªè¢èª°è®è¼¸ééé ¬éé¹éé§é¨ééé é¦é«é¬å塾å¤å°å®¿æ·æ½çç¡ç¹è è½å·¡å¾å¾ªææ¬æ 楯æ©æ®æ´µæ·³ç£ç¾ç¬çç´è£èèè´è£è©¢è«ééé 馴æè¡è¿°é¥å´å´§"], +["e3a1","嵩çèè¨æ¿æ¾ç¿è¤¶è¥²ä¸ä¹å§ååæ¿æ繩è éä¾åå¶å§åª¤å°¸å±å±å¸å¼ææ½æ¯ææ¾æ´çç¢ç¤ºç¿ èèè¦è©¦è©©è«¡è±è±ºå´å¯å¼æ¯ææ¤æ®æ¹çç¯èè軾é£é£¾ä¼¸ä¾ä¿¡å»å¨ 宸æ¼æ°æ¨ç¼ç³ç¥ç´³è è£èèªèèè¨èº«è¾ï¥±è¿ 失室實æ審å°å¿æ²"], +["e4a1","沈深ççè¯è«¶ä»å拾éæ°äºä¿å å娥峨æçè½èªè¾è¡è¨é¿é é¤é´éµå 岳嶽å¹æ¡ææ¡æ¨æ¸¥ééé¡é°é½·å®å²¸æææ¡ç¼ééé¡é®æ¡è¬è»é¼åµå²©å·åºµæçè´éå£æ¼ç鴨仰央ææ»æ®ç§§é´¦åååå´ææ涯ç¢è¾ééåæ¼æ液ç¸è é¡"], +["e5a1","æ«»ç½é¶¯é¸ä¹å»å¶å¤æ¹æ¶æ¤°çºè¶ï¥´é弱掠略ç´è¥è¯è»è¥èºï¥·ä½¯ï¥¸ï¥¹å£¤åæææææ梁æ¥æ¨£æ´çç ¬çç禳穰糧ç¾ï¥¼è¥ï¥½è®éé½ï¥¾é¤å御æ¼æ¼ç禦èªé¦é齬åæ¶ææªèåå °å½¦çè¨è«ºå¼è俺å¼å´å¥æ©æ·¹å¶ªæ¥åäºä½ï¥¿ï¦ï¦å¦ï¦"], +["e6a1","ï¦ææ±ï¦çµç¤ï¦ èè è¹è¼¿è½ï¦é¤ï¦ï¦ï¦äº¦ï¦åå½¹æï¦ï¦ç«ç¹¹è¯ï¦éé©å¥å §å§¸å¨å®´ï¦å»¶ï¦ï¦ææ»ï¦æ¤½æ²æ²¿æ¶æ¶æ·µæ¼ï¦çç¶ç ï¦ççï¦ç¡ç¡¯ï¦çµç·£ï¦ç¸¯ï¦è¡è»ï¦ï¦ï¦éï¦é³¶ï¦ï¦ï¦æ æ¶ ï¦ç±ï¦ 說é±å廉念捻æ殮çç°ç°è¶è"], +["e7a1","簾é»é«¥é¹½æ獵çè令囹å¡ï¦ªï¦«å¶¸å½±ï¦¬æ æ楹榮永泳渶æ½æ¿çç¯ç çç°ï¦ç瑩ççç©çºï¦¯ï¦°è±è© è¿ï¦±é零é靈領ä¹åªï¦µåå¡æ³æ±æ¿çç¿ç©¢è®èè禮è£è©£è½è±«ï¦·é³ï¦¸éé äºä¼ä¿å²åå¾å³å塢墺奧å¨å¯¤æ惡æææ¿æ¤æ¢§æ±æ¾³"], +["e8a1","çç¬çç½è誤鰲é¼å±æ²ççéºæº«ç¥çç©©ç¸èå å£ æç®çç°ç¿ééé¥æ¸¦ç¦çª©çªªè¥èè¸è¨å©å®å®æ¢¡æ¤æµ£ç©çç¬ç¢ç·©ç¿«èè èè±é®é æ°å¾æºæ汪çåå¨æªç®å¤åµ¬å·ç¥ç了僚å¥å¹å ¯å¤å¦å§å¯¥ï¦¼ï¦½å¶¢ææææ¾ï¦¾æ樂æ©ï§ç¿ç¤ï§"], +["e9a1","çªçª¯ç¹ç¹èè °ï§è¯è¦è¬ éï§éé¥æ ¾æ¬²æµ´ç¸è¤¥è¾±ä¿ååååå¢å®¹åº¸æ æ¦æ¶æ¹§æº¶çç¢ç¨ç¬è³è¸èè¸ééï§äºä½å¶åªååå³å®å¯å°¤æææ´ççççç¥ç¦ç¦¹ç´ç¾½èèèè¿ééµéªé é¨é©å彧ææ±æ ¯ç 稶éé äºï§ æ©æ®æ¾çèè¸è"], +["eaa1","ééé²é»è鬱äºçéå åå¡ååå£åªå«å¯æ¨æ¿æ´æ² 洹湲æºç°ç¿çèè¢è½ é ï§é¢é¡é´æè¶éä½ååå±åå§å¨å°æ °ææ¸ç²çç·¯èèè¦è¿èè¡è¤è¬éééä¹³ä¾åå ªï§å¯å©åºå®¥å¹¼å¹½åº¾æ æææææ¸æï§ææï§æ¥¡æ¥¢æ²¹æ´§ï§æ¸¸ï§"], +["eba1","æ¿¡ç¶ç·ï§çç±ï§çï§ï§ç¶è¾è¸è£èªè«è«è¸°è¹éé¾éºé éé®ï§ï§å ï§æ¯èè²ï§ï§å 奫尹ï§ï§æ½¤ç§è¤è´ï§ééï§ï§ï§ï§è¿æç絨èï§å æ©æ 殷誾éé±ä¹åæ·«èé°é³é£®ææ³£éåæèºé·¹ä¾ååå®ææ¿æ¬æ¤ æ¯ çç£ç¾©è¤èè»è¡£èª¼"], +["eca1","è°é«äºä»¥ä¼ï§ï§å¤·å§¨ï§å·²å¼å½æ¡ï§ 李梨泥ç¾ç¥ï§¤ç°ç痢移罹èè³èè¡è裏裡貽貳é里離飴é¤ï§«ï§¬ç·çç¿ç¿ç¿¼è¬äººä»åå°ï§å½å å§»å¯ å¼å¿æ¹®ï§®ï§¯çµªèµï§°èèªï§±éé·ï§²ï§³ä¸ä½ä½¾å£¹æ¥æº¢é¸é°é¦¹ä»»å£¬å¦å§æ林淋ç¨ï§¶èè³å ¥å"], +["eda1","立笠粒ä»å©åè¿ä»åºå¨å§å§¿åååæ£æ æ»çç ®çç·çµç£ç´«è èªè¨èèè«®è³éä½åºå¼æ«æ¨ç¼ç¸çµç¶½èé ééµ²å±æ£§æ®æ½ºçå²æ«æ½ç®´ç°ªè ¶éä¸ä»å å ´å¢»å£¯å¥¬å°å¸³åºå¼µææ²ææ¨æª£æ¬æ¼¿ç狀ççç« ç²§è ¸èè§èè¬è£èèè£è´é¬é·"], +["eea1","éååå¨å®°æææ ½æ¢æ¸½æ»ç½ç¸¡è£è²¡è¼é½é½çç®è«éä½ä½å²åå§åºæµæµæ¥®æ¨æ²®æ¸ççªç½ç®¸ç´µè§è¹èè·è©è²¯èºéé¸éé½å£åå«¡å¯ææµæ»´ç炙çç©ç¬ç±ç¸¾ç¿è»è¬«è³èµ¤è·¡è¹è¿ªè¿¹é©éä½ä½ºå³å ¨å ¸ååªå¡¡å¡¼å¥ å°å±å»ææ°æ 殿æ°æ¾±"], +["efa1","ç ç ç°ç¸çç²çç®ç®ç¯çºè©®è¼¾è½é¿éé¢é«é»é¡é¡«é¤åæªææµç¤ç«ç¯çµ¶å å²¾åºæ¼¸ç¹ç²éé®é»æ¥æºè¶ä¸äºäºååµåå§å®å¹åºå»·å¾æ æºæ¿æ´ææ¶æ¸æ¾æ¥¨æªæ£æ±æ·æ·¨æ¸æ¹çç¡çç½çºçç¢ç¦ç¨ç©½ç²¾ç¶èè¨è«ªè²éé éé¦éé éé"], +["f0a1","éé é¼å¶åå¼å ¤å¸å¼ææ梯æ¿ç¥ç¬¬èèºè£½è«¸è¹éé¤éé½é¡é½ä¿å åå©å²å¼å½«æªææ©ææºæ¹ææ¢æ£æ§½æ¼æ½®ç §ç¥çªçªçºç¥ç¥ç§ç¨ çªç²ç³çµç¹°èè»è¤è©èª¿è¶èºé éé£é»éé³¥æç°è¶³éåå°åæçå§å®å¾æ°æ «æ£æ·ç®ç¨®çµç¶ç¸±è «"], +["f1a1","踪踵é¾éä½å左座æ«ç½ªä¸»ä½ä¾åå§èåªå¨å¾å¥å®å·å»ææ±æ±æ ªæ³¨æ´²æ¹æ¾ç·ç çç±ç´ç´¬ç¶¢èèè¨»èª èµ°èºè¼³é±é é éé§ç«¹ç²¥ä¿ååå寯峻æ樽æµæºæ¿¬çç¯ç«£è ¢é¡éµé駿èä¸ä»²è¡éå½æ«æ¥«æ±èºå¢ææ¾æ¯çççç¹è¸èè´ä¹åª"], +["f2a1","å«å°åå¿æææ¯æ¯æ¨æºææ³æ¢æ± æ²æ¼¬ç¥ç ¥ç¥ç¥ç´è¢èè³èè·èèªï§¼è´è¶¾é²ç´ç¨ç¨·ç¹è·åå塵æ¯æ¢æææ¡æ¦æ®æ´¥æº±çç¨ç¡çç¹ç¡çç秦ç¸ç¸è»è¯è¢è¨ºè³è»«è¾°é²éé£é³éä¾å±å§ªå«å¸æ¡çç¾ç§©çªè£è質è·è¿ææ什å·æ½ç·è¼¯"], +["f3a1","é¶éå¾µæ²æ¾ä¸ä¾ååå嵯差次æ¤ç£ç®ï§¾è¹è»é®ææ¾ççªé¯é¿é½ªæ°æ¾¯ç¦ç¨çç«ç°çºç²²çºè®è´é½é¤é¥å¹å¯æ¦æç´®åå塹æ æ æºæ¬ç«è®è®åå¡åµå±å¨¼å» å½°æ´æææ¶æ¢æ§æ»æ¼²çç¡çªè¹èèè¼åµå°å¯å¯¨å½©æ¡ç ¦ç¶µèè¡ééµåæµç"], +["f4a1","責å妻æ½èå刺åå°ºæ ½æææ²æ¥æ»ç èè¹ éé»ä»åå天å·æ æ³æ·ºçç©¿èè¦è³¤è¸é·é§é¡é¡éå¸å²åå¾¹æ¤æ¾ç¶´è¼è½éµåå°æ²¾æ·»çç»ç°½ç±¤è©¹è«å 妾å¸æ·ççç«è«è²¼è¼å»³æ´æ·¸è½èè«éé¯ï¨åæ¿æ¶æ»¯ç· 諦é®éé«åå¿å¨æææ梢"], +["f5a1","æ¤æ¥æ¨µçç¦ç¡ç¤ç¤ç§ç¨èè¸èèèè²è¶ é ¢éé®ä¿åççè觸寸å¿æé¨å¢å¡å¯µæ¤ææ 總è°è¥éæ®å¬å´æå¢æ½æ¨æ¤æ¥¸æ¨æ¹«çºç§è»è©è«è¶¨è¿½éé ééééé騶é°ä¸çç¥ç«ºçç¯ç¸®èè¹è¹´è»¸éæ¥æ¤¿çåºæ®é»å å¿ æ²è²è¡è¡·æ´èµè"], +["f6a1","è´ åå¹å´å¨¶å°±çç¿ èèè趣éé©é·²å´ä»å æ»æ¸¬å±¤ä¾å¤å¤å³å¹æ¥æ¢æ²»æ·ç¾çç´ç¡ç¨ç©ç·ç·»ç½®è´è©è¼é馳é½åå é£è¦ªä¸ææ¼ä¾µå¯¢ææ²æµ¸çç §éé¼è秤稱快ä»å¤å¾å¢®å¦¥æ°æææ¶æ¥èµé馱é§å¬ååå¼ï¨æï¨æ¢æ«ææ¿æ¿¯ç¢ç¸è¨"], +["f7a1","é¸ååå¦å½ææçç綻èªå¥ªè«æ¢çè½è²ªå¡æ榻å®å¸æ¹¯ï¨è©å å°å¤ªæ æ æ®æ±°æ³°ç¬èèè·é°é¢±ï¨æ澤ææå ååè¨æ æ¡¶ï¨ çççµ±éå æ§è ¿è¤ªéé ¹å¸å¥å¦¬æé鬪æ ç¹éå¡å©å·´æææºæ·æ³¢æ´¾ç¬ç¶ç ´ç½·èè·é å¤åæ¿çç£è²©è¾¦é"], +["f8a1","éªå «åæ佩åæææ²æµ¿çç½ç¨è¦è²å½æ¾ç¹è¨æ便åæçç¯ç·¨ç¿©ééé¨è²¶åªå¹³æ°èè©å å¬å¹£å»¢å¼æèºè½ééä½å ååååºåå¸æææ±æï¨æ³¡æµ¦ç±ç ²èè¯èè¡è²è¢è¤ééªé£½é®å¹ æ´æççï¨ä¿µå½å½ªæ ææ¨æ¼ç¢ç¥¨è¡¨è±¹é£é£é©"], +["f9a1","åç¨æ¥è«·è±é¢¨é¦®å½¼æ«ç²ç®è¢«é¿éå¹å¼¼å¿ æ³çç¢ççè¾é¦ä¹é¼ä¸ä½å¦å¤å»æ°æ²³çè·è¦è³ééé°å£å¸èè¬é¶´å¯æ¨ææ±æ±æ¼¢æ¾£çç½ç¿°ééééå²è½å½å«å¸å£å檻涵ç·è¦éé·é¹¹ååçè¤é¤éé亢ä¼å§®å«¦å··ææææ¡æ²æ¸¯ç¼¸èèª"], +["faa1","ï¨ï¨é 亥åå³åå¥å©å®³æ楷海ç£è¹è§£è©²è«§éé§éª¸å¾æ ¸å幸æèè¡äº«åå®ç¦éé¿é¤é¥é¦åå¢è許æ²æ«¶ç»è»æéªé©å¥ç赫é©ä¿å³´å¼¦æ¸æ泫ç«çç¹ç¾ç©ççµçµ¢ç¸£è·è¡ï¨è³¢é顯åç©´è¡é å«ä¿ å夾峽æ¾æµ¹ç¹è èè¢éé °äº¨å åå"], +["fba1","å½¢æ³æ»ç çç¯çç©ç©èè¢è¡¡éé¢é£é¦¨å ®å½æ æ §æ³èè¹é¯éä¹äºå¼å£å£ºå¥½å²µå¼§æ¶æææ§æ¯«æµ©æ·æ¹æ»¸æ¾æ¿ æ¿©ççç¥çç çç¥ç³ç¸è¡è¦è«è¿èèè´è·è±ªé¬é é¡¥ææé ·å©æ混渾ç¿é忽æç¬åå¼æ±æ³æ´ªçç´ è¹è¨é´»ååå¬ æ¨ºç«çµ"], +["fca1","ç¦ç¦¾è±è¯è©±è貨é´ï¨æ´æ«ç¢ºç¢»ç©«ä¸¸åå¥å®¦å¹»æ£ææ¡æ¥æ¡æ¸ç ¥ç°ç´é驩鰥活æ»ç¾è±éå°å¹å¾¨ææ¶æ°æ ææ榥æ³æ¹æ»æ½¢ç ççç¯ç°§èèééé»å¯åå»»å¾æ¢ææ·æ¦ææªæ·®æ¾®ç°çªç¹ªè¾è´è誨è³åç²å®æ©«éå®ååææ ææ¢æ¶æ·"], +["fda1","ç»è´é µé©ä¾¯åååå¼åå 帿å¾æ½ç ¦çé åå³å¡¤å£ççç»è°è¨æè¨å§æç è±ååæ¯å½å¾½æ®æç 諱è¼éº¾ä¼æºçç¦è§æ¤èé·¸å å¶åæ´¶è¸é»æ欣ççåå±¹ç´è¨æ¬ 欽æå¸æ°æ´½ç¿èåååå«å姬å¬å¸æææ±ææ¦çç¹çºç§ç¦§ç¨ç¾²è©°"] +] diff --git a/node_modules/iconv-lite/encodings/tables/cp950.json b/node_modules/iconv-lite/encodings/tables/cp950.json new file mode 100644 index 0000000..d8bc871 --- /dev/null +++ b/node_modules/iconv-lite/encodings/tables/cp950.json @@ -0,0 +1,177 @@ +[ +["0","\u0000",127], +["a140","ãï¼ããï¼â§ï¼ï¼ï¼ï¼ï¸°â¦â¥ï¹ï¹ï¹Â·ï¹ï¹ï¹ï¹ï½â︱â︳â´ï¸´ï¹ï¼ï¼ï¸µï¸¶ï½ï½ï¸·ï¸¸ãã︹︺ãã︻︼ãã︽︾ãã︿ï¹ããï¹ï¹ããï¹ï¹ï¹ï¹"], +["a1a1","ï¹ï¹ï¹ï¹ââââããâµâ²ï¼ï¼ï¼â»Â§ãâââ³â²âââ âââ¡â â½â¼ã£â ¯ ̄_Ëï¹ï¹ï¹ï¹ï¹ï¹ï¹ï¹ ﹡ï¼ï¼Ã÷±âï¼ï¼ï¼â¦â§â âââ¡ï¹¢",4,"ï½â©âªâ¥â ââ¿ããâ«â®âµâ´âââââââââââââ¥â£ï¼"], +["a240","ï¼¼â﹨ï¼ï¿¥ãï¿ ï¿¡ï¼ ï¼ ââ﹩﹪﹫ãããããã¡ããã°å å å å å ¡å £å§ç©ç³â",7,"ââââââââ¼â´â¬â¤ââââââââââ"], +["a2a1","â®â°â¯âââªâ¡â¢â£â¥â¤â±â²â³ï¼",9,"â ",9,"ã¡",8,"ååå A",25,"ï½",21], +["a340","ï½ï½ï½ï½Î",16,"Σ",6,"α",16,"Ï",6,"ã ",10], +["a3a1","ã",25,"ËËËËË"], +["a3e1","â¬"], +["a440","ä¸ä¹ä¸ä¸ä¹ä¹äºäºäººå¿å ¥å «å åååååååä¸ä¸ä¸ä¸ä¸«ä¸¸å¡ä¹ ä¹ä¹ä¹äºäº¡å ååºååå£å士å¤å¤§å¥³ååå寸å°å°¢å°¸å±±å·å·¥å·±å·²å·³å·¾å¹²å»¾å¼å¼æ"], +["a4a1","ä¸ä¸ä¸ä¸ä¸°ä¸¹ä¹å°¹äºäºäºäºäºäº¢ä»ä»ä»ä»ä»ä»ä»ä»ä»å å å §å å ®å ¬åå¶åååå»å¾å¿åå¹ååå ååååå壬天夫太å¤åå°å°¤å°ºå±¯å·´å¹»å»¿å¼å¼å¿ææ¶æææ¯æææ¤æ¹æ¥æ°ææ¨æ¬ æ¢æ¹æ¯æ¯æ¯æ°æ°´ç«çªç¶ç»çççç¬çä¸"], +["a540","ä¸ä¸ä¸ä¸ä¸»ä¹ä¹ä¹ä»¥ä»ä»ä»ä»ä»ä»£ä»¤ä»ä»å å ååå¬å¹åºå¸åå åå åååä»ååå¡å å¯å®å»å¯å¤å³å¬å®å©å¨å¼å¸åµå«å¦åªå²å±å°å¥åå»ååå¤"], +["a5a1","央失奴奶åå®å°¼å·¨å·§å·¦å¸å¸å¹³å¹¼å¼å¼å¼å¿ ææææææ¥æ¦æ®æ¬æªæ«ææ£æ¯æ°æ°æ°¸æ±æ±æ°¾ç¯çççç¦ççç¨ç©ç°ç±ç²ç³çç½ç®ç¿ç®çç¢ç³ç¤ºç¦¾ç©´ç«ä¸ä¸ä¹ä¹ä¹©äºäº¤äº¦äº¥ä»¿ä¼ä¼ä¼ä¼ä¼ä¼ä¼ä¼ä»²ä»¶ä»»ä»°ä»³ä»½ä¼ä¼å å å å å ¨"], +["a640","å ±åå°åååååå£åå¡å å°å±åååååååååååååååå ååå³å°å¨åå¬å¯å©å¤å¤å¤·å¤¸å¦å¥¸å¦å¥½å¥¹å¦å¦ååå®å®å® å®å¯ºå°å±¹å·å¸å¹¶å¹´"], +["a6a1","å¼å¼å¿å¿æææææ£æææ¶æ©æ¨æ¬ææ²æ³ææ½æ´æ±æµæ¬¡æ¤æ»æ°æ±æ±æ±æ±æ± æ±æ±æ±¡æ±æ±æ±ç°ççç¾ç«¹ç±³ç³¸ç¼¶ç¾ç¾½èèèèè³è¿èèèè£èªè³è¼èèèè®è²è¾è«è¡è¡è¡£è¥¿é¡ä¸²äº¨ä½ä½ä½ä½ä½ä¼´ä½ä½ä¼°ä½ä½ä¼½ä¼ºä¼¸ä½ä½ä¼¼ä½ä½£"], +["a740","ä½ä½ 伯ä½ä¼¶ä½ä½ä½ä½å å å å µå¶å·å¥å¤å©åªå¨å«å©åªå¬å£å³åµåååå¾å¦åå§ååå³åååå©åå¹å»å¸å®åµå¶å å¼åå±å«åå¬åªå°å¤å«åååå"], +["a7a1","ååå¾ååå»å£¯å¤¾å¦å¦å¦¨å¦å¦£å¦å¦å¦å¦¤å¦å¦å¦¥ååååå®å®å®å°¬å±å±å°¿å°¾å²å²å²å²å·«å¸åºåºåºå»·å¼å¼å½¤å½¢å½·å½¹å¿å¿å¿å¿å¿±å¿«å¿¸å¿ªæææææææ¶ææææ¼æ¾æ¹æ³ææ¯ææ®æææææ¹æ»æ¸æ±æ´æææææææææææ "], +["a840","æææ¥æ¯æ±æ±æ²æ²æ²æ²æ² æ²æ±ªæ±ºæ²æ±°æ²æ±¨æ²æ²æ±½æ²æ±²æ±¾æ±´æ²æ±¶æ²æ²æ²æ²ç¶ç¼ç½ç¸ç¢ç¡ç çççç¬ç«ç·ç¸çç¯ç£ç§ç§ç¦¿ç©¶ç³»ç½èèèèèèè²è¯è"], +["a8a1","èèè¦è§è¨è°·è±è±è²èµ¤èµ°è¶³èº«è»è¾è¾°è¿è¿è¿ è¿å·¡éé¢éªé¦é£é ééé²é®é±éªé¬ä¸¦ä¹ä¹³äºäºäºäº«äº¬ä½¯ä¾ä¾ä½³ä½¿ä½¬ä¾ä¾ä¾ä¾ä½°ä½µä¾ä½©ä½»ä¾ä½¾ä¾ä¾ä½ºå å å å ©å ·å ¶å ¸å½å½å»å¸å·åºå°å®å¶åå¾å»ååååå¦å·å¸å¹åååå³åµ"], +["a940","åå¸ååå»å·åååå¼åå±å¶ååå¢å¨åå½ååºåå·åªå©å¡å¦å¤å¼å¤å¥å¥å¥å¥å¥å¦¾å¦»å§å¦¹å¦®å§å§å§å§å§å§å§å¦¯å¦³å§å§ åå¤å£å®å®å®å®å®å®å°å±å± "], +["a9a1","å±å²·å²¡å²¸å²©å²«å²±å²³å¸å¸å¸å¸å¸å¸å¹¸åºåºåºåºåºå»¶å¼¦å¼§å¼©å¾å¾å½¿å½¼å¿å¿ 忽念忿æææ¯æµææªææ¡æ§æ©æ«ææææ¿æ¾ææ¿ææææ¿ææ¹æææ«æææææ¨æ½æ¼æææææµææ±æææææ¬ææ¾æ§æ¼æºææææææææææ"], +["aa40","æææææææ±ææ³æ·ææææ¯æ°æ¿ææ¾ææµæææ¼æªæ²æ¬£æ¦æ§æ¿æ°æ°æ³£æ³¨æ³³æ²±æ³æ³¥æ²³æ²½æ²¾æ²¼æ³¢æ²«æ³æ³æ²¸æ³æ²¹æ³æ²®æ³æ³ 泱沿治泡æ³æ³æ²¬æ³¯æ³æ³æ³ "], +["aaa1","çççççç¬çç¸çç§ç©çççççç©ç¨çç«ç¥ç½çççççç²ç´ç¥ç½ç¤¾ç¥ç¥ç§ç§ç©ºç©¹ç«ºç³¾ç½ç¾ç¾è èºè¥è¢è±è¡è«è©è´èªè¯è¥è¾èè³èèèè½èè¹è±è¬è¥è¯è¸è£è°è¾è·èè±å表è»è¿è¿è¿éµé¸é±é¶ééé·éééé¿é»é"], +["ab40","éé¹é¨ééäºäºäº®ä¿¡ä¾µä¾¯ä¾¿ä¿ ä¿ä¿ä¿ä¿ä¾¶ä¿ä¿ä¿ä¿ä¾®ä¿ä¿ä¿ä¿ä¿ä¿ä¾·å ååå åååååååååååååå»ååå¬åå¨ååå¸å¦å³ååå½åªå"], +["aba1","ååå¯å«å±å»å©å§å¿å¿ååå å£å¢åå®åå¥å¥å¥å¥å¥å§å§å§¿å§£å§¨å¨å§¥å§ªå§å§¦å¨å§»å©å®£å®¦å®¤å®¢å®¥å°å±å±å±å±å³å³å··å¸å¸¥å¸å¹½åº 度建å¼å¼å½¥å¾å¾ å¾å¾å¾å¾å¾æææ æ¥ææ¨ææ°æ¨æ¢æææ¬æ«æªæ¤æææææ¼æææ®æ½ææ±æ·"], +["ac40","æ¯æ¬æ¾æ´æææ¿æ æ«æ½æ¢æ¥ææ æ§æ¯ææ¨æ±æ¤æ·æ¿ææ±æææ¬æ¶æ¯æµæ©æ¯æææ´ææ¥æ¸æææ³æ°ææ¢æææªæ®æ®æ®µæ¯æ¯æ°æ³æ´æ´²æ´ªæµæ´¥æ´æ´±æ´æ´"], +["aca1","活洽派洶æ´æ³µæ´¹æ´§æ´¸æ´©æ´®æ´µæ´æ´«ç«çºç³ç¬ç¯çç¸ç®ç¤ç°ç²ç¯ç´ç©ç ç¡ç·çç»ç²ççç³ççççççç«ç¤ç¥ç¢ç£ç¸ççççççç çç¹ç¸ççç¾ç¼ççç ç ç ç ç¥ç¥ç¥ç¥ç¦¹ç¦ºç§ç§ç§ç©¿çªç«¿ç«½ç±½ç´ç´ ç´ç´ç´ç´ç´ç¼¸ç¾ç¾¿è"], +["ad40","èèèè¶èè¥èèèèè¡èèèè¤èè´è¢è§èè è£èè¦èè¥èèèèè±èèèèèèèè¯èèè¹è»èºè¡è¡«è¦è§è¨è¨è¨è²è² 赴赳趴è»è»è¿°è¿¦è¿¢è¿ªè¿¥"], +["ada1","è¿è¿«è¿¤è¿¨ééééé é ééééééé¢é©ééé³é 風é£é£é¦é¦ä¹äº³ååå£ä¿¯å¦å¥ä¿¸å©ååå¼åååå俺ååå¨ä¿±å¡ååå俳修ååªä¿¾å«åå ¼å¤å¥å¢ååååååååååªå¿åååå¨ååå·å¼å¥å²ååºåå©åå¡åå®åª"], +["ae40","å¦å§åå½åååååååå å¤å¥å¥å¥å¨å¨å¨å¨å¨å¨å§¬å¨ 娣娩娥å¨å¨å«å±å®°å®³å®¶å®´å®®å®µå®¹å®¸å°å±å±å±å³å³½å³»å³ªå³¨å³°å³¶å´å³´å·®å¸å¸«åº«åºåº§å¼±å¾å¾å¾æ"], +["aea1","æ£æ¥ææææ©æ¯æææææææ æææ³ææ¿ææ¾æ¯ææææææºææ½æªæ«æ¨æææææææ æææææææ ææ¸ææææ ¡æ ¸æ¡æ¡æ¡æ ¹æ¡æ¡æ ©æ¢³æ æ¡æ¡æ ½æ´æ¡æ¡æ ¼æ¡æ ªæ¡ æ æ æ¡æ®æ®æ®·æ°£æ°§æ°¨æ°¦æ°¤æ³°æµªæ¶æ¶æ¶æµ¦æµ¸æµ·æµæ¶"], +["af40","浬æ¶æµ®æµæµ´æµ©æ¶æ¶æµ¹æ¶ æµ¥æ¶ççç¤çççç¹ç¹ç¼ç¹ç½ç¸ç·çççç®ç çªççççççç¾ç çç²ç³ç½ç¼ç¹çç¸çç°çççç©çç ç¨ç©ç °ç §ç ¸ç ç ´ç ·"], +["afa1","ç ¥ç ç ç ç ²ç¥ç¥ç¥ ç¥ç¥ç¥ç¥ç¥ç¥ç§¤ç§£ç§§ç§ç§¦ç§©ç§çªçªç«ç¬ç¬ç²ç´¡ç´ç´ç´ç´ ç´¢ç´ç´ç´ç´ç´ç´ç´ç´ç¼ºç½ç¾ç¿ ç¿èèèèèè½è¿è±èè°è èè´èè¸è³èè½èè¼è¯èè¬èèèªè«è¨è¬è»è«èèèè¸èèèµè´èè²è¹è¶èèè±è¨è"], +["b040","èèèªèè¤è©èè£èè¡°è¡·è¢è¢è¡½è¡¹è¨è¨è¨è¨è¨è¨è¨è¨è¨è¨è¨è±è±ºè±¹è²¡è²¢èµ·èº¬è»è»è»è¾±ééè¿·é迺迴é追é 迸éé¡éé¢é é é ééééééé¢é£é¡"], +["b0a1","ééé¤ééé»é£¢é¦¬éª¨é«é¬¥é¬²é¬¼ä¹¾åºå½ååååååå¥å¶åååµå´å·ååå¯åå åå°åªå¯åååååååå¿åå¾åæ¼ååªå¦ååå¡ååå±åååå¯å¤å¸å®åå¬å£å³ååååååå å å å å¤åºå å µå·å¹å¤ 奢娶å©å©å©¦å©ªå©"], +["b140","娼婢å©å©å©å°å¯å¯ å¯å¯å®¿å¯å°å°å°å± å±å±å´å´å´å´å´å´¢å´å´©å´å´å´¤å´§å´å·¢å¸¸å¸¶å¸³å¸·åº·åº¸åº¶åºµåº¾å¼µå¼·å½å½¬å½©å½«å¾å¾å¾å¾å¾¡å¾ å¾æ¿æ£ææ æ¨ææ´æ¦æ½"], +["b1a1","æ æ»æµææ¼æææææ¸ææææææ æ§æ²ææ¢æ¥æ·æ§ææªæ±æ©ææææ«æ¨ææææ¡æ¬ææææ»æ©æ¨æºæææææåæææææææ¬æææææææ¤æ¨æ¦ææ¹åææ¢æ¢¯æ¢¢æ¢æ¢µæ¡¿æ¡¶æ¢±æ¢§æ¢æ¢°æ¢æ£æ¢æ¢æ¢ æ¢æ¢æ¢¨æ¢æ¢¡æ¢æ¬²æ®º"], +["b240","毫毬氫æ¶æ¶¼æ·³æ·æ¶²æ·¡æ·æ·¤æ·»æ·ºæ¸ æ·æ·æ¶¯æ·æ¶®æ·æ·¹æ¶¸æ··æ·µæ· æ·æ¸æ¶µæ·æ·«æ·æ·ªæ·±æ·®æ·¨æ·æ·æ¶ªæ·¬æ¶¿æ·¦ç¹ççç½ç¯ç½ç½çççççççç çççç¾çç ç¶"], +["b2a1","ç·çç¢ç¥ç¦ç¢ç°ççççµççççççç·ç¾ç¼ç¶ç¸çºç¡«ç¡ç¡ç¥¥ç¥¨ç¥ç§»çªçªç¬ 笨ç¬ç¬¬ç¬¦ç¬ç¬ç¬®ç²ç²ç²çµçµçµ±ç´®ç´¹ç´¼çµç´°ç´³çµç´¯çµç´²ç´±ç¼½ç¾ç¾ç¿ç¿ç¿èèèè¯èè£è«è©è°è¤èèµè·è¶è¹èèèè¸è¢èè½è«èèèèè è·è»è¼"], +["b340","èè§è彪èèè¶èèµèèè±è¯èè¡è¢è¢è¢«è¢è¢è¢è¢è¦è¦è¨ªè¨è¨£è¨¥è¨±è¨è¨è¨è¨¢è±è±è²©è²¬è²«è²¨è²ªè²§èµ§èµ¦è¶¾è¶ºè»è»ééééé£éééééé éé¢ééé"], +["b3a1","é¨éé½é ééµé¦é£é§éé©ééªéµé³é¸é°é´é¶é·é¬ééªé©ç« ç«é é é鳥鹵鹿麥麻å¢åå ååååååæå±å²å´åµå©ååååå¥å»åå§å¼ååååååªååååå³å®åå¾å²åå»å¬å±å¾åå«ååå ¯å ªå ´å ¤å °å ±å ¡å å å£¹å£ºå¥ "], +["b440","å©·åªå©¿åªåªåª§å³å±å¯å¯å¯å¯å°å°å°±åµåµå´´åµå·½å¹ 帽å¹å¹å¹¾å»å»å»å»å¼¼å½å¾©å¾ªå¾¨ææ¡æ²æ¶æ ææ£æºææ°æ»æ´æ ¨æ±ææ¶ææææææ£ææææ©æææ"], +["b4a1","ææ£ææ¡æææ®æ¶æ´æªææææ¹ææ¦æ¢æ£æææ¯æ®æ°æ´æ¶æ¯ææºæ¾æ·æ¾æ¿ææ棺æ£æ£ æ£æ£æ¤ æ£æ£µæ£®æ£§æ£¹æ£æ£²æ££æ£æ£æ¤æ¤æ¤æ£æ£æ¥®æ£»æ¬¾æ¬ºæ¬½æ®æ®æ®¼æ¯¯æ°®æ°¯æ°¬æ¸¯æ¸¸æ¹æ¸¡æ¸²æ¹§æ¹æ¸ 渥渣æ¸æ¹æ¹æ¸¤æ¹æ¹®æ¸æ¸¦æ¹¯æ¸´æ¹æ¸ºæ¸¬æ¹æ¸æ¸¾æ»"], +["b540","æºæ¸æ¹æ¹£æ¹æ¹²æ¹©æ¹ççç¦ç°ç¡ç¶ç ®ççççç¶ç¥ç´ç©çºçªç³ç¢ç¥çµç¶ç´ç¯çç¦ç¨ç¥ç¦ç«çªç¢çç£çççç ç»ç¼ççç´çççç¡ç¡¬ç¡¯ç¨ç¨ç¨ç¨ ç¨çª"], +["b5a1","çªçªç«¥ç«£ççççççççççç²ç²¥çµçµçµ¨çµç´«çµ®çµ²çµ¡çµ¦çµ¢çµ°çµ³åç¿ç¿èèè è è è è è è¹è è¾è è è ´èèè©èè¸èè è èèè¯è±è´èèè°èèè½è²èè¸èèèèèèèèèèèèè¤èèè¡è£è£è¢±è¦è¦è¨»è© è©è©è¨¼è©"], +["b640","è©è©è©è©è¨´è¨ºè¨¶è©è±¡è²è²¯è²¼è²³è²½è³è²»è³è²´è²·è²¶è²¿è²¸è¶è¶ è¶è·è·è·è·è·è·è·è·è»»è»¸è»¼è¾é®éµé±é¸é²é¶ééµéé¾é £é ¥éééé£éééééééééé"], +["b6a1","ééééééé½é ééé²ééé éééé¯é²éé é é 飧飪飯飩飲é£é¦®é¦é»é»é»äºååµå²å³å å¾å¬å·å»å¯åå¿å·å½åå¦å¤å¢å£å¯åå¨åå¦ååååå£å¤å¯åå¡å åå¥åååå¡å¡å¡å¡å¡å¡å¡«å¡å¡å¡å¡¢å¡å¡å¥§å«å«å«åª¾åª½åª¼"], +["b740","媳å«åª²åµ©åµ¯å¹å¹¹å»å»å¼å½å¾¬å¾®æææ ææ³ææ¹æææ æ æ æ æ¾æ´æ§æææ·æ¡æ¢ææ¾ææªææ½æ¬æææææ¶ææææ¬ææ°ææææææææææ¦æ¥"], +["b7a1","æ¥æ¥·æ¥ æ¥æ¥µæ¤°æ¦æ¥æ¥¨æ¥«æ¥æ¥æ¥¹æ¦æ¥æ¥£æ¥ææ²æ¯æ®¿æ¯æ¯½æº¢æº¯æ»æº¶æ»æºæºæ»æ» 溥æºæº¼æººæº«æ»æºæºæ»æ»æºªæº§æº´ç ç ç ©ç ¤ç ç §ç ç ¬ç ¦ç ç ¥ç ç ç ¨ç çºçç·ç ç¿ç¾ç¯çççççç¿çççç¶ç¸çç°çç²ç±çºç¿ç´ç³çççç«ç¦çç£"], +["b840","ç¹çªç¬çç¥ç¨ç¢ç®ç¢ç¢°ç¢ç¢ç¢ç¢ç¡¼ç¢ç¢ç¡¿ç¥ºç¥¿ç¦è¬ç¦½ç¨ç¨ç¨ ç¨ç¨ç¨çªçª ç·ç¯ç ç®ç§ç²±ç²³ç²µç¶çµ¹ç¶ç¶ç¶çµç½®ç½©ç½ªç½²ç¾©ç¾¨ç¾¤èèèèè ±è °è ¸è ¥è ®è ³è «"], +["b8a1","è ¹è ºè ¦è èèè·è½è±èµè¦è«èè¬èè¼èµè¡è£è©èèèèèè¹èèèèè¾è»èèèèè¡è£è£è£è£è£è£è£¡è£è£è£è¦è§£è©«è©²è©³è©¦è©©è©°èªè©¼è©£èª è©±èª è©è©¢è©®è©¬è©¹è©»è¨¾è©¨è±¢è²è²è³è³è³è³è²²è³è³è³ è·¡è·è·¨è·¯è·³è·ºè·ªè·¤è·¦èº²è¼è¼è»¾è¼"], +["b940","è¾è¾²éééééé¼éééééééé¾éééé ¬é ªé ©éé·éé¸é½éé¾ééé¤éé´ééé é¹é¿éééééééééé·é»é¹é¶éé´é¶é é é é é é 飼飴"], +["b9a1","飽飾馳馱馴髡鳩éºé¼é¼é¼ å§å®å¥ååååååå±åå©å ¢å³ååå±åå¾åååå½åååååå·ååååå¶åå塵塾å¢å¢å¢å¡¹å¢ 塽壽夥夢夤奪奩嫡嫦嫩å«å«å«å«£åµå¯å¯§å¯¡å¯¥å¯¦å¯¨å¯¢å¯¤å¯å°å±¢å¶å¶å¹å¹£å¹å¹å¹å»å»å¼å½å½°å¾¹æ "], +["ba40","æ¿æ æ ·æ ¢æ £æ æ æ æ µæªææææ¤æ¸ææºææ§æ´ææ»æ²æ¡æææ¢æ¨ææ¦æ¦¨æ¦æ§æ¦®æ§æ§æ¦æ¦·æ¦»æ¦«æ¦´æ§æ§æ¦æ§æ¦¦æ§æ¦£ææ氳漳æ¼æ»¾æ¼æ»´æ¼©æ¼¾æ¼ 漬æ¼æ¼æ¼¢"], +["baa1","滿滯æ¼æ¼±æ¼¸æ¼²æ¼£æ¼æ¼«æ¼¯æ¾æ¼ªæ»¬æ¼æ»²æ»æ»·ççç ½çççç¾ççççç¤ç£çªç°çççç§ççççç¡ç£çç½ç¿ç¡ç£ç¢ç¢§ç¢³ç¢©ç¢£ç¦ç¦ç¦ç¨®ç¨±çªªçª©ç«ç«¯ç®¡ç®ç®çµç®ç®ç®ç®ç®¸ç®ç®ç²¹ç²½ç²¾ç¶»ç¶°ç¶ç¶½ç¶¾ç¶ ç·ç¶´ç¶²ç¶±ç¶ºç¶¢ç¶¿ç¶µç¶¸ç¶ç·ç·ç¶¬"], +["bb40","ç½°ç¿ ç¿¡ç¿èèèè èèèèè ¿èè§èºèèèèèè¿èèèèè²èèè¸èèèè¼èèè¿èè»è¢è¥è´èèè·è©è£³è¤è£´è£¹è£¸è£½è£¨è¤è£¯èª¦èªèªèª£èªèª¡èªèª¤"], +["bba1","說誥誨èªèªèªèª§è±ªè²è²è³è³è³èµ«è¶è¶è·¼è¼è¼è¼è¼è¾£é ééé£ééé¢éééééé µé ¸é ·é ´é¸éé ééé»ééé¨é¼éé¡é¨é©é£é¥é¤ééééééé¼é é¶é é 颯颱é¤é¤ é¤é¤é§éª¯éª°é«¦éé鳴鳶鳳麼鼻é½ååå»åµå¹åååå å"], +["bc40","åååååå°å²å®å»å¹å²å¿å´å©åååå´å¶å¯å°å¢å¢å¢å¢³å¢å¢®å¢©å¢¦å¥å¬å«»å¬å«µå¬å¬å¯®å¯¬å¯©å¯«å±¤å±¥å¶å¶å¹¢å¹å¹¡å»¢å»å»å»å»£å» å½å½±å¾·å¾µæ ¶æ §æ ®æ æ æ"], +["bca1","æ ¼æ °æ «æ ¾æ§ææ«ææ¬ææ¤ææ®æ®æ©æ¯æ¹ææ²æææ°æ¥æææ©ææ®ææ«ææ¬ææ¢æ³æµæ·æ¸æ®æ«æ´æ±æ¨£æ¨æ§¨æ¨æ¨æ¨æ§½æ¨¡æ¨æ¨æ§³æ¨æ¨ æ§æ¨æææ®¤æ¯ æ¯æ¼¿æ½¼æ¾æ½æ½¦æ½æ¾æ½æ½æ½¸æ½®æ¾æ½ºæ½°æ½¤æ¾æ½æ»æ½¯æ½ æ½çç¬ç±ç¨ççççç©çç"], +["bd40","ç¾çç¿ç ç©çç¤ç¦ç¡ç¢ççºç¤çççççç£ç£ 確ç£ç¢¾ç£ç¢¼ç£ç¨¿ç¨¼ç©ç¨½ç¨·ç¨»çª¯çª®ç®ç®±ç¯ç®´ç¯ç¯ç¯ç® ç¯ç³ç· 練緯緻ç·ç·¬ç·ç·¨ç·£ç·ç·ç·©ç¶ç·ç·²ç·¹ç½µç½·ç¾¯"], +["bda1","ç¿©è¦èèèè èèèè½èè®è¬èèèè£è¡èè¬è¥è¿èèè´è¶è è¦è¸è¨èèèèè¡è¡è¤è¤è¤è¤è¤è¤èª¼è«è«è«èªè«è«¸èª²è«è«èª¿èª°è«è«èª¶èª¹è«è±è±è±¬è³ è³è³¦è³¤è³¬è³è³¢è³£è³è³ªè³¡èµè¶è¶£è¸«è¸è¸è¸¢è¸è¸©è¸è¸¡è¸èººè¼è¼è¼è¼©è¼¦è¼ªè¼è¼"], +["be40","è¼¥é©é®é¨éé·é°éé§é±ééééé é»é·éªé¬é¤éé³é¼ééé°é²éé±ééééé éééé ¡é «é 颳é¤é¤é¤é¤é§é§é§é§é§é§é§é§éª·é«®é«¯é¬§é éé·é¯é´é´"], +["bea1","é´éº©éº¾é»å¢¨é½åååååååªåååå³åå«å¹å©å¤å¸åªå¨å¥å±å¯å¬å¢å¶å£å¢¾å£å£ 奮å¬å¬´å¸å¯°å°å½æ²ææ©æææ¶æ¾æææ°æ æææ»æ¼ææææææ¿æææ¾æ´æææ¹æææ¸æ¨½æ¨¸æ¨ºæ©æ©«æ©æ¨¹æ©æ©¢æ©¡æ©æ©æ¨µæ©æ©ææ·æ° æ¿æ¾±æ¾¡"], +["bf40","æ¿æ¾¤æ¿æ¾§æ¾³æ¿æ¾¹æ¾¶æ¾¦æ¾ æ¾´ç¾çççççç¹çççççç¨çç£çççç¢ççç´ç¸çºç§ç¥ç ççç¥ç£¨ç£ç£¬ç£§ç¦¦ç©ç©ç©ç©ç©çªºç¯ç°ç¯ç¯¤ç¯ç¯¡ç¯©ç¯¦ç³ç³ç¸"], +["bfa1","ç¸ç¸ç¸ç¸£ç¸ç¸ç¸ç¸ç½¹ç¾²ç¿°ç¿±ç¿®è¨è³è©è¨è»èèèèèèè¨è©èèèèªèèèèè¢è衡褪褲褥褫褡親覦諦諺諫諱è¬è«è«§è«®è«¾è¬è¬è«·è«è«³è«¶è«¼è±«è±è²è³´è¹è¸±è¸´è¹è¸¹è¸µè¼»è¼¯è¼¸è¼³è¾¨è¾¦éµé´é¸é²é¼éºé´éé é¶é¸é³é¯é¢é¼é«éé"], +["c040","éé¦é¡éé®éé»é§é¨éªéééééééééé¦éé °é ¸é »é ·é é ¹é ¤é¤é¤¨é¤é¤é¤¡é¤é§é§¢é§±éª¸éª¼é«»é«é¬¨é®é´é´£é´¦é´¨é´é´é»é»é¾é¾åªåå¡å²åµåååå å"], +["c0a1","åå£å£å£å£å¬°å¬ªå¬¤åºå°·å±¨å¶¼å¶ºå¶½å¶¸å¹«å½å¾½ææææ¦ææ²æ´ææææ æ°æ¦æ¬æ±æ¢ææææææªæªæªæª¢æªæ«æª£æ©¾æªæªæª ææ®®æ¯æ°æ¿æ¿±æ¿æ¿ æ¿æ¿¤æ¿«æ¿¯æ¾æ¿¬æ¿¡æ¿©æ¿æ¿®æ¿°ç§çç®ç¦ç¥çç¬ç´ç çµçç°ç²ç©ç°ç¦ç¨ççççªç³çªç°ç¬"], +["c140","ç§çç¯ç£·ç£ºç£´ç£¯ç¤ç¦§ç¦ªç©çª¿ç°ç°ç¯¾ç¯·ç°ç¯ ç³ ç³ç³ç³¢ç³ç³ç³ç¸®ç¸¾ç¹ç¸·ç¸²ç¹ç¸«ç¸½ç¸±ç¹ ç¹ç¸´ç¸¹ç¹ç¸µç¸¿ç¸¯ç½ç¿³ç¿¼è±è²è°è¯è³èèèºèèè¿è½èè¾è¨èè±èª"], +["c1a1","èè¾èèèè¯èèè¨èè§èèè³èèè«è»èºèè褻褶è¥è¤¸è¤½è¦¬è¬è¬è¬è¬è¬è¬ è¬è¬è¬è±è°¿è±³è³ºè³½è³¼è³¸è³»è¶¨è¹è¹è¹è¹è½è¼¾è½è½ 輿é¿é½ééééé¹é£ééééé¨éµéé¥ééé¾é¬éé°éééééééé±é¸éééé éé¡é¢¶é¤µé¨"], +["c240","駿鮮鮫鮪é®é´»é´¿éºé»é»é»é»é»é¼¾é½å¢åå®å£å£å¬¸å½æ£æ³æ´æ²æ¾ææºæ»æ·æ·ææ¦æª³æª¬æ«æª»æª¸æ«æª®æª¯ææ¸æ®¯çç濾ç濺ççç»ç¼ç¾ç¸ç·çµç§ç¿ççç"], +["c2a1","çç½ç¿ç»ç¼ç¤ç¦®ç©¡ç©¢ç© ç«ç« 簫簧簪ç°ç°£ç°¡ç³§ç¹ç¹ç¹ç¹ç¹¡ç¹ç¹ç½ç¿¹ç¿»è·è¶èèèèè©èèèè°èºè¹è¦è¯è¬è²è è¦è¦²è§´è¬¨è¬¹è¬¬è¬«è±è´ è¹è¹£è¹¦è¹¤è¹è¹è»è½è½éééé«é¬ééééé¢é³é®é¬é°éééééééé¢ééééé¤é£é¦"], +["c340","éé¹é¡é¡é¡é¡é¡é¢ºé¤¾é¤¿é¤½é¤®é¦¥é¨é«é¬é¬éééé¯é¯é¯½é¯é¯éµéµéµ é» é¼é¼¬å³å¥å£å£å£¢å¯µé¾å»¬æ²æ·æ¶æµæææ ææ«¥æ«æ«æ«ççç¨çççççççç¢ç¸"], +["c3a1","çºç½çç£çççç¡çç¤ç¦±ç©«ç©©ç°¾ç°¿ç°¸ç°½ç°·ç±ç¹«ç¹ç¹¹ç¹©ç¹ªç¾ 繳羶羹羸èè©èèªèè¤è¥è·è»è è è¹è¾è¥ è¥è¥è¥èèèèèèèèèè´è´è¹¼è¹²èºè¹¶è¹¬è¹ºè¹´è½è½è¾ééé±é®é¡éééééééé¢ééé¤éé¨éé´é£éªé§é¡éé»é¡"], +["c440","é¡é¡é¢¼é¥ é¥é¨é¨é¬é¯¨é¯§é¯é¯é¶éµ¡éµ²éµªéµ¬éºéºéºéº´å¸å¨å·å¶å´å¼å£¤ååå½å¯¶å·æ¸æºææææ¦æ§æ«¬ç¾ç°ç²çç»çç¢ç¥ç¤¦ç¤ªç¤¬ç¤«ç«ç«¶ç±ç±ç±ç³¯ç³°è¾®ç¹½ç¹¼"], +["c4a1","çºç½èèè¦è»è¹èèºèèèèè è 襤覺觸è°è¬è¦è¯èè«è´è´èºèºèº èºé´éééé½é¡é°é£é¥é¥é¦¨é¨«é¨°é¨·é¨µé°é°é¹¹éºµé»¨é¼¯é½é½£é½¡å·å¸åååå¤å±¬å·æ¼æ¾ææææ©æ«»æ¬æ«ºæ®²ççç§ççç©çç±çºçºç¾¼èèèè £è ¢è ¡è 襪襬覽è´"], +["c540","è·è½è´èºèºèºè½è¾¯éºé®é³éµéºé¸é²é«é¢é¸é¹é²é¿é¡§é¡¥é¥é© é©é©é¨¾é«ééé°é°¥é¶¯é¶´é·é¶¸éºé»¯é¼é½é½¦é½§å¼å»åååå¿å·å·å½æ¿æ¤æ¬æ¡çççç¤çç®ç¬"], +["c5a1","ç¦³ç± ç±è¾è½è襲襯觼è®è´è´èºèºè½¡é éééé½é¾ééé¡«é¥é©é©é«é¬é±é°±é°¾é°»é·é·é¼´é½¬é½ªé¾åå·ææ£æ«æªæ¬æ¬çç«ç±¤ç±£ç±¥çºçºçºè¢è¸è¿è ±è®ééé£é é¤é¨é¡¯é¥é©é©é©é«é«é«é±é±é±é·¥éºé»´å壩æ¬çç±ç²çç½ç¾è ¶è ¹è¡¢è®è®"], +["c640","è®è·è´ééªééééé¡°é©é¬¢éé±é·¹é·ºé¹¼é¹½é¼é½·é½²å»³æ¬ç£ç±¬ç±®è »è§èº¡éé²é°é¡±é¥é«é¬£é»ç¤çè®é·é驢驥çºè®èºªé é½é¾é¼é±·é±¸é»·è±é¿é¸ç¨é©ªé¬±é¸é¸ç±²"], +["c940","ä¹ä¹åµååä¸ä¸ä¹äºåï¨å±®å½³ä¸åä¸ä¸®äºä»ä»ä»åå¼å¬å¹å å¤å¤¬å°å·¿æ¡æ®³æ¯æ°ç¿ä¸±ä¸¼ä»¨ä»ä»©ä»¡ä»ä»åååå¢å£å¤å¤¯å®å®å°å°»å±´å±³å¸åºåºå¿æææ°"], +["c9a1","æ°¶æ±æ°¿æ°»ç®ç°ç禸èéä¼ä¼ä¼¬ä»µä¼ä»±ä¼ä»·ä¼ä¼ä¼ä¼ ä¼¢ä¼ä¼ä»´ä¼å±åååå¦å¢ååååå¡åå®åªå´å¤¼å¦å¥¼å¦ 奻奾奷奿åå°å°¥å±¼å±ºå±»å±¾å·å¹µåºå¼å¼å½´å¿å¿å¿æææ¤æ¡æ¦æ¢ææ ææ¥æ¯æ®æ¾æ¹æ¸æ»æºæ¿æ¼æ³æ°æ±æ±æ±æ±æ±æ±æ±"], +["ca40","æ±ç±çç´çµççªç¿ç©µç½è¸è¼èè½è¿è襾éééééé¢é¤é é£ä½ä¼»ä½¢ä½ä½ä½¤ä¼¾ä½§ä½ä½ä½ä½ä¼ä¼³ä¼¿ä½¡åå¹ååå¡åå®åå£å²ååå°å·åªåå ååå¥å"], +["caa1","å½ååå¨å¤åå®å§å¥åå ååååå¤å¥å¦¦å¦å¦ å¦å¦å¦¢å¦å¦å¦§å¦¡å®å®å°¨å°ªå²å²å²å²å²å²å²å²å²å²å· å¸å¸åºåºåºåºåºå¼ å¼å½¸å½¶å¿å¿å¿å¿å¿¨å¿®å¿³å¿¡å¿¤å¿£å¿ºå¿¯å¿·å¿»æå¿´æºæææææææ±æ»æºæ°æææ·æ½æ²æ´æ·æ°æ´æ³æ²æµæ æ"], +["cb40","æææææææææ¯æ°æ°æ±¸æ±§æ±«æ²æ²æ²æ±±æ±¯æ±©æ²æ±æ²æ²æ²æ±¦æ±³æ±¥æ±»æ²ç´çºç£ç¿ç½ççççºç ççççççºç¹ççç礽è´èèèèèèèè èèè"], +["cba1","èèè豸è¿è¾¿éé¡é¥éé§é é°é¨é¯é丳ä¾ä½¼ä¾ ä½½ä¾ä¾ä½¶ä½´ä¾ä¾ä½·ä½ä¾ä½ªä¾ä½¹ä¾ä½¸ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä½«ä½®åå¼å¾åµå²å³åå±å¼ååå¼åååå¿ååååå«åºå¾å¥å¬å´å¦åå¯å¡å åå£å§å¤å·å¹å¯å²åå«å±å°å¶ååµå»å³å´å¢"], +["cc40","å¨å½å¤å¥ 妵妺å§å§å¦²å§å§å¦¶å¦¼å§å§å¦±å¦½å§å§å¦´å§å¢å¥å®å®å±å±å²®å²¤å² 岵岯岨岬å²å²£å²å²¢å²ªå²§å²å²¥å²¶å²°å²¦å¸å¸å¸å¼¨å¼¢å¼£å¼¤å½å¾å½¾å½½å¿å¿¥ææ¦ææ²æ"], +["cca1","æ´æææ³æææ¬æ¢æææ®æææææææ½ææ´ææ¾æªæ¶ææ®æ³æ¯æ»æ©æ°æ¸æ½æ¨æ»ææ¼ææææ»ææææ æ½æææ¶ææ æ¬æææ¶æ»ææææ´æææºæææææ½ææ¸æ¹æ欥æ®æ¾æ¯æ°æ²æ³¬æ³«æ³®æ³æ²¶æ³æ²æ³§æ²·æ³æ³æ²ºæ³æ³æ³æ³²"], +["cd40","æ³æ³æ²´æ²æ²æ²æ³æ³æ´°æ³æ³æ²°æ³¹æ³æ³©æ³ççç çççççççççªççççççççççç¤ç¡çç¦ç¢ç ç¬ççç¨ç¿çç¾ççç¯ç³ç±ç°çµç¸ç¼ç¹ç»çº"], +["cda1","ç·ç¥ç¤¿ç§ 穸穻竻籵糽èµèè®è£è¸èµèè è èè«èèèèµè§è®è¼èèºè´è¨è¡è©èè¤èè¶è¢è°è¯èè®è±è¿è¿è¿è¿è¿è¿è¿é²é´é¯é³é°é¹é½é¼éºéä¿ä¿ ä¿ä¾²ä¿ä¿ä¿ä¿ä¿ä¿ä¾»ä¾³ä¿ä¿ä¿ä¾ºä¿ä¾¹ä¿¬ååååå½å¼åååååºå¡åå¥å"], +["ce40","åèå·å®åå¶å åå å°å¼å¢å¾å²åå°åµååå¤ååååååååå¥åå壴å¤å¥å§¡å§å§®å¨å§±å§å§ºå§½å§¼å§¶å§¤å§²å§·å§å§©å§³å§µå§ 姾姴å§å®¨å±å³å³å³å³å³å³"], +["cea1","å³å³å³å³å³å³å³å³å³å³å³å³å³å³¸å·¹å¸¡å¸¢å¸£å¸ 帤庰庤庢åºåº£åº¥å¼å¼®å½å¾æ·æ¹ææ²ææ æææææææææ¤æææ¦æ®ææææææµæææ«æ¹æææ¸æ¶ææææºææ»æ°æææªæ¿æ¶æ¡æ²æµææ¦æ¢æ³æ«æºææ´æ¹æ®ææææ²ææº"], +["cf40","ææ»æ¸æææ·æ æ«æ¤ææµææ³æ·æ¶æ®æ£ææ¹ææ§æ°æ²æ¼ææææ®æ¦ææºææææªæ欨æ®æ®æ®¶æ¯æ¯æ¯ æ° æ°¡æ´¨æ´´æ´æ´æ´¼æ´¿æ´æ´æ³æ´³æ´æ´æ´ºæ´æ´æ´æ´æµ"], +["cfa1","æ´æ´æ´·æ´æ´æµæ´æ´ æ´¬æ´æ´¢æ´æ´ç·çç¾ç±ç°ç¡ç´çµç©çççç¬ç°ç³ç®çç¤ç¨ç«ççªç¦ç£ç çççç ç¹ç¶çµç´ç«ç¿çç¾ççç¸çç¬ç®ç®ççç§çªç¹ççççç çç·ç»çºç§ç¨ç ç ç ç ç ç ç ç ç ç ç¥ç¥ç¥ç¥ ç¥ç§ç§ç§ç§ç§çª"], +["d040","穾ç«ç¬ç¬ç±ºç±¸ç±¹ç±¿ç²ç²ç´ç´ç´ç½ç¾ç¾ç¾¾èèèèè·èèè èèèèè è£èèèèèèèè¦èè¿è¡èèè¾è¹èè¨èèèºè«èè´è¬è¡è²èµèè»è¶è°èª"], +["d0a1","è¤è èºè³èè·è´è¼è³è¡è¡è¡§è¡ªè¡©è§è¨è¨èµ²è¿£è¿¡è¿®è¿ é±é½é¿éé é¾éééééééééééåå ååå¢å°å俵俴å³å·å¬ä¿¶ä¿·ååå å§åµå¯å±åå ååååå ååå¡åååååå¢åååå¦å¢ååå§å³å¤åå¿ååå«åå å±"], +["d140","åå»å·å¸å ååååååå ²åååºåå½å¼å¸å¶å¿ååå¹åå¤å¥å¨å¨å¨å¨®å¨å¨å¨å¨å¨å¨³å¬å®§å®å®¬å°å±å±å³¬å³¿å³®å³±å³·å´å³¹å¸©å¸¨åº¨åº®åºªåº¬å¼³å¼°å½§æææ§"], +["d1a1","ææ¢æææææææææææææææ²æææ¬ææ æ¶ææ¤æ¹æææ¼æ©ææ´ææææææ³æææ¸ææææææææææææææææ æ æ¡æ ²æ ³æ »æ¡æ¡æ æ ±æ æ µæ «æ æ ¯æ¡æ¡æ ´æ æ æ æ ¦æ ¨æ ®æ¡æ ºæ ¥æ 欬欯æ¬æ¬±æ¬´æèæ®æ¯¦æ¯¤"], +["d240","毨毣毢毧氥浺浣浤浶æ´æµ¡æ¶æµæµ¢æµæµ¯æ¶æ¶æ·¯æµ¿æ¶æµæµ§æµ æ¶æµ°æµ¼æµæ¶æ¶æ´¯æµ¨æ¶æµ¾æ¶æ¶æ´æ¶æµ»æµ½æµµæ¶çççççç¼¹ç¢çççç ççç ççççç¡çç¸"], +["d2a1","ç·ç¶ççºç´ç¾ç¶ç³ç»çççç¥çç¼ç§ç£ç©ççççççççç¨ççç´çµç¡ççç°çç»ççç¿ç¶çºçççççççç£ççççç¢ç§ç £ç ¬ç ¢ç µç ¯ç ¨ç ®ç «ç ¡ç ©ç ³ç ªç ±ç¥ç¥ç¥ç¥ç¥ç¥ç¥ç§«ç§¬ç§ 秮ç§ç§ªç§ç§ç§çªçªçª çªçªçªçªç«ç¬"], +["d340","ç¬ç¬ç¬ ç¬ç¬ç¬ç¬ç¬ç¬ç²ç²ç²ç²ç²ç²ç² ç´ç´ç´ç´ç´ç´ç´ç´ç´ç´ç´ç½ç½¡ç½ç½ ç½ç½ç¾ç¾ç¿ç¿ç¿èè¾è¹èºè²è¹èµèè»èèè¯è¥è³èèèèè¥èè¿èè¦èè¢"], +["d3a1","èèèèªèè¼èèè¤è è·è¯è©èè èèèè¬èè§èèèè¢è¨èèèèèèèèèè è¥èè¡è§èèèèèèè¡è¡è¡è¡µè¡¶è¡²è¢è¡±è¡¿è¡¯è¢è¡¾è¡´è¡¼è¨è±è±è±»è²¤è²£èµ¶èµ¸è¶µè¶·è¶¶è»è»è¿¾è¿µéè¿¿è¿»é迼迶éé ééé£éé¥ééééé¤é "], +["d440","é é éé¢éééé¼é££é«é¬¯ä¹¿å°åªå¡åå åååå²åååååå¢åå åå©å«å£å¤ååå®å³åååå«åå¬å®åååååµå¶å¼ååå´åªåå¢å¶åµå°åå "], +["d4a1","åå²å¥åå¹ååå»ååååå»å å¢å¶åå´å åå½å å¸å å³åå å®å£å²å¥å¬å¡å å¼å å§å å å±å©å°å å å¥å© å©å©å©§å©å¨¸å¨µå©å©å©å©¥å©¬å©å©¤å©å©å©å©å©å©å©åªå¨¾å©å¨¹å©å©°å©©å©å©å©å©å©å²å®å¯å¯å±å´å´å´å´å´ å´å´¨å´å´¦å´¥å´"], +["d540","å´°å´å´£å´å´®å¸¾å¸´åº±åº´åº¹åº²åº³å¼¶å¼¸å¾å¾å¾ææææ¾æ°æºææææ¤ææææ±ææ·ææ¿ææææ²æ¥æææ½æ½æææææ«ææ¯æææ®æ¯æµæææ®æ¼æ¤æ»æ"], +["d5a1","æ¸æ ææææ°æææ¥æ¡ææææ¢æ桹æ¢æ¢æ¢æ¡æ¡®æ¢®æ¢«æ¥æ¡¯æ¢£æ¢¬æ¢©æ¡µæ¡´æ¢²æ¢æ¡·æ¢æ¡¼æ¡«æ¡²æ¢ªæ¢æ¡±æ¡¾æ¢æ¢æ¢æ¢ æ¢æ¢¤æ¡¸æ¡»æ¢æ¢æ¢æ¡½æ¬¶æ¬³æ¬·æ¬¸æ®æ®æ®æ®æ®æ°ªæ·æ¶«æ¶´æ¶³æ¹´æ¶¬æ·©æ·¢æ¶·æ·¶æ·æ¸æ·æ· æ·æ·æ¶¾æ·¥æ·æ·æ·æ·´æ·æ¶½æ·æ·°æ¶ºæ·æ·æ·æ·"], +["d640","æ·æ·²æ·æ·½æ·æ·æ·£æ¶»çºçç·çç´çç°çç³çç¼ç¿çççç¸ç¶çççç¾ç»ç¼ç¿çççççççç¿çççç¶ç¸çµççç½çççºç¼ç¿ççç´çç¤ç£ççç"], +["d6a1","çççççççç¹ç¯çç±ç²ç´ç³ç½ç¥ç»çµç¡ç¡ç¡ç¡ç¡ç¡ç ¦ç¡ ç¡ç¥¤ç¥§ç¥©ç¥ªç¥£ç¥«ç¥¡ç¦»ç§ºç§¸ç§¶ç§·çªçªçªç¬µç笴笥笰笢笤笳ç¬ç¬ªç¬ç¬±ç¬«ç¬ç¬¯ç¬²ç¬¸ç¬ç¬£ç²ç²ç²ç²£ç´µç´½ç´¸ç´¶ç´ºçµ 紬紩çµçµç´¾ç´¿çµç´»ç´¨ç½£ç¾ç¾ç¾ç¾ç¿ç¿ç¿ç¿ç¿ç¿ç¿ç¿è"], +["d740","èèèèèèè¥èèèèè¬èè¡èè§èè¢èè¸è³èºè´è²è´èè£è¨èèºè³è¤è´èèèèèµèè©è½èèèèèªèè¾è¥è¯èèè°è¿è¦èè®è¶èèèè¿è·"], +["d7a1","èèè èºè°èè¹è³è¸èè´è»è¼èè½è¾è¡è¢è¢è¢¨è¢¢è¢ªè¢è¢è¢¡è¢è¢è¢§è¢è¢è¢è¢¤è¢¬è¢è¢è¢è¦è§è§è§è¨°è¨§è¨¬è¨è°¹è°»è±è±è±½è²¥èµ½èµ»èµ¹è¶¼è·è¶¹è¶¿è·è»è»è»è»è»è» 軡é¤ééééé¡é¯éªé°é´é²é³éé«é¬é©é é é é é é¬é´é±é³é¸é¤é¹éª"], +["d840","é«é·é¨é®éºééé¼éé«é±é¯é¿éªé 飥é¦åååååå£ååååå¨ååååå åååå¤å§åå¨å¥åå·å å¢ååååµåå£åå¤å½åå¦å¿åå¡ååå ©å ·"], +["d8a1","å å å §å £å ¨åµå¡å ¥å å å ³å ¿å ¶å ®å ¹å ¸å å ¬å »å¥¡åª¯åªåªå©ºåª¢åªå©¸åª¦å©¼åª¥åª¬åªåª®å¨·åªåªåªåªåªåª©å©»å©½åªåªåªåªåªå¯ªå¯å¯å¯å¯å¯å¯å°å°°å´·åµåµ«åµåµå´¿å´µåµåµåµå´³å´ºåµå´½å´±åµåµå´¹åµå´¸å´¼å´²å´¶åµåµ å¹å¹å½å¾¦å¾¥å¾«ææ¹ææ¢æææ"], +["d940","æ²æææ æµææ¸æ¼æ¾ææææææ¿æææææ±æ°ææ¥æ¨æ¯æææ³ææ æ¶ææ²æµæ¡ææ¾æææææææææææ°æææ²æ§æªæ¤ææ¨æ¥ææææ®ææ"], +["d9a1","æ¼æ¬æ»ææ±æ¹æªæ²ææ¤æ£æ¤æ£æ¤ªæ£¬æ£ªæ£±æ¤æ£æ£·æ£«æ£¤æ£¶æ¤æ¤æ£³æ£¡æ¤æ£æ¤æ¥°æ¢´æ¤æ£¯æ£æ¤æ£¸æ£æ£½æ£¼æ£¨æ¤æ¤æ¤æ£æ£æ£æ£æ£¦æ£´æ£æ¤æ£æ£©æ¤æ¤¥æ£æ¬¹æ¬»æ¬¿æ¬¼æ®æ®æ®æ®æ®½æ¯°æ¯²æ¯³æ°°æ·¼æ¹æ¹æ¸æ¹æºæ¸¼æ¸½æ¹ 湢渫渿æ¹æ¹æ¹³æ¸æ¸³æ¹æ¹æ¹æ¸»æ¸æ¸®æ¹"], +["da40","湨æ¹æ¹¡æ¸±æ¸¨æ¹ 湱湫渹渢渰æ¹æ¹¥æ¸§æ¹¸æ¹¤æ¹·æ¹æ¹¹æ¹æ¹¦æ¸µæ¸¶æ¹ç çç¯ç»ç®ç±ç£ç¥ç¢ç²çç¨çºççççççç çççç°ç¢ç±ç³ç§ç²çç¦ç£çµçç®ç¬ç°ç«ç"], +["daa1","çç¡çç±ç¤ç£çç©ç ç²ç»ç¯ç¯ç¬ç§çç¡ç¦ççç¤ççççççççç çççççç¬ç¡ 硤硥ç¡ç¡ç¡±ç¡ªç¡®ç¡°ç¡©ç¡¨ç¡ç¡¢ç¥´ç¥³ç¥²ç¥°ç¨ç¨ç¨ç¨ç¨çªç«¦ç«¤ç笻ççççççç ç²¢ç²ç²¨ç²¡çµçµ¯çµ£çµçµçµ§çµªçµçµçµçµ«çµçµçµ©çµçµçµç¼¾ç¼¿ç½¥"], +["db40","ç½¦ç¾¢ç¾ ç¾¡ç¿èèèè¾èè è è è è è½è èºè¦è®è·è¸è¹èè¼è½è¿èµè»èè¹è£èè¨èè§è¤è¼è¶èèèè«è£è¿èèè¥èè¿è¡èèèèµèèèèèèèè³"], +["dba1","èèºèèèªèèè¬è®èè»èè¢èèè¾èè¢è¦èè£èèªèè«èè¬è©èè¨èè¡è¡è¡è¢ºè£è¢¹è¢¸è£è¢¾è¢¶è¢¼è¢·è¢½è¢²è¤è£è¦è¦è¦è§è§è§è©è©è¨¹è©è©è©è©è©è© è©è©è©è©è©è©è±è²è²è²ºè²¾è²°è²¹è²µè¶è¶è¶è·è·è·è·è·è·è·è·è·è·è·è· 軯軷軺"], +["dc40","軹軦軮軥軵軧軨軶軫軱軬軴軩éé´é¯éé¬éé¿é¼éé¹é»éééé éé ¡é ¤é é ¢é ééé¥ééé¦ééééé¿é½ééé§ééé¤ééé éé»ééééé¾é"], +["dca1","ééééééé±é°é¬é°é®é 颩飫鳦黹äºäºäº¶å½å¿åå®ååå´ååå°ååºå±ååå¶å¸ååºå¸å»å¼ååååååååååå©å¿ååååå¢ååå²ååååå¡å¡¨å¡¤å¡å¡å¡å¡¯å¡å¡å¡å¡å¡¥å¡å ½å¡£å¡±å£¼å«å«å«åªºåª¸åª±åªµåª°åª¿å«åª»å«"], +["dd40","媷å«å«åª´åª¶å«åª¹åªå¯å¯å¯å°å°³åµ±åµ£åµåµ¥åµ²åµ¬åµåµ¨åµ§åµ¢å·°å¹å¹å¹å¹å¹å» å»å»å»å»å½å¾¯å¾æ·æ æ æ«æ æ¶æ²æ®æ æ¯æ æ©æ æ é ¨æ£æ¥æ¤æ æ±æ«ææææ æ¤"], +["dda1","æ³æææææ¹æ·æ¢æ£ææ¦æ°æ¨ææµæ¯ææææ¥æ§ææ§ææ®æ¡ææ¯æææææææææææ¸æ 楦æ¥æ¤¸æ¥æ¥¢æ¥±æ¤¿æ¥ 楪椹æ¥æ¥æ¥æ¥ºæ¥æ¥æ¤µæ¥¬æ¤³æ¤½æ¥¥æ£°æ¥¸æ¤´æ¥©æ¥æ¥¯æ¥æ¥¶æ¥æ¥æ¥´æ¥æ¤»æ¥æ¤·æ¥æ¥æ¥æ¤²æ¥æ¤¯æ¥»æ¤¼ææ æææææ®ï¨æ¯»æ¯¼"], +["de40","毹毷毸æºæ»æ»æºæ»æºæºæºæº 溱溹æ»æ»æº½æ»æºæ»æº·æº°æ»æº¦æ»æº²æº¾æ»æ»æ»æºæºæºæºæº¤æº¡æº¿æº³æ»æ»æºæº®æº£ç ç ç ç £ç ç ç ç ¢ç ²ç ¸ç ªç ¡ç ç ç ç ç °ç ç ç "], +["dea1","ç ç ç ççççççç¼çç»çºçççççççççççççççççç¡ç¿ç¾ç½çç¹ç·æ¦ç¯ççç·ç¾ç¼ç¹ç¸çç»ç¶ççµç½ççµçççç çççç©ç§çççç ç¢ç¢ç¢ç¢ç¢ç¢ç¢ ç¢ç¢¡ç¢ç¡¹ç¢ç¢ç¢ç¡»ç¥¼ç¦ç¥½ç¥¹ç¨ç¨ç¨ç¨ç¨ç¨ç¨¢ç¨"], +["df40","ç¨ç¨çª£çª¢çªç««ç¦ç¤çç´ç©ç²ç¥ç³ç±ç°ç¡ç¸ç¶ç£ç²²ç²´ç²¯ç¶ç¶ç¶ç¶çµ¿ç¶ 絺ç¶çµ»ç¶çµ¼ç¶ç¶ç¶çµ½ç¶ç½ç½«ç½§ç½¨ç½¬ç¾¦ç¾¥ç¾§ç¿ç¿è¡è ¤è è ·è è ©è è ¢è ²æ¡è è ¶è §è ¯"], +["dfa1","è è ¡èèèèèè è±è¿èè¶è¹èèè¥èèèè§è°èè½èèè´è³èèèè·èºè´èºèè¸è²è è©èèè¯èèèè°è¹èèèè¯è èè»èè¶è³è¨è¾èè«è èè®èèèè·èèºèèµèè¸èèèè¶èè è£è£è£è£è£è£è£è£è£è¦ è¦è§è§¥è§¤"], +["e040","è§¡è§ è§¢è§è§¦è©¶èªè©¿è©¡è¨¿è©·èªèªè©µèªèªè©´è©ºè°¼è±è±è±¥è±¤è±¦è²è²è² è³èµ¨èµ©è¶è¶è¶è¶è¶è¶è¶è¶è¶è·°è· 跬跱跮è·è·©è·£è·¢è·§è·²è·«è·´è¼è»¿è¼è¼è¼ è¼è¼è¼è¼éé¿"], +["e0a1","ééé½ééééééééé ®é ¯ééé°éºé¦é³é¥ééé®éééé¬éé é§é¯é¶é¡é°é±éé£éé²ééééé²ééééééééééºé½é¸éµé³é·é¸é²é é é 颬飶飹馯馲馰馵éªéª«é鳪é³é³§éºé»½å¦ååå¨å³ååªåå¤åå¬å°å¯å£å "], +["e140","åååå©å«å°å¬å§åååå¼ååååååºååå¿å¹å¢å¡¼å¢å¢å¢å¢å¡¿å¡´å¢å¡ºå¢å¢å¢å¡¶å¢å¢å¡»å¢å¢å£¾å¥«å«å«®å«¥å«å«ªå«å«å««å«³å«¢å« å«å«¬å«å«å«å«¨å«å·å¯ "], +["e1a1","寣屣å¶å¶åµ½å¶åµºå¶åµ·å¶å¶å¶åµ¾åµ¼å¶åµ¹åµ¿å¹å¹å¹å»å»å»å»å»å»å»å»å»å½å½å½¯å¾¶æ¬æ¨æ æ æ ±æ ³æ æ æ ²æ ¬ææ ´æ æ ºæ æ ¥æ»æ ªæ ¡æ æ©æ§æ«æ«ææææ´æ¶æ²æ³æ½æµæ¦æ¦æææææææ ææ¿æ¿æ¬æ«ææ¥æ·æ³æ æ¡æ ææ ææ¢æ¦±æ¦¶æ§"], +["e240","æ¦ æ§æ¦æ¦°æ¦¬æ¦¼æ¦æ¦æ¦æ¦§æ¦æ¦©æ¦¾æ¦¯æ¦¿æ§æ¦½æ¦¤æ§æ¦¹æ§æ¦æ§æ¦³æ¦æ¦ªæ¦¡æ¦æ§æ¦æ¦æ§æ¦µæ¦¥æ§ææææ®æ®æ® æ¯æ¯æ¯¾æ»æ»µæ»±æ¼æ¼¥æ»¸æ¼·æ»»æ¼®æ¼æ½æ¼æ¼æ¼§æ¼æ¼»æ¼æ»æ¼"], +["e2a1","漶潳滹滮æ¼æ½æ¼°æ¼¼æ¼µæ»«æ¼æ¼æ½æ¼ 滽滶漹æ¼æ»¼æ¼ºæ¼æ¼æ¼æ¼æ¼¡ççççç ççç »ççççççççççççç¢ç³ç±çµç²ç§ç®çççç½ççççççççç¸çç¼ç çç®çç¯ç¾ç碲碪碴ç¢ç¢¨ç¡¾ç¢«ç¢ç¢¥ç¢ 碬碢碤ç¦ç¦ç¦ç¦ç¦ç¦ç¦"], +["e340","ç¦ç¦ç¦ç¦ç¨«ç©ç¨°ç¨¯ç¨¨ç¨¦çª¨çª«çª¬ç«®ç®ç®ç®ç®ç®ç®ç®ç®ç®ç®ç® ç®åç®ç®¤ç®ç²»ç²¿ç²¼ç²ºç¶§ç¶·ç·ç¶£ç¶ªç·ç·ç· ç¶ç·ç·ç·ç·ç·ç¶¯ç¶¹ç¶ç¶¼ç¶ç¶¦ç¶®ç¶©ç¶¡ç·ç½³ç¿¢ç¿£ç¿¥ç¿"], +["e3a1","è¤èèèèèèèèèèèè¤è¡èèºèèè¬è®è«è¹è´èèèªèè±èèè§è»è¢èèèèè©è¯è¨èèè¶èè èèèèè°èè¡è³è£è¨è«èè®èè¡èèèè¬èè¾èè è²èªèè¼èèºè±èµèè¦è§è¸è¤èè°è裷裧裱裲裺裾裮裼裶裻"], +["e440","裰裬裫è¦è¦¡è¦è¦è§©è§«è§¨èª«èªèªèªèªèªè°½è±¨è±©è³è³è³è¶è¸è¸è·¿è¸è·½è¸è¸è¸è¸è¸ è·¾è¸è¸è¼è¼è¼è¼é£éé é¢éééé¤é¡éé ºé ²é ¹é ³é¥é¤é¶ééºé ééªé"], +["e4a1","é¦éé«é¹éé¿é£é®éééé¢é½éé¡ééééé§é¾éé©ééééé¡é¿éé½éºé¾éééé»ééé¿ééé é¢é¢®é¤é¤é¤é¦é¦é§é¦¹é¦»é¦ºé§é¦½é§éª±é«£é«§é¬¾é¬¿é é¡é鳱鳲鳵麧å¿åå°å¸ååå¶å¾ååå½åååå±å¯ååååµååååå"], +["e540","ååå³å½å¬å¾å¸åªåºå墫å¢å¢±å¢ 墣墯墬墥墡壿嫿嫴嫽嫷嫶å¬å«¸å¬å«¹å¬å¬å¬ å¬å±§å¶å¶å¶å¶å¶¢å¶å¶å¶ å¶å¶¡å¶å¶å¹©å¹å¹ å¹ç·³å»å»å»¡å½å¾²æææ ¹æ±æ°æ¢æ"], +["e5a1","æææ¯ææææªæ¡ææ ¦æ³ææ®æ°ææ æ æææææææ£ææ¨æ±ææ¶æºæ¹æ»æ²æ³æµæ°æ©æ²æ·æªæ¯æ¨æ¨æ¨æ§¥æ§¸æ¨æ§±æ§¤æ¨ 槿槬槢æ¨æ¨æ§¾æ¨§æ§²æ§®æ¨æ§·æ§§æ©æ¨æ§¦æ§»æ¨æ§¼æ§«æ¨æ¨æ¨æ¨¥æ¨æ§¶æ¨¦æ¨æ§´æ¨æ殥殣殢殦æ°æ°æ¯¿æ°æ½æ¼¦æ½¾æ¾æ¿æ¾"], +["e640","æ¾æ¾æ¾æ½¢æ½æ¾ æ½æ¾æ½¶æ½¬æ¾æ½æ½²æ½æ½æ½æ¾æ¾æ½æ¼æ½¡æ½«æ½½æ½§æ¾æ½æ¾æ½©æ½¿æ¾æ½£æ½·æ½ªæ½»ç²ç¯çç°ç çç©çµçç¥çç¤ç¡çªçç§ç³ççççççç ççç¡çç"], +["e6a1","ç¢çççççç½ç çç¼ç¹ççç¾ç¥ççççç£çç¨çççççççççç£ç¢»ç£ç£ç£ç£ç£ç£ç£ç£ç£ç¦ç¦¡ç¦ ç¦ç¦¢ç¦æ¶ç¨¹çª²çª´çª³ç®·ç¯ç®¾ç®¬ç¯ç®¯ç®¹ç¯ç®µç³ ç³ç³ç³ç··ç·ç·ªç·§ç·ç·¡ç¸ç·ºç·¦ç·¶ç·±ç·°ç·®ç·ç½¶ç¾¬ç¾°ç¾ç¿ç¿«ç¿ªç¿¬ç¿¦ç¿¨è¤è§è£è"], +["e740","èèè¢èèèèèèèèèè¤è»èèè©èèèèèè§èè»è«èºèèè´èªè²èè·è«è³è¼èèªè©èè¾è¨èè®èè½èè¶è±è¦è§è¨è°è¯è¹èè è°èèè¯è¢"], +["e7a1","èè£è¤è·è¡è³èèèèè¡èèèèèªèèèèè¯è¬èºè®èè¥èè»èµè¢è§è©è¡è¤ è¤è¤è¤è¤è¤è¤è¤è¤è¤è¤è¤è¦¢è¦¤è¦£è§è§°è§¬è«è«èª¸è«è«è«è«èª»è«èª¾è«è« è«è«èªºèª½è«è°¾è±è²è³¥è³è³è³¨è³è³è³§è¶ è¶è¶¡è¶è¸ 踣踥踤踮è¸è¸è¸è¸è¸è¸¦è¸§"], +["e840","è¸è¸è¸è¸è¸è¸è¸è¼¬è¼¤è¼è¼è¼ è¼£è¼è¼é³é°é¯é§é«é¯é«é©éªé²é¦é®é éééééééééééé¶éé±ééé©éééé¯éé¨éééé¦éééé éé§éé"], +["e8a1","éµé¡éé´é¼é¬é«é®é°é¤é¢éé ééééééééé é é ¦é ©é ¨é é é §é¢²é¤é£ºé¤é¤é¤é¤é¤é§é§é§é§é§é§é§é§é§é§é§é§éª³é«¬é««é«³é«²é«±ééé§é´é±é¦é¶éµé°é¨é¤é¬é³¼é³ºé³½é³¿é³·é´é´é³¹é³»é´é´ é´éºé»é¼é¼ååååååå´å¡å°å å®"], +["e940","å³å¦å£åå²åå·ååå£å¢½å£å¢¿å¢ºå£å¢¼å£å¬å¬å¬å¬¡å¬å¬å¬å¬å¬¨å¬å¬ å¬å¯¯å¶¬å¶±å¶©å¶§å¶µå¶°å¶®å¶ªå¶¨å¶²å¶å¶¯å¶´å¹§å¹¨å¹¦å¹¯å»©å»§å»¦å»¨å»¥å½å¾¼ææ¨ææ æ´ææææº"], +["e9a1","æ¿æ¸æææææææ½ææææ³ææ³æ¿æ¼æ¢ææ¾æææææ½æ»æºææ£æ¨´æ©¦æ©æ©§æ¨²æ©¨æ¨¾æ©æ©æ©¶æ©æ©æ¨¨æ©æ¨»æ¨¿æ©æ©ªæ©¤æ©æ©æ©æ©¯æ©©æ© 樼æ©æ©æ©æ©æ©æ©æææ殧殪殫æ¯æ¯æ°æ°æ°æ¾æ¿æ¾£æ¿æ¾¼æ¿æ¿æ½æ¿æ¾½æ¾æ¿æ¾¨ç澥澮澺澬澪æ¿æ¾¿æ¾¸"], +["ea40","æ¾¢æ¿æ¾«æ¿æ¾¯æ¾²æ¾°ç çç¿ç¸ççççççççç½çç¼çççççç©ç¦ç§ç¬ç¥ç«çªç¿çç çççç¡ççç¯çç±ç½ç³ç¼çµç²ç°ç»ç¦ççç¡ççç¢ç£çç"], +["eaa1","çç£ç£©ç£¥ç£ªç£ç££ç£ç£¡ç£¢ç£ç£ç£ 禤ç©ç©ç©çª¶çª¸çªµçª±çª·ç¯ç¯£ç¯§ç¯ç¯ç¯¥ç¯ç¯¨ç¯¹ç¯ç¯ªç¯¢ç¯ç¯«ç¯ç¯ç³ç³ç³ç³ç³ç¸ç¸¡ç¸ç¸ç¸ç¸ ç¸ç¸ç¸ç¸ç¸ç¸¢ç¸ç¸ç¸ç¸ç¸ç¸¥ç¸¤ç½ç½»ç½¼ç½ºç¾±ç¿¯èªè©è¬è±è¦è®è¹èµè«è°è¬è´è²è·è§è²èèèèè è«èèè¡è"], +["eb40","èèè¤èè¢èèèè£è¾èè±èè®èµèè§è èè¦èèè¥è¬è£è¥è¤èèèèèèèèèè¹èè£è èèèèèèèèè¤è¤¦è¤°è¤è¤®è¤§è¤±è¤¢è¤©è¤£è¤¯è¤¬è¤è§±è« "], +["eba1","諢諲諴諵è«è¬è«¤è«è«°è«è«è«¡è«¨è«¿è«¯è«»è²è²è²è³µè³®è³±è³°è³³èµ¬èµ®è¶¥è¶§è¸³è¸¾è¸¸è¹è¹ 踶踼踽è¹è¸°è¸¿èº½è¼¶è¼®è¼µè¼²è¼¹è¼·è¼´é¶é¹é»ééºé³éµé¶éééééé§ééééééºé¸é¼éé£éééééééééºé¥éé¹é·é´éé¤é¿é©é¹éµéªéé"], +["ec40","éé¾ééé»éé¼éé¾é¹éºé¶é¿éµé½é©éééééééé°é¸é µé ¯é ²é¤¤é¤é¤§é¤©é¦é§®é§¬é§¥é§¤é§°é§£é§ªé§©é§§éª¹éª¿éª´éª»é«¶é«ºé«¹é«·é¬³é®é® é®é¼é¾é»é®é®é®é®éºé®"], +["eca1","é½é®é´¥é´é´ é´é´é´©é´é´é´¢é´é´é´éºéºéºéº®éºé»é»é»ºé¼é¼½å¦å¥å¢å¤å å©å´ååååååå¾åå¿åå£å£å£å£å¬å¬¥å¬²å¬£å¬¬å¬§å¬¦å¬¯å¬®å»å¯±å¯²å¶·å¹¬å¹ªå¾¾å¾»ææµæ¼æ§æ æ¥æ¤æ¨ææ¯æ©æ£æ«æ¤æ¨æææ¶æææªæªæªæª¥æªæªæªæª¡æªæªæªæª"], +["ed40","æªæªæª¨æª¤æªæ©¿æª¦æªæª æªæªææ®æ°æ¿æ¾©æ¿´æ¿æ¿£æ¿æ¿æ¿§æ¿¦æ¿æ¿²æ¿æ¿¢æ¿¨ç¡ç±ç¨ç²ç¤ç°ç¢ç³ç®ç¯çç²ç«ççªçç±ç¥ç¯çççççççççç¤ç©çµç«ç²ç·ç¶"], +["eda1","ç´ç±ç¨ç°ç£³ç£½ç¤ç£»ç£¼ç£²ç¤ 磹磾ç¤ç¦«ç¦¨ç©ç©ç©ç©ç©ç©çª¾ç«ç«ç° ç°ç¯²ç°ç¯¿ç¯»ç°ç¯´ç°ç¯³ç°ç°ç°ç°ç¯¸ç¯½ç°ç¯°ç¯±ç°ç°ç³¨ç¸ç¸¼ç¹ç¸³é¡ç¸¸ç¸ªç¹ç¹ç¹ç¸©ç¹ç¸°ç¸»ç¸¶ç¹ç¸ºç½ 罿罾罽翴翲è¬è»èèèè èè¼è©èèèèèèè§èè èè£è»è¤èè"], +["ee40","è·è¼èè¡èºè¸èèèèèèèèè¢èèè è¹è¶èèèè¨è¾èªèè è°è¬è¹èµè¼è®èèèèè·è¯èèè´è¶è¿è¸è½èè²è¤µè¤³è¤¼è¤¾è¥è¥è¤·è¥è¦è¦¯è¦®è§²è§³è¬"], +["eea1","è¬è¬è¬è¬ è¬è¬¢è¬è¬è¬è¬è¬è¬è¬è¬è¬è¬è±è±°è±²è±±è±¯è²è²è³¹èµ¯è¹è¹è¹è¹è¹è¹è½è½é é¾é¸éé¢éééé¡éé é¡éé¯é¤ééé¼ééé¶éééé ééééªé¹ééééé±é·é»é¡éé£é§éééééééé é·é®é°é¬é éééééé¡é"], +["ef40","ééééé±é¡é¡é¡é¡é¡ é¡é¤¥é¤«é¤¬é¤ªé¤³é¤²é¤¯é¤é¤±é¤°é¦é¦£é¦¡é¨é§ºé§´é§·é§¹é§¸é§¶é§»é§½é§¾é§¼é¨éª¾é«¾é«½é¬é«¼éé®é®¨é®é®é®¦é®¡é®¥é®¤é®é®¢é® 鮯鴳éµéµ§é´¶é´®é´¯é´±é´¸é´°"], +["efa1","éµ éµéµé´¾é´·éµé´½ç¿µé´éºéºéºéº°é»é»é»»é»¿é¼¤é¼£é¼¢é½é¾ å±åå®åååååå奰嬼屩屪å·å¹å¹®ææææ®æ±æªæ°æ«ææ©æ¿ææ½æ¸æææ¼ææææææ« æª¹æª½æ«¡æ«æªºæª¶æª·æ«æª´æªææ¯æ°ççççç ççæ¿¿çæ¿»ç¦æ¿¼æ¿·ççç¿ç¹çç½ç¶"], +["f040","ç¸ççµçç¾ç¶ç»ççççç¤çççççç¦ç½ç¬ççºç£¿ç¤ç¤ç¤ç¤ç¤ç¤ç¤ç¦ç¦¬ç©ç°ç°©ç°ç° ç°ç°ç°ç°¦ç°¨ç°¢ç°¥ç°°ç¹ç¹ç¹ç¹£ç¹ç¹¢ç¹ç¹ç¹ ç¹ç¹ç¾µç¾³ç¿·ç¿¸èµèè"], +["f0a1","èèèè´èèèèè³èµè½èèè¿èèèè è±è¶èè¤è¸è·è¾è©è§è¦è¢èè«èªè¥èè³è¤èèèèèè£è¤èèè è´è¨èè¥è¥è¥è¥è¥è¥è¥è¥è¬ªè¬§è¬£è¬³è¬°è¬µè謯謼謾謱謥謷謦謶謮謤謻謽謺è±è±µè²è²è²è³¾è´è´è´è¹è¹¢è¹ è¹è¹è¹è¹¥è¹§"], +["f140","è¹è¹è¹¡è¹è¹©è¹è½è½è½è½é¨éºé»é¾é¨é¥é§é¯éªéµééé·éééé§ééªéé¦éééééé±éé²é¤é¨é´é£é¥éééé³ééå·éééé£é¢é¥é¬é®é¨é«é¤éª"], +["f1a1","é¢é¥éééééºé¡é¡é¡é¢¸é¥é¤¼é¤ºé¨é¨é¨é¨é¨é¨é¨é¨ é¨é¨é«é«é¬é¬é¬ 鬩鬵éééé¯é¯é¯é®¿é¯é®µé®¸é¯é®¶é¯é®¹é®½éµéµéµéµéµéµéµéµéµéµéµéµéµéµéµéºéºé»é¼é¼é¼é¼¥é¼«é¼ªé¼©é¼¨é½é½å´åµåå·å´å«åå¦å§åªå¬å£å£å£å¤å¬½å¬¾å¬¿å·å¹°"], +["f240","徿æ»æææææææææææ«§æ« æ«æ«æ«æ«æ«æ«æ«æ««æ«æ«æ«æ æ®°æ°çç§ç çç«ç¡ç¢ç£ç©çç¤ççªççççç ç¥ç¦ç¤ç£ç¡çç ç·ççç çççç±ç¤ç¤"], +["f2a1","礡ç¤ç¤ç¤ç¦°ç©§ç©¨ç°³ç°¼ç°¹ç°¬ç°»ç³¬ç³ªç¹¶ç¹µç¹¸ç¹°ç¹·ç¹¯ç¹ºç¹²ç¹´ç¹¨ç½ç½ç¾ç¾ç¾·ç¿½ç¿¾è¸èèè¤è¡è£è«è±èèè¡è¨èèè¬è²è¸èèè£èèè°è¦è¯èè¢è èºè è¶è·è è è è è¼è è¿è è 襢è¥è¥è¥è¥¡è¥è¥è¥è¥è¦è¦·è¦¶è§¶èèèèèèèèè"], +["f340","èèèèè±è±·è±¶è²è´è´è´è¶¬è¶ªè¶è¶«è¹è¹¸è¹³è¹ªè¹¯è¹»è»è½è½è½è½è½è¾´é é¿é°éééééééé¹é¬ééé©é¦ééé®é£éééééé§é½ééé¡é©é«é¬é¨é¦"], +["f3a1","é³é·é¶éééé¡é¡é¡é¡é¢¿é¢½é¢»é¢¾é¥é¥é¥é¦¦é¦§é¨é¨é¨¥é¨é¨¤é¨é¨¢é¨ 騧騣é¨é¨é¨é«é¬é¬é¬é¬é¬·é¯ªé¯«é¯ é¯é¯¤é¯¦é¯¢é¯°é¯é¯é¯¬é¯é¯é¯¥é¯é¯¡é¯éµ·é¶é¶é¶é¶éµ±é¶éµ¸é¶é¶é¶éµ½éµ«éµ´éµµéµ°éµ©é¶ 鵳鵻é¶éµ¯éµ¹éµ¿é¶éµ¨éºéºé»é»¼é¼é½é½é½é½é½é½å·å²"], +["f440","åµå³å££å å·å·å»®å»¯å¿å¿æ¹ææææææ¨æ£æ¤æ«³æ«°æ«ªæ«¨æ«¹æ«±æ«®æ«¯ç¼çµç¯ç·ç´ç±çç¸ç¿çºç¹çç»ç³çççç¨ç½ç¼çºç«çªç¾çççççç²ç¤¥ç¤£ç¤§ç¤¨ç¤¤ç¤©"], +["f4a1","禲穮穬ç©ç«·ç±ç±ç±ç±ç± 糮繻繾çºçºç¾ºç¿¿è¹èèèè¨è©è¢è¿èè¾èèè¶èèè èè½è è è è è è 襣襦覹觷è èªèè¨è£è¥è§è趮èºèºèºè½è½è½è½è½è½éé é é·éµé²é³ééé»é ééé¾ééé¨éééµéé·éééééºéé¸éé¿"], +["f540","é¼éé¶éééé éé®é¯é¹é»é½é¾é¡ 顢顣é¡é£é£é¥é¥é¥é¥é¥é¥é¨²é¨´é¨±é¨¬é¨ªé¨¶é¨©é¨®é¨¸é¨é«é«é«é¬é¬é¬é°é°é¯·é° é°é¯¸é±é°é°é°é°é°é°é¶é¶é¶¤é¶é¶é¶é¶é¶"], +["f5a1","é¶ é¶é¶é¶ªé¶é¶¡é¶é¶¢é¶¨é¶é¶£é¶¿é¶©é¶é¶¦é¶§éºéºéºé»¥é»¤é»§é»¦é¼°é¼®é½é½ é½é½é½é¾åºå¹åååå½å¾ååå·å·å»±æ½ææ¬æ«¼æ¬æ«¸æ¬çççççç ççççç¾ççªçç¤ç¤±ç¤¯ç±ç±ç³²çºçºçºçºçºçºç½ç¾»è°èèèªè¦èè£èèè§è®è¡è è©èè¥"], +["f640","è ©è è è è ¤è è «è¡è¥è¥©è¥®è¥«è§ºè¹è¸è èºè»è´è´è¶¯èºèºè½è½è½é é é é¹é¿é»é¶é©é½é¼é°é¹éªé·é¬éé±é¥é¤é£éµéºé¿é¡é¡¤é£é£é£é¥é¥é¨¹é¨½é©é©é©é©é¨º"], +["f6a1","騿é«é¬é¬é¬é¬é¬ºéé°«é°é°é°¬é°£é°¨é°©é°¤é°¡é¶·é¶¶é¶¼é·é·é·é·é¶¾é· é·é¶»é¶µé·é¶¹é¶ºé¶¬é·é¶±é¶é·é¶³é·é¶²é¹ºéºé»«é»®é»é¼é¼é¼é¼±é½é½¥é½¤é¾äº¹åå å奱ååå·å·å»²æ¡æ æ¦æ¢æ¬æ¬æ¬æ°ççççççç©ç¿çççççç礵禴穰穱ç±ç±ç±ç±ç±"], +["f740","ç³´ç³±çºç½ç¾èè«è´èµè³è¬è²è¶è ¬è ¨è ¦è ªè ¥è¥±è¦¿è¦¾è§»è¾è®è®è®è® è¿è´èºèºèºèºèºèºèºè½ è½¢é ééééééé éééé¿é£é¡ªé¡©é£é¥é¥é©é©é©é©é©é©é©"], +["f7a1","é©é©é©é«é¬é¬«é¬»ééé±é±é°¿é±é°¹é°³é±é°¼é°·é°´é°²é°½é°¶é·é·é·é·é·é·é·é·é·é·©é·é·é·é·µé·é·éº¶é»°é¼µé¼³é¼²é½é½«é¾é¾¢å½å壨壧奲åå·è ¯å½ææææ©æ¥ææ«æ¬æ¬æ¬æ¯ççç¢çççç°ç籧籦çºè¬èºèè¹è¼è±è»è¾è °è ²è ®è ³è¥¶è¥´è¥³è§¾"], +["f840","è®è®è®è®è± è´èºè½¤è½£é¼é¢éééééé é é©é©é¬é¬é¬ é±é±é±é±é±é±é±é±é±é±é·»é··é·¯é·£é·«é·¸é·¤é·¶é·¡é·®é·¦é·²é·°é·¢é·¬é·´é·³é·¨é·é»é»é»²é»³é¼é¼é¼¸é¼·é¼¶é½é½"], +["f8a1","齱齰齮齯åååå±æææ®æ¬çç¡çç ç£çç¥ç礸禷禶籪çºç¾èèè ¸è ·è µè¡è®è®èºèºèº èºé¾é½éé«é¨é©é¥ééééé¥é©é«é鱣鱧鱦鱢é±é± é¸é·¾é¸é¸é¸é¸ é¸é¸é¸é·¿é·½é¸éº é¼é½é½´é½µé½¶åæ®æ¸æ¬æ¬æ¬æ¬ç¢ç¦çªçç礹籩籫糶çº"], +["f940","çºçºçºè è¡èèè襹襺襼襻觿è®è®èº¥èº¤èº£é®éé¯é±é³é顲é¥é±¨é±®é±é¸é¸é¸é¸é¸é¸éº¡é»µé¼é½é½¸é½»é½ºé½¹åç¦ç±¯è ¼è¶²èº¦éé´é¸é¶éµé© 鱴鱳鱱鱵é¸é¸é»¶é¼"], +["f9a1","龤ç¨ç¥ç³·èªè ¾è ½è ¿è®è²èº©è»é顳顴é£é¥¡é¦«é©¤é©¦é©§é¬¤é¸é¸é½ææ¬ç§è躨ééé驩驨鬮é¸ç©èè®é鱹麷çµé©«é±ºé¸ç©çªéº¤é½¾é½é¾ç¢é¹è£å¢»æ粧嫺ââ¦ââ â¬â£ââ©âââ¤âââªâ¡ââ§âââ¥âââ«â¢ââ¨âââââ®â°â¯â"] +] diff --git a/node_modules/iconv-lite/encodings/tables/eucjp.json b/node_modules/iconv-lite/encodings/tables/eucjp.json new file mode 100644 index 0000000..4fa61ca --- /dev/null +++ b/node_modules/iconv-lite/encodings/tables/eucjp.json @@ -0,0 +1,182 @@ +[ +["0","\u0000",127], +["8ea1","。",62], +["a1a1","ãããï¼ï¼ã»ï¼ï¼ï¼ï¼ãã´ï½Â¨ï¼¾ï¿£ï¼¿ã½ã¾ãããä»ã ããã¼ââï¼ï¼¼ï½â¥ï½â¦â¥ââââï¼ï¼ãã[]ï½ï½ã",9,"ï¼ï¼Â±Ã÷ï¼â ï¼ï¼â¦â§ââ´ââ°â²â³âï¿¥ï¼ï¿ ï¿¡ï¼ ï¼ï¼ï¼ï¼ §ââ ââââ"], +["a2a1","ââ¡â â³â²â½â¼â»ãââââã"], +["a2ba","âââââââªâ©"], +["a2ca","â§â¨ï¿¢ââââ"], +["a2dc","â â¥ââââ¡ââªâ«ââ½ââµâ«â¬"], +["a2f2","â«â°â¯ââªâ â¡Â¶"], +["a2fe","â¯"], +["a3b0","ï¼",9], +["a3c1","A",25], +["a3e1","ï½",25], +["a4a1","ã",82], +["a5a1","ã¡",85], +["a6a1","Î",16,"Σ",6], +["a6c1","α",16,"Ï",6], +["a7a1","Ð",5,"ÐÐ",25], +["a7d1","а",5,"Ñж",25], +["a8a1","ââââââââ¬â¤â´â¼âââââââ£â³â«â»ââ â¯â¨â·â¿ââ°â¥â¸â"], +["ada1","â ",19,"â ",9], +["adc0","ããã¢ããã§ãã¶ãããã¦ã£ã«ãã»ããããããã¡"], +["addf","ã»ããâãâ¡ã¤",4,"ã±ã²ã¹ã¾ã½ã¼ââ¡â«â®âââ¥â ââ¿âµâ©âª"], +["b0a1","äºåå¨é¿åææ¨å§¶é¢èµèç©æªæ¡æ¸¥æè¦è¦é¯µæ¢å§æ¡æ±å®å§è»é£´çµ¢ç¶¾é®æç²è¢·å®åºµæææ¡ééæ以ä¼ä½ä¾åå²å¤·å§å¨å°æææ °ææ¤ çºçç°ç§»ç¶ç·¯èèè¡£è¬ééºå»äºäº¥åè²é磯ä¸å£±æº¢é¸ç¨²è¨èé°¯å å°å½å¡å 姻å¼é£²æ·«è¤è"], +["b1a1","é¢é°é é»åå³å®çç¾½è¿é¨å¯éµçªºä¸ç¢è¼æ¸¦ååæ¬è鰻姥å©æµ¦çéåäºéé²èé¤å¡å¶å¬°å½±æ æ³æ 永泳洩ççç©é ´è±è¡è© é液ç«çé§ æ¦è¬è¶é²æ¦åååå °å¥å®´å»¶æ¨æ©æ´æ²¿æ¼ççç çç¿ç¸è¶èèé éé´å¡©æ¼æ±ç¥å¹å¤®å¥¥å¾å¿"], +["b2a1","æ¼æºæ¨ªæ¬§æ®´çç¿è¥é´¬é´é»å²¡æ²è»åå±æ¶è桶ç¡ä¹ä¿ºå¸æ©æ¸©ç©é³ä¸åä»®ä½ä¼½ä¾¡ä½³å å¯åå¤å«å®¶å¯¡ç§æææ¶ææ²³ç«çç¦ç¦¾ç¨¼ç®è±èèè·è¯èè¦èª²å©è²¨è¿¦ééèä¿å³¨æçç»è¥è½è¾è³é é¤é§ä»ä¼è§£åå¡å£å»»å¿«æªææ¢ææææ¹"], +["b3a1","éæ¦æ¢°æµ·ç°çççµµè¥è¹ééè²å±å¾å¤å³å®³å´æ ¨æ¦æ¶¯ç¢èè¡è©²é§éª¸æµ¬é¦¨èå£æ¿èéåååå»æ¡æ¹æ ¼æ ¸æ®»ç²ç¢ºç©«è¦è§èµ«è¼éé£éé©å¦å²³æ¥½é¡é¡æç¬ æ¨«æ©¿æ¢¶é°æ½å²åæ°æ¬æ´»æ¸æ»èè¤è½ä¸é°¹å¶æ¤æ¨ºéæ ªå ç«è²ééåé´¨æ ¢è è±"], +["b4a1","ç²¥åè ç¦ä¹¾ä¾å å¯ååå§å·»åå ªå§¦å®å®å¯å¹²å¹¹æ£ææ £æ¾ææ¢ææ¡æ£ºæ¬¾ææ±æ¼¢æ¾æ½ ç°çç£ç竿管簡緩缶翰èè¦è観è«è²«ééééé¢é¥é館è丸å«å²¸å·ç©çç¼å²©ç¿«è´éé é¡é¡ä¼ä¼å±åå¨åºå¥å¬å¯å²å¸å¹¾å¿æ®æºææ¢ææ£æ£"], +["b5a1","æ©å¸°æ¯ æ°æ±½ç¿ç¥å£ç¨ç´å¾½è¦è¨è²´èµ·è»è¼é£¢é¨é¬¼äºå½åå¦å®æ¯ææ¬æ¬ºç çç¥ç¾©è»èª¼è°æ¬èé ååå«æ¡æ©è©°ç §æµé»å´å®¢èèéä¸ä¹ ä»ä¼åå¸å®®å¼æ¥ææ½æ±æ±²æ³£ç¸ç究窮ç¬ç´ç³¾çµ¦æ§çå»å± å·¨ææ ææ¸ è許è·é¸æ¼ç¦¦é亨享京"], +["b6a1","ä¾ä¾ åå ç«¶å ±å¶åå¡å¿å«å¬å¢å³¡å¼·å½æ¯æææææ©æ³ççç¯è¸è èèé·é¡é¿é¥é©ä»°åå°ææ¥å±æ²æ¥µçæ¡ç²å å¤åå·¾é¦æ¤æ¬£æ¬½ç´ç¦ç¦½çç·è¹èè¡¿è¥è¬¹è¿éåéä¹å¶å¥åºççç©è¦èº¯é§é§é§å ·æèå°ç©ºå¶å¯éé 串æ«é§å±å±"], +["b7a1","æçªæ²é´è½¡çªªçéç²æ ç¹°æ¡é¬å²åè«è¨ç¾¤è»é¡å¦è¢ç¥ä¿å¾åå ååçªåå¥å½¢å¾æµæ ¶æ §æ©æ²æºæ¬æ¯æ¡æ¸ç¦ç¨½ç³»çµç¶ç¹ç½«èèèè¨è©£è¦è»½é é¶è¸è¿é¯¨åæææ¿éæ¡åæ¬ æ±ºæ½ç©´çµè¡è¨£æ件å¹å¦å¥å ¼å¸å£å§åå å«å»ºæ²æ¸æ³æ²"], +["b8a1","æ¤æ¨©ç½ç¬ç®ç 硯絹çè©è¦è¬è³¢è»é£éµéºé¡é¨é¹¸å åå³å¹»å¼¦æ¸æºçç¾çµè·è¨è«ºéä¹åå¤å¼åºå§å¤å·±åº«å¼§æ¸æ æ¯æ¹çç³è¢´è¡è¡è°èèªè·¨é·é顧é¼äºäºä¼ååå¾å¨¯å¾å¾¡æ梧æªçç¢èªèª¤è·éä¹é¯äº¤ä½¼ä¾¯ååå å ¬åå¹å¾åå£å"], +["b9a1","åååå¢å¥½ååå®å·¥å·§å··å¹¸åºåºåº·å¼ææ æææ§æ»æææ´ææ ¡æ¢æ§æ±æ´ªæµ©æ¸¯æºç²çç¡¬ç¨¿ç³ ç´ ç´çµç¶±èèè¯è±è èèªèè¡è¡¡è¬è²¢è³¼éé µé±ç ¿é¼é¤éé é¦é«é´»åå«å·åå£æ·æ¿ 豪è½éº¹å å»åå½ç©é ·éµ é»çæ¼è °ç忽æ骨çè¾¼"], +["baa1","æ¤é ä»å°å¤å¢¾å©æ¨ææææ ¹æ¢±æ··çç´ºè®éäºä½åå嵯左差æ»æ²ç³ç è©éè£å座æ«åµå¬åæåå¡å¦»å®°å½©ææ¡æ ½æ³æ¸ç½éçç ç ¦ç¥æç´°èè£è¼éå¤å¨æ罪財å´åéªå ºæ¦è´å²å´å¼ç¢é·ºä½ååæ¾æ¨ææµçªçç´¢é¯æ¡é®ç¬¹ååå·"], +["bba1","å¯æ¶æ®æ¦æ殺è©éçé¯æé鮫ç¿æä¸ååå±±æ¨ææ£æ¡ç¦çç£ç®çºèè®è³é ¸é¤æ¬æ«æ®ä»ä»ä¼ºä½¿åºå¸å²å£å士å§å§å§¿åå±å¸å¸«å¿æææ¯åæ¯æ½æ¨ææ¢æ»æ°ç ç¥ç§ç³¸ç´ç´«è¢èè³è¦è©è©©è©¦èªè«®è³è³é飼æ¯äºä¼¼ä¾å å寺æ ææ"], +["bca1","次æ»æ²»ç¾ç½çç£ç¤ºèè³èªèè¾æ±é¹¿å¼è鴫竺軸å®é«ä¸å±å·å¤±å«å®¤æ湿æ¼ç¾è³ªå®èç¯ å²æ´è屡èç¸èåå°æ¨èµ¦æç ®ç¤¾ç´è è¬è»é®èéªååºå°ºæç¼çµé éé«è¥å¯å¼±æ¹ä¸»åå®ææ±æ®ç©ç ç¨®è «è¶£é é¦åååªå¯¿æ樹綬éååå¨"], +["bda1","å®å°±å·ä¿®ææ¾æ´²ç§ç§çµç¹ç¿èèèè¡è¥²è®è¹´è¼¯é±é é ¬ééä»ä½å åå¾æææ±æ¸ç£ç¸¦ééåå¤å®¿æ·ç¥ç¸®ç²å¡¾çåºè¡è¿°ä¿å³»æ¥ç¬ç«£è駿å循æ¬æ¥¯æ®æ·³æºæ½¤ç¾ç´å·¡éµéé å¦åææææ¸åº¶ç·ç½²æ¸è¯è·è«¸å©å女åºå¾æé¤é¤å·å"], +["bea1","åå åå¬å¨åå±å奨妾娼宵å°å°å°å°åºåºå» å½°æ¿ææææ·ææææ¶æ¾æ¢¢æ¨æ¨µæ²¼æ¶æ¸æ¹ç¼ç¦ç §ççç¡ç¤ç¥¥ç§°ç« ç¬ç²§ç´¹èèèèè¡è£³è¨è¨¼è©è©³è±¡è³é¤é¦é¾éééä¸ä¸ä¸ä¹åå°åå ´å£å¬¢å¸¸æ æ¾æ¡ææµç¶ç³ç©£è¸è²é¸é å±å´é£¾"], +["bfa1","ææ¤æ®çç¹è·è²è§¦é£è辱尻伸信侵åå¨ å¯å¯©å¿æ æ¯æ°æ森æ¦æµ¸æ·±ç³ç¹çç¥ç§¦ç´³è£è¯èªè¦ªè¨ºèº«è¾é²éé人ä»å塵壬å°çå°½è è¨è¿ é£é笥è«é é ¢å³å¨éå¹å帥æ¨æ°´çç¡ç²ç¿ è¡°éé éééçé«å´åµ©æ°æ¢è¶¨éæ®ææ¤è é é裾"], +["c0a1","æ¾æºå¯¸ä¸ç¬çæ¯åå¶å¢å§å¾æ§ææ¿æ´ææ´æ£²æ æ£æ¸ ç²ççç²¾èå£°è£½è¥¿èª èªè«ééééæç¨èé»å¸æææ¥ææç³ç©ç±ç¸¾è責赤跡è¹ç¢©åææ¥ææè¨çªç¯èª¬éªçµ¶èèä»å åå 宣å°å°å·æ¦ææ°æ æ ´æ³æµ æ´ææ½ç ç ½æç©¿ç®ç·"], +["c1a1","ç¹ç¾¨è ºèè¹è¦è©®è³è·µé¸é·éééé®®åå漸ç¶å ¨ç¦ ç¹è³ç³åå¡å²¨æªæ¾æ½æ¥çççç¤ç¥ç§ç²ç´ çµè訴é»é¡é¼ å§åµåå¢ååªå£®å¥ç½å®å±¤åæ£æ³æææ¿æ»ææ©æ¹å·£æ§æ§½æ¼ç¥äºç©ç¸çªç³ç·ç¶è¡èèè¬è¼è»è£ èµ°ééééé¨åå¢æ"], +["c2a1","èèµè´é ä¿å´åå³æ¯ææ測足éä¿å±è³æç¶åè¢å ¶æåå«å°ææéä»å¤å¤ªæ±°è©å¾å 妥æ°ææèµæ¥éé§é¨¨ä½å 対èå²±å¸¯å¾ æ æ æ´æ¿æ³°æ»èè ¿èè¢è²¸éé®éé»é¯ä»£å°å¤§ç¬¬éé¡é·¹æ»ç§ååå® æææ沢濯ç¢è¨é¸æ¿è«¾è¸å§è¸åª"], +["c3a1","å©ä½é辰奪è±å·½ç«ªè¾¿æ£è°·ç¸é±æ¨½èª°ä¸¹ååå¦æ æ¢æ¦ææ·¡æ¹çç端箪綻è½èèèªéå£å£å¼¾æææªæ®µç·è«å¤ç¥å°å¼æ¥æºæ± ç´ç¨ç½®è´èé 馳ç¯ç竹çèé秩çªè¶å«¡çä¸ä»²å®å¿ æ½æ¼æ±æ³¨è«è¡·è¨»é é³é§æ¨ç¦çªè§è貯ä¸å åå寵"], +["c4a1","å¸å¸³åºå¼å¼µå½«å¾´æ²ææ¢ææ½®ççºçºè´è¹è ¸è¶èª¿è«è¶ è·³éé·é é³¥å æç´ææ²çè³é®é³æ´¥å¢æ¤æ§è¿½éçéå¡æ æ´æ§»ä½æ¼¬æè¾»è¦ç¶´é椿潰åªå£·å¬¬ç´¬çªåé£é¶´äºä½ååµåè²åå ¤å®å¸åºåºå»·å¼ææµæºæ梯æ±ç¢ç¦ç¨ç· èè¨è«¦è¹é"], +["c5a1","é¸ééé¼æ³¥ææ¢æµæ»´çç¬é©é溺å²å¾¹æ¤è½è¿éå ¸å¡«å¤©å±åºæ·»çºç貼転é¡ç¹ä¼æ®¿æ¾±ç°é»å åå µå¡å¦¬å± å¾ææ渡ç»èè³éé½éç ¥ç ºåªåº¦å奴æåå å¬åååå¡å¡å¥å®å³¶å¶æ¼æææ±æ¡æ¢¼æ£çæ·æ¹¯æ¶ç¯çå½ç祷çççç³çµ±å°"], +["c6a1","è£è©è¤è¨è¬è±è¸éééé¶é 騰éåååå å°æ§ææ´ç³ç«¥è´èéé å³ é´å¿å¾å¾³æ¶ç¹ç£ç¦¿ç¯¤æ¯ç¬èªæ æ©¡å¸çªæ¤´å±é³¶è«å¯ é çå¸å±¯ææ¦æ²è±éé åæéå¥é£å ä¹åªèè¬çæºé楢馴ç¸ç·åæ¥ è»é£æ±äºå°¼å¼è¿©åè³èè¹å»¿æ¥ä¹³å ¥"], +["c7a1","å¦å°¿é®ä»»å¦å¿èªæ¿¡ç¦°ç¥¢å¯§è±ç«ç±å¹´å¿µæ»æçç²ä¹å»¼ä¹åå¢æ©æ¿ç´è½è³è¿è¾²è¦è¤å·´ææè¦æ·æ³¢æ´¾ç¶ç ´å©ç½µè馬俳å»ææææ¯ççèèºè¼©é åå¹åªæ¢ æ¥³ç ¤ç½è²·å£²è³ éªéè¿ç§¤ç§è©ä¼¯å¥åæææ³ç½ç®ç²è¶èè¿«ææ¼ çç¸è«é§éº¦"], +["c8a1","å½ç®±ç¡²ç®¸èç櫨幡èçç å «é¢æºçºé髪ä¼ç½°æçé¥é³©åºå¡è¤é¼ä¼´å¤åååå¸æ¬ææ¿æ°¾æ±çç¯ççç¹è¬è©è²©ç¯éç ©é 飯æ½æ©çªç¤ç£èè®åªåå¦å¦åºå½¼æ²ææ¹æ«ææ¯æ³ç²ç®ç¢ç§ç·ç½·è¥è¢«èª¹è²»é¿éé£æ¨ç°¸å尾微ææ¯çµçç¾"], +["c9a1","é¼»æç¨å¹çé«å½¦èè±èå¼¼å¿ ç¢çé¼æ¡§å§«åªç´ç¾è¬¬ä¿µå½ªæ¨æ°·æ¼ç¢ç¥¨è¡¨è©è±¹å»æç ç§èé¨é²èèé°å彬ææµç貧è³é »æç¶ä¸ä»å 夫婦å¯å¨å¸åºææ¶æ·æ§æ®æµ®ç¶ç¬¦è èèèè² è³¦èµ´ééä¾®æ«æ¦èè¡èªé¨å°æ¥é¢¨èºèä¼å¯å¾©å¹ æ"], +["caa1","ç¦è ¹è¤è¦æ·µå¼æ沸ä»ç©é®åå»å´å¢³æ¤æ®ç奮ç²ç³ç´é°æèä¸ä½µå µå¡å¹£å¹³å¼æ並è½ééç±³é å»å£ç碧å¥ç¥èç®åå¤çç¯ç·¨è¾ºè¿é便å娩å¼éä¿èéªåææ©ç«è£è¼ç©åå¢æ ææ®æ¯ç°¿è©å£ä¿¸å åå ±å¥å®å³°å³¯å´©åºæ±æ§æ¾æ¹æ"], +["cba1","æ³æ³¡ç¹ç ²ç¸«èè³èè¬èè¤è¨ªè±é¦é飽鳳鵬ä¹äº¡ååå妨帽å¿å¿æ¿æ´æææ£åç´¡èªè¨è¬è²è²¿é¾é²å é ¬ååå墨æ²æ´ç§ç¦ç©é¦å没æ®å å¹å¥æ¬ç¿»å¡çæ©ç£¨é麻å妹æ§ææ¯å©æ§å¹èæ鮪æ¾é±æ¡äº¦ä¿£åæ¹æ«æ²«è¿ä¾ç¹éº¿ä¸æ ¢æº"], +["cca1","漫èå³æªé å·³ç®å²¬å¯èæ¹èç¨èå¦ç²æ°ç å夢ç¡ççé§éµ¡æ¤å©¿å¨å¥åå½æçè¿·é鳴姪çæ» å æ£ç¶¿ç·¬é¢éººæ¸æ¨¡èå¦åæ¯çç²ç¶²èèå²æ¨é»ç®æ¢å¿é¤ å°¤æ»ç±¾è²°åæ¶ç´éåä¹å¶å¤çºè¶éå¼¥ç¢åå½¹ç´è¬è¨³èºéæ³è®éæææ²¹ç"], +["cda1","è«è¼¸å¯ä½åªåå宥幽æ ææææ湧æ¶ç¶ç·ç±ç¥è£èªéééµéèå¤äºä½ä¸èªè¼¿é åå¹¼å¦å®¹åº¸ææºæææ¥æ§æ´æº¶çç¨çª¯ç¾èèèè¦è¬¡è¸é¥é½é¤æ ¾æ欲æ²æµ´ç¿ç¿¼æ·ç¾ èºè£¸æ¥è±é ¼é·æ´çµ¡è½é ªä¹±åµåµæ¬æ¿«èè覧å©åå±¥æ梨çç"], +["cea1","ç¢è£è£¡éé¢é¸å¾çç«èæ ç¥åæµæºççç¡«ç²éç«é¾ä¾¶æ ®æ èäºäº®å両å寮ææ¢æ¶¼çççç¨ç³§è¯è«é¼ééµé åç·å«åææ·çç³è¨è¼ªé£é±éºç å¡æ¶ç´¯é¡ä»¤ä¼¶ä¾å·å±å¶ºæç²ç¤¼èé´é·é¶ééºé½¢æ¦æ´åå£çè£å»æææ¼£ç 簾練è¯"], +["cfa1","è®é£é¬åé¯æ«çè³è·¯é²å´å©å»å¼æ楼æ¦æµªæ¼ç¢ç¼ç¯èè¾èéå éºç¦èé²è«åå話æªè³èææ é·²äºäºé°è©«èè¨æ¤æ¹¾ç¢è "], +["d0a1","å¼ä¸ä¸ä¸ªä¸±ä¸¶ä¸¼ä¸¿ä¹ä¹ä¹äºäº 豫äºèå¼äºäºäºäº 亢亰亳亶ä»ä»ä»ä»ä»ä»ä»ä»ä»ä»·ä¼ä½ä¼°ä½ä½ä½ä½ä½¶ä¾ä¾ä¾ä½»ä½©ä½°ä¾ä½¯ä¾ä¾åä¿ä¿ä¿ä¿ä¿ä¿ä¿ä¿ä¿¤ä¿¥åå¨ååªå¥å ä¼ä¿¶å¡å©å¬ä¿¾ä¿¯ååååæåååååå¬å¸ååå å´å²"], +["d1a1","ååå³åååå¥åå£å®å¹åµåååååååå¡åºå·å¼å»å¿å å å å å ¢ç«¸å ©å ªå ®ååååååååååå¤å¦å¢å©åªå«å³å±å²å°åµå½å ååå èå©åå°åµå¾ååååå§åªå®å³å¹åååååååªå´å©å³å¿å½åååå±åå辨"], +["d2a1","辧å¬åå¼åµååååå£å¦é£å å³åµå¸å¹ååç¸åååååå£å¯å±å³å¸ååå ä¸ååååå©å®å¤å»å·ååå å¦å¥å®å°å¶åç°éåæ¼ç®å®å¨ååºåå½åå¬åå¼å®å¶å©ååååµååå±å·å°åå»åå¶ååååå¢å¸å¥å¬ååå¨"], +["d3a1","å«åå¤å¾å¼åå¥å¦ååå½å®ååºå¢å¹åå£åå®åå ååå¸å³åååå¯ååå»å¾ååå®å¼åå©åå¨åå åååå¤ååå·åå¾å½åå¹ååçå´å¶å²å¸å«å¤å¯å¬åªåååå ååå¥å®å¶å´åå¼ååååååååå®å¹åå¿åå"], +["d4a1","ååååååååå¦å·å¸åå»ååå©ååå¡å¿ååå å³å¤åªå°åååååå åå£å å å å¡²å ¡å¡¢å¡å¡°æ¯å¡å ½å¡¹å¢ 墹å¢å¢«å¢ºå£å¢»å¢¸å¢®å£ å£å£å£å£å£å£¥å£å£¤å£å£¯å£ºå£¹å£»å£¼å£½å¤å¤å¤å¤æ¢¦å¤¥å¤¬å¤å¤²å¤¸å¤¾ç«å¥å¥å¥å¥å¥å¥¢å¥ 奧奬奩"], +["d5a1","奸å¦å¦ä½ä¾«å¦£å¦²å§å§¨å§å¦å§å§å¨¥å¨å¨å¨å¨å¨å©å©¬å©å¨µå¨¶å©¢å©ªåªåª¼åª¾å«å«åª½å«£å«å«¦å«©å«å«ºå«»å¬å¬å¬å¬²å«å¬ªå¬¶å¬¾åå åååååå¥å©å°å³åµå¸æåºå®å®å®¦å®¸å¯å¯å¯å¯å¯å¯¤å¯¦å¯¢å¯å¯¥å¯«å¯°å¯¶å¯³å° å°å°å°å°å° 尢尨尸尹å±å±å±å±"], +["d6a1","å±å±å±å±¬å±®ä¹¢å±¶å±¹å²å²å²å¦å²«å²»å²¶å²¼å²·å³ å²¾å³å³å³©å³½å³ºå³å¶å³ªå´å´å´åµå´å´å´å´å´¢å´å´å´åµåµåµåµåµ¬åµ³åµ¶å¶å¶å¶å¶¢å¶å¶¬å¶®å¶½å¶å¶·å¶¼å·å·å·å·å·å·å·«å·²å·µå¸å¸å¸å¸å¸å¸¶å¸·å¹å¹å¹å¹å¹å¹å¹å¹¢å¹¤å¹å¹µå¹¶å¹ºéº¼å¹¿åº å»å»å»å»å»"], +["d7a1","å»å»£å»å»å»å»¢å»¡å»¨å»©å»¬å»±å»³å»°å»´å»¸å»¾å¼å¼å½å½å¼å¼å¼å¼©å¼å¼¸å½å½å½å½å¼¯å½å½å½å½å½¡å½å½³å½·å¾å¾å½¿å¾å¾å¾å¾å¾å¾å¾å¾ 徨å¾å¾¼å¿å¿»å¿¤å¿¸å¿±å¿æ³å¿¿æ¡æ æææ©ææ±æææ«æ¦ææºæææªæ·æææææ£ææ¤ææ¬æ«ææææ§ææ"], +["d8a1","ææææææ§ææ¡æ¸æ ææ´å¿°æ½ææµææ æææ¶æ·ææ´æºææ¡æ»æ±æææ æ¾æ¨æ§æ æ¿æ¼æ¬æ´æ½æ æ æ ³æ ·æ æ æ æ «æ ´æ ¯æ ¥æ ±æ æ æ æ µææææ¬æææææ«æ®ææææ·ææææºæç½¹ææ¦æ£æ¶æºæ´æ¿æ½æ¼æ¾æææææææ"], +["d9a1","ææ¡æªæ®æ°æ²æ³ææææ£ææ æ¨æ¼æææ¾æææææææææ»ææ¿ææææææææææææ®æ±æ§æææ¯æµææ¾æææææææ«æ¶æ£ææææµæ«æ©æ¾æ©æææ£æææ¶æææ´æææ¦æ¶æææ¨ææ§æ¯æ¶ææªæææ¥æ©ææ¼"], +["daa1","æææ ææ»æææ±æ§èæ æ¡æ¬æ£æ¯æ¬æ¶æ´æ²æºææ½æææ æ¤æ£æ«æ´æµæ·æ¶æ¸çææææææææ²æ¸ææè®æææ«æ·æææææææææ æ¡æ±æ²æææ»æ³æµæ¶æ´ææææææææ¤æ§æ¨ææ¢æ°æææææææææ¹ææ¾æ¼"], +["dba1","ææ¸æææ æ¿æ¦æ©æ°æµæ·ææææ¦æ§é¸æ®æ¿æ¶ææ¸æ·æææ ææ£æ¤ææ°æ©æ¼æªæææ¦æ¡æ æ·æ¯æ´æ¬æ³æ©æ¸æ¤æææ¢æ®æ¹æææ§æªæ æ¡æ ©æ¡æ¡æ ²æ¡æ¢³æ «æ¡æ¡£æ¡·æ¡¿æ¢æ¢æ¢æ¢æ¢æ¢æ¢æª®æ¢¹æ¡´æ¢µæ¢ 梺æ¤æ¢æ¡¾æ¤æ£æ¤æ£æ¤¢æ¤¦æ£¡æ¤æ£"], +["dca1","æ£æ£§æ£æ¤¶æ¤æ¤æ£æ££æ¤¥æ£¹æ£ 棯椨椪æ¤æ¤£æ¤¡æ£æ¥¹æ¥·æ¥æ¥¸æ¥«æ¥æ¥¾æ¥®æ¤¹æ¥´æ¤½æ¥æ¤°æ¥¡æ¥æ¥æ¦æ¥ªæ¦²æ¦®æ§æ¦¿æ§æ§æ¦¾æ§å¯¨æ§æ§æ¦»æ§æ¦§æ¨®æ¦æ¦ æ¦æ¦æ¦´æ§æ§¨æ¨æ¨æ§¿æ¬æ§¹æ§²æ§§æ¨ 榱æ¨æ§æ¨æ§«æ¨æ¨æ«æ¨£æ¨æ©æ¨æ©²æ¨¶æ©¸æ©æ©¢æ©æ©¦æ©æ¨¸æ¨¢æªæªæª æªæª¢æª£"], +["dda1","æªè檻æ«æ«æª¸æª³æª¬æ«æ«æ«æªªæ«æ«ªæ«»æ¬ è櫺æ¬æ¬é¬±æ¬æ¬¸æ¬·ç欹飮æææææææææ¡æ¸æ¹æ¿æ®æ®æ®æ®æ®æ®æ®æ®¤æ®ªæ®«æ®¯æ®²æ®±æ®³æ®·æ®¼æ¯æ¯æ¯æ¯æ¯¬æ¯«æ¯³æ¯¯éº¾æ°æ°æ°æ°æ°¤æ°£æ±æ±æ±¢æ±ªæ²æ²æ²æ²æ²æ±¾æ±¨æ±³æ²æ²æ³æ³±æ³æ²½æ³æ³ æ³æ²®æ²±æ²¾"], +["dea1","沺æ³æ³¯æ³æ³ªæ´è¡æ´¶æ´«æ´½æ´¸æ´æ´µæ´³æ´æ´æµ£æ¶æµ¤æµæµ¹æµæ¶æ¶æ¿¤æ¶ æ·¹æ¸æ¸æ¶µæ·æ·¦æ¶¸æ·æ·¬æ·æ·æ·¨æ·æ· æ·ºæ·æ·¤æ·æ·ªæ·®æ¸æ¹®æ¸®æ¸æ¹²æ¹æ¸¾æ¸£æ¹«æ¸«æ¹¶æ¹æ¸æ¹æ¸ºæ¹æ¸¤æ»¿æ¸æ¸¸æºæºªæºæ»æº·æ»æº½æº¯æ»æº²æ»æ»æºæº¥æ»æºæ½æ¼ç滬滸滾漿滲漱滯漲æ»"], +["dfa1","æ¼¾æ¼æ»·æ¾æ½ºæ½¸æ¾æ¾æ½¯æ½æ¿³æ½æ¾æ½¼æ½æ¾æ¾æ¿æ½¦æ¾³æ¾£æ¾¡æ¾¤æ¾¹æ¿æ¾ªæ¿æ¿æ¿¬æ¿æ¿æ¿±æ¿®æ¿çç濺ççç濾ççæ½´çççç°ç¾ç²çç£ççç¯ç±ç¬ç¸ç³ç®çççççç½ççç ¥ç çç ¦ç ¢ç ç ç ¬çç»ççç¨ç¬çç¹ç¾ççççç ç¬ç§çµç¼"], +["e0a1","ç¹ç¿çççç¨çç¬ç°ç²ç»ç¼ç¿ççççç´ç¾çççççç¢ç§ç¹ç²çççççç¢ç ç¡ç¹ç·åçççççç´ç¯ç©ç¥ç¾ççé»ççªç¨ç°ç¸çµç»çºçç³çç»çç¥ç®çç¢ç ç¯ç¥ç¸ç²çºçç¿ççççç©ç°ç£çªç¶ç¾ççç§çççç±"], +["e1a1","ç ç£ç§ç©ç®ç²ç°ç±ç¸ç·ççç ççççççç¦ç¬ç¼çççççççç©ç¤ç§ç«çç¸ç¶ççç´ççççççç¥ç£çç³ççµç½ç¸ç¼ç±ççççç£çç¾ç¿ç¼çç°çºç²ç³ççççç§ç ç¡ç¢ç¤ç´ç°ç»çççççç¡ç¢ç¨ç©çªç§ç¬ç°"], +["e2a1","ç²ç¶ç¸ç¼çççççççççç°ç´ç¸ç¹çºçççççç¡ç¥ç§çªè¯ç»çççç©ç¤çç¥ç¦çç·ç¸ççç¨ç«çç¥ç¿ç¾ç¹çççç çç°ç¶ç¹ç¿ç¼ç½ç»çççççç£ç®ç¼ç ç 礦ç ç¤ªç¡ ç¢ç¡´ç¢ç¡¼ç¢ç¢ç¢£ç¢µç¢ªç¢¯ç£ç£ç£ç£ç¢¾ç¢¼ç£ ç£ç£¬"], +["e3a1","磧ç£ç£½ç£´ç¤ç¤ç¤ç¤ç¤¬ç¤«ç¥ç¥ ç¥ç¥ç¥ç¥ç¥ç¥ºç¥¿ç¦ç¦ç¦§é½ç¦ªç¦®ç¦³ç¦¹ç¦ºç§ç§ç§§ç§¬ç§¡ç§£ç¨ç¨ç¨ç¨ç¨ ç¨ç¦ç¨±ç¨»ç¨¾ç¨·ç©ç©ç©ç©¡ç©¢ç©©é¾ç©°ç©¹ç©½çªçªçªçªçªçª©ç«çª°çª¶ç« ç«çª¿éç«ç«ç«ç«ç«ç«ç«ç«ç«ç«¡ç«¢ç«¦ç«ç«°ç¬ç¬ç¬ç¬ç¬³ç¬ç¬ç¬ç¬µç¬¨ç¬¶ç"], +["e4a1","çºç¬çç¬çç çµç¥ç´ç§ç°ç±ç¬ç®ç®ç®ç®ç®ç®ç®ç®ç®ç®çç®ç¯ç¯ç¯ç¯ç®´ç¯ç¯ç¯©ç°ç°ç¯¦ç¯¥ç± ç°ç°ç°ç¯³ç¯·ç°ç°ç¯¶ç°£ç°§ç°ªç°ç°·ç°«ç°½ç±ç±ç±ç±ç±ç±ç±ç±ç±¤ç±ç±¥ç±¬ç±µç²ç²ç²¤ç²ç²¢ç²«ç²¡ç²¨ç²³ç²²ç²±ç²®ç²¹ç²½ç³ç³ ç³ç³ç³ç³ç³¢é¬»ç³¯ç³²ç³´ç³¶ç³ºç´"], +["e5a1","ç´ç´ç´ç´çµ çµç´®ç´²ç´¿ç´µçµçµ³çµçµçµ²çµ¨çµ®çµçµ£ç¶ç¶çµç¶çµ½ç¶ç¶ºç¶®ç¶£ç¶µç·ç¶½ç¶«ç¸½ç¶¢ç¶¯ç·ç¶¸ç¶ç¶°ç·ç·ç·¤ç·ç·»ç·²ç·¡ç¸ ç¸ç¸£ç¸¡ç¸ç¸±ç¸ç¸ç¸ç¸¢ç¹ç¹¦ç¸»ç¸µç¸¹ç¹ç¸·ç¸²ç¸ºç¹§ç¹ç¹ç¹ç¹ç¹ç¹¹ç¹ªç¹©ç¹¼ç¹»çºç·ç¹½è¾®ç¹¿çºçºçºçºçºçºçºçºçºçºçºç¼¸ç¼º"], +["e6a1","ç½ ç½ç½ç½ç½ç½ç½ç½ç½ç½ç½ 罨罩罧罸ç¾ç¾ç¾ç¾ç¾ç¾ç¾ç¾ç¾ç¾ç¾£ç¾¯ç¾²ç¾¹ç¾®ç¾¶ç¾¸è±ç¿ ç¿ç¿ç¿ç¿ç¿¡ç¿¦ç¿©ç¿³ç¿¹é£èèèèèèèè¡è¨è¿è»èèèèèèè¢è¨è³è²è°è¶è¹è½è¿èèè èèèèåè¬èè¥èèèèèèè¯è±èè©è£è¯è "], +["e7a1","éè è¾è è è¼è ±è ®è ¥è ¦è ´èèèèèè èè¤è£è èè©è°èµè¾è¸è½èèèºèèèèèèèèè è§èºè»è¾èèè èèèèèè©è«è¸è³èèèèèèè¤è¢è¨èªè«è®è±è·è¸è¾èèè«èè»è¬è¡è£èèè´è³èºèèè»è¹èèèèè"], +["e8a1","èµè´èè²è±èè¹èè è¯è«èèè èèªèè¢èè£èèèè¼èµè³èµè èè¨è´èè«èè½èèèèè·èè è²èè¢è è½è¸èè»èèªè¼èèè·è«èè®èè©èè¬è¯è¹èµèè¢è¹è¿èèèè»èèèèèè¡è¡è¿è´èèè¬èèèè¼èè£èè"], +["e9a1","èèèèèè¤èèèè¨èèèèªèèè·è¾èèèºèè¹èèèè¥èè¹èèèè¾èºèè¢èè°è¿èä¹èèè§è±èè£è©èªèèè¶è¯èèè°èè £è«èèè©è¬èèè¯èèèèèè»èèèè¹èè´è¿è·è»è¥è©èè èè¸èèè´èè¨è®è"], +["eaa1","èè£èªè è¢èèè¯èè½èèéè«èè³èèè»è¯è²è è è è¾è¶è·è èè è è è ¢è ¡è ±è ¶è ¹è §è »è¡è¡è¡è¡è¡è¡¢è¡«è¢è¡¾è¢è¡µè¡½è¢µè¡²è¢è¢è¢è¢®è¢è¢¢è¢è¢¤è¢°è¢¿è¢±è£è£è£è£è£è£è£¹è¤è£¼è£´è£¨è£²è¤è¤è¤è¤è¥è¤è¤¥è¤ªè¤«è¥è¥è¤»è¤¶è¤¸è¥è¤è¥ è¥"], +["eba1","襦襤è¥è¥ªè¥¯è¥´è¥·è¥¾è¦è¦è¦è¦è¦è¦¡è¦©è¦¦è¦¬è¦¯è¦²è¦ºè¦½è¦¿è§è§è§è§è§§è§´è§¸è¨è¨è¨è¨è¨è¨è¨¥è¨¶è©è©è©è©è©è©¼è©è©¬è©¢èª èªèªèª¨èª¡èªèª¥èª¦èªèª£è«è«è«è«è««è«³è«§è«¤è«±è¬è« 諢諷è«è«è¬è¬è¬è«¡è¬è¬è¬è¬ 謳é«è¬¦è¬«è¬¾è¬¨èèèèèèèèè«"], +["eca1","èè¬è¯è´è½è®è®è®è®è®è®è®è®è°ºè±è°¿è±è±è±è±è±è±¢è±¬è±¸è±ºè²è²è² è²è²è²è²è±¼è²æè²è²ªè²½è²²è²³è²®è²¶è³è³è³¤è³£è³è³½è³ºè³»è´è´ è´è´è´è´è´é½è´è³è´è´èµ§èµèµ±èµ³è¶è¶è·è¶¾è¶ºè·è·è·è·è·è·è·ªè·«è·è·£è·¼è¸è¸è·¿è¸è¸è¸è¸è¹è¸µè¸°è¸´è¹"], +["eda1","è¹è¹è¹è¹è¹è¹è¹¤è¹ 踪蹣è¹è¹¶è¹²è¹¼èºèºèº èºèºèºèºèºèºèºèºªèº¡èº¬èº°è»èº±èº¾è» è»è»è»è»£è»¼è»»è»«è»¾è¼è¼ è¼è¼è¼è¼è¼è¼è¼è¼è¼¦è¼³è¼»è¼¹è½ è½è¼¾è½è½è½è½è½è½è½¢è½£è½¤è¾è¾è¾£è¾è¾¯è¾·è¿è¿¥è¿¢è¿ªè¿¯éè¿´é 迹迺ééé¡ééééé§é¶éµé¹è¿¸"], +["eea1","ééééééé¾éééé¨é¯é¶é¨é²éé½éééééé¨é¯é±éµé¢é¤æééééé²é°é é é é £é ¥é ©é ³é ²éééé¢é«é¯éªéµé´éºéééééééé¡éé¼éµé¶éé¿éé¬ééééé éé¤ééé¿ééééééééé¹é·é©ééºéé®"], +["efa1","éé¢éé£éºéµé»éé é¼é®éé°é¬ééé¹ééé¨é¥éééééé¤ééééééé¶é«éµé¡éºééééé é¢ééªé©é°éµé·é½éé¼é¾éé¿éééééééé é¨é§éé¼é»é¹é¾é濶éééééééé¡é¥é¢é¡é¨é®é¯ééééé·éé"], +["f0a1","ééé¦é²é¬éééééªé§é±é²é°é´é¶é¸é¹ééééè¥éééé¹éééééééééé¤éªé°é¹é½é¾ééééééé é¤é¦é¨åé«é±é¹é é¼ééºéééééé¨é¦é£é³é´ééééééé½é²ç«é¶éµé é é ¸é ¤é ¡é ·é ½é¡é¡é¡é¡«é¡¯é¡°"], +["f1a1","顱顴顳颪颯颱颶é£é£é£é£©é£«é¤é¤é¤é¤é¤é¤¡é¤é¤é¤¤é¤ 餬餮餽餾é¥é¥é¥ é¥é¥é¥é¥é¥é¥é¦é¦é¦¥é¦é¦®é¦¼é§é§é§é§é§é§é§®é§±é§²é§»é§¸é¨é¨é¨ 駢é¨é¨«é¨·é© é©é©é©é¨¾é©é©é©é©é©é©¢é©¥é©¤é©©é©«é©ªéªéª°éª¼é«é«é«é«é«é«é«é«¢é«£é«¦é«¯é««é«®é«´é«±é«·"], +["f2a1","é«»é¬é¬é¬é¬é¬¢é¬£é¬¥é¬§é¬¨é¬©é¬ªé¬®é¬¯é¬²éééééééé´é®é®é®é®é®é®é® 鮨鮴é¯é¯é®¹é¯é¯é¯é¯é¯£é¯¢é¯¤é¯é¯¡é°ºé¯²é¯±é¯°é°é°é°é°é°é°é°é°é°é°é°®é°é°¥é°¤é°¡é°°é±é°²é±é°¾é±é± 鱧鱶鱸鳧鳬鳰é´é´é³«é´é´é´ªé´¦é¶¯é´£é´éµé´é´éµé´¿é´¾éµéµ"], +["f3a1","éµéµéµ¤éµéµéµéµ²é¶é¶é¶«éµ¯éµºé¶é¶¤é¶©é¶²é·é·é¶»é¶¸é¶ºé·é·é·é·é·é·¸é·¦é·é·¯é·½é¸é¸é¸é¹µé¹¹é¹½éºéºéºéºéºéºéºéºéº¥éº©éº¸éºªéºé¡é»é»é»é»é»é»é»é»é» 黥黨黯黴黶黷黹黻黼黽é¼é¼ç·é¼é¼¡é¼¬é¼¾é½é½é½é½£é½é½ 齡齦齧齬齪齷齲齶é¾é¾é¾ "], +["f4a1","å ¯æ§éç¤åç"], +["f9a1","çºè¤ééèä¿ç»æ±æ£é¹æ»å½ 丨仡仼ä¼ä¼ä¼¹ä½ä¾ä¾ä¾ä¾ä¿åå¢ä¿¿ååå°ååå´åå å ¤åå¾å¬ååå¦ååååå¤å²åå²åï¨ååå©å¿ååå¥å¬ååï¨ï¨å¢å¢²å¤å¥å¥å¥å¥£å¦¤å¦ºåå¯ç¯å¯å¯¬å°å²¦å²ºå³µå´§åµï¨åµåµå¶¸å¶¹å·å¼¡å¼´å½§å¾·"], +["faa1","å¿ææ ææææ æ²ææ·æ°æææ¦æµæ ææææææ»ææ®ææ¤æ¥ææï¨æ³ææ æ²æ¿æºæ朗æ¦æ»æ¡ææ æ¡æ£ï¨æ¥¨ï¨æ¦æ§¢æ¨°æ©«æ©æ©³æ©¾æ«¢æ«¤æ¯æ°¿æ±æ²æ±¯æ³æ´æ¶æµ¯æ¶æ¶¬æ·æ·¸æ·²æ·¼æ¸¹æ¹æ¸§æ¸¼æº¿æ¾æ¾µæ¿µç çç¨ç ç«ççç ç ç ï¨çç¾ç±"], +["fba1","ç¾ç¤ï¨ç·ç½ççç£çççµç¦çªç©ç®ç¢çççç¯ççççç¦ï¨çå¯ç ¡ç¡ç¡¤ç¡ºç¤°ï¨ï¨ï¨ç¦ï¨ç¦ç«ç«§ï¨ç««ç®ï¨çµçµç¶·ç¶ ç·ç¹ç½ç¾¡ï¨èè¢è¿èè¶èè´èèè«ï¨è°ï¨ 﨡è 裵è¨è¨·è©¹èª§èª¾è«ï¨¢è«¶èè¿è³°è³´è´èµ¶ï¨£è»ï¨¤ï¨¥é§é都éé§é"], +["fca1","éééé®é¤é¥ééééºéé¼éééé¹é§é§é·é¸é§ééé﨧éé éé¥é¡é»ï¨¨éé¿ééé°éé¤ééé¸é±é ééï§ï¨©éé¯é³é»éééééé¡é¡¥ï¨ªï¨«é¤§ï¨¬é¦é©é«é«éµé²é®é®±é®»é°éµ°éµ«ï¨é¸é»"], +["fcf1","â °",9,"¬¦ï¼ï¼"], +["8fa2af","Ë˸Ë˯ËËï½ÎÎ "], +["8fa2c2","¡¦¿"], +["8fa2eb","ºª©®â¢Â¤â"], +["8fa6e1","ÎÎÎÎΪ"], +["8fa6e7","Î"], +["8fa6e9","ÎΫ"], +["8fa6ec","Î"], +["8fa6f1","άÎήίÏÎÏÏÏÏΰÏ"], +["8fa7c2","Ð",10,"ÐÐ"], +["8fa7f2","Ñ",10,"ÑÑ"], +["8fa9a1","ÃÄ"], +["8fa9a4","Ħ"], +["8fa9a6","IJ"], +["8fa9a8","ÅÄ¿"], +["8fa9ab","ÅÃÅ"], +["8fa9af","ŦÃ"], +["8fa9c1","æÄðħıijĸÅÅÅÅøÅÃŧþ"], +["8faaa1","ÃÃÃÃÄÇÄÄà ÃÄÄÄÃÄÄÃÃÃÃÄÄÄÄ"], +["8faaba","ÄÄÄ¢Ä Ä¤ÃÃÃÃÇİĪĮĨĴĶĹĽĻÅÅÅ ÃÃÃÃÃÇÅÅÃÅÅÅÅÅÅ ÅŤŢÃÃÃÃŬÇŰŪŲŮŨÇÇÇÇŴßŶŹŽŻ"], +["8faba1","áà äâÄÇÄÄ Ã¥Ã£ÄÄÄçÄÄéèëêÄÄÄÄǵÄÄ"], +["8fabbd","Ä¡Ä¥ÃìïîÇ"], +["8fabc5","īįĩĵķĺľļÅÅÅñóòöôÇÅÅõÅÅÅÅÅÅ¡ÅťţúùüûÅÇűūųůũÇÇÇÇŵýÿŷźžż"], +["8fb0a1","ä¸ä¸ä¸ ä¸ä¸ä¸ä¸£ä¸¤ä¸¨ä¸«ä¸®ä¸¯ä¸°ä¸µä¹ä¹ä¹ä¹ä¹ä¹ä¹ä¹£ä¹¨ä¹©ä¹´ä¹µä¹¹ä¹¿äºäºäºäºäº¯äº¹ä»ä»ä»ä»ä» 仡仢仨仯仱仳仵份仾仿ä¼ä¼ä¼ä¼ä¼ä¼ä¼ä¼ä¼ä¼ä¼ä¼®ä¼±ä½ 伳伵伷伹伻伾ä½ä½ä½ä½ä½ä½ä½ä½ä½ä½ä½ä½£ä½ªä½¬ä½®ä½±ä½·ä½¸ä½¹ä½ºä½½ä½¾ä¾ä¾ä¾"], +["8fb1a1","ä¾ ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾ä¾²ä¾·ä¾¹ä¾»ä¾¼ä¾½ä¾¾ä¿ä¿ä¿ ä¿ä¿ä¿ä¿ä¿ä¿ä¿ä¿ä¿ä¿ 俢俰俲俼俽俿åååååååååååååååå¢å§å®å°å²å³åµåååå ååååååååååå å¢å£å¦å§åªåå°å±å»åååååååå"], +["8fb2a1","ååååååå",4,"åªå¯å°å¹åºå½åååååååååååååå¢å¤å¦å¨å©å¯å±å¶åºå¾ååååååååå²åååååååå£å§å¨å¬åå¯å±å³å´åµå¸å¹å å å å å å å å å ¤å ¦å ¾ååååååå¡å£åå¸åºå¼å¾å¿å"], +["8fb3a1","ååååååååå¢å¥å®å²å³å´å·ååå åååååå¢å¨å±å²åµå¼å åååååååå å¡å¦å®å·å¸å¹ååå åååååååååå¤å¥å¦å§å¯å°å¶å·å¸åºå»å½åååååååååååå¡å¥å¨å©åªå¬å°å±å´å¶å·åååå"], +["8fb4a1","ååååååååå¥å§å¨å©å«å¬åå°å²åµå¼å½å¾åååååå¡å£å¥å¬åå²å¹å¾ååååååååå¡å¤åªå«å¯å²å´åµå·å¸åºå½åå åååååååå å¦å§åµåååå¡å§å¨åªå¯å±å´åµååååååå¢å¤å¦å§å©å«åå®å´å¿"], +["8fb5a1","ååå ååååååååå¡å¦å§å©åªåå®å±å·å¹åºå»å¿ååååå åªå¬å¯å¶å¼å¾å¿ååå åååååååªå«å²åµå¶å»å¼å½åååååååååååå å¡å¤å¦å¿åååååååååååå£å¤åå²å¿ååååååååå"], +["8fb6a1","åååååå¢å©å¶å¿å ååå",5,"åå¬å°å³åµå·å¹å»å¼å½å¿åååååååååååå å¡å¢å£å¦å©åå¯å±å²åµåå åååååååååå¦å§å¨å©å«å¬åå±å³å·å¾å åååååååååååå¡å¤",4,"å±å«å"], +["8fb7a1","å¶å·ååååååååååå å¢å£å¤å¥å©åªå¬å®å¯å³å´å½å¾å¿å ååååå¢å¥å§å¨å«å",4,"å³å´åµå·å¹åºå»å¼å¾åååååååååååå¡åå§å¨å©å¬å¸å½åååååååå¤å¦å§å©åå°åµå¶å¸å½å¾å¿å å å å å¡"], +["8fb8a1","å å å å å å å ¦å §å å ²å ¹å ¿å¡å¡å¡å¡å¡å¡å¡å¡¡å¡¤å¡§å¡¨å¡¸å¡¼å¡¿å¢å¢å¢å¢å¢å¢å¢å¢å¢å¢å¢å¢å¢å¢ 墡墢墦墩墱墲å£å¢¼å£å£å£å£å£å£å£å£å£å£å£¡å£¢å£©å£³å¤ å¤å¤å¤å¤å¤å¤èå¤å¤¡å¤£å¤¤å¤¨å¤¯å¤°å¤³å¤µå¤¶å¤¿å¥å¥å¥å¥å¥å¥å¥å¥å¥å¥¡å¥£å¥«å¥"], +["8fb9a1","奯奲奵奶她奻奼å¦å¦å¦å¦å¦å¦å¦å¦¤å¦§å¦å¦®å¦¯å¦°å¦³å¦·å¦ºå¦¼å§å§å§å§å§å§å§å§å§å§å§£å§¤å§§å§®å§¯å§±å§²å§´å§·å¨å¨å¨å¨å¨å¨å¨å¨å¨£å¨¤å¨§å¨¨å¨ªå¨å¨°å©å© å©å©å©å©å©å©å©£å©¥å©§å©å©·å©ºå©»å©¾åªåªåªåªåªåªåªåªåª 媢媧媬媱媲媳媵媸媺媻媿"], +["8fbaa1","å«å«å«å«å«å«å« 嫥嫪嫮嫵嫶嫽å¬å¬å¬å¬å¬´å¬å¬å¬å¬¡å¬¥å¬å¬¸ååååååå¨å®å¯å¼å½å¾å¿å®å®å®å®å®å®å®å®å®å®å®¨å®©å®¬å®å®¯å®±å®²å®·å®ºå®¼å¯å¯å¯å¯å¯",4,"å¯ å¯¯å¯±å¯´å¯½å°å°å°å°å°£å°¦å°©å°«å°¬å°®å°°å°²å°µå°¶å±å±å±å±¢å±£å±§å±¨å±©"], +["8fbba1","å±å±°å±´å±µå±ºå±»å±¼å±½å²å²å²å²å²å²å²å² 岢岣岦岪岲岴岵岺å³å³å³å³å³å³®å³±å³²å³´å´å´å´å´å´«å´£å´¤å´¦å´§å´±å´´å´¹å´½å´¿åµåµåµåµåµåµåµåµåµåµ 嵡嵢嵤嵪åµåµ°åµ¹åµºåµ¾åµ¿å¶å¶å¶å¶å¶å¶å¶å¶å¶å¶å¶å¶ 嶧嶫嶰嶴嶸嶹å·å·å·å·å·å·å·å· å·¤"], +["8fbca1","巩巸巹å¸å¸å¸å¸å¸å¸å¸å¸å¸ 帮帨帲帵帾å¹å¹å¹å¹å¹å¹å¹å¹å¹å¹¨å¹ª",4,"å¹°åºåºåºåº¢åº¤åº¥åº¨åºªåº¬åº±åº³åº½åº¾åº¿å»å»å»å»å»å»å»å»å»å»å»¥å»«å¼å¼å¼å¼å¼å¼å¼å¼å¼¡å¼¢å¼£å¼¤å¼¨å¼«å¼¬å¼®å¼°å¼´å¼¶å¼»å¼½å¼¿å½å½å½ å½å½å½å½å½å½å½ 彣彤彧"], +["8fbda1","彯彲彴彵彸彺彽彾å¾å¾å¾å¾å¾å¾å¾¢å¾§å¾«å¾¤å¾¬å¾¯å¾°å¾±å¾¸å¿å¿å¿å¿å¿å¿",4,"å¿å¿¡å¿¢å¿¨å¿©å¿ªå¿¬å¿å¿®å¿¯å¿²å¿³å¿¶å¿ºå¿¼ææææææææææ¤ææ³æµæææææææææææ¡æ§æ±æ¾æ¿ææææææææææææ¢æ¤æ¥æ¨æ°æ±æ·"], +["8fbea1","æ»æ¾æææææææææææææææ¢æ¥æ²æµæ¸æ¼æ½æææææ",4,"ææææææ¢æªæ«æ°æ±æµæ¶æ·æ¹æ æ æ æ æ æ æ ¬æ ²æ ¸æ »æ ¼æ ¿ææææææææææææææ æ¥æ¨æªææ¸æ¹æ¼æææææææææææ¡æ¢æ§æ©æ¥"], +["8fbfa1","æ¬ææ¯ææææææææ æ¢æ£æ§æ©æ«æ¹æ½æææææææææææææ¤ææ¯æ³æºæ½æææææ¦æ¨æ³æ¶æ·æºæ¾æ¿ææææææªæ²æ´æ¼æ½ææææææææææ©æªææµæ¶æ¹æ¼ææææææææææææææ¥æ¦æ¬ææ±æ´æµ"], +["8fc0a1","æ¸æ¼æ½æ¿æææææææææææ¤æ¦ææ®æ¯æ½ææ ææææææææ æ¥æªæ¬æ²æ³æµæ¸æ¹ææææææææ æ¢æ¤æ¥æ©æªæ¯æ°æµæ½æ¿ææææææææææææ æ¡æ£ææ³æ´æ»æ½æ ææææææææææ¡æ£æ¦æ¨æ¬æ³æ½æ¾æ¿"], +["8fc1a1","æææææææææææ¤æ¥æ©æªææ°æµæ·æ»æ¿ææææææææææææææ¢æ¦æ©æ®æ±æºæ¼æ½ææææææææ æ§æ«æºæ½ææ ææææææ æ£æ¦æ®æ²æ³æ´æ¿ææææææææææ°æ²æ´æµæ¹æ¾æ¿ææææææææææ"], +["8fc2a1","ææ¡æ¢æ£æ¤æ¦æ©æªæ«æ¬æ®æ°æ±æ³æ¹æ·ææ æææææææææææ æ¡æ»æªæ«æ¬æ¾æ³æµæ¿æ·æ¸æ¹æ»ææ¼æææææææææææ æ¤ææ±æ²æµæ»æ¿æææææææææææ¨æ«æ¬æ®æºæ ææææææ æ¢æ³æ¾æ ææææææ"], +["8fc3a1","æ¦æ¬æ®æ´æ¶æ»æææææææææææ°æ±æ²æµæ»æ¼æ½æ¹ææææ æææææææ¡æ¦æ°æ²æ¶æ·æ¡æ æ æ æ æ ¨æ §æ ¬æ æ ¯æ °æ ±æ ³æ »æ ¿æ¡æ¡ æ¡æ¡æ¡æ¡æ¡æ¡æ¡«æ¡®",4,"桵桹桺桻桼æ¢æ¢æ¢æ¢æ¢æ¢æ¢æ¢æ¢¡æ¢£æ¢¥æ¢©æ¢ªæ¢®æ¢²æ¢»æ£ æ£æ£æ£"], +["8fc4a1","æ£æ£æ£æ£æ£æ£æ£æ£¥æ£¨æ£ªæ£«æ£¬æ£æ£°æ£±æ£µæ£¶æ£»æ£¼æ£½æ¤æ¤æ¤æ¤æ¤æ¤æ¤æ¤æ¤±æ¤³æ¤µæ¤¸æ¤»æ¥æ¥ æ¥æ¥æ¥æ¥æ¥£æ¥¤æ¥¥æ¥¦æ¥¨æ¥©æ¥¬æ¥°æ¥±æ¥²æ¥ºæ¥»æ¥¿æ¦æ¦æ¦æ¦æ¦æ¦¡æ¦¥æ¦¦æ¦¨æ¦«æ¦æ¦¯æ¦·æ¦¸æ¦ºæ¦¼æ§ æ§æ§æ§æ§æ§¢æ§¥æ§®æ§¯æ§±æ§³æ§µæ§¾æ¨æ¨æ¨æ¨æ¨æ¨æ¨æ¨æ¨ 樤樨樰樲"], +["8fc5a1","æ¨´æ¨·æ¨»æ¨¾æ¨¿æ© æ©æ©æ©æ©æ©æ©æ©æ©æ©æ©æ©¤æ©§æ©ªæ©±æ©³æ©¾æªæªæªæªæªæªæªæªæªæªæªæª¥æª«æª¯æª°æª±æª´æª½æª¾æª¿æ«æ«æ«æ«æ«æ«æ«æ«æ«æ«æ«¤æ«§æ«¬æ«°æ«±æ«²æ«¼æ«½æ¬æ¬æ¬æ¬æ¬æ¬æ¬æ¬æ¬æ¬æ¬æ¬¤æ¬¨æ¬«æ¬¬æ¬¯æ¬µæ¬¶æ¬»æ¬¿ææææææææ æ§æ«æ®æ°æµæ½"], +["8fc6a1","æ¾æ®æ® æ®æ®æ®æ® 殢殣殨殩殬æ®æ®®æ®°æ®¸æ®¹æ®½æ®¾æ¯æ¯æ¯æ¯æ¯æ¯æ¯¡æ¯£æ¯¦æ¯§æ¯®æ¯±æ¯·æ¯¹æ¯¿æ°æ°æ° æ°æ°æ°æ°æ°æ°æ°æ°¦æ°§æ°¨æ°¬æ°®æ°³æ°µæ°¶æ°ºæ°»æ°¿æ±æ±æ±æ±æ±æ±æ±æ±æ±æ±«æ±æ±¯æ±´æ±¶æ±¸æ±¹æ±»æ² æ²æ²æ²æ²æ²æ²æ²æ²æ²æ²°æ²²æ²´æ³æ³æ³æ³æ³æ³æ³æ³æ³"], +["8fc7a1","æ³æ³æ³ 泧泩泫泬泮泲泴æ´æ´æ´æ´æ´æ´æ´æ´æ´¦æ´§æ´¨æ±§æ´®æ´¯æ´±æ´¹æ´¼æ´¿æµæµæµæµ¡æµ¥æµ§æµ¯æµ°æµ¼æ¶æ¶æ¶æ¶æ¶æ¶æ¶æ¶æ¶ªæ¶¬æ¶´æ¶·æ¶¹æ¶½æ¶¿æ·æ·æ·æ·æ·æ·æ·æ·æ·æ· 淢淥淩淯淰淴淶淼æ¸æ¸æ¸æ¸¢æ¸§æ¸²æ¸¶æ¸¹æ¸»æ¸¼æ¹æ¹ æ¹æ¹æ¹æ¹æ¹æ¹æ¹æ¹æ¹æ¹æ¹æ¹"], +["8fc8a1","湢湣湨湳湻湽æºæºæºæº 溧æºæº®æº±æº³æº»æº¿æ»æ»æ»æ»æ»æ»æ»æ»æ»æ»«æ»æ»®æ»¹æ»»æ»½æ¼æ¼æ¼æ¼æ¼æ¼æ¼æ¼æ¼æ¼¦æ¼©æ¼ªæ¼¯æ¼°æ¼³æ¼¶æ¼»æ¼¼æ¼æ½æ½æ½æ½æ½æ½æ½æ½æ½æ½¡æ½¢æ½¨æ½¬æ½½æ½¾æ¾æ¾æ¾æ¾æ¾æ¾æ¾æ¾æ¾æ¾æ¾æ¾æ¾æ¾ æ¾¥æ¾¦æ¾§æ¾¨æ¾®æ¾¯æ¾°æ¾µæ¾¶æ¾¼æ¿ æ¿æ¿æ¿"], +["8fc9a1","æ¿æ¿æ¿¨æ¿©æ¿°æ¿µæ¿¹æ¿¼æ¿½çç ççççç ç£ç¯ç´ç·ç¹ç¼çççççççççççç¤ç¥ç¬ç®çµç¶ç¾çç çç",4,"çç¤ç«ç°ç±ç´ç·ççççççççç¤çºç",4,"ççççç ç«çç¯ç°ç±ç¸ç ç ç ç ç ç ç ç ç ç ç ç ç "], +["8fcaa1","ç ¨ç ¹çç çççççç ç¢ç¯ç°ç²ç³çºç¿ççççççççççç¸ç¾çççççççççç¤ç«ç¯ç´ç¸ç¹çççç çççççççççç ç£ç¨ç«ç®ç¯ç±ç·ç¸ç»ç¼ç¿ççççççç¨çç®ç±ç´ç¾ççççççççç¥ç³ç´çºç»"], +["8fcba1","ç¾ççç ççççççççç¢ç¤ç§ç¨ç¬ç±ç²çµçºç»ç½çççççççççç ç¦ç§ç©ç«ç¬ç®ç¯ç±ç·ç¹ç¼çççç ççççççççççç ç¢ç¥ç¦çªç«ççµç·ç¹ç¼ç½ç¿ç ççççççççççç¡ç£ç¦ç§ç©ç´çµç·ç¹çºç»ç½"], +["8fcca1","ç¿ççççççççç¤ç¦ç¨",9,"ç¹çççççççççççç¢ç¦ç§ç¨ç«çç®ç±ç²ççç ççççççççççççç ç¡ç£ç¦ç¨ç©çªç«ç®ç¯ç±ç²çµç¹ç»ç¿ççççççççççç¤ç¨çªç«ç¯ç´çºç»ç¼ç¿ç"], +["8fcda1","çççç ç¡ç¤ç§ç©çªç¯ç¶ç¹ç½ç¾ç¿ççççççççççç¡ç¯ç±ç¹",5,"çç ççççççç¢ç¤ç´çºç¿ççççççççççç ç¡ç¤ç§ç¬ç®ç¯ç±ç¹ççççççççççççççççççç£ç¥ç¦ç©çç²ç³çµç¸ç¹"], +["8fcea1","çºç¼çççççç çççççç¤ç¥çç®ç¯ç±ç´çç çççççççç ç¢",6,"çªçç½çç ççççççç ç¦ç¨ç¬ç°ç±ç¶ç¹ç¼çççççççççççç¢ç¨çç®ç¯ç´çµç¶ç¹ç½ç¾çç çççççççççççç ç¢"], +["8fcfa1","ç¤ç§çªç¬ç°ç²ç³ç´çºç½çççççççççç¢ç§çªç®ç¯ç±çµç¾ççççççççç ç¤ç¦çªç¬ç°ç±ç´ç¸ç»ç ç ç ç ç ç ç ç ¡ç ¢ç £ç ç ®ç °ç µç ·ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ç¡ 硡硣硤硨硪确硺硾ç¢ç¢ç¢ç¢ç¢¡ç¢ç¢ç¢ç¢¤ç¢¨ç¢¬ç¢ç¢°ç¢±ç¢²ç¢³"], +["8fd0a1","碻碽碿ç£ç£ç£ç£ç£ç£ç£ç£ç£ç£¤ç£ç£ç£ 磡磦磪磲磳ç¤ç£¶ç£·ç£ºç£»ç£¿ç¤ç¤ç¤ç¤ç¤ç¤ç¤ç¤ 礥礧礩ç¤ç¤±ç¤´ç¤µç¤»ç¤½ç¤¿ç¥ç¥ ç¥ç¥ç¥ç¥ç¥ç¥ç¥ç¥ç¥ç¥§ç¥©ç¥«ç¥²ç¥¹ç¥»ç¥¼ç¥¾ç¦ç¦ç¦ç¦ç¦ç¦ç¦ç¦ç¦ç¦ç¦¡ç¦¨ç¦©ç¦«ç¦¯ç¦±ç¦´ç¦¸ç¦»ç§ç§ç§ç§ç§ç§ç§ç§ç§ç§ç§"], +["8fd1a1","ç§ ç§¢ç§¥ç§ªç§«ç§ç§±ç§¸ç§¼ç¨ç¨ç¨ç¨ç¨ç¨ç¨ç¨ç¨ç¨ç¨¡ç¨§ç¨«ç¨ç¨¯ç¨°ç¨´ç¨µç¨¸ç¨¹ç¨ºç©ç© ç©ç©ç©ç©ç©ç©ç©ç©ç©ç© 穥穧穪ç©ç©µç©¸ç©¾çªçªçª çªçªçªçªçªçªçªçª 窣窬窳窵窹窻窼ç«ç«ç«ç«ç«ç«ç«¨ç«©ç««ç«¬ç«±ç«´ç«»ç«½ç«¾ç¬ç¬ç¬ç¬£ç¬§ç¬©ç¬ªç¬«ç¬ç¬®ç¬¯ç¬°"], +["8fd2a1","笱笴笽笿çççççç ç¤ç¦ç©çªçç¯ç²ç³ç·ç®ç®ç®ç®ç®ç®ç®ç®ç® 箥箬箯箰箲箵箶箺箻箼箽ç¯ç¯ ç¯ç¯ç¯ç¯ç¯ç¯ç¯ç¯ç¯¨ç¯ªç¯²ç¯´ç¯µç¯¸ç¯¹ç¯ºç¯¼ç¯¾ç°ç°ç°ç°ç°ç°ç°ç°ç°ç°ç°ç°ç° 簥簦簨簬簱簳簴簶簹簺ç±ç±ç±ç±ç±ç±ç±",5], +["8fd3a1","籡籣籧籩ç±ç±®ç±°ç±²ç±¹ç±¼ç±½ç²ç²ç²ç²ç²ç² 粦粰粶粷粺粻粼粿ç³ç³ç³ç³ç³ç³ç³ç³ç³ç³ç³ç³ç³ç³¦ç³©ç³«ç³µç´ç´ç´ç´ç´ç´ç´ç´ç´ç´ç´ç´£ç´¦ç´ªç´ç´±ç´¼ç´½ç´¾çµçµçµçµçµçµçµçµçµçµçµçµçµ¥çµ§çµªçµ°çµ¸çµºçµ»çµ¿ç¶ç¶ç¶ç¶ ç¶ç¶ç¶ç¶ç¶ç¶ç¶ç¶ç¶"], +["8fd4a1","ç¶ç¶¦ç¶§ç¶ªç¶³ç¶¶ç¶·ç¶¹ç·",4,"ç·ç·ç·ç·ç·ç¸ç·¢ç·¥ç·¦ç·ªç·«ç·ç·±ç·µç·¶ç·¹ç·ºç¸ç¸ç¸ç¸ç¸ç¸ç¸ç¸ 縧縨縬ç¸ç¸¯ç¸³ç¸¶ç¸¿ç¹ç¹ ç¹ç¹ç¹ç¹ç¹ç¹ç¹¡ç¹¢ç¹¥ç¹«ç¹®ç¹¯ç¹³ç¹¸ç¹¾çºçºçºçºçºçºçºçºçºçºçºç¼¼ç¼»ç¼½ç¼¾ç¼¿ç½ç½ç½ç½ç½ç½ç½ç½ç½ç½¡ç½£ç½¤ç½¥ç½¦ç½"], +["8fd5a1","罱罽罾罿ç¾ç¾ç¾ç¾ç¾ç¾ç¾ç¾ç¾ç¾¡ç¾¢ç¾¦ç¾ªç¾ç¾´ç¾¼ç¾¿ç¿ç¿ç¿ç¿ç¿ç¿ç¿ç¿£ç¿¥ç¿¨ç¿¬ç¿®ç¿¯ç¿²ç¿ºç¿½ç¿¾ç¿¿èèèèèèèèèèèèèè è¤è¦è¬è®è°è´èµè·è¹èºè¼è¾èèè è¤è¦èè±èµèèèèèè¦è§è«è¸è¹èèèèèèèèè èè®"], +["8fd6a1","è°è²è³è¶è¹èºè¾èèèèèèèè è¤è§è¬è°èµèºè¼è è è è è è è è ¡è §è ¨è ©è è ¯è ·èèèè èèèèèèèè¢è®è²è´è»èèè èèèèèèèèè¡è¤è«è¬è°è±è²èµè¶è¸è¹è½è¿èèèèèèèèè¡è¢è¨è²è´èºèèè è"], +["8fd7a1","èèèèèèè è£è§èè´è»è½è¿èèèèèèèèèèèèèèè è¡è£è¤è§è¨è©èªè®è°è²è´è·èºè¼è¾è¿èèèèè è¢è¤è¨èªèè¯è¶è·è½è¾èèèèèèèèèèèè¡è¢è¬èè®è°è³è·èºè¼è½èèèèèèèèèèè°è¸"], +["8fd8a1","è½è¿èèèèèèèèèèèèèè¦è§è©è¬è¾è¿èèèèèèèèèè¨èªè¶è¸è¹è¼èèèèèèèèè¯è¹è èèèèèèèèèèèèè è¤è¥è§èªè°è³è´è¶è¸è¼è½èè èèèèè¦è¨è©èªè¯è±è´èºè½è¾èèèèèèè"], +["8fd9a1","èè§èªè¯è°è±è²è·è²èºè»è½èèèèèèèèè¢è£è¤è¥è§èªè«è¯è³è´è¶è¿èè",4,"èèè",6,"è¤è«è¯è¹èºè»è½è¿èè èèèèèèèèèè è¢è¥è§è´è¶è·è¸è¼è½è¾è¿èèèèèèèèèè è¦è¨èè³è¶è¼"], +["8fdaa1","è¿èèè èèèèèèèèèè¡è§è©è¶è¸èºè¼è½èèèèèèèèèèè ",4,"è©è¬è¯èµè¶è·èºèèèèèèè¡è¦è§è¨èè±è³è´èµè·è¸è¹è¿èèèè èèèèèèè è£è¥è§èèºè¼è½èè èèèèèèèèèèè¡è£"], +["8fdba1","è¨è®è¯è±è²è¹èºè¼è½è¾èèè èèèè¡è¤è¥è¯è±è²è»è",6,"èèèèèèèèèè è£è§è¬èè®è±èµè¾è¿èèèèèèèèèèèè¢è£è¤èªè«èè±è³è¸èºè¿è è è è è è è è è è è è è è è è è è ¨è è ®è °è ²è µ"], +["8fdca1","è ºè ¼è¡è¡è¡ è¡è¡è¡è¡è¡è¡è¡è¡è¡è¡è¡è¡è¡ 衤衩衱衹衻è¢è¢è¢è¢è¢è¢è¢ 袨袪袺袽袾è£è£",4,"è£è£è£è£è£è£§è£¯è£°è£±è£µè£·è¤è¤è¤è¤è¤è¤è¤è¤è¤è¤è¤è¤ 褦褧褨褰褱褲褵褹褺褾è¥è¥è¥ è¥è¥è¥è¥è¥è¥è¥è¥è¥¡è¥¢è¥£è¥«è¥®è¥°è¥³è¥µè¥º"], +["8fdda1","襻襼襽è¦è¦è¦è¦è¦è¦è¦è¦è¦ 覥覰覴覵覶覷覼è§",4,"觥觩觫è§è§±è§³è§¶è§¹è§½è§¿è¨è¨ è¨è¨è¨è¨è¨è¨è¨è¨ 訢訤訦訫訬訯訵訷訽訾è©è©è© è©è©è©è©è©è©è©è©è©è©è©¡è©¥è©§è©µè©¶è©·è©¹è©ºè©»è©¾è©¿èªèªèªèªèªèªèªèªèªèªèªèª§èª©èª®èª¯èª³"], +["8fdea1","誶誷誻誾è«è«è«è«è«è«è«è«è«è«è«è«è«¬è«°è«´è«µè«¶è«¼è«¿è¬ è¬è¬è¬è¬è¬è¬è¬è¬è¬°è¬·è¬¼è",4,"èèèèèèèè£èè¶è¸è¹è¼è¾è®è®è® è®è®è®è®è®è®è®è®è°¸è°¹è°½è°¾è± è±è±è±è±è±è±è±è±è±è±è±è±è±£è±¤è±¦è±¨è±©è±è±³è±µè±¶è±»è±¾è²"], +["8fdfa1","è²è²è²è²è²è²è²è²è²¤è²¹è²ºè³ è³è³è³è³è³è³è³è³è³¡è³¨è³¬è³¯è³°è³²è³µè³·è³¸è³¾è³¿è´è´è´è´è´è´èµ¥èµ©èµ¬èµ®èµ¿è¶è¶è¶è¶è¶è¶è¶è¶è¶è¶ 趦趫趬趯趲趵趷趹趻è·è· è·è·è·è·è·è·è·è·è·è·è·¤è·¥è·§è·¬è·°è¶¼è·±è·²è·´è·½è¸è¸è¸ è¸è¸è¸è¸è¸è¸ 踡踢"], +["8fe0a1","踣踦踧踱踳踶踷踸踹踽è¹è¹è¹è¹è¹è¹è¹è¹è¹è¹è¹è¹¡è¹¢è¹©è¹¬è¹è¹¯è¹°è¹±è¹¹è¹ºè¹»èºèºèºèºèºèºèºèºèºèºèº¢èº§èº©èºèº®èº³èºµèººèº»è»è»è»è»è»è»è»è»è»è»¨è»®è»°è»±è»·è»¹è»ºè»è¼è¼è¼è¼è¼è¼è¼è¼è¼è¼è¼ 輡輣輥輧輨輬è¼è¼®è¼´è¼µè¼¶è¼·è¼ºè½è½"], +["8fe1a1","è½è½è½è½",4,"è½è½è½è½¥è¾è¾ 辡辤辥辦辵辶辸达è¿è¿è¿è¿è¿è¿è¿è¿è¿è¿è¿ 迣迤迨迮迱迵迶迻迾ééééééé¨é©é¯éªé¬éé³é´é·é¿éééééé¢é¦é§é¬é°é´é¹é ééééééééééé é¡é¢é¥é°é²é³é´é¶é½éé¾é"], +["8fe2a1","éé éééééééééé¥éé¶é«é¯é°é´é¾é¿ééé éééééééééééé é¥é¢é£é§é©é®é¯é±é´é¶é·é¹éºé¼é½é é é é é é é é é é ¡é ¤é §é é ´é ¹é ºé »ééé éééééééééé¡é¦é¨é¬éé®é°é±é²é³é¶é»é¼é½é¿"], +["8fe3a1","ééé ééééééé¤é¥é©éªé¬",5,"é·é¹é»é½éééé ééééééééééééé£é¤é¥é¦é¨é®é¯é°é³éµé¶é¸é¹éºé¼é¾ééééééééééééééé é¡é¥é§é¨é©é®é¯é°éµ",4,"é»é¼é½é¿ééééééé"], +["8fe4a1","ééé é¤é¥é§é¨é«é¯é²é¶é¸éºé»é¼é½é¿",4,"é ééééééééééééééééé é¡é£é¥é§é¨é¬é®é°é¹é»é¿éééééééééééé¡é¤é¥é§é©éªé³é´é¶é·éééééééééééé¤é¥é§é©éªéé¯é°é±é³é´é¶"], +["8fe5a1","éºé½é¿éééééééééééééé¡é£é¤é¦é¨é«é´éµé¶éºé©ééé ééé",4,"éééééé¢é¦é§é¹é·é¸éºé»é½ééééééééééééé®é¯é±é²é³é´é»é¿é½éé éééééééé¡é£é¨é«éé®é¯é±é²ééé¸é¹"], +["8fe6a1","é¾ééééééééé¡é¦é©é«é¬é´é¶éºé½é¿éééééééééééééé é¤é¦ééé¢é¤é¥é¦é¬é±é³é·é¸é¹éºé¼é½ééééééé¡é®é´é»é¼é¾é¿ééééééééééé¤é¥é¦é©é®é¯é³éºéé嶲éééééé©é¯é±éºé"], +["8fe7a1","éé ééééé¡é¢é£é¨é±é³ééééééééééé£é§éªé®é³é¶é·é¸é»é½é¿éééééééééé¢é¬é®é±é²éµé¶é¸é¹éºé¼é¾é¿ééé ééééééééééééééé éé¡é¤é¯é±é´é·é¸éºé é é é é é é é é é é £é ¦"], +["8fe8a1","é «é ®é ¯é °é ²é ³é µé ¥é ¾é¡é¡é¡é¡é¡é¡é¡é¡é¡é¡é¡¢é¡£é¡¥é¡¦é¡ªé¡¬é¢«é¢é¢®é¢°é¢´é¢·é¢¸é¢ºé¢»é¢¿é£é£ é£é£é£¡é££é£¥é£¦é£§é£ªé£³é£¶é¤é¤é¤é¤é¤é¤é¤é¤é¤é¤é¤é¤¢é¤¦é¤§é¤«é¤±",4,"餹餺餻餼é¥é¥é¥é¥é¥é¥é¥é¥é¥é¥é¥é¥é¥é¥é¥ é¦é¦é¦é¦¦é¦°é¦±é¦²é¦µ"], +["8fe9a1","馹馺馽馿é§é§é§é§é§é§é§é§é§§é§ªé§«é§¬é§°é§´é§µé§¹é§½é§¾é¨é¨é¨é¨é¨é¨é¨é¨é¨é¨ 騢騣騤騧é¨é¨®é¨³é¨µé¨¶é¨¸é©é©é©é©é©é©é©é©é©é©é©éªªéª¬éª®éª¯éª²éª´éªµéª¶éª¹éª»éª¾éª¿é«é«é«é«é«é«é«é«é«é«é«é«é« 髤髥髧髩髬髲髳髵髹髺髽髿",4], +["8feaa1","é¬é¬ é¬é¬é¬é¬é¬é¬é¬é¬é¬é¬é¬é¬é¬ 鬦鬫é¬é¬³é¬´é¬µé¬·é¬¹é¬ºé¬½ééééééééé¡é£é¥é¦é¨éª",4,"é³éµé·é¸é¹é¿é®é®é® é®é®é®é®é®é®é®é®é®é®é®é®é®¦é®§é®©é®¬é®°é®±é®²é®·é®¸é®»é®¼é®¾é®¿é¯é¯é¯é¯é¯é¯é¯é¯é¯é¯¥é¯§é¯ªé¯«é¯¯é¯³é¯·é¯¸"], +["8feba1","鯹鯺鯽鯿é°é°é°é°é°é°é°é°é°é°é°é°¢é°£é°¦",4,"鰱鰵鰶鰷鰽é±é±é±é± é±é±é±é±é±é±é±é±é±é±é±é±é±é±£é±©é±ªé±é±«é±¨é±®é±°é±²é±µé±·é±»é³¦é³²é³·é³¹é´é´é´é´é´é´é´é´é´¯é´°é´²é´³é´´é´ºé´¼éµ é´½éµéµéµéµéµéµéµéµ£éµ¢éµ¥éµ©éµªéµ«éµ°éµ¶éµ·éµ»"], +["8feca1","鵼鵾é¶é¶é¶é¶é¶é¶é¶é¶é¶é¶é¶é¶é¶¡é¶ªé¶¬é¶®é¶±é¶µé¶¹é¶¼é¶¿é·é·é·é·é·é·é·é·é·é·é·é· 鷥鷧鷩鷫鷮鷰鷳鷴鷾é¸é¸é¸é¸é¸é¸é¸é¸é¸é¸é¸é¸é¹ºé¹»é¹¼éºéºéºéºéº éºéºéºéºéºéºéºéº¤éº¨éº¬éº®éº¯éº°éº³éº´éºµé»é»é»é»é»é»¤é»§é»¬é»é»®é»°é»±é»²é»µ"], +["8feda1","黸黿é¼é¼é¼é¼é¼é¼é¼é¼é¼é¼é¼é¼é¼é¼é¼¢é¼¦é¼ªé¼«é¼¯é¼±é¼²é¼´é¼·é¼¹é¼ºé¼¼é¼½é¼¿é½é½",4,"é½é½é½é½é½é½é½é½é½¨é½©é½",4,"齳齵齺齽é¾é¾é¾é¾é¾é¾é¾é¾é¾¡é¾¢é¾£é¾¥"] +] diff --git a/node_modules/iconv-lite/encodings/tables/gb18030-ranges.json b/node_modules/iconv-lite/encodings/tables/gb18030-ranges.json new file mode 100644 index 0000000..85c6934 --- /dev/null +++ b/node_modules/iconv-lite/encodings/tables/gb18030-ranges.json @@ -0,0 +1 @@ +{"uChars":[128,165,169,178,184,216,226,235,238,244,248,251,253,258,276,284,300,325,329,334,364,463,465,467,469,471,473,475,477,506,594,610,712,716,730,930,938,962,970,1026,1104,1106,8209,8215,8218,8222,8231,8241,8244,8246,8252,8365,8452,8454,8458,8471,8482,8556,8570,8596,8602,8713,8720,8722,8726,8731,8737,8740,8742,8748,8751,8760,8766,8777,8781,8787,8802,8808,8816,8854,8858,8870,8896,8979,9322,9372,9548,9588,9616,9622,9634,9652,9662,9672,9676,9680,9702,9735,9738,9793,9795,11906,11909,11913,11917,11928,11944,11947,11951,11956,11960,11964,11979,12284,12292,12312,12319,12330,12351,12436,12447,12535,12543,12586,12842,12850,12964,13200,13215,13218,13253,13263,13267,13270,13384,13428,13727,13839,13851,14617,14703,14801,14816,14964,15183,15471,15585,16471,16736,17208,17325,17330,17374,17623,17997,18018,18212,18218,18301,18318,18760,18811,18814,18820,18823,18844,18848,18872,19576,19620,19738,19887,40870,59244,59336,59367,59413,59417,59423,59431,59437,59443,59452,59460,59478,59493,63789,63866,63894,63976,63986,64016,64018,64021,64025,64034,64037,64042,65074,65093,65107,65112,65127,65132,65375,65510,65536],"gbChars":[0,36,38,45,50,81,89,95,96,100,103,104,105,109,126,133,148,172,175,179,208,306,307,308,309,310,311,312,313,341,428,443,544,545,558,741,742,749,750,805,819,820,7922,7924,7925,7927,7934,7943,7944,7945,7950,8062,8148,8149,8152,8164,8174,8236,8240,8262,8264,8374,8380,8381,8384,8388,8390,8392,8393,8394,8396,8401,8406,8416,8419,8424,8437,8439,8445,8482,8485,8496,8521,8603,8936,8946,9046,9050,9063,9066,9076,9092,9100,9108,9111,9113,9131,9162,9164,9218,9219,11329,11331,11334,11336,11346,11361,11363,11366,11370,11372,11375,11389,11682,11686,11687,11692,11694,11714,11716,11723,11725,11730,11736,11982,11989,12102,12336,12348,12350,12384,12393,12395,12397,12510,12553,12851,12962,12973,13738,13823,13919,13933,14080,14298,14585,14698,15583,15847,16318,16434,16438,16481,16729,17102,17122,17315,17320,17402,17418,17859,17909,17911,17915,17916,17936,17939,17961,18664,18703,18814,18962,19043,33469,33470,33471,33484,33485,33490,33497,33501,33505,33513,33520,33536,33550,37845,37921,37948,38029,38038,38064,38065,38066,38069,38075,38076,38078,39108,39109,39113,39114,39115,39116,39265,39394,189000]} \ No newline at end of file diff --git a/node_modules/iconv-lite/encodings/tables/gbk-added.json b/node_modules/iconv-lite/encodings/tables/gbk-added.json new file mode 100644 index 0000000..8abfa9f --- /dev/null +++ b/node_modules/iconv-lite/encodings/tables/gbk-added.json @@ -0,0 +1,55 @@ +[ +["a140","î",62], +["a180","î ",32], +["a240","î¦",62], +["a280","î¥",32], +["a2ab","î¦",5], +["a2e3","â¬î"], +["a2ef","î®î¯"], +["a2fd","î°î±"], +["a340","î",62], +["a380","î ",31,"ã"], +["a440","î¦",62], +["a480","î¥",32], +["a4f4","î²",10], +["a540","î",62], +["a580","î ",32], +["a5f7","î½",7], +["a640","î¦",62], +["a680","î¥",32], +["a6b9","î ",7], +["a6d9","î",6], +["a6ec","îî"], +["a6f3","î"], +["a6f6","î",8], +["a740","î",62], +["a780","î ",32], +["a7c2","î ",14], +["a7f2","î¯",12], +["a896","î¼",10], +["a8bc","î"], +["a8bf","ǹ"], +["a8c1","îîîî"], +["a8ea","î",20], +["a958","î¢"], +["a95b","î£"], +["a95d","î¤î¥î¦"], +["a989","ã¾â¿°",11], +["a997","î´",12], +["a9f0","î ",14], +["aaa1","î",93], +["aba1","î",93], +["aca1","î¼",93], +["ada1","î",93], +["aea1","î ¸",93], +["afa1","î",93], +["d7fa","î ",4], +["f8a1","î´",93], +["f9a1","î",93], +["faa1","î°",93], +["fba1","î",93], +["fca1","î¬",93], +["fda1","î",93], +["fe50","âºî î î âºã³ãâºâºî ãããâºâºã¥®ã¤î ¦ã§ã§ã©³ã§î «î ¬ãã±®ã³ âº§î ±î ²âºªää ⺮ä·âº³âº¶âº·î »ä±ä¬âº»äää¡äî¡"], +["fe80","ä£ä©ä¼äâ»ä¥ä¥ºä¥½ä¦ä¦ä¦ ä¦ä¦ä¦ä¦·ä¦¶î¡î¡ä²£ä²ä² 䲡䱷䲢ä´",6,"䶮î¨",93] +] diff --git a/node_modules/iconv-lite/encodings/tables/shiftjis.json b/node_modules/iconv-lite/encodings/tables/shiftjis.json new file mode 100644 index 0000000..5a3a43c --- /dev/null +++ b/node_modules/iconv-lite/encodings/tables/shiftjis.json @@ -0,0 +1,125 @@ +[ +["0","\u0000",128], +["a1","。",62], +["8140","ãããï¼ï¼ã»ï¼ï¼ï¼ï¼ãã´ï½Â¨ï¼¾ï¿£ï¼¿ã½ã¾ãããä»ã ããã¼ââï¼ï¼¼ï½â¥ï½â¦â¥ââââï¼ï¼ãã[]ï½ï½ã",9,"ï¼ï¼Â±Ã"], +["8180","÷ï¼â ï¼ï¼â¦â§ââ´ââ°â²â³âï¿¥ï¼ï¿ ï¿¡ï¼ ï¼ï¼ï¼ï¼ §ââ ââââââ¡â â³â²â½â¼â»ãââââã"], +["81b8","âââââââªâ©"], +["81c8","â§â¨ï¿¢ââââ"], +["81da","â â¥ââââ¡ââªâ«ââ½ââµâ«â¬"], +["81f0","â«â°â¯ââªâ â¡Â¶"], +["81fc","â¯"], +["824f","ï¼",9], +["8260","A",25], +["8281","ï½",25], +["829f","ã",82], +["8340","ã¡",62], +["8380","ã ",22], +["839f","Î",16,"Σ",6], +["83bf","α",16,"Ï",6], +["8440","Ð",5,"ÐÐ",25], +["8470","а",5,"Ñж",7], +["8480","о",17], +["849f","ââââââââ¬â¤â´â¼âââââââ£â³â«â»ââ â¯â¨â·â¿ââ°â¥â¸â"], +["8740","â ",19,"â ",9], +["875f","ããã¢ããã§ãã¶ãããã¦ã£ã«ãã»ããããããã¡"], +["877e","ã»"], +["8780","ããâãâ¡ã¤",4,"ã±ã²ã¹ã¾ã½ã¼ââ¡â«â®âââ¥â ââ¿âµâ©âª"], +["889f","äºåå¨é¿åææ¨å§¶é¢èµèç©æªæ¡æ¸¥æè¦è¦é¯µæ¢å§æ¡æ±å®å§è»é£´çµ¢ç¶¾é®æç²è¢·å®åºµæææ¡ééæ以ä¼ä½ä¾åå²å¤·å§å¨å°æææ °ææ¤ çºçç°ç§»ç¶ç·¯èèè¡£è¬ééºå»äºäº¥åè²é磯ä¸å£±æº¢é¸ç¨²è¨èé°¯å å°å½å¡å 姻å¼é£²æ·«è¤è"], +["8940","é¢é°é é»åå³å®çç¾½è¿é¨å¯éµçªºä¸ç¢è¼æ¸¦ååæ¬è鰻姥å©æµ¦çéåäºéé²èé¤å¡å¶å¬°å½±æ æ³æ 永泳洩ççç©é ´è±è¡è© é液ç«çé§ æ¦è¬è¶é²æ¦åå"], +["8980","åå °å¥å®´å»¶æ¨æ©æ´æ²¿æ¼ççç çç¿ç¸è¶èèé éé´å¡©æ¼æ±ç¥å¹å¤®å¥¥å¾å¿æ¼æºæ¨ªæ¬§æ®´çç¿è¥é´¬é´é»å²¡æ²è»åå±æ¶è桶ç¡ä¹ä¿ºå¸æ©æ¸©ç©é³ä¸åä»®ä½ä¼½ä¾¡ä½³å å¯åå¤å«å®¶å¯¡ç§æææ¶ææ²³ç«çç¦ç¦¾ç¨¼ç®è±èèè·è¯èè¦èª²å©è²¨è¿¦ééèä¿å³¨æçç»è¥è½è¾è³é é¤é§ä»ä¼è§£åå¡å£å»»å¿«æªææ¢ææææ¹"], +["8a40","éæ¦æ¢°æµ·ç°çççµµè¥è¹ééè²å±å¾å¤å³å®³å´æ ¨æ¦æ¶¯ç¢èè¡è©²é§éª¸æµ¬é¦¨èå£æ¿èéåååå»æ¡æ¹æ ¼æ ¸æ®»ç²ç¢ºç©«è¦è§èµ«è¼éé£éé©å¦å²³æ¥½é¡é¡æç¬ æ¨«"], +["8a80","橿梶é°æ½å²åæ°æ¬æ´»æ¸æ»èè¤è½ä¸é°¹å¶æ¤æ¨ºéæ ªå ç«è²ééåé´¨æ ¢è è±ç²¥åè ç¦ä¹¾ä¾å å¯ååå§å·»åå ªå§¦å®å®å¯å¹²å¹¹æ£ææ £æ¾ææ¢ææ¡æ£ºæ¬¾ææ±æ¼¢æ¾æ½ ç°çç£ç竿管簡緩缶翰èè¦è観è«è²«ééééé¢é¥é館è丸å«å²¸å·ç©çç¼å²©ç¿«è´éé é¡é¡ä¼ä¼å±åå¨åºå¥å¬å¯å²å¸å¹¾å¿æ®æºææ¢ææ£æ£"], +["8b40","æ©å¸°æ¯ æ°æ±½ç¿ç¥å£ç¨ç´å¾½è¦è¨è²´èµ·è»è¼é£¢é¨é¬¼äºå½åå¦å®æ¯ææ¬æ¬ºç çç¥ç¾©è»èª¼è°æ¬èé ååå«æ¡æ©è©°ç §æµé»å´å®¢èèéä¸ä¹ ä»ä¼åå¸å®®å¼æ¥æ"], +["8b80","æ½æ±æ±²æ³£ç¸ç究窮ç¬ç´ç³¾çµ¦æ§çå»å± å·¨ææ ææ¸ è許è·é¸æ¼ç¦¦é亨享京ä¾ä¾ åå ç«¶å ±å¶åå¡å¿å«å¬å¢å³¡å¼·å½æ¯æææææ©æ³ççç¯è¸è èèé·é¡é¿é¥é©ä»°åå°ææ¥å±æ²æ¥µçæ¡ç²å å¤åå·¾é¦æ¤æ¬£æ¬½ç´ç¦ç¦½çç·è¹èè¡¿è¥è¬¹è¿éåéä¹å¶å¥åºççç©è¦èº¯é§é§é§å ·æèå°ç©ºå¶å¯éé 串æ«é§å±å±"], +["8c40","æçªæ²é´è½¡çªªçéç²æ ç¹°æ¡é¬å²åè«è¨ç¾¤è»é¡å¦è¢ç¥ä¿å¾åå ååçªåå¥å½¢å¾æµæ ¶æ §æ©æ²æºæ¬æ¯æ¡æ¸ç¦ç¨½ç³»çµç¶ç¹ç½«èèèè¨è©£è¦è»½é é¶è¸è¿é¯¨"], +["8c80","åæææ¿éæ¡åæ¬ æ±ºæ½ç©´çµè¡è¨£æ件å¹å¦å¥å ¼å¸å£å§åå å«å»ºæ²æ¸æ³æ²æ¤æ¨©ç½ç¬ç®ç 硯絹çè©è¦è¬è³¢è»é£éµéºé¡é¨é¹¸å åå³å¹»å¼¦æ¸æºçç¾çµè·è¨è«ºéä¹åå¤å¼åºå§å¤å·±åº«å¼§æ¸æ æ¯æ¹çç³è¢´è¡è¡è°èèªè·¨é·é顧é¼äºäºä¼ååå¾å¨¯å¾å¾¡æ梧æªçç¢èªèª¤è·éä¹é¯äº¤ä½¼ä¾¯ååå å ¬åå¹å¾åå£å"], +["8d40","åååå¢å¥½ååå®å·¥å·§å··å¹¸åºåºåº·å¼ææ æææ§æ»æææ´ææ ¡æ¢æ§æ±æ´ªæµ©æ¸¯æºç²çç¡¬ç¨¿ç³ ç´ ç´çµç¶±èèè¯è±è èèªèè¡è¡¡è¬è²¢è³¼éé µé±ç ¿é¼é¤é"], +["8d80","é é¦é«é´»åå«å·åå£æ·æ¿ 豪è½éº¹å å»åå½ç©é ·éµ é»çæ¼è °ç忽æ骨çè¾¼æ¤é ä»å°å¤å¢¾å©æ¨ææææ ¹æ¢±æ··çç´ºè®éäºä½åå嵯左差æ»æ²ç³ç è©éè£å座æ«åµå¬åæåå¡å¦»å®°å½©ææ¡æ ½æ³æ¸ç½éçç ç ¦ç¥æç´°èè£è¼éå¤å¨æ罪財å´åéªå ºæ¦è´å²å´å¼ç¢é·ºä½ååæ¾æ¨ææµçªçç´¢é¯æ¡é®ç¬¹ååå·"], +["8e40","å¯æ¶æ®æ¦æ殺è©éçé¯æé鮫ç¿æä¸ååå±±æ¨ææ£æ¡ç¦çç£ç®çºèè®è³é ¸é¤æ¬æ«æ®ä»ä»ä¼ºä½¿åºå¸å²å£å士å§å§å§¿åå±å¸å¸«å¿æææ¯åæ¯æ½æ¨ææ¢"], +["8e80","æ»æ°ç ç¥ç§ç³¸ç´ç´«è¢èè³è¦è©è©©è©¦èªè«®è³è³é飼æ¯äºä¼¼ä¾å å寺æ ææ次æ»æ²»ç¾ç½çç£ç¤ºèè³èªèè¾æ±é¹¿å¼è鴫竺軸å®é«ä¸å±å·å¤±å«å®¤æ湿æ¼ç¾è³ªå®èç¯ å²æ´è屡èç¸èåå°æ¨èµ¦æç ®ç¤¾ç´è è¬è»é®èéªååºå°ºæç¼çµé éé«è¥å¯å¼±æ¹ä¸»åå®ææ±æ®ç©ç ç¨®è «è¶£é é¦åååªå¯¿æ樹綬éååå¨"], +["8f40","å®å°±å·ä¿®ææ¾æ´²ç§ç§çµç¹ç¿èèèè¡è¥²è®è¹´è¼¯é±é é ¬ééä»ä½å åå¾æææ±æ¸ç£ç¸¦ééåå¤å®¿æ·ç¥ç¸®ç²å¡¾çåºè¡è¿°ä¿å³»æ¥ç¬ç«£è駿å循æ¬æ¥¯æ®æ·³"], +["8f80","æºæ½¤ç¾ç´å·¡éµéé å¦åææææ¸åº¶ç·ç½²æ¸è¯è·è«¸å©å女åºå¾æé¤é¤å·ååå åå¬å¨åå±å奨妾娼宵å°å°å°å°åºåºå» å½°æ¿ææææ·ææææ¶æ¾æ¢¢æ¨æ¨µæ²¼æ¶æ¸æ¹ç¼ç¦ç §ççç¡ç¤ç¥¥ç§°ç« ç¬ç²§ç´¹èèèèè¡è£³è¨è¨¼è©è©³è±¡è³é¤é¦é¾éééä¸ä¸ä¸ä¹åå°åå ´å£å¬¢å¸¸æ æ¾æ¡ææµç¶ç³ç©£è¸è²é¸é å±å´é£¾"], +["9040","ææ¤æ®çç¹è·è²è§¦é£è辱尻伸信侵åå¨ å¯å¯©å¿æ æ¯æ°æ森æ¦æµ¸æ·±ç³ç¹çç¥ç§¦ç´³è£è¯èªè¦ªè¨ºèº«è¾é²éé人ä»å塵壬å°çå°½è è¨è¿ é£é笥è«é é ¢å³å¨"], +["9080","éå¹å帥æ¨æ°´çç¡ç²ç¿ è¡°éé éééçé«å´åµ©æ°æ¢è¶¨éæ®ææ¤è é é裾æ¾æºå¯¸ä¸ç¬çæ¯åå¶å¢å§å¾æ§ææ¿æ´ææ´æ£²æ æ£æ¸ ç²ççç²¾èå£°è£½è¥¿èª èªè«ééééæç¨èé»å¸æææ¥ææç³ç©ç±ç¸¾è責赤跡è¹ç¢©åææ¥ææè¨çªç¯èª¬éªçµ¶èèä»å åå 宣å°å°å·æ¦ææ°æ æ ´æ³æµ æ´ææ½ç ç ½æç©¿ç®ç·"], +["9140","ç¹ç¾¨è ºèè¹è¦è©®è³è·µé¸é·éééé®®åå漸ç¶å ¨ç¦ ç¹è³ç³åå¡å²¨æªæ¾æ½æ¥çççç¤ç¥ç§ç²ç´ çµè訴é»é¡é¼ å§åµåå¢ååªå£®å¥ç½å®å±¤åæ£æ³æææ¿æ»"], +["9180","ææ©æ¹å·£æ§æ§½æ¼ç¥äºç©ç¸çªç³ç·ç¶è¡èèè¬è¼è»è£ èµ°ééééé¨åå¢æèèµè´é ä¿å´åå³æ¯ææ測足éä¿å±è³æç¶åè¢å ¶æåå«å°ææéä»å¤å¤ªæ±°è©å¾å 妥æ°ææèµæ¥éé§é¨¨ä½å 対èå²±å¸¯å¾ æ æ æ´æ¿æ³°æ»èè ¿èè¢è²¸éé®éé»é¯ä»£å°å¤§ç¬¬éé¡é·¹æ»ç§ååå® æææ沢濯ç¢è¨é¸æ¿è«¾è¸å§è¸åª"], +["9240","å©ä½é辰奪è±å·½ç«ªè¾¿æ£è°·ç¸é±æ¨½èª°ä¸¹ååå¦æ æ¢æ¦ææ·¡æ¹çç端箪綻è½èèèªéå£å£å¼¾æææªæ®µç·è«å¤ç¥å°å¼æ¥æºæ± ç´ç¨ç½®è´èé 馳ç¯ç竹çè"], +["9280","é秩çªè¶å«¡çä¸ä»²å®å¿ æ½æ¼æ±æ³¨è«è¡·è¨»é é³é§æ¨ç¦çªè§è貯ä¸å åå寵å¸å¸³åºå¼å¼µå½«å¾´æ²ææ¢ææ½®ççºçºè´è¹è ¸è¶èª¿è«è¶ è·³éé·é é³¥å æç´ææ²çè³é®é³æ´¥å¢æ¤æ§è¿½éçéå¡æ æ´æ§»ä½æ¼¬æè¾»è¦ç¶´é椿潰åªå£·å¬¬ç´¬çªåé£é¶´äºä½ååµåè²åå ¤å®å¸åºåºå»·å¼ææµæºæ梯æ±ç¢ç¦ç¨ç· èè¨è«¦è¹é"], +["9340","é¸ééé¼æ³¥ææ¢æµæ»´çç¬é©é溺å²å¾¹æ¤è½è¿éå ¸å¡«å¤©å±åºæ·»çºç貼転é¡ç¹ä¼æ®¿æ¾±ç°é»å åå µå¡å¦¬å± å¾ææ渡ç»èè³éé½éç ¥ç ºåªåº¦å奴æåå å¬"], +["9380","åååå¡å¡å¥å®å³¶å¶æ¼æææ±æ¡æ¢¼æ£çæ·æ¹¯æ¶ç¯çå½ç祷çççç³çµ±å°è£è©è¤è¨è¬è±è¸éééé¶é 騰éåååå å°æ§ææ´ç³ç«¥è´èéé å³ é´å¿å¾å¾³æ¶ç¹ç£ç¦¿ç¯¤æ¯ç¬èªæ æ©¡å¸çªæ¤´å±é³¶è«å¯ é çå¸å±¯ææ¦æ²è±éé åæéå¥é£å ä¹åªèè¬çæºé楢馴ç¸ç·åæ¥ è»é£æ±äºå°¼å¼è¿©åè³èè¹å»¿æ¥ä¹³å ¥"], +["9440","å¦å°¿é®ä»»å¦å¿èªæ¿¡ç¦°ç¥¢å¯§è±ç«ç±å¹´å¿µæ»æçç²ä¹å»¼ä¹åå¢æ©æ¿ç´è½è³è¿è¾²è¦è¤å·´ææè¦æ·æ³¢æ´¾ç¶ç ´å©ç½µè馬俳å»ææææ¯ççèèºè¼©é åå¹åªæ¢ "], +["9480","æ¥³ç ¤ç½è²·å£²è³ éªéè¿ç§¤ç§è©ä¼¯å¥åæææ³ç½ç®ç²è¶èè¿«ææ¼ çç¸è«é§éº¦å½ç®±ç¡²ç®¸èç櫨幡èçç å «é¢æºçºé髪ä¼ç½°æçé¥é³©åºå¡è¤é¼ä¼´å¤åååå¸æ¬ææ¿æ°¾æ±çç¯ççç¹è¬è©è²©ç¯éç ©é 飯æ½æ©çªç¤ç£èè®åªåå¦å¦åºå½¼æ²ææ¹æ«ææ¯æ³ç²ç®ç¢ç§ç·ç½·è¥è¢«èª¹è²»é¿éé£æ¨ç°¸å尾微ææ¯çµçç¾"], +["9540","é¼»æç¨å¹çé«å½¦èè±èå¼¼å¿ ç¢çé¼æ¡§å§«åªç´ç¾è¬¬ä¿µå½ªæ¨æ°·æ¼ç¢ç¥¨è¡¨è©è±¹å»æç ç§èé¨é²èèé°å彬ææµç貧è³é »æç¶ä¸ä»å 夫婦å¯å¨å¸åºææ¶æ·"], +["9580","æ§æ®æµ®ç¶ç¬¦è èèèè² è³¦èµ´ééä¾®æ«æ¦èè¡èªé¨å°æ¥é¢¨èºèä¼å¯å¾©å¹ æç¦è ¹è¤è¦æ·µå¼æ沸ä»ç©é®åå»å´å¢³æ¤æ®ç奮ç²ç³ç´é°æèä¸ä½µå µå¡å¹£å¹³å¼æ並è½ééç±³é å»å£ç碧å¥ç¥èç®åå¤çç¯ç·¨è¾ºè¿é便å娩å¼éä¿èéªåææ©ç«è£è¼ç©åå¢æ ææ®æ¯ç°¿è©å£ä¿¸å åå ±å¥å®å³°å³¯å´©åºæ±æ§æ¾æ¹æ"], +["9640","æ³æ³¡ç¹ç ²ç¸«èè³èè¬èè¤è¨ªè±é¦é飽鳳鵬ä¹äº¡ååå妨帽å¿å¿æ¿æ´æææ£åç´¡èªè¨è¬è²è²¿é¾é²å é ¬ååå墨æ²æ´ç§ç¦ç©é¦å没æ®å å¹å¥æ¬ç¿»å¡ç"], +["9680","æ©ç£¨é麻å妹æ§ææ¯å©æ§å¹èæ鮪æ¾é±æ¡äº¦ä¿£åæ¹æ«æ²«è¿ä¾ç¹éº¿ä¸æ ¢æºæ¼«èå³æªé å·³ç®å²¬å¯èæ¹èç¨èå¦ç²æ°ç å夢ç¡ççé§éµ¡æ¤å©¿å¨å¥åå½æçè¿·é鳴姪çæ» å æ£ç¶¿ç·¬é¢éººæ¸æ¨¡èå¦åæ¯çç²ç¶²èèå²æ¨é»ç®æ¢å¿é¤ å°¤æ»ç±¾è²°åæ¶ç´éåä¹å¶å¤çºè¶éå¼¥ç¢åå½¹ç´è¬è¨³èºéæ³è®éæææ²¹ç"], +["9740","è«è¼¸å¯ä½åªåå宥幽æ ææææ湧æ¶ç¶ç·ç±ç¥è£èªéééµéèå¤äºä½ä¸èªè¼¿é åå¹¼å¦å®¹åº¸ææºæææ¥æ§æ´æº¶çç¨çª¯ç¾èèèè¦è¬¡è¸é¥é½é¤æ ¾æ欲"], +["9780","æ²æµ´ç¿ç¿¼æ·ç¾ èºè£¸æ¥è±é ¼é·æ´çµ¡è½é ªä¹±åµåµæ¬æ¿«èè覧å©åå±¥æ梨ççç¢è£è£¡éé¢é¸å¾çç«èæ ç¥åæµæºççç¡«ç²éç«é¾ä¾¶æ ®æ èäºäº®å両å寮ææ¢æ¶¼çççç¨ç³§è¯è«é¼ééµé åç·å«åææ·çç³è¨è¼ªé£é±éºç å¡æ¶ç´¯é¡ä»¤ä¼¶ä¾å·å±å¶ºæç²ç¤¼èé´é·é¶ééºé½¢æ¦æ´åå£çè£å»æææ¼£ç 簾練è¯"], +["9840","è®é£é¬åé¯æ«çè³è·¯é²å´å©å»å¼æ楼æ¦æµªæ¼ç¢ç¼ç¯èè¾èéå éºç¦èé²è«åå話æªè³èææ é·²äºäºé°è©«èè¨æ¤æ¹¾ç¢è "], +["989f","å¼ä¸ä¸ä¸ªä¸±ä¸¶ä¸¼ä¸¿ä¹ä¹ä¹äºäº 豫äºèå¼äºäºäºäº 亢亰亳亶ä»ä»ä»ä»ä»ä»ä»ä»ä»ä»·ä¼ä½ä¼°ä½ä½ä½ä½ä½¶ä¾ä¾ä¾ä½»ä½©ä½°ä¾ä½¯ä¾ä¾åä¿ä¿ä¿ä¿ä¿ä¿ä¿ä¿ä¿¤ä¿¥åå¨ååªå¥å ä¼ä¿¶å¡å©å¬ä¿¾ä¿¯ååååæåååååå¬å¸ååå å´å²"], +["9940","ååå³åååå¥åå£å®å¹åµåååååååå¡åºå·å¼å»å¿å å å å å ¢ç«¸å ©å ªå ®ååååååååååå¤å¦å¢å©åªå«å³å±å²å°åµå½å ååå èå©å"], +["9980","å°åµå¾ååååå§åªå®å³å¹åååååååªå´å©å³å¿å½åååå±åå辨辧å¬åå¼åµååååå£å¦é£å å³åµå¸å¹ååç¸åååååå£å¯å±å³å¸ååå ä¸ååååå©å®å¤å»å·ååå å¦å¥å®å°å¶åç°éåæ¼ç®å®å¨ååºåå½åå¬åå¼å®å¶å©ååååµååå±å·å°åå»åå¶ååååå¢å¸å¥å¬ååå¨"], +["9a40","å«åå¤å¾å¼åå¥å¦ååå½å®ååºå¢å¹åå£åå®åå ååå¸å³åååå¯ååå»å¾ååå®å¼åå©åå¨åå åååå¤ååå·åå¾å½åå¹ååçå´å¶å²å¸"], +["9a80","å«å¤å¯å¬åªåååå ååå¥å®å¶å´åå¼ååååååååå®å¹åå¿ååååååååååå¦å·å¸åå»ååå©ååå¡å¿ååå å³å¤åªå°åååååå åå£å å å å¡²å ¡å¡¢å¡å¡°æ¯å¡å ½å¡¹å¢ 墹å¢å¢«å¢ºå£å¢»å¢¸å¢®å£ å£å£å£å£å£å£¥å£å£¤å£å£¯å£ºå£¹å£»å£¼å£½å¤å¤å¤å¤æ¢¦å¤¥å¤¬å¤å¤²å¤¸å¤¾ç«å¥å¥å¥å¥å¥å¥¢å¥ 奧奬奩"], +["9b40","奸å¦å¦ä½ä¾«å¦£å¦²å§å§¨å§å¦å§å§å¨¥å¨å¨å¨å¨å¨å©å©¬å©å¨µå¨¶å©¢å©ªåªåª¼åª¾å«å«åª½å«£å«å«¦å«©å«å«ºå«»å¬å¬å¬å¬²å«å¬ªå¬¶å¬¾åå åååååå¥å©å°å³åµå¸æåºå®"], +["9b80","å®å®¦å®¸å¯å¯å¯å¯å¯å¯¤å¯¦å¯¢å¯å¯¥å¯«å¯°å¯¶å¯³å° å°å°å°å°å° 尢尨尸尹å±å±å±å±å±å±å±å±¬å±®ä¹¢å±¶å±¹å²å²å²å¦å²«å²»å²¶å²¼å²·å³ å²¾å³å³å³©å³½å³ºå³å¶å³ªå´å´å´åµå´å´å´å´å´¢å´å´å´åµåµåµåµåµ¬åµ³åµ¶å¶å¶å¶å¶¢å¶å¶¬å¶®å¶½å¶å¶·å¶¼å·å·å·å·å·å·å·«å·²å·µå¸å¸å¸å¸å¸å¸¶å¸·å¹å¹å¹å¹å¹å¹å¹å¹¢å¹¤å¹å¹µå¹¶å¹ºéº¼å¹¿åº å»å»å»å»å»"], +["9c40","å»å»£å»å»å»å»¢å»¡å»¨å»©å»¬å»±å»³å»°å»´å»¸å»¾å¼å¼å½å½å¼å¼å¼å¼©å¼å¼¸å½å½å½å½å¼¯å½å½å½å½å½¡å½å½³å½·å¾å¾å½¿å¾å¾å¾å¾å¾å¾å¾å¾ 徨å¾å¾¼å¿å¿»å¿¤å¿¸å¿±å¿æ³å¿¿æ¡æ "], +["9c80","æææ©ææ±æææ«æ¦ææºæææªæ·æææææ£ææ¤ææ¬æ«ææææ§ææææææææ§ææ¡æ¸æ ææ´å¿°æ½ææµææ æææ¶æ·ææ´æºææ¡æ»æ±æææ æ¾æ¨æ§æ æ¿æ¼æ¬æ´æ½æ æ æ ³æ ·æ æ æ æ «æ ´æ ¯æ ¥æ ±æ æ æ æ µææææ¬æææææ«æ®ææææ·ææææºæç½¹ææ¦æ£æ¶æºæ´æ¿æ½æ¼æ¾æææææææ"], +["9d40","ææ¡æªæ®æ°æ²æ³ææææ£ææ æ¨æ¼æææ¾æææææææææ»ææ¿ææææææææææææ®æ±æ§æææ¯æµææ¾æææææææ«æ¶æ£ææææµæ«"], +["9d80","æ©æ¾æ©æææ£æææ¶æææ´æææ¦æ¶æææ¨ææ§æ¯æ¶ææªæææ¥æ©ææ¼æææ ææ»æææ±æ§èæ æ¡æ¬æ£æ¯æ¬æ¶æ´æ²æºææ½æææ æ¤æ£æ«æ´æµæ·æ¶æ¸çææææææææ²æ¸ææè®æææ«æ·æææææææææ æ¡æ±æ²æææ»æ³æµæ¶æ´ææææææææ¤æ§æ¨ææ¢æ°æææææææææ¹ææ¾æ¼"], +["9e40","ææ¸æææ æ¿æ¦æ©æ°æµæ·ææææ¦æ§é¸æ®æ¿æ¶ææ¸æ·æææ ææ£æ¤ææ°æ©æ¼æªæææ¦æ¡æ æ·æ¯æ´æ¬æ³æ©æ¸æ¤æææ¢æ®æ¹æææ§æªæ æ¡æ ©æ¡æ¡æ ²æ¡"], +["9e80","æ¢³æ «æ¡æ¡£æ¡·æ¡¿æ¢æ¢æ¢æ¢æ¢æ¢æ¢æª®æ¢¹æ¡´æ¢µæ¢ 梺æ¤æ¢æ¡¾æ¤æ£æ¤æ£æ¤¢æ¤¦æ£¡æ¤æ£æ£æ£§æ£æ¤¶æ¤æ¤æ£æ££æ¤¥æ£¹æ£ 棯椨椪æ¤æ¤£æ¤¡æ£æ¥¹æ¥·æ¥æ¥¸æ¥«æ¥æ¥¾æ¥®æ¤¹æ¥´æ¤½æ¥æ¤°æ¥¡æ¥æ¥æ¦æ¥ªæ¦²æ¦®æ§æ¦¿æ§æ§æ¦¾æ§å¯¨æ§æ§æ¦»æ§æ¦§æ¨®æ¦æ¦ æ¦æ¦æ¦´æ§æ§¨æ¨æ¨æ§¿æ¬æ§¹æ§²æ§§æ¨ 榱æ¨æ§æ¨æ§«æ¨æ¨æ«æ¨£æ¨æ©æ¨æ©²æ¨¶æ©¸æ©æ©¢æ©æ©¦æ©æ¨¸æ¨¢æªæªæª æªæª¢æª£"], +["9f40","æªè檻æ«æ«æª¸æª³æª¬æ«æ«æ«æªªæ«æ«ªæ«»æ¬ è櫺æ¬æ¬é¬±æ¬æ¬¸æ¬·ç欹飮æææææææææ¡æ¸æ¹æ¿æ®æ®æ®æ®æ®æ®æ®æ®¤æ®ªæ®«æ®¯æ®²æ®±æ®³æ®·æ®¼æ¯æ¯æ¯æ¯æ¯¬æ¯«æ¯³æ¯¯"], +["9f80","麾æ°æ°æ°æ°æ°¤æ°£æ±æ±æ±¢æ±ªæ²æ²æ²æ²æ²æ±¾æ±¨æ±³æ²æ²æ³æ³±æ³æ²½æ³æ³ æ³æ²®æ²±æ²¾æ²ºæ³æ³¯æ³æ³ªæ´è¡æ´¶æ´«æ´½æ´¸æ´æ´µæ´³æ´æ´æµ£æ¶æµ¤æµæµ¹æµæ¶æ¶æ¿¤æ¶ æ·¹æ¸æ¸æ¶µæ·æ·¦æ¶¸æ·æ·¬æ·æ·æ·¨æ·æ· æ·ºæ·æ·¤æ·æ·ªæ·®æ¸æ¹®æ¸®æ¸æ¹²æ¹æ¸¾æ¸£æ¹«æ¸«æ¹¶æ¹æ¸æ¹æ¸ºæ¹æ¸¤æ»¿æ¸æ¸¸æºæºªæºæ»æº·æ»æº½æº¯æ»æº²æ»æ»æºæº¥æ»æºæ½æ¼ç滬滸滾漿滲漱滯漲æ»"], +["e040","æ¼¾æ¼æ»·æ¾æ½ºæ½¸æ¾æ¾æ½¯æ½æ¿³æ½æ¾æ½¼æ½æ¾æ¾æ¿æ½¦æ¾³æ¾£æ¾¡æ¾¤æ¾¹æ¿æ¾ªæ¿æ¿æ¿¬æ¿æ¿æ¿±æ¿®æ¿çç濺ççç濾ççæ½´çççç°ç¾ç²çç£ççç¯ç±ç¬ç¸ç³ç®ççç"], +["e080","ççç½ççç ¥ç çç ¦ç ¢ç ç ç ¬çç»ççç¨ç¬çç¹ç¾ççççç ç¬ç§çµç¼ç¹ç¿çççç¨çç¬ç°ç²ç»ç¼ç¿ççççç´ç¾çççççç¢ç§ç¹ç²çççççç¢ç ç¡ç¹ç·åçççççç´ç¯ç©ç¥ç¾ççé»ççªç¨ç°ç¸çµç»çºçç³çç»çç¥ç®çç¢ç ç¯ç¥ç¸ç²çºçç¿ççççç©ç°ç£çªç¶ç¾ççç§çççç±"], +["e140","ç ç£ç§ç©ç®ç²ç°ç±ç¸ç·ççç ççççççç¦ç¬ç¼çççççççç©ç¤ç§ç«çç¸ç¶ççç´ççççççç¥ç£çç³ççµç½ç¸ç¼ç±ççççç£çç¾ç¿"], +["e180","ç¼çç°çºç²ç³ççççç§ç ç¡ç¢ç¤ç´ç°ç»çççççç¡ç¢ç¨ç©çªç§ç¬ç°ç²ç¶ç¸ç¼çççççççççç°ç´ç¸ç¹çºçççççç¡ç¥ç§çªè¯ç»çççç©ç¤çç¥ç¦çç·ç¸ççç¨ç«çç¥ç¿ç¾ç¹çççç çç°ç¶ç¹ç¿ç¼ç½ç»çççççç£ç®ç¼ç ç 礦ç ç¤ªç¡ ç¢ç¡´ç¢ç¡¼ç¢ç¢ç¢£ç¢µç¢ªç¢¯ç£ç£ç£ç£ç¢¾ç¢¼ç£ ç£ç£¬"], +["e240","磧ç£ç£½ç£´ç¤ç¤ç¤ç¤ç¤¬ç¤«ç¥ç¥ ç¥ç¥ç¥ç¥ç¥ç¥ºç¥¿ç¦ç¦ç¦§é½ç¦ªç¦®ç¦³ç¦¹ç¦ºç§ç§ç§§ç§¬ç§¡ç§£ç¨ç¨ç¨ç¨ç¨ ç¨ç¦ç¨±ç¨»ç¨¾ç¨·ç©ç©ç©ç©¡ç©¢ç©©é¾ç©°ç©¹ç©½çªçªçªçªçªçª©ç«çª°"], +["e280","çª¶ç« ç«çª¿éç«ç«ç«ç«ç«ç«ç«ç«ç«ç«¡ç«¢ç«¦ç«ç«°ç¬ç¬ç¬ç¬ç¬³ç¬ç¬ç¬ç¬µç¬¨ç¬¶ççºç¬çç¬çç çµç¥ç´ç§ç°ç±ç¬ç®ç®ç®ç®ç®ç®ç®ç®ç®ç®çç®ç¯ç¯ç¯ç¯ç®´ç¯ç¯ç¯©ç°ç°ç¯¦ç¯¥ç± ç°ç°ç°ç¯³ç¯·ç°ç°ç¯¶ç°£ç°§ç°ªç°ç°·ç°«ç°½ç±ç±ç±ç±ç±ç±ç±ç±ç±¤ç±ç±¥ç±¬ç±µç²ç²ç²¤ç²ç²¢ç²«ç²¡ç²¨ç²³ç²²ç²±ç²®ç²¹ç²½ç³ç³ ç³ç³ç³ç³ç³¢é¬»ç³¯ç³²ç³´ç³¶ç³ºç´"], +["e340","ç´ç´ç´ç´çµ çµç´®ç´²ç´¿ç´µçµçµ³çµçµçµ²çµ¨çµ®çµçµ£ç¶ç¶çµç¶çµ½ç¶ç¶ºç¶®ç¶£ç¶µç·ç¶½ç¶«ç¸½ç¶¢ç¶¯ç·ç¶¸ç¶ç¶°ç·ç·ç·¤ç·ç·»ç·²ç·¡ç¸ ç¸ç¸£ç¸¡ç¸ç¸±ç¸ç¸ç¸ç¸¢ç¹ç¹¦ç¸»ç¸µç¸¹ç¹ç¸·"], +["e380","縲縺繧ç¹ç¹ç¹ç¹ç¹ç¹¹ç¹ªç¹©ç¹¼ç¹»çºç·ç¹½è¾®ç¹¿çºçºçºçºçºçºçºçºçºçºçºç¼¸ç¼ºç½ ç½ç½ç½ç½ç½ç½ç½ç½ç½ç½ 罨罩罧罸ç¾ç¾ç¾ç¾ç¾ç¾ç¾ç¾ç¾ç¾ç¾£ç¾¯ç¾²ç¾¹ç¾®ç¾¶ç¾¸è±ç¿ ç¿ç¿ç¿ç¿ç¿¡ç¿¦ç¿©ç¿³ç¿¹é£èèèèèèèè¡è¨è¿è»èèèèèèè¢è¨è³è²è°è¶è¹è½è¿èèè èèèèåè¬èè¥èèèèèèè¯è±èè©è£è¯è "], +["e440","éè è¾è è è¼è ±è ®è ¥è ¦è ´èèèèèè èè¤è£è èè©è°èµè¾è¸è½èèèºèèèèèèèèè è§èºè»è¾èèè èèèèèè©è«è¸è³èèèèèèè¤"], +["e480","è¢è¨èªè«è®è±è·è¸è¾èèè«èè»è¬è¡è£èèè´è³èºèèè»è¹èèèèèèµè´èè²è±èè¹èè è¯è«èèè èèªèè¢èè£èèèè¼èµè³èµè èè¨è´èè«èè½èèèèè·èè è²èè¢è è½è¸èè»èèªè¼èèè·è«èè®èè©èè¬è¯è¹èµèè¢è¹è¿èèèè»èèèèèè¡è¡è¿è´èèè¬èèèè¼èè£èè"], +["e540","èèèèèè¤èèèè¨èèèèªèèè·è¾èèèºèè¹èèèè¥èè¹èèèè¾èºèè¢èè°è¿èä¹èèè§è±èè£è©èªèèè¶è¯èèè°èè £è«èèè©è¬"], +["e580","èèè¯èèèèèè»èèèè¹èè´è¿è·è»è¥è©èè èè¸èèè´èè¨è®èèè£èªè è¢èèè¯èè½èèéè«èè³èèè»è¯è²è è è è¾è¶è·è èè è è è ¢è ¡è ±è ¶è ¹è §è »è¡è¡è¡è¡è¡è¡¢è¡«è¢è¡¾è¢è¡µè¡½è¢µè¡²è¢è¢è¢è¢®è¢è¢¢è¢è¢¤è¢°è¢¿è¢±è£è£è£è£è£è£è£¹è¤è£¼è£´è£¨è£²è¤è¤è¤è¤è¥è¤è¤¥è¤ªè¤«è¥è¥è¤»è¤¶è¤¸è¥è¤è¥ è¥"], +["e640","襦襤è¥è¥ªè¥¯è¥´è¥·è¥¾è¦è¦è¦è¦è¦è¦¡è¦©è¦¦è¦¬è¦¯è¦²è¦ºè¦½è¦¿è§è§è§è§è§§è§´è§¸è¨è¨è¨è¨è¨è¨è¨¥è¨¶è©è©è©è©è©è©¼è©è©¬è©¢èª èªèªèª¨èª¡èªèª¥èª¦èªèª£è«è«è«è«è««è«³è«§"], +["e680","諤諱è¬è« 諢諷è«è«è¬è¬è¬è«¡è¬è¬è¬è¬ 謳é«è¬¦è¬«è¬¾è¬¨èèèèèèèèè«èè¬è¯è´è½è®è®è®è®è®è®è®è®è°ºè±è°¿è±è±è±è±è±è±¢è±¬è±¸è±ºè²è²è² è²è²è²è²è±¼è²æè²è²ªè²½è²²è²³è²®è²¶è³è³è³¤è³£è³è³½è³ºè³»è´è´ è´è´è´è´è´é½è´è³è´è´èµ§èµèµ±èµ³è¶è¶è·è¶¾è¶ºè·è·è·è·è·è·è·ªè·«è·è·£è·¼è¸è¸è·¿è¸è¸è¸è¸è¹è¸µè¸°è¸´è¹"], +["e740","è¹è¹è¹è¹è¹è¹è¹¤è¹ 踪蹣è¹è¹¶è¹²è¹¼èºèºèº èºèºèºèºèºèºèºèºªèº¡èº¬èº°è»èº±èº¾è» è»è»è»è»£è»¼è»»è»«è»¾è¼è¼ è¼è¼è¼è¼è¼è¼è¼è¼è¼¦è¼³è¼»è¼¹è½ è½è¼¾è½è½è½è½è½è½"], +["e780","轢轣轤è¾è¾è¾£è¾è¾¯è¾·è¿è¿¥è¿¢è¿ªè¿¯éè¿´é 迹迺ééé¡ééééé§é¶éµé¹è¿¸ééééééé¾éééé¨é¯é¶é¨é²éé½éééééé¨é¯é±éµé¢é¤æééééé²é°é é é é £é ¥é ©é ³é ²éééé¢é«é¯éªéµé´éºéééééééé¡éé¼éµé¶éé¿éé¬ééééé éé¤ééé¿ééééééééé¹é·é©ééºéé®"], +["e840","éé¢éé£éºéµé»éé é¼é®éé°é¬ééé¹ééé¨é¥éééééé¤ééééééé¶é«éµé¡éºééééé é¢ééªé©é°éµé·é½éé¼é¾éé¿ééééééé"], +["e880","é é¨é§éé¼é»é¹é¾é濶éééééééé¡é¥é¢é¡é¨é®é¯ééééé·ééééé¦é²é¬éééééªé§é±é²é°é´é¶é¸é¹ééééè¥éééé¹éééééééééé¤éªé°é¹é½é¾ééééééé é¤é¦é¨åé«é±é¹é é¼ééºéééééé¨é¦é£é³é´ééééééé½é²ç«é¶éµé é é ¸é ¤é ¡é ·é ½é¡é¡é¡é¡«é¡¯é¡°"], +["e940","顱顴顳颪颯颱颶é£é£é£é£©é£«é¤é¤é¤é¤é¤é¤¡é¤é¤é¤¤é¤ 餬餮餽餾é¥é¥é¥ é¥é¥é¥é¥é¥é¥é¦é¦é¦¥é¦é¦®é¦¼é§é§é§é§é§é§é§®é§±é§²é§»é§¸é¨é¨é¨ 駢é¨é¨«é¨·é© é©é©é©"], +["e980","騾é©é©é©é©é©é©¢é©¥é©¤é©©é©«é©ªéªéª°éª¼é«é«é«é«é«é«é«é«¢é«£é«¦é«¯é««é«®é«´é«±é«·é«»é¬é¬é¬é¬é¬¢é¬£é¬¥é¬§é¬¨é¬©é¬ªé¬®é¬¯é¬²éééééééé´é®é®é®é®é®é®é® 鮨鮴é¯é¯é®¹é¯é¯é¯é¯é¯£é¯¢é¯¤é¯é¯¡é°ºé¯²é¯±é¯°é°é°é°é°é°é°é°é°é°é°é°®é°é°¥é°¤é°¡é°°é±é°²é±é°¾é±é± 鱧鱶鱸鳧鳬鳰é´é´é³«é´é´é´ªé´¦é¶¯é´£é´éµé´é´éµé´¿é´¾éµéµ"], +["ea40","éµéµéµ¤éµéµéµéµ²é¶é¶é¶«éµ¯éµºé¶é¶¤é¶©é¶²é·é·é¶»é¶¸é¶ºé·é·é·é·é·é·¸é·¦é·é·¯é·½é¸é¸é¸é¹µé¹¹é¹½éºéºéºéºéºéºéºéºéº¥éº©éº¸éºªéºé¡é»é»é»é»é»é»é»é»é» 黥黨黯"], +["ea80","黴黶黷黹黻黼黽é¼é¼ç·é¼é¼¡é¼¬é¼¾é½é½é½é½£é½é½ 齡齦齧齬齪齷齲齶é¾é¾é¾ å ¯æ§éç¤åç"], +["ed40","çºè¤ééèä¿ç»æ±æ£é¹æ»å½ 丨仡仼ä¼ä¼ä¼¹ä½ä¾ä¾ä¾ä¾ä¿åå¢ä¿¿ååå°ååå´åå å ¤åå¾å¬ååå¦ååååå¤å²åå²åï¨ååå©å¿ååå¥å¬ååï¨"], +["ed80","ï¨å¢å¢²å¤å¥å¥å¥å¥£å¦¤å¦ºåå¯ç¯å¯å¯¬å°å²¦å²ºå³µå´§åµï¨åµåµå¶¸å¶¹å·å¼¡å¼´å½§å¾·å¿ææ ææææ æ²ææ·æ°æææ¦æµæ ææææææ»ææ®ææ¤æ¥ææï¨æ³ææ æ²æ¿æºæ朗æ¦æ»æ¡ææ æ¡æ£ï¨æ¥¨ï¨æ¦æ§¢æ¨°æ©«æ©æ©³æ©¾æ«¢æ«¤æ¯æ°¿æ±æ²æ±¯æ³æ´æ¶æµ¯æ¶æ¶¬æ·æ·¸æ·²æ·¼æ¸¹æ¹æ¸§æ¸¼æº¿æ¾æ¾µæ¿µç çç¨ç ç«ççç ç ç ï¨çç¾ç±"], +["ee40","ç¾ç¤ï¨ç·ç½ççç£çççµç¦çªç©ç®ç¢çççç¯ççççç¦ï¨çå¯ç ¡ç¡ç¡¤ç¡ºç¤°ï¨ï¨ï¨ç¦ï¨ç¦ç«ç«§ï¨ç««ç®ï¨çµçµç¶·ç¶ ç·ç¹ç½ç¾¡ï¨èè¢è¿èè¶èè´èè"], +["ee80","è«ï¨è°ï¨ 﨡è 裵è¨è¨·è©¹èª§èª¾è«ï¨¢è«¶èè¿è³°è³´è´èµ¶ï¨£è»ï¨¤ï¨¥é§é都éé§ééééé®é¤é¥ééééºéé¼éééé¹é§é§é·é¸é§ééé﨧éé éé¥é¡é»ï¨¨éé¿ééé°éé¤ééé¸é±é ééï§ï¨©éé¯é³é»éééééé¡é¡¥ï¨ªï¨«é¤§ï¨¬é¦é©é«é«éµé²é®é®±é®»é°éµ°éµ«ï¨é¸é»"], +["eeef","â °",9,"¬¦ï¼ï¼"], +["f040","î",62], +["f080","î¿",124], +["f140","î¼",62], +["f180","î»",124], +["f240","î ¸",62], +["f280","î·",124], +["f340","î´",62], +["f380","î³",124], +["f440","î°",62], +["f480","î¯",124], +["f540","î¬",62], +["f580","î«",124], +["f640","î¨",62], +["f680","î§",124], +["f740","î¤",62], +["f780","î£",124], +["f840","î ",62], +["f880","î",124], +["f940","î"], +["fa40","â °",9,"â ",9,"¬¦ï¼ï¼ã±ââ¡âµçºè¤ééèä¿ç»æ±æ£é¹æ»å½ 丨仡仼ä¼ä¼ä¼¹ä½ä¾ä¾ä¾ä¾ä¿åå¢ä¿¿ååå°ååå´åå "], +["fa80","å ¤åå¾å¬ååå¦ååååå¤å²åå²åï¨ååå©å¿ååå¥å¬ååï¨ï¨å¢å¢²å¤å¥å¥å¥å¥£å¦¤å¦ºåå¯ç¯å¯å¯¬å°å²¦å²ºå³µå´§åµï¨åµåµå¶¸å¶¹å·å¼¡å¼´å½§å¾·å¿ææ ææææ æ²ææ·æ°æææ¦æµæ ææææææ»ææ®ææ¤æ¥ææï¨æ³ææ æ²æ¿æºæ朗æ¦æ»æ¡ææ æ¡æ£ï¨æ¥¨ï¨æ¦æ§¢æ¨°æ©«æ©æ©³æ©¾æ«¢æ«¤æ¯æ°¿æ±æ²æ±¯æ³æ´æ¶æµ¯"], +["fb40","æ¶æ¶¬æ·æ·¸æ·²æ·¼æ¸¹æ¹æ¸§æ¸¼æº¿æ¾æ¾µæ¿µç çç¨ç ç«ççç ç ç ï¨çç¾ç±ç¾ç¤ï¨ç·ç½ççç£çççµç¦çªç©ç®ç¢çççç¯ççççç¦ï¨çå¯ç ¡ç¡ç¡¤ç¡ºç¤°ï¨ï¨"], +["fb80","ï¨ç¦ï¨ç¦ç«ç«§ï¨ç««ç®ï¨çµçµç¶·ç¶ ç·ç¹ç½ç¾¡ï¨èè¢è¿èè¶èè´èèè«ï¨è°ï¨ 﨡è 裵è¨è¨·è©¹èª§èª¾è«ï¨¢è«¶èè¿è³°è³´è´èµ¶ï¨£è»ï¨¤ï¨¥é§é都éé§ééééé®é¤é¥ééééºéé¼éééé¹é§é§é·é¸é§ééé﨧éé éé¥é¡é»ï¨¨éé¿ééé°éé¤ééé¸é±é ééï§ï¨©éé¯é³é»éééééé¡é¡¥ï¨ªï¨«é¤§ï¨¬é¦é©é«"], +["fc40","é«éµé²é®é®±é®»é°éµ°éµ«ï¨é¸é»"] +] diff --git a/node_modules/iconv-lite/encodings/utf16.js b/node_modules/iconv-lite/encodings/utf16.js new file mode 100644 index 0000000..54765ae --- /dev/null +++ b/node_modules/iconv-lite/encodings/utf16.js @@ -0,0 +1,177 @@ +"use strict"; +var Buffer = require("safer-buffer").Buffer; + +// Note: UTF16-LE (or UCS2) codec is Node.js native. See encodings/internal.js + +// == UTF16-BE codec. ========================================================== + +exports.utf16be = Utf16BECodec; +function Utf16BECodec() { +} + +Utf16BECodec.prototype.encoder = Utf16BEEncoder; +Utf16BECodec.prototype.decoder = Utf16BEDecoder; +Utf16BECodec.prototype.bomAware = true; + + +// -- Encoding + +function Utf16BEEncoder() { +} + +Utf16BEEncoder.prototype.write = function(str) { + var buf = Buffer.from(str, 'ucs2'); + for (var i = 0; i < buf.length; i += 2) { + var tmp = buf[i]; buf[i] = buf[i+1]; buf[i+1] = tmp; + } + return buf; +} + +Utf16BEEncoder.prototype.end = function() { +} + + +// -- Decoding + +function Utf16BEDecoder() { + this.overflowByte = -1; +} + +Utf16BEDecoder.prototype.write = function(buf) { + if (buf.length == 0) + return ''; + + var buf2 = Buffer.alloc(buf.length + 1), + i = 0, j = 0; + + if (this.overflowByte !== -1) { + buf2[0] = buf[0]; + buf2[1] = this.overflowByte; + i = 1; j = 2; + } + + for (; i < buf.length-1; i += 2, j+= 2) { + buf2[j] = buf[i+1]; + buf2[j+1] = buf[i]; + } + + this.overflowByte = (i == buf.length-1) ? buf[buf.length-1] : -1; + + return buf2.slice(0, j).toString('ucs2'); +} + +Utf16BEDecoder.prototype.end = function() { +} + + +// == UTF-16 codec ============================================================= +// Decoder chooses automatically from UTF-16LE and UTF-16BE using BOM and space-based heuristic. +// Defaults to UTF-16LE, as it's prevalent and default in Node. +// http://en.wikipedia.org/wiki/UTF-16 and http://encoding.spec.whatwg.org/#utf-16le +// Decoder default can be changed: iconv.decode(buf, 'utf16', {defaultEncoding: 'utf-16be'}); + +// Encoder uses UTF-16LE and prepends BOM (which can be overridden with addBOM: false). + +exports.utf16 = Utf16Codec; +function Utf16Codec(codecOptions, iconv) { + this.iconv = iconv; +} + +Utf16Codec.prototype.encoder = Utf16Encoder; +Utf16Codec.prototype.decoder = Utf16Decoder; + + +// -- Encoding (pass-through) + +function Utf16Encoder(options, codec) { + options = options || {}; + if (options.addBOM === undefined) + options.addBOM = true; + this.encoder = codec.iconv.getEncoder('utf-16le', options); +} + +Utf16Encoder.prototype.write = function(str) { + return this.encoder.write(str); +} + +Utf16Encoder.prototype.end = function() { + return this.encoder.end(); +} + + +// -- Decoding + +function Utf16Decoder(options, codec) { + this.decoder = null; + this.initialBytes = []; + this.initialBytesLen = 0; + + this.options = options || {}; + this.iconv = codec.iconv; +} + +Utf16Decoder.prototype.write = function(buf) { + if (!this.decoder) { + // Codec is not chosen yet. Accumulate initial bytes. + this.initialBytes.push(buf); + this.initialBytesLen += buf.length; + + if (this.initialBytesLen < 16) // We need more bytes to use space heuristic (see below) + return ''; + + // We have enough bytes -> detect endianness. + var buf = Buffer.concat(this.initialBytes), + encoding = detectEncoding(buf, this.options.defaultEncoding); + this.decoder = this.iconv.getDecoder(encoding, this.options); + this.initialBytes.length = this.initialBytesLen = 0; + } + + return this.decoder.write(buf); +} + +Utf16Decoder.prototype.end = function() { + if (!this.decoder) { + var buf = Buffer.concat(this.initialBytes), + encoding = detectEncoding(buf, this.options.defaultEncoding); + this.decoder = this.iconv.getDecoder(encoding, this.options); + + var res = this.decoder.write(buf), + trail = this.decoder.end(); + + return trail ? (res + trail) : res; + } + return this.decoder.end(); +} + +function detectEncoding(buf, defaultEncoding) { + var enc = defaultEncoding || 'utf-16le'; + + if (buf.length >= 2) { + // Check BOM. + if (buf[0] == 0xFE && buf[1] == 0xFF) // UTF-16BE BOM + enc = 'utf-16be'; + else if (buf[0] == 0xFF && buf[1] == 0xFE) // UTF-16LE BOM + enc = 'utf-16le'; + else { + // No BOM found. Try to deduce encoding from initial content. + // Most of the time, the content has ASCII chars (U+00**), but the opposite (U+**00) is uncommon. + // So, we count ASCII as if it was LE or BE, and decide from that. + var asciiCharsLE = 0, asciiCharsBE = 0, // Counts of chars in both positions + _len = Math.min(buf.length - (buf.length % 2), 64); // Len is always even. + + for (var i = 0; i < _len; i += 2) { + if (buf[i] === 0 && buf[i+1] !== 0) asciiCharsBE++; + if (buf[i] !== 0 && buf[i+1] === 0) asciiCharsLE++; + } + + if (asciiCharsBE > asciiCharsLE) + enc = 'utf-16be'; + else if (asciiCharsBE < asciiCharsLE) + enc = 'utf-16le'; + } + } + + return enc; +} + + diff --git a/node_modules/iconv-lite/encodings/utf7.js b/node_modules/iconv-lite/encodings/utf7.js new file mode 100644 index 0000000..b7631c2 --- /dev/null +++ b/node_modules/iconv-lite/encodings/utf7.js @@ -0,0 +1,290 @@ +"use strict"; +var Buffer = require("safer-buffer").Buffer; + +// UTF-7 codec, according to https://tools.ietf.org/html/rfc2152 +// See also below a UTF-7-IMAP codec, according to http://tools.ietf.org/html/rfc3501#section-5.1.3 + +exports.utf7 = Utf7Codec; +exports.unicode11utf7 = 'utf7'; // Alias UNICODE-1-1-UTF-7 +function Utf7Codec(codecOptions, iconv) { + this.iconv = iconv; +}; + +Utf7Codec.prototype.encoder = Utf7Encoder; +Utf7Codec.prototype.decoder = Utf7Decoder; +Utf7Codec.prototype.bomAware = true; + + +// -- Encoding + +var nonDirectChars = /[^A-Za-z0-9'\(\),-\.\/:\? \n\r\t]+/g; + +function Utf7Encoder(options, codec) { + this.iconv = codec.iconv; +} + +Utf7Encoder.prototype.write = function(str) { + // Naive implementation. + // Non-direct chars are encoded as "+<base64>-"; single "+" char is encoded as "+-". + return Buffer.from(str.replace(nonDirectChars, function(chunk) { + return "+" + (chunk === '+' ? '' : + this.iconv.encode(chunk, 'utf16-be').toString('base64').replace(/=+$/, '')) + + "-"; + }.bind(this))); +} + +Utf7Encoder.prototype.end = function() { +} + + +// -- Decoding + +function Utf7Decoder(options, codec) { + this.iconv = codec.iconv; + this.inBase64 = false; + this.base64Accum = ''; +} + +var base64Regex = /[A-Za-z0-9\/+]/; +var base64Chars = []; +for (var i = 0; i < 256; i++) + base64Chars[i] = base64Regex.test(String.fromCharCode(i)); + +var plusChar = '+'.charCodeAt(0), + minusChar = '-'.charCodeAt(0), + andChar = '&'.charCodeAt(0); + +Utf7Decoder.prototype.write = function(buf) { + var res = "", lastI = 0, + inBase64 = this.inBase64, + base64Accum = this.base64Accum; + + // The decoder is more involved as we must handle chunks in stream. + + for (var i = 0; i < buf.length; i++) { + if (!inBase64) { // We're in direct mode. + // Write direct chars until '+' + if (buf[i] == plusChar) { + res += this.iconv.decode(buf.slice(lastI, i), "ascii"); // Write direct chars. + lastI = i+1; + inBase64 = true; + } + } else { // We decode base64. + if (!base64Chars[buf[i]]) { // Base64 ended. + if (i == lastI && buf[i] == minusChar) {// "+-" -> "+" + res += "+"; + } else { + var b64str = base64Accum + buf.slice(lastI, i).toString(); + res += this.iconv.decode(Buffer.from(b64str, 'base64'), "utf16-be"); + } + + if (buf[i] != minusChar) // Minus is absorbed after base64. + i--; + + lastI = i+1; + inBase64 = false; + base64Accum = ''; + } + } + } + + if (!inBase64) { + res += this.iconv.decode(buf.slice(lastI), "ascii"); // Write direct chars. + } else { + var b64str = base64Accum + buf.slice(lastI).toString(); + + var canBeDecoded = b64str.length - (b64str.length % 8); // Minimal chunk: 2 quads -> 2x3 bytes -> 3 chars. + base64Accum = b64str.slice(canBeDecoded); // The rest will be decoded in future. + b64str = b64str.slice(0, canBeDecoded); + + res += this.iconv.decode(Buffer.from(b64str, 'base64'), "utf16-be"); + } + + this.inBase64 = inBase64; + this.base64Accum = base64Accum; + + return res; +} + +Utf7Decoder.prototype.end = function() { + var res = ""; + if (this.inBase64 && this.base64Accum.length > 0) + res = this.iconv.decode(Buffer.from(this.base64Accum, 'base64'), "utf16-be"); + + this.inBase64 = false; + this.base64Accum = ''; + return res; +} + + +// UTF-7-IMAP codec. +// RFC3501 Sec. 5.1.3 Modified UTF-7 (http://tools.ietf.org/html/rfc3501#section-5.1.3) +// Differences: +// * Base64 part is started by "&" instead of "+" +// * Direct characters are 0x20-0x7E, except "&" (0x26) +// * In Base64, "," is used instead of "/" +// * Base64 must not be used to represent direct characters. +// * No implicit shift back from Base64 (should always end with '-') +// * String must end in non-shifted position. +// * "-&" while in base64 is not allowed. + + +exports.utf7imap = Utf7IMAPCodec; +function Utf7IMAPCodec(codecOptions, iconv) { + this.iconv = iconv; +}; + +Utf7IMAPCodec.prototype.encoder = Utf7IMAPEncoder; +Utf7IMAPCodec.prototype.decoder = Utf7IMAPDecoder; +Utf7IMAPCodec.prototype.bomAware = true; + + +// -- Encoding + +function Utf7IMAPEncoder(options, codec) { + this.iconv = codec.iconv; + this.inBase64 = false; + this.base64Accum = Buffer.alloc(6); + this.base64AccumIdx = 0; +} + +Utf7IMAPEncoder.prototype.write = function(str) { + var inBase64 = this.inBase64, + base64Accum = this.base64Accum, + base64AccumIdx = this.base64AccumIdx, + buf = Buffer.alloc(str.length*5 + 10), bufIdx = 0; + + for (var i = 0; i < str.length; i++) { + var uChar = str.charCodeAt(i); + if (0x20 <= uChar && uChar <= 0x7E) { // Direct character or '&'. + if (inBase64) { + if (base64AccumIdx > 0) { + bufIdx += buf.write(base64Accum.slice(0, base64AccumIdx).toString('base64').replace(/\//g, ',').replace(/=+$/, ''), bufIdx); + base64AccumIdx = 0; + } + + buf[bufIdx++] = minusChar; // Write '-', then go to direct mode. + inBase64 = false; + } + + if (!inBase64) { + buf[bufIdx++] = uChar; // Write direct character + + if (uChar === andChar) // Ampersand -> '&-' + buf[bufIdx++] = minusChar; + } + + } else { // Non-direct character + if (!inBase64) { + buf[bufIdx++] = andChar; // Write '&', then go to base64 mode. + inBase64 = true; + } + if (inBase64) { + base64Accum[base64AccumIdx++] = uChar >> 8; + base64Accum[base64AccumIdx++] = uChar & 0xFF; + + if (base64AccumIdx == base64Accum.length) { + bufIdx += buf.write(base64Accum.toString('base64').replace(/\//g, ','), bufIdx); + base64AccumIdx = 0; + } + } + } + } + + this.inBase64 = inBase64; + this.base64AccumIdx = base64AccumIdx; + + return buf.slice(0, bufIdx); +} + +Utf7IMAPEncoder.prototype.end = function() { + var buf = Buffer.alloc(10), bufIdx = 0; + if (this.inBase64) { + if (this.base64AccumIdx > 0) { + bufIdx += buf.write(this.base64Accum.slice(0, this.base64AccumIdx).toString('base64').replace(/\//g, ',').replace(/=+$/, ''), bufIdx); + this.base64AccumIdx = 0; + } + + buf[bufIdx++] = minusChar; // Write '-', then go to direct mode. + this.inBase64 = false; + } + + return buf.slice(0, bufIdx); +} + + +// -- Decoding + +function Utf7IMAPDecoder(options, codec) { + this.iconv = codec.iconv; + this.inBase64 = false; + this.base64Accum = ''; +} + +var base64IMAPChars = base64Chars.slice(); +base64IMAPChars[','.charCodeAt(0)] = true; + +Utf7IMAPDecoder.prototype.write = function(buf) { + var res = "", lastI = 0, + inBase64 = this.inBase64, + base64Accum = this.base64Accum; + + // The decoder is more involved as we must handle chunks in stream. + // It is forgiving, closer to standard UTF-7 (for example, '-' is optional at the end). + + for (var i = 0; i < buf.length; i++) { + if (!inBase64) { // We're in direct mode. + // Write direct chars until '&' + if (buf[i] == andChar) { + res += this.iconv.decode(buf.slice(lastI, i), "ascii"); // Write direct chars. + lastI = i+1; + inBase64 = true; + } + } else { // We decode base64. + if (!base64IMAPChars[buf[i]]) { // Base64 ended. + if (i == lastI && buf[i] == minusChar) { // "&-" -> "&" + res += "&"; + } else { + var b64str = base64Accum + buf.slice(lastI, i).toString().replace(/,/g, '/'); + res += this.iconv.decode(Buffer.from(b64str, 'base64'), "utf16-be"); + } + + if (buf[i] != minusChar) // Minus may be absorbed after base64. + i--; + + lastI = i+1; + inBase64 = false; + base64Accum = ''; + } + } + } + + if (!inBase64) { + res += this.iconv.decode(buf.slice(lastI), "ascii"); // Write direct chars. + } else { + var b64str = base64Accum + buf.slice(lastI).toString().replace(/,/g, '/'); + + var canBeDecoded = b64str.length - (b64str.length % 8); // Minimal chunk: 2 quads -> 2x3 bytes -> 3 chars. + base64Accum = b64str.slice(canBeDecoded); // The rest will be decoded in future. + b64str = b64str.slice(0, canBeDecoded); + + res += this.iconv.decode(Buffer.from(b64str, 'base64'), "utf16-be"); + } + + this.inBase64 = inBase64; + this.base64Accum = base64Accum; + + return res; +} + +Utf7IMAPDecoder.prototype.end = function() { + var res = ""; + if (this.inBase64 && this.base64Accum.length > 0) + res = this.iconv.decode(Buffer.from(this.base64Accum, 'base64'), "utf16-be"); + + this.inBase64 = false; + this.base64Accum = ''; + return res; +} + + diff --git a/node_modules/iconv-lite/lib/bom-handling.js b/node_modules/iconv-lite/lib/bom-handling.js new file mode 100644 index 0000000..1050872 --- /dev/null +++ b/node_modules/iconv-lite/lib/bom-handling.js @@ -0,0 +1,52 @@ +"use strict"; + +var BOMChar = '\uFEFF'; + +exports.PrependBOM = PrependBOMWrapper +function PrependBOMWrapper(encoder, options) { + this.encoder = encoder; + this.addBOM = true; +} + +PrependBOMWrapper.prototype.write = function(str) { + if (this.addBOM) { + str = BOMChar + str; + this.addBOM = false; + } + + return this.encoder.write(str); +} + +PrependBOMWrapper.prototype.end = function() { + return this.encoder.end(); +} + + +//------------------------------------------------------------------------------ + +exports.StripBOM = StripBOMWrapper; +function StripBOMWrapper(decoder, options) { + this.decoder = decoder; + this.pass = false; + this.options = options || {}; +} + +StripBOMWrapper.prototype.write = function(buf) { + var res = this.decoder.write(buf); + if (this.pass || !res) + return res; + + if (res[0] === BOMChar) { + res = res.slice(1); + if (typeof this.options.stripBOM === 'function') + this.options.stripBOM(); + } + + this.pass = true; + return res; +} + +StripBOMWrapper.prototype.end = function() { + return this.decoder.end(); +} + diff --git a/node_modules/iconv-lite/lib/extend-node.js b/node_modules/iconv-lite/lib/extend-node.js new file mode 100644 index 0000000..87f5394 --- /dev/null +++ b/node_modules/iconv-lite/lib/extend-node.js @@ -0,0 +1,217 @@ +"use strict"; +var Buffer = require("buffer").Buffer; +// Note: not polyfilled with safer-buffer on a purpose, as overrides Buffer + +// == Extend Node primitives to use iconv-lite ================================= + +module.exports = function (iconv) { + var original = undefined; // Place to keep original methods. + + // Node authors rewrote Buffer internals to make it compatible with + // Uint8Array and we cannot patch key functions since then. + // Note: this does use older Buffer API on a purpose + iconv.supportsNodeEncodingsExtension = !(Buffer.from || new Buffer(0) instanceof Uint8Array); + + iconv.extendNodeEncodings = function extendNodeEncodings() { + if (original) return; + original = {}; + + if (!iconv.supportsNodeEncodingsExtension) { + console.error("ACTION NEEDED: require('iconv-lite').extendNodeEncodings() is not supported in your version of Node"); + console.error("See more info at https://github.com/ashtuchkin/iconv-lite/wiki/Node-v4-compatibility"); + return; + } + + var nodeNativeEncodings = { + 'hex': true, 'utf8': true, 'utf-8': true, 'ascii': true, 'binary': true, + 'base64': true, 'ucs2': true, 'ucs-2': true, 'utf16le': true, 'utf-16le': true, + }; + + Buffer.isNativeEncoding = function(enc) { + return enc && nodeNativeEncodings[enc.toLowerCase()]; + } + + // -- SlowBuffer ----------------------------------------------------------- + var SlowBuffer = require('buffer').SlowBuffer; + + original.SlowBufferToString = SlowBuffer.prototype.toString; + SlowBuffer.prototype.toString = function(encoding, start, end) { + encoding = String(encoding || 'utf8').toLowerCase(); + + // Use native conversion when possible + if (Buffer.isNativeEncoding(encoding)) + return original.SlowBufferToString.call(this, encoding, start, end); + + // Otherwise, use our decoding method. + if (typeof start == 'undefined') start = 0; + if (typeof end == 'undefined') end = this.length; + return iconv.decode(this.slice(start, end), encoding); + } + + original.SlowBufferWrite = SlowBuffer.prototype.write; + SlowBuffer.prototype.write = function(string, offset, length, encoding) { + // Support both (string, offset, length, encoding) + // and the legacy (string, encoding, offset, length) + if (isFinite(offset)) { + if (!isFinite(length)) { + encoding = length; + length = undefined; + } + } else { // legacy + var swap = encoding; + encoding = offset; + offset = length; + length = swap; + } + + offset = +offset || 0; + var remaining = this.length - offset; + if (!length) { + length = remaining; + } else { + length = +length; + if (length > remaining) { + length = remaining; + } + } + encoding = String(encoding || 'utf8').toLowerCase(); + + // Use native conversion when possible + if (Buffer.isNativeEncoding(encoding)) + return original.SlowBufferWrite.call(this, string, offset, length, encoding); + + if (string.length > 0 && (length < 0 || offset < 0)) + throw new RangeError('attempt to write beyond buffer bounds'); + + // Otherwise, use our encoding method. + var buf = iconv.encode(string, encoding); + if (buf.length < length) length = buf.length; + buf.copy(this, offset, 0, length); + return length; + } + + // -- Buffer --------------------------------------------------------------- + + original.BufferIsEncoding = Buffer.isEncoding; + Buffer.isEncoding = function(encoding) { + return Buffer.isNativeEncoding(encoding) || iconv.encodingExists(encoding); + } + + original.BufferByteLength = Buffer.byteLength; + Buffer.byteLength = SlowBuffer.byteLength = function(str, encoding) { + encoding = String(encoding || 'utf8').toLowerCase(); + + // Use native conversion when possible + if (Buffer.isNativeEncoding(encoding)) + return original.BufferByteLength.call(this, str, encoding); + + // Slow, I know, but we don't have a better way yet. + return iconv.encode(str, encoding).length; + } + + original.BufferToString = Buffer.prototype.toString; + Buffer.prototype.toString = function(encoding, start, end) { + encoding = String(encoding || 'utf8').toLowerCase(); + + // Use native conversion when possible + if (Buffer.isNativeEncoding(encoding)) + return original.BufferToString.call(this, encoding, start, end); + + // Otherwise, use our decoding method. + if (typeof start == 'undefined') start = 0; + if (typeof end == 'undefined') end = this.length; + return iconv.decode(this.slice(start, end), encoding); + } + + original.BufferWrite = Buffer.prototype.write; + Buffer.prototype.write = function(string, offset, length, encoding) { + var _offset = offset, _length = length, _encoding = encoding; + // Support both (string, offset, length, encoding) + // and the legacy (string, encoding, offset, length) + if (isFinite(offset)) { + if (!isFinite(length)) { + encoding = length; + length = undefined; + } + } else { // legacy + var swap = encoding; + encoding = offset; + offset = length; + length = swap; + } + + encoding = String(encoding || 'utf8').toLowerCase(); + + // Use native conversion when possible + if (Buffer.isNativeEncoding(encoding)) + return original.BufferWrite.call(this, string, _offset, _length, _encoding); + + offset = +offset || 0; + var remaining = this.length - offset; + if (!length) { + length = remaining; + } else { + length = +length; + if (length > remaining) { + length = remaining; + } + } + + if (string.length > 0 && (length < 0 || offset < 0)) + throw new RangeError('attempt to write beyond buffer bounds'); + + // Otherwise, use our encoding method. + var buf = iconv.encode(string, encoding); + if (buf.length < length) length = buf.length; + buf.copy(this, offset, 0, length); + return length; + + // TODO: Set _charsWritten. + } + + + // -- Readable ------------------------------------------------------------- + if (iconv.supportsStreams) { + var Readable = require('stream').Readable; + + original.ReadableSetEncoding = Readable.prototype.setEncoding; + Readable.prototype.setEncoding = function setEncoding(enc, options) { + // Use our own decoder, it has the same interface. + // We cannot use original function as it doesn't handle BOM-s. + this._readableState.decoder = iconv.getDecoder(enc, options); + this._readableState.encoding = enc; + } + + Readable.prototype.collect = iconv._collect; + } + } + + // Remove iconv-lite Node primitive extensions. + iconv.undoExtendNodeEncodings = function undoExtendNodeEncodings() { + if (!iconv.supportsNodeEncodingsExtension) + return; + if (!original) + throw new Error("require('iconv-lite').undoExtendNodeEncodings(): Nothing to undo; extendNodeEncodings() is not called.") + + delete Buffer.isNativeEncoding; + + var SlowBuffer = require('buffer').SlowBuffer; + + SlowBuffer.prototype.toString = original.SlowBufferToString; + SlowBuffer.prototype.write = original.SlowBufferWrite; + + Buffer.isEncoding = original.BufferIsEncoding; + Buffer.byteLength = original.BufferByteLength; + Buffer.prototype.toString = original.BufferToString; + Buffer.prototype.write = original.BufferWrite; + + if (iconv.supportsStreams) { + var Readable = require('stream').Readable; + + Readable.prototype.setEncoding = original.ReadableSetEncoding; + delete Readable.prototype.collect; + } + + original = undefined; + } +} diff --git a/node_modules/iconv-lite/lib/index.d.ts b/node_modules/iconv-lite/lib/index.d.ts new file mode 100644 index 0000000..0547eb3 --- /dev/null +++ b/node_modules/iconv-lite/lib/index.d.ts @@ -0,0 +1,24 @@ +/*--------------------------------------------------------------------------------------------- + * Copyright (c) Microsoft Corporation. All rights reserved. + * Licensed under the MIT License. + * REQUIREMENT: This definition is dependent on the @types/node definition. + * Install with `npm install @types/node --save-dev` + *--------------------------------------------------------------------------------------------*/ + +declare module 'iconv-lite' { + export function decode(buffer: Buffer, encoding: string, options?: Options): string; + + export function encode(content: string, encoding: string, options?: Options): Buffer; + + export function encodingExists(encoding: string): boolean; + + export function decodeStream(encoding: string, options?: Options): NodeJS.ReadWriteStream; + + export function encodeStream(encoding: string, options?: Options): NodeJS.ReadWriteStream; +} + +export interface Options { + stripBOM?: boolean; + addBOM?: boolean; + defaultEncoding?: string; +} diff --git a/node_modules/iconv-lite/lib/index.js b/node_modules/iconv-lite/lib/index.js new file mode 100644 index 0000000..5391919 --- /dev/null +++ b/node_modules/iconv-lite/lib/index.js @@ -0,0 +1,153 @@ +"use strict"; + +// Some environments don't have global Buffer (e.g. React Native). +// Solution would be installing npm modules "buffer" and "stream" explicitly. +var Buffer = require("safer-buffer").Buffer; + +var bomHandling = require("./bom-handling"), + iconv = module.exports; + +// All codecs and aliases are kept here, keyed by encoding name/alias. +// They are lazy loaded in `iconv.getCodec` from `encodings/index.js`. +iconv.encodings = null; + +// Characters emitted in case of error. +iconv.defaultCharUnicode = '�'; +iconv.defaultCharSingleByte = '?'; + +// Public API. +iconv.encode = function encode(str, encoding, options) { + str = "" + (str || ""); // Ensure string. + + var encoder = iconv.getEncoder(encoding, options); + + var res = encoder.write(str); + var trail = encoder.end(); + + return (trail && trail.length > 0) ? Buffer.concat([res, trail]) : res; +} + +iconv.decode = function decode(buf, encoding, options) { + if (typeof buf === 'string') { + if (!iconv.skipDecodeWarning) { + console.error('Iconv-lite warning: decode()-ing strings is deprecated. Refer to https://github.com/ashtuchkin/iconv-lite/wiki/Use-Buffers-when-decoding'); + iconv.skipDecodeWarning = true; + } + + buf = Buffer.from("" + (buf || ""), "binary"); // Ensure buffer. + } + + var decoder = iconv.getDecoder(encoding, options); + + var res = decoder.write(buf); + var trail = decoder.end(); + + return trail ? (res + trail) : res; +} + +iconv.encodingExists = function encodingExists(enc) { + try { + iconv.getCodec(enc); + return true; + } catch (e) { + return false; + } +} + +// Legacy aliases to convert functions +iconv.toEncoding = iconv.encode; +iconv.fromEncoding = iconv.decode; + +// Search for a codec in iconv.encodings. Cache codec data in iconv._codecDataCache. +iconv._codecDataCache = {}; +iconv.getCodec = function getCodec(encoding) { + if (!iconv.encodings) + iconv.encodings = require("../encodings"); // Lazy load all encoding definitions. + + // Canonicalize encoding name: strip all non-alphanumeric chars and appended year. + var enc = iconv._canonicalizeEncoding(encoding); + + // Traverse iconv.encodings to find actual codec. + var codecOptions = {}; + while (true) { + var codec = iconv._codecDataCache[enc]; + if (codec) + return codec; + + var codecDef = iconv.encodings[enc]; + + switch (typeof codecDef) { + case "string": // Direct alias to other encoding. + enc = codecDef; + break; + + case "object": // Alias with options. Can be layered. + for (var key in codecDef) + codecOptions[key] = codecDef[key]; + + if (!codecOptions.encodingName) + codecOptions.encodingName = enc; + + enc = codecDef.type; + break; + + case "function": // Codec itself. + if (!codecOptions.encodingName) + codecOptions.encodingName = enc; + + // The codec function must load all tables and return object with .encoder and .decoder methods. + // It'll be called only once (for each different options object). + codec = new codecDef(codecOptions, iconv); + + iconv._codecDataCache[codecOptions.encodingName] = codec; // Save it to be reused later. + return codec; + + default: + throw new Error("Encoding not recognized: '" + encoding + "' (searched as: '"+enc+"')"); + } + } +} + +iconv._canonicalizeEncoding = function(encoding) { + // Canonicalize encoding name: strip all non-alphanumeric chars and appended year. + return (''+encoding).toLowerCase().replace(/:\d{4}$|[^0-9a-z]/g, ""); +} + +iconv.getEncoder = function getEncoder(encoding, options) { + var codec = iconv.getCodec(encoding), + encoder = new codec.encoder(options, codec); + + if (codec.bomAware && options && options.addBOM) + encoder = new bomHandling.PrependBOM(encoder, options); + + return encoder; +} + +iconv.getDecoder = function getDecoder(encoding, options) { + var codec = iconv.getCodec(encoding), + decoder = new codec.decoder(options, codec); + + if (codec.bomAware && !(options && options.stripBOM === false)) + decoder = new bomHandling.StripBOM(decoder, options); + + return decoder; +} + + +// Load extensions in Node. All of them are omitted in Browserify build via 'browser' field in package.json. +var nodeVer = typeof process !== 'undefined' && process.versions && process.versions.node; +if (nodeVer) { + + // Load streaming support in Node v0.10+ + var nodeVerArr = nodeVer.split(".").map(Number); + if (nodeVerArr[0] > 0 || nodeVerArr[1] >= 10) { + require("./streams")(iconv); + } + + // Load Node primitive extensions. + require("./extend-node")(iconv); +} + +if ("Ä" != "\u0100") { + console.error("iconv-lite warning: javascript files use encoding different from utf-8. See https://github.com/ashtuchkin/iconv-lite/wiki/Javascript-source-file-encodings for more info."); +} diff --git a/node_modules/iconv-lite/lib/streams.js b/node_modules/iconv-lite/lib/streams.js new file mode 100644 index 0000000..4409552 --- /dev/null +++ b/node_modules/iconv-lite/lib/streams.js @@ -0,0 +1,121 @@ +"use strict"; + +var Buffer = require("buffer").Buffer, + Transform = require("stream").Transform; + + +// == Exports ================================================================== +module.exports = function(iconv) { + + // Additional Public API. + iconv.encodeStream = function encodeStream(encoding, options) { + return new IconvLiteEncoderStream(iconv.getEncoder(encoding, options), options); + } + + iconv.decodeStream = function decodeStream(encoding, options) { + return new IconvLiteDecoderStream(iconv.getDecoder(encoding, options), options); + } + + iconv.supportsStreams = true; + + + // Not published yet. + iconv.IconvLiteEncoderStream = IconvLiteEncoderStream; + iconv.IconvLiteDecoderStream = IconvLiteDecoderStream; + iconv._collect = IconvLiteDecoderStream.prototype.collect; +}; + + +// == Encoder stream ======================================================= +function IconvLiteEncoderStream(conv, options) { + this.conv = conv; + options = options || {}; + options.decodeStrings = false; // We accept only strings, so we don't need to decode them. + Transform.call(this, options); +} + +IconvLiteEncoderStream.prototype = Object.create(Transform.prototype, { + constructor: { value: IconvLiteEncoderStream } +}); + +IconvLiteEncoderStream.prototype._transform = function(chunk, encoding, done) { + if (typeof chunk != 'string') + return done(new Error("Iconv encoding stream needs strings as its input.")); + try { + var res = this.conv.write(chunk); + if (res && res.length) this.push(res); + done(); + } + catch (e) { + done(e); + } +} + +IconvLiteEncoderStream.prototype._flush = function(done) { + try { + var res = this.conv.end(); + if (res && res.length) this.push(res); + done(); + } + catch (e) { + done(e); + } +} + +IconvLiteEncoderStream.prototype.collect = function(cb) { + var chunks = []; + this.on('error', cb); + this.on('data', function(chunk) { chunks.push(chunk); }); + this.on('end', function() { + cb(null, Buffer.concat(chunks)); + }); + return this; +} + + +// == Decoder stream ======================================================= +function IconvLiteDecoderStream(conv, options) { + this.conv = conv; + options = options || {}; + options.encoding = this.encoding = 'utf8'; // We output strings. + Transform.call(this, options); +} + +IconvLiteDecoderStream.prototype = Object.create(Transform.prototype, { + constructor: { value: IconvLiteDecoderStream } +}); + +IconvLiteDecoderStream.prototype._transform = function(chunk, encoding, done) { + if (!Buffer.isBuffer(chunk)) + return done(new Error("Iconv decoding stream needs buffers as its input.")); + try { + var res = this.conv.write(chunk); + if (res && res.length) this.push(res, this.encoding); + done(); + } + catch (e) { + done(e); + } +} + +IconvLiteDecoderStream.prototype._flush = function(done) { + try { + var res = this.conv.end(); + if (res && res.length) this.push(res, this.encoding); + done(); + } + catch (e) { + done(e); + } +} + +IconvLiteDecoderStream.prototype.collect = function(cb) { + var res = ''; + this.on('error', cb); + this.on('data', function(chunk) { res += chunk; }); + this.on('end', function() { + cb(null, res); + }); + return this; +} + diff --git a/node_modules/iconv-lite/package.json b/node_modules/iconv-lite/package.json new file mode 100644 index 0000000..931f5c0 --- /dev/null +++ b/node_modules/iconv-lite/package.json @@ -0,0 +1,77 @@ +{ + "_from": "iconv-lite@0.4.24", + "_id": "iconv-lite@0.4.24", + "_inBundle": false, + "_integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", + "_location": "/iconv-lite", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "iconv-lite@0.4.24", + "name": "iconv-lite", + "escapedName": "iconv-lite", + "rawSpec": "0.4.24", + "saveSpec": null, + "fetchSpec": "0.4.24" + }, + "_requiredBy": [ + "/body-parser", + "/raw-body" + ], + "_resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", + "_shasum": "2022b4b25fbddc21d2f524974a474aafe733908b", + "_spec": "iconv-lite@0.4.24", + "_where": "/home/josuer08/Documents/web/node_modules/body-parser", + "author": { + "name": "Alexander Shtuchkin", + "email": "ashtuchkin@gmail.com" + }, + "browser": { + "./lib/extend-node": false, + "./lib/streams": false + }, + "bugs": { + "url": "https://github.com/ashtuchkin/iconv-lite/issues" + }, + "bundleDependencies": false, + "dependencies": { + "safer-buffer": ">= 2.1.2 < 3" + }, + "deprecated": false, + "description": "Convert character encodings in pure javascript.", + "devDependencies": { + "async": "*", + "errto": "*", + "iconv": "*", + "istanbul": "*", + "mocha": "^3.1.0", + "request": "~2.87.0", + "semver": "*", + "unorm": "*" + }, + "engines": { + "node": ">=0.10.0" + }, + "homepage": "https://github.com/ashtuchkin/iconv-lite", + "keywords": [ + "iconv", + "convert", + "charset", + "icu" + ], + "license": "MIT", + "main": "./lib/index.js", + "name": "iconv-lite", + "repository": { + "type": "git", + "url": "git://github.com/ashtuchkin/iconv-lite.git" + }, + "scripts": { + "coverage": "istanbul cover _mocha -- --grep .", + "coverage-open": "open coverage/lcov-report/index.html", + "test": "mocha --reporter spec --grep ." + }, + "typings": "./lib/index.d.ts", + "version": "0.4.24" +} diff --git a/node_modules/inherits/LICENSE b/node_modules/inherits/LICENSE new file mode 100644 index 0000000..dea3013 --- /dev/null +++ b/node_modules/inherits/LICENSE @@ -0,0 +1,16 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM +LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR +OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR +PERFORMANCE OF THIS SOFTWARE. + diff --git a/node_modules/inherits/README.md b/node_modules/inherits/README.md new file mode 100644 index 0000000..b1c5665 --- /dev/null +++ b/node_modules/inherits/README.md @@ -0,0 +1,42 @@ +Browser-friendly inheritance fully compatible with standard node.js +[inherits](http://nodejs.org/api/util.html#util_util_inherits_constructor_superconstructor). + +This package exports standard `inherits` from node.js `util` module in +node environment, but also provides alternative browser-friendly +implementation through [browser +field](https://gist.github.com/shtylman/4339901). Alternative +implementation is a literal copy of standard one located in standalone +module to avoid requiring of `util`. It also has a shim for old +browsers with no `Object.create` support. + +While keeping you sure you are using standard `inherits` +implementation in node.js environment, it allows bundlers such as +[browserify](https://github.com/substack/node-browserify) to not +include full `util` package to your client code if all you need is +just `inherits` function. It worth, because browser shim for `util` +package is large and `inherits` is often the single function you need +from it. + +It's recommended to use this package instead of +`require('util').inherits` for any code that has chances to be used +not only in node.js but in browser too. + +## usage + +```js +var inherits = require('inherits'); +// then use exactly as the standard one +``` + +## note on version ~1.0 + +Version ~1.0 had completely different motivation and is not compatible +neither with 2.0 nor with standard node.js `inherits`. + +If you are using version ~1.0 and planning to switch to ~2.0, be +careful: + +* new version uses `super_` instead of `super` for referencing + superclass +* new version overwrites current prototype while old one preserves any + existing fields on it diff --git a/node_modules/inherits/inherits.js b/node_modules/inherits/inherits.js new file mode 100644 index 0000000..3b94763 --- /dev/null +++ b/node_modules/inherits/inherits.js @@ -0,0 +1,7 @@ +try { + var util = require('util'); + if (typeof util.inherits !== 'function') throw ''; + module.exports = util.inherits; +} catch (e) { + module.exports = require('./inherits_browser.js'); +} diff --git a/node_modules/inherits/inherits_browser.js b/node_modules/inherits/inherits_browser.js new file mode 100644 index 0000000..c1e78a7 --- /dev/null +++ b/node_modules/inherits/inherits_browser.js @@ -0,0 +1,23 @@ +if (typeof Object.create === 'function') { + // implementation from standard node.js 'util' module + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + ctor.prototype = Object.create(superCtor.prototype, { + constructor: { + value: ctor, + enumerable: false, + writable: true, + configurable: true + } + }); + }; +} else { + // old school shim for old browsers + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + var TempCtor = function () {} + TempCtor.prototype = superCtor.prototype + ctor.prototype = new TempCtor() + ctor.prototype.constructor = ctor + } +} diff --git a/node_modules/inherits/package.json b/node_modules/inherits/package.json new file mode 100644 index 0000000..050a308 --- /dev/null +++ b/node_modules/inherits/package.json @@ -0,0 +1,61 @@ +{ + "_from": "inherits@2.0.3", + "_id": "inherits@2.0.3", + "_inBundle": false, + "_integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=", + "_location": "/inherits", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "inherits@2.0.3", + "name": "inherits", + "escapedName": "inherits", + "rawSpec": "2.0.3", + "saveSpec": null, + "fetchSpec": "2.0.3" + }, + "_requiredBy": [ + "/http-errors" + ], + "_resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "_shasum": "633c2c83e3da42a502f52466022480f4208261de", + "_spec": "inherits@2.0.3", + "_where": "/home/josuer08/Documents/web/node_modules/http-errors", + "browser": "./inherits_browser.js", + "bugs": { + "url": "https://github.com/isaacs/inherits/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Browser-friendly inheritance fully compatible with standard node.js inherits()", + "devDependencies": { + "tap": "^7.1.0" + }, + "files": [ + "inherits.js", + "inherits_browser.js" + ], + "homepage": "https://github.com/isaacs/inherits#readme", + "keywords": [ + "inheritance", + "class", + "klass", + "oop", + "object-oriented", + "inherits", + "browser", + "browserify" + ], + "license": "ISC", + "main": "./inherits.js", + "name": "inherits", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/inherits.git" + }, + "scripts": { + "test": "node test" + }, + "version": "2.0.3" +} diff --git a/node_modules/ipaddr.js/LICENSE b/node_modules/ipaddr.js/LICENSE new file mode 100644 index 0000000..f6b37b5 --- /dev/null +++ b/node_modules/ipaddr.js/LICENSE @@ -0,0 +1,19 @@ +Copyright (C) 2011-2017 whitequark <whitequark@whitequark.org> + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/ipaddr.js/README.md b/node_modules/ipaddr.js/README.md new file mode 100644 index 0000000..6876a3b --- /dev/null +++ b/node_modules/ipaddr.js/README.md @@ -0,0 +1,233 @@ +# ipaddr.js â an IPv6 and IPv4 address manipulation library [](https://travis-ci.org/whitequark/ipaddr.js) + +ipaddr.js is a small (1.9K minified and gzipped) library for manipulating +IP addresses in JavaScript environments. It runs on both CommonJS runtimes +(e.g. [nodejs]) and in a web browser. + +ipaddr.js allows you to verify and parse string representation of an IP +address, match it against a CIDR range or range list, determine if it falls +into some reserved ranges (examples include loopback and private ranges), +and convert between IPv4 and IPv4-mapped IPv6 addresses. + +[nodejs]: http://nodejs.org + +## Installation + +`npm install ipaddr.js` + +or + +`bower install ipaddr.js` + +## API + +ipaddr.js defines one object in the global scope: `ipaddr`. In CommonJS, +it is exported from the module: + +```js +var ipaddr = require('ipaddr.js'); +``` + +The API consists of several global methods and two classes: ipaddr.IPv6 and ipaddr.IPv4. + +### Global methods + +There are three global methods defined: `ipaddr.isValid`, `ipaddr.parse` and +`ipaddr.process`. All of them receive a string as a single parameter. + +The `ipaddr.isValid` method returns `true` if the address is a valid IPv4 or +IPv6 address, and `false` otherwise. It does not throw any exceptions. + +The `ipaddr.parse` method returns an object representing the IP address, +or throws an `Error` if the passed string is not a valid representation of an +IP address. + +The `ipaddr.process` method works just like the `ipaddr.parse` one, but it +automatically converts IPv4-mapped IPv6 addresses to their IPv4 counterparts +before returning. It is useful when you have a Node.js instance listening +on an IPv6 socket, and the `net.ivp6.bindv6only` sysctl parameter (or its +equivalent on non-Linux OS) is set to 0. In this case, you can accept IPv4 +connections on your IPv6-only socket, but the remote address will be mangled. +Use `ipaddr.process` method to automatically demangle it. + +### Object representation + +Parsing methods return an object which descends from `ipaddr.IPv6` or +`ipaddr.IPv4`. These objects share some properties, but most of them differ. + +#### Shared properties + +One can determine the type of address by calling `addr.kind()`. It will return +either `"ipv6"` or `"ipv4"`. + +An address can be converted back to its string representation with `addr.toString()`. +Note that this method: + * does not return the original string used to create the object (in fact, there is + no way of getting that string) + * returns a compact representation (when it is applicable) + +A `match(range, bits)` method can be used to check if the address falls into a +certain CIDR range. +Note that an address can be (obviously) matched only against an address of the same type. + +For example: + +```js +var addr = ipaddr.parse("2001:db8:1234::1"); +var range = ipaddr.parse("2001:db8::"); + +addr.match(range, 32); // => true +``` + +Alternatively, `match` can also be called as `match([range, bits])`. In this way, +it can be used together with the `parseCIDR(string)` method, which parses an IP +address together with a CIDR range. + +For example: + +```js +var addr = ipaddr.parse("2001:db8:1234::1"); + +addr.match(ipaddr.parseCIDR("2001:db8::/32")); // => true +``` + +A `range()` method returns one of predefined names for several special ranges defined +by IP protocols. The exact names (and their respective CIDR ranges) can be looked up +in the source: [IPv6 ranges] and [IPv4 ranges]. Some common ones include `"unicast"` +(the default one) and `"reserved"`. + +You can match against your own range list by using +`ipaddr.subnetMatch(address, rangeList, defaultName)` method. It can work with a mix of IPv6 or IPv4 addresses, and accepts a name-to-subnet map as the range list. For example: + +```js +var rangeList = { + documentationOnly: [ ipaddr.parse('2001:db8::'), 32 ], + tunnelProviders: [ + [ ipaddr.parse('2001:470::'), 32 ], // he.net + [ ipaddr.parse('2001:5c0::'), 32 ] // freenet6 + ] +}; +ipaddr.subnetMatch(ipaddr.parse('2001:470:8:66::1'), rangeList, 'unknown'); // => "tunnelProviders" +``` + +The addresses can be converted to their byte representation with `toByteArray()`. +(Actually, JavaScript mostly does not know about byte buffers. They are emulated with +arrays of numbers, each in range of 0..255.) + +```js +var bytes = ipaddr.parse('2a00:1450:8007::68').toByteArray(); // ipv6.google.com +bytes // => [42, 0x00, 0x14, 0x50, 0x80, 0x07, 0x00, <zeroes...>, 0x00, 0x68 ] +``` + +The `ipaddr.IPv4` and `ipaddr.IPv6` objects have some methods defined, too. All of them +have the same interface for both protocols, and are similar to global methods. + +`ipaddr.IPvX.isValid(string)` can be used to check if the string is a valid address +for particular protocol, and `ipaddr.IPvX.parse(string)` is the error-throwing parser. + +`ipaddr.IPvX.isValid(string)` uses the same format for parsing as the POSIX `inet_ntoa` function, which accepts unusual formats like `0xc0.168.1.1` or `0x10000000`. The function `ipaddr.IPv4.isValidFourPartDecimal(string)` validates the IPv4 address and also ensures that it is written in four-part decimal format. + +[IPv6 ranges]: https://github.com/whitequark/ipaddr.js/blob/master/src/ipaddr.coffee#L186 +[IPv4 ranges]: https://github.com/whitequark/ipaddr.js/blob/master/src/ipaddr.coffee#L71 + +#### IPv6 properties + +Sometimes you will want to convert IPv6 not to a compact string representation (with +the `::` substitution); the `toNormalizedString()` method will return an address where +all zeroes are explicit. + +For example: + +```js +var addr = ipaddr.parse("2001:0db8::0001"); +addr.toString(); // => "2001:db8::1" +addr.toNormalizedString(); // => "2001:db8:0:0:0:0:0:1" +``` + +The `isIPv4MappedAddress()` method will return `true` if this address is an IPv4-mapped +one, and `toIPv4Address()` will return an IPv4 object address. + +To access the underlying binary representation of the address, use `addr.parts`. + +```js +var addr = ipaddr.parse("2001:db8:10::1234:DEAD"); +addr.parts // => [0x2001, 0xdb8, 0x10, 0, 0, 0, 0x1234, 0xdead] +``` + +A IPv6 zone index can be accessed via `addr.zoneId`: + +```js +var addr = ipaddr.parse("2001:db8::%eth0"); +addr.zoneId // => 'eth0' +``` + +#### IPv4 properties + +`toIPv4MappedAddress()` will return a corresponding IPv4-mapped IPv6 address. + +To access the underlying representation of the address, use `addr.octets`. + +```js +var addr = ipaddr.parse("192.168.1.1"); +addr.octets // => [192, 168, 1, 1] +``` + +`prefixLengthFromSubnetMask()` will return a CIDR prefix length for a valid IPv4 netmask or +false if the netmask is not valid. + +```js +ipaddr.IPv4.parse('255.255.255.240').prefixLengthFromSubnetMask() == 28 +ipaddr.IPv4.parse('255.192.164.0').prefixLengthFromSubnetMask() == null +``` + +`subnetMaskFromPrefixLength()` will return an IPv4 netmask for a valid CIDR prefix length. + +```js +ipaddr.IPv4.subnetMaskFromPrefixLength(24) == "255.255.255.0" +ipaddr.IPv4.subnetMaskFromPrefixLength(29) == "255.255.255.248" +``` + +`broadcastAddressFromCIDR()` will return the broadcast address for a given IPv4 interface and netmask in CIDR notation. +```js +ipaddr.IPv4.broadcastAddressFromCIDR("172.0.0.1/24") == "172.0.0.255" +``` +`networkAddressFromCIDR()` will return the network address for a given IPv4 interface and netmask in CIDR notation. +```js +ipaddr.IPv4.networkAddressFromCIDR("172.0.0.1/24") == "172.0.0.0" +``` + +#### Conversion + +IPv4 and IPv6 can be converted bidirectionally to and from network byte order (MSB) byte arrays. + +The `fromByteArray()` method will take an array and create an appropriate IPv4 or IPv6 object +if the input satisfies the requirements. For IPv4 it has to be an array of four 8-bit values, +while for IPv6 it has to be an array of sixteen 8-bit values. + +For example: +```js +var addr = ipaddr.fromByteArray([0x7f, 0, 0, 1]); +addr.toString(); // => "127.0.0.1" +``` + +or + +```js +var addr = ipaddr.fromByteArray([0x20, 1, 0xd, 0xb8, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]) +addr.toString(); // => "2001:db8::1" +``` + +Both objects also offer a `toByteArray()` method, which returns an array in network byte order (MSB). + +For example: +```js +var addr = ipaddr.parse("127.0.0.1"); +addr.toByteArray(); // => [0x7f, 0, 0, 1] +``` + +or + +```js +var addr = ipaddr.parse("2001:db8::1"); +addr.toByteArray(); // => [0x20, 1, 0xd, 0xb8, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1] +``` diff --git a/node_modules/ipaddr.js/ipaddr.min.js b/node_modules/ipaddr.js/ipaddr.min.js new file mode 100644 index 0000000..b54a7cc --- /dev/null +++ b/node_modules/ipaddr.js/ipaddr.min.js @@ -0,0 +1 @@ +(function(){var r,t,n,e,i,o,a,s;t={},s=this,"undefined"!=typeof module&&null!==module&&module.exports?module.exports=t:s.ipaddr=t,a=function(r,t,n,e){var i,o;if(r.length!==t.length)throw new Error("ipaddr: cannot match CIDR for objects with different lengths");for(i=0;e>0;){if((o=n-e)<0&&(o=0),r[i]>>o!=t[i]>>o)return!1;e-=n,i+=1}return!0},t.subnetMatch=function(r,t,n){var e,i,o,a,s;null==n&&(n="unicast");for(o in t)for(!(a=t[o])[0]||a[0]instanceof Array||(a=[a]),e=0,i=a.length;e<i;e++)if(s=a[e],r.kind()===s[0].kind()&&r.match.apply(r,s))return o;return n},t.IPv4=function(){function r(r){var t,n,e;if(4!==r.length)throw new Error("ipaddr: ipv4 octet count should be 4");for(t=0,n=r.length;t<n;t++)if(!(0<=(e=r[t])&&e<=255))throw new Error("ipaddr: ipv4 octet should fit in 8 bits");this.octets=r}return r.prototype.kind=function(){return"ipv4"},r.prototype.toString=function(){return this.octets.join(".")},r.prototype.toNormalizedString=function(){return this.toString()},r.prototype.toByteArray=function(){return this.octets.slice(0)},r.prototype.match=function(r,t){var n;if(void 0===t&&(r=(n=r)[0],t=n[1]),"ipv4"!==r.kind())throw new Error("ipaddr: cannot match ipv4 address with non-ipv4 one");return a(this.octets,r.octets,8,t)},r.prototype.SpecialRanges={unspecified:[[new r([0,0,0,0]),8]],broadcast:[[new r([255,255,255,255]),32]],multicast:[[new r([224,0,0,0]),4]],linkLocal:[[new r([169,254,0,0]),16]],loopback:[[new r([127,0,0,0]),8]],carrierGradeNat:[[new r([100,64,0,0]),10]],private:[[new r([10,0,0,0]),8],[new r([172,16,0,0]),12],[new r([192,168,0,0]),16]],reserved:[[new r([192,0,0,0]),24],[new r([192,0,2,0]),24],[new r([192,88,99,0]),24],[new r([198,51,100,0]),24],[new r([203,0,113,0]),24],[new r([240,0,0,0]),4]]},r.prototype.range=function(){return t.subnetMatch(this,this.SpecialRanges)},r.prototype.toIPv4MappedAddress=function(){return t.IPv6.parse("::ffff:"+this.toString())},r.prototype.prefixLengthFromSubnetMask=function(){var r,t,n,e,i,o,a;for(a={0:8,128:7,192:6,224:5,240:4,248:3,252:2,254:1,255:0},r=0,i=!1,t=n=3;n>=0;t=n+=-1){if(!((e=this.octets[t])in a))return null;if(o=a[e],i&&0!==o)return null;8!==o&&(i=!0),r+=o}return 32-r},r}(),n="(0?\\d+|0x[a-f0-9]+)",e={fourOctet:new RegExp("^"+n+"\\."+n+"\\."+n+"\\."+n+"$","i"),longValue:new RegExp("^"+n+"$","i")},t.IPv4.parser=function(r){var t,n,i,o,a;if(n=function(r){return"0"===r[0]&&"x"!==r[1]?parseInt(r,8):parseInt(r)},t=r.match(e.fourOctet))return function(){var r,e,o,a;for(a=[],r=0,e=(o=t.slice(1,6)).length;r<e;r++)i=o[r],a.push(n(i));return a}();if(t=r.match(e.longValue)){if((a=n(t[1]))>4294967295||a<0)throw new Error("ipaddr: address outside defined range");return function(){var r,t;for(t=[],o=r=0;r<=24;o=r+=8)t.push(a>>o&255);return t}().reverse()}return null},t.IPv6=function(){function r(r,t){var n,e,i,o,a,s;if(16===r.length)for(this.parts=[],n=e=0;e<=14;n=e+=2)this.parts.push(r[n]<<8|r[n+1]);else{if(8!==r.length)throw new Error("ipaddr: ipv6 part count should be 8 or 16");this.parts=r}for(i=0,o=(s=this.parts).length;i<o;i++)if(!(0<=(a=s[i])&&a<=65535))throw new Error("ipaddr: ipv6 part should fit in 16 bits");t&&(this.zoneId=t)}return r.prototype.kind=function(){return"ipv6"},r.prototype.toString=function(){return this.toNormalizedString().replace(/((^|:)(0(:|$))+)/,"::")},r.prototype.toRFC5952String=function(){var r,t,n,e,i;for(e=/((^|:)(0(:|$)){2,})/g,i=this.toNormalizedString(),r=0,t=-1;n=e.exec(i);)n[0].length>t&&(r=n.index,t=n[0].length);return t<0?i:i.substring(0,r)+"::"+i.substring(r+t)},r.prototype.toByteArray=function(){var r,t,n,e,i;for(r=[],t=0,n=(i=this.parts).length;t<n;t++)e=i[t],r.push(e>>8),r.push(255&e);return r},r.prototype.toNormalizedString=function(){var r,t,n;return r=function(){var r,n,e,i;for(i=[],r=0,n=(e=this.parts).length;r<n;r++)t=e[r],i.push(t.toString(16));return i}.call(this).join(":"),n="",this.zoneId&&(n="%"+this.zoneId),r+n},r.prototype.toFixedLengthString=function(){var r,t,n;return r=function(){var r,n,e,i;for(i=[],r=0,n=(e=this.parts).length;r<n;r++)t=e[r],i.push(t.toString(16).padStart(4,"0"));return i}.call(this).join(":"),n="",this.zoneId&&(n="%"+this.zoneId),r+n},r.prototype.match=function(r,t){var n;if(void 0===t&&(r=(n=r)[0],t=n[1]),"ipv6"!==r.kind())throw new Error("ipaddr: cannot match ipv6 address with non-ipv6 one");return a(this.parts,r.parts,16,t)},r.prototype.SpecialRanges={unspecified:[new r([0,0,0,0,0,0,0,0]),128],linkLocal:[new r([65152,0,0,0,0,0,0,0]),10],multicast:[new r([65280,0,0,0,0,0,0,0]),8],loopback:[new r([0,0,0,0,0,0,0,1]),128],uniqueLocal:[new r([64512,0,0,0,0,0,0,0]),7],ipv4Mapped:[new r([0,0,0,0,0,65535,0,0]),96],rfc6145:[new r([0,0,0,0,65535,0,0,0]),96],rfc6052:[new r([100,65435,0,0,0,0,0,0]),96],"6to4":[new r([8194,0,0,0,0,0,0,0]),16],teredo:[new r([8193,0,0,0,0,0,0,0]),32],reserved:[[new r([8193,3512,0,0,0,0,0,0]),32]]},r.prototype.range=function(){return t.subnetMatch(this,this.SpecialRanges)},r.prototype.isIPv4MappedAddress=function(){return"ipv4Mapped"===this.range()},r.prototype.toIPv4Address=function(){var r,n,e;if(!this.isIPv4MappedAddress())throw new Error("ipaddr: trying to convert a generic ipv6 address to ipv4");return e=this.parts.slice(-2),r=e[0],n=e[1],new t.IPv4([r>>8,255&r,n>>8,255&n])},r.prototype.prefixLengthFromSubnetMask=function(){var r,t,n,e,i,o,a;for(a={0:16,32768:15,49152:14,57344:13,61440:12,63488:11,64512:10,65024:9,65280:8,65408:7,65472:6,65504:5,65520:4,65528:3,65532:2,65534:1,65535:0},r=0,i=!1,t=n=7;n>=0;t=n+=-1){if(!((e=this.parts[t])in a))return null;if(o=a[e],i&&0!==o)return null;16!==o&&(i=!0),r+=o}return 128-r},r}(),i="(?:[0-9a-f]+::?)+",o={zoneIndex:new RegExp("%[0-9a-z]{1,}","i"),native:new RegExp("^(::)?("+i+")?([0-9a-f]+)?(::)?(%[0-9a-z]{1,})?$","i"),transitional:new RegExp("^((?:"+i+")|(?:::)(?:"+i+")?)"+n+"\\."+n+"\\."+n+"\\."+n+"(%[0-9a-z]{1,})?$","i")},r=function(r,t){var n,e,i,a,s,p;if(r.indexOf("::")!==r.lastIndexOf("::"))return null;for((p=(r.match(o.zoneIndex)||[])[0])&&(p=p.substring(1),r=r.replace(/%.+$/,"")),n=0,e=-1;(e=r.indexOf(":",e+1))>=0;)n++;if("::"===r.substr(0,2)&&n--,"::"===r.substr(-2,2)&&n--,n>t)return null;for(s=t-n,a=":";s--;)a+="0:";return":"===(r=r.replace("::",a))[0]&&(r=r.slice(1)),":"===r[r.length-1]&&(r=r.slice(0,-1)),t=function(){var t,n,e,o;for(o=[],t=0,n=(e=r.split(":")).length;t<n;t++)i=e[t],o.push(parseInt(i,16));return o}(),{parts:t,zoneId:p}},t.IPv6.parser=function(t){var n,e,i,a,s,p,u;if(o.native.test(t))return r(t,8);if((a=t.match(o.transitional))&&(u=a[6]||"",(n=r(a[1].slice(0,-1)+u,6)).parts)){for(e=0,i=(p=[parseInt(a[2]),parseInt(a[3]),parseInt(a[4]),parseInt(a[5])]).length;e<i;e++)if(!(0<=(s=p[e])&&s<=255))return null;return n.parts.push(p[0]<<8|p[1]),n.parts.push(p[2]<<8|p[3]),{parts:n.parts,zoneId:n.zoneId}}return null},t.IPv4.isIPv4=t.IPv6.isIPv6=function(r){return null!==this.parser(r)},t.IPv4.isValid=function(r){try{return new this(this.parser(r)),!0}catch(r){return r,!1}},t.IPv4.isValidFourPartDecimal=function(r){return!(!t.IPv4.isValid(r)||!r.match(/^(0|[1-9]\d*)(\.(0|[1-9]\d*)){3}$/))},t.IPv6.isValid=function(r){var t;if("string"==typeof r&&-1===r.indexOf(":"))return!1;try{return t=this.parser(r),new this(t.parts,t.zoneId),!0}catch(r){return r,!1}},t.IPv4.parse=function(r){var t;if(null===(t=this.parser(r)))throw new Error("ipaddr: string is not formatted like ip address");return new this(t)},t.IPv6.parse=function(r){var t;if(null===(t=this.parser(r)).parts)throw new Error("ipaddr: string is not formatted like ip address");return new this(t.parts,t.zoneId)},t.IPv4.parseCIDR=function(r){var t,n,e;if((n=r.match(/^(.+)\/(\d+)$/))&&(t=parseInt(n[2]))>=0&&t<=32)return e=[this.parse(n[1]),t],Object.defineProperty(e,"toString",{value:function(){return this.join("/")}}),e;throw new Error("ipaddr: string is not formatted like an IPv4 CIDR range")},t.IPv4.subnetMaskFromPrefixLength=function(r){var t,n,e;if((r=parseInt(r))<0||r>32)throw new Error("ipaddr: invalid IPv4 prefix length");for(e=[0,0,0,0],n=0,t=Math.floor(r/8);n<t;)e[n]=255,n++;return t<4&&(e[t]=Math.pow(2,r%8)-1<<8-r%8),new this(e)},t.IPv4.broadcastAddressFromCIDR=function(r){var t,n,e,i,o;try{for(e=(t=this.parseCIDR(r))[0].toByteArray(),o=this.subnetMaskFromPrefixLength(t[1]).toByteArray(),i=[],n=0;n<4;)i.push(parseInt(e[n],10)|255^parseInt(o[n],10)),n++;return new this(i)}catch(r){throw r,new Error("ipaddr: the address does not have IPv4 CIDR format")}},t.IPv4.networkAddressFromCIDR=function(r){var t,n,e,i,o;try{for(e=(t=this.parseCIDR(r))[0].toByteArray(),o=this.subnetMaskFromPrefixLength(t[1]).toByteArray(),i=[],n=0;n<4;)i.push(parseInt(e[n],10)&parseInt(o[n],10)),n++;return new this(i)}catch(r){throw r,new Error("ipaddr: the address does not have IPv4 CIDR format")}},t.IPv6.parseCIDR=function(r){var t,n,e;if((n=r.match(/^(.+)\/(\d+)$/))&&(t=parseInt(n[2]))>=0&&t<=128)return e=[this.parse(n[1]),t],Object.defineProperty(e,"toString",{value:function(){return this.join("/")}}),e;throw new Error("ipaddr: string is not formatted like an IPv6 CIDR range")},t.isValid=function(r){return t.IPv6.isValid(r)||t.IPv4.isValid(r)},t.parse=function(r){if(t.IPv6.isValid(r))return t.IPv6.parse(r);if(t.IPv4.isValid(r))return t.IPv4.parse(r);throw new Error("ipaddr: the address has neither IPv6 nor IPv4 format")},t.parseCIDR=function(r){try{return t.IPv6.parseCIDR(r)}catch(n){n;try{return t.IPv4.parseCIDR(r)}catch(r){throw r,new Error("ipaddr: the address has neither IPv6 nor IPv4 CIDR format")}}},t.fromByteArray=function(r){var n;if(4===(n=r.length))return new t.IPv4(r);if(16===n)return new t.IPv6(r);throw new Error("ipaddr: the binary input is neither an IPv6 nor IPv4 address")},t.process=function(r){var t;return t=this.parse(r),"ipv6"===t.kind()&&t.isIPv4MappedAddress()?t.toIPv4Address():t}}).call(this); \ No newline at end of file diff --git a/node_modules/ipaddr.js/lib/ipaddr.js b/node_modules/ipaddr.js/lib/ipaddr.js new file mode 100644 index 0000000..18bd93b --- /dev/null +++ b/node_modules/ipaddr.js/lib/ipaddr.js @@ -0,0 +1,673 @@ +(function() { + var expandIPv6, ipaddr, ipv4Part, ipv4Regexes, ipv6Part, ipv6Regexes, matchCIDR, root, zoneIndex; + + ipaddr = {}; + + root = this; + + if ((typeof module !== "undefined" && module !== null) && module.exports) { + module.exports = ipaddr; + } else { + root['ipaddr'] = ipaddr; + } + + matchCIDR = function(first, second, partSize, cidrBits) { + var part, shift; + if (first.length !== second.length) { + throw new Error("ipaddr: cannot match CIDR for objects with different lengths"); + } + part = 0; + while (cidrBits > 0) { + shift = partSize - cidrBits; + if (shift < 0) { + shift = 0; + } + if (first[part] >> shift !== second[part] >> shift) { + return false; + } + cidrBits -= partSize; + part += 1; + } + return true; + }; + + ipaddr.subnetMatch = function(address, rangeList, defaultName) { + var k, len, rangeName, rangeSubnets, subnet; + if (defaultName == null) { + defaultName = 'unicast'; + } + for (rangeName in rangeList) { + rangeSubnets = rangeList[rangeName]; + if (rangeSubnets[0] && !(rangeSubnets[0] instanceof Array)) { + rangeSubnets = [rangeSubnets]; + } + for (k = 0, len = rangeSubnets.length; k < len; k++) { + subnet = rangeSubnets[k]; + if (address.kind() === subnet[0].kind()) { + if (address.match.apply(address, subnet)) { + return rangeName; + } + } + } + } + return defaultName; + }; + + ipaddr.IPv4 = (function() { + function IPv4(octets) { + var k, len, octet; + if (octets.length !== 4) { + throw new Error("ipaddr: ipv4 octet count should be 4"); + } + for (k = 0, len = octets.length; k < len; k++) { + octet = octets[k]; + if (!((0 <= octet && octet <= 255))) { + throw new Error("ipaddr: ipv4 octet should fit in 8 bits"); + } + } + this.octets = octets; + } + + IPv4.prototype.kind = function() { + return 'ipv4'; + }; + + IPv4.prototype.toString = function() { + return this.octets.join("."); + }; + + IPv4.prototype.toNormalizedString = function() { + return this.toString(); + }; + + IPv4.prototype.toByteArray = function() { + return this.octets.slice(0); + }; + + IPv4.prototype.match = function(other, cidrRange) { + var ref; + if (cidrRange === void 0) { + ref = other, other = ref[0], cidrRange = ref[1]; + } + if (other.kind() !== 'ipv4') { + throw new Error("ipaddr: cannot match ipv4 address with non-ipv4 one"); + } + return matchCIDR(this.octets, other.octets, 8, cidrRange); + }; + + IPv4.prototype.SpecialRanges = { + unspecified: [[new IPv4([0, 0, 0, 0]), 8]], + broadcast: [[new IPv4([255, 255, 255, 255]), 32]], + multicast: [[new IPv4([224, 0, 0, 0]), 4]], + linkLocal: [[new IPv4([169, 254, 0, 0]), 16]], + loopback: [[new IPv4([127, 0, 0, 0]), 8]], + carrierGradeNat: [[new IPv4([100, 64, 0, 0]), 10]], + "private": [[new IPv4([10, 0, 0, 0]), 8], [new IPv4([172, 16, 0, 0]), 12], [new IPv4([192, 168, 0, 0]), 16]], + reserved: [[new IPv4([192, 0, 0, 0]), 24], [new IPv4([192, 0, 2, 0]), 24], [new IPv4([192, 88, 99, 0]), 24], [new IPv4([198, 51, 100, 0]), 24], [new IPv4([203, 0, 113, 0]), 24], [new IPv4([240, 0, 0, 0]), 4]] + }; + + IPv4.prototype.range = function() { + return ipaddr.subnetMatch(this, this.SpecialRanges); + }; + + IPv4.prototype.toIPv4MappedAddress = function() { + return ipaddr.IPv6.parse("::ffff:" + (this.toString())); + }; + + IPv4.prototype.prefixLengthFromSubnetMask = function() { + var cidr, i, k, octet, stop, zeros, zerotable; + zerotable = { + 0: 8, + 128: 7, + 192: 6, + 224: 5, + 240: 4, + 248: 3, + 252: 2, + 254: 1, + 255: 0 + }; + cidr = 0; + stop = false; + for (i = k = 3; k >= 0; i = k += -1) { + octet = this.octets[i]; + if (octet in zerotable) { + zeros = zerotable[octet]; + if (stop && zeros !== 0) { + return null; + } + if (zeros !== 8) { + stop = true; + } + cidr += zeros; + } else { + return null; + } + } + return 32 - cidr; + }; + + return IPv4; + + })(); + + ipv4Part = "(0?\\d+|0x[a-f0-9]+)"; + + ipv4Regexes = { + fourOctet: new RegExp("^" + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "$", 'i'), + longValue: new RegExp("^" + ipv4Part + "$", 'i') + }; + + ipaddr.IPv4.parser = function(string) { + var match, parseIntAuto, part, shift, value; + parseIntAuto = function(string) { + if (string[0] === "0" && string[1] !== "x") { + return parseInt(string, 8); + } else { + return parseInt(string); + } + }; + if (match = string.match(ipv4Regexes.fourOctet)) { + return (function() { + var k, len, ref, results; + ref = match.slice(1, 6); + results = []; + for (k = 0, len = ref.length; k < len; k++) { + part = ref[k]; + results.push(parseIntAuto(part)); + } + return results; + })(); + } else if (match = string.match(ipv4Regexes.longValue)) { + value = parseIntAuto(match[1]); + if (value > 0xffffffff || value < 0) { + throw new Error("ipaddr: address outside defined range"); + } + return ((function() { + var k, results; + results = []; + for (shift = k = 0; k <= 24; shift = k += 8) { + results.push((value >> shift) & 0xff); + } + return results; + })()).reverse(); + } else { + return null; + } + }; + + ipaddr.IPv6 = (function() { + function IPv6(parts, zoneId) { + var i, k, l, len, part, ref; + if (parts.length === 16) { + this.parts = []; + for (i = k = 0; k <= 14; i = k += 2) { + this.parts.push((parts[i] << 8) | parts[i + 1]); + } + } else if (parts.length === 8) { + this.parts = parts; + } else { + throw new Error("ipaddr: ipv6 part count should be 8 or 16"); + } + ref = this.parts; + for (l = 0, len = ref.length; l < len; l++) { + part = ref[l]; + if (!((0 <= part && part <= 0xffff))) { + throw new Error("ipaddr: ipv6 part should fit in 16 bits"); + } + } + if (zoneId) { + this.zoneId = zoneId; + } + } + + IPv6.prototype.kind = function() { + return 'ipv6'; + }; + + IPv6.prototype.toString = function() { + return this.toNormalizedString().replace(/((^|:)(0(:|$))+)/, '::'); + }; + + IPv6.prototype.toRFC5952String = function() { + var bestMatchIndex, bestMatchLength, match, regex, string; + regex = /((^|:)(0(:|$)){2,})/g; + string = this.toNormalizedString(); + bestMatchIndex = 0; + bestMatchLength = -1; + while ((match = regex.exec(string))) { + if (match[0].length > bestMatchLength) { + bestMatchIndex = match.index; + bestMatchLength = match[0].length; + } + } + if (bestMatchLength < 0) { + return string; + } + return string.substring(0, bestMatchIndex) + '::' + string.substring(bestMatchIndex + bestMatchLength); + }; + + IPv6.prototype.toByteArray = function() { + var bytes, k, len, part, ref; + bytes = []; + ref = this.parts; + for (k = 0, len = ref.length; k < len; k++) { + part = ref[k]; + bytes.push(part >> 8); + bytes.push(part & 0xff); + } + return bytes; + }; + + IPv6.prototype.toNormalizedString = function() { + var addr, part, suffix; + addr = ((function() { + var k, len, ref, results; + ref = this.parts; + results = []; + for (k = 0, len = ref.length; k < len; k++) { + part = ref[k]; + results.push(part.toString(16)); + } + return results; + }).call(this)).join(":"); + suffix = ''; + if (this.zoneId) { + suffix = '%' + this.zoneId; + } + return addr + suffix; + }; + + IPv6.prototype.toFixedLengthString = function() { + var addr, part, suffix; + addr = ((function() { + var k, len, ref, results; + ref = this.parts; + results = []; + for (k = 0, len = ref.length; k < len; k++) { + part = ref[k]; + results.push(part.toString(16).padStart(4, '0')); + } + return results; + }).call(this)).join(":"); + suffix = ''; + if (this.zoneId) { + suffix = '%' + this.zoneId; + } + return addr + suffix; + }; + + IPv6.prototype.match = function(other, cidrRange) { + var ref; + if (cidrRange === void 0) { + ref = other, other = ref[0], cidrRange = ref[1]; + } + if (other.kind() !== 'ipv6') { + throw new Error("ipaddr: cannot match ipv6 address with non-ipv6 one"); + } + return matchCIDR(this.parts, other.parts, 16, cidrRange); + }; + + IPv6.prototype.SpecialRanges = { + unspecified: [new IPv6([0, 0, 0, 0, 0, 0, 0, 0]), 128], + linkLocal: [new IPv6([0xfe80, 0, 0, 0, 0, 0, 0, 0]), 10], + multicast: [new IPv6([0xff00, 0, 0, 0, 0, 0, 0, 0]), 8], + loopback: [new IPv6([0, 0, 0, 0, 0, 0, 0, 1]), 128], + uniqueLocal: [new IPv6([0xfc00, 0, 0, 0, 0, 0, 0, 0]), 7], + ipv4Mapped: [new IPv6([0, 0, 0, 0, 0, 0xffff, 0, 0]), 96], + rfc6145: [new IPv6([0, 0, 0, 0, 0xffff, 0, 0, 0]), 96], + rfc6052: [new IPv6([0x64, 0xff9b, 0, 0, 0, 0, 0, 0]), 96], + '6to4': [new IPv6([0x2002, 0, 0, 0, 0, 0, 0, 0]), 16], + teredo: [new IPv6([0x2001, 0, 0, 0, 0, 0, 0, 0]), 32], + reserved: [[new IPv6([0x2001, 0xdb8, 0, 0, 0, 0, 0, 0]), 32]] + }; + + IPv6.prototype.range = function() { + return ipaddr.subnetMatch(this, this.SpecialRanges); + }; + + IPv6.prototype.isIPv4MappedAddress = function() { + return this.range() === 'ipv4Mapped'; + }; + + IPv6.prototype.toIPv4Address = function() { + var high, low, ref; + if (!this.isIPv4MappedAddress()) { + throw new Error("ipaddr: trying to convert a generic ipv6 address to ipv4"); + } + ref = this.parts.slice(-2), high = ref[0], low = ref[1]; + return new ipaddr.IPv4([high >> 8, high & 0xff, low >> 8, low & 0xff]); + }; + + IPv6.prototype.prefixLengthFromSubnetMask = function() { + var cidr, i, k, part, stop, zeros, zerotable; + zerotable = { + 0: 16, + 32768: 15, + 49152: 14, + 57344: 13, + 61440: 12, + 63488: 11, + 64512: 10, + 65024: 9, + 65280: 8, + 65408: 7, + 65472: 6, + 65504: 5, + 65520: 4, + 65528: 3, + 65532: 2, + 65534: 1, + 65535: 0 + }; + cidr = 0; + stop = false; + for (i = k = 7; k >= 0; i = k += -1) { + part = this.parts[i]; + if (part in zerotable) { + zeros = zerotable[part]; + if (stop && zeros !== 0) { + return null; + } + if (zeros !== 16) { + stop = true; + } + cidr += zeros; + } else { + return null; + } + } + return 128 - cidr; + }; + + return IPv6; + + })(); + + ipv6Part = "(?:[0-9a-f]+::?)+"; + + zoneIndex = "%[0-9a-z]{1,}"; + + ipv6Regexes = { + zoneIndex: new RegExp(zoneIndex, 'i'), + "native": new RegExp("^(::)?(" + ipv6Part + ")?([0-9a-f]+)?(::)?(" + zoneIndex + ")?$", 'i'), + transitional: new RegExp(("^((?:" + ipv6Part + ")|(?:::)(?:" + ipv6Part + ")?)") + (ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part) + ("(" + zoneIndex + ")?$"), 'i') + }; + + expandIPv6 = function(string, parts) { + var colonCount, lastColon, part, replacement, replacementCount, zoneId; + if (string.indexOf('::') !== string.lastIndexOf('::')) { + return null; + } + zoneId = (string.match(ipv6Regexes['zoneIndex']) || [])[0]; + if (zoneId) { + zoneId = zoneId.substring(1); + string = string.replace(/%.+$/, ''); + } + colonCount = 0; + lastColon = -1; + while ((lastColon = string.indexOf(':', lastColon + 1)) >= 0) { + colonCount++; + } + if (string.substr(0, 2) === '::') { + colonCount--; + } + if (string.substr(-2, 2) === '::') { + colonCount--; + } + if (colonCount > parts) { + return null; + } + replacementCount = parts - colonCount; + replacement = ':'; + while (replacementCount--) { + replacement += '0:'; + } + string = string.replace('::', replacement); + if (string[0] === ':') { + string = string.slice(1); + } + if (string[string.length - 1] === ':') { + string = string.slice(0, -1); + } + parts = (function() { + var k, len, ref, results; + ref = string.split(":"); + results = []; + for (k = 0, len = ref.length; k < len; k++) { + part = ref[k]; + results.push(parseInt(part, 16)); + } + return results; + })(); + return { + parts: parts, + zoneId: zoneId + }; + }; + + ipaddr.IPv6.parser = function(string) { + var addr, k, len, match, octet, octets, zoneId; + if (ipv6Regexes['native'].test(string)) { + return expandIPv6(string, 8); + } else if (match = string.match(ipv6Regexes['transitional'])) { + zoneId = match[6] || ''; + addr = expandIPv6(match[1].slice(0, -1) + zoneId, 6); + if (addr.parts) { + octets = [parseInt(match[2]), parseInt(match[3]), parseInt(match[4]), parseInt(match[5])]; + for (k = 0, len = octets.length; k < len; k++) { + octet = octets[k]; + if (!((0 <= octet && octet <= 255))) { + return null; + } + } + addr.parts.push(octets[0] << 8 | octets[1]); + addr.parts.push(octets[2] << 8 | octets[3]); + return { + parts: addr.parts, + zoneId: addr.zoneId + }; + } + } + return null; + }; + + ipaddr.IPv4.isIPv4 = ipaddr.IPv6.isIPv6 = function(string) { + return this.parser(string) !== null; + }; + + ipaddr.IPv4.isValid = function(string) { + var e; + try { + new this(this.parser(string)); + return true; + } catch (error1) { + e = error1; + return false; + } + }; + + ipaddr.IPv4.isValidFourPartDecimal = function(string) { + if (ipaddr.IPv4.isValid(string) && string.match(/^(0|[1-9]\d*)(\.(0|[1-9]\d*)){3}$/)) { + return true; + } else { + return false; + } + }; + + ipaddr.IPv6.isValid = function(string) { + var addr, e; + if (typeof string === "string" && string.indexOf(":") === -1) { + return false; + } + try { + addr = this.parser(string); + new this(addr.parts, addr.zoneId); + return true; + } catch (error1) { + e = error1; + return false; + } + }; + + ipaddr.IPv4.parse = function(string) { + var parts; + parts = this.parser(string); + if (parts === null) { + throw new Error("ipaddr: string is not formatted like ip address"); + } + return new this(parts); + }; + + ipaddr.IPv6.parse = function(string) { + var addr; + addr = this.parser(string); + if (addr.parts === null) { + throw new Error("ipaddr: string is not formatted like ip address"); + } + return new this(addr.parts, addr.zoneId); + }; + + ipaddr.IPv4.parseCIDR = function(string) { + var maskLength, match, parsed; + if (match = string.match(/^(.+)\/(\d+)$/)) { + maskLength = parseInt(match[2]); + if (maskLength >= 0 && maskLength <= 32) { + parsed = [this.parse(match[1]), maskLength]; + Object.defineProperty(parsed, 'toString', { + value: function() { + return this.join('/'); + } + }); + return parsed; + } + } + throw new Error("ipaddr: string is not formatted like an IPv4 CIDR range"); + }; + + ipaddr.IPv4.subnetMaskFromPrefixLength = function(prefix) { + var filledOctetCount, j, octets; + prefix = parseInt(prefix); + if (prefix < 0 || prefix > 32) { + throw new Error('ipaddr: invalid IPv4 prefix length'); + } + octets = [0, 0, 0, 0]; + j = 0; + filledOctetCount = Math.floor(prefix / 8); + while (j < filledOctetCount) { + octets[j] = 255; + j++; + } + if (filledOctetCount < 4) { + octets[filledOctetCount] = Math.pow(2, prefix % 8) - 1 << 8 - (prefix % 8); + } + return new this(octets); + }; + + ipaddr.IPv4.broadcastAddressFromCIDR = function(string) { + var cidr, error, i, ipInterfaceOctets, octets, subnetMaskOctets; + try { + cidr = this.parseCIDR(string); + ipInterfaceOctets = cidr[0].toByteArray(); + subnetMaskOctets = this.subnetMaskFromPrefixLength(cidr[1]).toByteArray(); + octets = []; + i = 0; + while (i < 4) { + octets.push(parseInt(ipInterfaceOctets[i], 10) | parseInt(subnetMaskOctets[i], 10) ^ 255); + i++; + } + return new this(octets); + } catch (error1) { + error = error1; + throw new Error('ipaddr: the address does not have IPv4 CIDR format'); + } + }; + + ipaddr.IPv4.networkAddressFromCIDR = function(string) { + var cidr, error, i, ipInterfaceOctets, octets, subnetMaskOctets; + try { + cidr = this.parseCIDR(string); + ipInterfaceOctets = cidr[0].toByteArray(); + subnetMaskOctets = this.subnetMaskFromPrefixLength(cidr[1]).toByteArray(); + octets = []; + i = 0; + while (i < 4) { + octets.push(parseInt(ipInterfaceOctets[i], 10) & parseInt(subnetMaskOctets[i], 10)); + i++; + } + return new this(octets); + } catch (error1) { + error = error1; + throw new Error('ipaddr: the address does not have IPv4 CIDR format'); + } + }; + + ipaddr.IPv6.parseCIDR = function(string) { + var maskLength, match, parsed; + if (match = string.match(/^(.+)\/(\d+)$/)) { + maskLength = parseInt(match[2]); + if (maskLength >= 0 && maskLength <= 128) { + parsed = [this.parse(match[1]), maskLength]; + Object.defineProperty(parsed, 'toString', { + value: function() { + return this.join('/'); + } + }); + return parsed; + } + } + throw new Error("ipaddr: string is not formatted like an IPv6 CIDR range"); + }; + + ipaddr.isValid = function(string) { + return ipaddr.IPv6.isValid(string) || ipaddr.IPv4.isValid(string); + }; + + ipaddr.parse = function(string) { + if (ipaddr.IPv6.isValid(string)) { + return ipaddr.IPv6.parse(string); + } else if (ipaddr.IPv4.isValid(string)) { + return ipaddr.IPv4.parse(string); + } else { + throw new Error("ipaddr: the address has neither IPv6 nor IPv4 format"); + } + }; + + ipaddr.parseCIDR = function(string) { + var e; + try { + return ipaddr.IPv6.parseCIDR(string); + } catch (error1) { + e = error1; + try { + return ipaddr.IPv4.parseCIDR(string); + } catch (error1) { + e = error1; + throw new Error("ipaddr: the address has neither IPv6 nor IPv4 CIDR format"); + } + } + }; + + ipaddr.fromByteArray = function(bytes) { + var length; + length = bytes.length; + if (length === 4) { + return new ipaddr.IPv4(bytes); + } else if (length === 16) { + return new ipaddr.IPv6(bytes); + } else { + throw new Error("ipaddr: the binary input is neither an IPv6 nor IPv4 address"); + } + }; + + ipaddr.process = function(string) { + var addr; + addr = this.parse(string); + if (addr.kind() === 'ipv6' && addr.isIPv4MappedAddress()) { + return addr.toIPv4Address(); + } else { + return addr; + } + }; + +}).call(this); diff --git a/node_modules/ipaddr.js/lib/ipaddr.js.d.ts b/node_modules/ipaddr.js/lib/ipaddr.js.d.ts new file mode 100644 index 0000000..ef01ac4 --- /dev/null +++ b/node_modules/ipaddr.js/lib/ipaddr.js.d.ts @@ -0,0 +1,71 @@ + + +declare module "ipaddr.js" { + + type IPv4Range = 'unicast' | 'unspecified' | 'broadcast' | 'multicast' | 'linkLocal' | 'loopback' | 'carrierGradeNat' | 'private' | 'reserved'; + type IPv6Range = 'unicast' | 'unspecified' | 'linkLocal' | 'multicast' | 'loopback' | 'uniqueLocal' | 'ipv4Mapped' | 'rfc6145' | 'rfc6052' | '6to4' | 'teredo' | 'reserved'; + + interface RangeList<T> { + [name: string]: [T, number] | [T, number][]; + } + + + // Common methods/properties for IPv4 and IPv6 classes. + class IP { + + prefixLengthFromSubnetMask(): number | false; + toByteArray(): number[]; + toNormalizedString(): string; + toString(): string; + } + + namespace Address { + + export function isValid(addr: string): boolean; + export function fromByteArray(bytes: number[]): IPv4 | IPv6; + export function parse(addr: string): IPv4 | IPv6; + export function parseCIDR(mask: string): [IPv4 | IPv6, number]; + export function process(address: string): IPv4 | IPv6; + export function subnetMatch(addr: IPv4, rangeList: RangeList<IPv4>, defaultName?: string): string; + export function subnetMatch(addr: IPv6, rangeList: RangeList<IPv6>, defaultName?: string): string; + + export class IPv4 extends IP { + static broadcastAddressFromCIDR(addr: string): IPv4; + static isIPv4(addr: string): boolean; + static isValidFourPartDecimal(addr: string): boolean; + static isValid(addr: string): boolean; + static networkAddressFromCIDR(addr: string): IPv4; + static parse(addr: string): IPv4; + static parseCIDR(addr: string): [IPv4, number]; + static subnetMaskFromPrefixLength(prefix: number): IPv4; + constructor(octets: number[]); + + kind(): 'ipv4'; + match(addr: IPv4, bits: number): boolean; + match(mask: [IPv4, number]): boolean; + range(): IPv4Range; + subnetMatch(rangeList: RangeList<IPv4>, defaultName?: string): string; + toIPv4MappedAddress(): IPv6; + } + + export class IPv6 extends IP { + static broadcastAddressFromCIDR(addr: string): IPv6; + static isIPv6(addr: string): boolean; + static isValid(addr: string): boolean; + static parse(addr: string): IPv6; + static parseCIDR(addr: string): [IPv6, number]; + static subnetMaskFromPrefixLength(prefix: number): IPv6; + constructor(octets: number[]); + + isIPv4MappedAddress(): boolean; + kind(): 'ipv6'; + match(addr: IPv6, bits: number): boolean; + match(mask: [IPv6, number]): boolean; + range(): IPv6Range; + subnetMatch(rangeList: RangeList<IPv6>, defaultName?: string): string; + toIPv4Address(): IPv4; + } + } + + export = Address; +} diff --git a/node_modules/ipaddr.js/package.json b/node_modules/ipaddr.js/package.json new file mode 100644 index 0000000..d859191 --- /dev/null +++ b/node_modules/ipaddr.js/package.json @@ -0,0 +1,69 @@ +{ + "_from": "ipaddr.js@1.9.0", + "_id": "ipaddr.js@1.9.0", + "_inBundle": false, + "_integrity": "sha512-M4Sjn6N/+O6/IXSJseKqHoFc+5FdGJ22sXqnjTpdZweHK64MzEPAyQZyEU3R/KRv2GLoa7nNtg/C2Ev6m7z+eA==", + "_location": "/ipaddr.js", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ipaddr.js@1.9.0", + "name": "ipaddr.js", + "escapedName": "ipaddr.js", + "rawSpec": "1.9.0", + "saveSpec": null, + "fetchSpec": "1.9.0" + }, + "_requiredBy": [ + "/proxy-addr" + ], + "_resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.0.tgz", + "_shasum": "37df74e430a0e47550fe54a2defe30d8acd95f65", + "_spec": "ipaddr.js@1.9.0", + "_where": "/home/josuer08/Documents/web/node_modules/proxy-addr", + "author": { + "name": "whitequark", + "email": "whitequark@whitequark.org" + }, + "bugs": { + "url": "https://github.com/whitequark/ipaddr.js/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "A library for manipulating IPv4 and IPv6 addresses in JavaScript.", + "devDependencies": { + "coffee-script": "~1.12.6", + "nodeunit": ">=0.8.2 <0.8.7", + "uglify-js": "~3.0.19" + }, + "directories": { + "lib": "./lib" + }, + "engines": { + "node": ">= 0.10" + }, + "files": [ + "lib/", + "ipaddr.min.js" + ], + "homepage": "https://github.com/whitequark/ipaddr.js#readme", + "keywords": [ + "ip", + "ipv4", + "ipv6" + ], + "license": "MIT", + "main": "./lib/ipaddr.js", + "name": "ipaddr.js", + "repository": { + "type": "git", + "url": "git://github.com/whitequark/ipaddr.js.git" + }, + "scripts": { + "test": "cake build test" + }, + "types": "./lib/ipaddr.js.d.ts", + "version": "1.9.0" +} diff --git a/node_modules/media-typer/HISTORY.md b/node_modules/media-typer/HISTORY.md new file mode 100644 index 0000000..62c2003 --- /dev/null +++ b/node_modules/media-typer/HISTORY.md @@ -0,0 +1,22 @@ +0.3.0 / 2014-09-07 +================== + + * Support Node.js 0.6 + * Throw error when parameter format invalid on parse + +0.2.0 / 2014-06-18 +================== + + * Add `typer.format()` to format media types + +0.1.0 / 2014-06-17 +================== + + * Accept `req` as argument to `parse` + * Accept `res` as argument to `parse` + * Parse media type with extra LWS between type and first parameter + +0.0.0 / 2014-06-13 +================== + + * Initial implementation diff --git a/node_modules/media-typer/LICENSE b/node_modules/media-typer/LICENSE new file mode 100644 index 0000000..b7dce6c --- /dev/null +++ b/node_modules/media-typer/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/media-typer/README.md b/node_modules/media-typer/README.md new file mode 100644 index 0000000..d8df623 --- /dev/null +++ b/node_modules/media-typer/README.md @@ -0,0 +1,81 @@ +# media-typer + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Simple RFC 6838 media type parser + +## Installation + +```sh +$ npm install media-typer +``` + +## API + +```js +var typer = require('media-typer') +``` + +### typer.parse(string) + +```js +var obj = typer.parse('image/svg+xml; charset=utf-8') +``` + +Parse a media type string. This will return an object with the following +properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`): + + - `type`: The type of the media type (always lower case). Example: `'image'` + + - `subtype`: The subtype of the media type (always lower case). Example: `'svg'` + + - `suffix`: The suffix of the media type (always lower case). Example: `'xml'` + + - `parameters`: An object of the parameters in the media type (name of parameter always lower case). Example: `{charset: 'utf-8'}` + +### typer.parse(req) + +```js +var obj = typer.parse(req) +``` + +Parse the `content-type` header from the given `req`. Short-cut for +`typer.parse(req.headers['content-type'])`. + +### typer.parse(res) + +```js +var obj = typer.parse(res) +``` + +Parse the `content-type` header set on the given `res`. Short-cut for +`typer.parse(res.getHeader('content-type'))`. + +### typer.format(obj) + +```js +var obj = typer.format({type: 'image', subtype: 'svg', suffix: 'xml'}) +``` + +Format an object into a media type string. This will return a string of the +mime type for the given object. For the properties of the object, see the +documentation for `typer.parse(string)`. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/media-typer.svg?style=flat +[npm-url]: https://npmjs.org/package/media-typer +[node-version-image]: https://img.shields.io/badge/node.js-%3E%3D_0.6-brightgreen.svg?style=flat +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/media-typer.svg?style=flat +[travis-url]: https://travis-ci.org/jshttp/media-typer +[coveralls-image]: https://img.shields.io/coveralls/jshttp/media-typer.svg?style=flat +[coveralls-url]: https://coveralls.io/r/jshttp/media-typer +[downloads-image]: https://img.shields.io/npm/dm/media-typer.svg?style=flat +[downloads-url]: https://npmjs.org/package/media-typer diff --git a/node_modules/media-typer/index.js b/node_modules/media-typer/index.js new file mode 100644 index 0000000..07f7295 --- /dev/null +++ b/node_modules/media-typer/index.js @@ -0,0 +1,270 @@ +/*! + * media-typer + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * RegExp to match *( ";" parameter ) in RFC 2616 sec 3.7 + * + * parameter = token "=" ( token | quoted-string ) + * token = 1*<any CHAR except CTLs or separators> + * separators = "(" | ")" | "<" | ">" | "@" + * | "," | ";" | ":" | "\" | <"> + * | "/" | "[" | "]" | "?" | "=" + * | "{" | "}" | SP | HT + * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> ) + * qdtext = <any TEXT except <">> + * quoted-pair = "\" CHAR + * CHAR = <any US-ASCII character (octets 0 - 127)> + * TEXT = <any OCTET except CTLs, but including LWS> + * LWS = [CRLF] 1*( SP | HT ) + * CRLF = CR LF + * CR = <US-ASCII CR, carriage return (13)> + * LF = <US-ASCII LF, linefeed (10)> + * SP = <US-ASCII SP, space (32)> + * SHT = <US-ASCII HT, horizontal-tab (9)> + * CTL = <any US-ASCII control character (octets 0 - 31) and DEL (127)> + * OCTET = <any 8-bit sequence of data> + */ +var paramRegExp = /; *([!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+) *= *("(?:[ !\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u0020-\u007e])*"|[!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+) */g; +var textRegExp = /^[\u0020-\u007e\u0080-\u00ff]+$/ +var tokenRegExp = /^[!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+$/ + +/** + * RegExp to match quoted-pair in RFC 2616 + * + * quoted-pair = "\" CHAR + * CHAR = <any US-ASCII character (octets 0 - 127)> + */ +var qescRegExp = /\\([\u0000-\u007f])/g; + +/** + * RegExp to match chars that must be quoted-pair in RFC 2616 + */ +var quoteRegExp = /([\\"])/g; + +/** + * RegExp to match type in RFC 6838 + * + * type-name = restricted-name + * subtype-name = restricted-name + * restricted-name = restricted-name-first *126restricted-name-chars + * restricted-name-first = ALPHA / DIGIT + * restricted-name-chars = ALPHA / DIGIT / "!" / "#" / + * "$" / "&" / "-" / "^" / "_" + * restricted-name-chars =/ "." ; Characters before first dot always + * ; specify a facet name + * restricted-name-chars =/ "+" ; Characters after last plus always + * ; specify a structured syntax suffix + * ALPHA = %x41-5A / %x61-7A ; A-Z / a-z + * DIGIT = %x30-39 ; 0-9 + */ +var subtypeNameRegExp = /^[A-Za-z0-9][A-Za-z0-9!#$&^_.-]{0,126}$/ +var typeNameRegExp = /^[A-Za-z0-9][A-Za-z0-9!#$&^_-]{0,126}$/ +var typeRegExp = /^ *([A-Za-z0-9][A-Za-z0-9!#$&^_-]{0,126})\/([A-Za-z0-9][A-Za-z0-9!#$&^_.+-]{0,126}) *$/; + +/** + * Module exports. + */ + +exports.format = format +exports.parse = parse + +/** + * Format object to media type. + * + * @param {object} obj + * @return {string} + * @api public + */ + +function format(obj) { + if (!obj || typeof obj !== 'object') { + throw new TypeError('argument obj is required') + } + + var parameters = obj.parameters + var subtype = obj.subtype + var suffix = obj.suffix + var type = obj.type + + if (!type || !typeNameRegExp.test(type)) { + throw new TypeError('invalid type') + } + + if (!subtype || !subtypeNameRegExp.test(subtype)) { + throw new TypeError('invalid subtype') + } + + // format as type/subtype + var string = type + '/' + subtype + + // append +suffix + if (suffix) { + if (!typeNameRegExp.test(suffix)) { + throw new TypeError('invalid suffix') + } + + string += '+' + suffix + } + + // append parameters + if (parameters && typeof parameters === 'object') { + var param + var params = Object.keys(parameters).sort() + + for (var i = 0; i < params.length; i++) { + param = params[i] + + if (!tokenRegExp.test(param)) { + throw new TypeError('invalid parameter name') + } + + string += '; ' + param + '=' + qstring(parameters[param]) + } + } + + return string +} + +/** + * Parse media type to object. + * + * @param {string|object} string + * @return {Object} + * @api public + */ + +function parse(string) { + if (!string) { + throw new TypeError('argument string is required') + } + + // support req/res-like objects as argument + if (typeof string === 'object') { + string = getcontenttype(string) + } + + if (typeof string !== 'string') { + throw new TypeError('argument string is required to be a string') + } + + var index = string.indexOf(';') + var type = index !== -1 + ? string.substr(0, index) + : string + + var key + var match + var obj = splitType(type) + var params = {} + var value + + paramRegExp.lastIndex = index + + while (match = paramRegExp.exec(string)) { + if (match.index !== index) { + throw new TypeError('invalid parameter format') + } + + index += match[0].length + key = match[1].toLowerCase() + value = match[2] + + if (value[0] === '"') { + // remove quotes and escapes + value = value + .substr(1, value.length - 2) + .replace(qescRegExp, '$1') + } + + params[key] = value + } + + if (index !== -1 && index !== string.length) { + throw new TypeError('invalid parameter format') + } + + obj.parameters = params + + return obj +} + +/** + * Get content-type from req/res objects. + * + * @param {object} + * @return {Object} + * @api private + */ + +function getcontenttype(obj) { + if (typeof obj.getHeader === 'function') { + // res-like + return obj.getHeader('content-type') + } + + if (typeof obj.headers === 'object') { + // req-like + return obj.headers && obj.headers['content-type'] + } +} + +/** + * Quote a string if necessary. + * + * @param {string} val + * @return {string} + * @api private + */ + +function qstring(val) { + var str = String(val) + + // no need to quote tokens + if (tokenRegExp.test(str)) { + return str + } + + if (str.length > 0 && !textRegExp.test(str)) { + throw new TypeError('invalid parameter value') + } + + return '"' + str.replace(quoteRegExp, '\\$1') + '"' +} + +/** + * Simply "type/subtype+siffx" into parts. + * + * @param {string} string + * @return {Object} + * @api private + */ + +function splitType(string) { + var match = typeRegExp.exec(string.toLowerCase()) + + if (!match) { + throw new TypeError('invalid media type') + } + + var type = match[1] + var subtype = match[2] + var suffix + + // suffix after last + + var index = subtype.lastIndexOf('+') + if (index !== -1) { + suffix = subtype.substr(index + 1) + subtype = subtype.substr(0, index) + } + + var obj = { + type: type, + subtype: subtype, + suffix: suffix + } + + return obj +} diff --git a/node_modules/media-typer/package.json b/node_modules/media-typer/package.json new file mode 100644 index 0000000..3c6e9a6 --- /dev/null +++ b/node_modules/media-typer/package.json @@ -0,0 +1,61 @@ +{ + "_from": "media-typer@0.3.0", + "_id": "media-typer@0.3.0", + "_inBundle": false, + "_integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=", + "_location": "/media-typer", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "media-typer@0.3.0", + "name": "media-typer", + "escapedName": "media-typer", + "rawSpec": "0.3.0", + "saveSpec": null, + "fetchSpec": "0.3.0" + }, + "_requiredBy": [ + "/type-is" + ], + "_resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "_shasum": "8710d7af0aa626f8fffa1ce00168545263255748", + "_spec": "media-typer@0.3.0", + "_where": "/home/josuer08/Documents/web/node_modules/type-is", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/media-typer/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Simple RFC 6838 media type parser and formatter", + "devDependencies": { + "istanbul": "0.3.2", + "mocha": "~1.21.4", + "should": "~4.0.4" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/media-typer#readme", + "license": "MIT", + "name": "media-typer", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/media-typer.git" + }, + "scripts": { + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "0.3.0" +} diff --git a/node_modules/merge-descriptors/HISTORY.md b/node_modules/merge-descriptors/HISTORY.md new file mode 100644 index 0000000..486771f --- /dev/null +++ b/node_modules/merge-descriptors/HISTORY.md @@ -0,0 +1,21 @@ +1.0.1 / 2016-01-17 +================== + + * perf: enable strict mode + +1.0.0 / 2015-03-01 +================== + + * Add option to only add new descriptors + * Add simple argument validation + * Add jsdoc to source file + +0.0.2 / 2013-12-14 +================== + + * Move repository to `component` organization + +0.0.1 / 2013-10-29 +================== + + * Initial release diff --git a/node_modules/merge-descriptors/LICENSE b/node_modules/merge-descriptors/LICENSE new file mode 100644 index 0000000..274bfd8 --- /dev/null +++ b/node_modules/merge-descriptors/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2013 Jonathan Ong <me@jongleberry.com> +Copyright (c) 2015 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/merge-descriptors/README.md b/node_modules/merge-descriptors/README.md new file mode 100644 index 0000000..d593c0e --- /dev/null +++ b/node_modules/merge-descriptors/README.md @@ -0,0 +1,48 @@ +# Merge Descriptors + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Merge objects using descriptors. + +```js +var thing = { + get name() { + return 'jon' + } +} + +var animal = { + +} + +merge(animal, thing) + +animal.name === 'jon' +``` + +## API + +### merge(destination, source) + +Redefines `destination`'s descriptors with `source`'s. + +### merge(destination, source, false) + +Defines `source`'s descriptors on `destination` if `destination` does not have +a descriptor by the same name. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/merge-descriptors.svg +[npm-url]: https://npmjs.org/package/merge-descriptors +[travis-image]: https://img.shields.io/travis/component/merge-descriptors/master.svg +[travis-url]: https://travis-ci.org/component/merge-descriptors +[coveralls-image]: https://img.shields.io/coveralls/component/merge-descriptors/master.svg +[coveralls-url]: https://coveralls.io/r/component/merge-descriptors?branch=master +[downloads-image]: https://img.shields.io/npm/dm/merge-descriptors.svg +[downloads-url]: https://npmjs.org/package/merge-descriptors diff --git a/node_modules/merge-descriptors/index.js b/node_modules/merge-descriptors/index.js new file mode 100644 index 0000000..573b132 --- /dev/null +++ b/node_modules/merge-descriptors/index.js @@ -0,0 +1,60 @@ +/*! + * merge-descriptors + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = merge + +/** + * Module variables. + * @private + */ + +var hasOwnProperty = Object.prototype.hasOwnProperty + +/** + * Merge the property descriptors of `src` into `dest` + * + * @param {object} dest Object to add descriptors to + * @param {object} src Object to clone descriptors from + * @param {boolean} [redefine=true] Redefine `dest` properties with `src` properties + * @returns {object} Reference to dest + * @public + */ + +function merge(dest, src, redefine) { + if (!dest) { + throw new TypeError('argument dest is required') + } + + if (!src) { + throw new TypeError('argument src is required') + } + + if (redefine === undefined) { + // Default to true + redefine = true + } + + Object.getOwnPropertyNames(src).forEach(function forEachOwnPropertyName(name) { + if (!redefine && hasOwnProperty.call(dest, name)) { + // Skip desriptor + return + } + + // Copy descriptor + var descriptor = Object.getOwnPropertyDescriptor(src, name) + Object.defineProperty(dest, name, descriptor) + }) + + return dest +} diff --git a/node_modules/merge-descriptors/package.json b/node_modules/merge-descriptors/package.json new file mode 100644 index 0000000..7395032 --- /dev/null +++ b/node_modules/merge-descriptors/package.json @@ -0,0 +1,69 @@ +{ + "_from": "merge-descriptors@1.0.1", + "_id": "merge-descriptors@1.0.1", + "_inBundle": false, + "_integrity": "sha1-sAqqVW3YtEVoFQ7J0blT8/kMu2E=", + "_location": "/merge-descriptors", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "merge-descriptors@1.0.1", + "name": "merge-descriptors", + "escapedName": "merge-descriptors", + "rawSpec": "1.0.1", + "saveSpec": null, + "fetchSpec": "1.0.1" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", + "_shasum": "b00aaa556dd8b44568150ec9d1b953f3f90cbb61", + "_spec": "merge-descriptors@1.0.1", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/component/merge-descriptors/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Mike Grabowski", + "email": "grabbou@gmail.com" + } + ], + "deprecated": false, + "description": "Merge objects using descriptors", + "devDependencies": { + "istanbul": "0.4.1", + "mocha": "1.21.5" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/component/merge-descriptors#readme", + "license": "MIT", + "name": "merge-descriptors", + "repository": { + "type": "git", + "url": "git+https://github.com/component/merge-descriptors.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + }, + "version": "1.0.1" +} diff --git a/node_modules/methods/HISTORY.md b/node_modules/methods/HISTORY.md new file mode 100644 index 0000000..c0ecf07 --- /dev/null +++ b/node_modules/methods/HISTORY.md @@ -0,0 +1,29 @@ +1.1.2 / 2016-01-17 +================== + + * perf: enable strict mode + +1.1.1 / 2014-12-30 +================== + + * Improve `browserify` support + +1.1.0 / 2014-07-05 +================== + + * Add `CONNECT` method + +1.0.1 / 2014-06-02 +================== + + * Fix module to work with harmony transform + +1.0.0 / 2014-05-08 +================== + + * Add `PURGE` method + +0.1.0 / 2013-10-28 +================== + + * Add `http.METHODS` support diff --git a/node_modules/methods/LICENSE b/node_modules/methods/LICENSE new file mode 100644 index 0000000..220dc1a --- /dev/null +++ b/node_modules/methods/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2013-2014 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2015-2016 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/methods/README.md b/node_modules/methods/README.md new file mode 100644 index 0000000..672a32b --- /dev/null +++ b/node_modules/methods/README.md @@ -0,0 +1,51 @@ +# Methods + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP verbs that Node.js core's HTTP parser supports. + +This module provides an export that is just like `http.METHODS` from Node.js core, +with the following differences: + + * All method names are lower-cased. + * Contains a fallback list of methods for Node.js versions that do not have a + `http.METHODS` export (0.10 and lower). + * Provides the fallback list when using tools like `browserify` without pulling + in the `http` shim module. + +## Install + +```bash +$ npm install methods +``` + +## API + +```js +var methods = require('methods') +``` + +### methods + +This is an array of lower-cased method names that Node.js supports. If Node.js +provides the `http.METHODS` export, then this is the same array lower-cased, +otherwise it is a snapshot of the verbs from Node.js 0.10. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/methods.svg?style=flat +[npm-url]: https://npmjs.org/package/methods +[node-version-image]: https://img.shields.io/node/v/methods.svg?style=flat +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/methods.svg?style=flat +[travis-url]: https://travis-ci.org/jshttp/methods +[coveralls-image]: https://img.shields.io/coveralls/jshttp/methods.svg?style=flat +[coveralls-url]: https://coveralls.io/r/jshttp/methods?branch=master +[downloads-image]: https://img.shields.io/npm/dm/methods.svg?style=flat +[downloads-url]: https://npmjs.org/package/methods diff --git a/node_modules/methods/index.js b/node_modules/methods/index.js new file mode 100644 index 0000000..667a50b --- /dev/null +++ b/node_modules/methods/index.js @@ -0,0 +1,69 @@ +/*! + * methods + * Copyright(c) 2013-2014 TJ Holowaychuk + * Copyright(c) 2015-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var http = require('http'); + +/** + * Module exports. + * @public + */ + +module.exports = getCurrentNodeMethods() || getBasicNodeMethods(); + +/** + * Get the current Node.js methods. + * @private + */ + +function getCurrentNodeMethods() { + return http.METHODS && http.METHODS.map(function lowerCaseMethod(method) { + return method.toLowerCase(); + }); +} + +/** + * Get the "basic" Node.js methods, a snapshot from Node.js 0.10. + * @private + */ + +function getBasicNodeMethods() { + return [ + 'get', + 'post', + 'put', + 'head', + 'delete', + 'options', + 'trace', + 'copy', + 'lock', + 'mkcol', + 'move', + 'purge', + 'propfind', + 'proppatch', + 'unlock', + 'report', + 'mkactivity', + 'checkout', + 'merge', + 'm-search', + 'notify', + 'subscribe', + 'unsubscribe', + 'patch', + 'search', + 'connect' + ]; +} diff --git a/node_modules/methods/package.json b/node_modules/methods/package.json new file mode 100644 index 0000000..e44823e --- /dev/null +++ b/node_modules/methods/package.json @@ -0,0 +1,79 @@ +{ + "_from": "methods@~1.1.2", + "_id": "methods@1.1.2", + "_inBundle": false, + "_integrity": "sha1-VSmk1nZUE07cxSZmVoNbD4Ua/O4=", + "_location": "/methods", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "methods@~1.1.2", + "name": "methods", + "escapedName": "methods", + "rawSpec": "~1.1.2", + "saveSpec": null, + "fetchSpec": "~1.1.2" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "_shasum": "5529a4d67654134edcc5266656835b0f851afcee", + "_spec": "methods@~1.1.2", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "browser": { + "http": false + }, + "bugs": { + "url": "https://github.com/jshttp/methods/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + } + ], + "deprecated": false, + "description": "HTTP methods that node supports", + "devDependencies": { + "istanbul": "0.4.1", + "mocha": "1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "index.js", + "HISTORY.md", + "LICENSE" + ], + "homepage": "https://github.com/jshttp/methods#readme", + "keywords": [ + "http", + "methods" + ], + "license": "MIT", + "name": "methods", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/methods.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.2" +} diff --git a/node_modules/mime-db/HISTORY.md b/node_modules/mime-db/HISTORY.md new file mode 100644 index 0000000..0907d62 --- /dev/null +++ b/node_modules/mime-db/HISTORY.md @@ -0,0 +1,417 @@ +1.40.0 / 2019-04-20 +=================== + + * Add extensions from IANA for `model/*` types + * Add `text/mdx` with extension `.mdx` + +1.39.0 / 2019-04-04 +=================== + + * Add extensions `.siv` and `.sieve` to `application/sieve` + * Add new upstream MIME types + +1.38.0 / 2019-02-04 +=================== + + * Add extension `.nq` to `application/n-quads` + * Add extension `.nt` to `application/n-triples` + * Add new upstream MIME types + * Mark `text/less` as compressible + +1.37.0 / 2018-10-19 +=================== + + * Add extensions to HEIC image types + * Add new upstream MIME types + +1.36.0 / 2018-08-20 +=================== + + * Add Apple file extensions from IANA + * Add extensions from IANA for `image/*` types + * Add new upstream MIME types + +1.35.0 / 2018-07-15 +=================== + + * Add extension `.owl` to `application/rdf+xml` + * Add new upstream MIME types + - Removes extension `.woff` from `application/font-woff` + +1.34.0 / 2018-06-03 +=================== + + * Add extension `.csl` to `application/vnd.citationstyles.style+xml` + * Add extension `.es` to `application/ecmascript` + * Add new upstream MIME types + * Add `UTF-8` as default charset for `text/turtle` + * Mark all XML-derived types as compressible + +1.33.0 / 2018-02-15 +=================== + + * Add extensions from IANA for `message/*` types + * Add new upstream MIME types + * Fix some incorrect OOXML types + * Remove `application/font-woff2` + +1.32.0 / 2017-11-29 +=================== + + * Add new upstream MIME types + * Update `text/hjson` to registered `application/hjson` + * Add `text/shex` with extension `.shex` + +1.31.0 / 2017-10-25 +=================== + + * Add `application/raml+yaml` with extension `.raml` + * Add `application/wasm` with extension `.wasm` + * Add new `font` type from IANA + * Add new upstream font extensions + * Add new upstream MIME types + * Add extensions for JPEG-2000 images + +1.30.0 / 2017-08-27 +=================== + + * Add `application/vnd.ms-outlook` + * Add `application/x-arj` + * Add extension `.mjs` to `application/javascript` + * Add glTF types and extensions + * Add new upstream MIME types + * Add `text/x-org` + * Add VirtualBox MIME types + * Fix `source` records for `video/*` types that are IANA + * Update `font/opentype` to registered `font/otf` + +1.29.0 / 2017-07-10 +=================== + + * Add `application/fido.trusted-apps+json` + * Add extension `.wadl` to `application/vnd.sun.wadl+xml` + * Add new upstream MIME types + * Add `UTF-8` as default charset for `text/css` + +1.28.0 / 2017-05-14 +=================== + + * Add new upstream MIME types + * Add extension `.gz` to `application/gzip` + * Update extensions `.md` and `.markdown` to be `text/markdown` + +1.27.0 / 2017-03-16 +=================== + + * Add new upstream MIME types + * Add `image/apng` with extension `.apng` + +1.26.0 / 2017-01-14 +=================== + + * Add new upstream MIME types + * Add extension `.geojson` to `application/geo+json` + +1.25.0 / 2016-11-11 +=================== + + * Add new upstream MIME types + +1.24.0 / 2016-09-18 +=================== + + * Add `audio/mp3` + * Add new upstream MIME types + +1.23.0 / 2016-05-01 +=================== + + * Add new upstream MIME types + * Add extension `.3gpp` to `audio/3gpp` + +1.22.0 / 2016-02-15 +=================== + + * Add `text/slim` + * Add extension `.rng` to `application/xml` + * Add new upstream MIME types + * Fix extension of `application/dash+xml` to be `.mpd` + * Update primary extension to `.m4a` for `audio/mp4` + +1.21.0 / 2016-01-06 +=================== + + * Add Google document types + * Add new upstream MIME types + +1.20.0 / 2015-11-10 +=================== + + * Add `text/x-suse-ymp` + * Add new upstream MIME types + +1.19.0 / 2015-09-17 +=================== + + * Add `application/vnd.apple.pkpass` + * Add new upstream MIME types + +1.18.0 / 2015-09-03 +=================== + + * Add new upstream MIME types + +1.17.0 / 2015-08-13 +=================== + + * Add `application/x-msdos-program` + * Add `audio/g711-0` + * Add `image/vnd.mozilla.apng` + * Add extension `.exe` to `application/x-msdos-program` + +1.16.0 / 2015-07-29 +=================== + + * Add `application/vnd.uri-map` + +1.15.0 / 2015-07-13 +=================== + + * Add `application/x-httpd-php` + +1.14.0 / 2015-06-25 +=================== + + * Add `application/scim+json` + * Add `application/vnd.3gpp.ussd+xml` + * Add `application/vnd.biopax.rdf+xml` + * Add `text/x-processing` + +1.13.0 / 2015-06-07 +=================== + + * Add nginx as a source + * Add `application/x-cocoa` + * Add `application/x-java-archive-diff` + * Add `application/x-makeself` + * Add `application/x-perl` + * Add `application/x-pilot` + * Add `application/x-redhat-package-manager` + * Add `application/x-sea` + * Add `audio/x-m4a` + * Add `audio/x-realaudio` + * Add `image/x-jng` + * Add `text/mathml` + +1.12.0 / 2015-06-05 +=================== + + * Add `application/bdoc` + * Add `application/vnd.hyperdrive+json` + * Add `application/x-bdoc` + * Add extension `.rtf` to `text/rtf` + +1.11.0 / 2015-05-31 +=================== + + * Add `audio/wav` + * Add `audio/wave` + * Add extension `.litcoffee` to `text/coffeescript` + * Add extension `.sfd-hdstx` to `application/vnd.hydrostatix.sof-data` + * Add extension `.n-gage` to `application/vnd.nokia.n-gage.symbian.install` + +1.10.0 / 2015-05-19 +=================== + + * Add `application/vnd.balsamiq.bmpr` + * Add `application/vnd.microsoft.portable-executable` + * Add `application/x-ns-proxy-autoconfig` + +1.9.1 / 2015-04-19 +================== + + * Remove `.json` extension from `application/manifest+json` + - This is causing bugs downstream + +1.9.0 / 2015-04-19 +================== + + * Add `application/manifest+json` + * Add `application/vnd.micro+json` + * Add `image/vnd.zbrush.pcx` + * Add `image/x-ms-bmp` + +1.8.0 / 2015-03-13 +================== + + * Add `application/vnd.citationstyles.style+xml` + * Add `application/vnd.fastcopy-disk-image` + * Add `application/vnd.gov.sk.xmldatacontainer+xml` + * Add extension `.jsonld` to `application/ld+json` + +1.7.0 / 2015-02-08 +================== + + * Add `application/vnd.gerber` + * Add `application/vnd.msa-disk-image` + +1.6.1 / 2015-02-05 +================== + + * Community extensions ownership transferred from `node-mime` + +1.6.0 / 2015-01-29 +================== + + * Add `application/jose` + * Add `application/jose+json` + * Add `application/json-seq` + * Add `application/jwk+json` + * Add `application/jwk-set+json` + * Add `application/jwt` + * Add `application/rdap+json` + * Add `application/vnd.gov.sk.e-form+xml` + * Add `application/vnd.ims.imsccv1p3` + +1.5.0 / 2014-12-30 +================== + + * Add `application/vnd.oracle.resource+json` + * Fix various invalid MIME type entries + - `application/mbox+xml` + - `application/oscp-response` + - `application/vwg-multiplexed` + - `audio/g721` + +1.4.0 / 2014-12-21 +================== + + * Add `application/vnd.ims.imsccv1p2` + * Fix various invalid MIME type entries + - `application/vnd-acucobol` + - `application/vnd-curl` + - `application/vnd-dart` + - `application/vnd-dxr` + - `application/vnd-fdf` + - `application/vnd-mif` + - `application/vnd-sema` + - `application/vnd-wap-wmlc` + - `application/vnd.adobe.flash-movie` + - `application/vnd.dece-zip` + - `application/vnd.dvb_service` + - `application/vnd.micrografx-igx` + - `application/vnd.sealed-doc` + - `application/vnd.sealed-eml` + - `application/vnd.sealed-mht` + - `application/vnd.sealed-ppt` + - `application/vnd.sealed-tiff` + - `application/vnd.sealed-xls` + - `application/vnd.sealedmedia.softseal-html` + - `application/vnd.sealedmedia.softseal-pdf` + - `application/vnd.wap-slc` + - `application/vnd.wap-wbxml` + - `audio/vnd.sealedmedia.softseal-mpeg` + - `image/vnd-djvu` + - `image/vnd-svf` + - `image/vnd-wap-wbmp` + - `image/vnd.sealed-png` + - `image/vnd.sealedmedia.softseal-gif` + - `image/vnd.sealedmedia.softseal-jpg` + - `model/vnd-dwf` + - `model/vnd.parasolid.transmit-binary` + - `model/vnd.parasolid.transmit-text` + - `text/vnd-a` + - `text/vnd-curl` + - `text/vnd.wap-wml` + * Remove example template MIME types + - `application/example` + - `audio/example` + - `image/example` + - `message/example` + - `model/example` + - `multipart/example` + - `text/example` + - `video/example` + +1.3.1 / 2014-12-16 +================== + + * Fix missing extensions + - `application/json5` + - `text/hjson` + +1.3.0 / 2014-12-07 +================== + + * Add `application/a2l` + * Add `application/aml` + * Add `application/atfx` + * Add `application/atxml` + * Add `application/cdfx+xml` + * Add `application/dii` + * Add `application/json5` + * Add `application/lxf` + * Add `application/mf4` + * Add `application/vnd.apache.thrift.compact` + * Add `application/vnd.apache.thrift.json` + * Add `application/vnd.coffeescript` + * Add `application/vnd.enphase.envoy` + * Add `application/vnd.ims.imsccv1p1` + * Add `text/csv-schema` + * Add `text/hjson` + * Add `text/markdown` + * Add `text/yaml` + +1.2.0 / 2014-11-09 +================== + + * Add `application/cea` + * Add `application/dit` + * Add `application/vnd.gov.sk.e-form+zip` + * Add `application/vnd.tmd.mediaflex.api+xml` + * Type `application/epub+zip` is now IANA-registered + +1.1.2 / 2014-10-23 +================== + + * Rebuild database for `application/x-www-form-urlencoded` change + +1.1.1 / 2014-10-20 +================== + + * Mark `application/x-www-form-urlencoded` as compressible. + +1.1.0 / 2014-09-28 +================== + + * Add `application/font-woff2` + +1.0.3 / 2014-09-25 +================== + + * Fix engine requirement in package + +1.0.2 / 2014-09-25 +================== + + * Add `application/coap-group+json` + * Add `application/dcd` + * Add `application/vnd.apache.thrift.binary` + * Add `image/vnd.tencent.tap` + * Mark all JSON-derived types as compressible + * Update `text/vtt` data + +1.0.1 / 2014-08-30 +================== + + * Fix extension ordering + +1.0.0 / 2014-08-30 +================== + + * Add `application/atf` + * Add `application/merge-patch+json` + * Add `multipart/x-mixed-replace` + * Add `source: 'apache'` metadata + * Add `source: 'iana'` metadata + * Remove badly-assumed charset data diff --git a/node_modules/mime-db/LICENSE b/node_modules/mime-db/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/node_modules/mime-db/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/mime-db/README.md b/node_modules/mime-db/README.md new file mode 100644 index 0000000..dcc9d09 --- /dev/null +++ b/node_modules/mime-db/README.md @@ -0,0 +1,94 @@ +# mime-db + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +This is a database of all mime types. +It consists of a single, public JSON file and does not include any logic, +allowing it to remain as un-opinionated as possible with an API. +It aggregates data from the following sources: + +- http://www.iana.org/assignments/media-types/media-types.xhtml +- http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types +- http://hg.nginx.org/nginx/raw-file/default/conf/mime.types + +## Installation + +```bash +npm install mime-db +``` + +### Database Download + +If you're crazy enough to use this in the browser, you can just grab the +JSON file using [jsDelivr](https://www.jsdelivr.com/). It is recommended to +replace `master` with [a release tag](https://github.com/jshttp/mime-db/tags) +as the JSON format may change in the future. + +``` +https://cdn.jsdelivr.net/gh/jshttp/mime-db@master/db.json +``` + +## Usage + +```js +var db = require('mime-db'); + +// grab data on .js files +var data = db['application/javascript']; +``` + +## Data Structure + +The JSON file is a map lookup for lowercased mime types. +Each mime type has the following properties: + +- `.source` - where the mime type is defined. + If not set, it's probably a custom media type. + - `apache` - [Apache common media types](http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types) + - `iana` - [IANA-defined media types](http://www.iana.org/assignments/media-types/media-types.xhtml) + - `nginx` - [nginx media types](http://hg.nginx.org/nginx/raw-file/default/conf/mime.types) +- `.extensions[]` - known extensions associated with this mime type. +- `.compressible` - whether a file of this type can be gzipped. +- `.charset` - the default charset associated with this type, if any. + +If unknown, every property could be `undefined`. + +## Contributing + +To edit the database, only make PRs against `src/custom.json` or +`src/custom-suffix.json`. + +The `src/custom.json` file is a JSON object with the MIME type as the keys +and the values being an object with the following keys: + +- `compressible` - leave out if you don't know, otherwise `true`/`false` to + indicate whether the data represented by the type is typically compressible. +- `extensions` - include an array of file extensions that are associated with + the type. +- `notes` - human-readable notes about the type, typically what the type is. +- `sources` - include an array of URLs of where the MIME type and the associated + extensions are sourced from. This needs to be a [primary source](https://en.wikipedia.org/wiki/Primary_source); + links to type aggregating sites and Wikipedia are _not acceptable_. + +To update the build, run `npm run build`. + +## Adding Custom Media Types + +The best way to get new media types included in this library is to register +them with the IANA. The community registration procedure is outlined in +[RFC 6838 section 5](http://tools.ietf.org/html/rfc6838#section-5). Types +registered with the IANA are automatically pulled into this library. + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/mime-db/master +[coveralls-url]: https://coveralls.io/r/jshttp/mime-db?branch=master +[node-image]: https://badgen.net/npm/node/mime-db +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/mime-db +[npm-url]: https://npmjs.org/package/mime-db +[npm-version-image]: https://badgen.net/npm/v/mime-db +[travis-image]: https://badgen.net/travis/jshttp/mime-db/master +[travis-url]: https://travis-ci.org/jshttp/mime-db diff --git a/node_modules/mime-db/db.json b/node_modules/mime-db/db.json new file mode 100644 index 0000000..a5fc987 --- /dev/null +++ b/node_modules/mime-db/db.json @@ -0,0 +1,7834 @@ +{ + "application/1d-interleaved-parityfec": { + "source": "iana" + }, + "application/3gpdash-qoe-report+xml": { + "source": "iana", + "compressible": true + }, + "application/3gpp-ims+xml": { + "source": "iana", + "compressible": true + }, + "application/a2l": { + "source": "iana" + }, + "application/activemessage": { + "source": "iana" + }, + "application/activity+json": { + "source": "iana", + "compressible": true + }, + "application/alto-costmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-costmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/alto-directory+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcost+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcostparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointprop+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointpropparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-error+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/aml": { + "source": "iana" + }, + "application/andrew-inset": { + "source": "iana", + "extensions": ["ez"] + }, + "application/applefile": { + "source": "iana" + }, + "application/applixware": { + "source": "apache", + "extensions": ["aw"] + }, + "application/atf": { + "source": "iana" + }, + "application/atfx": { + "source": "iana" + }, + "application/atom+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atom"] + }, + "application/atomcat+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atomcat"] + }, + "application/atomdeleted+xml": { + "source": "iana", + "compressible": true + }, + "application/atomicmail": { + "source": "iana" + }, + "application/atomsvc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atomsvc"] + }, + "application/atsc-dwd+xml": { + "source": "iana", + "compressible": true + }, + "application/atsc-held+xml": { + "source": "iana", + "compressible": true + }, + "application/atsc-rsat+xml": { + "source": "iana", + "compressible": true + }, + "application/atxml": { + "source": "iana" + }, + "application/auth-policy+xml": { + "source": "iana", + "compressible": true + }, + "application/bacnet-xdd+zip": { + "source": "iana", + "compressible": false + }, + "application/batch-smtp": { + "source": "iana" + }, + "application/bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/beep+xml": { + "source": "iana", + "compressible": true + }, + "application/calendar+json": { + "source": "iana", + "compressible": true + }, + "application/calendar+xml": { + "source": "iana", + "compressible": true + }, + "application/call-completion": { + "source": "iana" + }, + "application/cals-1840": { + "source": "iana" + }, + "application/cbor": { + "source": "iana" + }, + "application/cccex": { + "source": "iana" + }, + "application/ccmp+xml": { + "source": "iana", + "compressible": true + }, + "application/ccxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ccxml"] + }, + "application/cdfx+xml": { + "source": "iana", + "compressible": true + }, + "application/cdmi-capability": { + "source": "iana", + "extensions": ["cdmia"] + }, + "application/cdmi-container": { + "source": "iana", + "extensions": ["cdmic"] + }, + "application/cdmi-domain": { + "source": "iana", + "extensions": ["cdmid"] + }, + "application/cdmi-object": { + "source": "iana", + "extensions": ["cdmio"] + }, + "application/cdmi-queue": { + "source": "iana", + "extensions": ["cdmiq"] + }, + "application/cdni": { + "source": "iana" + }, + "application/cea": { + "source": "iana" + }, + "application/cea-2018+xml": { + "source": "iana", + "compressible": true + }, + "application/cellml+xml": { + "source": "iana", + "compressible": true + }, + "application/cfw": { + "source": "iana" + }, + "application/clue_info+xml": { + "source": "iana", + "compressible": true + }, + "application/cms": { + "source": "iana" + }, + "application/cnrp+xml": { + "source": "iana", + "compressible": true + }, + "application/coap-group+json": { + "source": "iana", + "compressible": true + }, + "application/coap-payload": { + "source": "iana" + }, + "application/commonground": { + "source": "iana" + }, + "application/conference-info+xml": { + "source": "iana", + "compressible": true + }, + "application/cose": { + "source": "iana" + }, + "application/cose-key": { + "source": "iana" + }, + "application/cose-key-set": { + "source": "iana" + }, + "application/cpl+xml": { + "source": "iana", + "compressible": true + }, + "application/csrattrs": { + "source": "iana" + }, + "application/csta+xml": { + "source": "iana", + "compressible": true + }, + "application/cstadata+xml": { + "source": "iana", + "compressible": true + }, + "application/csvm+json": { + "source": "iana", + "compressible": true + }, + "application/cu-seeme": { + "source": "apache", + "extensions": ["cu"] + }, + "application/cwt": { + "source": "iana" + }, + "application/cybercash": { + "source": "iana" + }, + "application/dart": { + "compressible": true + }, + "application/dash+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mpd"] + }, + "application/dashdelta": { + "source": "iana" + }, + "application/davmount+xml": { + "source": "iana", + "compressible": true, + "extensions": ["davmount"] + }, + "application/dca-rft": { + "source": "iana" + }, + "application/dcd": { + "source": "iana" + }, + "application/dec-dx": { + "source": "iana" + }, + "application/dialog-info+xml": { + "source": "iana", + "compressible": true + }, + "application/dicom": { + "source": "iana" + }, + "application/dicom+json": { + "source": "iana", + "compressible": true + }, + "application/dicom+xml": { + "source": "iana", + "compressible": true + }, + "application/dii": { + "source": "iana" + }, + "application/dit": { + "source": "iana" + }, + "application/dns": { + "source": "iana" + }, + "application/dns+json": { + "source": "iana", + "compressible": true + }, + "application/dns-message": { + "source": "iana" + }, + "application/docbook+xml": { + "source": "apache", + "compressible": true, + "extensions": ["dbk"] + }, + "application/dskpp+xml": { + "source": "iana", + "compressible": true + }, + "application/dssc+der": { + "source": "iana", + "extensions": ["dssc"] + }, + "application/dssc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdssc"] + }, + "application/dvcs": { + "source": "iana" + }, + "application/ecmascript": { + "source": "iana", + "compressible": true, + "extensions": ["ecma","es"] + }, + "application/edi-consent": { + "source": "iana" + }, + "application/edi-x12": { + "source": "iana", + "compressible": false + }, + "application/edifact": { + "source": "iana", + "compressible": false + }, + "application/efi": { + "source": "iana" + }, + "application/emergencycalldata.comment+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.control+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.deviceinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.ecall.msd": { + "source": "iana" + }, + "application/emergencycalldata.providerinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.serviceinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.subscriberinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.veds+xml": { + "source": "iana", + "compressible": true + }, + "application/emma+xml": { + "source": "iana", + "compressible": true, + "extensions": ["emma"] + }, + "application/emotionml+xml": { + "source": "iana", + "compressible": true + }, + "application/encaprtp": { + "source": "iana" + }, + "application/epp+xml": { + "source": "iana", + "compressible": true + }, + "application/epub+zip": { + "source": "iana", + "compressible": false, + "extensions": ["epub"] + }, + "application/eshop": { + "source": "iana" + }, + "application/exi": { + "source": "iana", + "extensions": ["exi"] + }, + "application/expect-ct-report+json": { + "source": "iana", + "compressible": true + }, + "application/fastinfoset": { + "source": "iana" + }, + "application/fastsoap": { + "source": "iana" + }, + "application/fdt+xml": { + "source": "iana", + "compressible": true + }, + "application/fhir+json": { + "source": "iana", + "compressible": true + }, + "application/fhir+xml": { + "source": "iana", + "compressible": true + }, + "application/fido.trusted-apps+json": { + "compressible": true + }, + "application/fits": { + "source": "iana" + }, + "application/font-sfnt": { + "source": "iana" + }, + "application/font-tdpfr": { + "source": "iana", + "extensions": ["pfr"] + }, + "application/font-woff": { + "source": "iana", + "compressible": false + }, + "application/framework-attributes+xml": { + "source": "iana", + "compressible": true + }, + "application/geo+json": { + "source": "iana", + "compressible": true, + "extensions": ["geojson"] + }, + "application/geo+json-seq": { + "source": "iana" + }, + "application/geopackage+sqlite3": { + "source": "iana" + }, + "application/geoxacml+xml": { + "source": "iana", + "compressible": true + }, + "application/gltf-buffer": { + "source": "iana" + }, + "application/gml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["gml"] + }, + "application/gpx+xml": { + "source": "apache", + "compressible": true, + "extensions": ["gpx"] + }, + "application/gxf": { + "source": "apache", + "extensions": ["gxf"] + }, + "application/gzip": { + "source": "iana", + "compressible": false, + "extensions": ["gz"] + }, + "application/h224": { + "source": "iana" + }, + "application/held+xml": { + "source": "iana", + "compressible": true + }, + "application/hjson": { + "extensions": ["hjson"] + }, + "application/http": { + "source": "iana" + }, + "application/hyperstudio": { + "source": "iana", + "extensions": ["stk"] + }, + "application/ibe-key-request+xml": { + "source": "iana", + "compressible": true + }, + "application/ibe-pkg-reply+xml": { + "source": "iana", + "compressible": true + }, + "application/ibe-pp-data": { + "source": "iana" + }, + "application/iges": { + "source": "iana" + }, + "application/im-iscomposing+xml": { + "source": "iana", + "compressible": true + }, + "application/index": { + "source": "iana" + }, + "application/index.cmd": { + "source": "iana" + }, + "application/index.obj": { + "source": "iana" + }, + "application/index.response": { + "source": "iana" + }, + "application/index.vnd": { + "source": "iana" + }, + "application/inkml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ink","inkml"] + }, + "application/iotp": { + "source": "iana" + }, + "application/ipfix": { + "source": "iana", + "extensions": ["ipfix"] + }, + "application/ipp": { + "source": "iana" + }, + "application/isup": { + "source": "iana" + }, + "application/its+xml": { + "source": "iana", + "compressible": true + }, + "application/java-archive": { + "source": "apache", + "compressible": false, + "extensions": ["jar","war","ear"] + }, + "application/java-serialized-object": { + "source": "apache", + "compressible": false, + "extensions": ["ser"] + }, + "application/java-vm": { + "source": "apache", + "compressible": false, + "extensions": ["class"] + }, + "application/javascript": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["js","mjs"] + }, + "application/jf2feed+json": { + "source": "iana", + "compressible": true + }, + "application/jose": { + "source": "iana" + }, + "application/jose+json": { + "source": "iana", + "compressible": true + }, + "application/jrd+json": { + "source": "iana", + "compressible": true + }, + "application/json": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["json","map"] + }, + "application/json-patch+json": { + "source": "iana", + "compressible": true + }, + "application/json-seq": { + "source": "iana" + }, + "application/json5": { + "extensions": ["json5"] + }, + "application/jsonml+json": { + "source": "apache", + "compressible": true, + "extensions": ["jsonml"] + }, + "application/jwk+json": { + "source": "iana", + "compressible": true + }, + "application/jwk-set+json": { + "source": "iana", + "compressible": true + }, + "application/jwt": { + "source": "iana" + }, + "application/kpml-request+xml": { + "source": "iana", + "compressible": true + }, + "application/kpml-response+xml": { + "source": "iana", + "compressible": true + }, + "application/ld+json": { + "source": "iana", + "compressible": true, + "extensions": ["jsonld"] + }, + "application/lgr+xml": { + "source": "iana", + "compressible": true + }, + "application/link-format": { + "source": "iana" + }, + "application/load-control+xml": { + "source": "iana", + "compressible": true + }, + "application/lost+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lostxml"] + }, + "application/lostsync+xml": { + "source": "iana", + "compressible": true + }, + "application/lxf": { + "source": "iana" + }, + "application/mac-binhex40": { + "source": "iana", + "extensions": ["hqx"] + }, + "application/mac-compactpro": { + "source": "apache", + "extensions": ["cpt"] + }, + "application/macwriteii": { + "source": "iana" + }, + "application/mads+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mads"] + }, + "application/manifest+json": { + "charset": "UTF-8", + "compressible": true, + "extensions": ["webmanifest"] + }, + "application/marc": { + "source": "iana", + "extensions": ["mrc"] + }, + "application/marcxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mrcx"] + }, + "application/mathematica": { + "source": "iana", + "extensions": ["ma","nb","mb"] + }, + "application/mathml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mathml"] + }, + "application/mathml-content+xml": { + "source": "iana", + "compressible": true + }, + "application/mathml-presentation+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-associated-procedure-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-deregister+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-envelope+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-msk+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-msk-response+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-protection-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-reception-report+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-register+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-register-response+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-schedule+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-user-service-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbox": { + "source": "iana", + "extensions": ["mbox"] + }, + "application/media-policy-dataset+xml": { + "source": "iana", + "compressible": true + }, + "application/media_control+xml": { + "source": "iana", + "compressible": true + }, + "application/mediaservercontrol+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mscml"] + }, + "application/merge-patch+json": { + "source": "iana", + "compressible": true + }, + "application/metalink+xml": { + "source": "apache", + "compressible": true, + "extensions": ["metalink"] + }, + "application/metalink4+xml": { + "source": "iana", + "compressible": true, + "extensions": ["meta4"] + }, + "application/mets+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mets"] + }, + "application/mf4": { + "source": "iana" + }, + "application/mikey": { + "source": "iana" + }, + "application/mmt-aei+xml": { + "source": "iana", + "compressible": true + }, + "application/mmt-usd+xml": { + "source": "iana", + "compressible": true + }, + "application/mods+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mods"] + }, + "application/moss-keys": { + "source": "iana" + }, + "application/moss-signature": { + "source": "iana" + }, + "application/mosskey-data": { + "source": "iana" + }, + "application/mosskey-request": { + "source": "iana" + }, + "application/mp21": { + "source": "iana", + "extensions": ["m21","mp21"] + }, + "application/mp4": { + "source": "iana", + "extensions": ["mp4s","m4p"] + }, + "application/mpeg4-generic": { + "source": "iana" + }, + "application/mpeg4-iod": { + "source": "iana" + }, + "application/mpeg4-iod-xmt": { + "source": "iana" + }, + "application/mrb-consumer+xml": { + "source": "iana", + "compressible": true + }, + "application/mrb-publish+xml": { + "source": "iana", + "compressible": true + }, + "application/msc-ivr+xml": { + "source": "iana", + "compressible": true + }, + "application/msc-mixer+xml": { + "source": "iana", + "compressible": true + }, + "application/msword": { + "source": "iana", + "compressible": false, + "extensions": ["doc","dot"] + }, + "application/mud+json": { + "source": "iana", + "compressible": true + }, + "application/mxf": { + "source": "iana", + "extensions": ["mxf"] + }, + "application/n-quads": { + "source": "iana", + "extensions": ["nq"] + }, + "application/n-triples": { + "source": "iana", + "extensions": ["nt"] + }, + "application/nasdata": { + "source": "iana" + }, + "application/news-checkgroups": { + "source": "iana" + }, + "application/news-groupinfo": { + "source": "iana" + }, + "application/news-transmission": { + "source": "iana" + }, + "application/nlsml+xml": { + "source": "iana", + "compressible": true + }, + "application/node": { + "source": "iana" + }, + "application/nss": { + "source": "iana" + }, + "application/ocsp-request": { + "source": "iana" + }, + "application/ocsp-response": { + "source": "iana" + }, + "application/octet-stream": { + "source": "iana", + "compressible": false, + "extensions": ["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"] + }, + "application/oda": { + "source": "iana", + "extensions": ["oda"] + }, + "application/odm+xml": { + "source": "iana", + "compressible": true + }, + "application/odx": { + "source": "iana" + }, + "application/oebps-package+xml": { + "source": "iana", + "compressible": true, + "extensions": ["opf"] + }, + "application/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["ogx"] + }, + "application/omdoc+xml": { + "source": "apache", + "compressible": true, + "extensions": ["omdoc"] + }, + "application/onenote": { + "source": "apache", + "extensions": ["onetoc","onetoc2","onetmp","onepkg"] + }, + "application/oscore": { + "source": "iana" + }, + "application/oxps": { + "source": "iana", + "extensions": ["oxps"] + }, + "application/p2p-overlay+xml": { + "source": "iana", + "compressible": true + }, + "application/parityfec": { + "source": "iana" + }, + "application/passport": { + "source": "iana" + }, + "application/patch-ops-error+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xer"] + }, + "application/pdf": { + "source": "iana", + "compressible": false, + "extensions": ["pdf"] + }, + "application/pdx": { + "source": "iana" + }, + "application/pem-certificate-chain": { + "source": "iana" + }, + "application/pgp-encrypted": { + "source": "iana", + "compressible": false, + "extensions": ["pgp"] + }, + "application/pgp-keys": { + "source": "iana" + }, + "application/pgp-signature": { + "source": "iana", + "extensions": ["asc","sig"] + }, + "application/pics-rules": { + "source": "apache", + "extensions": ["prf"] + }, + "application/pidf+xml": { + "source": "iana", + "compressible": true + }, + "application/pidf-diff+xml": { + "source": "iana", + "compressible": true + }, + "application/pkcs10": { + "source": "iana", + "extensions": ["p10"] + }, + "application/pkcs12": { + "source": "iana" + }, + "application/pkcs7-mime": { + "source": "iana", + "extensions": ["p7m","p7c"] + }, + "application/pkcs7-signature": { + "source": "iana", + "extensions": ["p7s"] + }, + "application/pkcs8": { + "source": "iana", + "extensions": ["p8"] + }, + "application/pkcs8-encrypted": { + "source": "iana" + }, + "application/pkix-attr-cert": { + "source": "iana", + "extensions": ["ac"] + }, + "application/pkix-cert": { + "source": "iana", + "extensions": ["cer"] + }, + "application/pkix-crl": { + "source": "iana", + "extensions": ["crl"] + }, + "application/pkix-pkipath": { + "source": "iana", + "extensions": ["pkipath"] + }, + "application/pkixcmp": { + "source": "iana", + "extensions": ["pki"] + }, + "application/pls+xml": { + "source": "iana", + "compressible": true, + "extensions": ["pls"] + }, + "application/poc-settings+xml": { + "source": "iana", + "compressible": true + }, + "application/postscript": { + "source": "iana", + "compressible": true, + "extensions": ["ai","eps","ps"] + }, + "application/ppsp-tracker+json": { + "source": "iana", + "compressible": true + }, + "application/problem+json": { + "source": "iana", + "compressible": true + }, + "application/problem+xml": { + "source": "iana", + "compressible": true + }, + "application/provenance+xml": { + "source": "iana", + "compressible": true + }, + "application/prs.alvestrand.titrax-sheet": { + "source": "iana" + }, + "application/prs.cww": { + "source": "iana", + "extensions": ["cww"] + }, + "application/prs.hpub+zip": { + "source": "iana", + "compressible": false + }, + "application/prs.nprend": { + "source": "iana" + }, + "application/prs.plucker": { + "source": "iana" + }, + "application/prs.rdf-xml-crypt": { + "source": "iana" + }, + "application/prs.xsf+xml": { + "source": "iana", + "compressible": true + }, + "application/pskc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["pskcxml"] + }, + "application/qsig": { + "source": "iana" + }, + "application/raml+yaml": { + "compressible": true, + "extensions": ["raml"] + }, + "application/raptorfec": { + "source": "iana" + }, + "application/rdap+json": { + "source": "iana", + "compressible": true + }, + "application/rdf+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rdf","owl"] + }, + "application/reginfo+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rif"] + }, + "application/relax-ng-compact-syntax": { + "source": "iana", + "extensions": ["rnc"] + }, + "application/remote-printing": { + "source": "iana" + }, + "application/reputon+json": { + "source": "iana", + "compressible": true + }, + "application/resource-lists+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rl"] + }, + "application/resource-lists-diff+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rld"] + }, + "application/rfc+xml": { + "source": "iana", + "compressible": true + }, + "application/riscos": { + "source": "iana" + }, + "application/rlmi+xml": { + "source": "iana", + "compressible": true + }, + "application/rls-services+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rs"] + }, + "application/route-apd+xml": { + "source": "iana", + "compressible": true + }, + "application/route-s-tsid+xml": { + "source": "iana", + "compressible": true + }, + "application/route-usd+xml": { + "source": "iana", + "compressible": true + }, + "application/rpki-ghostbusters": { + "source": "iana", + "extensions": ["gbr"] + }, + "application/rpki-manifest": { + "source": "iana", + "extensions": ["mft"] + }, + "application/rpki-publication": { + "source": "iana" + }, + "application/rpki-roa": { + "source": "iana", + "extensions": ["roa"] + }, + "application/rpki-updown": { + "source": "iana" + }, + "application/rsd+xml": { + "source": "apache", + "compressible": true, + "extensions": ["rsd"] + }, + "application/rss+xml": { + "source": "apache", + "compressible": true, + "extensions": ["rss"] + }, + "application/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "application/rtploopback": { + "source": "iana" + }, + "application/rtx": { + "source": "iana" + }, + "application/samlassertion+xml": { + "source": "iana", + "compressible": true + }, + "application/samlmetadata+xml": { + "source": "iana", + "compressible": true + }, + "application/sbml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sbml"] + }, + "application/scaip+xml": { + "source": "iana", + "compressible": true + }, + "application/scim+json": { + "source": "iana", + "compressible": true + }, + "application/scvp-cv-request": { + "source": "iana", + "extensions": ["scq"] + }, + "application/scvp-cv-response": { + "source": "iana", + "extensions": ["scs"] + }, + "application/scvp-vp-request": { + "source": "iana", + "extensions": ["spq"] + }, + "application/scvp-vp-response": { + "source": "iana", + "extensions": ["spp"] + }, + "application/sdp": { + "source": "iana", + "extensions": ["sdp"] + }, + "application/secevent+jwt": { + "source": "iana" + }, + "application/senml+cbor": { + "source": "iana" + }, + "application/senml+json": { + "source": "iana", + "compressible": true + }, + "application/senml+xml": { + "source": "iana", + "compressible": true + }, + "application/senml-exi": { + "source": "iana" + }, + "application/sensml+cbor": { + "source": "iana" + }, + "application/sensml+json": { + "source": "iana", + "compressible": true + }, + "application/sensml+xml": { + "source": "iana", + "compressible": true + }, + "application/sensml-exi": { + "source": "iana" + }, + "application/sep+xml": { + "source": "iana", + "compressible": true + }, + "application/sep-exi": { + "source": "iana" + }, + "application/session-info": { + "source": "iana" + }, + "application/set-payment": { + "source": "iana" + }, + "application/set-payment-initiation": { + "source": "iana", + "extensions": ["setpay"] + }, + "application/set-registration": { + "source": "iana" + }, + "application/set-registration-initiation": { + "source": "iana", + "extensions": ["setreg"] + }, + "application/sgml": { + "source": "iana" + }, + "application/sgml-open-catalog": { + "source": "iana" + }, + "application/shf+xml": { + "source": "iana", + "compressible": true, + "extensions": ["shf"] + }, + "application/sieve": { + "source": "iana", + "extensions": ["siv","sieve"] + }, + "application/simple-filter+xml": { + "source": "iana", + "compressible": true + }, + "application/simple-message-summary": { + "source": "iana" + }, + "application/simplesymbolcontainer": { + "source": "iana" + }, + "application/slate": { + "source": "iana" + }, + "application/smil": { + "source": "iana" + }, + "application/smil+xml": { + "source": "iana", + "compressible": true, + "extensions": ["smi","smil"] + }, + "application/smpte336m": { + "source": "iana" + }, + "application/soap+fastinfoset": { + "source": "iana" + }, + "application/soap+xml": { + "source": "iana", + "compressible": true + }, + "application/sparql-query": { + "source": "iana", + "extensions": ["rq"] + }, + "application/sparql-results+xml": { + "source": "iana", + "compressible": true, + "extensions": ["srx"] + }, + "application/spirits-event+xml": { + "source": "iana", + "compressible": true + }, + "application/sql": { + "source": "iana" + }, + "application/srgs": { + "source": "iana", + "extensions": ["gram"] + }, + "application/srgs+xml": { + "source": "iana", + "compressible": true, + "extensions": ["grxml"] + }, + "application/sru+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sru"] + }, + "application/ssdl+xml": { + "source": "apache", + "compressible": true, + "extensions": ["ssdl"] + }, + "application/ssml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ssml"] + }, + "application/stix+json": { + "source": "iana", + "compressible": true + }, + "application/tamp-apex-update": { + "source": "iana" + }, + "application/tamp-apex-update-confirm": { + "source": "iana" + }, + "application/tamp-community-update": { + "source": "iana" + }, + "application/tamp-community-update-confirm": { + "source": "iana" + }, + "application/tamp-error": { + "source": "iana" + }, + "application/tamp-sequence-adjust": { + "source": "iana" + }, + "application/tamp-sequence-adjust-confirm": { + "source": "iana" + }, + "application/tamp-status-query": { + "source": "iana" + }, + "application/tamp-status-response": { + "source": "iana" + }, + "application/tamp-update": { + "source": "iana" + }, + "application/tamp-update-confirm": { + "source": "iana" + }, + "application/tar": { + "compressible": true + }, + "application/taxii+json": { + "source": "iana", + "compressible": true + }, + "application/tei+xml": { + "source": "iana", + "compressible": true, + "extensions": ["tei","teicorpus"] + }, + "application/tetra_isi": { + "source": "iana" + }, + "application/thraud+xml": { + "source": "iana", + "compressible": true, + "extensions": ["tfi"] + }, + "application/timestamp-query": { + "source": "iana" + }, + "application/timestamp-reply": { + "source": "iana" + }, + "application/timestamped-data": { + "source": "iana", + "extensions": ["tsd"] + }, + "application/tlsrpt+gzip": { + "source": "iana" + }, + "application/tlsrpt+json": { + "source": "iana", + "compressible": true + }, + "application/tnauthlist": { + "source": "iana" + }, + "application/trickle-ice-sdpfrag": { + "source": "iana" + }, + "application/trig": { + "source": "iana" + }, + "application/ttml+xml": { + "source": "iana", + "compressible": true + }, + "application/tve-trigger": { + "source": "iana" + }, + "application/tzif": { + "source": "iana" + }, + "application/tzif-leap": { + "source": "iana" + }, + "application/ulpfec": { + "source": "iana" + }, + "application/urc-grpsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/urc-ressheet+xml": { + "source": "iana", + "compressible": true + }, + "application/urc-targetdesc+xml": { + "source": "iana", + "compressible": true + }, + "application/urc-uisocketdesc+xml": { + "source": "iana", + "compressible": true + }, + "application/vcard+json": { + "source": "iana", + "compressible": true + }, + "application/vcard+xml": { + "source": "iana", + "compressible": true + }, + "application/vemmi": { + "source": "iana" + }, + "application/vividence.scriptfile": { + "source": "apache" + }, + "application/vnd.1000minds.decision-model+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-prose+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-prose-pc3ch+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-v2x-local-service-information": { + "source": "iana" + }, + "application/vnd.3gpp.access-transfer-events+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.bsf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.gmop+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mc-signalling-ear": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-payload": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-signalling": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-floor-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-location-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-mbms-usage-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-signed+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-ue-init-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-affiliation-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-location-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-mbms-usage-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-transmission-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mid-call+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.pic-bw-large": { + "source": "iana", + "extensions": ["plb"] + }, + "application/vnd.3gpp.pic-bw-small": { + "source": "iana", + "extensions": ["psb"] + }, + "application/vnd.3gpp.pic-bw-var": { + "source": "iana", + "extensions": ["pvb"] + }, + "application/vnd.3gpp.sms": { + "source": "iana" + }, + "application/vnd.3gpp.sms+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.srvcc-ext+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.srvcc-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.state-and-event-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.ussd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp2.bcmcsinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp2.sms": { + "source": "iana" + }, + "application/vnd.3gpp2.tcap": { + "source": "iana", + "extensions": ["tcap"] + }, + "application/vnd.3lightssoftware.imagescal": { + "source": "iana" + }, + "application/vnd.3m.post-it-notes": { + "source": "iana", + "extensions": ["pwn"] + }, + "application/vnd.accpac.simply.aso": { + "source": "iana", + "extensions": ["aso"] + }, + "application/vnd.accpac.simply.imp": { + "source": "iana", + "extensions": ["imp"] + }, + "application/vnd.acucobol": { + "source": "iana", + "extensions": ["acu"] + }, + "application/vnd.acucorp": { + "source": "iana", + "extensions": ["atc","acutc"] + }, + "application/vnd.adobe.air-application-installer-package+zip": { + "source": "apache", + "compressible": false, + "extensions": ["air"] + }, + "application/vnd.adobe.flash.movie": { + "source": "iana" + }, + "application/vnd.adobe.formscentral.fcdt": { + "source": "iana", + "extensions": ["fcdt"] + }, + "application/vnd.adobe.fxp": { + "source": "iana", + "extensions": ["fxp","fxpl"] + }, + "application/vnd.adobe.partial-upload": { + "source": "iana" + }, + "application/vnd.adobe.xdp+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdp"] + }, + "application/vnd.adobe.xfdf": { + "source": "iana", + "extensions": ["xfdf"] + }, + "application/vnd.aether.imp": { + "source": "iana" + }, + "application/vnd.afpc.afplinedata": { + "source": "iana" + }, + "application/vnd.afpc.modca": { + "source": "iana" + }, + "application/vnd.ah-barcode": { + "source": "iana" + }, + "application/vnd.ahead.space": { + "source": "iana", + "extensions": ["ahead"] + }, + "application/vnd.airzip.filesecure.azf": { + "source": "iana", + "extensions": ["azf"] + }, + "application/vnd.airzip.filesecure.azs": { + "source": "iana", + "extensions": ["azs"] + }, + "application/vnd.amadeus+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.amazon.ebook": { + "source": "apache", + "extensions": ["azw"] + }, + "application/vnd.amazon.mobi8-ebook": { + "source": "iana" + }, + "application/vnd.americandynamics.acc": { + "source": "iana", + "extensions": ["acc"] + }, + "application/vnd.amiga.ami": { + "source": "iana", + "extensions": ["ami"] + }, + "application/vnd.amundsen.maze+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.android.package-archive": { + "source": "apache", + "compressible": false, + "extensions": ["apk"] + }, + "application/vnd.anki": { + "source": "iana" + }, + "application/vnd.anser-web-certificate-issue-initiation": { + "source": "iana", + "extensions": ["cii"] + }, + "application/vnd.anser-web-funds-transfer-initiation": { + "source": "apache", + "extensions": ["fti"] + }, + "application/vnd.antix.game-component": { + "source": "iana", + "extensions": ["atx"] + }, + "application/vnd.apache.thrift.binary": { + "source": "iana" + }, + "application/vnd.apache.thrift.compact": { + "source": "iana" + }, + "application/vnd.apache.thrift.json": { + "source": "iana" + }, + "application/vnd.api+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.apothekende.reservation+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.apple.installer+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mpkg"] + }, + "application/vnd.apple.keynote": { + "source": "iana", + "extensions": ["keynote"] + }, + "application/vnd.apple.mpegurl": { + "source": "iana", + "extensions": ["m3u8"] + }, + "application/vnd.apple.numbers": { + "source": "iana", + "extensions": ["numbers"] + }, + "application/vnd.apple.pages": { + "source": "iana", + "extensions": ["pages"] + }, + "application/vnd.apple.pkpass": { + "compressible": false, + "extensions": ["pkpass"] + }, + "application/vnd.arastra.swi": { + "source": "iana" + }, + "application/vnd.aristanetworks.swi": { + "source": "iana", + "extensions": ["swi"] + }, + "application/vnd.artisan+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.artsquare": { + "source": "iana" + }, + "application/vnd.astraea-software.iota": { + "source": "iana", + "extensions": ["iota"] + }, + "application/vnd.audiograph": { + "source": "iana", + "extensions": ["aep"] + }, + "application/vnd.autopackage": { + "source": "iana" + }, + "application/vnd.avalon+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.avistar+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.balsamiq.bmml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.balsamiq.bmpr": { + "source": "iana" + }, + "application/vnd.banana-accounting": { + "source": "iana" + }, + "application/vnd.bbf.usp.msg": { + "source": "iana" + }, + "application/vnd.bbf.usp.msg+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.bekitzur-stech+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.bint.med-content": { + "source": "iana" + }, + "application/vnd.biopax.rdf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.blink-idb-value-wrapper": { + "source": "iana" + }, + "application/vnd.blueice.multipass": { + "source": "iana", + "extensions": ["mpm"] + }, + "application/vnd.bluetooth.ep.oob": { + "source": "iana" + }, + "application/vnd.bluetooth.le.oob": { + "source": "iana" + }, + "application/vnd.bmi": { + "source": "iana", + "extensions": ["bmi"] + }, + "application/vnd.businessobjects": { + "source": "iana", + "extensions": ["rep"] + }, + "application/vnd.byu.uapi+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cab-jscript": { + "source": "iana" + }, + "application/vnd.canon-cpdl": { + "source": "iana" + }, + "application/vnd.canon-lips": { + "source": "iana" + }, + "application/vnd.capasystems-pg+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cendio.thinlinc.clientconf": { + "source": "iana" + }, + "application/vnd.century-systems.tcp_stream": { + "source": "iana" + }, + "application/vnd.chemdraw+xml": { + "source": "iana", + "compressible": true, + "extensions": ["cdxml"] + }, + "application/vnd.chess-pgn": { + "source": "iana" + }, + "application/vnd.chipnuts.karaoke-mmd": { + "source": "iana", + "extensions": ["mmd"] + }, + "application/vnd.cinderella": { + "source": "iana", + "extensions": ["cdy"] + }, + "application/vnd.cirpack.isdn-ext": { + "source": "iana" + }, + "application/vnd.citationstyles.style+xml": { + "source": "iana", + "compressible": true, + "extensions": ["csl"] + }, + "application/vnd.claymore": { + "source": "iana", + "extensions": ["cla"] + }, + "application/vnd.cloanto.rp9": { + "source": "iana", + "extensions": ["rp9"] + }, + "application/vnd.clonk.c4group": { + "source": "iana", + "extensions": ["c4g","c4d","c4f","c4p","c4u"] + }, + "application/vnd.cluetrust.cartomobile-config": { + "source": "iana", + "extensions": ["c11amc"] + }, + "application/vnd.cluetrust.cartomobile-config-pkg": { + "source": "iana", + "extensions": ["c11amz"] + }, + "application/vnd.coffeescript": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.document": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.document-template": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.presentation": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.presentation-template": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.spreadsheet": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.spreadsheet-template": { + "source": "iana" + }, + "application/vnd.collection+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.doc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.next+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.comicbook+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.comicbook-rar": { + "source": "iana" + }, + "application/vnd.commerce-battelle": { + "source": "iana" + }, + "application/vnd.commonspace": { + "source": "iana", + "extensions": ["csp"] + }, + "application/vnd.contact.cmsg": { + "source": "iana", + "extensions": ["cdbcmsg"] + }, + "application/vnd.coreos.ignition+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cosmocaller": { + "source": "iana", + "extensions": ["cmc"] + }, + "application/vnd.crick.clicker": { + "source": "iana", + "extensions": ["clkx"] + }, + "application/vnd.crick.clicker.keyboard": { + "source": "iana", + "extensions": ["clkk"] + }, + "application/vnd.crick.clicker.palette": { + "source": "iana", + "extensions": ["clkp"] + }, + "application/vnd.crick.clicker.template": { + "source": "iana", + "extensions": ["clkt"] + }, + "application/vnd.crick.clicker.wordbank": { + "source": "iana", + "extensions": ["clkw"] + }, + "application/vnd.criticaltools.wbs+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wbs"] + }, + "application/vnd.ctc-posml": { + "source": "iana", + "extensions": ["pml"] + }, + "application/vnd.ctct.ws+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.cups-pdf": { + "source": "iana" + }, + "application/vnd.cups-postscript": { + "source": "iana" + }, + "application/vnd.cups-ppd": { + "source": "iana", + "extensions": ["ppd"] + }, + "application/vnd.cups-raster": { + "source": "iana" + }, + "application/vnd.cups-raw": { + "source": "iana" + }, + "application/vnd.curl": { + "source": "iana" + }, + "application/vnd.curl.car": { + "source": "apache", + "extensions": ["car"] + }, + "application/vnd.curl.pcurl": { + "source": "apache", + "extensions": ["pcurl"] + }, + "application/vnd.cyan.dean.root+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.cybank": { + "source": "iana" + }, + "application/vnd.d2l.coursepackage1p0+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.dart": { + "source": "iana", + "compressible": true, + "extensions": ["dart"] + }, + "application/vnd.data-vision.rdz": { + "source": "iana", + "extensions": ["rdz"] + }, + "application/vnd.datapackage+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dataresource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.debian.binary-package": { + "source": "iana" + }, + "application/vnd.dece.data": { + "source": "iana", + "extensions": ["uvf","uvvf","uvd","uvvd"] + }, + "application/vnd.dece.ttml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["uvt","uvvt"] + }, + "application/vnd.dece.unspecified": { + "source": "iana", + "extensions": ["uvx","uvvx"] + }, + "application/vnd.dece.zip": { + "source": "iana", + "extensions": ["uvz","uvvz"] + }, + "application/vnd.denovo.fcselayout-link": { + "source": "iana", + "extensions": ["fe_launch"] + }, + "application/vnd.desmume.movie": { + "source": "iana" + }, + "application/vnd.dir-bi.plate-dl-nosuffix": { + "source": "iana" + }, + "application/vnd.dm.delegation+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dna": { + "source": "iana", + "extensions": ["dna"] + }, + "application/vnd.document+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dolby.mlp": { + "source": "apache", + "extensions": ["mlp"] + }, + "application/vnd.dolby.mobile.1": { + "source": "iana" + }, + "application/vnd.dolby.mobile.2": { + "source": "iana" + }, + "application/vnd.doremir.scorecloud-binary-document": { + "source": "iana" + }, + "application/vnd.dpgraph": { + "source": "iana", + "extensions": ["dpg"] + }, + "application/vnd.dreamfactory": { + "source": "iana", + "extensions": ["dfac"] + }, + "application/vnd.drive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ds-keypoint": { + "source": "apache", + "extensions": ["kpxx"] + }, + "application/vnd.dtg.local": { + "source": "iana" + }, + "application/vnd.dtg.local.flash": { + "source": "iana" + }, + "application/vnd.dtg.local.html": { + "source": "iana" + }, + "application/vnd.dvb.ait": { + "source": "iana", + "extensions": ["ait"] + }, + "application/vnd.dvb.dvbj": { + "source": "iana" + }, + "application/vnd.dvb.esgcontainer": { + "source": "iana" + }, + "application/vnd.dvb.ipdcdftnotifaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess2": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgpdd": { + "source": "iana" + }, + "application/vnd.dvb.ipdcroaming": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-base": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-enhancement": { + "source": "iana" + }, + "application/vnd.dvb.notif-aggregate-root+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-container+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-generic+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-msglist+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-registration-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-registration-response+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-init+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.pfr": { + "source": "iana" + }, + "application/vnd.dvb.service": { + "source": "iana", + "extensions": ["svc"] + }, + "application/vnd.dxr": { + "source": "iana" + }, + "application/vnd.dynageo": { + "source": "iana", + "extensions": ["geo"] + }, + "application/vnd.dzr": { + "source": "iana" + }, + "application/vnd.easykaraoke.cdgdownload": { + "source": "iana" + }, + "application/vnd.ecdis-update": { + "source": "iana" + }, + "application/vnd.ecip.rlp": { + "source": "iana" + }, + "application/vnd.ecowin.chart": { + "source": "iana", + "extensions": ["mag"] + }, + "application/vnd.ecowin.filerequest": { + "source": "iana" + }, + "application/vnd.ecowin.fileupdate": { + "source": "iana" + }, + "application/vnd.ecowin.series": { + "source": "iana" + }, + "application/vnd.ecowin.seriesrequest": { + "source": "iana" + }, + "application/vnd.ecowin.seriesupdate": { + "source": "iana" + }, + "application/vnd.efi.img": { + "source": "iana" + }, + "application/vnd.efi.iso": { + "source": "iana" + }, + "application/vnd.emclient.accessrequest+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.enliven": { + "source": "iana", + "extensions": ["nml"] + }, + "application/vnd.enphase.envoy": { + "source": "iana" + }, + "application/vnd.eprints.data+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.epson.esf": { + "source": "iana", + "extensions": ["esf"] + }, + "application/vnd.epson.msf": { + "source": "iana", + "extensions": ["msf"] + }, + "application/vnd.epson.quickanime": { + "source": "iana", + "extensions": ["qam"] + }, + "application/vnd.epson.salt": { + "source": "iana", + "extensions": ["slt"] + }, + "application/vnd.epson.ssf": { + "source": "iana", + "extensions": ["ssf"] + }, + "application/vnd.ericsson.quickcall": { + "source": "iana" + }, + "application/vnd.espass-espass+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.eszigno3+xml": { + "source": "iana", + "compressible": true, + "extensions": ["es3","et3"] + }, + "application/vnd.etsi.aoc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.asic-e+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.etsi.asic-s+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.etsi.cug+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvcommand+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvdiscovery+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-bc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-cod+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-npvr+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvservice+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsync+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvueprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.mcid+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.mheg5": { + "source": "iana" + }, + "application/vnd.etsi.overload-control-policy-dataset+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.pstn+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.sci+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.simservs+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.timestamp-token": { + "source": "iana" + }, + "application/vnd.etsi.tsl+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.tsl.der": { + "source": "iana" + }, + "application/vnd.eudora.data": { + "source": "iana" + }, + "application/vnd.evolv.ecig.profile": { + "source": "iana" + }, + "application/vnd.evolv.ecig.settings": { + "source": "iana" + }, + "application/vnd.evolv.ecig.theme": { + "source": "iana" + }, + "application/vnd.exstream-empower+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.exstream-package": { + "source": "iana" + }, + "application/vnd.ezpix-album": { + "source": "iana", + "extensions": ["ez2"] + }, + "application/vnd.ezpix-package": { + "source": "iana", + "extensions": ["ez3"] + }, + "application/vnd.f-secure.mobile": { + "source": "iana" + }, + "application/vnd.fastcopy-disk-image": { + "source": "iana" + }, + "application/vnd.fdf": { + "source": "iana", + "extensions": ["fdf"] + }, + "application/vnd.fdsn.mseed": { + "source": "iana", + "extensions": ["mseed"] + }, + "application/vnd.fdsn.seed": { + "source": "iana", + "extensions": ["seed","dataless"] + }, + "application/vnd.ffsns": { + "source": "iana" + }, + "application/vnd.filmit.zfc": { + "source": "iana" + }, + "application/vnd.fints": { + "source": "iana" + }, + "application/vnd.firemonkeys.cloudcell": { + "source": "iana" + }, + "application/vnd.flographit": { + "source": "iana", + "extensions": ["gph"] + }, + "application/vnd.fluxtime.clip": { + "source": "iana", + "extensions": ["ftc"] + }, + "application/vnd.font-fontforge-sfd": { + "source": "iana" + }, + "application/vnd.framemaker": { + "source": "iana", + "extensions": ["fm","frame","maker","book"] + }, + "application/vnd.frogans.fnc": { + "source": "iana", + "extensions": ["fnc"] + }, + "application/vnd.frogans.ltf": { + "source": "iana", + "extensions": ["ltf"] + }, + "application/vnd.fsc.weblaunch": { + "source": "iana", + "extensions": ["fsc"] + }, + "application/vnd.fujitsu.oasys": { + "source": "iana", + "extensions": ["oas"] + }, + "application/vnd.fujitsu.oasys2": { + "source": "iana", + "extensions": ["oa2"] + }, + "application/vnd.fujitsu.oasys3": { + "source": "iana", + "extensions": ["oa3"] + }, + "application/vnd.fujitsu.oasysgp": { + "source": "iana", + "extensions": ["fg5"] + }, + "application/vnd.fujitsu.oasysprs": { + "source": "iana", + "extensions": ["bh2"] + }, + "application/vnd.fujixerox.art-ex": { + "source": "iana" + }, + "application/vnd.fujixerox.art4": { + "source": "iana" + }, + "application/vnd.fujixerox.ddd": { + "source": "iana", + "extensions": ["ddd"] + }, + "application/vnd.fujixerox.docuworks": { + "source": "iana", + "extensions": ["xdw"] + }, + "application/vnd.fujixerox.docuworks.binder": { + "source": "iana", + "extensions": ["xbd"] + }, + "application/vnd.fujixerox.docuworks.container": { + "source": "iana" + }, + "application/vnd.fujixerox.hbpl": { + "source": "iana" + }, + "application/vnd.fut-misnet": { + "source": "iana" + }, + "application/vnd.futoin+cbor": { + "source": "iana" + }, + "application/vnd.futoin+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.fuzzysheet": { + "source": "iana", + "extensions": ["fzs"] + }, + "application/vnd.genomatix.tuxedo": { + "source": "iana", + "extensions": ["txd"] + }, + "application/vnd.geo+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.geocube+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.geogebra.file": { + "source": "iana", + "extensions": ["ggb"] + }, + "application/vnd.geogebra.tool": { + "source": "iana", + "extensions": ["ggt"] + }, + "application/vnd.geometry-explorer": { + "source": "iana", + "extensions": ["gex","gre"] + }, + "application/vnd.geonext": { + "source": "iana", + "extensions": ["gxt"] + }, + "application/vnd.geoplan": { + "source": "iana", + "extensions": ["g2w"] + }, + "application/vnd.geospace": { + "source": "iana", + "extensions": ["g3w"] + }, + "application/vnd.gerber": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt-response": { + "source": "iana" + }, + "application/vnd.gmx": { + "source": "iana", + "extensions": ["gmx"] + }, + "application/vnd.google-apps.document": { + "compressible": false, + "extensions": ["gdoc"] + }, + "application/vnd.google-apps.presentation": { + "compressible": false, + "extensions": ["gslides"] + }, + "application/vnd.google-apps.spreadsheet": { + "compressible": false, + "extensions": ["gsheet"] + }, + "application/vnd.google-earth.kml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["kml"] + }, + "application/vnd.google-earth.kmz": { + "source": "iana", + "compressible": false, + "extensions": ["kmz"] + }, + "application/vnd.gov.sk.e-form+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.gov.sk.e-form+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.gov.sk.xmldatacontainer+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.grafeq": { + "source": "iana", + "extensions": ["gqf","gqs"] + }, + "application/vnd.gridmp": { + "source": "iana" + }, + "application/vnd.groove-account": { + "source": "iana", + "extensions": ["gac"] + }, + "application/vnd.groove-help": { + "source": "iana", + "extensions": ["ghf"] + }, + "application/vnd.groove-identity-message": { + "source": "iana", + "extensions": ["gim"] + }, + "application/vnd.groove-injector": { + "source": "iana", + "extensions": ["grv"] + }, + "application/vnd.groove-tool-message": { + "source": "iana", + "extensions": ["gtm"] + }, + "application/vnd.groove-tool-template": { + "source": "iana", + "extensions": ["tpl"] + }, + "application/vnd.groove-vcard": { + "source": "iana", + "extensions": ["vcg"] + }, + "application/vnd.hal+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hal+xml": { + "source": "iana", + "compressible": true, + "extensions": ["hal"] + }, + "application/vnd.handheld-entertainment+xml": { + "source": "iana", + "compressible": true, + "extensions": ["zmm"] + }, + "application/vnd.hbci": { + "source": "iana", + "extensions": ["hbci"] + }, + "application/vnd.hc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hcl-bireports": { + "source": "iana" + }, + "application/vnd.hdt": { + "source": "iana" + }, + "application/vnd.heroku+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hhe.lesson-player": { + "source": "iana", + "extensions": ["les"] + }, + "application/vnd.hp-hpgl": { + "source": "iana", + "extensions": ["hpgl"] + }, + "application/vnd.hp-hpid": { + "source": "iana", + "extensions": ["hpid"] + }, + "application/vnd.hp-hps": { + "source": "iana", + "extensions": ["hps"] + }, + "application/vnd.hp-jlyt": { + "source": "iana", + "extensions": ["jlt"] + }, + "application/vnd.hp-pcl": { + "source": "iana", + "extensions": ["pcl"] + }, + "application/vnd.hp-pclxl": { + "source": "iana", + "extensions": ["pclxl"] + }, + "application/vnd.httphone": { + "source": "iana" + }, + "application/vnd.hydrostatix.sof-data": { + "source": "iana", + "extensions": ["sfd-hdstx"] + }, + "application/vnd.hyper+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hyper-item+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hyperdrive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hzn-3d-crossword": { + "source": "iana" + }, + "application/vnd.ibm.afplinedata": { + "source": "iana" + }, + "application/vnd.ibm.electronic-media": { + "source": "iana" + }, + "application/vnd.ibm.minipay": { + "source": "iana", + "extensions": ["mpy"] + }, + "application/vnd.ibm.modcap": { + "source": "iana", + "extensions": ["afp","listafp","list3820"] + }, + "application/vnd.ibm.rights-management": { + "source": "iana", + "extensions": ["irm"] + }, + "application/vnd.ibm.secure-container": { + "source": "iana", + "extensions": ["sc"] + }, + "application/vnd.iccprofile": { + "source": "iana", + "extensions": ["icc","icm"] + }, + "application/vnd.ieee.1905": { + "source": "iana" + }, + "application/vnd.igloader": { + "source": "iana", + "extensions": ["igl"] + }, + "application/vnd.imagemeter.folder+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.imagemeter.image+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.immervision-ivp": { + "source": "iana", + "extensions": ["ivp"] + }, + "application/vnd.immervision-ivu": { + "source": "iana", + "extensions": ["ivu"] + }, + "application/vnd.ims.imsccv1p1": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p2": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p3": { + "source": "iana" + }, + "application/vnd.ims.lis.v2.result+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolconsumerprofile+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy.id+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings.simple+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.informedcontrol.rms+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.informix-visionary": { + "source": "iana" + }, + "application/vnd.infotech.project": { + "source": "iana" + }, + "application/vnd.infotech.project+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.innopath.wamp.notification": { + "source": "iana" + }, + "application/vnd.insors.igm": { + "source": "iana", + "extensions": ["igm"] + }, + "application/vnd.intercon.formnet": { + "source": "iana", + "extensions": ["xpw","xpx"] + }, + "application/vnd.intergeo": { + "source": "iana", + "extensions": ["i2g"] + }, + "application/vnd.intertrust.digibox": { + "source": "iana" + }, + "application/vnd.intertrust.nncp": { + "source": "iana" + }, + "application/vnd.intu.qbo": { + "source": "iana", + "extensions": ["qbo"] + }, + "application/vnd.intu.qfx": { + "source": "iana", + "extensions": ["qfx"] + }, + "application/vnd.iptc.g2.catalogitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.conceptitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.knowledgeitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.newsitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.newsmessage+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.packageitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.planningitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ipunplugged.rcprofile": { + "source": "iana", + "extensions": ["rcprofile"] + }, + "application/vnd.irepository.package+xml": { + "source": "iana", + "compressible": true, + "extensions": ["irp"] + }, + "application/vnd.is-xpr": { + "source": "iana", + "extensions": ["xpr"] + }, + "application/vnd.isac.fcs": { + "source": "iana", + "extensions": ["fcs"] + }, + "application/vnd.jam": { + "source": "iana", + "extensions": ["jam"] + }, + "application/vnd.japannet-directory-service": { + "source": "iana" + }, + "application/vnd.japannet-jpnstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-payment-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-registration": { + "source": "iana" + }, + "application/vnd.japannet-registration-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-setstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-verification": { + "source": "iana" + }, + "application/vnd.japannet-verification-wakeup": { + "source": "iana" + }, + "application/vnd.jcp.javame.midlet-rms": { + "source": "iana", + "extensions": ["rms"] + }, + "application/vnd.jisp": { + "source": "iana", + "extensions": ["jisp"] + }, + "application/vnd.joost.joda-archive": { + "source": "iana", + "extensions": ["joda"] + }, + "application/vnd.jsk.isdn-ngn": { + "source": "iana" + }, + "application/vnd.kahootz": { + "source": "iana", + "extensions": ["ktz","ktr"] + }, + "application/vnd.kde.karbon": { + "source": "iana", + "extensions": ["karbon"] + }, + "application/vnd.kde.kchart": { + "source": "iana", + "extensions": ["chrt"] + }, + "application/vnd.kde.kformula": { + "source": "iana", + "extensions": ["kfo"] + }, + "application/vnd.kde.kivio": { + "source": "iana", + "extensions": ["flw"] + }, + "application/vnd.kde.kontour": { + "source": "iana", + "extensions": ["kon"] + }, + "application/vnd.kde.kpresenter": { + "source": "iana", + "extensions": ["kpr","kpt"] + }, + "application/vnd.kde.kspread": { + "source": "iana", + "extensions": ["ksp"] + }, + "application/vnd.kde.kword": { + "source": "iana", + "extensions": ["kwd","kwt"] + }, + "application/vnd.kenameaapp": { + "source": "iana", + "extensions": ["htke"] + }, + "application/vnd.kidspiration": { + "source": "iana", + "extensions": ["kia"] + }, + "application/vnd.kinar": { + "source": "iana", + "extensions": ["kne","knp"] + }, + "application/vnd.koan": { + "source": "iana", + "extensions": ["skp","skd","skt","skm"] + }, + "application/vnd.kodak-descriptor": { + "source": "iana", + "extensions": ["sse"] + }, + "application/vnd.las.las+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.las.las+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lasxml"] + }, + "application/vnd.leap+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.liberty-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.llamagraphics.life-balance.desktop": { + "source": "iana", + "extensions": ["lbd"] + }, + "application/vnd.llamagraphics.life-balance.exchange+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lbe"] + }, + "application/vnd.lotus-1-2-3": { + "source": "iana", + "extensions": ["123"] + }, + "application/vnd.lotus-approach": { + "source": "iana", + "extensions": ["apr"] + }, + "application/vnd.lotus-freelance": { + "source": "iana", + "extensions": ["pre"] + }, + "application/vnd.lotus-notes": { + "source": "iana", + "extensions": ["nsf"] + }, + "application/vnd.lotus-organizer": { + "source": "iana", + "extensions": ["org"] + }, + "application/vnd.lotus-screencam": { + "source": "iana", + "extensions": ["scm"] + }, + "application/vnd.lotus-wordpro": { + "source": "iana", + "extensions": ["lwp"] + }, + "application/vnd.macports.portpkg": { + "source": "iana", + "extensions": ["portpkg"] + }, + "application/vnd.mapbox-vector-tile": { + "source": "iana" + }, + "application/vnd.marlin.drm.actiontoken+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.conftoken+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.license+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.mdcf": { + "source": "iana" + }, + "application/vnd.mason+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.maxmind.maxmind-db": { + "source": "iana" + }, + "application/vnd.mcd": { + "source": "iana", + "extensions": ["mcd"] + }, + "application/vnd.medcalcdata": { + "source": "iana", + "extensions": ["mc1"] + }, + "application/vnd.mediastation.cdkey": { + "source": "iana", + "extensions": ["cdkey"] + }, + "application/vnd.meridian-slingshot": { + "source": "iana" + }, + "application/vnd.mfer": { + "source": "iana", + "extensions": ["mwf"] + }, + "application/vnd.mfmp": { + "source": "iana", + "extensions": ["mfm"] + }, + "application/vnd.micro+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.micrografx.flo": { + "source": "iana", + "extensions": ["flo"] + }, + "application/vnd.micrografx.igx": { + "source": "iana", + "extensions": ["igx"] + }, + "application/vnd.microsoft.portable-executable": { + "source": "iana" + }, + "application/vnd.microsoft.windows.thumbnail-cache": { + "source": "iana" + }, + "application/vnd.miele+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.mif": { + "source": "iana", + "extensions": ["mif"] + }, + "application/vnd.minisoft-hp3000-save": { + "source": "iana" + }, + "application/vnd.mitsubishi.misty-guard.trustweb": { + "source": "iana" + }, + "application/vnd.mobius.daf": { + "source": "iana", + "extensions": ["daf"] + }, + "application/vnd.mobius.dis": { + "source": "iana", + "extensions": ["dis"] + }, + "application/vnd.mobius.mbk": { + "source": "iana", + "extensions": ["mbk"] + }, + "application/vnd.mobius.mqy": { + "source": "iana", + "extensions": ["mqy"] + }, + "application/vnd.mobius.msl": { + "source": "iana", + "extensions": ["msl"] + }, + "application/vnd.mobius.plc": { + "source": "iana", + "extensions": ["plc"] + }, + "application/vnd.mobius.txf": { + "source": "iana", + "extensions": ["txf"] + }, + "application/vnd.mophun.application": { + "source": "iana", + "extensions": ["mpn"] + }, + "application/vnd.mophun.certificate": { + "source": "iana", + "extensions": ["mpc"] + }, + "application/vnd.motorola.flexsuite": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.adsi": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.fis": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.gotap": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.kmr": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.ttc": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.wem": { + "source": "iana" + }, + "application/vnd.motorola.iprm": { + "source": "iana" + }, + "application/vnd.mozilla.xul+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xul"] + }, + "application/vnd.ms-3mfdocument": { + "source": "iana" + }, + "application/vnd.ms-artgalry": { + "source": "iana", + "extensions": ["cil"] + }, + "application/vnd.ms-asf": { + "source": "iana" + }, + "application/vnd.ms-cab-compressed": { + "source": "iana", + "extensions": ["cab"] + }, + "application/vnd.ms-color.iccprofile": { + "source": "apache" + }, + "application/vnd.ms-excel": { + "source": "iana", + "compressible": false, + "extensions": ["xls","xlm","xla","xlc","xlt","xlw"] + }, + "application/vnd.ms-excel.addin.macroenabled.12": { + "source": "iana", + "extensions": ["xlam"] + }, + "application/vnd.ms-excel.sheet.binary.macroenabled.12": { + "source": "iana", + "extensions": ["xlsb"] + }, + "application/vnd.ms-excel.sheet.macroenabled.12": { + "source": "iana", + "extensions": ["xlsm"] + }, + "application/vnd.ms-excel.template.macroenabled.12": { + "source": "iana", + "extensions": ["xltm"] + }, + "application/vnd.ms-fontobject": { + "source": "iana", + "compressible": true, + "extensions": ["eot"] + }, + "application/vnd.ms-htmlhelp": { + "source": "iana", + "extensions": ["chm"] + }, + "application/vnd.ms-ims": { + "source": "iana", + "extensions": ["ims"] + }, + "application/vnd.ms-lrm": { + "source": "iana", + "extensions": ["lrm"] + }, + "application/vnd.ms-office.activex+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-officetheme": { + "source": "iana", + "extensions": ["thmx"] + }, + "application/vnd.ms-opentype": { + "source": "apache", + "compressible": true + }, + "application/vnd.ms-outlook": { + "compressible": false, + "extensions": ["msg"] + }, + "application/vnd.ms-package.obfuscated-opentype": { + "source": "apache" + }, + "application/vnd.ms-pki.seccat": { + "source": "apache", + "extensions": ["cat"] + }, + "application/vnd.ms-pki.stl": { + "source": "apache", + "extensions": ["stl"] + }, + "application/vnd.ms-playready.initiator+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-powerpoint": { + "source": "iana", + "compressible": false, + "extensions": ["ppt","pps","pot"] + }, + "application/vnd.ms-powerpoint.addin.macroenabled.12": { + "source": "iana", + "extensions": ["ppam"] + }, + "application/vnd.ms-powerpoint.presentation.macroenabled.12": { + "source": "iana", + "extensions": ["pptm"] + }, + "application/vnd.ms-powerpoint.slide.macroenabled.12": { + "source": "iana", + "extensions": ["sldm"] + }, + "application/vnd.ms-powerpoint.slideshow.macroenabled.12": { + "source": "iana", + "extensions": ["ppsm"] + }, + "application/vnd.ms-powerpoint.template.macroenabled.12": { + "source": "iana", + "extensions": ["potm"] + }, + "application/vnd.ms-printdevicecapabilities+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-printing.printticket+xml": { + "source": "apache", + "compressible": true + }, + "application/vnd.ms-printschematicket+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-project": { + "source": "iana", + "extensions": ["mpp","mpt"] + }, + "application/vnd.ms-tnef": { + "source": "iana" + }, + "application/vnd.ms-windows.devicepairing": { + "source": "iana" + }, + "application/vnd.ms-windows.nwprinting.oob": { + "source": "iana" + }, + "application/vnd.ms-windows.printerpairing": { + "source": "iana" + }, + "application/vnd.ms-windows.wsd.oob": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-resp": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-resp": { + "source": "iana" + }, + "application/vnd.ms-word.document.macroenabled.12": { + "source": "iana", + "extensions": ["docm"] + }, + "application/vnd.ms-word.template.macroenabled.12": { + "source": "iana", + "extensions": ["dotm"] + }, + "application/vnd.ms-works": { + "source": "iana", + "extensions": ["wps","wks","wcm","wdb"] + }, + "application/vnd.ms-wpl": { + "source": "iana", + "extensions": ["wpl"] + }, + "application/vnd.ms-xpsdocument": { + "source": "iana", + "compressible": false, + "extensions": ["xps"] + }, + "application/vnd.msa-disk-image": { + "source": "iana" + }, + "application/vnd.mseq": { + "source": "iana", + "extensions": ["mseq"] + }, + "application/vnd.msign": { + "source": "iana" + }, + "application/vnd.multiad.creator": { + "source": "iana" + }, + "application/vnd.multiad.creator.cif": { + "source": "iana" + }, + "application/vnd.music-niff": { + "source": "iana" + }, + "application/vnd.musician": { + "source": "iana", + "extensions": ["mus"] + }, + "application/vnd.muvee.style": { + "source": "iana", + "extensions": ["msty"] + }, + "application/vnd.mynfc": { + "source": "iana", + "extensions": ["taglet"] + }, + "application/vnd.ncd.control": { + "source": "iana" + }, + "application/vnd.ncd.reference": { + "source": "iana" + }, + "application/vnd.nearst.inv+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.nervana": { + "source": "iana" + }, + "application/vnd.netfpx": { + "source": "iana" + }, + "application/vnd.neurolanguage.nlu": { + "source": "iana", + "extensions": ["nlu"] + }, + "application/vnd.nimn": { + "source": "iana" + }, + "application/vnd.nintendo.nitro.rom": { + "source": "iana" + }, + "application/vnd.nintendo.snes.rom": { + "source": "iana" + }, + "application/vnd.nitf": { + "source": "iana", + "extensions": ["ntf","nitf"] + }, + "application/vnd.noblenet-directory": { + "source": "iana", + "extensions": ["nnd"] + }, + "application/vnd.noblenet-sealer": { + "source": "iana", + "extensions": ["nns"] + }, + "application/vnd.noblenet-web": { + "source": "iana", + "extensions": ["nnw"] + }, + "application/vnd.nokia.catalogs": { + "source": "iana" + }, + "application/vnd.nokia.conml+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.conml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.iptv.config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.isds-radio-presets": { + "source": "iana" + }, + "application/vnd.nokia.landmark+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.landmark+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.landmarkcollection+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.n-gage.ac+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.n-gage.data": { + "source": "iana", + "extensions": ["ngdat"] + }, + "application/vnd.nokia.n-gage.symbian.install": { + "source": "iana", + "extensions": ["n-gage"] + }, + "application/vnd.nokia.ncd": { + "source": "iana" + }, + "application/vnd.nokia.pcd+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.pcd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.radio-preset": { + "source": "iana", + "extensions": ["rpst"] + }, + "application/vnd.nokia.radio-presets": { + "source": "iana", + "extensions": ["rpss"] + }, + "application/vnd.novadigm.edm": { + "source": "iana", + "extensions": ["edm"] + }, + "application/vnd.novadigm.edx": { + "source": "iana", + "extensions": ["edx"] + }, + "application/vnd.novadigm.ext": { + "source": "iana", + "extensions": ["ext"] + }, + "application/vnd.ntt-local.content-share": { + "source": "iana" + }, + "application/vnd.ntt-local.file-transfer": { + "source": "iana" + }, + "application/vnd.ntt-local.ogw_remote-access": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_remote": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_tcp_stream": { + "source": "iana" + }, + "application/vnd.oasis.opendocument.chart": { + "source": "iana", + "extensions": ["odc"] + }, + "application/vnd.oasis.opendocument.chart-template": { + "source": "iana", + "extensions": ["otc"] + }, + "application/vnd.oasis.opendocument.database": { + "source": "iana", + "extensions": ["odb"] + }, + "application/vnd.oasis.opendocument.formula": { + "source": "iana", + "extensions": ["odf"] + }, + "application/vnd.oasis.opendocument.formula-template": { + "source": "iana", + "extensions": ["odft"] + }, + "application/vnd.oasis.opendocument.graphics": { + "source": "iana", + "compressible": false, + "extensions": ["odg"] + }, + "application/vnd.oasis.opendocument.graphics-template": { + "source": "iana", + "extensions": ["otg"] + }, + "application/vnd.oasis.opendocument.image": { + "source": "iana", + "extensions": ["odi"] + }, + "application/vnd.oasis.opendocument.image-template": { + "source": "iana", + "extensions": ["oti"] + }, + "application/vnd.oasis.opendocument.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["odp"] + }, + "application/vnd.oasis.opendocument.presentation-template": { + "source": "iana", + "extensions": ["otp"] + }, + "application/vnd.oasis.opendocument.spreadsheet": { + "source": "iana", + "compressible": false, + "extensions": ["ods"] + }, + "application/vnd.oasis.opendocument.spreadsheet-template": { + "source": "iana", + "extensions": ["ots"] + }, + "application/vnd.oasis.opendocument.text": { + "source": "iana", + "compressible": false, + "extensions": ["odt"] + }, + "application/vnd.oasis.opendocument.text-master": { + "source": "iana", + "extensions": ["odm"] + }, + "application/vnd.oasis.opendocument.text-template": { + "source": "iana", + "extensions": ["ott"] + }, + "application/vnd.oasis.opendocument.text-web": { + "source": "iana", + "extensions": ["oth"] + }, + "application/vnd.obn": { + "source": "iana" + }, + "application/vnd.ocf+cbor": { + "source": "iana" + }, + "application/vnd.oftn.l10n+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.contentaccessdownload+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.contentaccessstreaming+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.cspg-hexbinary": { + "source": "iana" + }, + "application/vnd.oipf.dae.svg+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.dae.xhtml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.mippvcontrolmessage+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.pae.gem": { + "source": "iana" + }, + "application/vnd.oipf.spdiscovery+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.spdlist+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.ueprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.userprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.olpc-sugar": { + "source": "iana", + "extensions": ["xo"] + }, + "application/vnd.oma-scws-config": { + "source": "iana" + }, + "application/vnd.oma-scws-http-request": { + "source": "iana" + }, + "application/vnd.oma-scws-http-response": { + "source": "iana" + }, + "application/vnd.oma.bcast.associated-procedure-parameter+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.drm-trigger+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.imd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.ltkm": { + "source": "iana" + }, + "application/vnd.oma.bcast.notification+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.provisioningtrigger": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgboot": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgdd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.sgdu": { + "source": "iana" + }, + "application/vnd.oma.bcast.simple-symbol-container": { + "source": "iana" + }, + "application/vnd.oma.bcast.smartcard-trigger+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.sprov+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.stkm": { + "source": "iana" + }, + "application/vnd.oma.cab-address-book+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-feature-handler+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-pcc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-subs-invite+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-user-prefs+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.dcd": { + "source": "iana" + }, + "application/vnd.oma.dcdc": { + "source": "iana" + }, + "application/vnd.oma.dd2+xml": { + "source": "iana", + "compressible": true, + "extensions": ["dd2"] + }, + "application/vnd.oma.drm.risd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.group-usage-list+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.lwm2m+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.lwm2m+tlv": { + "source": "iana" + }, + "application/vnd.oma.pal+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.detailed-progress-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.final-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.groups+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.invocation-descriptor+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.optimized-progress-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.push": { + "source": "iana" + }, + "application/vnd.oma.scidm.messages+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.xcap-directory+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.omads-email+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.omads-file+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.omads-folder+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.omaloc-supl-init": { + "source": "iana" + }, + "application/vnd.onepager": { + "source": "iana" + }, + "application/vnd.onepagertamp": { + "source": "iana" + }, + "application/vnd.onepagertamx": { + "source": "iana" + }, + "application/vnd.onepagertat": { + "source": "iana" + }, + "application/vnd.onepagertatp": { + "source": "iana" + }, + "application/vnd.onepagertatx": { + "source": "iana" + }, + "application/vnd.openblox.game+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openblox.game-binary": { + "source": "iana" + }, + "application/vnd.openeye.oeb": { + "source": "iana" + }, + "application/vnd.openofficeorg.extension": { + "source": "apache", + "extensions": ["oxt"] + }, + "application/vnd.openstreetmap.data+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.custom-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.customxmlproperties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawing+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.chart+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.extended-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["pptx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.presprops+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide": { + "source": "iana", + "extensions": ["sldx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow": { + "source": "iana", + "extensions": ["ppsx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.tags+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.template": { + "source": "iana", + "extensions": ["potx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet": { + "source": "iana", + "compressible": false, + "extensions": ["xlsx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template": { + "source": "iana", + "extensions": ["xltx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.theme+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.themeoverride+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.vmldrawing": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document": { + "source": "iana", + "compressible": false, + "extensions": ["docx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template": { + "source": "iana", + "extensions": ["dotx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.core-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.relationships+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oracle.resource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.orange.indata": { + "source": "iana" + }, + "application/vnd.osa.netdeploy": { + "source": "iana" + }, + "application/vnd.osgeo.mapguide.package": { + "source": "iana", + "extensions": ["mgp"] + }, + "application/vnd.osgi.bundle": { + "source": "iana" + }, + "application/vnd.osgi.dp": { + "source": "iana", + "extensions": ["dp"] + }, + "application/vnd.osgi.subsystem": { + "source": "iana", + "extensions": ["esa"] + }, + "application/vnd.otps.ct-kip+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oxli.countgraph": { + "source": "iana" + }, + "application/vnd.pagerduty+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.palm": { + "source": "iana", + "extensions": ["pdb","pqa","oprc"] + }, + "application/vnd.panoply": { + "source": "iana" + }, + "application/vnd.paos.xml": { + "source": "iana" + }, + "application/vnd.patentdive": { + "source": "iana" + }, + "application/vnd.patientecommsdoc": { + "source": "iana" + }, + "application/vnd.pawaafile": { + "source": "iana", + "extensions": ["paw"] + }, + "application/vnd.pcos": { + "source": "iana" + }, + "application/vnd.pg.format": { + "source": "iana", + "extensions": ["str"] + }, + "application/vnd.pg.osasli": { + "source": "iana", + "extensions": ["ei6"] + }, + "application/vnd.piaccess.application-licence": { + "source": "iana" + }, + "application/vnd.picsel": { + "source": "iana", + "extensions": ["efif"] + }, + "application/vnd.pmi.widget": { + "source": "iana", + "extensions": ["wg"] + }, + "application/vnd.poc.group-advertisement+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.pocketlearn": { + "source": "iana", + "extensions": ["plf"] + }, + "application/vnd.powerbuilder6": { + "source": "iana", + "extensions": ["pbd"] + }, + "application/vnd.powerbuilder6-s": { + "source": "iana" + }, + "application/vnd.powerbuilder7": { + "source": "iana" + }, + "application/vnd.powerbuilder7-s": { + "source": "iana" + }, + "application/vnd.powerbuilder75": { + "source": "iana" + }, + "application/vnd.powerbuilder75-s": { + "source": "iana" + }, + "application/vnd.preminet": { + "source": "iana" + }, + "application/vnd.previewsystems.box": { + "source": "iana", + "extensions": ["box"] + }, + "application/vnd.proteus.magazine": { + "source": "iana", + "extensions": ["mgz"] + }, + "application/vnd.psfs": { + "source": "iana" + }, + "application/vnd.publishare-delta-tree": { + "source": "iana", + "extensions": ["qps"] + }, + "application/vnd.pvi.ptid1": { + "source": "iana", + "extensions": ["ptid"] + }, + "application/vnd.pwg-multiplexed": { + "source": "iana" + }, + "application/vnd.pwg-xhtml-print+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.qualcomm.brew-app-res": { + "source": "iana" + }, + "application/vnd.quarantainenet": { + "source": "iana" + }, + "application/vnd.quark.quarkxpress": { + "source": "iana", + "extensions": ["qxd","qxt","qwd","qwt","qxl","qxb"] + }, + "application/vnd.quobject-quoxdocument": { + "source": "iana" + }, + "application/vnd.radisys.moml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-conf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-conn+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-dialog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-stream+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-conf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-base+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-fax-detect+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-fax-sendrecv+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-group+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-speech+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-transform+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.rainstor.data": { + "source": "iana" + }, + "application/vnd.rapid": { + "source": "iana" + }, + "application/vnd.rar": { + "source": "iana" + }, + "application/vnd.realvnc.bed": { + "source": "iana", + "extensions": ["bed"] + }, + "application/vnd.recordare.musicxml": { + "source": "iana", + "extensions": ["mxl"] + }, + "application/vnd.recordare.musicxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["musicxml"] + }, + "application/vnd.renlearn.rlprint": { + "source": "iana" + }, + "application/vnd.restful+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.rig.cryptonote": { + "source": "iana", + "extensions": ["cryptonote"] + }, + "application/vnd.rim.cod": { + "source": "apache", + "extensions": ["cod"] + }, + "application/vnd.rn-realmedia": { + "source": "apache", + "extensions": ["rm"] + }, + "application/vnd.rn-realmedia-vbr": { + "source": "apache", + "extensions": ["rmvb"] + }, + "application/vnd.route66.link66+xml": { + "source": "iana", + "compressible": true, + "extensions": ["link66"] + }, + "application/vnd.rs-274x": { + "source": "iana" + }, + "application/vnd.ruckus.download": { + "source": "iana" + }, + "application/vnd.s3sms": { + "source": "iana" + }, + "application/vnd.sailingtracker.track": { + "source": "iana", + "extensions": ["st"] + }, + "application/vnd.sbm.cid": { + "source": "iana" + }, + "application/vnd.sbm.mid2": { + "source": "iana" + }, + "application/vnd.scribus": { + "source": "iana" + }, + "application/vnd.sealed.3df": { + "source": "iana" + }, + "application/vnd.sealed.csf": { + "source": "iana" + }, + "application/vnd.sealed.doc": { + "source": "iana" + }, + "application/vnd.sealed.eml": { + "source": "iana" + }, + "application/vnd.sealed.mht": { + "source": "iana" + }, + "application/vnd.sealed.net": { + "source": "iana" + }, + "application/vnd.sealed.ppt": { + "source": "iana" + }, + "application/vnd.sealed.tiff": { + "source": "iana" + }, + "application/vnd.sealed.xls": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.html": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.pdf": { + "source": "iana" + }, + "application/vnd.seemail": { + "source": "iana", + "extensions": ["see"] + }, + "application/vnd.sema": { + "source": "iana", + "extensions": ["sema"] + }, + "application/vnd.semd": { + "source": "iana", + "extensions": ["semd"] + }, + "application/vnd.semf": { + "source": "iana", + "extensions": ["semf"] + }, + "application/vnd.shana.informed.formdata": { + "source": "iana", + "extensions": ["ifm"] + }, + "application/vnd.shana.informed.formtemplate": { + "source": "iana", + "extensions": ["itp"] + }, + "application/vnd.shana.informed.interchange": { + "source": "iana", + "extensions": ["iif"] + }, + "application/vnd.shana.informed.package": { + "source": "iana", + "extensions": ["ipk"] + }, + "application/vnd.shootproof+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.sigrok.session": { + "source": "iana" + }, + "application/vnd.simtech-mindmapper": { + "source": "iana", + "extensions": ["twd","twds"] + }, + "application/vnd.siren+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.smaf": { + "source": "iana", + "extensions": ["mmf"] + }, + "application/vnd.smart.notebook": { + "source": "iana" + }, + "application/vnd.smart.teacher": { + "source": "iana", + "extensions": ["teacher"] + }, + "application/vnd.software602.filler.form+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.software602.filler.form-xml-zip": { + "source": "iana" + }, + "application/vnd.solent.sdkm+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sdkm","sdkd"] + }, + "application/vnd.spotfire.dxp": { + "source": "iana", + "extensions": ["dxp"] + }, + "application/vnd.spotfire.sfs": { + "source": "iana", + "extensions": ["sfs"] + }, + "application/vnd.sqlite3": { + "source": "iana" + }, + "application/vnd.sss-cod": { + "source": "iana" + }, + "application/vnd.sss-dtf": { + "source": "iana" + }, + "application/vnd.sss-ntf": { + "source": "iana" + }, + "application/vnd.stardivision.calc": { + "source": "apache", + "extensions": ["sdc"] + }, + "application/vnd.stardivision.draw": { + "source": "apache", + "extensions": ["sda"] + }, + "application/vnd.stardivision.impress": { + "source": "apache", + "extensions": ["sdd"] + }, + "application/vnd.stardivision.math": { + "source": "apache", + "extensions": ["smf"] + }, + "application/vnd.stardivision.writer": { + "source": "apache", + "extensions": ["sdw","vor"] + }, + "application/vnd.stardivision.writer-global": { + "source": "apache", + "extensions": ["sgl"] + }, + "application/vnd.stepmania.package": { + "source": "iana", + "extensions": ["smzip"] + }, + "application/vnd.stepmania.stepchart": { + "source": "iana", + "extensions": ["sm"] + }, + "application/vnd.street-stream": { + "source": "iana" + }, + "application/vnd.sun.wadl+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wadl"] + }, + "application/vnd.sun.xml.calc": { + "source": "apache", + "extensions": ["sxc"] + }, + "application/vnd.sun.xml.calc.template": { + "source": "apache", + "extensions": ["stc"] + }, + "application/vnd.sun.xml.draw": { + "source": "apache", + "extensions": ["sxd"] + }, + "application/vnd.sun.xml.draw.template": { + "source": "apache", + "extensions": ["std"] + }, + "application/vnd.sun.xml.impress": { + "source": "apache", + "extensions": ["sxi"] + }, + "application/vnd.sun.xml.impress.template": { + "source": "apache", + "extensions": ["sti"] + }, + "application/vnd.sun.xml.math": { + "source": "apache", + "extensions": ["sxm"] + }, + "application/vnd.sun.xml.writer": { + "source": "apache", + "extensions": ["sxw"] + }, + "application/vnd.sun.xml.writer.global": { + "source": "apache", + "extensions": ["sxg"] + }, + "application/vnd.sun.xml.writer.template": { + "source": "apache", + "extensions": ["stw"] + }, + "application/vnd.sus-calendar": { + "source": "iana", + "extensions": ["sus","susp"] + }, + "application/vnd.svd": { + "source": "iana", + "extensions": ["svd"] + }, + "application/vnd.swiftview-ics": { + "source": "iana" + }, + "application/vnd.symbian.install": { + "source": "apache", + "extensions": ["sis","sisx"] + }, + "application/vnd.syncml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xsm"] + }, + "application/vnd.syncml.dm+wbxml": { + "source": "iana", + "extensions": ["bdm"] + }, + "application/vnd.syncml.dm+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdm"] + }, + "application/vnd.syncml.dm.notification": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.syncml.dmtnds+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmtnds+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.syncml.ds.notification": { + "source": "iana" + }, + "application/vnd.tableschema+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.tao.intent-module-archive": { + "source": "iana", + "extensions": ["tao"] + }, + "application/vnd.tcpdump.pcap": { + "source": "iana", + "extensions": ["pcap","cap","dmp"] + }, + "application/vnd.think-cell.ppttc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.tmd.mediaflex.api+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.tml": { + "source": "iana" + }, + "application/vnd.tmobile-livetv": { + "source": "iana", + "extensions": ["tmo"] + }, + "application/vnd.tri.onesource": { + "source": "iana" + }, + "application/vnd.trid.tpt": { + "source": "iana", + "extensions": ["tpt"] + }, + "application/vnd.triscape.mxs": { + "source": "iana", + "extensions": ["mxs"] + }, + "application/vnd.trueapp": { + "source": "iana", + "extensions": ["tra"] + }, + "application/vnd.truedoc": { + "source": "iana" + }, + "application/vnd.ubisoft.webplayer": { + "source": "iana" + }, + "application/vnd.ufdl": { + "source": "iana", + "extensions": ["ufd","ufdl"] + }, + "application/vnd.uiq.theme": { + "source": "iana", + "extensions": ["utz"] + }, + "application/vnd.umajin": { + "source": "iana", + "extensions": ["umj"] + }, + "application/vnd.unity": { + "source": "iana", + "extensions": ["unityweb"] + }, + "application/vnd.uoml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["uoml"] + }, + "application/vnd.uplanet.alert": { + "source": "iana" + }, + "application/vnd.uplanet.alert-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.channel": { + "source": "iana" + }, + "application/vnd.uplanet.channel-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.list": { + "source": "iana" + }, + "application/vnd.uplanet.list-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.signal": { + "source": "iana" + }, + "application/vnd.uri-map": { + "source": "iana" + }, + "application/vnd.valve.source.material": { + "source": "iana" + }, + "application/vnd.vcx": { + "source": "iana", + "extensions": ["vcx"] + }, + "application/vnd.vd-study": { + "source": "iana" + }, + "application/vnd.vectorworks": { + "source": "iana" + }, + "application/vnd.vel+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.verimatrix.vcas": { + "source": "iana" + }, + "application/vnd.veryant.thin": { + "source": "iana" + }, + "application/vnd.vidsoft.vidconference": { + "source": "iana" + }, + "application/vnd.visio": { + "source": "iana", + "extensions": ["vsd","vst","vss","vsw"] + }, + "application/vnd.visionary": { + "source": "iana", + "extensions": ["vis"] + }, + "application/vnd.vividence.scriptfile": { + "source": "iana" + }, + "application/vnd.vsf": { + "source": "iana", + "extensions": ["vsf"] + }, + "application/vnd.wap.sic": { + "source": "iana" + }, + "application/vnd.wap.slc": { + "source": "iana" + }, + "application/vnd.wap.wbxml": { + "source": "iana", + "extensions": ["wbxml"] + }, + "application/vnd.wap.wmlc": { + "source": "iana", + "extensions": ["wmlc"] + }, + "application/vnd.wap.wmlscriptc": { + "source": "iana", + "extensions": ["wmlsc"] + }, + "application/vnd.webturbo": { + "source": "iana", + "extensions": ["wtb"] + }, + "application/vnd.wfa.p2p": { + "source": "iana" + }, + "application/vnd.wfa.wsc": { + "source": "iana" + }, + "application/vnd.windows.devicepairing": { + "source": "iana" + }, + "application/vnd.wmc": { + "source": "iana" + }, + "application/vnd.wmf.bootstrap": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica.package": { + "source": "iana" + }, + "application/vnd.wolfram.player": { + "source": "iana", + "extensions": ["nbp"] + }, + "application/vnd.wordperfect": { + "source": "iana", + "extensions": ["wpd"] + }, + "application/vnd.wqd": { + "source": "iana", + "extensions": ["wqd"] + }, + "application/vnd.wrq-hp3000-labelled": { + "source": "iana" + }, + "application/vnd.wt.stf": { + "source": "iana", + "extensions": ["stf"] + }, + "application/vnd.wv.csp+wbxml": { + "source": "iana" + }, + "application/vnd.wv.csp+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.wv.ssp+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.xacml+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.xara": { + "source": "iana", + "extensions": ["xar"] + }, + "application/vnd.xfdl": { + "source": "iana", + "extensions": ["xfdl"] + }, + "application/vnd.xfdl.webform": { + "source": "iana" + }, + "application/vnd.xmi+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.xmpie.cpkg": { + "source": "iana" + }, + "application/vnd.xmpie.dpkg": { + "source": "iana" + }, + "application/vnd.xmpie.plan": { + "source": "iana" + }, + "application/vnd.xmpie.ppkg": { + "source": "iana" + }, + "application/vnd.xmpie.xlim": { + "source": "iana" + }, + "application/vnd.yamaha.hv-dic": { + "source": "iana", + "extensions": ["hvd"] + }, + "application/vnd.yamaha.hv-script": { + "source": "iana", + "extensions": ["hvs"] + }, + "application/vnd.yamaha.hv-voice": { + "source": "iana", + "extensions": ["hvp"] + }, + "application/vnd.yamaha.openscoreformat": { + "source": "iana", + "extensions": ["osf"] + }, + "application/vnd.yamaha.openscoreformat.osfpvg+xml": { + "source": "iana", + "compressible": true, + "extensions": ["osfpvg"] + }, + "application/vnd.yamaha.remote-setup": { + "source": "iana" + }, + "application/vnd.yamaha.smaf-audio": { + "source": "iana", + "extensions": ["saf"] + }, + "application/vnd.yamaha.smaf-phrase": { + "source": "iana", + "extensions": ["spf"] + }, + "application/vnd.yamaha.through-ngn": { + "source": "iana" + }, + "application/vnd.yamaha.tunnel-udpencap": { + "source": "iana" + }, + "application/vnd.yaoweme": { + "source": "iana" + }, + "application/vnd.yellowriver-custom-menu": { + "source": "iana", + "extensions": ["cmp"] + }, + "application/vnd.youtube.yt": { + "source": "iana" + }, + "application/vnd.zul": { + "source": "iana", + "extensions": ["zir","zirz"] + }, + "application/vnd.zzazz.deck+xml": { + "source": "iana", + "compressible": true, + "extensions": ["zaz"] + }, + "application/voicexml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["vxml"] + }, + "application/voucher-cms+json": { + "source": "iana", + "compressible": true + }, + "application/vq-rtcpxr": { + "source": "iana" + }, + "application/wasm": { + "compressible": true, + "extensions": ["wasm"] + }, + "application/watcherinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/webpush-options+json": { + "source": "iana", + "compressible": true + }, + "application/whoispp-query": { + "source": "iana" + }, + "application/whoispp-response": { + "source": "iana" + }, + "application/widget": { + "source": "iana", + "extensions": ["wgt"] + }, + "application/winhlp": { + "source": "apache", + "extensions": ["hlp"] + }, + "application/wita": { + "source": "iana" + }, + "application/wordperfect5.1": { + "source": "iana" + }, + "application/wsdl+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wsdl"] + }, + "application/wspolicy+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wspolicy"] + }, + "application/x-7z-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["7z"] + }, + "application/x-abiword": { + "source": "apache", + "extensions": ["abw"] + }, + "application/x-ace-compressed": { + "source": "apache", + "extensions": ["ace"] + }, + "application/x-amf": { + "source": "apache" + }, + "application/x-apple-diskimage": { + "source": "apache", + "extensions": ["dmg"] + }, + "application/x-arj": { + "compressible": false, + "extensions": ["arj"] + }, + "application/x-authorware-bin": { + "source": "apache", + "extensions": ["aab","x32","u32","vox"] + }, + "application/x-authorware-map": { + "source": "apache", + "extensions": ["aam"] + }, + "application/x-authorware-seg": { + "source": "apache", + "extensions": ["aas"] + }, + "application/x-bcpio": { + "source": "apache", + "extensions": ["bcpio"] + }, + "application/x-bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/x-bittorrent": { + "source": "apache", + "extensions": ["torrent"] + }, + "application/x-blorb": { + "source": "apache", + "extensions": ["blb","blorb"] + }, + "application/x-bzip": { + "source": "apache", + "compressible": false, + "extensions": ["bz"] + }, + "application/x-bzip2": { + "source": "apache", + "compressible": false, + "extensions": ["bz2","boz"] + }, + "application/x-cbr": { + "source": "apache", + "extensions": ["cbr","cba","cbt","cbz","cb7"] + }, + "application/x-cdlink": { + "source": "apache", + "extensions": ["vcd"] + }, + "application/x-cfs-compressed": { + "source": "apache", + "extensions": ["cfs"] + }, + "application/x-chat": { + "source": "apache", + "extensions": ["chat"] + }, + "application/x-chess-pgn": { + "source": "apache", + "extensions": ["pgn"] + }, + "application/x-chrome-extension": { + "extensions": ["crx"] + }, + "application/x-cocoa": { + "source": "nginx", + "extensions": ["cco"] + }, + "application/x-compress": { + "source": "apache" + }, + "application/x-conference": { + "source": "apache", + "extensions": ["nsc"] + }, + "application/x-cpio": { + "source": "apache", + "extensions": ["cpio"] + }, + "application/x-csh": { + "source": "apache", + "extensions": ["csh"] + }, + "application/x-deb": { + "compressible": false + }, + "application/x-debian-package": { + "source": "apache", + "extensions": ["deb","udeb"] + }, + "application/x-dgc-compressed": { + "source": "apache", + "extensions": ["dgc"] + }, + "application/x-director": { + "source": "apache", + "extensions": ["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"] + }, + "application/x-doom": { + "source": "apache", + "extensions": ["wad"] + }, + "application/x-dtbncx+xml": { + "source": "apache", + "compressible": true, + "extensions": ["ncx"] + }, + "application/x-dtbook+xml": { + "source": "apache", + "compressible": true, + "extensions": ["dtb"] + }, + "application/x-dtbresource+xml": { + "source": "apache", + "compressible": true, + "extensions": ["res"] + }, + "application/x-dvi": { + "source": "apache", + "compressible": false, + "extensions": ["dvi"] + }, + "application/x-envoy": { + "source": "apache", + "extensions": ["evy"] + }, + "application/x-eva": { + "source": "apache", + "extensions": ["eva"] + }, + "application/x-font-bdf": { + "source": "apache", + "extensions": ["bdf"] + }, + "application/x-font-dos": { + "source": "apache" + }, + "application/x-font-framemaker": { + "source": "apache" + }, + "application/x-font-ghostscript": { + "source": "apache", + "extensions": ["gsf"] + }, + "application/x-font-libgrx": { + "source": "apache" + }, + "application/x-font-linux-psf": { + "source": "apache", + "extensions": ["psf"] + }, + "application/x-font-pcf": { + "source": "apache", + "extensions": ["pcf"] + }, + "application/x-font-snf": { + "source": "apache", + "extensions": ["snf"] + }, + "application/x-font-speedo": { + "source": "apache" + }, + "application/x-font-sunos-news": { + "source": "apache" + }, + "application/x-font-type1": { + "source": "apache", + "extensions": ["pfa","pfb","pfm","afm"] + }, + "application/x-font-vfont": { + "source": "apache" + }, + "application/x-freearc": { + "source": "apache", + "extensions": ["arc"] + }, + "application/x-futuresplash": { + "source": "apache", + "extensions": ["spl"] + }, + "application/x-gca-compressed": { + "source": "apache", + "extensions": ["gca"] + }, + "application/x-glulx": { + "source": "apache", + "extensions": ["ulx"] + }, + "application/x-gnumeric": { + "source": "apache", + "extensions": ["gnumeric"] + }, + "application/x-gramps-xml": { + "source": "apache", + "extensions": ["gramps"] + }, + "application/x-gtar": { + "source": "apache", + "extensions": ["gtar"] + }, + "application/x-gzip": { + "source": "apache" + }, + "application/x-hdf": { + "source": "apache", + "extensions": ["hdf"] + }, + "application/x-httpd-php": { + "compressible": true, + "extensions": ["php"] + }, + "application/x-install-instructions": { + "source": "apache", + "extensions": ["install"] + }, + "application/x-iso9660-image": { + "source": "apache", + "extensions": ["iso"] + }, + "application/x-java-archive-diff": { + "source": "nginx", + "extensions": ["jardiff"] + }, + "application/x-java-jnlp-file": { + "source": "apache", + "compressible": false, + "extensions": ["jnlp"] + }, + "application/x-javascript": { + "compressible": true + }, + "application/x-latex": { + "source": "apache", + "compressible": false, + "extensions": ["latex"] + }, + "application/x-lua-bytecode": { + "extensions": ["luac"] + }, + "application/x-lzh-compressed": { + "source": "apache", + "extensions": ["lzh","lha"] + }, + "application/x-makeself": { + "source": "nginx", + "extensions": ["run"] + }, + "application/x-mie": { + "source": "apache", + "extensions": ["mie"] + }, + "application/x-mobipocket-ebook": { + "source": "apache", + "extensions": ["prc","mobi"] + }, + "application/x-mpegurl": { + "compressible": false + }, + "application/x-ms-application": { + "source": "apache", + "extensions": ["application"] + }, + "application/x-ms-shortcut": { + "source": "apache", + "extensions": ["lnk"] + }, + "application/x-ms-wmd": { + "source": "apache", + "extensions": ["wmd"] + }, + "application/x-ms-wmz": { + "source": "apache", + "extensions": ["wmz"] + }, + "application/x-ms-xbap": { + "source": "apache", + "extensions": ["xbap"] + }, + "application/x-msaccess": { + "source": "apache", + "extensions": ["mdb"] + }, + "application/x-msbinder": { + "source": "apache", + "extensions": ["obd"] + }, + "application/x-mscardfile": { + "source": "apache", + "extensions": ["crd"] + }, + "application/x-msclip": { + "source": "apache", + "extensions": ["clp"] + }, + "application/x-msdos-program": { + "extensions": ["exe"] + }, + "application/x-msdownload": { + "source": "apache", + "extensions": ["exe","dll","com","bat","msi"] + }, + "application/x-msmediaview": { + "source": "apache", + "extensions": ["mvb","m13","m14"] + }, + "application/x-msmetafile": { + "source": "apache", + "extensions": ["wmf","wmz","emf","emz"] + }, + "application/x-msmoney": { + "source": "apache", + "extensions": ["mny"] + }, + "application/x-mspublisher": { + "source": "apache", + "extensions": ["pub"] + }, + "application/x-msschedule": { + "source": "apache", + "extensions": ["scd"] + }, + "application/x-msterminal": { + "source": "apache", + "extensions": ["trm"] + }, + "application/x-mswrite": { + "source": "apache", + "extensions": ["wri"] + }, + "application/x-netcdf": { + "source": "apache", + "extensions": ["nc","cdf"] + }, + "application/x-ns-proxy-autoconfig": { + "compressible": true, + "extensions": ["pac"] + }, + "application/x-nzb": { + "source": "apache", + "extensions": ["nzb"] + }, + "application/x-perl": { + "source": "nginx", + "extensions": ["pl","pm"] + }, + "application/x-pilot": { + "source": "nginx", + "extensions": ["prc","pdb"] + }, + "application/x-pkcs12": { + "source": "apache", + "compressible": false, + "extensions": ["p12","pfx"] + }, + "application/x-pkcs7-certificates": { + "source": "apache", + "extensions": ["p7b","spc"] + }, + "application/x-pkcs7-certreqresp": { + "source": "apache", + "extensions": ["p7r"] + }, + "application/x-rar-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["rar"] + }, + "application/x-redhat-package-manager": { + "source": "nginx", + "extensions": ["rpm"] + }, + "application/x-research-info-systems": { + "source": "apache", + "extensions": ["ris"] + }, + "application/x-sea": { + "source": "nginx", + "extensions": ["sea"] + }, + "application/x-sh": { + "source": "apache", + "compressible": true, + "extensions": ["sh"] + }, + "application/x-shar": { + "source": "apache", + "extensions": ["shar"] + }, + "application/x-shockwave-flash": { + "source": "apache", + "compressible": false, + "extensions": ["swf"] + }, + "application/x-silverlight-app": { + "source": "apache", + "extensions": ["xap"] + }, + "application/x-sql": { + "source": "apache", + "extensions": ["sql"] + }, + "application/x-stuffit": { + "source": "apache", + "compressible": false, + "extensions": ["sit"] + }, + "application/x-stuffitx": { + "source": "apache", + "extensions": ["sitx"] + }, + "application/x-subrip": { + "source": "apache", + "extensions": ["srt"] + }, + "application/x-sv4cpio": { + "source": "apache", + "extensions": ["sv4cpio"] + }, + "application/x-sv4crc": { + "source": "apache", + "extensions": ["sv4crc"] + }, + "application/x-t3vm-image": { + "source": "apache", + "extensions": ["t3"] + }, + "application/x-tads": { + "source": "apache", + "extensions": ["gam"] + }, + "application/x-tar": { + "source": "apache", + "compressible": true, + "extensions": ["tar"] + }, + "application/x-tcl": { + "source": "apache", + "extensions": ["tcl","tk"] + }, + "application/x-tex": { + "source": "apache", + "extensions": ["tex"] + }, + "application/x-tex-tfm": { + "source": "apache", + "extensions": ["tfm"] + }, + "application/x-texinfo": { + "source": "apache", + "extensions": ["texinfo","texi"] + }, + "application/x-tgif": { + "source": "apache", + "extensions": ["obj"] + }, + "application/x-ustar": { + "source": "apache", + "extensions": ["ustar"] + }, + "application/x-virtualbox-hdd": { + "compressible": true, + "extensions": ["hdd"] + }, + "application/x-virtualbox-ova": { + "compressible": true, + "extensions": ["ova"] + }, + "application/x-virtualbox-ovf": { + "compressible": true, + "extensions": ["ovf"] + }, + "application/x-virtualbox-vbox": { + "compressible": true, + "extensions": ["vbox"] + }, + "application/x-virtualbox-vbox-extpack": { + "compressible": false, + "extensions": ["vbox-extpack"] + }, + "application/x-virtualbox-vdi": { + "compressible": true, + "extensions": ["vdi"] + }, + "application/x-virtualbox-vhd": { + "compressible": true, + "extensions": ["vhd"] + }, + "application/x-virtualbox-vmdk": { + "compressible": true, + "extensions": ["vmdk"] + }, + "application/x-wais-source": { + "source": "apache", + "extensions": ["src"] + }, + "application/x-web-app-manifest+json": { + "compressible": true, + "extensions": ["webapp"] + }, + "application/x-www-form-urlencoded": { + "source": "iana", + "compressible": true + }, + "application/x-x509-ca-cert": { + "source": "apache", + "extensions": ["der","crt","pem"] + }, + "application/x-xfig": { + "source": "apache", + "extensions": ["fig"] + }, + "application/x-xliff+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xlf"] + }, + "application/x-xpinstall": { + "source": "apache", + "compressible": false, + "extensions": ["xpi"] + }, + "application/x-xz": { + "source": "apache", + "extensions": ["xz"] + }, + "application/x-zmachine": { + "source": "apache", + "extensions": ["z1","z2","z3","z4","z5","z6","z7","z8"] + }, + "application/x400-bp": { + "source": "iana" + }, + "application/xacml+xml": { + "source": "iana", + "compressible": true + }, + "application/xaml+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xaml"] + }, + "application/xcap-att+xml": { + "source": "iana", + "compressible": true + }, + "application/xcap-caps+xml": { + "source": "iana", + "compressible": true + }, + "application/xcap-diff+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdf"] + }, + "application/xcap-el+xml": { + "source": "iana", + "compressible": true + }, + "application/xcap-error+xml": { + "source": "iana", + "compressible": true + }, + "application/xcap-ns+xml": { + "source": "iana", + "compressible": true + }, + "application/xcon-conference-info+xml": { + "source": "iana", + "compressible": true + }, + "application/xcon-conference-info-diff+xml": { + "source": "iana", + "compressible": true + }, + "application/xenc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xenc"] + }, + "application/xhtml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xhtml","xht"] + }, + "application/xhtml-voice+xml": { + "source": "apache", + "compressible": true + }, + "application/xliff+xml": { + "source": "iana", + "compressible": true + }, + "application/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml","xsl","xsd","rng"] + }, + "application/xml-dtd": { + "source": "iana", + "compressible": true, + "extensions": ["dtd"] + }, + "application/xml-external-parsed-entity": { + "source": "iana" + }, + "application/xml-patch+xml": { + "source": "iana", + "compressible": true + }, + "application/xmpp+xml": { + "source": "iana", + "compressible": true + }, + "application/xop+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xop"] + }, + "application/xproc+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xpl"] + }, + "application/xslt+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xslt"] + }, + "application/xspf+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xspf"] + }, + "application/xv+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mxml","xhvml","xvml","xvm"] + }, + "application/yang": { + "source": "iana", + "extensions": ["yang"] + }, + "application/yang-data+json": { + "source": "iana", + "compressible": true + }, + "application/yang-data+xml": { + "source": "iana", + "compressible": true + }, + "application/yang-patch+json": { + "source": "iana", + "compressible": true + }, + "application/yang-patch+xml": { + "source": "iana", + "compressible": true + }, + "application/yin+xml": { + "source": "iana", + "compressible": true, + "extensions": ["yin"] + }, + "application/zip": { + "source": "iana", + "compressible": false, + "extensions": ["zip"] + }, + "application/zlib": { + "source": "iana" + }, + "application/zstd": { + "source": "iana" + }, + "audio/1d-interleaved-parityfec": { + "source": "iana" + }, + "audio/32kadpcm": { + "source": "iana" + }, + "audio/3gpp": { + "source": "iana", + "compressible": false, + "extensions": ["3gpp"] + }, + "audio/3gpp2": { + "source": "iana" + }, + "audio/aac": { + "source": "iana" + }, + "audio/ac3": { + "source": "iana" + }, + "audio/adpcm": { + "source": "apache", + "extensions": ["adp"] + }, + "audio/amr": { + "source": "iana" + }, + "audio/amr-wb": { + "source": "iana" + }, + "audio/amr-wb+": { + "source": "iana" + }, + "audio/aptx": { + "source": "iana" + }, + "audio/asc": { + "source": "iana" + }, + "audio/atrac-advanced-lossless": { + "source": "iana" + }, + "audio/atrac-x": { + "source": "iana" + }, + "audio/atrac3": { + "source": "iana" + }, + "audio/basic": { + "source": "iana", + "compressible": false, + "extensions": ["au","snd"] + }, + "audio/bv16": { + "source": "iana" + }, + "audio/bv32": { + "source": "iana" + }, + "audio/clearmode": { + "source": "iana" + }, + "audio/cn": { + "source": "iana" + }, + "audio/dat12": { + "source": "iana" + }, + "audio/dls": { + "source": "iana" + }, + "audio/dsr-es201108": { + "source": "iana" + }, + "audio/dsr-es202050": { + "source": "iana" + }, + "audio/dsr-es202211": { + "source": "iana" + }, + "audio/dsr-es202212": { + "source": "iana" + }, + "audio/dv": { + "source": "iana" + }, + "audio/dvi4": { + "source": "iana" + }, + "audio/eac3": { + "source": "iana" + }, + "audio/encaprtp": { + "source": "iana" + }, + "audio/evrc": { + "source": "iana" + }, + "audio/evrc-qcp": { + "source": "iana" + }, + "audio/evrc0": { + "source": "iana" + }, + "audio/evrc1": { + "source": "iana" + }, + "audio/evrcb": { + "source": "iana" + }, + "audio/evrcb0": { + "source": "iana" + }, + "audio/evrcb1": { + "source": "iana" + }, + "audio/evrcnw": { + "source": "iana" + }, + "audio/evrcnw0": { + "source": "iana" + }, + "audio/evrcnw1": { + "source": "iana" + }, + "audio/evrcwb": { + "source": "iana" + }, + "audio/evrcwb0": { + "source": "iana" + }, + "audio/evrcwb1": { + "source": "iana" + }, + "audio/evs": { + "source": "iana" + }, + "audio/fwdred": { + "source": "iana" + }, + "audio/g711-0": { + "source": "iana" + }, + "audio/g719": { + "source": "iana" + }, + "audio/g722": { + "source": "iana" + }, + "audio/g7221": { + "source": "iana" + }, + "audio/g723": { + "source": "iana" + }, + "audio/g726-16": { + "source": "iana" + }, + "audio/g726-24": { + "source": "iana" + }, + "audio/g726-32": { + "source": "iana" + }, + "audio/g726-40": { + "source": "iana" + }, + "audio/g728": { + "source": "iana" + }, + "audio/g729": { + "source": "iana" + }, + "audio/g7291": { + "source": "iana" + }, + "audio/g729d": { + "source": "iana" + }, + "audio/g729e": { + "source": "iana" + }, + "audio/gsm": { + "source": "iana" + }, + "audio/gsm-efr": { + "source": "iana" + }, + "audio/gsm-hr-08": { + "source": "iana" + }, + "audio/ilbc": { + "source": "iana" + }, + "audio/ip-mr_v2.5": { + "source": "iana" + }, + "audio/isac": { + "source": "apache" + }, + "audio/l16": { + "source": "iana" + }, + "audio/l20": { + "source": "iana" + }, + "audio/l24": { + "source": "iana", + "compressible": false + }, + "audio/l8": { + "source": "iana" + }, + "audio/lpc": { + "source": "iana" + }, + "audio/melp": { + "source": "iana" + }, + "audio/melp1200": { + "source": "iana" + }, + "audio/melp2400": { + "source": "iana" + }, + "audio/melp600": { + "source": "iana" + }, + "audio/midi": { + "source": "apache", + "extensions": ["mid","midi","kar","rmi"] + }, + "audio/mobile-xmf": { + "source": "iana" + }, + "audio/mp3": { + "compressible": false, + "extensions": ["mp3"] + }, + "audio/mp4": { + "source": "iana", + "compressible": false, + "extensions": ["m4a","mp4a"] + }, + "audio/mp4a-latm": { + "source": "iana" + }, + "audio/mpa": { + "source": "iana" + }, + "audio/mpa-robust": { + "source": "iana" + }, + "audio/mpeg": { + "source": "iana", + "compressible": false, + "extensions": ["mpga","mp2","mp2a","mp3","m2a","m3a"] + }, + "audio/mpeg4-generic": { + "source": "iana" + }, + "audio/musepack": { + "source": "apache" + }, + "audio/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["oga","ogg","spx"] + }, + "audio/opus": { + "source": "iana" + }, + "audio/parityfec": { + "source": "iana" + }, + "audio/pcma": { + "source": "iana" + }, + "audio/pcma-wb": { + "source": "iana" + }, + "audio/pcmu": { + "source": "iana" + }, + "audio/pcmu-wb": { + "source": "iana" + }, + "audio/prs.sid": { + "source": "iana" + }, + "audio/qcelp": { + "source": "iana" + }, + "audio/raptorfec": { + "source": "iana" + }, + "audio/red": { + "source": "iana" + }, + "audio/rtp-enc-aescm128": { + "source": "iana" + }, + "audio/rtp-midi": { + "source": "iana" + }, + "audio/rtploopback": { + "source": "iana" + }, + "audio/rtx": { + "source": "iana" + }, + "audio/s3m": { + "source": "apache", + "extensions": ["s3m"] + }, + "audio/silk": { + "source": "apache", + "extensions": ["sil"] + }, + "audio/smv": { + "source": "iana" + }, + "audio/smv-qcp": { + "source": "iana" + }, + "audio/smv0": { + "source": "iana" + }, + "audio/sp-midi": { + "source": "iana" + }, + "audio/speex": { + "source": "iana" + }, + "audio/t140c": { + "source": "iana" + }, + "audio/t38": { + "source": "iana" + }, + "audio/telephone-event": { + "source": "iana" + }, + "audio/tetra_acelp": { + "source": "iana" + }, + "audio/tone": { + "source": "iana" + }, + "audio/uemclip": { + "source": "iana" + }, + "audio/ulpfec": { + "source": "iana" + }, + "audio/usac": { + "source": "iana" + }, + "audio/vdvi": { + "source": "iana" + }, + "audio/vmr-wb": { + "source": "iana" + }, + "audio/vnd.3gpp.iufp": { + "source": "iana" + }, + "audio/vnd.4sb": { + "source": "iana" + }, + "audio/vnd.audiokoz": { + "source": "iana" + }, + "audio/vnd.celp": { + "source": "iana" + }, + "audio/vnd.cisco.nse": { + "source": "iana" + }, + "audio/vnd.cmles.radio-events": { + "source": "iana" + }, + "audio/vnd.cns.anp1": { + "source": "iana" + }, + "audio/vnd.cns.inf1": { + "source": "iana" + }, + "audio/vnd.dece.audio": { + "source": "iana", + "extensions": ["uva","uvva"] + }, + "audio/vnd.digital-winds": { + "source": "iana", + "extensions": ["eol"] + }, + "audio/vnd.dlna.adts": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.1": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.2": { + "source": "iana" + }, + "audio/vnd.dolby.mlp": { + "source": "iana" + }, + "audio/vnd.dolby.mps": { + "source": "iana" + }, + "audio/vnd.dolby.pl2": { + "source": "iana" + }, + "audio/vnd.dolby.pl2x": { + "source": "iana" + }, + "audio/vnd.dolby.pl2z": { + "source": "iana" + }, + "audio/vnd.dolby.pulse.1": { + "source": "iana" + }, + "audio/vnd.dra": { + "source": "iana", + "extensions": ["dra"] + }, + "audio/vnd.dts": { + "source": "iana", + "extensions": ["dts"] + }, + "audio/vnd.dts.hd": { + "source": "iana", + "extensions": ["dtshd"] + }, + "audio/vnd.dts.uhd": { + "source": "iana" + }, + "audio/vnd.dvb.file": { + "source": "iana" + }, + "audio/vnd.everad.plj": { + "source": "iana" + }, + "audio/vnd.hns.audio": { + "source": "iana" + }, + "audio/vnd.lucent.voice": { + "source": "iana", + "extensions": ["lvp"] + }, + "audio/vnd.ms-playready.media.pya": { + "source": "iana", + "extensions": ["pya"] + }, + "audio/vnd.nokia.mobile-xmf": { + "source": "iana" + }, + "audio/vnd.nortel.vbk": { + "source": "iana" + }, + "audio/vnd.nuera.ecelp4800": { + "source": "iana", + "extensions": ["ecelp4800"] + }, + "audio/vnd.nuera.ecelp7470": { + "source": "iana", + "extensions": ["ecelp7470"] + }, + "audio/vnd.nuera.ecelp9600": { + "source": "iana", + "extensions": ["ecelp9600"] + }, + "audio/vnd.octel.sbc": { + "source": "iana" + }, + "audio/vnd.presonus.multitrack": { + "source": "iana" + }, + "audio/vnd.qcelp": { + "source": "iana" + }, + "audio/vnd.rhetorex.32kadpcm": { + "source": "iana" + }, + "audio/vnd.rip": { + "source": "iana", + "extensions": ["rip"] + }, + "audio/vnd.rn-realaudio": { + "compressible": false + }, + "audio/vnd.sealedmedia.softseal.mpeg": { + "source": "iana" + }, + "audio/vnd.vmx.cvsd": { + "source": "iana" + }, + "audio/vnd.wave": { + "compressible": false + }, + "audio/vorbis": { + "source": "iana", + "compressible": false + }, + "audio/vorbis-config": { + "source": "iana" + }, + "audio/wav": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/wave": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/webm": { + "source": "apache", + "compressible": false, + "extensions": ["weba"] + }, + "audio/x-aac": { + "source": "apache", + "compressible": false, + "extensions": ["aac"] + }, + "audio/x-aiff": { + "source": "apache", + "extensions": ["aif","aiff","aifc"] + }, + "audio/x-caf": { + "source": "apache", + "compressible": false, + "extensions": ["caf"] + }, + "audio/x-flac": { + "source": "apache", + "extensions": ["flac"] + }, + "audio/x-m4a": { + "source": "nginx", + "extensions": ["m4a"] + }, + "audio/x-matroska": { + "source": "apache", + "extensions": ["mka"] + }, + "audio/x-mpegurl": { + "source": "apache", + "extensions": ["m3u"] + }, + "audio/x-ms-wax": { + "source": "apache", + "extensions": ["wax"] + }, + "audio/x-ms-wma": { + "source": "apache", + "extensions": ["wma"] + }, + "audio/x-pn-realaudio": { + "source": "apache", + "extensions": ["ram","ra"] + }, + "audio/x-pn-realaudio-plugin": { + "source": "apache", + "extensions": ["rmp"] + }, + "audio/x-realaudio": { + "source": "nginx", + "extensions": ["ra"] + }, + "audio/x-tta": { + "source": "apache" + }, + "audio/x-wav": { + "source": "apache", + "extensions": ["wav"] + }, + "audio/xm": { + "source": "apache", + "extensions": ["xm"] + }, + "chemical/x-cdx": { + "source": "apache", + "extensions": ["cdx"] + }, + "chemical/x-cif": { + "source": "apache", + "extensions": ["cif"] + }, + "chemical/x-cmdf": { + "source": "apache", + "extensions": ["cmdf"] + }, + "chemical/x-cml": { + "source": "apache", + "extensions": ["cml"] + }, + "chemical/x-csml": { + "source": "apache", + "extensions": ["csml"] + }, + "chemical/x-pdb": { + "source": "apache" + }, + "chemical/x-xyz": { + "source": "apache", + "extensions": ["xyz"] + }, + "font/collection": { + "source": "iana", + "extensions": ["ttc"] + }, + "font/otf": { + "source": "iana", + "compressible": true, + "extensions": ["otf"] + }, + "font/sfnt": { + "source": "iana" + }, + "font/ttf": { + "source": "iana", + "extensions": ["ttf"] + }, + "font/woff": { + "source": "iana", + "extensions": ["woff"] + }, + "font/woff2": { + "source": "iana", + "extensions": ["woff2"] + }, + "image/aces": { + "source": "iana", + "extensions": ["exr"] + }, + "image/apng": { + "compressible": false, + "extensions": ["apng"] + }, + "image/avci": { + "source": "iana" + }, + "image/avcs": { + "source": "iana" + }, + "image/bmp": { + "source": "iana", + "compressible": true, + "extensions": ["bmp"] + }, + "image/cgm": { + "source": "iana", + "extensions": ["cgm"] + }, + "image/dicom-rle": { + "source": "iana", + "extensions": ["drle"] + }, + "image/emf": { + "source": "iana", + "extensions": ["emf"] + }, + "image/fits": { + "source": "iana", + "extensions": ["fits"] + }, + "image/g3fax": { + "source": "iana", + "extensions": ["g3"] + }, + "image/gif": { + "source": "iana", + "compressible": false, + "extensions": ["gif"] + }, + "image/heic": { + "source": "iana", + "extensions": ["heic"] + }, + "image/heic-sequence": { + "source": "iana", + "extensions": ["heics"] + }, + "image/heif": { + "source": "iana", + "extensions": ["heif"] + }, + "image/heif-sequence": { + "source": "iana", + "extensions": ["heifs"] + }, + "image/ief": { + "source": "iana", + "extensions": ["ief"] + }, + "image/jls": { + "source": "iana", + "extensions": ["jls"] + }, + "image/jp2": { + "source": "iana", + "compressible": false, + "extensions": ["jp2","jpg2"] + }, + "image/jpeg": { + "source": "iana", + "compressible": false, + "extensions": ["jpeg","jpg","jpe"] + }, + "image/jpm": { + "source": "iana", + "compressible": false, + "extensions": ["jpm"] + }, + "image/jpx": { + "source": "iana", + "compressible": false, + "extensions": ["jpx","jpf"] + }, + "image/jxr": { + "source": "iana", + "extensions": ["jxr"] + }, + "image/ktx": { + "source": "iana", + "extensions": ["ktx"] + }, + "image/naplps": { + "source": "iana" + }, + "image/pjpeg": { + "compressible": false + }, + "image/png": { + "source": "iana", + "compressible": false, + "extensions": ["png"] + }, + "image/prs.btif": { + "source": "iana", + "extensions": ["btif"] + }, + "image/prs.pti": { + "source": "iana", + "extensions": ["pti"] + }, + "image/pwg-raster": { + "source": "iana" + }, + "image/sgi": { + "source": "apache", + "extensions": ["sgi"] + }, + "image/svg+xml": { + "source": "iana", + "compressible": true, + "extensions": ["svg","svgz"] + }, + "image/t38": { + "source": "iana", + "extensions": ["t38"] + }, + "image/tiff": { + "source": "iana", + "compressible": false, + "extensions": ["tif","tiff"] + }, + "image/tiff-fx": { + "source": "iana", + "extensions": ["tfx"] + }, + "image/vnd.adobe.photoshop": { + "source": "iana", + "compressible": true, + "extensions": ["psd"] + }, + "image/vnd.airzip.accelerator.azv": { + "source": "iana", + "extensions": ["azv"] + }, + "image/vnd.cns.inf2": { + "source": "iana" + }, + "image/vnd.dece.graphic": { + "source": "iana", + "extensions": ["uvi","uvvi","uvg","uvvg"] + }, + "image/vnd.djvu": { + "source": "iana", + "extensions": ["djvu","djv"] + }, + "image/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "image/vnd.dwg": { + "source": "iana", + "extensions": ["dwg"] + }, + "image/vnd.dxf": { + "source": "iana", + "extensions": ["dxf"] + }, + "image/vnd.fastbidsheet": { + "source": "iana", + "extensions": ["fbs"] + }, + "image/vnd.fpx": { + "source": "iana", + "extensions": ["fpx"] + }, + "image/vnd.fst": { + "source": "iana", + "extensions": ["fst"] + }, + "image/vnd.fujixerox.edmics-mmr": { + "source": "iana", + "extensions": ["mmr"] + }, + "image/vnd.fujixerox.edmics-rlc": { + "source": "iana", + "extensions": ["rlc"] + }, + "image/vnd.globalgraphics.pgb": { + "source": "iana" + }, + "image/vnd.microsoft.icon": { + "source": "iana", + "extensions": ["ico"] + }, + "image/vnd.mix": { + "source": "iana" + }, + "image/vnd.mozilla.apng": { + "source": "iana" + }, + "image/vnd.ms-modi": { + "source": "iana", + "extensions": ["mdi"] + }, + "image/vnd.ms-photo": { + "source": "apache", + "extensions": ["wdp"] + }, + "image/vnd.net-fpx": { + "source": "iana", + "extensions": ["npx"] + }, + "image/vnd.radiance": { + "source": "iana" + }, + "image/vnd.sealed.png": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.gif": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.jpg": { + "source": "iana" + }, + "image/vnd.svf": { + "source": "iana" + }, + "image/vnd.tencent.tap": { + "source": "iana", + "extensions": ["tap"] + }, + "image/vnd.valve.source.texture": { + "source": "iana", + "extensions": ["vtf"] + }, + "image/vnd.wap.wbmp": { + "source": "iana", + "extensions": ["wbmp"] + }, + "image/vnd.xiff": { + "source": "iana", + "extensions": ["xif"] + }, + "image/vnd.zbrush.pcx": { + "source": "iana", + "extensions": ["pcx"] + }, + "image/webp": { + "source": "apache", + "extensions": ["webp"] + }, + "image/wmf": { + "source": "iana", + "extensions": ["wmf"] + }, + "image/x-3ds": { + "source": "apache", + "extensions": ["3ds"] + }, + "image/x-cmu-raster": { + "source": "apache", + "extensions": ["ras"] + }, + "image/x-cmx": { + "source": "apache", + "extensions": ["cmx"] + }, + "image/x-freehand": { + "source": "apache", + "extensions": ["fh","fhc","fh4","fh5","fh7"] + }, + "image/x-icon": { + "source": "apache", + "compressible": true, + "extensions": ["ico"] + }, + "image/x-jng": { + "source": "nginx", + "extensions": ["jng"] + }, + "image/x-mrsid-image": { + "source": "apache", + "extensions": ["sid"] + }, + "image/x-ms-bmp": { + "source": "nginx", + "compressible": true, + "extensions": ["bmp"] + }, + "image/x-pcx": { + "source": "apache", + "extensions": ["pcx"] + }, + "image/x-pict": { + "source": "apache", + "extensions": ["pic","pct"] + }, + "image/x-portable-anymap": { + "source": "apache", + "extensions": ["pnm"] + }, + "image/x-portable-bitmap": { + "source": "apache", + "extensions": ["pbm"] + }, + "image/x-portable-graymap": { + "source": "apache", + "extensions": ["pgm"] + }, + "image/x-portable-pixmap": { + "source": "apache", + "extensions": ["ppm"] + }, + "image/x-rgb": { + "source": "apache", + "extensions": ["rgb"] + }, + "image/x-tga": { + "source": "apache", + "extensions": ["tga"] + }, + "image/x-xbitmap": { + "source": "apache", + "extensions": ["xbm"] + }, + "image/x-xcf": { + "compressible": false + }, + "image/x-xpixmap": { + "source": "apache", + "extensions": ["xpm"] + }, + "image/x-xwindowdump": { + "source": "apache", + "extensions": ["xwd"] + }, + "message/cpim": { + "source": "iana" + }, + "message/delivery-status": { + "source": "iana" + }, + "message/disposition-notification": { + "source": "iana", + "extensions": [ + "disposition-notification" + ] + }, + "message/external-body": { + "source": "iana" + }, + "message/feedback-report": { + "source": "iana" + }, + "message/global": { + "source": "iana", + "extensions": ["u8msg"] + }, + "message/global-delivery-status": { + "source": "iana", + "extensions": ["u8dsn"] + }, + "message/global-disposition-notification": { + "source": "iana", + "extensions": ["u8mdn"] + }, + "message/global-headers": { + "source": "iana", + "extensions": ["u8hdr"] + }, + "message/http": { + "source": "iana", + "compressible": false + }, + "message/imdn+xml": { + "source": "iana", + "compressible": true + }, + "message/news": { + "source": "iana" + }, + "message/partial": { + "source": "iana", + "compressible": false + }, + "message/rfc822": { + "source": "iana", + "compressible": true, + "extensions": ["eml","mime"] + }, + "message/s-http": { + "source": "iana" + }, + "message/sip": { + "source": "iana" + }, + "message/sipfrag": { + "source": "iana" + }, + "message/tracking-status": { + "source": "iana" + }, + "message/vnd.si.simp": { + "source": "iana" + }, + "message/vnd.wfa.wsc": { + "source": "iana", + "extensions": ["wsc"] + }, + "model/3mf": { + "source": "iana", + "extensions": ["3mf"] + }, + "model/gltf+json": { + "source": "iana", + "compressible": true, + "extensions": ["gltf"] + }, + "model/gltf-binary": { + "source": "iana", + "compressible": true, + "extensions": ["glb"] + }, + "model/iges": { + "source": "iana", + "compressible": false, + "extensions": ["igs","iges"] + }, + "model/mesh": { + "source": "iana", + "compressible": false, + "extensions": ["msh","mesh","silo"] + }, + "model/stl": { + "source": "iana", + "extensions": ["stl"] + }, + "model/vnd.collada+xml": { + "source": "iana", + "compressible": true, + "extensions": ["dae"] + }, + "model/vnd.dwf": { + "source": "iana", + "extensions": ["dwf"] + }, + "model/vnd.flatland.3dml": { + "source": "iana" + }, + "model/vnd.gdl": { + "source": "iana", + "extensions": ["gdl"] + }, + "model/vnd.gs-gdl": { + "source": "apache" + }, + "model/vnd.gs.gdl": { + "source": "iana" + }, + "model/vnd.gtw": { + "source": "iana", + "extensions": ["gtw"] + }, + "model/vnd.moml+xml": { + "source": "iana", + "compressible": true + }, + "model/vnd.mts": { + "source": "iana", + "extensions": ["mts"] + }, + "model/vnd.opengex": { + "source": "iana", + "extensions": ["ogex"] + }, + "model/vnd.parasolid.transmit.binary": { + "source": "iana", + "extensions": ["x_b"] + }, + "model/vnd.parasolid.transmit.text": { + "source": "iana", + "extensions": ["x_t"] + }, + "model/vnd.rosette.annotated-data-model": { + "source": "iana" + }, + "model/vnd.usdz+zip": { + "source": "iana", + "compressible": false, + "extensions": ["usdz"] + }, + "model/vnd.valve.source.compiled-map": { + "source": "iana", + "extensions": ["bsp"] + }, + "model/vnd.vtu": { + "source": "iana", + "extensions": ["vtu"] + }, + "model/vrml": { + "source": "iana", + "compressible": false, + "extensions": ["wrl","vrml"] + }, + "model/x3d+binary": { + "source": "apache", + "compressible": false, + "extensions": ["x3db","x3dbz"] + }, + "model/x3d+fastinfoset": { + "source": "iana", + "extensions": ["x3db"] + }, + "model/x3d+vrml": { + "source": "apache", + "compressible": false, + "extensions": ["x3dv","x3dvz"] + }, + "model/x3d+xml": { + "source": "iana", + "compressible": true, + "extensions": ["x3d","x3dz"] + }, + "model/x3d-vrml": { + "source": "iana", + "extensions": ["x3dv"] + }, + "multipart/alternative": { + "source": "iana", + "compressible": false + }, + "multipart/appledouble": { + "source": "iana" + }, + "multipart/byteranges": { + "source": "iana" + }, + "multipart/digest": { + "source": "iana" + }, + "multipart/encrypted": { + "source": "iana", + "compressible": false + }, + "multipart/form-data": { + "source": "iana", + "compressible": false + }, + "multipart/header-set": { + "source": "iana" + }, + "multipart/mixed": { + "source": "iana", + "compressible": false + }, + "multipart/multilingual": { + "source": "iana" + }, + "multipart/parallel": { + "source": "iana" + }, + "multipart/related": { + "source": "iana", + "compressible": false + }, + "multipart/report": { + "source": "iana" + }, + "multipart/signed": { + "source": "iana", + "compressible": false + }, + "multipart/vnd.bint.med-plus": { + "source": "iana" + }, + "multipart/voice-message": { + "source": "iana" + }, + "multipart/x-mixed-replace": { + "source": "iana" + }, + "text/1d-interleaved-parityfec": { + "source": "iana" + }, + "text/cache-manifest": { + "source": "iana", + "compressible": true, + "extensions": ["appcache","manifest"] + }, + "text/calendar": { + "source": "iana", + "extensions": ["ics","ifb"] + }, + "text/calender": { + "compressible": true + }, + "text/cmd": { + "compressible": true + }, + "text/coffeescript": { + "extensions": ["coffee","litcoffee"] + }, + "text/css": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["css"] + }, + "text/csv": { + "source": "iana", + "compressible": true, + "extensions": ["csv"] + }, + "text/csv-schema": { + "source": "iana" + }, + "text/directory": { + "source": "iana" + }, + "text/dns": { + "source": "iana" + }, + "text/ecmascript": { + "source": "iana" + }, + "text/encaprtp": { + "source": "iana" + }, + "text/enriched": { + "source": "iana" + }, + "text/fwdred": { + "source": "iana" + }, + "text/grammar-ref-list": { + "source": "iana" + }, + "text/html": { + "source": "iana", + "compressible": true, + "extensions": ["html","htm","shtml"] + }, + "text/jade": { + "extensions": ["jade"] + }, + "text/javascript": { + "source": "iana", + "compressible": true + }, + "text/jcr-cnd": { + "source": "iana" + }, + "text/jsx": { + "compressible": true, + "extensions": ["jsx"] + }, + "text/less": { + "compressible": true, + "extensions": ["less"] + }, + "text/markdown": { + "source": "iana", + "compressible": true, + "extensions": ["markdown","md"] + }, + "text/mathml": { + "source": "nginx", + "extensions": ["mml"] + }, + "text/mdx": { + "compressible": true, + "extensions": ["mdx"] + }, + "text/mizar": { + "source": "iana" + }, + "text/n3": { + "source": "iana", + "compressible": true, + "extensions": ["n3"] + }, + "text/parameters": { + "source": "iana" + }, + "text/parityfec": { + "source": "iana" + }, + "text/plain": { + "source": "iana", + "compressible": true, + "extensions": ["txt","text","conf","def","list","log","in","ini"] + }, + "text/provenance-notation": { + "source": "iana" + }, + "text/prs.fallenstein.rst": { + "source": "iana" + }, + "text/prs.lines.tag": { + "source": "iana", + "extensions": ["dsc"] + }, + "text/prs.prop.logic": { + "source": "iana" + }, + "text/raptorfec": { + "source": "iana" + }, + "text/red": { + "source": "iana" + }, + "text/rfc822-headers": { + "source": "iana" + }, + "text/richtext": { + "source": "iana", + "compressible": true, + "extensions": ["rtx"] + }, + "text/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "text/rtp-enc-aescm128": { + "source": "iana" + }, + "text/rtploopback": { + "source": "iana" + }, + "text/rtx": { + "source": "iana" + }, + "text/sgml": { + "source": "iana", + "extensions": ["sgml","sgm"] + }, + "text/shex": { + "extensions": ["shex"] + }, + "text/slim": { + "extensions": ["slim","slm"] + }, + "text/strings": { + "source": "iana" + }, + "text/stylus": { + "extensions": ["stylus","styl"] + }, + "text/t140": { + "source": "iana" + }, + "text/tab-separated-values": { + "source": "iana", + "compressible": true, + "extensions": ["tsv"] + }, + "text/troff": { + "source": "iana", + "extensions": ["t","tr","roff","man","me","ms"] + }, + "text/turtle": { + "source": "iana", + "charset": "UTF-8", + "extensions": ["ttl"] + }, + "text/ulpfec": { + "source": "iana" + }, + "text/uri-list": { + "source": "iana", + "compressible": true, + "extensions": ["uri","uris","urls"] + }, + "text/vcard": { + "source": "iana", + "compressible": true, + "extensions": ["vcard"] + }, + "text/vnd.a": { + "source": "iana" + }, + "text/vnd.abc": { + "source": "iana" + }, + "text/vnd.ascii-art": { + "source": "iana" + }, + "text/vnd.curl": { + "source": "iana", + "extensions": ["curl"] + }, + "text/vnd.curl.dcurl": { + "source": "apache", + "extensions": ["dcurl"] + }, + "text/vnd.curl.mcurl": { + "source": "apache", + "extensions": ["mcurl"] + }, + "text/vnd.curl.scurl": { + "source": "apache", + "extensions": ["scurl"] + }, + "text/vnd.debian.copyright": { + "source": "iana" + }, + "text/vnd.dmclientscript": { + "source": "iana" + }, + "text/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "text/vnd.esmertec.theme-descriptor": { + "source": "iana" + }, + "text/vnd.fly": { + "source": "iana", + "extensions": ["fly"] + }, + "text/vnd.fmi.flexstor": { + "source": "iana", + "extensions": ["flx"] + }, + "text/vnd.gml": { + "source": "iana" + }, + "text/vnd.graphviz": { + "source": "iana", + "extensions": ["gv"] + }, + "text/vnd.hgl": { + "source": "iana" + }, + "text/vnd.in3d.3dml": { + "source": "iana", + "extensions": ["3dml"] + }, + "text/vnd.in3d.spot": { + "source": "iana", + "extensions": ["spot"] + }, + "text/vnd.iptc.newsml": { + "source": "iana" + }, + "text/vnd.iptc.nitf": { + "source": "iana" + }, + "text/vnd.latex-z": { + "source": "iana" + }, + "text/vnd.motorola.reflex": { + "source": "iana" + }, + "text/vnd.ms-mediapackage": { + "source": "iana" + }, + "text/vnd.net2phone.commcenter.command": { + "source": "iana" + }, + "text/vnd.radisys.msml-basic-layout": { + "source": "iana" + }, + "text/vnd.senx.warpscript": { + "source": "iana" + }, + "text/vnd.si.uricatalogue": { + "source": "iana" + }, + "text/vnd.sun.j2me.app-descriptor": { + "source": "iana", + "extensions": ["jad"] + }, + "text/vnd.trolltech.linguist": { + "source": "iana" + }, + "text/vnd.wap.si": { + "source": "iana" + }, + "text/vnd.wap.sl": { + "source": "iana" + }, + "text/vnd.wap.wml": { + "source": "iana", + "extensions": ["wml"] + }, + "text/vnd.wap.wmlscript": { + "source": "iana", + "extensions": ["wmls"] + }, + "text/vtt": { + "charset": "UTF-8", + "compressible": true, + "extensions": ["vtt"] + }, + "text/x-asm": { + "source": "apache", + "extensions": ["s","asm"] + }, + "text/x-c": { + "source": "apache", + "extensions": ["c","cc","cxx","cpp","h","hh","dic"] + }, + "text/x-component": { + "source": "nginx", + "extensions": ["htc"] + }, + "text/x-fortran": { + "source": "apache", + "extensions": ["f","for","f77","f90"] + }, + "text/x-gwt-rpc": { + "compressible": true + }, + "text/x-handlebars-template": { + "extensions": ["hbs"] + }, + "text/x-java-source": { + "source": "apache", + "extensions": ["java"] + }, + "text/x-jquery-tmpl": { + "compressible": true + }, + "text/x-lua": { + "extensions": ["lua"] + }, + "text/x-markdown": { + "compressible": true, + "extensions": ["mkd"] + }, + "text/x-nfo": { + "source": "apache", + "extensions": ["nfo"] + }, + "text/x-opml": { + "source": "apache", + "extensions": ["opml"] + }, + "text/x-org": { + "compressible": true, + "extensions": ["org"] + }, + "text/x-pascal": { + "source": "apache", + "extensions": ["p","pas"] + }, + "text/x-processing": { + "compressible": true, + "extensions": ["pde"] + }, + "text/x-sass": { + "extensions": ["sass"] + }, + "text/x-scss": { + "extensions": ["scss"] + }, + "text/x-setext": { + "source": "apache", + "extensions": ["etx"] + }, + "text/x-sfv": { + "source": "apache", + "extensions": ["sfv"] + }, + "text/x-suse-ymp": { + "compressible": true, + "extensions": ["ymp"] + }, + "text/x-uuencode": { + "source": "apache", + "extensions": ["uu"] + }, + "text/x-vcalendar": { + "source": "apache", + "extensions": ["vcs"] + }, + "text/x-vcard": { + "source": "apache", + "extensions": ["vcf"] + }, + "text/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml"] + }, + "text/xml-external-parsed-entity": { + "source": "iana" + }, + "text/yaml": { + "extensions": ["yaml","yml"] + }, + "video/1d-interleaved-parityfec": { + "source": "iana" + }, + "video/3gpp": { + "source": "iana", + "extensions": ["3gp","3gpp"] + }, + "video/3gpp-tt": { + "source": "iana" + }, + "video/3gpp2": { + "source": "iana", + "extensions": ["3g2"] + }, + "video/bmpeg": { + "source": "iana" + }, + "video/bt656": { + "source": "iana" + }, + "video/celb": { + "source": "iana" + }, + "video/dv": { + "source": "iana" + }, + "video/encaprtp": { + "source": "iana" + }, + "video/h261": { + "source": "iana", + "extensions": ["h261"] + }, + "video/h263": { + "source": "iana", + "extensions": ["h263"] + }, + "video/h263-1998": { + "source": "iana" + }, + "video/h263-2000": { + "source": "iana" + }, + "video/h264": { + "source": "iana", + "extensions": ["h264"] + }, + "video/h264-rcdo": { + "source": "iana" + }, + "video/h264-svc": { + "source": "iana" + }, + "video/h265": { + "source": "iana" + }, + "video/iso.segment": { + "source": "iana" + }, + "video/jpeg": { + "source": "iana", + "extensions": ["jpgv"] + }, + "video/jpeg2000": { + "source": "iana" + }, + "video/jpm": { + "source": "apache", + "extensions": ["jpm","jpgm"] + }, + "video/mj2": { + "source": "iana", + "extensions": ["mj2","mjp2"] + }, + "video/mp1s": { + "source": "iana" + }, + "video/mp2p": { + "source": "iana" + }, + "video/mp2t": { + "source": "iana", + "extensions": ["ts"] + }, + "video/mp4": { + "source": "iana", + "compressible": false, + "extensions": ["mp4","mp4v","mpg4"] + }, + "video/mp4v-es": { + "source": "iana" + }, + "video/mpeg": { + "source": "iana", + "compressible": false, + "extensions": ["mpeg","mpg","mpe","m1v","m2v"] + }, + "video/mpeg4-generic": { + "source": "iana" + }, + "video/mpv": { + "source": "iana" + }, + "video/nv": { + "source": "iana" + }, + "video/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["ogv"] + }, + "video/parityfec": { + "source": "iana" + }, + "video/pointer": { + "source": "iana" + }, + "video/quicktime": { + "source": "iana", + "compressible": false, + "extensions": ["qt","mov"] + }, + "video/raptorfec": { + "source": "iana" + }, + "video/raw": { + "source": "iana" + }, + "video/rtp-enc-aescm128": { + "source": "iana" + }, + "video/rtploopback": { + "source": "iana" + }, + "video/rtx": { + "source": "iana" + }, + "video/smpte291": { + "source": "iana" + }, + "video/smpte292m": { + "source": "iana" + }, + "video/ulpfec": { + "source": "iana" + }, + "video/vc1": { + "source": "iana" + }, + "video/vc2": { + "source": "iana" + }, + "video/vnd.cctv": { + "source": "iana" + }, + "video/vnd.dece.hd": { + "source": "iana", + "extensions": ["uvh","uvvh"] + }, + "video/vnd.dece.mobile": { + "source": "iana", + "extensions": ["uvm","uvvm"] + }, + "video/vnd.dece.mp4": { + "source": "iana" + }, + "video/vnd.dece.pd": { + "source": "iana", + "extensions": ["uvp","uvvp"] + }, + "video/vnd.dece.sd": { + "source": "iana", + "extensions": ["uvs","uvvs"] + }, + "video/vnd.dece.video": { + "source": "iana", + "extensions": ["uvv","uvvv"] + }, + "video/vnd.directv.mpeg": { + "source": "iana" + }, + "video/vnd.directv.mpeg-tts": { + "source": "iana" + }, + "video/vnd.dlna.mpeg-tts": { + "source": "iana" + }, + "video/vnd.dvb.file": { + "source": "iana", + "extensions": ["dvb"] + }, + "video/vnd.fvt": { + "source": "iana", + "extensions": ["fvt"] + }, + "video/vnd.hns.video": { + "source": "iana" + }, + "video/vnd.iptvforum.1dparityfec-1010": { + "source": "iana" + }, + "video/vnd.iptvforum.1dparityfec-2005": { + "source": "iana" + }, + "video/vnd.iptvforum.2dparityfec-1010": { + "source": "iana" + }, + "video/vnd.iptvforum.2dparityfec-2005": { + "source": "iana" + }, + "video/vnd.iptvforum.ttsavc": { + "source": "iana" + }, + "video/vnd.iptvforum.ttsmpeg2": { + "source": "iana" + }, + "video/vnd.motorola.video": { + "source": "iana" + }, + "video/vnd.motorola.videop": { + "source": "iana" + }, + "video/vnd.mpegurl": { + "source": "iana", + "extensions": ["mxu","m4u"] + }, + "video/vnd.ms-playready.media.pyv": { + "source": "iana", + "extensions": ["pyv"] + }, + "video/vnd.nokia.interleaved-multimedia": { + "source": "iana" + }, + "video/vnd.nokia.mp4vr": { + "source": "iana" + }, + "video/vnd.nokia.videovoip": { + "source": "iana" + }, + "video/vnd.objectvideo": { + "source": "iana" + }, + "video/vnd.radgamettools.bink": { + "source": "iana" + }, + "video/vnd.radgamettools.smacker": { + "source": "iana" + }, + "video/vnd.sealed.mpeg1": { + "source": "iana" + }, + "video/vnd.sealed.mpeg4": { + "source": "iana" + }, + "video/vnd.sealed.swf": { + "source": "iana" + }, + "video/vnd.sealedmedia.softseal.mov": { + "source": "iana" + }, + "video/vnd.uvvu.mp4": { + "source": "iana", + "extensions": ["uvu","uvvu"] + }, + "video/vnd.vivo": { + "source": "iana", + "extensions": ["viv"] + }, + "video/vp8": { + "source": "iana" + }, + "video/webm": { + "source": "apache", + "compressible": false, + "extensions": ["webm"] + }, + "video/x-f4v": { + "source": "apache", + "extensions": ["f4v"] + }, + "video/x-fli": { + "source": "apache", + "extensions": ["fli"] + }, + "video/x-flv": { + "source": "apache", + "compressible": false, + "extensions": ["flv"] + }, + "video/x-m4v": { + "source": "apache", + "extensions": ["m4v"] + }, + "video/x-matroska": { + "source": "apache", + "compressible": false, + "extensions": ["mkv","mk3d","mks"] + }, + "video/x-mng": { + "source": "apache", + "extensions": ["mng"] + }, + "video/x-ms-asf": { + "source": "apache", + "extensions": ["asf","asx"] + }, + "video/x-ms-vob": { + "source": "apache", + "extensions": ["vob"] + }, + "video/x-ms-wm": { + "source": "apache", + "extensions": ["wm"] + }, + "video/x-ms-wmv": { + "source": "apache", + "compressible": false, + "extensions": ["wmv"] + }, + "video/x-ms-wmx": { + "source": "apache", + "extensions": ["wmx"] + }, + "video/x-ms-wvx": { + "source": "apache", + "extensions": ["wvx"] + }, + "video/x-msvideo": { + "source": "apache", + "extensions": ["avi"] + }, + "video/x-sgi-movie": { + "source": "apache", + "extensions": ["movie"] + }, + "video/x-smv": { + "source": "apache", + "extensions": ["smv"] + }, + "x-conference/x-cooltalk": { + "source": "apache", + "extensions": ["ice"] + }, + "x-shader/x-fragment": { + "compressible": true + }, + "x-shader/x-vertex": { + "compressible": true + } +} diff --git a/node_modules/mime-db/index.js b/node_modules/mime-db/index.js new file mode 100644 index 0000000..551031f --- /dev/null +++ b/node_modules/mime-db/index.js @@ -0,0 +1,11 @@ +/*! + * mime-db + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = require('./db.json') diff --git a/node_modules/mime-db/package.json b/node_modules/mime-db/package.json new file mode 100644 index 0000000..5c6e993 --- /dev/null +++ b/node_modules/mime-db/package.json @@ -0,0 +1,101 @@ +{ + "_from": "mime-db@1.40.0", + "_id": "mime-db@1.40.0", + "_inBundle": false, + "_integrity": "sha512-jYdeOMPy9vnxEqFRRo6ZvTZ8d9oPb+k18PKoYNYUe2stVEBPPwsln/qWzdbmaIvnhZ9v2P+CuecK+fpUfsV2mA==", + "_location": "/mime-db", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "mime-db@1.40.0", + "name": "mime-db", + "escapedName": "mime-db", + "rawSpec": "1.40.0", + "saveSpec": null, + "fetchSpec": "1.40.0" + }, + "_requiredBy": [ + "/mime-types" + ], + "_resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.40.0.tgz", + "_shasum": "a65057e998db090f732a68f6c276d387d4126c32", + "_spec": "mime-db@1.40.0", + "_where": "/home/josuer08/Documents/web/node_modules/mime-types", + "bugs": { + "url": "https://github.com/jshttp/mime-db/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + { + "name": "Robert Kieffer", + "email": "robert@broofa.com", + "url": "http://github.com/broofa" + } + ], + "deprecated": false, + "description": "Media Type Database", + "devDependencies": { + "bluebird": "3.5.4", + "co": "4.6.0", + "cogent": "1.0.1", + "csv-parse": "4.3.4", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.16.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "gnode": "0.1.2", + "mocha": "6.1.4", + "nyc": "14.0.0", + "raw-body": "2.3.3", + "stream-to-array": "2.3.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "db.json", + "index.js" + ], + "homepage": "https://github.com/jshttp/mime-db#readme", + "keywords": [ + "mime", + "db", + "type", + "types", + "database", + "charset", + "charsets" + ], + "license": "MIT", + "name": "mime-db", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/mime-db.git" + }, + "scripts": { + "build": "node scripts/build", + "fetch": "node scripts/fetch-apache && gnode scripts/fetch-iana && node scripts/fetch-nginx", + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test", + "update": "npm run fetch && npm run build", + "version": "node scripts/version-history.js && git add HISTORY.md" + }, + "version": "1.40.0" +} diff --git a/node_modules/mime-types/HISTORY.md b/node_modules/mime-types/HISTORY.md new file mode 100644 index 0000000..aef15bb --- /dev/null +++ b/node_modules/mime-types/HISTORY.md @@ -0,0 +1,308 @@ +2.1.24 / 2019-04-20 +=================== + + * deps: mime-db@1.40.0 + - Add extensions from IANA for `model/*` types + - Add `text/mdx` with extension `.mdx` + +2.1.23 / 2019-04-17 +=================== + + * deps: mime-db@~1.39.0 + - Add extensions `.siv` and `.sieve` to `application/sieve` + - Add new upstream MIME types + +2.1.22 / 2019-02-14 +=================== + + * deps: mime-db@~1.38.0 + - Add extension `.nq` to `application/n-quads` + - Add extension `.nt` to `application/n-triples` + - Add new upstream MIME types + - Mark `text/less` as compressible + +2.1.21 / 2018-10-19 +=================== + + * deps: mime-db@~1.37.0 + - Add extensions to HEIC image types + - Add new upstream MIME types + +2.1.20 / 2018-08-26 +=================== + + * deps: mime-db@~1.36.0 + - Add Apple file extensions from IANA + - Add extensions from IANA for `image/*` types + - Add new upstream MIME types + +2.1.19 / 2018-07-17 +=================== + + * deps: mime-db@~1.35.0 + - Add extension `.csl` to `application/vnd.citationstyles.style+xml` + - Add extension `.es` to `application/ecmascript` + - Add extension `.owl` to `application/rdf+xml` + - Add new upstream MIME types + - Add UTF-8 as default charset for `text/turtle` + +2.1.18 / 2018-02-16 +=================== + + * deps: mime-db@~1.33.0 + - Add `application/raml+yaml` with extension `.raml` + - Add `application/wasm` with extension `.wasm` + - Add `text/shex` with extension `.shex` + - Add extensions for JPEG-2000 images + - Add extensions from IANA for `message/*` types + - Add new upstream MIME types + - Update font MIME types + - Update `text/hjson` to registered `application/hjson` + +2.1.17 / 2017-09-01 +=================== + + * deps: mime-db@~1.30.0 + - Add `application/vnd.ms-outlook` + - Add `application/x-arj` + - Add extension `.mjs` to `application/javascript` + - Add glTF types and extensions + - Add new upstream MIME types + - Add `text/x-org` + - Add VirtualBox MIME types + - Fix `source` records for `video/*` types that are IANA + - Update `font/opentype` to registered `font/otf` + +2.1.16 / 2017-07-24 +=================== + + * deps: mime-db@~1.29.0 + - Add `application/fido.trusted-apps+json` + - Add extension `.wadl` to `application/vnd.sun.wadl+xml` + - Add extension `.gz` to `application/gzip` + - Add new upstream MIME types + - Update extensions `.md` and `.markdown` to be `text/markdown` + +2.1.15 / 2017-03-23 +=================== + + * deps: mime-db@~1.27.0 + - Add new mime types + - Add `image/apng` + +2.1.14 / 2017-01-14 +=================== + + * deps: mime-db@~1.26.0 + - Add new mime types + +2.1.13 / 2016-11-18 +=================== + + * deps: mime-db@~1.25.0 + - Add new mime types + +2.1.12 / 2016-09-18 +=================== + + * deps: mime-db@~1.24.0 + - Add new mime types + - Add `audio/mp3` + +2.1.11 / 2016-05-01 +=================== + + * deps: mime-db@~1.23.0 + - Add new mime types + +2.1.10 / 2016-02-15 +=================== + + * deps: mime-db@~1.22.0 + - Add new mime types + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + +2.1.9 / 2016-01-06 +================== + + * deps: mime-db@~1.21.0 + - Add new mime types + +2.1.8 / 2015-11-30 +================== + + * deps: mime-db@~1.20.0 + - Add new mime types + +2.1.7 / 2015-09-20 +================== + + * deps: mime-db@~1.19.0 + - Add new mime types + +2.1.6 / 2015-09-03 +================== + + * deps: mime-db@~1.18.0 + - Add new mime types + +2.1.5 / 2015-08-20 +================== + + * deps: mime-db@~1.17.0 + - Add new mime types + +2.1.4 / 2015-07-30 +================== + + * deps: mime-db@~1.16.0 + - Add new mime types + +2.1.3 / 2015-07-13 +================== + + * deps: mime-db@~1.15.0 + - Add new mime types + +2.1.2 / 2015-06-25 +================== + + * deps: mime-db@~1.14.0 + - Add new mime types + +2.1.1 / 2015-06-08 +================== + + * perf: fix deopt during mapping + +2.1.0 / 2015-06-07 +================== + + * Fix incorrectly treating extension-less file name as extension + - i.e. `'path/to/json'` will no longer return `application/json` + * Fix `.charset(type)` to accept parameters + * Fix `.charset(type)` to match case-insensitive + * Improve generation of extension to MIME mapping + * Refactor internals for readability and no argument reassignment + * Prefer `application/*` MIME types from the same source + * Prefer any type over `application/octet-stream` + * deps: mime-db@~1.13.0 + - Add nginx as a source + - Add new mime types + +2.0.14 / 2015-06-06 +=================== + + * deps: mime-db@~1.12.0 + - Add new mime types + +2.0.13 / 2015-05-31 +=================== + + * deps: mime-db@~1.11.0 + - Add new mime types + +2.0.12 / 2015-05-19 +=================== + + * deps: mime-db@~1.10.0 + - Add new mime types + +2.0.11 / 2015-05-05 +=================== + + * deps: mime-db@~1.9.1 + - Add new mime types + +2.0.10 / 2015-03-13 +=================== + + * deps: mime-db@~1.8.0 + - Add new mime types + +2.0.9 / 2015-02-09 +================== + + * deps: mime-db@~1.7.0 + - Add new mime types + - Community extensions ownership transferred from `node-mime` + +2.0.8 / 2015-01-29 +================== + + * deps: mime-db@~1.6.0 + - Add new mime types + +2.0.7 / 2014-12-30 +================== + + * deps: mime-db@~1.5.0 + - Add new mime types + - Fix various invalid MIME type entries + +2.0.6 / 2014-12-30 +================== + + * deps: mime-db@~1.4.0 + - Add new mime types + - Fix various invalid MIME type entries + - Remove example template MIME types + +2.0.5 / 2014-12-29 +================== + + * deps: mime-db@~1.3.1 + - Fix missing extensions + +2.0.4 / 2014-12-10 +================== + + * deps: mime-db@~1.3.0 + - Add new mime types + +2.0.3 / 2014-11-09 +================== + + * deps: mime-db@~1.2.0 + - Add new mime types + +2.0.2 / 2014-09-28 +================== + + * deps: mime-db@~1.1.0 + - Add new mime types + - Add additional compressible + - Update charsets + +2.0.1 / 2014-09-07 +================== + + * Support Node.js 0.6 + +2.0.0 / 2014-09-02 +================== + + * Use `mime-db` + * Remove `.define()` + +1.0.2 / 2014-08-04 +================== + + * Set charset=utf-8 for `text/javascript` + +1.0.1 / 2014-06-24 +================== + + * Add `text/jsx` type + +1.0.0 / 2014-05-12 +================== + + * Return `false` for unknown types + * Set charset=utf-8 for `application/json` + +0.1.0 / 2014-05-02 +================== + + * Initial release diff --git a/node_modules/mime-types/LICENSE b/node_modules/mime-types/LICENSE new file mode 100644 index 0000000..0616607 --- /dev/null +++ b/node_modules/mime-types/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong <me@jongleberry.com> +Copyright (c) 2015 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/mime-types/README.md b/node_modules/mime-types/README.md new file mode 100644 index 0000000..1dbef2b --- /dev/null +++ b/node_modules/mime-types/README.md @@ -0,0 +1,113 @@ +# mime-types + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +The ultimate javascript content-type utility. + +Similar to [the `mime@1.x` module](https://www.npmjs.com/package/mime), except: + +- __No fallbacks.__ Instead of naively returning the first available type, + `mime-types` simply returns `false`, so do + `var type = mime.lookup('unrecognized') || 'application/octet-stream'`. +- No `new Mime()` business, so you could do `var lookup = require('mime-types').lookup`. +- No `.define()` functionality +- Bug fixes for `.lookup(path)` + +Otherwise, the API is compatible with `mime` 1.x. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install mime-types +``` + +## Adding Types + +All mime types are based on [mime-db](https://www.npmjs.com/package/mime-db), +so open a PR there if you'd like to add mime types. + +## API + +```js +var mime = require('mime-types') +``` + +All functions return `false` if input is invalid or not found. + +### mime.lookup(path) + +Lookup the content-type associated with a file. + +```js +mime.lookup('json') // 'application/json' +mime.lookup('.md') // 'text/markdown' +mime.lookup('file.html') // 'text/html' +mime.lookup('folder/file.js') // 'application/javascript' +mime.lookup('folder/.htaccess') // false + +mime.lookup('cats') // false +``` + +### mime.contentType(type) + +Create a full content-type header given a content-type or extension. +When given an extension, `mime.lookup` is used to get the matching +content-type, otherwise the given content-type is used. Then if the +content-type does not already have a `charset` parameter, `mime.charset` +is used to get the default charset and add to the returned content-type. + +```js +mime.contentType('markdown') // 'text/x-markdown; charset=utf-8' +mime.contentType('file.json') // 'application/json; charset=utf-8' +mime.contentType('text/html') // 'text/html; charset=utf-8' +mime.contentType('text/html; charset=iso-8859-1') // 'text/html; charset=iso-8859-1' + +// from a full path +mime.contentType(path.extname('/path/to/file.json')) // 'application/json; charset=utf-8' +``` + +### mime.extension(type) + +Get the default extension for a content-type. + +```js +mime.extension('application/octet-stream') // 'bin' +``` + +### mime.charset(type) + +Lookup the implied default charset of a content-type. + +```js +mime.charset('text/markdown') // 'UTF-8' +``` + +### var type = mime.types[extension] + +A map of content-types by extension. + +### [extensions...] = mime.extensions[type] + +A map of extensions by content-type. + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/mime-types/master +[coveralls-url]: https://coveralls.io/r/jshttp/mime-types?branch=master +[node-version-image]: https://badgen.net/npm/node/mime-types +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/mime-types +[npm-url]: https://npmjs.org/package/mime-types +[npm-version-image]: https://badgen.net/npm/v/mime-types +[travis-image]: https://badgen.net/travis/jshttp/mime-types/master +[travis-url]: https://travis-ci.org/jshttp/mime-types diff --git a/node_modules/mime-types/index.js b/node_modules/mime-types/index.js new file mode 100644 index 0000000..b9f34d5 --- /dev/null +++ b/node_modules/mime-types/index.js @@ -0,0 +1,188 @@ +/*! + * mime-types + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var db = require('mime-db') +var extname = require('path').extname + +/** + * Module variables. + * @private + */ + +var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/ +var TEXT_TYPE_REGEXP = /^text\//i + +/** + * Module exports. + * @public + */ + +exports.charset = charset +exports.charsets = { lookup: charset } +exports.contentType = contentType +exports.extension = extension +exports.extensions = Object.create(null) +exports.lookup = lookup +exports.types = Object.create(null) + +// Populate the extensions/types maps +populateMaps(exports.extensions, exports.types) + +/** + * Get the default charset for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function charset (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = EXTRACT_TYPE_REGEXP.exec(type) + var mime = match && db[match[1].toLowerCase()] + + if (mime && mime.charset) { + return mime.charset + } + + // default text/* to utf-8 + if (match && TEXT_TYPE_REGEXP.test(match[1])) { + return 'UTF-8' + } + + return false +} + +/** + * Create a full Content-Type header given a MIME type or extension. + * + * @param {string} str + * @return {boolean|string} + */ + +function contentType (str) { + // TODO: should this even be in this module? + if (!str || typeof str !== 'string') { + return false + } + + var mime = str.indexOf('/') === -1 + ? exports.lookup(str) + : str + + if (!mime) { + return false + } + + // TODO: use content-type or other module + if (mime.indexOf('charset') === -1) { + var charset = exports.charset(mime) + if (charset) mime += '; charset=' + charset.toLowerCase() + } + + return mime +} + +/** + * Get the default extension for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function extension (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = EXTRACT_TYPE_REGEXP.exec(type) + + // get extensions + var exts = match && exports.extensions[match[1].toLowerCase()] + + if (!exts || !exts.length) { + return false + } + + return exts[0] +} + +/** + * Lookup the MIME type for a file path/extension. + * + * @param {string} path + * @return {boolean|string} + */ + +function lookup (path) { + if (!path || typeof path !== 'string') { + return false + } + + // get the extension ("ext" or ".ext" or full path) + var extension = extname('x.' + path) + .toLowerCase() + .substr(1) + + if (!extension) { + return false + } + + return exports.types[extension] || false +} + +/** + * Populate the extensions and types maps. + * @private + */ + +function populateMaps (extensions, types) { + // source preference (least -> most) + var preference = ['nginx', 'apache', undefined, 'iana'] + + Object.keys(db).forEach(function forEachMimeType (type) { + var mime = db[type] + var exts = mime.extensions + + if (!exts || !exts.length) { + return + } + + // mime -> extensions + extensions[type] = exts + + // extension -> mime + for (var i = 0; i < exts.length; i++) { + var extension = exts[i] + + if (types[extension]) { + var from = preference.indexOf(db[types[extension]].source) + var to = preference.indexOf(mime.source) + + if (types[extension] !== 'application/octet-stream' && + (from > to || (from === to && types[extension].substr(0, 12) === 'application/'))) { + // skip the remapping + continue + } + } + + // set the extension -> mime + types[extension] = type + } + }) +} diff --git a/node_modules/mime-types/package.json b/node_modules/mime-types/package.json new file mode 100644 index 0000000..72fae55 --- /dev/null +++ b/node_modules/mime-types/package.json @@ -0,0 +1,87 @@ +{ + "_from": "mime-types@~2.1.24", + "_id": "mime-types@2.1.24", + "_inBundle": false, + "_integrity": "sha512-WaFHS3MCl5fapm3oLxU4eYDw77IQM2ACcxQ9RIxfaC3ooc6PFuBMGZZsYpvoXS5D5QTWPieo1jjLdAm3TBP3cQ==", + "_location": "/mime-types", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "mime-types@~2.1.24", + "name": "mime-types", + "escapedName": "mime-types", + "rawSpec": "~2.1.24", + "saveSpec": null, + "fetchSpec": "~2.1.24" + }, + "_requiredBy": [ + "/accepts", + "/type-is" + ], + "_resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.24.tgz", + "_shasum": "b6f8d0b3e951efb77dedeca194cff6d16f676f81", + "_spec": "mime-types@~2.1.24", + "_where": "/home/josuer08/Documents/web/node_modules/accepts", + "bugs": { + "url": "https://github.com/jshttp/mime-types/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jeremiah Senkpiel", + "email": "fishrock123@rocketmail.com", + "url": "https://searchbeam.jit.su" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "mime-db": "1.40.0" + }, + "deprecated": false, + "description": "The ultimate javascript content-type utility.", + "devDependencies": { + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "mocha": "6.1.4", + "nyc": "14.0.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "homepage": "https://github.com/jshttp/mime-types#readme", + "keywords": [ + "mime", + "types" + ], + "license": "MIT", + "name": "mime-types", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/mime-types.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec test/test.js", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test" + }, + "version": "2.1.24" +} diff --git a/node_modules/mime/.npmignore b/node_modules/mime/.npmignore new file mode 100644 index 0000000..e69de29 diff --git a/node_modules/mime/CHANGELOG.md b/node_modules/mime/CHANGELOG.md new file mode 100644 index 0000000..f127535 --- /dev/null +++ b/node_modules/mime/CHANGELOG.md @@ -0,0 +1,164 @@ +# Changelog + +## v1.6.0 (24/11/2017) +*No changelog for this release.* + +--- + +## v2.0.4 (24/11/2017) +- [**closed**] Switch to mime-score module for resolving extension contention issues. [#182](https://github.com/broofa/node-mime/issues/182) +- [**closed**] Update mime-db to 1.31.0 in v1.x branch [#181](https://github.com/broofa/node-mime/issues/181) + +--- + +## v1.5.0 (22/11/2017) +- [**closed**] need ES5 version ready in npm package [#179](https://github.com/broofa/node-mime/issues/179) +- [**closed**] mime-db no trace of iWork - pages / numbers / etc. [#178](https://github.com/broofa/node-mime/issues/178) +- [**closed**] How it works in brownser ? [#176](https://github.com/broofa/node-mime/issues/176) +- [**closed**] Missing `./Mime` [#175](https://github.com/broofa/node-mime/issues/175) +- [**closed**] Vulnerable Regular Expression [#167](https://github.com/broofa/node-mime/issues/167) + +--- + +## v2.0.3 (25/09/2017) +*No changelog for this release.* + +--- + +## v1.4.1 (25/09/2017) +- [**closed**] Issue when bundling with webpack [#172](https://github.com/broofa/node-mime/issues/172) + +--- + +## v2.0.2 (15/09/2017) +- [**V2**] fs.readFileSync is not a function [#165](https://github.com/broofa/node-mime/issues/165) +- [**closed**] The extension for video/quicktime should map to .mov, not .qt [#164](https://github.com/broofa/node-mime/issues/164) +- [**V2**] [v2 Feedback request] Mime class API [#163](https://github.com/broofa/node-mime/issues/163) +- [**V2**] [v2 Feedback request] Resolving conflicts over extensions [#162](https://github.com/broofa/node-mime/issues/162) +- [**V2**] Allow callers to load module with official, full, or no defined types. [#161](https://github.com/broofa/node-mime/issues/161) +- [**V2**] Use "facets" to resolve extension conflicts [#160](https://github.com/broofa/node-mime/issues/160) +- [**V2**] Remove fs and path dependencies [#152](https://github.com/broofa/node-mime/issues/152) +- [**V2**] Default content-type should not be application/octet-stream [#139](https://github.com/broofa/node-mime/issues/139) +- [**V2**] reset mime-types [#124](https://github.com/broofa/node-mime/issues/124) +- [**V2**] Extensionless paths should return null or false [#113](https://github.com/broofa/node-mime/issues/113) + +--- + +## v2.0.1 (14/09/2017) +- [**closed**] Changelog for v2.0 does not mention breaking changes [#171](https://github.com/broofa/node-mime/issues/171) +- [**closed**] MIME breaking with 'class' declaration as it is without 'use strict mode' [#170](https://github.com/broofa/node-mime/issues/170) + +--- + +## v2.0.0 (12/09/2017) +- [**closed**] woff and woff2 [#168](https://github.com/broofa/node-mime/issues/168) + +--- + +## v1.4.0 (28/08/2017) +- [**closed**] support for ac3 voc files [#159](https://github.com/broofa/node-mime/issues/159) +- [**closed**] Help understanding change from application/xml to text/xml [#158](https://github.com/broofa/node-mime/issues/158) +- [**closed**] no longer able to override mimetype [#157](https://github.com/broofa/node-mime/issues/157) +- [**closed**] application/vnd.adobe.photoshop [#147](https://github.com/broofa/node-mime/issues/147) +- [**closed**] Directories should appear as something other than application/octet-stream [#135](https://github.com/broofa/node-mime/issues/135) +- [**closed**] requested features [#131](https://github.com/broofa/node-mime/issues/131) +- [**closed**] Make types.json loading optional? [#129](https://github.com/broofa/node-mime/issues/129) +- [**closed**] Cannot find module './types.json' [#120](https://github.com/broofa/node-mime/issues/120) +- [**V2**] .wav files show up as "audio/x-wav" instead of "audio/x-wave" [#118](https://github.com/broofa/node-mime/issues/118) +- [**closed**] Don't be a pain in the ass for node community [#108](https://github.com/broofa/node-mime/issues/108) +- [**closed**] don't make default_type global [#78](https://github.com/broofa/node-mime/issues/78) +- [**closed**] mime.extension() fails if the content-type is parameterized [#74](https://github.com/broofa/node-mime/issues/74) + +--- + +## v1.3.6 (11/05/2017) +- [**closed**] .md should be text/markdown as of March 2016 [#154](https://github.com/broofa/node-mime/issues/154) +- [**closed**] Error while installing mime [#153](https://github.com/broofa/node-mime/issues/153) +- [**closed**] application/manifest+json [#149](https://github.com/broofa/node-mime/issues/149) +- [**closed**] Dynamic adaptive streaming over HTTP (DASH) file extension typo [#141](https://github.com/broofa/node-mime/issues/141) +- [**closed**] charsets image/png undefined [#140](https://github.com/broofa/node-mime/issues/140) +- [**closed**] Mime-db dependency out of date [#130](https://github.com/broofa/node-mime/issues/130) +- [**closed**] how to support plistï¼ [#126](https://github.com/broofa/node-mime/issues/126) +- [**closed**] how does .types file format look like? [#123](https://github.com/broofa/node-mime/issues/123) +- [**closed**] Feature: support for expanding MIME patterns [#121](https://github.com/broofa/node-mime/issues/121) +- [**closed**] DEBUG_MIME doesn't work [#117](https://github.com/broofa/node-mime/issues/117) + +--- + +## v1.3.4 (06/02/2015) +*No changelog for this release.* + +--- + +## v1.3.3 (06/02/2015) +*No changelog for this release.* + +--- + +## v1.3.1 (05/02/2015) +- [**closed**] Consider adding support for Handlebars .hbs file ending [#111](https://github.com/broofa/node-mime/issues/111) +- [**closed**] Consider adding support for hjson. [#110](https://github.com/broofa/node-mime/issues/110) +- [**closed**] Add mime type for Opus audio files [#94](https://github.com/broofa/node-mime/issues/94) +- [**closed**] Consider making the `Requesting New Types` information more visible [#77](https://github.com/broofa/node-mime/issues/77) + +--- + +## v1.3.0 (05/02/2015) +- [**closed**] Add common name? [#114](https://github.com/broofa/node-mime/issues/114) +- [**closed**] application/x-yaml [#104](https://github.com/broofa/node-mime/issues/104) +- [**closed**] Add mime type for WOFF file format 2.0 [#102](https://github.com/broofa/node-mime/issues/102) +- [**closed**] application/x-msi for .msi [#99](https://github.com/broofa/node-mime/issues/99) +- [**closed**] Add mimetype for gettext translation files [#98](https://github.com/broofa/node-mime/issues/98) +- [**closed**] collaborators [#88](https://github.com/broofa/node-mime/issues/88) +- [**closed**] getting errot in installation of mime module...any1 can help? [#87](https://github.com/broofa/node-mime/issues/87) +- [**closed**] should application/json's charset be utf8? [#86](https://github.com/broofa/node-mime/issues/86) +- [**closed**] Add "license" and "licenses" to package.json [#81](https://github.com/broofa/node-mime/issues/81) +- [**closed**] lookup with extension-less file on Windows returns wrong type [#68](https://github.com/broofa/node-mime/issues/68) + +--- + +## v1.2.11 (15/08/2013) +- [**closed**] Update mime.types [#65](https://github.com/broofa/node-mime/issues/65) +- [**closed**] Publish a new version [#63](https://github.com/broofa/node-mime/issues/63) +- [**closed**] README should state upfront that "application/octet-stream" is default for unknown extension [#55](https://github.com/broofa/node-mime/issues/55) +- [**closed**] Suggested improvement to the charset API [#52](https://github.com/broofa/node-mime/issues/52) + +--- + +## v1.2.10 (25/07/2013) +- [**closed**] Mime type for woff files should be application/font-woff and not application/x-font-woff [#62](https://github.com/broofa/node-mime/issues/62) +- [**closed**] node.types in conflict with mime.types [#51](https://github.com/broofa/node-mime/issues/51) + +--- + +## v1.2.9 (17/01/2013) +- [**closed**] Please update "mime" NPM [#49](https://github.com/broofa/node-mime/issues/49) +- [**closed**] Please add semicolon [#46](https://github.com/broofa/node-mime/issues/46) +- [**closed**] parse full mime types [#43](https://github.com/broofa/node-mime/issues/43) + +--- + +## v1.2.8 (10/01/2013) +- [**closed**] /js directory mime is application/javascript. Is it correct? [#47](https://github.com/broofa/node-mime/issues/47) +- [**closed**] Add mime types for lua code. [#45](https://github.com/broofa/node-mime/issues/45) + +--- + +## v1.2.7 (19/10/2012) +- [**closed**] cannot install 1.2.7 via npm [#41](https://github.com/broofa/node-mime/issues/41) +- [**closed**] Transfer ownership to @broofa [#36](https://github.com/broofa/node-mime/issues/36) +- [**closed**] it's wrong to set charset to UTF-8 for text [#30](https://github.com/broofa/node-mime/issues/30) +- [**closed**] Allow multiple instances of MIME types container [#27](https://github.com/broofa/node-mime/issues/27) + +--- + +## v1.2.5 (16/02/2012) +- [**closed**] When looking up a types, check hasOwnProperty [#23](https://github.com/broofa/node-mime/issues/23) +- [**closed**] Bump version to 1.2.2 [#18](https://github.com/broofa/node-mime/issues/18) +- [**closed**] No license [#16](https://github.com/broofa/node-mime/issues/16) +- [**closed**] Some types missing that are used by html5/css3 [#13](https://github.com/broofa/node-mime/issues/13) +- [**closed**] npm install fails for 1.2.1 [#12](https://github.com/broofa/node-mime/issues/12) +- [**closed**] image/pjpeg + image/x-png [#10](https://github.com/broofa/node-mime/issues/10) +- [**closed**] symlink [#8](https://github.com/broofa/node-mime/issues/8) +- [**closed**] gzip [#2](https://github.com/broofa/node-mime/issues/2) +- [**closed**] ALL CAPS filenames return incorrect mime type [#1](https://github.com/broofa/node-mime/issues/1) diff --git a/node_modules/mime/LICENSE b/node_modules/mime/LICENSE new file mode 100644 index 0000000..d3f46f7 --- /dev/null +++ b/node_modules/mime/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2010 Benjamin Thomas, Robert Kieffer + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/mime/README.md b/node_modules/mime/README.md new file mode 100644 index 0000000..506fbe5 --- /dev/null +++ b/node_modules/mime/README.md @@ -0,0 +1,90 @@ +# mime + +Comprehensive MIME type mapping API based on mime-db module. + +## Install + +Install with [npm](http://github.com/isaacs/npm): + + npm install mime + +## Contributing / Testing + + npm run test + +## Command Line + + mime [path_string] + +E.g. + + > mime scripts/jquery.js + application/javascript + +## API - Queries + +### mime.lookup(path) +Get the mime type associated with a file, if no mime type is found `application/octet-stream` is returned. Performs a case-insensitive lookup using the extension in `path` (the substring after the last '/' or '.'). E.g. + +```js +var mime = require('mime'); + +mime.lookup('/path/to/file.txt'); // => 'text/plain' +mime.lookup('file.txt'); // => 'text/plain' +mime.lookup('.TXT'); // => 'text/plain' +mime.lookup('htm'); // => 'text/html' +``` + +### mime.default_type +Sets the mime type returned when `mime.lookup` fails to find the extension searched for. (Default is `application/octet-stream`.) + +### mime.extension(type) +Get the default extension for `type` + +```js +mime.extension('text/html'); // => 'html' +mime.extension('application/octet-stream'); // => 'bin' +``` + +### mime.charsets.lookup() + +Map mime-type to charset + +```js +mime.charsets.lookup('text/plain'); // => 'UTF-8' +``` + +(The logic for charset lookups is pretty rudimentary. Feel free to suggest improvements.) + +## API - Defining Custom Types + +Custom type mappings can be added on a per-project basis via the following APIs. + +### mime.define() + +Add custom mime/extension mappings + +```js +mime.define({ + 'text/x-some-format': ['x-sf', 'x-sft', 'x-sfml'], + 'application/x-my-type': ['x-mt', 'x-mtt'], + // etc ... +}); + +mime.lookup('x-sft'); // => 'text/x-some-format' +``` + +The first entry in the extensions array is returned by `mime.extension()`. E.g. + +```js +mime.extension('text/x-some-format'); // => 'x-sf' +``` + +### mime.load(filepath) + +Load mappings from an Apache ".types" format file + +```js +mime.load('./my_project.types'); +``` +The .types file format is simple - See the `types` dir for examples. diff --git a/node_modules/mime/cli.js b/node_modules/mime/cli.js new file mode 100755 index 0000000..20b1ffe --- /dev/null +++ b/node_modules/mime/cli.js @@ -0,0 +1,8 @@ +#!/usr/bin/env node + +var mime = require('./mime.js'); +var file = process.argv[2]; +var type = mime.lookup(file); + +process.stdout.write(type + '\n'); + diff --git a/node_modules/mime/mime.js b/node_modules/mime/mime.js new file mode 100644 index 0000000..d7efbde --- /dev/null +++ b/node_modules/mime/mime.js @@ -0,0 +1,108 @@ +var path = require('path'); +var fs = require('fs'); + +function Mime() { + // Map of extension -> mime type + this.types = Object.create(null); + + // Map of mime type -> extension + this.extensions = Object.create(null); +} + +/** + * Define mimetype -> extension mappings. Each key is a mime-type that maps + * to an array of extensions associated with the type. The first extension is + * used as the default extension for the type. + * + * e.g. mime.define({'audio/ogg', ['oga', 'ogg', 'spx']}); + * + * @param map (Object) type definitions + */ +Mime.prototype.define = function (map) { + for (var type in map) { + var exts = map[type]; + for (var i = 0; i < exts.length; i++) { + if (process.env.DEBUG_MIME && this.types[exts[i]]) { + console.warn((this._loading || "define()").replace(/.*\//, ''), 'changes "' + exts[i] + '" extension type from ' + + this.types[exts[i]] + ' to ' + type); + } + + this.types[exts[i]] = type; + } + + // Default extension is the first one we encounter + if (!this.extensions[type]) { + this.extensions[type] = exts[0]; + } + } +}; + +/** + * Load an Apache2-style ".types" file + * + * This may be called multiple times (it's expected). Where files declare + * overlapping types/extensions, the last file wins. + * + * @param file (String) path of file to load. + */ +Mime.prototype.load = function(file) { + this._loading = file; + // Read file and split into lines + var map = {}, + content = fs.readFileSync(file, 'ascii'), + lines = content.split(/[\r\n]+/); + + lines.forEach(function(line) { + // Clean up whitespace/comments, and split into fields + var fields = line.replace(/\s*#.*|^\s*|\s*$/g, '').split(/\s+/); + map[fields.shift()] = fields; + }); + + this.define(map); + + this._loading = null; +}; + +/** + * Lookup a mime type based on extension + */ +Mime.prototype.lookup = function(path, fallback) { + var ext = path.replace(/^.*[\.\/\\]/, '').toLowerCase(); + + return this.types[ext] || fallback || this.default_type; +}; + +/** + * Return file extension associated with a mime type + */ +Mime.prototype.extension = function(mimeType) { + var type = mimeType.match(/^\s*([^;\s]*)(?:;|\s|$)/)[1].toLowerCase(); + return this.extensions[type]; +}; + +// Default instance +var mime = new Mime(); + +// Define built-in types +mime.define(require('./types.json')); + +// Default type +mime.default_type = mime.lookup('bin'); + +// +// Additional API specific to the default instance +// + +mime.Mime = Mime; + +/** + * Lookup a charset based on mime type. + */ +mime.charsets = { + lookup: function(mimeType, fallback) { + // Assume text types are utf8 + return (/^text\/|^application\/(javascript|json)/).test(mimeType) ? 'UTF-8' : fallback; + } +}; + +module.exports = mime; diff --git a/node_modules/mime/package.json b/node_modules/mime/package.json new file mode 100644 index 0000000..6805efe --- /dev/null +++ b/node_modules/mime/package.json @@ -0,0 +1,73 @@ +{ + "_from": "mime@1.6.0", + "_id": "mime@1.6.0", + "_inBundle": false, + "_integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==", + "_location": "/mime", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "mime@1.6.0", + "name": "mime", + "escapedName": "mime", + "rawSpec": "1.6.0", + "saveSpec": null, + "fetchSpec": "1.6.0" + }, + "_requiredBy": [ + "/send" + ], + "_resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz", + "_shasum": "32cd9e5c64553bd58d19a568af452acff04981b1", + "_spec": "mime@1.6.0", + "_where": "/home/josuer08/Documents/web/node_modules/send", + "author": { + "name": "Robert Kieffer", + "email": "robert@broofa.com", + "url": "http://github.com/broofa" + }, + "bin": { + "mime": "cli.js" + }, + "bugs": { + "url": "https://github.com/broofa/node-mime/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Benjamin Thomas", + "email": "benjamin@benjaminthomas.org", + "url": "http://github.com/bentomas" + } + ], + "dependencies": {}, + "deprecated": false, + "description": "A comprehensive library for mime-type mapping", + "devDependencies": { + "github-release-notes": "0.13.1", + "mime-db": "1.31.0", + "mime-score": "1.1.0" + }, + "engines": { + "node": ">=4" + }, + "homepage": "https://github.com/broofa/node-mime#readme", + "keywords": [ + "util", + "mime" + ], + "license": "MIT", + "main": "mime.js", + "name": "mime", + "repository": { + "url": "git+https://github.com/broofa/node-mime.git", + "type": "git" + }, + "scripts": { + "changelog": "gren changelog --tags=all --generate --override", + "prepare": "node src/build.js", + "test": "node src/test.js" + }, + "version": "1.6.0" +} diff --git a/node_modules/mime/src/build.js b/node_modules/mime/src/build.js new file mode 100755 index 0000000..4928e48 --- /dev/null +++ b/node_modules/mime/src/build.js @@ -0,0 +1,53 @@ +#!/usr/bin/env node + +'use strict'; + +const fs = require('fs'); +const path = require('path'); +const mimeScore = require('mime-score'); + +let db = require('mime-db'); +let chalk = require('chalk'); + +const STANDARD_FACET_SCORE = 900; + +const byExtension = {}; + +// Clear out any conflict extensions in mime-db +for (let type in db) { + let entry = db[type]; + entry.type = type; + + if (!entry.extensions) continue; + + entry.extensions.forEach(ext => { + if (ext in byExtension) { + const e0 = entry; + const e1 = byExtension[ext]; + e0.pri = mimeScore(e0.type, e0.source); + e1.pri = mimeScore(e1.type, e1.source); + + let drop = e0.pri < e1.pri ? e0 : e1; + let keep = e0.pri >= e1.pri ? e0 : e1; + drop.extensions = drop.extensions.filter(e => e !== ext); + + console.log(`${ext}: Keeping ${chalk.green(keep.type)} (${keep.pri}), dropping ${chalk.red(drop.type)} (${drop.pri})`); + } + byExtension[ext] = entry; + }); +} + +function writeTypesFile(types, path) { + fs.writeFileSync(path, JSON.stringify(types)); +} + +// Segregate into standard and non-standard types based on facet per +// https://tools.ietf.org/html/rfc6838#section-3.1 +const types = {}; + +Object.keys(db).sort().forEach(k => { + const entry = db[k]; + types[entry.type] = entry.extensions; +}); + +writeTypesFile(types, path.join(__dirname, '..', 'types.json')); diff --git a/node_modules/mime/src/test.js b/node_modules/mime/src/test.js new file mode 100644 index 0000000..42958a2 --- /dev/null +++ b/node_modules/mime/src/test.js @@ -0,0 +1,60 @@ +/** + * Usage: node test.js + */ + +var mime = require('../mime'); +var assert = require('assert'); +var path = require('path'); + +// +// Test mime lookups +// + +assert.equal('text/plain', mime.lookup('text.txt')); // normal file +assert.equal('text/plain', mime.lookup('TEXT.TXT')); // uppercase +assert.equal('text/plain', mime.lookup('dir/text.txt')); // dir + file +assert.equal('text/plain', mime.lookup('.text.txt')); // hidden file +assert.equal('text/plain', mime.lookup('.txt')); // nameless +assert.equal('text/plain', mime.lookup('txt')); // extension-only +assert.equal('text/plain', mime.lookup('/txt')); // extension-less () +assert.equal('text/plain', mime.lookup('\\txt')); // Windows, extension-less +assert.equal('application/octet-stream', mime.lookup('text.nope')); // unrecognized +assert.equal('fallback', mime.lookup('text.fallback', 'fallback')); // alternate default + +// +// Test extensions +// + +assert.equal('txt', mime.extension(mime.types.text)); +assert.equal('html', mime.extension(mime.types.htm)); +assert.equal('bin', mime.extension('application/octet-stream')); +assert.equal('bin', mime.extension('application/octet-stream ')); +assert.equal('html', mime.extension(' text/html; charset=UTF-8')); +assert.equal('html', mime.extension('text/html; charset=UTF-8 ')); +assert.equal('html', mime.extension('text/html; charset=UTF-8')); +assert.equal('html', mime.extension('text/html ; charset=UTF-8')); +assert.equal('html', mime.extension('text/html;charset=UTF-8')); +assert.equal('html', mime.extension('text/Html;charset=UTF-8')); +assert.equal(undefined, mime.extension('unrecognized')); + +// +// Test node.types lookups +// + +assert.equal('font/woff', mime.lookup('file.woff')); +assert.equal('application/octet-stream', mime.lookup('file.buffer')); +// TODO: Uncomment once #157 is resolved +// assert.equal('audio/mp4', mime.lookup('file.m4a')); +assert.equal('font/otf', mime.lookup('file.otf')); + +// +// Test charsets +// + +assert.equal('UTF-8', mime.charsets.lookup('text/plain')); +assert.equal('UTF-8', mime.charsets.lookup(mime.types.js)); +assert.equal('UTF-8', mime.charsets.lookup(mime.types.json)); +assert.equal(undefined, mime.charsets.lookup(mime.types.bin)); +assert.equal('fallback', mime.charsets.lookup('application/octet-stream', 'fallback')); + +console.log('\nAll tests passed'); diff --git a/node_modules/mime/types.json b/node_modules/mime/types.json new file mode 100644 index 0000000..bec78ab --- /dev/null +++ b/node_modules/mime/types.json @@ -0,0 +1 @@ +{"application/andrew-inset":["ez"],"application/applixware":["aw"],"application/atom+xml":["atom"],"application/atomcat+xml":["atomcat"],"application/atomsvc+xml":["atomsvc"],"application/bdoc":["bdoc"],"application/ccxml+xml":["ccxml"],"application/cdmi-capability":["cdmia"],"application/cdmi-container":["cdmic"],"application/cdmi-domain":["cdmid"],"application/cdmi-object":["cdmio"],"application/cdmi-queue":["cdmiq"],"application/cu-seeme":["cu"],"application/dash+xml":["mpd"],"application/davmount+xml":["davmount"],"application/docbook+xml":["dbk"],"application/dssc+der":["dssc"],"application/dssc+xml":["xdssc"],"application/ecmascript":["ecma"],"application/emma+xml":["emma"],"application/epub+zip":["epub"],"application/exi":["exi"],"application/font-tdpfr":["pfr"],"application/font-woff":[],"application/font-woff2":[],"application/geo+json":["geojson"],"application/gml+xml":["gml"],"application/gpx+xml":["gpx"],"application/gxf":["gxf"],"application/gzip":["gz"],"application/hyperstudio":["stk"],"application/inkml+xml":["ink","inkml"],"application/ipfix":["ipfix"],"application/java-archive":["jar","war","ear"],"application/java-serialized-object":["ser"],"application/java-vm":["class"],"application/javascript":["js","mjs"],"application/json":["json","map"],"application/json5":["json5"],"application/jsonml+json":["jsonml"],"application/ld+json":["jsonld"],"application/lost+xml":["lostxml"],"application/mac-binhex40":["hqx"],"application/mac-compactpro":["cpt"],"application/mads+xml":["mads"],"application/manifest+json":["webmanifest"],"application/marc":["mrc"],"application/marcxml+xml":["mrcx"],"application/mathematica":["ma","nb","mb"],"application/mathml+xml":["mathml"],"application/mbox":["mbox"],"application/mediaservercontrol+xml":["mscml"],"application/metalink+xml":["metalink"],"application/metalink4+xml":["meta4"],"application/mets+xml":["mets"],"application/mods+xml":["mods"],"application/mp21":["m21","mp21"],"application/mp4":["mp4s","m4p"],"application/msword":["doc","dot"],"application/mxf":["mxf"],"application/octet-stream":["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"],"application/oda":["oda"],"application/oebps-package+xml":["opf"],"application/ogg":["ogx"],"application/omdoc+xml":["omdoc"],"application/onenote":["onetoc","onetoc2","onetmp","onepkg"],"application/oxps":["oxps"],"application/patch-ops-error+xml":["xer"],"application/pdf":["pdf"],"application/pgp-encrypted":["pgp"],"application/pgp-signature":["asc","sig"],"application/pics-rules":["prf"],"application/pkcs10":["p10"],"application/pkcs7-mime":["p7m","p7c"],"application/pkcs7-signature":["p7s"],"application/pkcs8":["p8"],"application/pkix-attr-cert":["ac"],"application/pkix-cert":["cer"],"application/pkix-crl":["crl"],"application/pkix-pkipath":["pkipath"],"application/pkixcmp":["pki"],"application/pls+xml":["pls"],"application/postscript":["ai","eps","ps"],"application/prs.cww":["cww"],"application/pskc+xml":["pskcxml"],"application/raml+yaml":["raml"],"application/rdf+xml":["rdf"],"application/reginfo+xml":["rif"],"application/relax-ng-compact-syntax":["rnc"],"application/resource-lists+xml":["rl"],"application/resource-lists-diff+xml":["rld"],"application/rls-services+xml":["rs"],"application/rpki-ghostbusters":["gbr"],"application/rpki-manifest":["mft"],"application/rpki-roa":["roa"],"application/rsd+xml":["rsd"],"application/rss+xml":["rss"],"application/rtf":["rtf"],"application/sbml+xml":["sbml"],"application/scvp-cv-request":["scq"],"application/scvp-cv-response":["scs"],"application/scvp-vp-request":["spq"],"application/scvp-vp-response":["spp"],"application/sdp":["sdp"],"application/set-payment-initiation":["setpay"],"application/set-registration-initiation":["setreg"],"application/shf+xml":["shf"],"application/smil+xml":["smi","smil"],"application/sparql-query":["rq"],"application/sparql-results+xml":["srx"],"application/srgs":["gram"],"application/srgs+xml":["grxml"],"application/sru+xml":["sru"],"application/ssdl+xml":["ssdl"],"application/ssml+xml":["ssml"],"application/tei+xml":["tei","teicorpus"],"application/thraud+xml":["tfi"],"application/timestamped-data":["tsd"],"application/vnd.3gpp.pic-bw-large":["plb"],"application/vnd.3gpp.pic-bw-small":["psb"],"application/vnd.3gpp.pic-bw-var":["pvb"],"application/vnd.3gpp2.tcap":["tcap"],"application/vnd.3m.post-it-notes":["pwn"],"application/vnd.accpac.simply.aso":["aso"],"application/vnd.accpac.simply.imp":["imp"],"application/vnd.acucobol":["acu"],"application/vnd.acucorp":["atc","acutc"],"application/vnd.adobe.air-application-installer-package+zip":["air"],"application/vnd.adobe.formscentral.fcdt":["fcdt"],"application/vnd.adobe.fxp":["fxp","fxpl"],"application/vnd.adobe.xdp+xml":["xdp"],"application/vnd.adobe.xfdf":["xfdf"],"application/vnd.ahead.space":["ahead"],"application/vnd.airzip.filesecure.azf":["azf"],"application/vnd.airzip.filesecure.azs":["azs"],"application/vnd.amazon.ebook":["azw"],"application/vnd.americandynamics.acc":["acc"],"application/vnd.amiga.ami":["ami"],"application/vnd.android.package-archive":["apk"],"application/vnd.anser-web-certificate-issue-initiation":["cii"],"application/vnd.anser-web-funds-transfer-initiation":["fti"],"application/vnd.antix.game-component":["atx"],"application/vnd.apple.installer+xml":["mpkg"],"application/vnd.apple.mpegurl":["m3u8"],"application/vnd.apple.pkpass":["pkpass"],"application/vnd.aristanetworks.swi":["swi"],"application/vnd.astraea-software.iota":["iota"],"application/vnd.audiograph":["aep"],"application/vnd.blueice.multipass":["mpm"],"application/vnd.bmi":["bmi"],"application/vnd.businessobjects":["rep"],"application/vnd.chemdraw+xml":["cdxml"],"application/vnd.chipnuts.karaoke-mmd":["mmd"],"application/vnd.cinderella":["cdy"],"application/vnd.claymore":["cla"],"application/vnd.cloanto.rp9":["rp9"],"application/vnd.clonk.c4group":["c4g","c4d","c4f","c4p","c4u"],"application/vnd.cluetrust.cartomobile-config":["c11amc"],"application/vnd.cluetrust.cartomobile-config-pkg":["c11amz"],"application/vnd.commonspace":["csp"],"application/vnd.contact.cmsg":["cdbcmsg"],"application/vnd.cosmocaller":["cmc"],"application/vnd.crick.clicker":["clkx"],"application/vnd.crick.clicker.keyboard":["clkk"],"application/vnd.crick.clicker.palette":["clkp"],"application/vnd.crick.clicker.template":["clkt"],"application/vnd.crick.clicker.wordbank":["clkw"],"application/vnd.criticaltools.wbs+xml":["wbs"],"application/vnd.ctc-posml":["pml"],"application/vnd.cups-ppd":["ppd"],"application/vnd.curl.car":["car"],"application/vnd.curl.pcurl":["pcurl"],"application/vnd.dart":["dart"],"application/vnd.data-vision.rdz":["rdz"],"application/vnd.dece.data":["uvf","uvvf","uvd","uvvd"],"application/vnd.dece.ttml+xml":["uvt","uvvt"],"application/vnd.dece.unspecified":["uvx","uvvx"],"application/vnd.dece.zip":["uvz","uvvz"],"application/vnd.denovo.fcselayout-link":["fe_launch"],"application/vnd.dna":["dna"],"application/vnd.dolby.mlp":["mlp"],"application/vnd.dpgraph":["dpg"],"application/vnd.dreamfactory":["dfac"],"application/vnd.ds-keypoint":["kpxx"],"application/vnd.dvb.ait":["ait"],"application/vnd.dvb.service":["svc"],"application/vnd.dynageo":["geo"],"application/vnd.ecowin.chart":["mag"],"application/vnd.enliven":["nml"],"application/vnd.epson.esf":["esf"],"application/vnd.epson.msf":["msf"],"application/vnd.epson.quickanime":["qam"],"application/vnd.epson.salt":["slt"],"application/vnd.epson.ssf":["ssf"],"application/vnd.eszigno3+xml":["es3","et3"],"application/vnd.ezpix-album":["ez2"],"application/vnd.ezpix-package":["ez3"],"application/vnd.fdf":["fdf"],"application/vnd.fdsn.mseed":["mseed"],"application/vnd.fdsn.seed":["seed","dataless"],"application/vnd.flographit":["gph"],"application/vnd.fluxtime.clip":["ftc"],"application/vnd.framemaker":["fm","frame","maker","book"],"application/vnd.frogans.fnc":["fnc"],"application/vnd.frogans.ltf":["ltf"],"application/vnd.fsc.weblaunch":["fsc"],"application/vnd.fujitsu.oasys":["oas"],"application/vnd.fujitsu.oasys2":["oa2"],"application/vnd.fujitsu.oasys3":["oa3"],"application/vnd.fujitsu.oasysgp":["fg5"],"application/vnd.fujitsu.oasysprs":["bh2"],"application/vnd.fujixerox.ddd":["ddd"],"application/vnd.fujixerox.docuworks":["xdw"],"application/vnd.fujixerox.docuworks.binder":["xbd"],"application/vnd.fuzzysheet":["fzs"],"application/vnd.genomatix.tuxedo":["txd"],"application/vnd.geogebra.file":["ggb"],"application/vnd.geogebra.tool":["ggt"],"application/vnd.geometry-explorer":["gex","gre"],"application/vnd.geonext":["gxt"],"application/vnd.geoplan":["g2w"],"application/vnd.geospace":["g3w"],"application/vnd.gmx":["gmx"],"application/vnd.google-apps.document":["gdoc"],"application/vnd.google-apps.presentation":["gslides"],"application/vnd.google-apps.spreadsheet":["gsheet"],"application/vnd.google-earth.kml+xml":["kml"],"application/vnd.google-earth.kmz":["kmz"],"application/vnd.grafeq":["gqf","gqs"],"application/vnd.groove-account":["gac"],"application/vnd.groove-help":["ghf"],"application/vnd.groove-identity-message":["gim"],"application/vnd.groove-injector":["grv"],"application/vnd.groove-tool-message":["gtm"],"application/vnd.groove-tool-template":["tpl"],"application/vnd.groove-vcard":["vcg"],"application/vnd.hal+xml":["hal"],"application/vnd.handheld-entertainment+xml":["zmm"],"application/vnd.hbci":["hbci"],"application/vnd.hhe.lesson-player":["les"],"application/vnd.hp-hpgl":["hpgl"],"application/vnd.hp-hpid":["hpid"],"application/vnd.hp-hps":["hps"],"application/vnd.hp-jlyt":["jlt"],"application/vnd.hp-pcl":["pcl"],"application/vnd.hp-pclxl":["pclxl"],"application/vnd.hydrostatix.sof-data":["sfd-hdstx"],"application/vnd.ibm.minipay":["mpy"],"application/vnd.ibm.modcap":["afp","listafp","list3820"],"application/vnd.ibm.rights-management":["irm"],"application/vnd.ibm.secure-container":["sc"],"application/vnd.iccprofile":["icc","icm"],"application/vnd.igloader":["igl"],"application/vnd.immervision-ivp":["ivp"],"application/vnd.immervision-ivu":["ivu"],"application/vnd.insors.igm":["igm"],"application/vnd.intercon.formnet":["xpw","xpx"],"application/vnd.intergeo":["i2g"],"application/vnd.intu.qbo":["qbo"],"application/vnd.intu.qfx":["qfx"],"application/vnd.ipunplugged.rcprofile":["rcprofile"],"application/vnd.irepository.package+xml":["irp"],"application/vnd.is-xpr":["xpr"],"application/vnd.isac.fcs":["fcs"],"application/vnd.jam":["jam"],"application/vnd.jcp.javame.midlet-rms":["rms"],"application/vnd.jisp":["jisp"],"application/vnd.joost.joda-archive":["joda"],"application/vnd.kahootz":["ktz","ktr"],"application/vnd.kde.karbon":["karbon"],"application/vnd.kde.kchart":["chrt"],"application/vnd.kde.kformula":["kfo"],"application/vnd.kde.kivio":["flw"],"application/vnd.kde.kontour":["kon"],"application/vnd.kde.kpresenter":["kpr","kpt"],"application/vnd.kde.kspread":["ksp"],"application/vnd.kde.kword":["kwd","kwt"],"application/vnd.kenameaapp":["htke"],"application/vnd.kidspiration":["kia"],"application/vnd.kinar":["kne","knp"],"application/vnd.koan":["skp","skd","skt","skm"],"application/vnd.kodak-descriptor":["sse"],"application/vnd.las.las+xml":["lasxml"],"application/vnd.llamagraphics.life-balance.desktop":["lbd"],"application/vnd.llamagraphics.life-balance.exchange+xml":["lbe"],"application/vnd.lotus-1-2-3":["123"],"application/vnd.lotus-approach":["apr"],"application/vnd.lotus-freelance":["pre"],"application/vnd.lotus-notes":["nsf"],"application/vnd.lotus-organizer":["org"],"application/vnd.lotus-screencam":["scm"],"application/vnd.lotus-wordpro":["lwp"],"application/vnd.macports.portpkg":["portpkg"],"application/vnd.mcd":["mcd"],"application/vnd.medcalcdata":["mc1"],"application/vnd.mediastation.cdkey":["cdkey"],"application/vnd.mfer":["mwf"],"application/vnd.mfmp":["mfm"],"application/vnd.micrografx.flo":["flo"],"application/vnd.micrografx.igx":["igx"],"application/vnd.mif":["mif"],"application/vnd.mobius.daf":["daf"],"application/vnd.mobius.dis":["dis"],"application/vnd.mobius.mbk":["mbk"],"application/vnd.mobius.mqy":["mqy"],"application/vnd.mobius.msl":["msl"],"application/vnd.mobius.plc":["plc"],"application/vnd.mobius.txf":["txf"],"application/vnd.mophun.application":["mpn"],"application/vnd.mophun.certificate":["mpc"],"application/vnd.mozilla.xul+xml":["xul"],"application/vnd.ms-artgalry":["cil"],"application/vnd.ms-cab-compressed":["cab"],"application/vnd.ms-excel":["xls","xlm","xla","xlc","xlt","xlw"],"application/vnd.ms-excel.addin.macroenabled.12":["xlam"],"application/vnd.ms-excel.sheet.binary.macroenabled.12":["xlsb"],"application/vnd.ms-excel.sheet.macroenabled.12":["xlsm"],"application/vnd.ms-excel.template.macroenabled.12":["xltm"],"application/vnd.ms-fontobject":["eot"],"application/vnd.ms-htmlhelp":["chm"],"application/vnd.ms-ims":["ims"],"application/vnd.ms-lrm":["lrm"],"application/vnd.ms-officetheme":["thmx"],"application/vnd.ms-outlook":["msg"],"application/vnd.ms-pki.seccat":["cat"],"application/vnd.ms-pki.stl":["stl"],"application/vnd.ms-powerpoint":["ppt","pps","pot"],"application/vnd.ms-powerpoint.addin.macroenabled.12":["ppam"],"application/vnd.ms-powerpoint.presentation.macroenabled.12":["pptm"],"application/vnd.ms-powerpoint.slide.macroenabled.12":["sldm"],"application/vnd.ms-powerpoint.slideshow.macroenabled.12":["ppsm"],"application/vnd.ms-powerpoint.template.macroenabled.12":["potm"],"application/vnd.ms-project":["mpp","mpt"],"application/vnd.ms-word.document.macroenabled.12":["docm"],"application/vnd.ms-word.template.macroenabled.12":["dotm"],"application/vnd.ms-works":["wps","wks","wcm","wdb"],"application/vnd.ms-wpl":["wpl"],"application/vnd.ms-xpsdocument":["xps"],"application/vnd.mseq":["mseq"],"application/vnd.musician":["mus"],"application/vnd.muvee.style":["msty"],"application/vnd.mynfc":["taglet"],"application/vnd.neurolanguage.nlu":["nlu"],"application/vnd.nitf":["ntf","nitf"],"application/vnd.noblenet-directory":["nnd"],"application/vnd.noblenet-sealer":["nns"],"application/vnd.noblenet-web":["nnw"],"application/vnd.nokia.n-gage.data":["ngdat"],"application/vnd.nokia.n-gage.symbian.install":["n-gage"],"application/vnd.nokia.radio-preset":["rpst"],"application/vnd.nokia.radio-presets":["rpss"],"application/vnd.novadigm.edm":["edm"],"application/vnd.novadigm.edx":["edx"],"application/vnd.novadigm.ext":["ext"],"application/vnd.oasis.opendocument.chart":["odc"],"application/vnd.oasis.opendocument.chart-template":["otc"],"application/vnd.oasis.opendocument.database":["odb"],"application/vnd.oasis.opendocument.formula":["odf"],"application/vnd.oasis.opendocument.formula-template":["odft"],"application/vnd.oasis.opendocument.graphics":["odg"],"application/vnd.oasis.opendocument.graphics-template":["otg"],"application/vnd.oasis.opendocument.image":["odi"],"application/vnd.oasis.opendocument.image-template":["oti"],"application/vnd.oasis.opendocument.presentation":["odp"],"application/vnd.oasis.opendocument.presentation-template":["otp"],"application/vnd.oasis.opendocument.spreadsheet":["ods"],"application/vnd.oasis.opendocument.spreadsheet-template":["ots"],"application/vnd.oasis.opendocument.text":["odt"],"application/vnd.oasis.opendocument.text-master":["odm"],"application/vnd.oasis.opendocument.text-template":["ott"],"application/vnd.oasis.opendocument.text-web":["oth"],"application/vnd.olpc-sugar":["xo"],"application/vnd.oma.dd2+xml":["dd2"],"application/vnd.openofficeorg.extension":["oxt"],"application/vnd.openxmlformats-officedocument.presentationml.presentation":["pptx"],"application/vnd.openxmlformats-officedocument.presentationml.slide":["sldx"],"application/vnd.openxmlformats-officedocument.presentationml.slideshow":["ppsx"],"application/vnd.openxmlformats-officedocument.presentationml.template":["potx"],"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet":["xlsx"],"application/vnd.openxmlformats-officedocument.spreadsheetml.template":["xltx"],"application/vnd.openxmlformats-officedocument.wordprocessingml.document":["docx"],"application/vnd.openxmlformats-officedocument.wordprocessingml.template":["dotx"],"application/vnd.osgeo.mapguide.package":["mgp"],"application/vnd.osgi.dp":["dp"],"application/vnd.osgi.subsystem":["esa"],"application/vnd.palm":["pdb","pqa","oprc"],"application/vnd.pawaafile":["paw"],"application/vnd.pg.format":["str"],"application/vnd.pg.osasli":["ei6"],"application/vnd.picsel":["efif"],"application/vnd.pmi.widget":["wg"],"application/vnd.pocketlearn":["plf"],"application/vnd.powerbuilder6":["pbd"],"application/vnd.previewsystems.box":["box"],"application/vnd.proteus.magazine":["mgz"],"application/vnd.publishare-delta-tree":["qps"],"application/vnd.pvi.ptid1":["ptid"],"application/vnd.quark.quarkxpress":["qxd","qxt","qwd","qwt","qxl","qxb"],"application/vnd.realvnc.bed":["bed"],"application/vnd.recordare.musicxml":["mxl"],"application/vnd.recordare.musicxml+xml":["musicxml"],"application/vnd.rig.cryptonote":["cryptonote"],"application/vnd.rim.cod":["cod"],"application/vnd.rn-realmedia":["rm"],"application/vnd.rn-realmedia-vbr":["rmvb"],"application/vnd.route66.link66+xml":["link66"],"application/vnd.sailingtracker.track":["st"],"application/vnd.seemail":["see"],"application/vnd.sema":["sema"],"application/vnd.semd":["semd"],"application/vnd.semf":["semf"],"application/vnd.shana.informed.formdata":["ifm"],"application/vnd.shana.informed.formtemplate":["itp"],"application/vnd.shana.informed.interchange":["iif"],"application/vnd.shana.informed.package":["ipk"],"application/vnd.simtech-mindmapper":["twd","twds"],"application/vnd.smaf":["mmf"],"application/vnd.smart.teacher":["teacher"],"application/vnd.solent.sdkm+xml":["sdkm","sdkd"],"application/vnd.spotfire.dxp":["dxp"],"application/vnd.spotfire.sfs":["sfs"],"application/vnd.stardivision.calc":["sdc"],"application/vnd.stardivision.draw":["sda"],"application/vnd.stardivision.impress":["sdd"],"application/vnd.stardivision.math":["smf"],"application/vnd.stardivision.writer":["sdw","vor"],"application/vnd.stardivision.writer-global":["sgl"],"application/vnd.stepmania.package":["smzip"],"application/vnd.stepmania.stepchart":["sm"],"application/vnd.sun.wadl+xml":["wadl"],"application/vnd.sun.xml.calc":["sxc"],"application/vnd.sun.xml.calc.template":["stc"],"application/vnd.sun.xml.draw":["sxd"],"application/vnd.sun.xml.draw.template":["std"],"application/vnd.sun.xml.impress":["sxi"],"application/vnd.sun.xml.impress.template":["sti"],"application/vnd.sun.xml.math":["sxm"],"application/vnd.sun.xml.writer":["sxw"],"application/vnd.sun.xml.writer.global":["sxg"],"application/vnd.sun.xml.writer.template":["stw"],"application/vnd.sus-calendar":["sus","susp"],"application/vnd.svd":["svd"],"application/vnd.symbian.install":["sis","sisx"],"application/vnd.syncml+xml":["xsm"],"application/vnd.syncml.dm+wbxml":["bdm"],"application/vnd.syncml.dm+xml":["xdm"],"application/vnd.tao.intent-module-archive":["tao"],"application/vnd.tcpdump.pcap":["pcap","cap","dmp"],"application/vnd.tmobile-livetv":["tmo"],"application/vnd.trid.tpt":["tpt"],"application/vnd.triscape.mxs":["mxs"],"application/vnd.trueapp":["tra"],"application/vnd.ufdl":["ufd","ufdl"],"application/vnd.uiq.theme":["utz"],"application/vnd.umajin":["umj"],"application/vnd.unity":["unityweb"],"application/vnd.uoml+xml":["uoml"],"application/vnd.vcx":["vcx"],"application/vnd.visio":["vsd","vst","vss","vsw"],"application/vnd.visionary":["vis"],"application/vnd.vsf":["vsf"],"application/vnd.wap.wbxml":["wbxml"],"application/vnd.wap.wmlc":["wmlc"],"application/vnd.wap.wmlscriptc":["wmlsc"],"application/vnd.webturbo":["wtb"],"application/vnd.wolfram.player":["nbp"],"application/vnd.wordperfect":["wpd"],"application/vnd.wqd":["wqd"],"application/vnd.wt.stf":["stf"],"application/vnd.xara":["xar"],"application/vnd.xfdl":["xfdl"],"application/vnd.yamaha.hv-dic":["hvd"],"application/vnd.yamaha.hv-script":["hvs"],"application/vnd.yamaha.hv-voice":["hvp"],"application/vnd.yamaha.openscoreformat":["osf"],"application/vnd.yamaha.openscoreformat.osfpvg+xml":["osfpvg"],"application/vnd.yamaha.smaf-audio":["saf"],"application/vnd.yamaha.smaf-phrase":["spf"],"application/vnd.yellowriver-custom-menu":["cmp"],"application/vnd.zul":["zir","zirz"],"application/vnd.zzazz.deck+xml":["zaz"],"application/voicexml+xml":["vxml"],"application/wasm":["wasm"],"application/widget":["wgt"],"application/winhlp":["hlp"],"application/wsdl+xml":["wsdl"],"application/wspolicy+xml":["wspolicy"],"application/x-7z-compressed":["7z"],"application/x-abiword":["abw"],"application/x-ace-compressed":["ace"],"application/x-apple-diskimage":[],"application/x-arj":["arj"],"application/x-authorware-bin":["aab","x32","u32","vox"],"application/x-authorware-map":["aam"],"application/x-authorware-seg":["aas"],"application/x-bcpio":["bcpio"],"application/x-bdoc":[],"application/x-bittorrent":["torrent"],"application/x-blorb":["blb","blorb"],"application/x-bzip":["bz"],"application/x-bzip2":["bz2","boz"],"application/x-cbr":["cbr","cba","cbt","cbz","cb7"],"application/x-cdlink":["vcd"],"application/x-cfs-compressed":["cfs"],"application/x-chat":["chat"],"application/x-chess-pgn":["pgn"],"application/x-chrome-extension":["crx"],"application/x-cocoa":["cco"],"application/x-conference":["nsc"],"application/x-cpio":["cpio"],"application/x-csh":["csh"],"application/x-debian-package":["udeb"],"application/x-dgc-compressed":["dgc"],"application/x-director":["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"],"application/x-doom":["wad"],"application/x-dtbncx+xml":["ncx"],"application/x-dtbook+xml":["dtb"],"application/x-dtbresource+xml":["res"],"application/x-dvi":["dvi"],"application/x-envoy":["evy"],"application/x-eva":["eva"],"application/x-font-bdf":["bdf"],"application/x-font-ghostscript":["gsf"],"application/x-font-linux-psf":["psf"],"application/x-font-pcf":["pcf"],"application/x-font-snf":["snf"],"application/x-font-type1":["pfa","pfb","pfm","afm"],"application/x-freearc":["arc"],"application/x-futuresplash":["spl"],"application/x-gca-compressed":["gca"],"application/x-glulx":["ulx"],"application/x-gnumeric":["gnumeric"],"application/x-gramps-xml":["gramps"],"application/x-gtar":["gtar"],"application/x-hdf":["hdf"],"application/x-httpd-php":["php"],"application/x-install-instructions":["install"],"application/x-iso9660-image":[],"application/x-java-archive-diff":["jardiff"],"application/x-java-jnlp-file":["jnlp"],"application/x-latex":["latex"],"application/x-lua-bytecode":["luac"],"application/x-lzh-compressed":["lzh","lha"],"application/x-makeself":["run"],"application/x-mie":["mie"],"application/x-mobipocket-ebook":["prc","mobi"],"application/x-ms-application":["application"],"application/x-ms-shortcut":["lnk"],"application/x-ms-wmd":["wmd"],"application/x-ms-wmz":["wmz"],"application/x-ms-xbap":["xbap"],"application/x-msaccess":["mdb"],"application/x-msbinder":["obd"],"application/x-mscardfile":["crd"],"application/x-msclip":["clp"],"application/x-msdos-program":[],"application/x-msdownload":["com","bat"],"application/x-msmediaview":["mvb","m13","m14"],"application/x-msmetafile":["wmf","emf","emz"],"application/x-msmoney":["mny"],"application/x-mspublisher":["pub"],"application/x-msschedule":["scd"],"application/x-msterminal":["trm"],"application/x-mswrite":["wri"],"application/x-netcdf":["nc","cdf"],"application/x-ns-proxy-autoconfig":["pac"],"application/x-nzb":["nzb"],"application/x-perl":["pl","pm"],"application/x-pilot":[],"application/x-pkcs12":["p12","pfx"],"application/x-pkcs7-certificates":["p7b","spc"],"application/x-pkcs7-certreqresp":["p7r"],"application/x-rar-compressed":["rar"],"application/x-redhat-package-manager":["rpm"],"application/x-research-info-systems":["ris"],"application/x-sea":["sea"],"application/x-sh":["sh"],"application/x-shar":["shar"],"application/x-shockwave-flash":["swf"],"application/x-silverlight-app":["xap"],"application/x-sql":["sql"],"application/x-stuffit":["sit"],"application/x-stuffitx":["sitx"],"application/x-subrip":["srt"],"application/x-sv4cpio":["sv4cpio"],"application/x-sv4crc":["sv4crc"],"application/x-t3vm-image":["t3"],"application/x-tads":["gam"],"application/x-tar":["tar"],"application/x-tcl":["tcl","tk"],"application/x-tex":["tex"],"application/x-tex-tfm":["tfm"],"application/x-texinfo":["texinfo","texi"],"application/x-tgif":["obj"],"application/x-ustar":["ustar"],"application/x-virtualbox-hdd":["hdd"],"application/x-virtualbox-ova":["ova"],"application/x-virtualbox-ovf":["ovf"],"application/x-virtualbox-vbox":["vbox"],"application/x-virtualbox-vbox-extpack":["vbox-extpack"],"application/x-virtualbox-vdi":["vdi"],"application/x-virtualbox-vhd":["vhd"],"application/x-virtualbox-vmdk":["vmdk"],"application/x-wais-source":["src"],"application/x-web-app-manifest+json":["webapp"],"application/x-x509-ca-cert":["der","crt","pem"],"application/x-xfig":["fig"],"application/x-xliff+xml":["xlf"],"application/x-xpinstall":["xpi"],"application/x-xz":["xz"],"application/x-zmachine":["z1","z2","z3","z4","z5","z6","z7","z8"],"application/xaml+xml":["xaml"],"application/xcap-diff+xml":["xdf"],"application/xenc+xml":["xenc"],"application/xhtml+xml":["xhtml","xht"],"application/xml":["xml","xsl","xsd","rng"],"application/xml-dtd":["dtd"],"application/xop+xml":["xop"],"application/xproc+xml":["xpl"],"application/xslt+xml":["xslt"],"application/xspf+xml":["xspf"],"application/xv+xml":["mxml","xhvml","xvml","xvm"],"application/yang":["yang"],"application/yin+xml":["yin"],"application/zip":["zip"],"audio/3gpp":[],"audio/adpcm":["adp"],"audio/basic":["au","snd"],"audio/midi":["mid","midi","kar","rmi"],"audio/mp3":[],"audio/mp4":["m4a","mp4a"],"audio/mpeg":["mpga","mp2","mp2a","mp3","m2a","m3a"],"audio/ogg":["oga","ogg","spx"],"audio/s3m":["s3m"],"audio/silk":["sil"],"audio/vnd.dece.audio":["uva","uvva"],"audio/vnd.digital-winds":["eol"],"audio/vnd.dra":["dra"],"audio/vnd.dts":["dts"],"audio/vnd.dts.hd":["dtshd"],"audio/vnd.lucent.voice":["lvp"],"audio/vnd.ms-playready.media.pya":["pya"],"audio/vnd.nuera.ecelp4800":["ecelp4800"],"audio/vnd.nuera.ecelp7470":["ecelp7470"],"audio/vnd.nuera.ecelp9600":["ecelp9600"],"audio/vnd.rip":["rip"],"audio/wav":["wav"],"audio/wave":[],"audio/webm":["weba"],"audio/x-aac":["aac"],"audio/x-aiff":["aif","aiff","aifc"],"audio/x-caf":["caf"],"audio/x-flac":["flac"],"audio/x-m4a":[],"audio/x-matroska":["mka"],"audio/x-mpegurl":["m3u"],"audio/x-ms-wax":["wax"],"audio/x-ms-wma":["wma"],"audio/x-pn-realaudio":["ram","ra"],"audio/x-pn-realaudio-plugin":["rmp"],"audio/x-realaudio":[],"audio/x-wav":[],"audio/xm":["xm"],"chemical/x-cdx":["cdx"],"chemical/x-cif":["cif"],"chemical/x-cmdf":["cmdf"],"chemical/x-cml":["cml"],"chemical/x-csml":["csml"],"chemical/x-xyz":["xyz"],"font/collection":["ttc"],"font/otf":["otf"],"font/ttf":["ttf"],"font/woff":["woff"],"font/woff2":["woff2"],"image/apng":["apng"],"image/bmp":["bmp"],"image/cgm":["cgm"],"image/g3fax":["g3"],"image/gif":["gif"],"image/ief":["ief"],"image/jp2":["jp2","jpg2"],"image/jpeg":["jpeg","jpg","jpe"],"image/jpm":["jpm"],"image/jpx":["jpx","jpf"],"image/ktx":["ktx"],"image/png":["png"],"image/prs.btif":["btif"],"image/sgi":["sgi"],"image/svg+xml":["svg","svgz"],"image/tiff":["tiff","tif"],"image/vnd.adobe.photoshop":["psd"],"image/vnd.dece.graphic":["uvi","uvvi","uvg","uvvg"],"image/vnd.djvu":["djvu","djv"],"image/vnd.dvb.subtitle":[],"image/vnd.dwg":["dwg"],"image/vnd.dxf":["dxf"],"image/vnd.fastbidsheet":["fbs"],"image/vnd.fpx":["fpx"],"image/vnd.fst":["fst"],"image/vnd.fujixerox.edmics-mmr":["mmr"],"image/vnd.fujixerox.edmics-rlc":["rlc"],"image/vnd.ms-modi":["mdi"],"image/vnd.ms-photo":["wdp"],"image/vnd.net-fpx":["npx"],"image/vnd.wap.wbmp":["wbmp"],"image/vnd.xiff":["xif"],"image/webp":["webp"],"image/x-3ds":["3ds"],"image/x-cmu-raster":["ras"],"image/x-cmx":["cmx"],"image/x-freehand":["fh","fhc","fh4","fh5","fh7"],"image/x-icon":["ico"],"image/x-jng":["jng"],"image/x-mrsid-image":["sid"],"image/x-ms-bmp":[],"image/x-pcx":["pcx"],"image/x-pict":["pic","pct"],"image/x-portable-anymap":["pnm"],"image/x-portable-bitmap":["pbm"],"image/x-portable-graymap":["pgm"],"image/x-portable-pixmap":["ppm"],"image/x-rgb":["rgb"],"image/x-tga":["tga"],"image/x-xbitmap":["xbm"],"image/x-xpixmap":["xpm"],"image/x-xwindowdump":["xwd"],"message/rfc822":["eml","mime"],"model/gltf+json":["gltf"],"model/gltf-binary":["glb"],"model/iges":["igs","iges"],"model/mesh":["msh","mesh","silo"],"model/vnd.collada+xml":["dae"],"model/vnd.dwf":["dwf"],"model/vnd.gdl":["gdl"],"model/vnd.gtw":["gtw"],"model/vnd.mts":["mts"],"model/vnd.vtu":["vtu"],"model/vrml":["wrl","vrml"],"model/x3d+binary":["x3db","x3dbz"],"model/x3d+vrml":["x3dv","x3dvz"],"model/x3d+xml":["x3d","x3dz"],"text/cache-manifest":["appcache","manifest"],"text/calendar":["ics","ifb"],"text/coffeescript":["coffee","litcoffee"],"text/css":["css"],"text/csv":["csv"],"text/hjson":["hjson"],"text/html":["html","htm","shtml"],"text/jade":["jade"],"text/jsx":["jsx"],"text/less":["less"],"text/markdown":["markdown","md"],"text/mathml":["mml"],"text/n3":["n3"],"text/plain":["txt","text","conf","def","list","log","in","ini"],"text/prs.lines.tag":["dsc"],"text/richtext":["rtx"],"text/rtf":[],"text/sgml":["sgml","sgm"],"text/slim":["slim","slm"],"text/stylus":["stylus","styl"],"text/tab-separated-values":["tsv"],"text/troff":["t","tr","roff","man","me","ms"],"text/turtle":["ttl"],"text/uri-list":["uri","uris","urls"],"text/vcard":["vcard"],"text/vnd.curl":["curl"],"text/vnd.curl.dcurl":["dcurl"],"text/vnd.curl.mcurl":["mcurl"],"text/vnd.curl.scurl":["scurl"],"text/vnd.dvb.subtitle":["sub"],"text/vnd.fly":["fly"],"text/vnd.fmi.flexstor":["flx"],"text/vnd.graphviz":["gv"],"text/vnd.in3d.3dml":["3dml"],"text/vnd.in3d.spot":["spot"],"text/vnd.sun.j2me.app-descriptor":["jad"],"text/vnd.wap.wml":["wml"],"text/vnd.wap.wmlscript":["wmls"],"text/vtt":["vtt"],"text/x-asm":["s","asm"],"text/x-c":["c","cc","cxx","cpp","h","hh","dic"],"text/x-component":["htc"],"text/x-fortran":["f","for","f77","f90"],"text/x-handlebars-template":["hbs"],"text/x-java-source":["java"],"text/x-lua":["lua"],"text/x-markdown":["mkd"],"text/x-nfo":["nfo"],"text/x-opml":["opml"],"text/x-org":[],"text/x-pascal":["p","pas"],"text/x-processing":["pde"],"text/x-sass":["sass"],"text/x-scss":["scss"],"text/x-setext":["etx"],"text/x-sfv":["sfv"],"text/x-suse-ymp":["ymp"],"text/x-uuencode":["uu"],"text/x-vcalendar":["vcs"],"text/x-vcard":["vcf"],"text/xml":[],"text/yaml":["yaml","yml"],"video/3gpp":["3gp","3gpp"],"video/3gpp2":["3g2"],"video/h261":["h261"],"video/h263":["h263"],"video/h264":["h264"],"video/jpeg":["jpgv"],"video/jpm":["jpgm"],"video/mj2":["mj2","mjp2"],"video/mp2t":["ts"],"video/mp4":["mp4","mp4v","mpg4"],"video/mpeg":["mpeg","mpg","mpe","m1v","m2v"],"video/ogg":["ogv"],"video/quicktime":["qt","mov"],"video/vnd.dece.hd":["uvh","uvvh"],"video/vnd.dece.mobile":["uvm","uvvm"],"video/vnd.dece.pd":["uvp","uvvp"],"video/vnd.dece.sd":["uvs","uvvs"],"video/vnd.dece.video":["uvv","uvvv"],"video/vnd.dvb.file":["dvb"],"video/vnd.fvt":["fvt"],"video/vnd.mpegurl":["mxu","m4u"],"video/vnd.ms-playready.media.pyv":["pyv"],"video/vnd.uvvu.mp4":["uvu","uvvu"],"video/vnd.vivo":["viv"],"video/webm":["webm"],"video/x-f4v":["f4v"],"video/x-fli":["fli"],"video/x-flv":["flv"],"video/x-m4v":["m4v"],"video/x-matroska":["mkv","mk3d","mks"],"video/x-mng":["mng"],"video/x-ms-asf":["asf","asx"],"video/x-ms-vob":["vob"],"video/x-ms-wm":["wm"],"video/x-ms-wmv":["wmv"],"video/x-ms-wmx":["wmx"],"video/x-ms-wvx":["wvx"],"video/x-msvideo":["avi"],"video/x-sgi-movie":["movie"],"video/x-smv":["smv"],"x-conference/x-cooltalk":["ice"]} \ No newline at end of file diff --git a/node_modules/ms/index.js b/node_modules/ms/index.js new file mode 100644 index 0000000..6a522b1 --- /dev/null +++ b/node_modules/ms/index.js @@ -0,0 +1,152 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + if (ms >= d) { + return Math.round(ms / d) + 'd'; + } + if (ms >= h) { + return Math.round(ms / h) + 'h'; + } + if (ms >= m) { + return Math.round(ms / m) + 'm'; + } + if (ms >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + return plural(ms, d, 'day') || + plural(ms, h, 'hour') || + plural(ms, m, 'minute') || + plural(ms, s, 'second') || + ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) { + return; + } + if (ms < n * 1.5) { + return Math.floor(ms / n) + ' ' + name; + } + return Math.ceil(ms / n) + ' ' + name + 's'; +} diff --git a/node_modules/ms/license.md b/node_modules/ms/license.md new file mode 100644 index 0000000..69b6125 --- /dev/null +++ b/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/ms/package.json b/node_modules/ms/package.json new file mode 100644 index 0000000..a5362f4 --- /dev/null +++ b/node_modules/ms/package.json @@ -0,0 +1,69 @@ +{ + "_from": "ms@2.0.0", + "_id": "ms@2.0.0", + "_inBundle": false, + "_integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=", + "_location": "/ms", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ms@2.0.0", + "name": "ms", + "escapedName": "ms", + "rawSpec": "2.0.0", + "saveSpec": null, + "fetchSpec": "2.0.0" + }, + "_requiredBy": [ + "/debug" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "_shasum": "5608aeadfc00be6c2901df5f9861788de0d597c8", + "_spec": "ms@2.0.0", + "_where": "/home/josuer08/Documents/web/node_modules/debug", + "bugs": { + "url": "https://github.com/zeit/ms/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Tiny milisecond conversion utility", + "devDependencies": { + "eslint": "3.19.0", + "expect.js": "0.3.1", + "husky": "0.13.3", + "lint-staged": "3.4.1", + "mocha": "3.4.1" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/zeit/ms#readme", + "license": "MIT", + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "main": "./index", + "name": "ms", + "repository": { + "type": "git", + "url": "git+https://github.com/zeit/ms.git" + }, + "scripts": { + "lint": "eslint lib/* bin/*", + "precommit": "lint-staged", + "test": "mocha tests.js" + }, + "version": "2.0.0" +} diff --git a/node_modules/ms/readme.md b/node_modules/ms/readme.md new file mode 100644 index 0000000..84a9974 --- /dev/null +++ b/node_modules/ms/readme.md @@ -0,0 +1,51 @@ +# ms + +[](https://travis-ci.org/zeit/ms) +[](https://zeit.chat/) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +``` + +### Convert from milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +### Time format written-out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [node](https://nodejs.org) and in the browser. +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of equivalent ms is returned. + +## Caught a bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/node_modules/negotiator/HISTORY.md b/node_modules/negotiator/HISTORY.md new file mode 100644 index 0000000..6d06c76 --- /dev/null +++ b/node_modules/negotiator/HISTORY.md @@ -0,0 +1,103 @@ +0.6.2 / 2019-04-29 +================== + + * Fix sorting charset, encoding, and language with extra parameters + +0.6.1 / 2016-05-02 +================== + + * perf: improve `Accept` parsing speed + * perf: improve `Accept-Charset` parsing speed + * perf: improve `Accept-Encoding` parsing speed + * perf: improve `Accept-Language` parsing speed + +0.6.0 / 2015-09-29 +================== + + * Fix including type extensions in parameters in `Accept` parsing + * Fix parsing `Accept` parameters with quoted equals + * Fix parsing `Accept` parameters with quoted semicolons + * Lazy-load modules from main entry point + * perf: delay type concatenation until needed + * perf: enable strict mode + * perf: hoist regular expressions + * perf: remove closures getting spec properties + * perf: remove a closure from media type parsing + * perf: remove property delete from media type parsing + +0.5.3 / 2015-05-10 +================== + + * Fix media type parameter matching to be case-insensitive + +0.5.2 / 2015-05-06 +================== + + * Fix comparing media types with quoted values + * Fix splitting media types with quoted commas + +0.5.1 / 2015-02-14 +================== + + * Fix preference sorting to be stable for long acceptable lists + +0.5.0 / 2014-12-18 +================== + + * Fix list return order when large accepted list + * Fix missing identity encoding when q=0 exists + * Remove dynamic building of Negotiator class + +0.4.9 / 2014-10-14 +================== + + * Fix error when media type has invalid parameter + +0.4.8 / 2014-09-28 +================== + + * Fix all negotiations to be case-insensitive + * Stable sort preferences of same quality according to client order + * Support Node.js 0.6 + +0.4.7 / 2014-06-24 +================== + + * Handle invalid provided languages + * Handle invalid provided media types + +0.4.6 / 2014-06-11 +================== + + * Order by specificity when quality is the same + +0.4.5 / 2014-05-29 +================== + + * Fix regression in empty header handling + +0.4.4 / 2014-05-29 +================== + + * Fix behaviors when headers are not present + +0.4.3 / 2014-04-16 +================== + + * Handle slashes on media params correctly + +0.4.2 / 2014-02-28 +================== + + * Fix media type sorting + * Handle media types params strictly + +0.4.1 / 2014-01-16 +================== + + * Use most specific matches + +0.4.0 / 2014-01-09 +================== + + * Remove preferred prefix from methods diff --git a/node_modules/negotiator/LICENSE b/node_modules/negotiator/LICENSE new file mode 100644 index 0000000..ea6b9e2 --- /dev/null +++ b/node_modules/negotiator/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Federico Romero +Copyright (c) 2012-2014 Isaac Z. Schlueter +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/negotiator/README.md b/node_modules/negotiator/README.md new file mode 100644 index 0000000..04a67ff --- /dev/null +++ b/node_modules/negotiator/README.md @@ -0,0 +1,203 @@ +# negotiator + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +An HTTP content negotiator for Node.js + +## Installation + +```sh +$ npm install negotiator +``` + +## API + +```js +var Negotiator = require('negotiator') +``` + +### Accept Negotiation + +```js +availableMediaTypes = ['text/html', 'text/plain', 'application/json'] + +// The negotiator constructor receives a request object +negotiator = new Negotiator(request) + +// Let's say Accept header is 'text/html, application/*;q=0.2, image/jpeg;q=0.8' + +negotiator.mediaTypes() +// -> ['text/html', 'image/jpeg', 'application/*'] + +negotiator.mediaTypes(availableMediaTypes) +// -> ['text/html', 'application/json'] + +negotiator.mediaType(availableMediaTypes) +// -> 'text/html' +``` + +You can check a working example at `examples/accept.js`. + +#### Methods + +##### mediaType() + +Returns the most preferred media type from the client. + +##### mediaType(availableMediaType) + +Returns the most preferred media type from a list of available media types. + +##### mediaTypes() + +Returns an array of preferred media types ordered by the client preference. + +##### mediaTypes(availableMediaTypes) + +Returns an array of preferred media types ordered by priority from a list of +available media types. + +### Accept-Language Negotiation + +```js +negotiator = new Negotiator(request) + +availableLanguages = ['en', 'es', 'fr'] + +// Let's say Accept-Language header is 'en;q=0.8, es, pt' + +negotiator.languages() +// -> ['es', 'pt', 'en'] + +negotiator.languages(availableLanguages) +// -> ['es', 'en'] + +language = negotiator.language(availableLanguages) +// -> 'es' +``` + +You can check a working example at `examples/language.js`. + +#### Methods + +##### language() + +Returns the most preferred language from the client. + +##### language(availableLanguages) + +Returns the most preferred language from a list of available languages. + +##### languages() + +Returns an array of preferred languages ordered by the client preference. + +##### languages(availableLanguages) + +Returns an array of preferred languages ordered by priority from a list of +available languages. + +### Accept-Charset Negotiation + +```js +availableCharsets = ['utf-8', 'iso-8859-1', 'iso-8859-5'] + +negotiator = new Negotiator(request) + +// Let's say Accept-Charset header is 'utf-8, iso-8859-1;q=0.8, utf-7;q=0.2' + +negotiator.charsets() +// -> ['utf-8', 'iso-8859-1', 'utf-7'] + +negotiator.charsets(availableCharsets) +// -> ['utf-8', 'iso-8859-1'] + +negotiator.charset(availableCharsets) +// -> 'utf-8' +``` + +You can check a working example at `examples/charset.js`. + +#### Methods + +##### charset() + +Returns the most preferred charset from the client. + +##### charset(availableCharsets) + +Returns the most preferred charset from a list of available charsets. + +##### charsets() + +Returns an array of preferred charsets ordered by the client preference. + +##### charsets(availableCharsets) + +Returns an array of preferred charsets ordered by priority from a list of +available charsets. + +### Accept-Encoding Negotiation + +```js +availableEncodings = ['identity', 'gzip'] + +negotiator = new Negotiator(request) + +// Let's say Accept-Encoding header is 'gzip, compress;q=0.2, identity;q=0.5' + +negotiator.encodings() +// -> ['gzip', 'identity', 'compress'] + +negotiator.encodings(availableEncodings) +// -> ['gzip', 'identity'] + +negotiator.encoding(availableEncodings) +// -> 'gzip' +``` + +You can check a working example at `examples/encoding.js`. + +#### Methods + +##### encoding() + +Returns the most preferred encoding from the client. + +##### encoding(availableEncodings) + +Returns the most preferred encoding from a list of available encodings. + +##### encodings() + +Returns an array of preferred encodings ordered by the client preference. + +##### encodings(availableEncodings) + +Returns an array of preferred encodings ordered by priority from a list of +available encodings. + +## See Also + +The [accepts](https://npmjs.org/package/accepts#readme) module builds on +this module and provides an alternative interface, mime type validation, +and more. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/negotiator.svg +[npm-url]: https://npmjs.org/package/negotiator +[node-version-image]: https://img.shields.io/node/v/negotiator.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/negotiator/master.svg +[travis-url]: https://travis-ci.org/jshttp/negotiator +[coveralls-image]: https://img.shields.io/coveralls/jshttp/negotiator/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/negotiator?branch=master +[downloads-image]: https://img.shields.io/npm/dm/negotiator.svg +[downloads-url]: https://npmjs.org/package/negotiator diff --git a/node_modules/negotiator/index.js b/node_modules/negotiator/index.js new file mode 100644 index 0000000..8d4f6a2 --- /dev/null +++ b/node_modules/negotiator/index.js @@ -0,0 +1,124 @@ +/*! + * negotiator + * Copyright(c) 2012 Federico Romero + * Copyright(c) 2012-2014 Isaac Z. Schlueter + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Cached loaded submodules. + * @private + */ + +var modules = Object.create(null); + +/** + * Module exports. + * @public + */ + +module.exports = Negotiator; +module.exports.Negotiator = Negotiator; + +/** + * Create a Negotiator instance from a request. + * @param {object} request + * @public + */ + +function Negotiator(request) { + if (!(this instanceof Negotiator)) { + return new Negotiator(request); + } + + this.request = request; +} + +Negotiator.prototype.charset = function charset(available) { + var set = this.charsets(available); + return set && set[0]; +}; + +Negotiator.prototype.charsets = function charsets(available) { + var preferredCharsets = loadModule('charset').preferredCharsets; + return preferredCharsets(this.request.headers['accept-charset'], available); +}; + +Negotiator.prototype.encoding = function encoding(available) { + var set = this.encodings(available); + return set && set[0]; +}; + +Negotiator.prototype.encodings = function encodings(available) { + var preferredEncodings = loadModule('encoding').preferredEncodings; + return preferredEncodings(this.request.headers['accept-encoding'], available); +}; + +Negotiator.prototype.language = function language(available) { + var set = this.languages(available); + return set && set[0]; +}; + +Negotiator.prototype.languages = function languages(available) { + var preferredLanguages = loadModule('language').preferredLanguages; + return preferredLanguages(this.request.headers['accept-language'], available); +}; + +Negotiator.prototype.mediaType = function mediaType(available) { + var set = this.mediaTypes(available); + return set && set[0]; +}; + +Negotiator.prototype.mediaTypes = function mediaTypes(available) { + var preferredMediaTypes = loadModule('mediaType').preferredMediaTypes; + return preferredMediaTypes(this.request.headers.accept, available); +}; + +// Backwards compatibility +Negotiator.prototype.preferredCharset = Negotiator.prototype.charset; +Negotiator.prototype.preferredCharsets = Negotiator.prototype.charsets; +Negotiator.prototype.preferredEncoding = Negotiator.prototype.encoding; +Negotiator.prototype.preferredEncodings = Negotiator.prototype.encodings; +Negotiator.prototype.preferredLanguage = Negotiator.prototype.language; +Negotiator.prototype.preferredLanguages = Negotiator.prototype.languages; +Negotiator.prototype.preferredMediaType = Negotiator.prototype.mediaType; +Negotiator.prototype.preferredMediaTypes = Negotiator.prototype.mediaTypes; + +/** + * Load the given module. + * @private + */ + +function loadModule(moduleName) { + var module = modules[moduleName]; + + if (module !== undefined) { + return module; + } + + // This uses a switch for static require analysis + switch (moduleName) { + case 'charset': + module = require('./lib/charset'); + break; + case 'encoding': + module = require('./lib/encoding'); + break; + case 'language': + module = require('./lib/language'); + break; + case 'mediaType': + module = require('./lib/mediaType'); + break; + default: + throw new Error('Cannot find module \'' + moduleName + '\''); + } + + // Store to prevent invoking require() + modules[moduleName] = module; + + return module; +} diff --git a/node_modules/negotiator/lib/charset.js b/node_modules/negotiator/lib/charset.js new file mode 100644 index 0000000..cdd0148 --- /dev/null +++ b/node_modules/negotiator/lib/charset.js @@ -0,0 +1,169 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredCharsets; +module.exports.preferredCharsets = preferredCharsets; + +/** + * Module variables. + * @private + */ + +var simpleCharsetRegExp = /^\s*([^\s;]+)\s*(?:;(.*))?$/; + +/** + * Parse the Accept-Charset header. + * @private + */ + +function parseAcceptCharset(accept) { + var accepts = accept.split(','); + + for (var i = 0, j = 0; i < accepts.length; i++) { + var charset = parseCharset(accepts[i].trim(), i); + + if (charset) { + accepts[j++] = charset; + } + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse a charset from the Accept-Charset header. + * @private + */ + +function parseCharset(str, i) { + var match = simpleCharsetRegExp.exec(str); + if (!match) return null; + + var charset = match[1]; + var q = 1; + if (match[2]) { + var params = match[2].split(';') + for (var j = 0; j < params.length; j++) { + var p = params[j].trim().split('='); + if (p[0] === 'q') { + q = parseFloat(p[1]); + break; + } + } + } + + return { + charset: charset, + q: q, + i: i + }; +} + +/** + * Get the priority of a charset. + * @private + */ + +function getCharsetPriority(charset, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(charset, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the charset. + * @private + */ + +function specify(charset, spec, index) { + var s = 0; + if(spec.charset.toLowerCase() === charset.toLowerCase()){ + s |= 1; + } else if (spec.charset !== '*' ) { + return null + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s + } +} + +/** + * Get the preferred charsets from an Accept-Charset header. + * @public + */ + +function preferredCharsets(accept, provided) { + // RFC 2616 sec 14.2: no header = * + var accepts = parseAcceptCharset(accept === undefined ? '*' : accept || ''); + + if (!provided) { + // sorted list of all charsets + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullCharset); + } + + var priorities = provided.map(function getPriority(type, index) { + return getCharsetPriority(type, accepts, index); + }); + + // sorted list of accepted charsets + return priorities.filter(isQuality).sort(compareSpecs).map(function getCharset(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full charset string. + * @private + */ + +function getFullCharset(spec) { + return spec.charset; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} diff --git a/node_modules/negotiator/lib/encoding.js b/node_modules/negotiator/lib/encoding.js new file mode 100644 index 0000000..8432cd7 --- /dev/null +++ b/node_modules/negotiator/lib/encoding.js @@ -0,0 +1,184 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredEncodings; +module.exports.preferredEncodings = preferredEncodings; + +/** + * Module variables. + * @private + */ + +var simpleEncodingRegExp = /^\s*([^\s;]+)\s*(?:;(.*))?$/; + +/** + * Parse the Accept-Encoding header. + * @private + */ + +function parseAcceptEncoding(accept) { + var accepts = accept.split(','); + var hasIdentity = false; + var minQuality = 1; + + for (var i = 0, j = 0; i < accepts.length; i++) { + var encoding = parseEncoding(accepts[i].trim(), i); + + if (encoding) { + accepts[j++] = encoding; + hasIdentity = hasIdentity || specify('identity', encoding); + minQuality = Math.min(minQuality, encoding.q || 1); + } + } + + if (!hasIdentity) { + /* + * If identity doesn't explicitly appear in the accept-encoding header, + * it's added to the list of acceptable encoding with the lowest q + */ + accepts[j++] = { + encoding: 'identity', + q: minQuality, + i: i + }; + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse an encoding from the Accept-Encoding header. + * @private + */ + +function parseEncoding(str, i) { + var match = simpleEncodingRegExp.exec(str); + if (!match) return null; + + var encoding = match[1]; + var q = 1; + if (match[2]) { + var params = match[2].split(';'); + for (var j = 0; j < params.length; j++) { + var p = params[j].trim().split('='); + if (p[0] === 'q') { + q = parseFloat(p[1]); + break; + } + } + } + + return { + encoding: encoding, + q: q, + i: i + }; +} + +/** + * Get the priority of an encoding. + * @private + */ + +function getEncodingPriority(encoding, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(encoding, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the encoding. + * @private + */ + +function specify(encoding, spec, index) { + var s = 0; + if(spec.encoding.toLowerCase() === encoding.toLowerCase()){ + s |= 1; + } else if (spec.encoding !== '*' ) { + return null + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s + } +}; + +/** + * Get the preferred encodings from an Accept-Encoding header. + * @public + */ + +function preferredEncodings(accept, provided) { + var accepts = parseAcceptEncoding(accept || ''); + + if (!provided) { + // sorted list of all encodings + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullEncoding); + } + + var priorities = provided.map(function getPriority(type, index) { + return getEncodingPriority(type, accepts, index); + }); + + // sorted list of accepted encodings + return priorities.filter(isQuality).sort(compareSpecs).map(function getEncoding(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full encoding string. + * @private + */ + +function getFullEncoding(spec) { + return spec.encoding; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} diff --git a/node_modules/negotiator/lib/language.js b/node_modules/negotiator/lib/language.js new file mode 100644 index 0000000..62f737f --- /dev/null +++ b/node_modules/negotiator/lib/language.js @@ -0,0 +1,179 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredLanguages; +module.exports.preferredLanguages = preferredLanguages; + +/** + * Module variables. + * @private + */ + +var simpleLanguageRegExp = /^\s*([^\s\-;]+)(?:-([^\s;]+))?\s*(?:;(.*))?$/; + +/** + * Parse the Accept-Language header. + * @private + */ + +function parseAcceptLanguage(accept) { + var accepts = accept.split(','); + + for (var i = 0, j = 0; i < accepts.length; i++) { + var language = parseLanguage(accepts[i].trim(), i); + + if (language) { + accepts[j++] = language; + } + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse a language from the Accept-Language header. + * @private + */ + +function parseLanguage(str, i) { + var match = simpleLanguageRegExp.exec(str); + if (!match) return null; + + var prefix = match[1], + suffix = match[2], + full = prefix; + + if (suffix) full += "-" + suffix; + + var q = 1; + if (match[3]) { + var params = match[3].split(';') + for (var j = 0; j < params.length; j++) { + var p = params[j].split('='); + if (p[0] === 'q') q = parseFloat(p[1]); + } + } + + return { + prefix: prefix, + suffix: suffix, + q: q, + i: i, + full: full + }; +} + +/** + * Get the priority of a language. + * @private + */ + +function getLanguagePriority(language, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(language, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the language. + * @private + */ + +function specify(language, spec, index) { + var p = parseLanguage(language) + if (!p) return null; + var s = 0; + if(spec.full.toLowerCase() === p.full.toLowerCase()){ + s |= 4; + } else if (spec.prefix.toLowerCase() === p.full.toLowerCase()) { + s |= 2; + } else if (spec.full.toLowerCase() === p.prefix.toLowerCase()) { + s |= 1; + } else if (spec.full !== '*' ) { + return null + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s + } +}; + +/** + * Get the preferred languages from an Accept-Language header. + * @public + */ + +function preferredLanguages(accept, provided) { + // RFC 2616 sec 14.4: no header = * + var accepts = parseAcceptLanguage(accept === undefined ? '*' : accept || ''); + + if (!provided) { + // sorted list of all languages + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullLanguage); + } + + var priorities = provided.map(function getPriority(type, index) { + return getLanguagePriority(type, accepts, index); + }); + + // sorted list of accepted languages + return priorities.filter(isQuality).sort(compareSpecs).map(function getLanguage(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full language string. + * @private + */ + +function getFullLanguage(spec) { + return spec.full; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} diff --git a/node_modules/negotiator/lib/mediaType.js b/node_modules/negotiator/lib/mediaType.js new file mode 100644 index 0000000..67309dd --- /dev/null +++ b/node_modules/negotiator/lib/mediaType.js @@ -0,0 +1,294 @@ +/** + * negotiator + * Copyright(c) 2012 Isaac Z. Schlueter + * Copyright(c) 2014 Federico Romero + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = preferredMediaTypes; +module.exports.preferredMediaTypes = preferredMediaTypes; + +/** + * Module variables. + * @private + */ + +var simpleMediaTypeRegExp = /^\s*([^\s\/;]+)\/([^;\s]+)\s*(?:;(.*))?$/; + +/** + * Parse the Accept header. + * @private + */ + +function parseAccept(accept) { + var accepts = splitMediaTypes(accept); + + for (var i = 0, j = 0; i < accepts.length; i++) { + var mediaType = parseMediaType(accepts[i].trim(), i); + + if (mediaType) { + accepts[j++] = mediaType; + } + } + + // trim accepts + accepts.length = j; + + return accepts; +} + +/** + * Parse a media type from the Accept header. + * @private + */ + +function parseMediaType(str, i) { + var match = simpleMediaTypeRegExp.exec(str); + if (!match) return null; + + var params = Object.create(null); + var q = 1; + var subtype = match[2]; + var type = match[1]; + + if (match[3]) { + var kvps = splitParameters(match[3]).map(splitKeyValuePair); + + for (var j = 0; j < kvps.length; j++) { + var pair = kvps[j]; + var key = pair[0].toLowerCase(); + var val = pair[1]; + + // get the value, unwrapping quotes + var value = val && val[0] === '"' && val[val.length - 1] === '"' + ? val.substr(1, val.length - 2) + : val; + + if (key === 'q') { + q = parseFloat(value); + break; + } + + // store parameter + params[key] = value; + } + } + + return { + type: type, + subtype: subtype, + params: params, + q: q, + i: i + }; +} + +/** + * Get the priority of a media type. + * @private + */ + +function getMediaTypePriority(type, accepted, index) { + var priority = {o: -1, q: 0, s: 0}; + + for (var i = 0; i < accepted.length; i++) { + var spec = specify(type, accepted[i], index); + + if (spec && (priority.s - spec.s || priority.q - spec.q || priority.o - spec.o) < 0) { + priority = spec; + } + } + + return priority; +} + +/** + * Get the specificity of the media type. + * @private + */ + +function specify(type, spec, index) { + var p = parseMediaType(type); + var s = 0; + + if (!p) { + return null; + } + + if(spec.type.toLowerCase() == p.type.toLowerCase()) { + s |= 4 + } else if(spec.type != '*') { + return null; + } + + if(spec.subtype.toLowerCase() == p.subtype.toLowerCase()) { + s |= 2 + } else if(spec.subtype != '*') { + return null; + } + + var keys = Object.keys(spec.params); + if (keys.length > 0) { + if (keys.every(function (k) { + return spec.params[k] == '*' || (spec.params[k] || '').toLowerCase() == (p.params[k] || '').toLowerCase(); + })) { + s |= 1 + } else { + return null + } + } + + return { + i: index, + o: spec.i, + q: spec.q, + s: s, + } +} + +/** + * Get the preferred media types from an Accept header. + * @public + */ + +function preferredMediaTypes(accept, provided) { + // RFC 2616 sec 14.2: no header = */* + var accepts = parseAccept(accept === undefined ? '*/*' : accept || ''); + + if (!provided) { + // sorted list of all types + return accepts + .filter(isQuality) + .sort(compareSpecs) + .map(getFullType); + } + + var priorities = provided.map(function getPriority(type, index) { + return getMediaTypePriority(type, accepts, index); + }); + + // sorted list of accepted types + return priorities.filter(isQuality).sort(compareSpecs).map(function getType(priority) { + return provided[priorities.indexOf(priority)]; + }); +} + +/** + * Compare two specs. + * @private + */ + +function compareSpecs(a, b) { + return (b.q - a.q) || (b.s - a.s) || (a.o - b.o) || (a.i - b.i) || 0; +} + +/** + * Get full type string. + * @private + */ + +function getFullType(spec) { + return spec.type + '/' + spec.subtype; +} + +/** + * Check if a spec has any quality. + * @private + */ + +function isQuality(spec) { + return spec.q > 0; +} + +/** + * Count the number of quotes in a string. + * @private + */ + +function quoteCount(string) { + var count = 0; + var index = 0; + + while ((index = string.indexOf('"', index)) !== -1) { + count++; + index++; + } + + return count; +} + +/** + * Split a key value pair. + * @private + */ + +function splitKeyValuePair(str) { + var index = str.indexOf('='); + var key; + var val; + + if (index === -1) { + key = str; + } else { + key = str.substr(0, index); + val = str.substr(index + 1); + } + + return [key, val]; +} + +/** + * Split an Accept header into media types. + * @private + */ + +function splitMediaTypes(accept) { + var accepts = accept.split(','); + + for (var i = 1, j = 0; i < accepts.length; i++) { + if (quoteCount(accepts[j]) % 2 == 0) { + accepts[++j] = accepts[i]; + } else { + accepts[j] += ',' + accepts[i]; + } + } + + // trim accepts + accepts.length = j + 1; + + return accepts; +} + +/** + * Split a string of parameters. + * @private + */ + +function splitParameters(str) { + var parameters = str.split(';'); + + for (var i = 1, j = 0; i < parameters.length; i++) { + if (quoteCount(parameters[j]) % 2 == 0) { + parameters[++j] = parameters[i]; + } else { + parameters[j] += ';' + parameters[i]; + } + } + + // trim parameters + parameters.length = j + 1; + + for (var i = 0; i < parameters.length; i++) { + parameters[i] = parameters[i].trim(); + } + + return parameters; +} diff --git a/node_modules/negotiator/package.json b/node_modules/negotiator/package.json new file mode 100644 index 0000000..0bc9633 --- /dev/null +++ b/node_modules/negotiator/package.json @@ -0,0 +1,84 @@ +{ + "_from": "negotiator@0.6.2", + "_id": "negotiator@0.6.2", + "_inBundle": false, + "_integrity": "sha512-hZXc7K2e+PgeI1eDBe/10Ard4ekbfrrqG8Ep+8Jmf4JID2bNg7NvCPOZN+kfF574pFQI7mum2AUqDidoKqcTOw==", + "_location": "/negotiator", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "negotiator@0.6.2", + "name": "negotiator", + "escapedName": "negotiator", + "rawSpec": "0.6.2", + "saveSpec": null, + "fetchSpec": "0.6.2" + }, + "_requiredBy": [ + "/accepts" + ], + "_resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.2.tgz", + "_shasum": "feacf7ccf525a77ae9634436a64883ffeca346fb", + "_spec": "negotiator@0.6.2", + "_where": "/home/josuer08/Documents/web/node_modules/accepts", + "bugs": { + "url": "https://github.com/jshttp/negotiator/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Federico Romero", + "email": "federico.romero@outboxlabs.com" + }, + { + "name": "Isaac Z. Schlueter", + "email": "i@izs.me", + "url": "http://blog.izs.me/" + } + ], + "deprecated": false, + "description": "HTTP content negotiation", + "devDependencies": { + "eslint": "5.16.0", + "eslint-plugin-markdown": "1.0.0", + "mocha": "6.1.4", + "nyc": "14.0.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "lib/", + "HISTORY.md", + "LICENSE", + "index.js", + "README.md" + ], + "homepage": "https://github.com/jshttp/negotiator#readme", + "keywords": [ + "http", + "content negotiation", + "accept", + "accept-language", + "accept-encoding", + "accept-charset" + ], + "license": "MIT", + "name": "negotiator", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/negotiator.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test" + }, + "version": "0.6.2" +} diff --git a/node_modules/on-finished/HISTORY.md b/node_modules/on-finished/HISTORY.md new file mode 100644 index 0000000..98ff0e9 --- /dev/null +++ b/node_modules/on-finished/HISTORY.md @@ -0,0 +1,88 @@ +2.3.0 / 2015-05-26 +================== + + * Add defined behavior for HTTP `CONNECT` requests + * Add defined behavior for HTTP `Upgrade` requests + * deps: ee-first@1.1.1 + +2.2.1 / 2015-04-22 +================== + + * Fix `isFinished(req)` when data buffered + +2.2.0 / 2014-12-22 +================== + + * Add message object to callback arguments + +2.1.1 / 2014-10-22 +================== + + * Fix handling of pipelined requests + +2.1.0 / 2014-08-16 +================== + + * Check if `socket` is detached + * Return `undefined` for `isFinished` if state unknown + +2.0.0 / 2014-08-16 +================== + + * Add `isFinished` function + * Move to `jshttp` organization + * Remove support for plain socket argument + * Rename to `on-finished` + * Support both `req` and `res` as arguments + * deps: ee-first@1.0.5 + +1.2.2 / 2014-06-10 +================== + + * Reduce listeners added to emitters + - avoids "event emitter leak" warnings when used multiple times on same request + +1.2.1 / 2014-06-08 +================== + + * Fix returned value when already finished + +1.2.0 / 2014-06-05 +================== + + * Call callback when called on already-finished socket + +1.1.4 / 2014-05-27 +================== + + * Support node.js 0.8 + +1.1.3 / 2014-04-30 +================== + + * Make sure errors passed as instanceof `Error` + +1.1.2 / 2014-04-18 +================== + + * Default the `socket` to passed-in object + +1.1.1 / 2014-01-16 +================== + + * Rename module to `finished` + +1.1.0 / 2013-12-25 +================== + + * Call callback when called on already-errored socket + +1.0.1 / 2013-12-20 +================== + + * Actually pass the error to the callback + +1.0.0 / 2013-12-20 +================== + + * Initial release diff --git a/node_modules/on-finished/LICENSE b/node_modules/on-finished/LICENSE new file mode 100644 index 0000000..5931fd2 --- /dev/null +++ b/node_modules/on-finished/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2013 Jonathan Ong <me@jongleberry.com> +Copyright (c) 2014 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/on-finished/README.md b/node_modules/on-finished/README.md new file mode 100644 index 0000000..a0e1157 --- /dev/null +++ b/node_modules/on-finished/README.md @@ -0,0 +1,154 @@ +# on-finished + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Execute a callback when a HTTP request closes, finishes, or errors. + +## Install + +```sh +$ npm install on-finished +``` + +## API + +```js +var onFinished = require('on-finished') +``` + +### onFinished(res, listener) + +Attach a listener to listen for the response to finish. The listener will +be invoked only once when the response finished. If the response finished +to an error, the first argument will contain the error. If the response +has already finished, the listener will be invoked. + +Listening to the end of a response would be used to close things associated +with the response, like open files. + +Listener is invoked as `listener(err, res)`. + +```js +onFinished(res, function (err, res) { + // clean up open fds, etc. + // err contains the error is request error'd +}) +``` + +### onFinished(req, listener) + +Attach a listener to listen for the request to finish. The listener will +be invoked only once when the request finished. If the request finished +to an error, the first argument will contain the error. If the request +has already finished, the listener will be invoked. + +Listening to the end of a request would be used to know when to continue +after reading the data. + +Listener is invoked as `listener(err, req)`. + +```js +var data = '' + +req.setEncoding('utf8') +res.on('data', function (str) { + data += str +}) + +onFinished(req, function (err, req) { + // data is read unless there is err +}) +``` + +### onFinished.isFinished(res) + +Determine if `res` is already finished. This would be useful to check and +not even start certain operations if the response has already finished. + +### onFinished.isFinished(req) + +Determine if `req` is already finished. This would be useful to check and +not even start certain operations if the request has already finished. + +## Special Node.js requests + +### HTTP CONNECT method + +The meaning of the `CONNECT` method from RFC 7231, section 4.3.6: + +> The CONNECT method requests that the recipient establish a tunnel to +> the destination origin server identified by the request-target and, +> if successful, thereafter restrict its behavior to blind forwarding +> of packets, in both directions, until the tunnel is closed. Tunnels +> are commonly used to create an end-to-end virtual connection, through +> one or more proxies, which can then be secured using TLS (Transport +> Layer Security, [RFC5246]). + +In Node.js, these request objects come from the `'connect'` event on +the HTTP server. + +When this module is used on a HTTP `CONNECT` request, the request is +considered "finished" immediately, **due to limitations in the Node.js +interface**. This means if the `CONNECT` request contains a request entity, +the request will be considered "finished" even before it has been read. + +There is no such thing as a response object to a `CONNECT` request in +Node.js, so there is no support for for one. + +### HTTP Upgrade request + +The meaning of the `Upgrade` header from RFC 7230, section 6.1: + +> The "Upgrade" header field is intended to provide a simple mechanism +> for transitioning from HTTP/1.1 to some other protocol on the same +> connection. + +In Node.js, these request objects come from the `'upgrade'` event on +the HTTP server. + +When this module is used on a HTTP request with an `Upgrade` header, the +request is considered "finished" immediately, **due to limitations in the +Node.js interface**. This means if the `Upgrade` request contains a request +entity, the request will be considered "finished" even before it has been +read. + +There is no such thing as a response object to a `Upgrade` request in +Node.js, so there is no support for for one. + +## Example + +The following code ensures that file descriptors are always closed +once the response finishes. + +```js +var destroy = require('destroy') +var http = require('http') +var onFinished = require('on-finished') + +http.createServer(function onRequest(req, res) { + var stream = fs.createReadStream('package.json') + stream.pipe(res) + onFinished(res, function (err) { + destroy(stream) + }) +}) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/on-finished.svg +[npm-url]: https://npmjs.org/package/on-finished +[node-version-image]: https://img.shields.io/node/v/on-finished.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/on-finished/master.svg +[travis-url]: https://travis-ci.org/jshttp/on-finished +[coveralls-image]: https://img.shields.io/coveralls/jshttp/on-finished/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/on-finished?branch=master +[downloads-image]: https://img.shields.io/npm/dm/on-finished.svg +[downloads-url]: https://npmjs.org/package/on-finished diff --git a/node_modules/on-finished/index.js b/node_modules/on-finished/index.js new file mode 100644 index 0000000..9abd98f --- /dev/null +++ b/node_modules/on-finished/index.js @@ -0,0 +1,196 @@ +/*! + * on-finished + * Copyright(c) 2013 Jonathan Ong + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = onFinished +module.exports.isFinished = isFinished + +/** + * Module dependencies. + * @private + */ + +var first = require('ee-first') + +/** + * Variables. + * @private + */ + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) } + +/** + * Invoke callback when the response has finished, useful for + * cleaning up resources afterwards. + * + * @param {object} msg + * @param {function} listener + * @return {object} + * @public + */ + +function onFinished(msg, listener) { + if (isFinished(msg) !== false) { + defer(listener, null, msg) + return msg + } + + // attach the listener to the message + attachListener(msg, listener) + + return msg +} + +/** + * Determine if message is already finished. + * + * @param {object} msg + * @return {boolean} + * @public + */ + +function isFinished(msg) { + var socket = msg.socket + + if (typeof msg.finished === 'boolean') { + // OutgoingMessage + return Boolean(msg.finished || (socket && !socket.writable)) + } + + if (typeof msg.complete === 'boolean') { + // IncomingMessage + return Boolean(msg.upgrade || !socket || !socket.readable || (msg.complete && !msg.readable)) + } + + // don't know + return undefined +} + +/** + * Attach a finished listener to the message. + * + * @param {object} msg + * @param {function} callback + * @private + */ + +function attachFinishedListener(msg, callback) { + var eeMsg + var eeSocket + var finished = false + + function onFinish(error) { + eeMsg.cancel() + eeSocket.cancel() + + finished = true + callback(error) + } + + // finished on first message event + eeMsg = eeSocket = first([[msg, 'end', 'finish']], onFinish) + + function onSocket(socket) { + // remove listener + msg.removeListener('socket', onSocket) + + if (finished) return + if (eeMsg !== eeSocket) return + + // finished on first socket event + eeSocket = first([[socket, 'error', 'close']], onFinish) + } + + if (msg.socket) { + // socket already assigned + onSocket(msg.socket) + return + } + + // wait for socket to be assigned + msg.on('socket', onSocket) + + if (msg.socket === undefined) { + // node.js 0.8 patch + patchAssignSocket(msg, onSocket) + } +} + +/** + * Attach the listener to the message. + * + * @param {object} msg + * @return {function} + * @private + */ + +function attachListener(msg, listener) { + var attached = msg.__onFinished + + // create a private single listener with queue + if (!attached || !attached.queue) { + attached = msg.__onFinished = createListener(msg) + attachFinishedListener(msg, attached) + } + + attached.queue.push(listener) +} + +/** + * Create listener on message. + * + * @param {object} msg + * @return {function} + * @private + */ + +function createListener(msg) { + function listener(err) { + if (msg.__onFinished === listener) msg.__onFinished = null + if (!listener.queue) return + + var queue = listener.queue + listener.queue = null + + for (var i = 0; i < queue.length; i++) { + queue[i](err, msg) + } + } + + listener.queue = [] + + return listener +} + +/** + * Patch ServerResponse.prototype.assignSocket for node.js 0.8. + * + * @param {ServerResponse} res + * @param {function} callback + * @private + */ + +function patchAssignSocket(res, callback) { + var assignSocket = res.assignSocket + + if (typeof assignSocket !== 'function') return + + // res.on('socket', callback) is broken in 0.8 + res.assignSocket = function _assignSocket(socket) { + assignSocket.call(this, socket) + callback(socket) + } +} diff --git a/node_modules/on-finished/package.json b/node_modules/on-finished/package.json new file mode 100644 index 0000000..7a6494f --- /dev/null +++ b/node_modules/on-finished/package.json @@ -0,0 +1,73 @@ +{ + "_from": "on-finished@~2.3.0", + "_id": "on-finished@2.3.0", + "_inBundle": false, + "_integrity": "sha1-IPEzZIGwg811M3mSoWlxqi2QaUc=", + "_location": "/on-finished", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "on-finished@~2.3.0", + "name": "on-finished", + "escapedName": "on-finished", + "rawSpec": "~2.3.0", + "saveSpec": null, + "fetchSpec": "~2.3.0" + }, + "_requiredBy": [ + "/body-parser", + "/express", + "/finalhandler", + "/send" + ], + "_resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz", + "_shasum": "20f1336481b083cd75337992a16971aa2d906947", + "_spec": "on-finished@~2.3.0", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/on-finished/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "ee-first": "1.1.1" + }, + "deprecated": false, + "description": "Execute a callback when a request closes, finishes, or errors", + "devDependencies": { + "istanbul": "0.3.9", + "mocha": "2.2.5" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "homepage": "https://github.com/jshttp/on-finished#readme", + "license": "MIT", + "name": "on-finished", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/on-finished.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "2.3.0" +} diff --git a/node_modules/parseurl/HISTORY.md b/node_modules/parseurl/HISTORY.md new file mode 100644 index 0000000..8e40954 --- /dev/null +++ b/node_modules/parseurl/HISTORY.md @@ -0,0 +1,58 @@ +1.3.3 / 2019-04-15 +================== + + * Fix Node.js 0.8 return value inconsistencies + +1.3.2 / 2017-09-09 +================== + + * perf: reduce overhead for full URLs + * perf: unroll the "fast-path" `RegExp` + +1.3.1 / 2016-01-17 +================== + + * perf: enable strict mode + +1.3.0 / 2014-08-09 +================== + + * Add `parseurl.original` for parsing `req.originalUrl` with fallback + * Return `undefined` if `req.url` is `undefined` + +1.2.0 / 2014-07-21 +================== + + * Cache URLs based on original value + * Remove no-longer-needed URL mis-parse work-around + * Simplify the "fast-path" `RegExp` + +1.1.3 / 2014-07-08 +================== + + * Fix typo + +1.1.2 / 2014-07-08 +================== + + * Seriously fix Node.js 0.8 compatibility + +1.1.1 / 2014-07-08 +================== + + * Fix Node.js 0.8 compatibility + +1.1.0 / 2014-07-08 +================== + + * Incorporate URL href-only parse fast-path + +1.0.1 / 2014-03-08 +================== + + * Add missing `require` + +1.0.0 / 2014-03-08 +================== + + * Genesis from `connect` diff --git a/node_modules/parseurl/LICENSE b/node_modules/parseurl/LICENSE new file mode 100644 index 0000000..27653d3 --- /dev/null +++ b/node_modules/parseurl/LICENSE @@ -0,0 +1,24 @@ + +(The MIT License) + +Copyright (c) 2014 Jonathan Ong <me@jongleberry.com> +Copyright (c) 2014-2017 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/parseurl/README.md b/node_modules/parseurl/README.md new file mode 100644 index 0000000..443e716 --- /dev/null +++ b/node_modules/parseurl/README.md @@ -0,0 +1,133 @@ +# parseurl + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Parse a URL with memoization. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install parseurl +``` + +## API + +```js +var parseurl = require('parseurl') +``` + +### parseurl(req) + +Parse the URL of the given request object (looks at the `req.url` property) +and return the result. The result is the same as `url.parse` in Node.js core. +Calling this function multiple times on the same `req` where `req.url` does +not change will return a cached parsed object, rather than parsing again. + +### parseurl.original(req) + +Parse the original URL of the given request object and return the result. +This works by trying to parse `req.originalUrl` if it is a string, otherwise +parses `req.url`. The result is the same as `url.parse` in Node.js core. +Calling this function multiple times on the same `req` where `req.originalUrl` +does not change will return a cached parsed object, rather than parsing again. + +## Benchmark + +```bash +$ npm run-script bench + +> parseurl@1.3.3 bench nodejs-parseurl +> node benchmark/index.js + + http_parser@2.8.0 + node@10.6.0 + v8@6.7.288.46-node.13 + uv@1.21.0 + zlib@1.2.11 + ares@1.14.0 + modules@64 + nghttp2@1.32.0 + napi@3 + openssl@1.1.0h + icu@61.1 + unicode@10.0 + cldr@33.0 + tz@2018c + +> node benchmark/fullurl.js + + Parsing URL "http://localhost:8888/foo/bar?user=tj&pet=fluffy" + + 4 tests completed. + + fasturl x 2,207,842 ops/sec ±3.76% (184 runs sampled) + nativeurl - legacy x 507,180 ops/sec ±0.82% (191 runs sampled) + nativeurl - whatwg x 290,044 ops/sec ±1.96% (189 runs sampled) + parseurl x 488,907 ops/sec ±2.13% (192 runs sampled) + +> node benchmark/pathquery.js + + Parsing URL "/foo/bar?user=tj&pet=fluffy" + + 4 tests completed. + + fasturl x 3,812,564 ops/sec ±3.15% (188 runs sampled) + nativeurl - legacy x 2,651,631 ops/sec ±1.68% (189 runs sampled) + nativeurl - whatwg x 161,837 ops/sec ±2.26% (189 runs sampled) + parseurl x 4,166,338 ops/sec ±2.23% (184 runs sampled) + +> node benchmark/samerequest.js + + Parsing URL "/foo/bar?user=tj&pet=fluffy" on same request object + + 4 tests completed. + + fasturl x 3,821,651 ops/sec ±2.42% (185 runs sampled) + nativeurl - legacy x 2,651,162 ops/sec ±1.90% (187 runs sampled) + nativeurl - whatwg x 175,166 ops/sec ±1.44% (188 runs sampled) + parseurl x 14,912,606 ops/sec ±3.59% (183 runs sampled) + +> node benchmark/simplepath.js + + Parsing URL "/foo/bar" + + 4 tests completed. + + fasturl x 12,421,765 ops/sec ±2.04% (191 runs sampled) + nativeurl - legacy x 7,546,036 ops/sec ±1.41% (188 runs sampled) + nativeurl - whatwg x 198,843 ops/sec ±1.83% (189 runs sampled) + parseurl x 24,244,006 ops/sec ±0.51% (194 runs sampled) + +> node benchmark/slash.js + + Parsing URL "/" + + 4 tests completed. + + fasturl x 17,159,456 ops/sec ±3.25% (188 runs sampled) + nativeurl - legacy x 11,635,097 ops/sec ±3.79% (184 runs sampled) + nativeurl - whatwg x 240,693 ops/sec ±0.83% (189 runs sampled) + parseurl x 42,279,067 ops/sec ±0.55% (190 runs sampled) +``` + +## License + + [MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/pillarjs/parseurl/master +[coveralls-url]: https://coveralls.io/r/pillarjs/parseurl?branch=master +[node-image]: https://badgen.net/npm/node/parseurl +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/parseurl +[npm-url]: https://npmjs.org/package/parseurl +[npm-version-image]: https://badgen.net/npm/v/parseurl +[travis-image]: https://badgen.net/travis/pillarjs/parseurl/master +[travis-url]: https://travis-ci.org/pillarjs/parseurl diff --git a/node_modules/parseurl/index.js b/node_modules/parseurl/index.js new file mode 100644 index 0000000..ece7223 --- /dev/null +++ b/node_modules/parseurl/index.js @@ -0,0 +1,158 @@ +/*! + * parseurl + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var url = require('url') +var parse = url.parse +var Url = url.Url + +/** + * Module exports. + * @public + */ + +module.exports = parseurl +module.exports.original = originalurl + +/** + * Parse the `req` url with memoization. + * + * @param {ServerRequest} req + * @return {Object} + * @public + */ + +function parseurl (req) { + var url = req.url + + if (url === undefined) { + // URL is undefined + return undefined + } + + var parsed = req._parsedUrl + + if (fresh(url, parsed)) { + // Return cached URL parse + return parsed + } + + // Parse the URL + parsed = fastparse(url) + parsed._raw = url + + return (req._parsedUrl = parsed) +}; + +/** + * Parse the `req` original url with fallback and memoization. + * + * @param {ServerRequest} req + * @return {Object} + * @public + */ + +function originalurl (req) { + var url = req.originalUrl + + if (typeof url !== 'string') { + // Fallback + return parseurl(req) + } + + var parsed = req._parsedOriginalUrl + + if (fresh(url, parsed)) { + // Return cached URL parse + return parsed + } + + // Parse the URL + parsed = fastparse(url) + parsed._raw = url + + return (req._parsedOriginalUrl = parsed) +}; + +/** + * Parse the `str` url with fast-path short-cut. + * + * @param {string} str + * @return {Object} + * @private + */ + +function fastparse (str) { + if (typeof str !== 'string' || str.charCodeAt(0) !== 0x2f /* / */) { + return parse(str) + } + + var pathname = str + var query = null + var search = null + + // This takes the regexp from https://github.com/joyent/node/pull/7878 + // Which is /^(\/[^?#\s]*)(\?[^#\s]*)?$/ + // And unrolls it into a for loop + for (var i = 1; i < str.length; i++) { + switch (str.charCodeAt(i)) { + case 0x3f: /* ? */ + if (search === null) { + pathname = str.substring(0, i) + query = str.substring(i + 1) + search = str.substring(i) + } + break + case 0x09: /* \t */ + case 0x0a: /* \n */ + case 0x0c: /* \f */ + case 0x0d: /* \r */ + case 0x20: /* */ + case 0x23: /* # */ + case 0xa0: + case 0xfeff: + return parse(str) + } + } + + var url = Url !== undefined + ? new Url() + : {} + + url.path = str + url.href = str + url.pathname = pathname + + if (search !== null) { + url.query = query + url.search = search + } + + return url +} + +/** + * Determine if parsed is still fresh for url. + * + * @param {string} url + * @param {object} parsedUrl + * @return {boolean} + * @private + */ + +function fresh (url, parsedUrl) { + return typeof parsedUrl === 'object' && + parsedUrl !== null && + (Url === undefined || parsedUrl instanceof Url) && + parsedUrl._raw === url +} diff --git a/node_modules/parseurl/package.json b/node_modules/parseurl/package.json new file mode 100644 index 0000000..813e2b1 --- /dev/null +++ b/node_modules/parseurl/package.json @@ -0,0 +1,81 @@ +{ + "_from": "parseurl@~1.3.3", + "_id": "parseurl@1.3.3", + "_inBundle": false, + "_integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==", + "_location": "/parseurl", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "parseurl@~1.3.3", + "name": "parseurl", + "escapedName": "parseurl", + "rawSpec": "~1.3.3", + "saveSpec": null, + "fetchSpec": "~1.3.3" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "_shasum": "9da19e7bee8d12dff0513ed5b76957793bc2e8d4", + "_spec": "parseurl@~1.3.3", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "bugs": { + "url": "https://github.com/pillarjs/parseurl/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "deprecated": false, + "description": "parse a url with memoization", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.1", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "fast-url-parser": "1.1.3", + "istanbul": "0.4.5", + "mocha": "6.1.3" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/pillarjs/parseurl#readme", + "license": "MIT", + "name": "parseurl", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/parseurl.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint .", + "test": "mocha --check-leaks --bail --reporter spec test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec test/" + }, + "version": "1.3.3" +} diff --git a/node_modules/path-to-regexp/History.md b/node_modules/path-to-regexp/History.md new file mode 100644 index 0000000..7f65878 --- /dev/null +++ b/node_modules/path-to-regexp/History.md @@ -0,0 +1,36 @@ +0.1.7 / 2015-07-28 +================== + + * Fixed regression with escaped round brackets and matching groups. + +0.1.6 / 2015-06-19 +================== + + * Replace `index` feature by outputting all parameters, unnamed and named. + +0.1.5 / 2015-05-08 +================== + + * Add an index property for position in match result. + +0.1.4 / 2015-03-05 +================== + + * Add license information + +0.1.3 / 2014-07-06 +================== + + * Better array support + * Improved support for trailing slash in non-ending mode + +0.1.0 / 2014-03-06 +================== + + * add options.end + +0.0.2 / 2013-02-10 +================== + + * Update to match current express + * add .license property to component.json diff --git a/node_modules/path-to-regexp/LICENSE b/node_modules/path-to-regexp/LICENSE new file mode 100644 index 0000000..983fbe8 --- /dev/null +++ b/node_modules/path-to-regexp/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/path-to-regexp/Readme.md b/node_modules/path-to-regexp/Readme.md new file mode 100644 index 0000000..95452a6 --- /dev/null +++ b/node_modules/path-to-regexp/Readme.md @@ -0,0 +1,35 @@ +# Path-to-RegExp + +Turn an Express-style path string such as `/user/:name` into a regular expression. + +**Note:** This is a legacy branch. You should upgrade to `1.x`. + +## Usage + +```javascript +var pathToRegexp = require('path-to-regexp'); +``` + +### pathToRegexp(path, keys, options) + + - **path** A string in the express format, an array of such strings, or a regular expression + - **keys** An array to be populated with the keys present in the url. Once the function completes, this will be an array of strings. + - **options** + - **options.sensitive** Defaults to false, set this to true to make routes case sensitive + - **options.strict** Defaults to false, set this to true to make the trailing slash matter. + - **options.end** Defaults to true, set this to false to only match the prefix of the URL. + +```javascript +var keys = []; +var exp = pathToRegexp('/foo/:bar', keys); +//keys = ['bar'] +//exp = /^\/foo\/(?:([^\/]+?))\/?$/i +``` + +## Live Demo + +You can see a live demo of this library in use at [express-route-tester](http://forbeslindesay.github.com/express-route-tester/). + +## License + + MIT diff --git a/node_modules/path-to-regexp/index.js b/node_modules/path-to-regexp/index.js new file mode 100644 index 0000000..500d1da --- /dev/null +++ b/node_modules/path-to-regexp/index.js @@ -0,0 +1,129 @@ +/** + * Expose `pathtoRegexp`. + */ + +module.exports = pathtoRegexp; + +/** + * Match matching groups in a regular expression. + */ +var MATCHING_GROUP_REGEXP = /\((?!\?)/g; + +/** + * Normalize the given path string, + * returning a regular expression. + * + * An empty array should be passed, + * which will contain the placeholder + * key names. For example "/user/:id" will + * then contain ["id"]. + * + * @param {String|RegExp|Array} path + * @param {Array} keys + * @param {Object} options + * @return {RegExp} + * @api private + */ + +function pathtoRegexp(path, keys, options) { + options = options || {}; + keys = keys || []; + var strict = options.strict; + var end = options.end !== false; + var flags = options.sensitive ? '' : 'i'; + var extraOffset = 0; + var keysOffset = keys.length; + var i = 0; + var name = 0; + var m; + + if (path instanceof RegExp) { + while (m = MATCHING_GROUP_REGEXP.exec(path.source)) { + keys.push({ + name: name++, + optional: false, + offset: m.index + }); + } + + return path; + } + + if (Array.isArray(path)) { + // Map array parts into regexps and return their source. We also pass + // the same keys and options instance into every generation to get + // consistent matching groups before we join the sources together. + path = path.map(function (value) { + return pathtoRegexp(value, keys, options).source; + }); + + return new RegExp('(?:' + path.join('|') + ')', flags); + } + + path = ('^' + path + (strict ? '' : path[path.length - 1] === '/' ? '?' : '/?')) + .replace(/\/\(/g, '/(?:') + .replace(/([\/\.])/g, '\\$1') + .replace(/(\\\/)?(\\\.)?:(\w+)(\(.*?\))?(\*)?(\?)?/g, function (match, slash, format, key, capture, star, optional, offset) { + slash = slash || ''; + format = format || ''; + capture = capture || '([^\\/' + format + ']+?)'; + optional = optional || ''; + + keys.push({ + name: key, + optional: !!optional, + offset: offset + extraOffset + }); + + var result = '' + + (optional ? '' : slash) + + '(?:' + + format + (optional ? slash : '') + capture + + (star ? '((?:[\\/' + format + '].+?)?)' : '') + + ')' + + optional; + + extraOffset += result.length - match.length; + + return result; + }) + .replace(/\*/g, function (star, index) { + var len = keys.length + + while (len-- > keysOffset && keys[len].offset > index) { + keys[len].offset += 3; // Replacement length minus asterisk length. + } + + return '(.*)'; + }); + + // This is a workaround for handling unnamed matching groups. + while (m = MATCHING_GROUP_REGEXP.exec(path)) { + var escapeCount = 0; + var index = m.index; + + while (path.charAt(--index) === '\\') { + escapeCount++; + } + + // It's possible to escape the bracket. + if (escapeCount % 2 === 1) { + continue; + } + + if (keysOffset + i === keys.length || keys[keysOffset + i].offset > m.index) { + keys.splice(keysOffset + i, 0, { + name: name++, // Unnamed matching groups must be consistently linear. + optional: false, + offset: m.index + }); + } + + i++; + } + + // If the path is non-ending, match until the end or a slash. + path += (end ? '$' : (path[path.length - 1] === '/' ? '' : '(?=\\/|$)')); + + return new RegExp(path, flags); +}; diff --git a/node_modules/path-to-regexp/package.json b/node_modules/path-to-regexp/package.json new file mode 100644 index 0000000..892c33a --- /dev/null +++ b/node_modules/path-to-regexp/package.json @@ -0,0 +1,59 @@ +{ + "_from": "path-to-regexp@0.1.7", + "_id": "path-to-regexp@0.1.7", + "_inBundle": false, + "_integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=", + "_location": "/path-to-regexp", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "path-to-regexp@0.1.7", + "name": "path-to-regexp", + "escapedName": "path-to-regexp", + "rawSpec": "0.1.7", + "saveSpec": null, + "fetchSpec": "0.1.7" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", + "_shasum": "df604178005f522f15eb4490e7247a1bfaa67f8c", + "_spec": "path-to-regexp@0.1.7", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "bugs": { + "url": "https://github.com/component/path-to-regexp/issues" + }, + "bundleDependencies": false, + "component": { + "scripts": { + "path-to-regexp": "index.js" + } + }, + "deprecated": false, + "description": "Express style path to RegExp utility", + "devDependencies": { + "istanbul": "^0.2.6", + "mocha": "^1.17.1" + }, + "files": [ + "index.js", + "LICENSE" + ], + "homepage": "https://github.com/component/path-to-regexp#readme", + "keywords": [ + "express", + "regexp" + ], + "license": "MIT", + "name": "path-to-regexp", + "repository": { + "type": "git", + "url": "git+https://github.com/component/path-to-regexp.git" + }, + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "version": "0.1.7" +} diff --git a/node_modules/proxy-addr/HISTORY.md b/node_modules/proxy-addr/HISTORY.md new file mode 100644 index 0000000..9765f08 --- /dev/null +++ b/node_modules/proxy-addr/HISTORY.md @@ -0,0 +1,150 @@ +2.0.5 / 2019-04-16 +================== + + * deps: ipaddr.js@1.9.0 + +2.0.4 / 2018-07-26 +================== + + * deps: ipaddr.js@1.8.0 + +2.0.3 / 2018-02-19 +================== + + * deps: ipaddr.js@1.6.0 + +2.0.2 / 2017-09-24 +================== + + * deps: forwarded@~0.1.2 + - perf: improve header parsing + - perf: reduce overhead when no `X-Forwarded-For` header + +2.0.1 / 2017-09-10 +================== + + * deps: forwarded@~0.1.1 + - Fix trimming leading / trailing OWS + - perf: hoist regular expression + * deps: ipaddr.js@1.5.2 + +2.0.0 / 2017-08-08 +================== + + * Drop support for Node.js below 0.10 + +1.1.5 / 2017-07-25 +================== + + * Fix array argument being altered + * deps: ipaddr.js@1.4.0 + +1.1.4 / 2017-03-24 +================== + + * deps: ipaddr.js@1.3.0 + +1.1.3 / 2017-01-14 +================== + + * deps: ipaddr.js@1.2.0 + +1.1.2 / 2016-05-29 +================== + + * deps: ipaddr.js@1.1.1 + - Fix IPv6-mapped IPv4 validation edge cases + +1.1.1 / 2016-05-03 +================== + + * Fix regression matching mixed versions against multiple subnets + +1.1.0 / 2016-05-01 +================== + + * Fix accepting various invalid netmasks + - IPv4 netmasks must be contingous + - IPv6 addresses cannot be used as a netmask + * deps: ipaddr.js@1.1.0 + +1.0.10 / 2015-12-09 +=================== + + * deps: ipaddr.js@1.0.5 + - Fix regression in `isValid` with non-string arguments + +1.0.9 / 2015-12-01 +================== + + * deps: ipaddr.js@1.0.4 + - Fix accepting some invalid IPv6 addresses + - Reject CIDRs with negative or overlong masks + * perf: enable strict mode + +1.0.8 / 2015-05-10 +================== + + * deps: ipaddr.js@1.0.1 + +1.0.7 / 2015-03-16 +================== + + * deps: ipaddr.js@0.1.9 + - Fix OOM on certain inputs to `isValid` + +1.0.6 / 2015-02-01 +================== + + * deps: ipaddr.js@0.1.8 + +1.0.5 / 2015-01-08 +================== + + * deps: ipaddr.js@0.1.6 + +1.0.4 / 2014-11-23 +================== + + * deps: ipaddr.js@0.1.5 + - Fix edge cases with `isValid` + +1.0.3 / 2014-09-21 +================== + + * Use `forwarded` npm module + +1.0.2 / 2014-09-18 +================== + + * Fix a global leak when multiple subnets are trusted + * Support Node.js 0.6 + * deps: ipaddr.js@0.1.3 + +1.0.1 / 2014-06-03 +================== + + * Fix links in npm package + +1.0.0 / 2014-05-08 +================== + + * Add `trust` argument to determine proxy trust on + * Accepts custom function + * Accepts IPv4/IPv6 address(es) + * Accepts subnets + * Accepts pre-defined names + * Add optional `trust` argument to `proxyaddr.all` to + stop at first untrusted + * Add `proxyaddr.compile` to pre-compile `trust` function + to make subsequent calls faster + +0.0.1 / 2014-05-04 +================== + + * Fix bad npm publish + +0.0.0 / 2014-05-04 +================== + + * Initial release diff --git a/node_modules/proxy-addr/LICENSE b/node_modules/proxy-addr/LICENSE new file mode 100644 index 0000000..cab251c --- /dev/null +++ b/node_modules/proxy-addr/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/proxy-addr/README.md b/node_modules/proxy-addr/README.md new file mode 100644 index 0000000..8c176ea --- /dev/null +++ b/node_modules/proxy-addr/README.md @@ -0,0 +1,155 @@ +# proxy-addr + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Determine address of proxied request + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install proxy-addr +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var proxyaddr = require('proxy-addr') +``` + +### proxyaddr(req, trust) + +Return the address of the request, using the given `trust` parameter. + +The `trust` argument is a function that returns `true` if you trust +the address, `false` if you don't. The closest untrusted address is +returned. + +<!-- eslint-disable no-undef --> + +```js +proxyaddr(req, function (addr) { return addr === '127.0.0.1' }) +proxyaddr(req, function (addr, i) { return i < 1 }) +``` + +The `trust` arugment may also be a single IP address string or an +array of trusted addresses, as plain IP addresses, CIDR-formatted +strings, or IP/netmask strings. + +<!-- eslint-disable no-undef --> + +```js +proxyaddr(req, '127.0.0.1') +proxyaddr(req, ['127.0.0.0/8', '10.0.0.0/8']) +proxyaddr(req, ['127.0.0.0/255.0.0.0', '192.168.0.0/255.255.0.0']) +``` + +This module also supports IPv6. Your IPv6 addresses will be normalized +automatically (i.e. `fe80::00ed:1` equals `fe80:0:0:0:0:0:ed:1`). + +<!-- eslint-disable no-undef --> + +```js +proxyaddr(req, '::1') +proxyaddr(req, ['::1/128', 'fe80::/10']) +``` + +This module will automatically work with IPv4-mapped IPv6 addresses +as well to support node.js in IPv6-only mode. This means that you do +not have to specify both `::ffff:a00:1` and `10.0.0.1`. + +As a convenience, this module also takes certain pre-defined names +in addition to IP addresses, which expand into IP addresses: + +<!-- eslint-disable no-undef --> + +```js +proxyaddr(req, 'loopback') +proxyaddr(req, ['loopback', 'fc00:ac:1ab5:fff::1/64']) +``` + + * `loopback`: IPv4 and IPv6 loopback addresses (like `::1` and + `127.0.0.1`). + * `linklocal`: IPv4 and IPv6 link-local addresses (like + `fe80::1:1:1:1` and `169.254.0.1`). + * `uniquelocal`: IPv4 private addresses and IPv6 unique-local + addresses (like `fc00:ac:1ab5:fff::1` and `192.168.0.1`). + +When `trust` is specified as a function, it will be called for each +address to determine if it is a trusted address. The function is +given two arguments: `addr` and `i`, where `addr` is a string of +the address to check and `i` is a number that represents the distance +from the socket address. + +### proxyaddr.all(req, [trust]) + +Return all the addresses of the request, optionally stopping at the +first untrusted. This array is ordered from closest to furthest +(i.e. `arr[0] === req.connection.remoteAddress`). + +<!-- eslint-disable no-undef --> + +```js +proxyaddr.all(req) +``` + +The optional `trust` argument takes the same arguments as `trust` +does in `proxyaddr(req, trust)`. + +<!-- eslint-disable no-undef --> + +```js +proxyaddr.all(req, 'loopback') +``` + +### proxyaddr.compile(val) + +Compiles argument `val` into a `trust` function. This function takes +the same arguments as `trust` does in `proxyaddr(req, trust)` and +returns a function suitable for `proxyaddr(req, trust)`. + +<!-- eslint-disable no-undef, no-unused-vars --> + +```js +var trust = proxyaddr.compile('loopback') +var addr = proxyaddr(req, trust) +``` + +This function is meant to be optimized for use against every request. +It is recommend to compile a trust function up-front for the trusted +configuration and pass that to `proxyaddr(req, trust)` for each request. + +## Testing + +```sh +$ npm test +``` + +## Benchmarks + +```sh +$ npm run-script bench +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/proxy-addr/master +[coveralls-url]: https://coveralls.io/r/jshttp/proxy-addr?branch=master +[node-image]: https://badgen.net/npm/node/proxy-addr +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/proxy-addr +[npm-url]: https://npmjs.org/package/proxy-addr +[npm-version-image]: https://badgen.net/npm/v/proxy-addr +[travis-image]: https://badgen.net/travis/jshttp/proxy-addr/master +[travis-url]: https://travis-ci.org/jshttp/proxy-addr diff --git a/node_modules/proxy-addr/index.js b/node_modules/proxy-addr/index.js new file mode 100644 index 0000000..8bb7d33 --- /dev/null +++ b/node_modules/proxy-addr/index.js @@ -0,0 +1,327 @@ +/*! + * proxy-addr + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = proxyaddr +module.exports.all = alladdrs +module.exports.compile = compile + +/** + * Module dependencies. + * @private + */ + +var forwarded = require('forwarded') +var ipaddr = require('ipaddr.js') + +/** + * Variables. + * @private + */ + +var DIGIT_REGEXP = /^[0-9]+$/ +var isip = ipaddr.isValid +var parseip = ipaddr.parse + +/** + * Pre-defined IP ranges. + * @private + */ + +var IP_RANGES = { + linklocal: ['169.254.0.0/16', 'fe80::/10'], + loopback: ['127.0.0.1/8', '::1/128'], + uniquelocal: ['10.0.0.0/8', '172.16.0.0/12', '192.168.0.0/16', 'fc00::/7'] +} + +/** + * Get all addresses in the request, optionally stopping + * at the first untrusted. + * + * @param {Object} request + * @param {Function|Array|String} [trust] + * @public + */ + +function alladdrs (req, trust) { + // get addresses + var addrs = forwarded(req) + + if (!trust) { + // Return all addresses + return addrs + } + + if (typeof trust !== 'function') { + trust = compile(trust) + } + + for (var i = 0; i < addrs.length - 1; i++) { + if (trust(addrs[i], i)) continue + + addrs.length = i + 1 + } + + return addrs +} + +/** + * Compile argument into trust function. + * + * @param {Array|String} val + * @private + */ + +function compile (val) { + if (!val) { + throw new TypeError('argument is required') + } + + var trust + + if (typeof val === 'string') { + trust = [val] + } else if (Array.isArray(val)) { + trust = val.slice() + } else { + throw new TypeError('unsupported trust argument') + } + + for (var i = 0; i < trust.length; i++) { + val = trust[i] + + if (!IP_RANGES.hasOwnProperty(val)) { + continue + } + + // Splice in pre-defined range + val = IP_RANGES[val] + trust.splice.apply(trust, [i, 1].concat(val)) + i += val.length - 1 + } + + return compileTrust(compileRangeSubnets(trust)) +} + +/** + * Compile `arr` elements into range subnets. + * + * @param {Array} arr + * @private + */ + +function compileRangeSubnets (arr) { + var rangeSubnets = new Array(arr.length) + + for (var i = 0; i < arr.length; i++) { + rangeSubnets[i] = parseipNotation(arr[i]) + } + + return rangeSubnets +} + +/** + * Compile range subnet array into trust function. + * + * @param {Array} rangeSubnets + * @private + */ + +function compileTrust (rangeSubnets) { + // Return optimized function based on length + var len = rangeSubnets.length + return len === 0 + ? trustNone + : len === 1 + ? trustSingle(rangeSubnets[0]) + : trustMulti(rangeSubnets) +} + +/** + * Parse IP notation string into range subnet. + * + * @param {String} note + * @private + */ + +function parseipNotation (note) { + var pos = note.lastIndexOf('/') + var str = pos !== -1 + ? note.substring(0, pos) + : note + + if (!isip(str)) { + throw new TypeError('invalid IP address: ' + str) + } + + var ip = parseip(str) + + if (pos === -1 && ip.kind() === 'ipv6' && ip.isIPv4MappedAddress()) { + // Store as IPv4 + ip = ip.toIPv4Address() + } + + var max = ip.kind() === 'ipv6' + ? 128 + : 32 + + var range = pos !== -1 + ? note.substring(pos + 1, note.length) + : null + + if (range === null) { + range = max + } else if (DIGIT_REGEXP.test(range)) { + range = parseInt(range, 10) + } else if (ip.kind() === 'ipv4' && isip(range)) { + range = parseNetmask(range) + } else { + range = null + } + + if (range <= 0 || range > max) { + throw new TypeError('invalid range on address: ' + note) + } + + return [ip, range] +} + +/** + * Parse netmask string into CIDR range. + * + * @param {String} netmask + * @private + */ + +function parseNetmask (netmask) { + var ip = parseip(netmask) + var kind = ip.kind() + + return kind === 'ipv4' + ? ip.prefixLengthFromSubnetMask() + : null +} + +/** + * Determine address of proxied request. + * + * @param {Object} request + * @param {Function|Array|String} trust + * @public + */ + +function proxyaddr (req, trust) { + if (!req) { + throw new TypeError('req argument is required') + } + + if (!trust) { + throw new TypeError('trust argument is required') + } + + var addrs = alladdrs(req, trust) + var addr = addrs[addrs.length - 1] + + return addr +} + +/** + * Static trust function to trust nothing. + * + * @private + */ + +function trustNone () { + return false +} + +/** + * Compile trust function for multiple subnets. + * + * @param {Array} subnets + * @private + */ + +function trustMulti (subnets) { + return function trust (addr) { + if (!isip(addr)) return false + + var ip = parseip(addr) + var ipconv + var kind = ip.kind() + + for (var i = 0; i < subnets.length; i++) { + var subnet = subnets[i] + var subnetip = subnet[0] + var subnetkind = subnetip.kind() + var subnetrange = subnet[1] + var trusted = ip + + if (kind !== subnetkind) { + if (subnetkind === 'ipv4' && !ip.isIPv4MappedAddress()) { + // Incompatible IP addresses + continue + } + + if (!ipconv) { + // Convert IP to match subnet IP kind + ipconv = subnetkind === 'ipv4' + ? ip.toIPv4Address() + : ip.toIPv4MappedAddress() + } + + trusted = ipconv + } + + if (trusted.match(subnetip, subnetrange)) { + return true + } + } + + return false + } +} + +/** + * Compile trust function for single subnet. + * + * @param {Object} subnet + * @private + */ + +function trustSingle (subnet) { + var subnetip = subnet[0] + var subnetkind = subnetip.kind() + var subnetisipv4 = subnetkind === 'ipv4' + var subnetrange = subnet[1] + + return function trust (addr) { + if (!isip(addr)) return false + + var ip = parseip(addr) + var kind = ip.kind() + + if (kind !== subnetkind) { + if (subnetisipv4 && !ip.isIPv4MappedAddress()) { + // Incompatible IP addresses + return false + } + + // Convert IP to match subnet IP kind + ip = subnetisipv4 + ? ip.toIPv4Address() + : ip.toIPv4MappedAddress() + } + + return ip.match(subnetip, subnetrange) + } +} diff --git a/node_modules/proxy-addr/package.json b/node_modules/proxy-addr/package.json new file mode 100644 index 0000000..d6e02e1 --- /dev/null +++ b/node_modules/proxy-addr/package.json @@ -0,0 +1,82 @@ +{ + "_from": "proxy-addr@~2.0.5", + "_id": "proxy-addr@2.0.5", + "_inBundle": false, + "_integrity": "sha512-t/7RxHXPH6cJtP0pRG6smSr9QJidhB+3kXu0KgXnbGYMgzEnUxRQ4/LDdfOwZEMyIh3/xHb8PX3t+lfL9z+YVQ==", + "_location": "/proxy-addr", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "proxy-addr@~2.0.5", + "name": "proxy-addr", + "escapedName": "proxy-addr", + "rawSpec": "~2.0.5", + "saveSpec": null, + "fetchSpec": "~2.0.5" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.5.tgz", + "_shasum": "34cbd64a2d81f4b1fd21e76f9f06c8a45299ee34", + "_spec": "proxy-addr@~2.0.5", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/proxy-addr/issues" + }, + "bundleDependencies": false, + "dependencies": { + "forwarded": "~0.1.2", + "ipaddr.js": "1.9.0" + }, + "deprecated": false, + "description": "Determine address of proxied request", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "deep-equal": "1.0.1", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.1", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "mocha": "6.1.3", + "nyc": "13.3.0" + }, + "engines": { + "node": ">= 0.10" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/proxy-addr#readme", + "keywords": [ + "ip", + "proxy", + "x-forwarded-for" + ], + "license": "MIT", + "name": "proxy-addr", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/proxy-addr.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "nyc --reporter=text npm test", + "test-travis": "nyc --reporter=html --reporter=text npm test" + }, + "version": "2.0.5" +} diff --git a/node_modules/qs/.editorconfig b/node_modules/qs/.editorconfig new file mode 100644 index 0000000..a4893dd --- /dev/null +++ b/node_modules/qs/.editorconfig @@ -0,0 +1,30 @@ +root = true + +[*] +indent_style = space +indent_size = 4 +end_of_line = lf +charset = utf-8 +trim_trailing_whitespace = true +insert_final_newline = true +max_line_length = 160 + +[test/*] +max_line_length = off + +[*.md] +max_line_length = off + +[*.json] +max_line_length = off + +[Makefile] +max_line_length = off + +[CHANGELOG.md] +indent_style = space +indent_size = 2 + +[LICENSE] +indent_size = 2 +max_line_length = off diff --git a/node_modules/qs/.eslintignore b/node_modules/qs/.eslintignore new file mode 100644 index 0000000..1521c8b --- /dev/null +++ b/node_modules/qs/.eslintignore @@ -0,0 +1 @@ +dist diff --git a/node_modules/qs/.eslintrc b/node_modules/qs/.eslintrc new file mode 100644 index 0000000..e3bde89 --- /dev/null +++ b/node_modules/qs/.eslintrc @@ -0,0 +1,21 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "complexity": 0, + "consistent-return": 1, + "func-name-matching": 0, + "id-length": [2, { "min": 1, "max": 25, "properties": "never" }], + "indent": [2, 4], + "max-lines-per-function": [2, { "max": 150 }], + "max-params": [2, 14], + "max-statements": [2, 52], + "multiline-comment-style": 0, + "no-continue": 1, + "no-magic-numbers": 0, + "no-restricted-syntax": [2, "BreakStatement", "DebuggerStatement", "ForInStatement", "LabeledStatement", "WithStatement"], + "operator-linebreak": [2, "before"], + } +} diff --git a/node_modules/qs/CHANGELOG.md b/node_modules/qs/CHANGELOG.md new file mode 100644 index 0000000..50505c4 --- /dev/null +++ b/node_modules/qs/CHANGELOG.md @@ -0,0 +1,256 @@ +## **6.7.0** +- [New] `stringify`/`parse`: add `comma` as an `arrayFormat` option (#276, #219) +- [Fix] correctly parse nested arrays (#212) +- [Fix] `utils.merge`: avoid a crash with a null target and a truthy non-array source, also with an array source +- [Robustness] `stringify`: cache `Object.prototype.hasOwnProperty` +- [Refactor] `utils`: `isBuffer`: small tweak; add tests +- [Refactor] use cached `Array.isArray` +- [Refactor] `parse`/`stringify`: make a function to normalize the options +- [Refactor] `utils`: reduce observable [[Get]]s +- [Refactor] `stringify`/`utils`: cache `Array.isArray` +- [Tests] always use `String(x)` over `x.toString()` +- [Tests] fix Buffer tests to work in node < 4.5 and node < 5.10 +- [Tests] temporarily allow coverage to fail + +## **6.6.0** +- [New] Add support for iso-8859-1, utf8 "sentinel" and numeric entities (#268) +- [New] move two-value combine to a `utils` function (#189) +- [Fix] `stringify`: fix a crash with `strictNullHandling` and a custom `filter`/`serializeDate` (#279) +- [Fix] when `parseArrays` is false, properly handle keys ending in `[]` (#260) +- [Fix] `stringify`: do not crash in an obscure combo of `interpretNumericEntities`, a bad custom `decoder`, & `iso-8859-1` +- [Fix] `utils`: `merge`: fix crash when `source` is a truthy primitive & no options are provided +- [refactor] `stringify`: Avoid arr = arr.concat(...), push to the existing instance (#269) +- [Refactor] `parse`: only need to reassign the var once +- [Refactor] `parse`/`stringify`: clean up `charset` options checking; fix defaults +- [Refactor] add missing defaults +- [Refactor] `parse`: one less `concat` call +- [Refactor] `utils`: `compactQueue`: make it explicitly side-effecting +- [Dev Deps] update `browserify`, `eslint`, `@ljharb/eslint-config`, `iconv-lite`, `safe-publish-latest`, `tape` +- [Tests] up to `node` `v10.10`, `v9.11`, `v8.12`, `v6.14`, `v4.9`; pin included builds to LTS + +## **6.5.2** +- [Fix] use `safer-buffer` instead of `Buffer` constructor +- [Refactor] utils: `module.exports` one thing, instead of mutating `exports` (#230) +- [Dev Deps] update `browserify`, `eslint`, `iconv-lite`, `safer-buffer`, `tape`, `browserify` + +## **6.5.1** +- [Fix] Fix parsing & compacting very deep objects (#224) +- [Refactor] name utils functions +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `tape` +- [Tests] up to `node` `v8.4`; use `nvm install-latest-npm` so newer npm doesnât break older node +- [Tests] Use precise dist for Node.js 0.6 runtime (#225) +- [Tests] make 0.6 required, now that itâs passing +- [Tests] on `node` `v8.2`; fix npm on node 0.6 + +## **6.5.0** +- [New] add `utils.assign` +- [New] pass default encoder/decoder to custom encoder/decoder functions (#206) +- [New] `parse`/`stringify`: add `ignoreQueryPrefix`/`addQueryPrefix` options, respectively (#213) +- [Fix] Handle stringifying empty objects with addQueryPrefix (#217) +- [Fix] do not mutate `options` argument (#207) +- [Refactor] `parse`: cache index to reuse in else statement (#182) +- [Docs] add various badges to readme (#208) +- [Dev Deps] update `eslint`, `browserify`, `iconv-lite`, `tape` +- [Tests] up to `node` `v8.1`, `v7.10`, `v6.11`; npm v4.6 breaks on node < v1; npm v5+ breaks on node < v4 +- [Tests] add `editorconfig-tools` + +## **6.4.0** +- [New] `qs.stringify`: add `encodeValuesOnly` option +- [Fix] follow `allowPrototypes` option during merge (#201, #201) +- [Fix] support keys starting with brackets (#202, #200) +- [Fix] chmod a-x +- [Dev Deps] update `eslint` +- [Tests] up to `node` `v7.7`, `v6.10`,` v4.8`; disable osx builds since they block linux builds +- [eslint] reduce warnings + +## **6.3.2** +- [Fix] follow `allowPrototypes` option during merge (#201, #200) +- [Dev Deps] update `eslint` +- [Fix] chmod a-x +- [Fix] support keys starting with brackets (#202, #200) +- [Tests] up to `node` `v7.7`, `v6.10`,` v4.8`; disable osx builds since they block linux builds + +## **6.3.1** +- [Fix] ensure that `allowPrototypes: false` does not ever shadow Object.prototype properties (thanks, @snyk!) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `browserify`, `iconv-lite`, `qs-iconv`, `tape` +- [Tests] on all node minors; improve test matrix +- [Docs] document stringify option `allowDots` (#195) +- [Docs] add empty object and array values example (#195) +- [Docs] Fix minor inconsistency/typo (#192) +- [Docs] document stringify option `sort` (#191) +- [Refactor] `stringify`: throw faster with an invalid encoder +- [Refactor] remove unnecessary escapes (#184) +- Remove contributing.md, since `qs` is no longer part of `hapi` (#183) + +## **6.3.0** +- [New] Add support for RFC 1738 (#174, #173) +- [New] `stringify`: Add `serializeDate` option to customize Date serialization (#159) +- [Fix] ensure `utils.merge` handles merging two arrays +- [Refactor] only constructors should be capitalized +- [Refactor] capitalized var names are for constructors only +- [Refactor] avoid using a sparse array +- [Robustness] `formats`: cache `String#replace` +- [Dev Deps] update `browserify`, `eslint`, `@ljharb/eslint-config`; add `safe-publish-latest` +- [Tests] up to `node` `v6.8`, `v4.6`; improve test matrix +- [Tests] flesh out arrayLimit/arrayFormat tests (#107) +- [Tests] skip Object.create tests when null objects are not available +- [Tests] Turn on eslint for test files (#175) + +## **6.2.3** +- [Fix] follow `allowPrototypes` option during merge (#201, #200) +- [Fix] chmod a-x +- [Fix] support keys starting with brackets (#202, #200) +- [Tests] up to `node` `v7.7`, `v6.10`,` v4.8`; disable osx builds since they block linux builds + +## **6.2.2** +- [Fix] ensure that `allowPrototypes: false` does not ever shadow Object.prototype properties + +## **6.2.1** +- [Fix] ensure `key[]=x&key[]&key[]=y` results in 3, not 2, values +- [Refactor] Be explicit and use `Object.prototype.hasOwnProperty.call` +- [Tests] remove `parallelshell` since it does not reliably report failures +- [Tests] up to `node` `v6.3`, `v5.12` +- [Dev Deps] update `tape`, `eslint`, `@ljharb/eslint-config`, `qs-iconv` + +## [**6.2.0**](https://github.com/ljharb/qs/issues?milestone=36&state=closed) +- [New] pass Buffers to the encoder/decoder directly (#161) +- [New] add "encoder" and "decoder" options, for custom param encoding/decoding (#160) +- [Fix] fix compacting of nested sparse arrays (#150) + +## **6.1.2 +- [Fix] follow `allowPrototypes` option during merge (#201, #200) +- [Fix] chmod a-x +- [Fix] support keys starting with brackets (#202, #200) +- [Tests] up to `node` `v7.7`, `v6.10`,` v4.8`; disable osx builds since they block linux builds + +## **6.1.1** +- [Fix] ensure that `allowPrototypes: false` does not ever shadow Object.prototype properties + +## [**6.1.0**](https://github.com/ljharb/qs/issues?milestone=35&state=closed) +- [New] allowDots option for `stringify` (#151) +- [Fix] "sort" option should work at a depth of 3 or more (#151) +- [Fix] Restore `dist` directory; will be removed in v7 (#148) + +## **6.0.4** +- [Fix] follow `allowPrototypes` option during merge (#201, #200) +- [Fix] chmod a-x +- [Fix] support keys starting with brackets (#202, #200) +- [Tests] up to `node` `v7.7`, `v6.10`,` v4.8`; disable osx builds since they block linux builds + +## **6.0.3** +- [Fix] ensure that `allowPrototypes: false` does not ever shadow Object.prototype properties +- [Fix] Restore `dist` directory; will be removed in v7 (#148) + +## [**6.0.2**](https://github.com/ljharb/qs/issues?milestone=33&state=closed) +- Revert ES6 requirement and restore support for node down to v0.8. + +## [**6.0.1**](https://github.com/ljharb/qs/issues?milestone=32&state=closed) +- [**#127**](https://github.com/ljharb/qs/pull/127) Fix engines definition in package.json + +## [**6.0.0**](https://github.com/ljharb/qs/issues?milestone=31&state=closed) +- [**#124**](https://github.com/ljharb/qs/issues/124) Use ES6 and drop support for node < v4 + +## **5.2.1** +- [Fix] ensure `key[]=x&key[]&key[]=y` results in 3, not 2, values + +## [**5.2.0**](https://github.com/ljharb/qs/issues?milestone=30&state=closed) +- [**#64**](https://github.com/ljharb/qs/issues/64) Add option to sort object keys in the query string + +## [**5.1.0**](https://github.com/ljharb/qs/issues?milestone=29&state=closed) +- [**#117**](https://github.com/ljharb/qs/issues/117) make URI encoding stringified results optional +- [**#106**](https://github.com/ljharb/qs/issues/106) Add flag `skipNulls` to optionally skip null values in stringify + +## [**5.0.0**](https://github.com/ljharb/qs/issues?milestone=28&state=closed) +- [**#114**](https://github.com/ljharb/qs/issues/114) default allowDots to false +- [**#100**](https://github.com/ljharb/qs/issues/100) include dist to npm + +## [**4.0.0**](https://github.com/ljharb/qs/issues?milestone=26&state=closed) +- [**#98**](https://github.com/ljharb/qs/issues/98) make returning plain objects and allowing prototype overwriting properties optional + +## [**3.1.0**](https://github.com/ljharb/qs/issues?milestone=24&state=closed) +- [**#89**](https://github.com/ljharb/qs/issues/89) Add option to disable "Transform dot notation to bracket notation" + +## [**3.0.0**](https://github.com/ljharb/qs/issues?milestone=23&state=closed) +- [**#80**](https://github.com/ljharb/qs/issues/80) qs.parse silently drops properties +- [**#77**](https://github.com/ljharb/qs/issues/77) Perf boost +- [**#60**](https://github.com/ljharb/qs/issues/60) Add explicit option to disable array parsing +- [**#74**](https://github.com/ljharb/qs/issues/74) Bad parse when turning array into object +- [**#81**](https://github.com/ljharb/qs/issues/81) Add a `filter` option +- [**#68**](https://github.com/ljharb/qs/issues/68) Fixed issue with recursion and passing strings into objects. +- [**#66**](https://github.com/ljharb/qs/issues/66) Add mixed array and object dot notation support Closes: #47 +- [**#76**](https://github.com/ljharb/qs/issues/76) RFC 3986 +- [**#85**](https://github.com/ljharb/qs/issues/85) No equal sign +- [**#84**](https://github.com/ljharb/qs/issues/84) update license attribute + +## [**2.4.1**](https://github.com/ljharb/qs/issues?milestone=20&state=closed) +- [**#73**](https://github.com/ljharb/qs/issues/73) Property 'hasOwnProperty' of object #<Object> is not a function + +## [**2.4.0**](https://github.com/ljharb/qs/issues?milestone=19&state=closed) +- [**#70**](https://github.com/ljharb/qs/issues/70) Add arrayFormat option + +## [**2.3.3**](https://github.com/ljharb/qs/issues?milestone=18&state=closed) +- [**#59**](https://github.com/ljharb/qs/issues/59) make sure array indexes are >= 0, closes #57 +- [**#58**](https://github.com/ljharb/qs/issues/58) make qs usable for browser loader + +## [**2.3.2**](https://github.com/ljharb/qs/issues?milestone=17&state=closed) +- [**#55**](https://github.com/ljharb/qs/issues/55) allow merging a string into an object + +## [**2.3.1**](https://github.com/ljharb/qs/issues?milestone=16&state=closed) +- [**#52**](https://github.com/ljharb/qs/issues/52) Return "undefined" and "false" instead of throwing "TypeError". + +## [**2.3.0**](https://github.com/ljharb/qs/issues?milestone=15&state=closed) +- [**#50**](https://github.com/ljharb/qs/issues/50) add option to omit array indices, closes #46 + +## [**2.2.5**](https://github.com/ljharb/qs/issues?milestone=14&state=closed) +- [**#39**](https://github.com/ljharb/qs/issues/39) Is there an alternative to Buffer.isBuffer? +- [**#49**](https://github.com/ljharb/qs/issues/49) refactor utils.merge, fixes #45 +- [**#41**](https://github.com/ljharb/qs/issues/41) avoid browserifying Buffer, for #39 + +## [**2.2.4**](https://github.com/ljharb/qs/issues?milestone=13&state=closed) +- [**#38**](https://github.com/ljharb/qs/issues/38) how to handle object keys beginning with a number + +## [**2.2.3**](https://github.com/ljharb/qs/issues?milestone=12&state=closed) +- [**#37**](https://github.com/ljharb/qs/issues/37) parser discards first empty value in array +- [**#36**](https://github.com/ljharb/qs/issues/36) Update to lab 4.x + +## [**2.2.2**](https://github.com/ljharb/qs/issues?milestone=11&state=closed) +- [**#33**](https://github.com/ljharb/qs/issues/33) Error when plain object in a value +- [**#34**](https://github.com/ljharb/qs/issues/34) use Object.prototype.hasOwnProperty.call instead of obj.hasOwnProperty +- [**#24**](https://github.com/ljharb/qs/issues/24) Changelog? Semver? + +## [**2.2.1**](https://github.com/ljharb/qs/issues?milestone=10&state=closed) +- [**#32**](https://github.com/ljharb/qs/issues/32) account for circular references properly, closes #31 +- [**#31**](https://github.com/ljharb/qs/issues/31) qs.parse stackoverflow on circular objects + +## [**2.2.0**](https://github.com/ljharb/qs/issues?milestone=9&state=closed) +- [**#26**](https://github.com/ljharb/qs/issues/26) Don't use Buffer global if it's not present +- [**#30**](https://github.com/ljharb/qs/issues/30) Bug when merging non-object values into arrays +- [**#29**](https://github.com/ljharb/qs/issues/29) Don't call Utils.clone at the top of Utils.merge +- [**#23**](https://github.com/ljharb/qs/issues/23) Ability to not limit parameters? + +## [**2.1.0**](https://github.com/ljharb/qs/issues?milestone=8&state=closed) +- [**#22**](https://github.com/ljharb/qs/issues/22) Enable using a RegExp as delimiter + +## [**2.0.0**](https://github.com/ljharb/qs/issues?milestone=7&state=closed) +- [**#18**](https://github.com/ljharb/qs/issues/18) Why is there arrayLimit? +- [**#20**](https://github.com/ljharb/qs/issues/20) Configurable parametersLimit +- [**#21**](https://github.com/ljharb/qs/issues/21) make all limits optional, for #18, for #20 + +## [**1.2.2**](https://github.com/ljharb/qs/issues?milestone=6&state=closed) +- [**#19**](https://github.com/ljharb/qs/issues/19) Don't overwrite null values + +## [**1.2.1**](https://github.com/ljharb/qs/issues?milestone=5&state=closed) +- [**#16**](https://github.com/ljharb/qs/issues/16) ignore non-string delimiters +- [**#15**](https://github.com/ljharb/qs/issues/15) Close code block + +## [**1.2.0**](https://github.com/ljharb/qs/issues?milestone=4&state=closed) +- [**#12**](https://github.com/ljharb/qs/issues/12) Add optional delim argument +- [**#13**](https://github.com/ljharb/qs/issues/13) fix #11: flattened keys in array are now correctly parsed + +## [**1.1.0**](https://github.com/ljharb/qs/issues?milestone=3&state=closed) +- [**#7**](https://github.com/ljharb/qs/issues/7) Empty values of a POST array disappear after being submitted +- [**#9**](https://github.com/ljharb/qs/issues/9) Should not omit equals signs (=) when value is null +- [**#6**](https://github.com/ljharb/qs/issues/6) Minor grammar fix in README + +## [**1.0.2**](https://github.com/ljharb/qs/issues?milestone=2&state=closed) +- [**#5**](https://github.com/ljharb/qs/issues/5) array holes incorrectly copied into object on large index diff --git a/node_modules/qs/LICENSE b/node_modules/qs/LICENSE new file mode 100644 index 0000000..d456948 --- /dev/null +++ b/node_modules/qs/LICENSE @@ -0,0 +1,28 @@ +Copyright (c) 2014 Nathan LaFreniere and other contributors. +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + * The names of any contributors may not be used to endorse or promote + products derived from this software without specific prior written + permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND +ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDERS AND CONTRIBUTORS BE LIABLE FOR ANY +DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + + * * * + +The complete list of contributors can be found at: https://github.com/hapijs/qs/graphs/contributors diff --git a/node_modules/qs/README.md b/node_modules/qs/README.md new file mode 100644 index 0000000..8590cfd --- /dev/null +++ b/node_modules/qs/README.md @@ -0,0 +1,570 @@ +# qs <sup>[![Version Badge][2]][1]</sup> + +[![Build Status][3]][4] +[![dependency status][5]][6] +[![dev dependency status][7]][8] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] + +[![npm badge][11]][1] + +A querystring parsing and stringifying library with some added security. + +Lead Maintainer: [Jordan Harband](https://github.com/ljharb) + +The **qs** module was originally created and maintained by [TJ Holowaychuk](https://github.com/visionmedia/node-querystring). + +## Usage + +```javascript +var qs = require('qs'); +var assert = require('assert'); + +var obj = qs.parse('a=c'); +assert.deepEqual(obj, { a: 'c' }); + +var str = qs.stringify(obj); +assert.equal(str, 'a=c'); +``` + +### Parsing Objects + +[](#preventEval) +```javascript +qs.parse(string, [options]); +``` + +**qs** allows you to create nested objects within your query strings, by surrounding the name of sub-keys with square brackets `[]`. +For example, the string `'foo[bar]=baz'` converts to: + +```javascript +assert.deepEqual(qs.parse('foo[bar]=baz'), { + foo: { + bar: 'baz' + } +}); +``` + +When using the `plainObjects` option the parsed value is returned as a null object, created via `Object.create(null)` and as such you should be aware that prototype methods will not exist on it and a user may set those names to whatever value they like: + +```javascript +var nullObject = qs.parse('a[hasOwnProperty]=b', { plainObjects: true }); +assert.deepEqual(nullObject, { a: { hasOwnProperty: 'b' } }); +``` + +By default parameters that would overwrite properties on the object prototype are ignored, if you wish to keep the data from those fields either use `plainObjects` as mentioned above, or set `allowPrototypes` to `true` which will allow user input to overwrite those properties. *WARNING* It is generally a bad idea to enable this option as it can cause problems when attempting to use the properties that have been overwritten. Always be careful with this option. + +```javascript +var protoObject = qs.parse('a[hasOwnProperty]=b', { allowPrototypes: true }); +assert.deepEqual(protoObject, { a: { hasOwnProperty: 'b' } }); +``` + +URI encoded strings work too: + +```javascript +assert.deepEqual(qs.parse('a%5Bb%5D=c'), { + a: { b: 'c' } +}); +``` + +You can also nest your objects, like `'foo[bar][baz]=foobarbaz'`: + +```javascript +assert.deepEqual(qs.parse('foo[bar][baz]=foobarbaz'), { + foo: { + bar: { + baz: 'foobarbaz' + } + } +}); +``` + +By default, when nesting objects **qs** will only parse up to 5 children deep. This means if you attempt to parse a string like +`'a[b][c][d][e][f][g][h][i]=j'` your resulting object will be: + +```javascript +var expected = { + a: { + b: { + c: { + d: { + e: { + f: { + '[g][h][i]': 'j' + } + } + } + } + } + } +}; +var string = 'a[b][c][d][e][f][g][h][i]=j'; +assert.deepEqual(qs.parse(string), expected); +``` + +This depth can be overridden by passing a `depth` option to `qs.parse(string, [options])`: + +```javascript +var deep = qs.parse('a[b][c][d][e][f][g][h][i]=j', { depth: 1 }); +assert.deepEqual(deep, { a: { b: { '[c][d][e][f][g][h][i]': 'j' } } }); +``` + +The depth limit helps mitigate abuse when **qs** is used to parse user input, and it is recommended to keep it a reasonably small number. + +For similar reasons, by default **qs** will only parse up to 1000 parameters. This can be overridden by passing a `parameterLimit` option: + +```javascript +var limited = qs.parse('a=b&c=d', { parameterLimit: 1 }); +assert.deepEqual(limited, { a: 'b' }); +``` + +To bypass the leading question mark, use `ignoreQueryPrefix`: + +```javascript +var prefixed = qs.parse('?a=b&c=d', { ignoreQueryPrefix: true }); +assert.deepEqual(prefixed, { a: 'b', c: 'd' }); +``` + +An optional delimiter can also be passed: + +```javascript +var delimited = qs.parse('a=b;c=d', { delimiter: ';' }); +assert.deepEqual(delimited, { a: 'b', c: 'd' }); +``` + +Delimiters can be a regular expression too: + +```javascript +var regexed = qs.parse('a=b;c=d,e=f', { delimiter: /[;,]/ }); +assert.deepEqual(regexed, { a: 'b', c: 'd', e: 'f' }); +``` + +Option `allowDots` can be used to enable dot notation: + +```javascript +var withDots = qs.parse('a.b=c', { allowDots: true }); +assert.deepEqual(withDots, { a: { b: 'c' } }); +``` + +If you have to deal with legacy browsers or services, there's +also support for decoding percent-encoded octets as iso-8859-1: + +```javascript +var oldCharset = qs.parse('a=%A7', { charset: 'iso-8859-1' }); +assert.deepEqual(oldCharset, { a: '§' }); +``` + +Some services add an initial `utf8=â` value to forms so that old +Internet Explorer versions are more likely to submit the form as +utf-8. Additionally, the server can check the value against wrong +encodings of the checkmark character and detect that a query string +or `application/x-www-form-urlencoded` body was *not* sent as +utf-8, eg. if the form had an `accept-charset` parameter or the +containing page had a different character set. + +**qs** supports this mechanism via the `charsetSentinel` option. +If specified, the `utf8` parameter will be omitted from the +returned object. It will be used to switch to `iso-8859-1`/`utf-8` +mode depending on how the checkmark is encoded. + +**Important**: When you specify both the `charset` option and the +`charsetSentinel` option, the `charset` will be overridden when +the request contains a `utf8` parameter from which the actual +charset can be deduced. In that sense the `charset` will behave +as the default charset rather than the authoritative charset. + +```javascript +var detectedAsUtf8 = qs.parse('utf8=%E2%9C%93&a=%C3%B8', { + charset: 'iso-8859-1', + charsetSentinel: true +}); +assert.deepEqual(detectedAsUtf8, { a: 'ø' }); + +// Browsers encode the checkmark as ✓ when submitting as iso-8859-1: +var detectedAsIso8859_1 = qs.parse('utf8=%26%2310003%3B&a=%F8', { + charset: 'utf-8', + charsetSentinel: true +}); +assert.deepEqual(detectedAsIso8859_1, { a: 'ø' }); +``` + +If you want to decode the `&#...;` syntax to the actual character, +you can specify the `interpretNumericEntities` option as well: + +```javascript +var detectedAsIso8859_1 = qs.parse('a=%26%239786%3B', { + charset: 'iso-8859-1', + interpretNumericEntities: true +}); +assert.deepEqual(detectedAsIso8859_1, { a: 'âº' }); +``` + +It also works when the charset has been detected in `charsetSentinel` +mode. + +### Parsing Arrays + +**qs** can also parse arrays using a similar `[]` notation: + +```javascript +var withArray = qs.parse('a[]=b&a[]=c'); +assert.deepEqual(withArray, { a: ['b', 'c'] }); +``` + +You may specify an index as well: + +```javascript +var withIndexes = qs.parse('a[1]=c&a[0]=b'); +assert.deepEqual(withIndexes, { a: ['b', 'c'] }); +``` + +Note that the only difference between an index in an array and a key in an object is that the value between the brackets must be a number +to create an array. When creating arrays with specific indices, **qs** will compact a sparse array to only the existing values preserving +their order: + +```javascript +var noSparse = qs.parse('a[1]=b&a[15]=c'); +assert.deepEqual(noSparse, { a: ['b', 'c'] }); +``` + +Note that an empty string is also a value, and will be preserved: + +```javascript +var withEmptyString = qs.parse('a[]=&a[]=b'); +assert.deepEqual(withEmptyString, { a: ['', 'b'] }); + +var withIndexedEmptyString = qs.parse('a[0]=b&a[1]=&a[2]=c'); +assert.deepEqual(withIndexedEmptyString, { a: ['b', '', 'c'] }); +``` + +**qs** will also limit specifying indices in an array to a maximum index of `20`. Any array members with an index of greater than `20` will +instead be converted to an object with the index as the key. This is needed to handle cases when someone sent, for example, `a[999999999]` and it will take significant time to iterate over this huge array. + +```javascript +var withMaxIndex = qs.parse('a[100]=b'); +assert.deepEqual(withMaxIndex, { a: { '100': 'b' } }); +``` + +This limit can be overridden by passing an `arrayLimit` option: + +```javascript +var withArrayLimit = qs.parse('a[1]=b', { arrayLimit: 0 }); +assert.deepEqual(withArrayLimit, { a: { '1': 'b' } }); +``` + +To disable array parsing entirely, set `parseArrays` to `false`. + +```javascript +var noParsingArrays = qs.parse('a[]=b', { parseArrays: false }); +assert.deepEqual(noParsingArrays, { a: { '0': 'b' } }); +``` + +If you mix notations, **qs** will merge the two items into an object: + +```javascript +var mixedNotation = qs.parse('a[0]=b&a[b]=c'); +assert.deepEqual(mixedNotation, { a: { '0': 'b', b: 'c' } }); +``` + +You can also create arrays of objects: + +```javascript +var arraysOfObjects = qs.parse('a[][b]=c'); +assert.deepEqual(arraysOfObjects, { a: [{ b: 'c' }] }); +``` + +Some people use comma to join array, **qs** can parse it: +```javascript +var arraysOfObjects = qs.parse('a=b,c', { comma: true }) +assert.deepEqual(arraysOfObjects, { a: ['b', 'c'] }) +``` +(_this cannot convert nested objects, such as `a={b:1},{c:d}`_) + +### Stringifying + +[](#preventEval) +```javascript +qs.stringify(object, [options]); +``` + +When stringifying, **qs** by default URI encodes output. Objects are stringified as you would expect: + +```javascript +assert.equal(qs.stringify({ a: 'b' }), 'a=b'); +assert.equal(qs.stringify({ a: { b: 'c' } }), 'a%5Bb%5D=c'); +``` + +This encoding can be disabled by setting the `encode` option to `false`: + +```javascript +var unencoded = qs.stringify({ a: { b: 'c' } }, { encode: false }); +assert.equal(unencoded, 'a[b]=c'); +``` + +Encoding can be disabled for keys by setting the `encodeValuesOnly` option to `true`: +```javascript +var encodedValues = qs.stringify( + { a: 'b', c: ['d', 'e=f'], f: [['g'], ['h']] }, + { encodeValuesOnly: true } +); +assert.equal(encodedValues,'a=b&c[0]=d&c[1]=e%3Df&f[0][0]=g&f[1][0]=h'); +``` + +This encoding can also be replaced by a custom encoding method set as `encoder` option: + +```javascript +var encoded = qs.stringify({ a: { b: 'c' } }, { encoder: function (str) { + // Passed in values `a`, `b`, `c` + return // Return encoded string +}}) +``` + +_(Note: the `encoder` option does not apply if `encode` is `false`)_ + +Analogue to the `encoder` there is a `decoder` option for `parse` to override decoding of properties and values: + +```javascript +var decoded = qs.parse('x=z', { decoder: function (str) { + // Passed in values `x`, `z` + return // Return decoded string +}}) +``` + +Examples beyond this point will be shown as though the output is not URI encoded for clarity. Please note that the return values in these cases *will* be URI encoded during real usage. + +When arrays are stringified, by default they are given explicit indices: + +```javascript +qs.stringify({ a: ['b', 'c', 'd'] }); +// 'a[0]=b&a[1]=c&a[2]=d' +``` + +You may override this by setting the `indices` option to `false`: + +```javascript +qs.stringify({ a: ['b', 'c', 'd'] }, { indices: false }); +// 'a=b&a=c&a=d' +``` + +You may use the `arrayFormat` option to specify the format of the output array: + +```javascript +qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'indices' }) +// 'a[0]=b&a[1]=c' +qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'brackets' }) +// 'a[]=b&a[]=c' +qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'repeat' }) +// 'a=b&a=c' +qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'comma' }) +// 'a=b,c' +``` + +When objects are stringified, by default they use bracket notation: + +```javascript +qs.stringify({ a: { b: { c: 'd', e: 'f' } } }); +// 'a[b][c]=d&a[b][e]=f' +``` + +You may override this to use dot notation by setting the `allowDots` option to `true`: + +```javascript +qs.stringify({ a: { b: { c: 'd', e: 'f' } } }, { allowDots: true }); +// 'a.b.c=d&a.b.e=f' +``` + +Empty strings and null values will omit the value, but the equals sign (=) remains in place: + +```javascript +assert.equal(qs.stringify({ a: '' }), 'a='); +``` + +Key with no values (such as an empty object or array) will return nothing: + +```javascript +assert.equal(qs.stringify({ a: [] }), ''); +assert.equal(qs.stringify({ a: {} }), ''); +assert.equal(qs.stringify({ a: [{}] }), ''); +assert.equal(qs.stringify({ a: { b: []} }), ''); +assert.equal(qs.stringify({ a: { b: {}} }), ''); +``` + +Properties that are set to `undefined` will be omitted entirely: + +```javascript +assert.equal(qs.stringify({ a: null, b: undefined }), 'a='); +``` + +The query string may optionally be prepended with a question mark: + +```javascript +assert.equal(qs.stringify({ a: 'b', c: 'd' }, { addQueryPrefix: true }), '?a=b&c=d'); +``` + +The delimiter may be overridden with stringify as well: + +```javascript +assert.equal(qs.stringify({ a: 'b', c: 'd' }, { delimiter: ';' }), 'a=b;c=d'); +``` + +If you only want to override the serialization of `Date` objects, you can provide a `serializeDate` option: + +```javascript +var date = new Date(7); +assert.equal(qs.stringify({ a: date }), 'a=1970-01-01T00:00:00.007Z'.replace(/:/g, '%3A')); +assert.equal( + qs.stringify({ a: date }, { serializeDate: function (d) { return d.getTime(); } }), + 'a=7' +); +``` + +You may use the `sort` option to affect the order of parameter keys: + +```javascript +function alphabeticalSort(a, b) { + return a.localeCompare(b); +} +assert.equal(qs.stringify({ a: 'c', z: 'y', b : 'f' }, { sort: alphabeticalSort }), 'a=c&b=f&z=y'); +``` + +Finally, you can use the `filter` option to restrict which keys will be included in the stringified output. +If you pass a function, it will be called for each key to obtain the replacement value. Otherwise, if you +pass an array, it will be used to select properties and array indices for stringification: + +```javascript +function filterFunc(prefix, value) { + if (prefix == 'b') { + // Return an `undefined` value to omit a property. + return; + } + if (prefix == 'e[f]') { + return value.getTime(); + } + if (prefix == 'e[g][0]') { + return value * 2; + } + return value; +} +qs.stringify({ a: 'b', c: 'd', e: { f: new Date(123), g: [2] } }, { filter: filterFunc }); +// 'a=b&c=d&e[f]=123&e[g][0]=4' +qs.stringify({ a: 'b', c: 'd', e: 'f' }, { filter: ['a', 'e'] }); +// 'a=b&e=f' +qs.stringify({ a: ['b', 'c', 'd'], e: 'f' }, { filter: ['a', 0, 2] }); +// 'a[0]=b&a[2]=d' +``` + +### Handling of `null` values + +By default, `null` values are treated like empty strings: + +```javascript +var withNull = qs.stringify({ a: null, b: '' }); +assert.equal(withNull, 'a=&b='); +``` + +Parsing does not distinguish between parameters with and without equal signs. Both are converted to empty strings. + +```javascript +var equalsInsensitive = qs.parse('a&b='); +assert.deepEqual(equalsInsensitive, { a: '', b: '' }); +``` + +To distinguish between `null` values and empty strings use the `strictNullHandling` flag. In the result string the `null` +values have no `=` sign: + +```javascript +var strictNull = qs.stringify({ a: null, b: '' }, { strictNullHandling: true }); +assert.equal(strictNull, 'a&b='); +``` + +To parse values without `=` back to `null` use the `strictNullHandling` flag: + +```javascript +var parsedStrictNull = qs.parse('a&b=', { strictNullHandling: true }); +assert.deepEqual(parsedStrictNull, { a: null, b: '' }); +``` + +To completely skip rendering keys with `null` values, use the `skipNulls` flag: + +```javascript +var nullsSkipped = qs.stringify({ a: 'b', c: null}, { skipNulls: true }); +assert.equal(nullsSkipped, 'a=b'); +``` + +If you're communicating with legacy systems, you can switch to `iso-8859-1` +using the `charset` option: + +```javascript +var iso = qs.stringify({ æ: 'æ' }, { charset: 'iso-8859-1' }); +assert.equal(iso, '%E6=%E6'); +``` + +Characters that don't exist in `iso-8859-1` will be converted to numeric +entities, similar to what browsers do: + +```javascript +var numeric = qs.stringify({ a: 'âº' }, { charset: 'iso-8859-1' }); +assert.equal(numeric, 'a=%26%239786%3B'); +``` + +You can use the `charsetSentinel` option to announce the character by +including an `utf8=â` parameter with the proper encoding if the checkmark, +similar to what Ruby on Rails and others do when submitting forms. + +```javascript +var sentinel = qs.stringify({ a: 'âº' }, { charsetSentinel: true }); +assert.equal(sentinel, 'utf8=%E2%9C%93&a=%E2%98%BA'); + +var isoSentinel = qs.stringify({ a: 'æ' }, { charsetSentinel: true, charset: 'iso-8859-1' }); +assert.equal(isoSentinel, 'utf8=%26%2310003%3B&a=%E6'); +``` + +### Dealing with special character sets + +By default the encoding and decoding of characters is done in `utf-8`, +and `iso-8859-1` support is also built in via the `charset` parameter. + +If you wish to encode querystrings to a different character set (i.e. +[Shift JIS](https://en.wikipedia.org/wiki/Shift_JIS)) you can use the +[`qs-iconv`](https://github.com/martinheidegger/qs-iconv) library: + +```javascript +var encoder = require('qs-iconv/encoder')('shift_jis'); +var shiftJISEncoded = qs.stringify({ a: 'ããã«ã¡ã¯ï¼' }, { encoder: encoder }); +assert.equal(shiftJISEncoded, 'a=%82%B1%82%F1%82%C9%82%BF%82%CD%81I'); +``` + +This also works for decoding of query strings: + +```javascript +var decoder = require('qs-iconv/decoder')('shift_jis'); +var obj = qs.parse('a=%82%B1%82%F1%82%C9%82%BF%82%CD%81I', { decoder: decoder }); +assert.deepEqual(obj, { a: 'ããã«ã¡ã¯ï¼' }); +``` + +### RFC 3986 and RFC 1738 space encoding + +RFC3986 used as default option and encodes ' ' to *%20* which is backward compatible. +In the same time, output can be stringified as per RFC1738 with ' ' equal to '+'. + +``` +assert.equal(qs.stringify({ a: 'b c' }), 'a=b%20c'); +assert.equal(qs.stringify({ a: 'b c' }, { format : 'RFC3986' }), 'a=b%20c'); +assert.equal(qs.stringify({ a: 'b c' }, { format : 'RFC1738' }), 'a=b+c'); +``` + +[1]: https://npmjs.org/package/qs +[2]: http://versionbadg.es/ljharb/qs.svg +[3]: https://api.travis-ci.org/ljharb/qs.svg +[4]: https://travis-ci.org/ljharb/qs +[5]: https://david-dm.org/ljharb/qs.svg +[6]: https://david-dm.org/ljharb/qs +[7]: https://david-dm.org/ljharb/qs/dev-status.svg +[8]: https://david-dm.org/ljharb/qs?type=dev +[9]: https://ci.testling.com/ljharb/qs.png +[10]: https://ci.testling.com/ljharb/qs +[11]: https://nodei.co/npm/qs.png?downloads=true&stars=true +[license-image]: http://img.shields.io/npm/l/qs.svg +[license-url]: LICENSE +[downloads-image]: http://img.shields.io/npm/dm/qs.svg +[downloads-url]: http://npm-stat.com/charts.html?package=qs diff --git a/node_modules/qs/dist/qs.js b/node_modules/qs/dist/qs.js new file mode 100644 index 0000000..17f4e60 --- /dev/null +++ b/node_modules/qs/dist/qs.js @@ -0,0 +1,782 @@ +(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.Qs = f()}})(function(){var define,module,exports;return (function(){function r(e,n,t){function o(i,f){if(!n[i]){if(!e[i]){var c="function"==typeof require&&require;if(!f&&c)return c(i,!0);if(u)return u(i,!0);var a=new Error("Cannot find module '"+i+"'");throw a.code="MODULE_NOT_FOUND",a}var p=n[i]={exports:{}};e[i][0].call(p.exports,function(r){var n=e[i][1][r];return o(n||r)},p,p.exports,r,e,n,t)}return n[i].exports}for(var u="function"==typeof require&&require,i=0;i<t.length;i++)o(t[i]);return o}return r})()({1:[function(require,module,exports){ +'use strict'; + +var replace = String.prototype.replace; +var percentTwenties = /%20/g; + +module.exports = { + 'default': 'RFC3986', + formatters: { + RFC1738: function (value) { + return replace.call(value, percentTwenties, '+'); + }, + RFC3986: function (value) { + return value; + } + }, + RFC1738: 'RFC1738', + RFC3986: 'RFC3986' +}; + +},{}],2:[function(require,module,exports){ +'use strict'; + +var stringify = require('./stringify'); +var parse = require('./parse'); +var formats = require('./formats'); + +module.exports = { + formats: formats, + parse: parse, + stringify: stringify +}; + +},{"./formats":1,"./parse":3,"./stringify":4}],3:[function(require,module,exports){ +'use strict'; + +var utils = require('./utils'); + +var has = Object.prototype.hasOwnProperty; + +var defaults = { + allowDots: false, + allowPrototypes: false, + arrayLimit: 20, + charset: 'utf-8', + charsetSentinel: false, + comma: false, + decoder: utils.decode, + delimiter: '&', + depth: 5, + ignoreQueryPrefix: false, + interpretNumericEntities: false, + parameterLimit: 1000, + parseArrays: true, + plainObjects: false, + strictNullHandling: false +}; + +var interpretNumericEntities = function (str) { + return str.replace(/&#(\d+);/g, function ($0, numberStr) { + return String.fromCharCode(parseInt(numberStr, 10)); + }); +}; + +// This is what browsers will submit when the â character occurs in an +// application/x-www-form-urlencoded body and the encoding of the page containing +// the form is iso-8859-1, or when the submitted form has an accept-charset +// attribute of iso-8859-1. Presumably also with other charsets that do not contain +// the â character, such as us-ascii. +var isoSentinel = 'utf8=%26%2310003%3B'; // encodeURIComponent('✓') + +// These are the percent-encoded utf-8 octets representing a checkmark, indicating that the request actually is utf-8 encoded. +var charsetSentinel = 'utf8=%E2%9C%93'; // encodeURIComponent('â') + +var parseValues = function parseQueryStringValues(str, options) { + var obj = {}; + var cleanStr = options.ignoreQueryPrefix ? str.replace(/^\?/, '') : str; + var limit = options.parameterLimit === Infinity ? undefined : options.parameterLimit; + var parts = cleanStr.split(options.delimiter, limit); + var skipIndex = -1; // Keep track of where the utf8 sentinel was found + var i; + + var charset = options.charset; + if (options.charsetSentinel) { + for (i = 0; i < parts.length; ++i) { + if (parts[i].indexOf('utf8=') === 0) { + if (parts[i] === charsetSentinel) { + charset = 'utf-8'; + } else if (parts[i] === isoSentinel) { + charset = 'iso-8859-1'; + } + skipIndex = i; + i = parts.length; // The eslint settings do not allow break; + } + } + } + + for (i = 0; i < parts.length; ++i) { + if (i === skipIndex) { + continue; + } + var part = parts[i]; + + var bracketEqualsPos = part.indexOf(']='); + var pos = bracketEqualsPos === -1 ? part.indexOf('=') : bracketEqualsPos + 1; + + var key, val; + if (pos === -1) { + key = options.decoder(part, defaults.decoder, charset); + val = options.strictNullHandling ? null : ''; + } else { + key = options.decoder(part.slice(0, pos), defaults.decoder, charset); + val = options.decoder(part.slice(pos + 1), defaults.decoder, charset); + } + + if (val && options.interpretNumericEntities && charset === 'iso-8859-1') { + val = interpretNumericEntities(val); + } + + if (val && options.comma && val.indexOf(',') > -1) { + val = val.split(','); + } + + if (has.call(obj, key)) { + obj[key] = utils.combine(obj[key], val); + } else { + obj[key] = val; + } + } + + return obj; +}; + +var parseObject = function (chain, val, options) { + var leaf = val; + + for (var i = chain.length - 1; i >= 0; --i) { + var obj; + var root = chain[i]; + + if (root === '[]' && options.parseArrays) { + obj = [].concat(leaf); + } else { + obj = options.plainObjects ? Object.create(null) : {}; + var cleanRoot = root.charAt(0) === '[' && root.charAt(root.length - 1) === ']' ? root.slice(1, -1) : root; + var index = parseInt(cleanRoot, 10); + if (!options.parseArrays && cleanRoot === '') { + obj = { 0: leaf }; + } else if ( + !isNaN(index) + && root !== cleanRoot + && String(index) === cleanRoot + && index >= 0 + && (options.parseArrays && index <= options.arrayLimit) + ) { + obj = []; + obj[index] = leaf; + } else { + obj[cleanRoot] = leaf; + } + } + + leaf = obj; + } + + return leaf; +}; + +var parseKeys = function parseQueryStringKeys(givenKey, val, options) { + if (!givenKey) { + return; + } + + // Transform dot notation to bracket notation + var key = options.allowDots ? givenKey.replace(/\.([^.[]+)/g, '[$1]') : givenKey; + + // The regex chunks + + var brackets = /(\[[^[\]]*])/; + var child = /(\[[^[\]]*])/g; + + // Get the parent + + var segment = brackets.exec(key); + var parent = segment ? key.slice(0, segment.index) : key; + + // Stash the parent if it exists + + var keys = []; + if (parent) { + // If we aren't using plain objects, optionally prefix keys that would overwrite object prototype properties + if (!options.plainObjects && has.call(Object.prototype, parent)) { + if (!options.allowPrototypes) { + return; + } + } + + keys.push(parent); + } + + // Loop through children appending to the array until we hit depth + + var i = 0; + while ((segment = child.exec(key)) !== null && i < options.depth) { + i += 1; + if (!options.plainObjects && has.call(Object.prototype, segment[1].slice(1, -1))) { + if (!options.allowPrototypes) { + return; + } + } + keys.push(segment[1]); + } + + // If there's a remainder, just add whatever is left + + if (segment) { + keys.push('[' + key.slice(segment.index) + ']'); + } + + return parseObject(keys, val, options); +}; + +var normalizeParseOptions = function normalizeParseOptions(opts) { + if (!opts) { + return defaults; + } + + if (opts.decoder !== null && opts.decoder !== undefined && typeof opts.decoder !== 'function') { + throw new TypeError('Decoder has to be a function.'); + } + + if (typeof opts.charset !== 'undefined' && opts.charset !== 'utf-8' && opts.charset !== 'iso-8859-1') { + throw new Error('The charset option must be either utf-8, iso-8859-1, or undefined'); + } + var charset = typeof opts.charset === 'undefined' ? defaults.charset : opts.charset; + + return { + allowDots: typeof opts.allowDots === 'undefined' ? defaults.allowDots : !!opts.allowDots, + allowPrototypes: typeof opts.allowPrototypes === 'boolean' ? opts.allowPrototypes : defaults.allowPrototypes, + arrayLimit: typeof opts.arrayLimit === 'number' ? opts.arrayLimit : defaults.arrayLimit, + charset: charset, + charsetSentinel: typeof opts.charsetSentinel === 'boolean' ? opts.charsetSentinel : defaults.charsetSentinel, + comma: typeof opts.comma === 'boolean' ? opts.comma : defaults.comma, + decoder: typeof opts.decoder === 'function' ? opts.decoder : defaults.decoder, + delimiter: typeof opts.delimiter === 'string' || utils.isRegExp(opts.delimiter) ? opts.delimiter : defaults.delimiter, + depth: typeof opts.depth === 'number' ? opts.depth : defaults.depth, + ignoreQueryPrefix: opts.ignoreQueryPrefix === true, + interpretNumericEntities: typeof opts.interpretNumericEntities === 'boolean' ? opts.interpretNumericEntities : defaults.interpretNumericEntities, + parameterLimit: typeof opts.parameterLimit === 'number' ? opts.parameterLimit : defaults.parameterLimit, + parseArrays: opts.parseArrays !== false, + plainObjects: typeof opts.plainObjects === 'boolean' ? opts.plainObjects : defaults.plainObjects, + strictNullHandling: typeof opts.strictNullHandling === 'boolean' ? opts.strictNullHandling : defaults.strictNullHandling + }; +}; + +module.exports = function (str, opts) { + var options = normalizeParseOptions(opts); + + if (str === '' || str === null || typeof str === 'undefined') { + return options.plainObjects ? Object.create(null) : {}; + } + + var tempObj = typeof str === 'string' ? parseValues(str, options) : str; + var obj = options.plainObjects ? Object.create(null) : {}; + + // Iterate over the keys and setup the new object + + var keys = Object.keys(tempObj); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + var newObj = parseKeys(key, tempObj[key], options); + obj = utils.merge(obj, newObj, options); + } + + return utils.compact(obj); +}; + +},{"./utils":5}],4:[function(require,module,exports){ +'use strict'; + +var utils = require('./utils'); +var formats = require('./formats'); +var has = Object.prototype.hasOwnProperty; + +var arrayPrefixGenerators = { + brackets: function brackets(prefix) { // eslint-disable-line func-name-matching + return prefix + '[]'; + }, + comma: 'comma', + indices: function indices(prefix, key) { // eslint-disable-line func-name-matching + return prefix + '[' + key + ']'; + }, + repeat: function repeat(prefix) { // eslint-disable-line func-name-matching + return prefix; + } +}; + +var isArray = Array.isArray; +var push = Array.prototype.push; +var pushToArray = function (arr, valueOrArray) { + push.apply(arr, isArray(valueOrArray) ? valueOrArray : [valueOrArray]); +}; + +var toISO = Date.prototype.toISOString; + +var defaults = { + addQueryPrefix: false, + allowDots: false, + charset: 'utf-8', + charsetSentinel: false, + delimiter: '&', + encode: true, + encoder: utils.encode, + encodeValuesOnly: false, + formatter: formats.formatters[formats['default']], + // deprecated + indices: false, + serializeDate: function serializeDate(date) { // eslint-disable-line func-name-matching + return toISO.call(date); + }, + skipNulls: false, + strictNullHandling: false +}; + +var stringify = function stringify( // eslint-disable-line func-name-matching + object, + prefix, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly, + charset +) { + var obj = object; + if (typeof filter === 'function') { + obj = filter(prefix, obj); + } else if (obj instanceof Date) { + obj = serializeDate(obj); + } else if (generateArrayPrefix === 'comma' && isArray(obj)) { + obj = obj.join(','); + } + + if (obj === null) { + if (strictNullHandling) { + return encoder && !encodeValuesOnly ? encoder(prefix, defaults.encoder, charset) : prefix; + } + + obj = ''; + } + + if (typeof obj === 'string' || typeof obj === 'number' || typeof obj === 'boolean' || utils.isBuffer(obj)) { + if (encoder) { + var keyValue = encodeValuesOnly ? prefix : encoder(prefix, defaults.encoder, charset); + return [formatter(keyValue) + '=' + formatter(encoder(obj, defaults.encoder, charset))]; + } + return [formatter(prefix) + '=' + formatter(String(obj))]; + } + + var values = []; + + if (typeof obj === 'undefined') { + return values; + } + + var objKeys; + if (isArray(filter)) { + objKeys = filter; + } else { + var keys = Object.keys(obj); + objKeys = sort ? keys.sort(sort) : keys; + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + if (isArray(obj)) { + pushToArray(values, stringify( + obj[key], + typeof generateArrayPrefix === 'function' ? generateArrayPrefix(prefix, key) : prefix, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly, + charset + )); + } else { + pushToArray(values, stringify( + obj[key], + prefix + (allowDots ? '.' + key : '[' + key + ']'), + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly, + charset + )); + } + } + + return values; +}; + +var normalizeStringifyOptions = function normalizeStringifyOptions(opts) { + if (!opts) { + return defaults; + } + + if (opts.encoder !== null && opts.encoder !== undefined && typeof opts.encoder !== 'function') { + throw new TypeError('Encoder has to be a function.'); + } + + var charset = opts.charset || defaults.charset; + if (typeof opts.charset !== 'undefined' && opts.charset !== 'utf-8' && opts.charset !== 'iso-8859-1') { + throw new TypeError('The charset option must be either utf-8, iso-8859-1, or undefined'); + } + + var format = formats['default']; + if (typeof opts.format !== 'undefined') { + if (!has.call(formats.formatters, opts.format)) { + throw new TypeError('Unknown format option provided.'); + } + format = opts.format; + } + var formatter = formats.formatters[format]; + + var filter = defaults.filter; + if (typeof opts.filter === 'function' || isArray(opts.filter)) { + filter = opts.filter; + } + + return { + addQueryPrefix: typeof opts.addQueryPrefix === 'boolean' ? opts.addQueryPrefix : defaults.addQueryPrefix, + allowDots: typeof opts.allowDots === 'undefined' ? defaults.allowDots : !!opts.allowDots, + charset: charset, + charsetSentinel: typeof opts.charsetSentinel === 'boolean' ? opts.charsetSentinel : defaults.charsetSentinel, + delimiter: typeof opts.delimiter === 'undefined' ? defaults.delimiter : opts.delimiter, + encode: typeof opts.encode === 'boolean' ? opts.encode : defaults.encode, + encoder: typeof opts.encoder === 'function' ? opts.encoder : defaults.encoder, + encodeValuesOnly: typeof opts.encodeValuesOnly === 'boolean' ? opts.encodeValuesOnly : defaults.encodeValuesOnly, + filter: filter, + formatter: formatter, + serializeDate: typeof opts.serializeDate === 'function' ? opts.serializeDate : defaults.serializeDate, + skipNulls: typeof opts.skipNulls === 'boolean' ? opts.skipNulls : defaults.skipNulls, + sort: typeof opts.sort === 'function' ? opts.sort : null, + strictNullHandling: typeof opts.strictNullHandling === 'boolean' ? opts.strictNullHandling : defaults.strictNullHandling + }; +}; + +module.exports = function (object, opts) { + var obj = object; + var options = normalizeStringifyOptions(opts); + + var objKeys; + var filter; + + if (typeof options.filter === 'function') { + filter = options.filter; + obj = filter('', obj); + } else if (isArray(options.filter)) { + filter = options.filter; + objKeys = filter; + } + + var keys = []; + + if (typeof obj !== 'object' || obj === null) { + return ''; + } + + var arrayFormat; + if (opts && opts.arrayFormat in arrayPrefixGenerators) { + arrayFormat = opts.arrayFormat; + } else if (opts && 'indices' in opts) { + arrayFormat = opts.indices ? 'indices' : 'repeat'; + } else { + arrayFormat = 'indices'; + } + + var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; + + if (!objKeys) { + objKeys = Object.keys(obj); + } + + if (options.sort) { + objKeys.sort(options.sort); + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (options.skipNulls && obj[key] === null) { + continue; + } + pushToArray(keys, stringify( + obj[key], + key, + generateArrayPrefix, + options.strictNullHandling, + options.skipNulls, + options.encode ? options.encoder : null, + options.filter, + options.sort, + options.allowDots, + options.serializeDate, + options.formatter, + options.encodeValuesOnly, + options.charset + )); + } + + var joined = keys.join(options.delimiter); + var prefix = options.addQueryPrefix === true ? '?' : ''; + + if (options.charsetSentinel) { + if (options.charset === 'iso-8859-1') { + // encodeURIComponent('✓'), the "numeric entity" representation of a checkmark + prefix += 'utf8=%26%2310003%3B&'; + } else { + // encodeURIComponent('â') + prefix += 'utf8=%E2%9C%93&'; + } + } + + return joined.length > 0 ? prefix + joined : ''; +}; + +},{"./formats":1,"./utils":5}],5:[function(require,module,exports){ +'use strict'; + +var has = Object.prototype.hasOwnProperty; +var isArray = Array.isArray; + +var hexTable = (function () { + var array = []; + for (var i = 0; i < 256; ++i) { + array.push('%' + ((i < 16 ? '0' : '') + i.toString(16)).toUpperCase()); + } + + return array; +}()); + +var compactQueue = function compactQueue(queue) { + while (queue.length > 1) { + var item = queue.pop(); + var obj = item.obj[item.prop]; + + if (isArray(obj)) { + var compacted = []; + + for (var j = 0; j < obj.length; ++j) { + if (typeof obj[j] !== 'undefined') { + compacted.push(obj[j]); + } + } + + item.obj[item.prop] = compacted; + } + } +}; + +var arrayToObject = function arrayToObject(source, options) { + var obj = options && options.plainObjects ? Object.create(null) : {}; + for (var i = 0; i < source.length; ++i) { + if (typeof source[i] !== 'undefined') { + obj[i] = source[i]; + } + } + + return obj; +}; + +var merge = function merge(target, source, options) { + if (!source) { + return target; + } + + if (typeof source !== 'object') { + if (isArray(target)) { + target.push(source); + } else if (target && typeof target === 'object') { + if ((options && (options.plainObjects || options.allowPrototypes)) || !has.call(Object.prototype, source)) { + target[source] = true; + } + } else { + return [target, source]; + } + + return target; + } + + if (!target || typeof target !== 'object') { + return [target].concat(source); + } + + var mergeTarget = target; + if (isArray(target) && !isArray(source)) { + mergeTarget = arrayToObject(target, options); + } + + if (isArray(target) && isArray(source)) { + source.forEach(function (item, i) { + if (has.call(target, i)) { + var targetItem = target[i]; + if (targetItem && typeof targetItem === 'object' && item && typeof item === 'object') { + target[i] = merge(targetItem, item, options); + } else { + target.push(item); + } + } else { + target[i] = item; + } + }); + return target; + } + + return Object.keys(source).reduce(function (acc, key) { + var value = source[key]; + + if (has.call(acc, key)) { + acc[key] = merge(acc[key], value, options); + } else { + acc[key] = value; + } + return acc; + }, mergeTarget); +}; + +var assign = function assignSingleSource(target, source) { + return Object.keys(source).reduce(function (acc, key) { + acc[key] = source[key]; + return acc; + }, target); +}; + +var decode = function (str, decoder, charset) { + var strWithoutPlus = str.replace(/\+/g, ' '); + if (charset === 'iso-8859-1') { + // unescape never throws, no try...catch needed: + return strWithoutPlus.replace(/%[0-9a-f]{2}/gi, unescape); + } + // utf-8 + try { + return decodeURIComponent(strWithoutPlus); + } catch (e) { + return strWithoutPlus; + } +}; + +var encode = function encode(str, defaultEncoder, charset) { + // This code was originally written by Brian White (mscdex) for the io.js core querystring library. + // It has been adapted here for stricter adherence to RFC 3986 + if (str.length === 0) { + return str; + } + + var string = typeof str === 'string' ? str : String(str); + + if (charset === 'iso-8859-1') { + return escape(string).replace(/%u[0-9a-f]{4}/gi, function ($0) { + return '%26%23' + parseInt($0.slice(2), 16) + '%3B'; + }); + } + + var out = ''; + for (var i = 0; i < string.length; ++i) { + var c = string.charCodeAt(i); + + if ( + c === 0x2D // - + || c === 0x2E // . + || c === 0x5F // _ + || c === 0x7E // ~ + || (c >= 0x30 && c <= 0x39) // 0-9 + || (c >= 0x41 && c <= 0x5A) // a-z + || (c >= 0x61 && c <= 0x7A) // A-Z + ) { + out += string.charAt(i); + continue; + } + + if (c < 0x80) { + out = out + hexTable[c]; + continue; + } + + if (c < 0x800) { + out = out + (hexTable[0xC0 | (c >> 6)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + if (c < 0xD800 || c >= 0xE000) { + out = out + (hexTable[0xE0 | (c >> 12)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + i += 1; + c = 0x10000 + (((c & 0x3FF) << 10) | (string.charCodeAt(i) & 0x3FF)); + out += hexTable[0xF0 | (c >> 18)] + + hexTable[0x80 | ((c >> 12) & 0x3F)] + + hexTable[0x80 | ((c >> 6) & 0x3F)] + + hexTable[0x80 | (c & 0x3F)]; + } + + return out; +}; + +var compact = function compact(value) { + var queue = [{ obj: { o: value }, prop: 'o' }]; + var refs = []; + + for (var i = 0; i < queue.length; ++i) { + var item = queue[i]; + var obj = item.obj[item.prop]; + + var keys = Object.keys(obj); + for (var j = 0; j < keys.length; ++j) { + var key = keys[j]; + var val = obj[key]; + if (typeof val === 'object' && val !== null && refs.indexOf(val) === -1) { + queue.push({ obj: obj, prop: key }); + refs.push(val); + } + } + } + + compactQueue(queue); + + return value; +}; + +var isRegExp = function isRegExp(obj) { + return Object.prototype.toString.call(obj) === '[object RegExp]'; +}; + +var isBuffer = function isBuffer(obj) { + if (!obj || typeof obj !== 'object') { + return false; + } + + return !!(obj.constructor && obj.constructor.isBuffer && obj.constructor.isBuffer(obj)); +}; + +var combine = function combine(a, b) { + return [].concat(a, b); +}; + +module.exports = { + arrayToObject: arrayToObject, + assign: assign, + combine: combine, + compact: compact, + decode: decode, + encode: encode, + isBuffer: isBuffer, + isRegExp: isRegExp, + merge: merge +}; + +},{}]},{},[2])(2) +}); diff --git a/node_modules/qs/lib/formats.js b/node_modules/qs/lib/formats.js new file mode 100644 index 0000000..df45997 --- /dev/null +++ b/node_modules/qs/lib/formats.js @@ -0,0 +1,18 @@ +'use strict'; + +var replace = String.prototype.replace; +var percentTwenties = /%20/g; + +module.exports = { + 'default': 'RFC3986', + formatters: { + RFC1738: function (value) { + return replace.call(value, percentTwenties, '+'); + }, + RFC3986: function (value) { + return value; + } + }, + RFC1738: 'RFC1738', + RFC3986: 'RFC3986' +}; diff --git a/node_modules/qs/lib/index.js b/node_modules/qs/lib/index.js new file mode 100644 index 0000000..0d6a97d --- /dev/null +++ b/node_modules/qs/lib/index.js @@ -0,0 +1,11 @@ +'use strict'; + +var stringify = require('./stringify'); +var parse = require('./parse'); +var formats = require('./formats'); + +module.exports = { + formats: formats, + parse: parse, + stringify: stringify +}; diff --git a/node_modules/qs/lib/parse.js b/node_modules/qs/lib/parse.js new file mode 100644 index 0000000..d81628b --- /dev/null +++ b/node_modules/qs/lib/parse.js @@ -0,0 +1,242 @@ +'use strict'; + +var utils = require('./utils'); + +var has = Object.prototype.hasOwnProperty; + +var defaults = { + allowDots: false, + allowPrototypes: false, + arrayLimit: 20, + charset: 'utf-8', + charsetSentinel: false, + comma: false, + decoder: utils.decode, + delimiter: '&', + depth: 5, + ignoreQueryPrefix: false, + interpretNumericEntities: false, + parameterLimit: 1000, + parseArrays: true, + plainObjects: false, + strictNullHandling: false +}; + +var interpretNumericEntities = function (str) { + return str.replace(/&#(\d+);/g, function ($0, numberStr) { + return String.fromCharCode(parseInt(numberStr, 10)); + }); +}; + +// This is what browsers will submit when the â character occurs in an +// application/x-www-form-urlencoded body and the encoding of the page containing +// the form is iso-8859-1, or when the submitted form has an accept-charset +// attribute of iso-8859-1. Presumably also with other charsets that do not contain +// the â character, such as us-ascii. +var isoSentinel = 'utf8=%26%2310003%3B'; // encodeURIComponent('✓') + +// These are the percent-encoded utf-8 octets representing a checkmark, indicating that the request actually is utf-8 encoded. +var charsetSentinel = 'utf8=%E2%9C%93'; // encodeURIComponent('â') + +var parseValues = function parseQueryStringValues(str, options) { + var obj = {}; + var cleanStr = options.ignoreQueryPrefix ? str.replace(/^\?/, '') : str; + var limit = options.parameterLimit === Infinity ? undefined : options.parameterLimit; + var parts = cleanStr.split(options.delimiter, limit); + var skipIndex = -1; // Keep track of where the utf8 sentinel was found + var i; + + var charset = options.charset; + if (options.charsetSentinel) { + for (i = 0; i < parts.length; ++i) { + if (parts[i].indexOf('utf8=') === 0) { + if (parts[i] === charsetSentinel) { + charset = 'utf-8'; + } else if (parts[i] === isoSentinel) { + charset = 'iso-8859-1'; + } + skipIndex = i; + i = parts.length; // The eslint settings do not allow break; + } + } + } + + for (i = 0; i < parts.length; ++i) { + if (i === skipIndex) { + continue; + } + var part = parts[i]; + + var bracketEqualsPos = part.indexOf(']='); + var pos = bracketEqualsPos === -1 ? part.indexOf('=') : bracketEqualsPos + 1; + + var key, val; + if (pos === -1) { + key = options.decoder(part, defaults.decoder, charset); + val = options.strictNullHandling ? null : ''; + } else { + key = options.decoder(part.slice(0, pos), defaults.decoder, charset); + val = options.decoder(part.slice(pos + 1), defaults.decoder, charset); + } + + if (val && options.interpretNumericEntities && charset === 'iso-8859-1') { + val = interpretNumericEntities(val); + } + + if (val && options.comma && val.indexOf(',') > -1) { + val = val.split(','); + } + + if (has.call(obj, key)) { + obj[key] = utils.combine(obj[key], val); + } else { + obj[key] = val; + } + } + + return obj; +}; + +var parseObject = function (chain, val, options) { + var leaf = val; + + for (var i = chain.length - 1; i >= 0; --i) { + var obj; + var root = chain[i]; + + if (root === '[]' && options.parseArrays) { + obj = [].concat(leaf); + } else { + obj = options.plainObjects ? Object.create(null) : {}; + var cleanRoot = root.charAt(0) === '[' && root.charAt(root.length - 1) === ']' ? root.slice(1, -1) : root; + var index = parseInt(cleanRoot, 10); + if (!options.parseArrays && cleanRoot === '') { + obj = { 0: leaf }; + } else if ( + !isNaN(index) + && root !== cleanRoot + && String(index) === cleanRoot + && index >= 0 + && (options.parseArrays && index <= options.arrayLimit) + ) { + obj = []; + obj[index] = leaf; + } else { + obj[cleanRoot] = leaf; + } + } + + leaf = obj; + } + + return leaf; +}; + +var parseKeys = function parseQueryStringKeys(givenKey, val, options) { + if (!givenKey) { + return; + } + + // Transform dot notation to bracket notation + var key = options.allowDots ? givenKey.replace(/\.([^.[]+)/g, '[$1]') : givenKey; + + // The regex chunks + + var brackets = /(\[[^[\]]*])/; + var child = /(\[[^[\]]*])/g; + + // Get the parent + + var segment = brackets.exec(key); + var parent = segment ? key.slice(0, segment.index) : key; + + // Stash the parent if it exists + + var keys = []; + if (parent) { + // If we aren't using plain objects, optionally prefix keys that would overwrite object prototype properties + if (!options.plainObjects && has.call(Object.prototype, parent)) { + if (!options.allowPrototypes) { + return; + } + } + + keys.push(parent); + } + + // Loop through children appending to the array until we hit depth + + var i = 0; + while ((segment = child.exec(key)) !== null && i < options.depth) { + i += 1; + if (!options.plainObjects && has.call(Object.prototype, segment[1].slice(1, -1))) { + if (!options.allowPrototypes) { + return; + } + } + keys.push(segment[1]); + } + + // If there's a remainder, just add whatever is left + + if (segment) { + keys.push('[' + key.slice(segment.index) + ']'); + } + + return parseObject(keys, val, options); +}; + +var normalizeParseOptions = function normalizeParseOptions(opts) { + if (!opts) { + return defaults; + } + + if (opts.decoder !== null && opts.decoder !== undefined && typeof opts.decoder !== 'function') { + throw new TypeError('Decoder has to be a function.'); + } + + if (typeof opts.charset !== 'undefined' && opts.charset !== 'utf-8' && opts.charset !== 'iso-8859-1') { + throw new Error('The charset option must be either utf-8, iso-8859-1, or undefined'); + } + var charset = typeof opts.charset === 'undefined' ? defaults.charset : opts.charset; + + return { + allowDots: typeof opts.allowDots === 'undefined' ? defaults.allowDots : !!opts.allowDots, + allowPrototypes: typeof opts.allowPrototypes === 'boolean' ? opts.allowPrototypes : defaults.allowPrototypes, + arrayLimit: typeof opts.arrayLimit === 'number' ? opts.arrayLimit : defaults.arrayLimit, + charset: charset, + charsetSentinel: typeof opts.charsetSentinel === 'boolean' ? opts.charsetSentinel : defaults.charsetSentinel, + comma: typeof opts.comma === 'boolean' ? opts.comma : defaults.comma, + decoder: typeof opts.decoder === 'function' ? opts.decoder : defaults.decoder, + delimiter: typeof opts.delimiter === 'string' || utils.isRegExp(opts.delimiter) ? opts.delimiter : defaults.delimiter, + depth: typeof opts.depth === 'number' ? opts.depth : defaults.depth, + ignoreQueryPrefix: opts.ignoreQueryPrefix === true, + interpretNumericEntities: typeof opts.interpretNumericEntities === 'boolean' ? opts.interpretNumericEntities : defaults.interpretNumericEntities, + parameterLimit: typeof opts.parameterLimit === 'number' ? opts.parameterLimit : defaults.parameterLimit, + parseArrays: opts.parseArrays !== false, + plainObjects: typeof opts.plainObjects === 'boolean' ? opts.plainObjects : defaults.plainObjects, + strictNullHandling: typeof opts.strictNullHandling === 'boolean' ? opts.strictNullHandling : defaults.strictNullHandling + }; +}; + +module.exports = function (str, opts) { + var options = normalizeParseOptions(opts); + + if (str === '' || str === null || typeof str === 'undefined') { + return options.plainObjects ? Object.create(null) : {}; + } + + var tempObj = typeof str === 'string' ? parseValues(str, options) : str; + var obj = options.plainObjects ? Object.create(null) : {}; + + // Iterate over the keys and setup the new object + + var keys = Object.keys(tempObj); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + var newObj = parseKeys(key, tempObj[key], options); + obj = utils.merge(obj, newObj, options); + } + + return utils.compact(obj); +}; diff --git a/node_modules/qs/lib/stringify.js b/node_modules/qs/lib/stringify.js new file mode 100644 index 0000000..7455049 --- /dev/null +++ b/node_modules/qs/lib/stringify.js @@ -0,0 +1,269 @@ +'use strict'; + +var utils = require('./utils'); +var formats = require('./formats'); +var has = Object.prototype.hasOwnProperty; + +var arrayPrefixGenerators = { + brackets: function brackets(prefix) { // eslint-disable-line func-name-matching + return prefix + '[]'; + }, + comma: 'comma', + indices: function indices(prefix, key) { // eslint-disable-line func-name-matching + return prefix + '[' + key + ']'; + }, + repeat: function repeat(prefix) { // eslint-disable-line func-name-matching + return prefix; + } +}; + +var isArray = Array.isArray; +var push = Array.prototype.push; +var pushToArray = function (arr, valueOrArray) { + push.apply(arr, isArray(valueOrArray) ? valueOrArray : [valueOrArray]); +}; + +var toISO = Date.prototype.toISOString; + +var defaults = { + addQueryPrefix: false, + allowDots: false, + charset: 'utf-8', + charsetSentinel: false, + delimiter: '&', + encode: true, + encoder: utils.encode, + encodeValuesOnly: false, + formatter: formats.formatters[formats['default']], + // deprecated + indices: false, + serializeDate: function serializeDate(date) { // eslint-disable-line func-name-matching + return toISO.call(date); + }, + skipNulls: false, + strictNullHandling: false +}; + +var stringify = function stringify( // eslint-disable-line func-name-matching + object, + prefix, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly, + charset +) { + var obj = object; + if (typeof filter === 'function') { + obj = filter(prefix, obj); + } else if (obj instanceof Date) { + obj = serializeDate(obj); + } else if (generateArrayPrefix === 'comma' && isArray(obj)) { + obj = obj.join(','); + } + + if (obj === null) { + if (strictNullHandling) { + return encoder && !encodeValuesOnly ? encoder(prefix, defaults.encoder, charset) : prefix; + } + + obj = ''; + } + + if (typeof obj === 'string' || typeof obj === 'number' || typeof obj === 'boolean' || utils.isBuffer(obj)) { + if (encoder) { + var keyValue = encodeValuesOnly ? prefix : encoder(prefix, defaults.encoder, charset); + return [formatter(keyValue) + '=' + formatter(encoder(obj, defaults.encoder, charset))]; + } + return [formatter(prefix) + '=' + formatter(String(obj))]; + } + + var values = []; + + if (typeof obj === 'undefined') { + return values; + } + + var objKeys; + if (isArray(filter)) { + objKeys = filter; + } else { + var keys = Object.keys(obj); + objKeys = sort ? keys.sort(sort) : keys; + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + if (isArray(obj)) { + pushToArray(values, stringify( + obj[key], + typeof generateArrayPrefix === 'function' ? generateArrayPrefix(prefix, key) : prefix, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly, + charset + )); + } else { + pushToArray(values, stringify( + obj[key], + prefix + (allowDots ? '.' + key : '[' + key + ']'), + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly, + charset + )); + } + } + + return values; +}; + +var normalizeStringifyOptions = function normalizeStringifyOptions(opts) { + if (!opts) { + return defaults; + } + + if (opts.encoder !== null && opts.encoder !== undefined && typeof opts.encoder !== 'function') { + throw new TypeError('Encoder has to be a function.'); + } + + var charset = opts.charset || defaults.charset; + if (typeof opts.charset !== 'undefined' && opts.charset !== 'utf-8' && opts.charset !== 'iso-8859-1') { + throw new TypeError('The charset option must be either utf-8, iso-8859-1, or undefined'); + } + + var format = formats['default']; + if (typeof opts.format !== 'undefined') { + if (!has.call(formats.formatters, opts.format)) { + throw new TypeError('Unknown format option provided.'); + } + format = opts.format; + } + var formatter = formats.formatters[format]; + + var filter = defaults.filter; + if (typeof opts.filter === 'function' || isArray(opts.filter)) { + filter = opts.filter; + } + + return { + addQueryPrefix: typeof opts.addQueryPrefix === 'boolean' ? opts.addQueryPrefix : defaults.addQueryPrefix, + allowDots: typeof opts.allowDots === 'undefined' ? defaults.allowDots : !!opts.allowDots, + charset: charset, + charsetSentinel: typeof opts.charsetSentinel === 'boolean' ? opts.charsetSentinel : defaults.charsetSentinel, + delimiter: typeof opts.delimiter === 'undefined' ? defaults.delimiter : opts.delimiter, + encode: typeof opts.encode === 'boolean' ? opts.encode : defaults.encode, + encoder: typeof opts.encoder === 'function' ? opts.encoder : defaults.encoder, + encodeValuesOnly: typeof opts.encodeValuesOnly === 'boolean' ? opts.encodeValuesOnly : defaults.encodeValuesOnly, + filter: filter, + formatter: formatter, + serializeDate: typeof opts.serializeDate === 'function' ? opts.serializeDate : defaults.serializeDate, + skipNulls: typeof opts.skipNulls === 'boolean' ? opts.skipNulls : defaults.skipNulls, + sort: typeof opts.sort === 'function' ? opts.sort : null, + strictNullHandling: typeof opts.strictNullHandling === 'boolean' ? opts.strictNullHandling : defaults.strictNullHandling + }; +}; + +module.exports = function (object, opts) { + var obj = object; + var options = normalizeStringifyOptions(opts); + + var objKeys; + var filter; + + if (typeof options.filter === 'function') { + filter = options.filter; + obj = filter('', obj); + } else if (isArray(options.filter)) { + filter = options.filter; + objKeys = filter; + } + + var keys = []; + + if (typeof obj !== 'object' || obj === null) { + return ''; + } + + var arrayFormat; + if (opts && opts.arrayFormat in arrayPrefixGenerators) { + arrayFormat = opts.arrayFormat; + } else if (opts && 'indices' in opts) { + arrayFormat = opts.indices ? 'indices' : 'repeat'; + } else { + arrayFormat = 'indices'; + } + + var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; + + if (!objKeys) { + objKeys = Object.keys(obj); + } + + if (options.sort) { + objKeys.sort(options.sort); + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (options.skipNulls && obj[key] === null) { + continue; + } + pushToArray(keys, stringify( + obj[key], + key, + generateArrayPrefix, + options.strictNullHandling, + options.skipNulls, + options.encode ? options.encoder : null, + options.filter, + options.sort, + options.allowDots, + options.serializeDate, + options.formatter, + options.encodeValuesOnly, + options.charset + )); + } + + var joined = keys.join(options.delimiter); + var prefix = options.addQueryPrefix === true ? '?' : ''; + + if (options.charsetSentinel) { + if (options.charset === 'iso-8859-1') { + // encodeURIComponent('✓'), the "numeric entity" representation of a checkmark + prefix += 'utf8=%26%2310003%3B&'; + } else { + // encodeURIComponent('â') + prefix += 'utf8=%E2%9C%93&'; + } + } + + return joined.length > 0 ? prefix + joined : ''; +}; diff --git a/node_modules/qs/lib/utils.js b/node_modules/qs/lib/utils.js new file mode 100644 index 0000000..1b219cd --- /dev/null +++ b/node_modules/qs/lib/utils.js @@ -0,0 +1,230 @@ +'use strict'; + +var has = Object.prototype.hasOwnProperty; +var isArray = Array.isArray; + +var hexTable = (function () { + var array = []; + for (var i = 0; i < 256; ++i) { + array.push('%' + ((i < 16 ? '0' : '') + i.toString(16)).toUpperCase()); + } + + return array; +}()); + +var compactQueue = function compactQueue(queue) { + while (queue.length > 1) { + var item = queue.pop(); + var obj = item.obj[item.prop]; + + if (isArray(obj)) { + var compacted = []; + + for (var j = 0; j < obj.length; ++j) { + if (typeof obj[j] !== 'undefined') { + compacted.push(obj[j]); + } + } + + item.obj[item.prop] = compacted; + } + } +}; + +var arrayToObject = function arrayToObject(source, options) { + var obj = options && options.plainObjects ? Object.create(null) : {}; + for (var i = 0; i < source.length; ++i) { + if (typeof source[i] !== 'undefined') { + obj[i] = source[i]; + } + } + + return obj; +}; + +var merge = function merge(target, source, options) { + if (!source) { + return target; + } + + if (typeof source !== 'object') { + if (isArray(target)) { + target.push(source); + } else if (target && typeof target === 'object') { + if ((options && (options.plainObjects || options.allowPrototypes)) || !has.call(Object.prototype, source)) { + target[source] = true; + } + } else { + return [target, source]; + } + + return target; + } + + if (!target || typeof target !== 'object') { + return [target].concat(source); + } + + var mergeTarget = target; + if (isArray(target) && !isArray(source)) { + mergeTarget = arrayToObject(target, options); + } + + if (isArray(target) && isArray(source)) { + source.forEach(function (item, i) { + if (has.call(target, i)) { + var targetItem = target[i]; + if (targetItem && typeof targetItem === 'object' && item && typeof item === 'object') { + target[i] = merge(targetItem, item, options); + } else { + target.push(item); + } + } else { + target[i] = item; + } + }); + return target; + } + + return Object.keys(source).reduce(function (acc, key) { + var value = source[key]; + + if (has.call(acc, key)) { + acc[key] = merge(acc[key], value, options); + } else { + acc[key] = value; + } + return acc; + }, mergeTarget); +}; + +var assign = function assignSingleSource(target, source) { + return Object.keys(source).reduce(function (acc, key) { + acc[key] = source[key]; + return acc; + }, target); +}; + +var decode = function (str, decoder, charset) { + var strWithoutPlus = str.replace(/\+/g, ' '); + if (charset === 'iso-8859-1') { + // unescape never throws, no try...catch needed: + return strWithoutPlus.replace(/%[0-9a-f]{2}/gi, unescape); + } + // utf-8 + try { + return decodeURIComponent(strWithoutPlus); + } catch (e) { + return strWithoutPlus; + } +}; + +var encode = function encode(str, defaultEncoder, charset) { + // This code was originally written by Brian White (mscdex) for the io.js core querystring library. + // It has been adapted here for stricter adherence to RFC 3986 + if (str.length === 0) { + return str; + } + + var string = typeof str === 'string' ? str : String(str); + + if (charset === 'iso-8859-1') { + return escape(string).replace(/%u[0-9a-f]{4}/gi, function ($0) { + return '%26%23' + parseInt($0.slice(2), 16) + '%3B'; + }); + } + + var out = ''; + for (var i = 0; i < string.length; ++i) { + var c = string.charCodeAt(i); + + if ( + c === 0x2D // - + || c === 0x2E // . + || c === 0x5F // _ + || c === 0x7E // ~ + || (c >= 0x30 && c <= 0x39) // 0-9 + || (c >= 0x41 && c <= 0x5A) // a-z + || (c >= 0x61 && c <= 0x7A) // A-Z + ) { + out += string.charAt(i); + continue; + } + + if (c < 0x80) { + out = out + hexTable[c]; + continue; + } + + if (c < 0x800) { + out = out + (hexTable[0xC0 | (c >> 6)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + if (c < 0xD800 || c >= 0xE000) { + out = out + (hexTable[0xE0 | (c >> 12)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + + i += 1; + c = 0x10000 + (((c & 0x3FF) << 10) | (string.charCodeAt(i) & 0x3FF)); + out += hexTable[0xF0 | (c >> 18)] + + hexTable[0x80 | ((c >> 12) & 0x3F)] + + hexTable[0x80 | ((c >> 6) & 0x3F)] + + hexTable[0x80 | (c & 0x3F)]; + } + + return out; +}; + +var compact = function compact(value) { + var queue = [{ obj: { o: value }, prop: 'o' }]; + var refs = []; + + for (var i = 0; i < queue.length; ++i) { + var item = queue[i]; + var obj = item.obj[item.prop]; + + var keys = Object.keys(obj); + for (var j = 0; j < keys.length; ++j) { + var key = keys[j]; + var val = obj[key]; + if (typeof val === 'object' && val !== null && refs.indexOf(val) === -1) { + queue.push({ obj: obj, prop: key }); + refs.push(val); + } + } + } + + compactQueue(queue); + + return value; +}; + +var isRegExp = function isRegExp(obj) { + return Object.prototype.toString.call(obj) === '[object RegExp]'; +}; + +var isBuffer = function isBuffer(obj) { + if (!obj || typeof obj !== 'object') { + return false; + } + + return !!(obj.constructor && obj.constructor.isBuffer && obj.constructor.isBuffer(obj)); +}; + +var combine = function combine(a, b) { + return [].concat(a, b); +}; + +module.exports = { + arrayToObject: arrayToObject, + assign: assign, + combine: combine, + compact: compact, + decode: decode, + encode: encode, + isBuffer: isBuffer, + isRegExp: isRegExp, + merge: merge +}; diff --git a/node_modules/qs/package.json b/node_modules/qs/package.json new file mode 100644 index 0000000..4ce3cda --- /dev/null +++ b/node_modules/qs/package.json @@ -0,0 +1,87 @@ +{ + "_from": "qs@6.7.0", + "_id": "qs@6.7.0", + "_inBundle": false, + "_integrity": "sha512-VCdBRNFTX1fyE7Nb6FYoURo/SPe62QCaAyzJvUjwRaIsc+NePBEniHlvxFmmX56+HZphIGtV0XeCirBtpDrTyQ==", + "_location": "/qs", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "qs@6.7.0", + "name": "qs", + "escapedName": "qs", + "rawSpec": "6.7.0", + "saveSpec": null, + "fetchSpec": "6.7.0" + }, + "_requiredBy": [ + "/body-parser", + "/express" + ], + "_resolved": "https://registry.npmjs.org/qs/-/qs-6.7.0.tgz", + "_shasum": "41dc1a015e3d581f1621776be31afb2876a9b1bc", + "_spec": "qs@6.7.0", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "bugs": { + "url": "https://github.com/ljharb/qs/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Jordan Harband", + "email": "ljharb@gmail.com", + "url": "http://ljharb.codes" + } + ], + "dependencies": {}, + "deprecated": false, + "description": "A querystring parser that supports nesting and arrays, with a depth limit", + "devDependencies": { + "@ljharb/eslint-config": "^13.1.1", + "browserify": "^16.2.3", + "covert": "^1.1.1", + "editorconfig-tools": "^0.1.1", + "eslint": "^5.15.3", + "evalmd": "^0.0.17", + "for-each": "^0.3.3", + "iconv-lite": "^0.4.24", + "mkdirp": "^0.5.1", + "object-inspect": "^1.6.0", + "qs-iconv": "^1.0.4", + "safe-publish-latest": "^1.1.2", + "safer-buffer": "^2.1.2", + "tape": "^4.10.1" + }, + "engines": { + "node": ">=0.6" + }, + "homepage": "https://github.com/ljharb/qs", + "keywords": [ + "querystring", + "qs", + "query", + "url", + "parse", + "stringify" + ], + "license": "BSD-3-Clause", + "main": "lib/index.js", + "name": "qs", + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/qs.git" + }, + "scripts": { + "coverage": "covert test", + "dist": "mkdirp dist && browserify --standalone Qs lib/index.js > dist/qs.js", + "lint": "eslint lib/*.js test/*.js", + "postlint": "editorconfig-tools check * lib/* test/*", + "prepublish": "safe-publish-latest && npm run dist", + "pretest": "npm run --silent readme && npm run --silent lint", + "readme": "evalmd README.md", + "test": "npm run --silent coverage", + "tests-only": "node test" + }, + "version": "6.7.0" +} diff --git a/node_modules/qs/test/.eslintrc b/node_modules/qs/test/.eslintrc new file mode 100644 index 0000000..9ebbb92 --- /dev/null +++ b/node_modules/qs/test/.eslintrc @@ -0,0 +1,17 @@ +{ + "rules": { + "array-bracket-newline": 0, + "array-element-newline": 0, + "consistent-return": 2, + "function-paren-newline": 0, + "max-lines": 0, + "max-lines-per-function": 0, + "max-nested-callbacks": [2, 3], + "max-statements": 0, + "no-buffer-constructor": 0, + "no-extend-native": 0, + "no-magic-numbers": 0, + "object-curly-newline": 0, + "sort-keys": 0 + } +} diff --git a/node_modules/qs/test/index.js b/node_modules/qs/test/index.js new file mode 100644 index 0000000..5e6bc8f --- /dev/null +++ b/node_modules/qs/test/index.js @@ -0,0 +1,7 @@ +'use strict'; + +require('./parse'); + +require('./stringify'); + +require('./utils'); diff --git a/node_modules/qs/test/parse.js b/node_modules/qs/test/parse.js new file mode 100644 index 0000000..8967789 --- /dev/null +++ b/node_modules/qs/test/parse.js @@ -0,0 +1,676 @@ +'use strict'; + +var test = require('tape'); +var qs = require('../'); +var utils = require('../lib/utils'); +var iconv = require('iconv-lite'); +var SaferBuffer = require('safer-buffer').Buffer; + +test('parse()', function (t) { + t.test('parses a simple string', function (st) { + st.deepEqual(qs.parse('0=foo'), { 0: 'foo' }); + st.deepEqual(qs.parse('foo=c++'), { foo: 'c ' }); + st.deepEqual(qs.parse('a[>=]=23'), { a: { '>=': '23' } }); + st.deepEqual(qs.parse('a[<=>]==23'), { a: { '<=>': '=23' } }); + st.deepEqual(qs.parse('a[==]=23'), { a: { '==': '23' } }); + st.deepEqual(qs.parse('foo', { strictNullHandling: true }), { foo: null }); + st.deepEqual(qs.parse('foo'), { foo: '' }); + st.deepEqual(qs.parse('foo='), { foo: '' }); + st.deepEqual(qs.parse('foo=bar'), { foo: 'bar' }); + st.deepEqual(qs.parse(' foo = bar = baz '), { ' foo ': ' bar = baz ' }); + st.deepEqual(qs.parse('foo=bar=baz'), { foo: 'bar=baz' }); + st.deepEqual(qs.parse('foo=bar&bar=baz'), { foo: 'bar', bar: 'baz' }); + st.deepEqual(qs.parse('foo2=bar2&baz2='), { foo2: 'bar2', baz2: '' }); + st.deepEqual(qs.parse('foo=bar&baz', { strictNullHandling: true }), { foo: 'bar', baz: null }); + st.deepEqual(qs.parse('foo=bar&baz'), { foo: 'bar', baz: '' }); + st.deepEqual(qs.parse('cht=p3&chd=t:60,40&chs=250x100&chl=Hello|World'), { + cht: 'p3', + chd: 't:60,40', + chs: '250x100', + chl: 'Hello|World' + }); + st.end(); + }); + + t.test('allows enabling dot notation', function (st) { + st.deepEqual(qs.parse('a.b=c'), { 'a.b': 'c' }); + st.deepEqual(qs.parse('a.b=c', { allowDots: true }), { a: { b: 'c' } }); + st.end(); + }); + + t.deepEqual(qs.parse('a[b]=c'), { a: { b: 'c' } }, 'parses a single nested string'); + t.deepEqual(qs.parse('a[b][c]=d'), { a: { b: { c: 'd' } } }, 'parses a double nested string'); + t.deepEqual( + qs.parse('a[b][c][d][e][f][g][h]=i'), + { a: { b: { c: { d: { e: { f: { '[g][h]': 'i' } } } } } } }, + 'defaults to a depth of 5' + ); + + t.test('only parses one level when depth = 1', function (st) { + st.deepEqual(qs.parse('a[b][c]=d', { depth: 1 }), { a: { b: { '[c]': 'd' } } }); + st.deepEqual(qs.parse('a[b][c][d]=e', { depth: 1 }), { a: { b: { '[c][d]': 'e' } } }); + st.end(); + }); + + t.deepEqual(qs.parse('a=b&a=c'), { a: ['b', 'c'] }, 'parses a simple array'); + + t.test('parses an explicit array', function (st) { + st.deepEqual(qs.parse('a[]=b'), { a: ['b'] }); + st.deepEqual(qs.parse('a[]=b&a[]=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[]=b&a[]=c&a[]=d'), { a: ['b', 'c', 'd'] }); + st.end(); + }); + + t.test('parses a mix of simple and explicit arrays', function (st) { + st.deepEqual(qs.parse('a=b&a[]=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[]=b&a=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[0]=b&a=c'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a=b&a[0]=c'), { a: ['b', 'c'] }); + + st.deepEqual(qs.parse('a[1]=b&a=c', { arrayLimit: 20 }), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[]=b&a=c', { arrayLimit: 0 }), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[]=b&a=c'), { a: ['b', 'c'] }); + + st.deepEqual(qs.parse('a=b&a[1]=c', { arrayLimit: 20 }), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a=b&a[]=c', { arrayLimit: 0 }), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a=b&a[]=c'), { a: ['b', 'c'] }); + + st.end(); + }); + + t.test('parses a nested array', function (st) { + st.deepEqual(qs.parse('a[b][]=c&a[b][]=d'), { a: { b: ['c', 'd'] } }); + st.deepEqual(qs.parse('a[>=]=25'), { a: { '>=': '25' } }); + st.end(); + }); + + t.test('allows to specify array indices', function (st) { + st.deepEqual(qs.parse('a[1]=c&a[0]=b&a[2]=d'), { a: ['b', 'c', 'd'] }); + st.deepEqual(qs.parse('a[1]=c&a[0]=b'), { a: ['b', 'c'] }); + st.deepEqual(qs.parse('a[1]=c', { arrayLimit: 20 }), { a: ['c'] }); + st.deepEqual(qs.parse('a[1]=c', { arrayLimit: 0 }), { a: { 1: 'c' } }); + st.deepEqual(qs.parse('a[1]=c'), { a: ['c'] }); + st.end(); + }); + + t.test('limits specific array indices to arrayLimit', function (st) { + st.deepEqual(qs.parse('a[20]=a', { arrayLimit: 20 }), { a: ['a'] }); + st.deepEqual(qs.parse('a[21]=a', { arrayLimit: 20 }), { a: { 21: 'a' } }); + st.end(); + }); + + t.deepEqual(qs.parse('a[12b]=c'), { a: { '12b': 'c' } }, 'supports keys that begin with a number'); + + t.test('supports encoded = signs', function (st) { + st.deepEqual(qs.parse('he%3Dllo=th%3Dere'), { 'he=llo': 'th=ere' }); + st.end(); + }); + + t.test('is ok with url encoded strings', function (st) { + st.deepEqual(qs.parse('a[b%20c]=d'), { a: { 'b c': 'd' } }); + st.deepEqual(qs.parse('a[b]=c%20d'), { a: { b: 'c d' } }); + st.end(); + }); + + t.test('allows brackets in the value', function (st) { + st.deepEqual(qs.parse('pets=["tobi"]'), { pets: '["tobi"]' }); + st.deepEqual(qs.parse('operators=[">=", "<="]'), { operators: '[">=", "<="]' }); + st.end(); + }); + + t.test('allows empty values', function (st) { + st.deepEqual(qs.parse(''), {}); + st.deepEqual(qs.parse(null), {}); + st.deepEqual(qs.parse(undefined), {}); + st.end(); + }); + + t.test('transforms arrays to objects', function (st) { + st.deepEqual(qs.parse('foo[0]=bar&foo[bad]=baz'), { foo: { 0: 'bar', bad: 'baz' } }); + st.deepEqual(qs.parse('foo[bad]=baz&foo[0]=bar'), { foo: { bad: 'baz', 0: 'bar' } }); + st.deepEqual(qs.parse('foo[bad]=baz&foo[]=bar'), { foo: { bad: 'baz', 0: 'bar' } }); + st.deepEqual(qs.parse('foo[]=bar&foo[bad]=baz'), { foo: { 0: 'bar', bad: 'baz' } }); + st.deepEqual(qs.parse('foo[bad]=baz&foo[]=bar&foo[]=foo'), { foo: { bad: 'baz', 0: 'bar', 1: 'foo' } }); + st.deepEqual(qs.parse('foo[0][a]=a&foo[0][b]=b&foo[1][a]=aa&foo[1][b]=bb'), { foo: [{ a: 'a', b: 'b' }, { a: 'aa', b: 'bb' }] }); + + st.deepEqual(qs.parse('a[]=b&a[t]=u&a[hasOwnProperty]=c', { allowPrototypes: false }), { a: { 0: 'b', t: 'u' } }); + st.deepEqual(qs.parse('a[]=b&a[t]=u&a[hasOwnProperty]=c', { allowPrototypes: true }), { a: { 0: 'b', t: 'u', hasOwnProperty: 'c' } }); + st.deepEqual(qs.parse('a[]=b&a[hasOwnProperty]=c&a[x]=y', { allowPrototypes: false }), { a: { 0: 'b', x: 'y' } }); + st.deepEqual(qs.parse('a[]=b&a[hasOwnProperty]=c&a[x]=y', { allowPrototypes: true }), { a: { 0: 'b', hasOwnProperty: 'c', x: 'y' } }); + st.end(); + }); + + t.test('transforms arrays to objects (dot notation)', function (st) { + st.deepEqual(qs.parse('foo[0].baz=bar&fool.bad=baz', { allowDots: true }), { foo: [{ baz: 'bar' }], fool: { bad: 'baz' } }); + st.deepEqual(qs.parse('foo[0].baz=bar&fool.bad.boo=baz', { allowDots: true }), { foo: [{ baz: 'bar' }], fool: { bad: { boo: 'baz' } } }); + st.deepEqual(qs.parse('foo[0][0].baz=bar&fool.bad=baz', { allowDots: true }), { foo: [[{ baz: 'bar' }]], fool: { bad: 'baz' } }); + st.deepEqual(qs.parse('foo[0].baz[0]=15&foo[0].bar=2', { allowDots: true }), { foo: [{ baz: ['15'], bar: '2' }] }); + st.deepEqual(qs.parse('foo[0].baz[0]=15&foo[0].baz[1]=16&foo[0].bar=2', { allowDots: true }), { foo: [{ baz: ['15', '16'], bar: '2' }] }); + st.deepEqual(qs.parse('foo.bad=baz&foo[0]=bar', { allowDots: true }), { foo: { bad: 'baz', 0: 'bar' } }); + st.deepEqual(qs.parse('foo.bad=baz&foo[]=bar', { allowDots: true }), { foo: { bad: 'baz', 0: 'bar' } }); + st.deepEqual(qs.parse('foo[]=bar&foo.bad=baz', { allowDots: true }), { foo: { 0: 'bar', bad: 'baz' } }); + st.deepEqual(qs.parse('foo.bad=baz&foo[]=bar&foo[]=foo', { allowDots: true }), { foo: { bad: 'baz', 0: 'bar', 1: 'foo' } }); + st.deepEqual(qs.parse('foo[0].a=a&foo[0].b=b&foo[1].a=aa&foo[1].b=bb', { allowDots: true }), { foo: [{ a: 'a', b: 'b' }, { a: 'aa', b: 'bb' }] }); + st.end(); + }); + + t.test('correctly prunes undefined values when converting an array to an object', function (st) { + st.deepEqual(qs.parse('a[2]=b&a[99999999]=c'), { a: { 2: 'b', 99999999: 'c' } }); + st.end(); + }); + + t.test('supports malformed uri characters', function (st) { + st.deepEqual(qs.parse('{%:%}', { strictNullHandling: true }), { '{%:%}': null }); + st.deepEqual(qs.parse('{%:%}='), { '{%:%}': '' }); + st.deepEqual(qs.parse('foo=%:%}'), { foo: '%:%}' }); + st.end(); + }); + + t.test('doesn\'t produce empty keys', function (st) { + st.deepEqual(qs.parse('_r=1&'), { _r: '1' }); + st.end(); + }); + + t.test('cannot access Object prototype', function (st) { + qs.parse('constructor[prototype][bad]=bad'); + qs.parse('bad[constructor][prototype][bad]=bad'); + st.equal(typeof Object.prototype.bad, 'undefined'); + st.end(); + }); + + t.test('parses arrays of objects', function (st) { + st.deepEqual(qs.parse('a[][b]=c'), { a: [{ b: 'c' }] }); + st.deepEqual(qs.parse('a[0][b]=c'), { a: [{ b: 'c' }] }); + st.end(); + }); + + t.test('allows for empty strings in arrays', function (st) { + st.deepEqual(qs.parse('a[]=b&a[]=&a[]=c'), { a: ['b', '', 'c'] }); + + st.deepEqual( + qs.parse('a[0]=b&a[1]&a[2]=c&a[19]=', { strictNullHandling: true, arrayLimit: 20 }), + { a: ['b', null, 'c', ''] }, + 'with arrayLimit 20 + array indices: null then empty string works' + ); + st.deepEqual( + qs.parse('a[]=b&a[]&a[]=c&a[]=', { strictNullHandling: true, arrayLimit: 0 }), + { a: ['b', null, 'c', ''] }, + 'with arrayLimit 0 + array brackets: null then empty string works' + ); + + st.deepEqual( + qs.parse('a[0]=b&a[1]=&a[2]=c&a[19]', { strictNullHandling: true, arrayLimit: 20 }), + { a: ['b', '', 'c', null] }, + 'with arrayLimit 20 + array indices: empty string then null works' + ); + st.deepEqual( + qs.parse('a[]=b&a[]=&a[]=c&a[]', { strictNullHandling: true, arrayLimit: 0 }), + { a: ['b', '', 'c', null] }, + 'with arrayLimit 0 + array brackets: empty string then null works' + ); + + st.deepEqual( + qs.parse('a[]=&a[]=b&a[]=c'), + { a: ['', 'b', 'c'] }, + 'array brackets: empty strings work' + ); + st.end(); + }); + + t.test('compacts sparse arrays', function (st) { + st.deepEqual(qs.parse('a[10]=1&a[2]=2', { arrayLimit: 20 }), { a: ['2', '1'] }); + st.deepEqual(qs.parse('a[1][b][2][c]=1', { arrayLimit: 20 }), { a: [{ b: [{ c: '1' }] }] }); + st.deepEqual(qs.parse('a[1][2][3][c]=1', { arrayLimit: 20 }), { a: [[[{ c: '1' }]]] }); + st.deepEqual(qs.parse('a[1][2][3][c][1]=1', { arrayLimit: 20 }), { a: [[[{ c: ['1'] }]]] }); + st.end(); + }); + + t.test('parses semi-parsed strings', function (st) { + st.deepEqual(qs.parse({ 'a[b]': 'c' }), { a: { b: 'c' } }); + st.deepEqual(qs.parse({ 'a[b]': 'c', 'a[d]': 'e' }), { a: { b: 'c', d: 'e' } }); + st.end(); + }); + + t.test('parses buffers correctly', function (st) { + var b = SaferBuffer.from('test'); + st.deepEqual(qs.parse({ a: b }), { a: b }); + st.end(); + }); + + t.test('parses jquery-param strings', function (st) { + // readable = 'filter[0][]=int1&filter[0][]==&filter[0][]=77&filter[]=and&filter[2][]=int2&filter[2][]==&filter[2][]=8' + var encoded = 'filter%5B0%5D%5B%5D=int1&filter%5B0%5D%5B%5D=%3D&filter%5B0%5D%5B%5D=77&filter%5B%5D=and&filter%5B2%5D%5B%5D=int2&filter%5B2%5D%5B%5D=%3D&filter%5B2%5D%5B%5D=8'; + var expected = { filter: [['int1', '=', '77'], 'and', ['int2', '=', '8']] }; + st.deepEqual(qs.parse(encoded), expected); + st.end(); + }); + + t.test('continues parsing when no parent is found', function (st) { + st.deepEqual(qs.parse('[]=&a=b'), { 0: '', a: 'b' }); + st.deepEqual(qs.parse('[]&a=b', { strictNullHandling: true }), { 0: null, a: 'b' }); + st.deepEqual(qs.parse('[foo]=bar'), { foo: 'bar' }); + st.end(); + }); + + t.test('does not error when parsing a very long array', function (st) { + var str = 'a[]=a'; + while (Buffer.byteLength(str) < 128 * 1024) { + str = str + '&' + str; + } + + st.doesNotThrow(function () { + qs.parse(str); + }); + + st.end(); + }); + + t.test('should not throw when a native prototype has an enumerable property', function (st) { + Object.prototype.crash = ''; + Array.prototype.crash = ''; + st.doesNotThrow(qs.parse.bind(null, 'a=b')); + st.deepEqual(qs.parse('a=b'), { a: 'b' }); + st.doesNotThrow(qs.parse.bind(null, 'a[][b]=c')); + st.deepEqual(qs.parse('a[][b]=c'), { a: [{ b: 'c' }] }); + delete Object.prototype.crash; + delete Array.prototype.crash; + st.end(); + }); + + t.test('parses a string with an alternative string delimiter', function (st) { + st.deepEqual(qs.parse('a=b;c=d', { delimiter: ';' }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('parses a string with an alternative RegExp delimiter', function (st) { + st.deepEqual(qs.parse('a=b; c=d', { delimiter: /[;,] */ }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('does not use non-splittable objects as delimiters', function (st) { + st.deepEqual(qs.parse('a=b&c=d', { delimiter: true }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('allows overriding parameter limit', function (st) { + st.deepEqual(qs.parse('a=b&c=d', { parameterLimit: 1 }), { a: 'b' }); + st.end(); + }); + + t.test('allows setting the parameter limit to Infinity', function (st) { + st.deepEqual(qs.parse('a=b&c=d', { parameterLimit: Infinity }), { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('allows overriding array limit', function (st) { + st.deepEqual(qs.parse('a[0]=b', { arrayLimit: -1 }), { a: { 0: 'b' } }); + st.deepEqual(qs.parse('a[-1]=b', { arrayLimit: -1 }), { a: { '-1': 'b' } }); + st.deepEqual(qs.parse('a[0]=b&a[1]=c', { arrayLimit: 0 }), { a: { 0: 'b', 1: 'c' } }); + st.end(); + }); + + t.test('allows disabling array parsing', function (st) { + var indices = qs.parse('a[0]=b&a[1]=c', { parseArrays: false }); + st.deepEqual(indices, { a: { 0: 'b', 1: 'c' } }); + st.equal(Array.isArray(indices.a), false, 'parseArrays:false, indices case is not an array'); + + var emptyBrackets = qs.parse('a[]=b', { parseArrays: false }); + st.deepEqual(emptyBrackets, { a: { 0: 'b' } }); + st.equal(Array.isArray(emptyBrackets.a), false, 'parseArrays:false, empty brackets case is not an array'); + + st.end(); + }); + + t.test('allows for query string prefix', function (st) { + st.deepEqual(qs.parse('?foo=bar', { ignoreQueryPrefix: true }), { foo: 'bar' }); + st.deepEqual(qs.parse('foo=bar', { ignoreQueryPrefix: true }), { foo: 'bar' }); + st.deepEqual(qs.parse('?foo=bar', { ignoreQueryPrefix: false }), { '?foo': 'bar' }); + st.end(); + }); + + t.test('parses an object', function (st) { + var input = { + 'user[name]': { 'pop[bob]': 3 }, + 'user[email]': null + }; + + var expected = { + user: { + name: { 'pop[bob]': 3 }, + email: null + } + }; + + var result = qs.parse(input); + + st.deepEqual(result, expected); + st.end(); + }); + + t.test('parses string with comma as array divider', function (st) { + st.deepEqual(qs.parse('foo=bar,tee', { comma: true }), { foo: ['bar', 'tee'] }); + st.deepEqual(qs.parse('foo[bar]=coffee,tee', { comma: true }), { foo: { bar: ['coffee', 'tee'] } }); + st.deepEqual(qs.parse('foo=', { comma: true }), { foo: '' }); + st.deepEqual(qs.parse('foo', { comma: true }), { foo: '' }); + st.deepEqual(qs.parse('foo', { comma: true, strictNullHandling: true }), { foo: null }); + st.end(); + }); + + t.test('parses an object in dot notation', function (st) { + var input = { + 'user.name': { 'pop[bob]': 3 }, + 'user.email.': null + }; + + var expected = { + user: { + name: { 'pop[bob]': 3 }, + email: null + } + }; + + var result = qs.parse(input, { allowDots: true }); + + st.deepEqual(result, expected); + st.end(); + }); + + t.test('parses an object and not child values', function (st) { + var input = { + 'user[name]': { 'pop[bob]': { test: 3 } }, + 'user[email]': null + }; + + var expected = { + user: { + name: { 'pop[bob]': { test: 3 } }, + email: null + } + }; + + var result = qs.parse(input); + + st.deepEqual(result, expected); + st.end(); + }); + + t.test('does not blow up when Buffer global is missing', function (st) { + var tempBuffer = global.Buffer; + delete global.Buffer; + var result = qs.parse('a=b&c=d'); + global.Buffer = tempBuffer; + st.deepEqual(result, { a: 'b', c: 'd' }); + st.end(); + }); + + t.test('does not crash when parsing circular references', function (st) { + var a = {}; + a.b = a; + + var parsed; + + st.doesNotThrow(function () { + parsed = qs.parse({ 'foo[bar]': 'baz', 'foo[baz]': a }); + }); + + st.equal('foo' in parsed, true, 'parsed has "foo" property'); + st.equal('bar' in parsed.foo, true); + st.equal('baz' in parsed.foo, true); + st.equal(parsed.foo.bar, 'baz'); + st.deepEqual(parsed.foo.baz, a); + st.end(); + }); + + t.test('does not crash when parsing deep objects', function (st) { + var parsed; + var str = 'foo'; + + for (var i = 0; i < 5000; i++) { + str += '[p]'; + } + + str += '=bar'; + + st.doesNotThrow(function () { + parsed = qs.parse(str, { depth: 5000 }); + }); + + st.equal('foo' in parsed, true, 'parsed has "foo" property'); + + var depth = 0; + var ref = parsed.foo; + while ((ref = ref.p)) { + depth += 1; + } + + st.equal(depth, 5000, 'parsed is 5000 properties deep'); + + st.end(); + }); + + t.test('parses null objects correctly', { skip: !Object.create }, function (st) { + var a = Object.create(null); + a.b = 'c'; + + st.deepEqual(qs.parse(a), { b: 'c' }); + var result = qs.parse({ a: a }); + st.equal('a' in result, true, 'result has "a" property'); + st.deepEqual(result.a, a); + st.end(); + }); + + t.test('parses dates correctly', function (st) { + var now = new Date(); + st.deepEqual(qs.parse({ a: now }), { a: now }); + st.end(); + }); + + t.test('parses regular expressions correctly', function (st) { + var re = /^test$/; + st.deepEqual(qs.parse({ a: re }), { a: re }); + st.end(); + }); + + t.test('does not allow overwriting prototype properties', function (st) { + st.deepEqual(qs.parse('a[hasOwnProperty]=b', { allowPrototypes: false }), {}); + st.deepEqual(qs.parse('hasOwnProperty=b', { allowPrototypes: false }), {}); + + st.deepEqual( + qs.parse('toString', { allowPrototypes: false }), + {}, + 'bare "toString" results in {}' + ); + + st.end(); + }); + + t.test('can allow overwriting prototype properties', function (st) { + st.deepEqual(qs.parse('a[hasOwnProperty]=b', { allowPrototypes: true }), { a: { hasOwnProperty: 'b' } }); + st.deepEqual(qs.parse('hasOwnProperty=b', { allowPrototypes: true }), { hasOwnProperty: 'b' }); + + st.deepEqual( + qs.parse('toString', { allowPrototypes: true }), + { toString: '' }, + 'bare "toString" results in { toString: "" }' + ); + + st.end(); + }); + + t.test('params starting with a closing bracket', function (st) { + st.deepEqual(qs.parse(']=toString'), { ']': 'toString' }); + st.deepEqual(qs.parse(']]=toString'), { ']]': 'toString' }); + st.deepEqual(qs.parse(']hello]=toString'), { ']hello]': 'toString' }); + st.end(); + }); + + t.test('params starting with a starting bracket', function (st) { + st.deepEqual(qs.parse('[=toString'), { '[': 'toString' }); + st.deepEqual(qs.parse('[[=toString'), { '[[': 'toString' }); + st.deepEqual(qs.parse('[hello[=toString'), { '[hello[': 'toString' }); + st.end(); + }); + + t.test('add keys to objects', function (st) { + st.deepEqual( + qs.parse('a[b]=c&a=d'), + { a: { b: 'c', d: true } }, + 'can add keys to objects' + ); + + st.deepEqual( + qs.parse('a[b]=c&a=toString'), + { a: { b: 'c' } }, + 'can not overwrite prototype' + ); + + st.deepEqual( + qs.parse('a[b]=c&a=toString', { allowPrototypes: true }), + { a: { b: 'c', toString: true } }, + 'can overwrite prototype with allowPrototypes true' + ); + + st.deepEqual( + qs.parse('a[b]=c&a=toString', { plainObjects: true }), + { a: { b: 'c', toString: true } }, + 'can overwrite prototype with plainObjects true' + ); + + st.end(); + }); + + t.test('can return null objects', { skip: !Object.create }, function (st) { + var expected = Object.create(null); + expected.a = Object.create(null); + expected.a.b = 'c'; + expected.a.hasOwnProperty = 'd'; + st.deepEqual(qs.parse('a[b]=c&a[hasOwnProperty]=d', { plainObjects: true }), expected); + st.deepEqual(qs.parse(null, { plainObjects: true }), Object.create(null)); + var expectedArray = Object.create(null); + expectedArray.a = Object.create(null); + expectedArray.a[0] = 'b'; + expectedArray.a.c = 'd'; + st.deepEqual(qs.parse('a[]=b&a[c]=d', { plainObjects: true }), expectedArray); + st.end(); + }); + + t.test('can parse with custom encoding', function (st) { + st.deepEqual(qs.parse('%8c%a7=%91%e5%8d%e3%95%7b', { + decoder: function (str) { + var reg = /%([0-9A-F]{2})/ig; + var result = []; + var parts = reg.exec(str); + while (parts) { + result.push(parseInt(parts[1], 16)); + parts = reg.exec(str); + } + return String(iconv.decode(SaferBuffer.from(result), 'shift_jis')); + } + }), { ç: '大éªåº' }); + st.end(); + }); + + t.test('receives the default decoder as a second argument', function (st) { + st.plan(1); + qs.parse('a', { + decoder: function (str, defaultDecoder) { + st.equal(defaultDecoder, utils.decode); + } + }); + st.end(); + }); + + t.test('throws error with wrong decoder', function (st) { + st['throws'](function () { + qs.parse({}, { decoder: 'string' }); + }, new TypeError('Decoder has to be a function.')); + st.end(); + }); + + t.test('does not mutate the options argument', function (st) { + var options = {}; + qs.parse('a[b]=true', options); + st.deepEqual(options, {}); + st.end(); + }); + + t.test('throws if an invalid charset is specified', function (st) { + st['throws'](function () { + qs.parse('a=b', { charset: 'foobar' }); + }, new TypeError('The charset option must be either utf-8, iso-8859-1, or undefined')); + st.end(); + }); + + t.test('parses an iso-8859-1 string if asked to', function (st) { + st.deepEqual(qs.parse('%A2=%BD', { charset: 'iso-8859-1' }), { '¢': '½' }); + st.end(); + }); + + var urlEncodedCheckmarkInUtf8 = '%E2%9C%93'; + var urlEncodedOSlashInUtf8 = '%C3%B8'; + var urlEncodedNumCheckmark = '%26%2310003%3B'; + var urlEncodedNumSmiley = '%26%239786%3B'; + + t.test('prefers an utf-8 charset specified by the utf8 sentinel to a default charset of iso-8859-1', function (st) { + st.deepEqual(qs.parse('utf8=' + urlEncodedCheckmarkInUtf8 + '&' + urlEncodedOSlashInUtf8 + '=' + urlEncodedOSlashInUtf8, { charsetSentinel: true, charset: 'iso-8859-1' }), { ø: 'ø' }); + st.end(); + }); + + t.test('prefers an iso-8859-1 charset specified by the utf8 sentinel to a default charset of utf-8', function (st) { + st.deepEqual(qs.parse('utf8=' + urlEncodedNumCheckmark + '&' + urlEncodedOSlashInUtf8 + '=' + urlEncodedOSlashInUtf8, { charsetSentinel: true, charset: 'utf-8' }), { 'ø': 'ø' }); + st.end(); + }); + + t.test('does not require the utf8 sentinel to be defined before the parameters whose decoding it affects', function (st) { + st.deepEqual(qs.parse('a=' + urlEncodedOSlashInUtf8 + '&utf8=' + urlEncodedNumCheckmark, { charsetSentinel: true, charset: 'utf-8' }), { a: 'ø' }); + st.end(); + }); + + t.test('should ignore an utf8 sentinel with an unknown value', function (st) { + st.deepEqual(qs.parse('utf8=foo&' + urlEncodedOSlashInUtf8 + '=' + urlEncodedOSlashInUtf8, { charsetSentinel: true, charset: 'utf-8' }), { ø: 'ø' }); + st.end(); + }); + + t.test('uses the utf8 sentinel to switch to utf-8 when no default charset is given', function (st) { + st.deepEqual(qs.parse('utf8=' + urlEncodedCheckmarkInUtf8 + '&' + urlEncodedOSlashInUtf8 + '=' + urlEncodedOSlashInUtf8, { charsetSentinel: true }), { ø: 'ø' }); + st.end(); + }); + + t.test('uses the utf8 sentinel to switch to iso-8859-1 when no default charset is given', function (st) { + st.deepEqual(qs.parse('utf8=' + urlEncodedNumCheckmark + '&' + urlEncodedOSlashInUtf8 + '=' + urlEncodedOSlashInUtf8, { charsetSentinel: true }), { 'ø': 'ø' }); + st.end(); + }); + + t.test('interprets numeric entities in iso-8859-1 when `interpretNumericEntities`', function (st) { + st.deepEqual(qs.parse('foo=' + urlEncodedNumSmiley, { charset: 'iso-8859-1', interpretNumericEntities: true }), { foo: 'âº' }); + st.end(); + }); + + t.test('handles a custom decoder returning `null`, in the `iso-8859-1` charset, when `interpretNumericEntities`', function (st) { + st.deepEqual(qs.parse('foo=&bar=' + urlEncodedNumSmiley, { + charset: 'iso-8859-1', + decoder: function (str, defaultDecoder, charset) { + return str ? defaultDecoder(str, defaultDecoder, charset) : null; + }, + interpretNumericEntities: true + }), { foo: null, bar: 'âº' }); + st.end(); + }); + + t.test('does not interpret numeric entities in iso-8859-1 when `interpretNumericEntities` is absent', function (st) { + st.deepEqual(qs.parse('foo=' + urlEncodedNumSmiley, { charset: 'iso-8859-1' }), { foo: '☺' }); + st.end(); + }); + + t.test('does not interpret numeric entities when the charset is utf-8, even when `interpretNumericEntities`', function (st) { + st.deepEqual(qs.parse('foo=' + urlEncodedNumSmiley, { charset: 'utf-8', interpretNumericEntities: true }), { foo: '☺' }); + st.end(); + }); + + t.test('does not interpret %uXXXX syntax in iso-8859-1 mode', function (st) { + st.deepEqual(qs.parse('%u263A=%u263A', { charset: 'iso-8859-1' }), { '%u263A': '%u263A' }); + st.end(); + }); + + t.end(); +}); diff --git a/node_modules/qs/test/stringify.js b/node_modules/qs/test/stringify.js new file mode 100644 index 0000000..53041c2 --- /dev/null +++ b/node_modules/qs/test/stringify.js @@ -0,0 +1,679 @@ +'use strict'; + +var test = require('tape'); +var qs = require('../'); +var utils = require('../lib/utils'); +var iconv = require('iconv-lite'); +var SaferBuffer = require('safer-buffer').Buffer; + +test('stringify()', function (t) { + t.test('stringifies a querystring object', function (st) { + st.equal(qs.stringify({ a: 'b' }), 'a=b'); + st.equal(qs.stringify({ a: 1 }), 'a=1'); + st.equal(qs.stringify({ a: 1, b: 2 }), 'a=1&b=2'); + st.equal(qs.stringify({ a: 'A_Z' }), 'a=A_Z'); + st.equal(qs.stringify({ a: 'â¬' }), 'a=%E2%82%AC'); + st.equal(qs.stringify({ a: 'î' }), 'a=%EE%80%80'); + st.equal(qs.stringify({ a: '×' }), 'a=%D7%90'); + st.equal(qs.stringify({ a: 'ð·' }), 'a=%F0%90%90%B7'); + st.end(); + }); + + t.test('stringifies falsy values', function (st) { + st.equal(qs.stringify(undefined), ''); + st.equal(qs.stringify(null), ''); + st.equal(qs.stringify(null, { strictNullHandling: true }), ''); + st.equal(qs.stringify(false), ''); + st.equal(qs.stringify(0), ''); + st.end(); + }); + + t.test('adds query prefix', function (st) { + st.equal(qs.stringify({ a: 'b' }, { addQueryPrefix: true }), '?a=b'); + st.end(); + }); + + t.test('with query prefix, outputs blank string given an empty object', function (st) { + st.equal(qs.stringify({}, { addQueryPrefix: true }), ''); + st.end(); + }); + + t.test('stringifies nested falsy values', function (st) { + st.equal(qs.stringify({ a: { b: { c: null } } }), 'a%5Bb%5D%5Bc%5D='); + st.equal(qs.stringify({ a: { b: { c: null } } }, { strictNullHandling: true }), 'a%5Bb%5D%5Bc%5D'); + st.equal(qs.stringify({ a: { b: { c: false } } }), 'a%5Bb%5D%5Bc%5D=false'); + st.end(); + }); + + t.test('stringifies a nested object', function (st) { + st.equal(qs.stringify({ a: { b: 'c' } }), 'a%5Bb%5D=c'); + st.equal(qs.stringify({ a: { b: { c: { d: 'e' } } } }), 'a%5Bb%5D%5Bc%5D%5Bd%5D=e'); + st.end(); + }); + + t.test('stringifies a nested object with dots notation', function (st) { + st.equal(qs.stringify({ a: { b: 'c' } }, { allowDots: true }), 'a.b=c'); + st.equal(qs.stringify({ a: { b: { c: { d: 'e' } } } }, { allowDots: true }), 'a.b.c.d=e'); + st.end(); + }); + + t.test('stringifies an array value', function (st) { + st.equal( + qs.stringify({ a: ['b', 'c', 'd'] }, { arrayFormat: 'indices' }), + 'a%5B0%5D=b&a%5B1%5D=c&a%5B2%5D=d', + 'indices => indices' + ); + st.equal( + qs.stringify({ a: ['b', 'c', 'd'] }, { arrayFormat: 'brackets' }), + 'a%5B%5D=b&a%5B%5D=c&a%5B%5D=d', + 'brackets => brackets' + ); + st.equal( + qs.stringify({ a: ['b', 'c', 'd'] }, { arrayFormat: 'comma' }), + 'a=b%2Cc%2Cd', + 'comma => comma' + ); + st.equal( + qs.stringify({ a: ['b', 'c', 'd'] }), + 'a%5B0%5D=b&a%5B1%5D=c&a%5B2%5D=d', + 'default => indices' + ); + st.end(); + }); + + t.test('omits nulls when asked', function (st) { + st.equal(qs.stringify({ a: 'b', c: null }, { skipNulls: true }), 'a=b'); + st.end(); + }); + + t.test('omits nested nulls when asked', function (st) { + st.equal(qs.stringify({ a: { b: 'c', d: null } }, { skipNulls: true }), 'a%5Bb%5D=c'); + st.end(); + }); + + t.test('omits array indices when asked', function (st) { + st.equal(qs.stringify({ a: ['b', 'c', 'd'] }, { indices: false }), 'a=b&a=c&a=d'); + st.end(); + }); + + t.test('stringifies a nested array value', function (st) { + st.equal(qs.stringify({ a: { b: ['c', 'd'] } }, { arrayFormat: 'indices' }), 'a%5Bb%5D%5B0%5D=c&a%5Bb%5D%5B1%5D=d'); + st.equal(qs.stringify({ a: { b: ['c', 'd'] } }, { arrayFormat: 'brackets' }), 'a%5Bb%5D%5B%5D=c&a%5Bb%5D%5B%5D=d'); + st.equal(qs.stringify({ a: { b: ['c', 'd'] } }, { arrayFormat: 'comma' }), 'a%5Bb%5D=c%2Cd'); // a[b]=c,d + st.equal(qs.stringify({ a: { b: ['c', 'd'] } }), 'a%5Bb%5D%5B0%5D=c&a%5Bb%5D%5B1%5D=d'); + st.end(); + }); + + t.test('stringifies a nested array value with dots notation', function (st) { + st.equal( + qs.stringify( + { a: { b: ['c', 'd'] } }, + { allowDots: true, encode: false, arrayFormat: 'indices' } + ), + 'a.b[0]=c&a.b[1]=d', + 'indices: stringifies with dots + indices' + ); + st.equal( + qs.stringify( + { a: { b: ['c', 'd'] } }, + { allowDots: true, encode: false, arrayFormat: 'brackets' } + ), + 'a.b[]=c&a.b[]=d', + 'brackets: stringifies with dots + brackets' + ); + st.equal( + qs.stringify( + { a: { b: ['c', 'd'] } }, + { allowDots: true, encode: false, arrayFormat: 'comma' } + ), + 'a.b=c,d', + 'comma: stringifies with dots + comma' + ); + st.equal( + qs.stringify( + { a: { b: ['c', 'd'] } }, + { allowDots: true, encode: false } + ), + 'a.b[0]=c&a.b[1]=d', + 'default: stringifies with dots + indices' + ); + st.end(); + }); + + t.test('stringifies an object inside an array', function (st) { + st.equal( + qs.stringify({ a: [{ b: 'c' }] }, { arrayFormat: 'indices' }), + 'a%5B0%5D%5Bb%5D=c', // a[0][b]=c + 'indices => brackets' + ); + st.equal( + qs.stringify({ a: [{ b: 'c' }] }, { arrayFormat: 'brackets' }), + 'a%5B%5D%5Bb%5D=c', // a[][b]=c + 'brackets => brackets' + ); + st.equal( + qs.stringify({ a: [{ b: 'c' }] }), + 'a%5B0%5D%5Bb%5D=c', + 'default => indices' + ); + + st.equal( + qs.stringify({ a: [{ b: { c: [1] } }] }, { arrayFormat: 'indices' }), + 'a%5B0%5D%5Bb%5D%5Bc%5D%5B0%5D=1', + 'indices => indices' + ); + + st.equal( + qs.stringify({ a: [{ b: { c: [1] } }] }, { arrayFormat: 'brackets' }), + 'a%5B%5D%5Bb%5D%5Bc%5D%5B%5D=1', + 'brackets => brackets' + ); + + st.equal( + qs.stringify({ a: [{ b: { c: [1] } }] }), + 'a%5B0%5D%5Bb%5D%5Bc%5D%5B0%5D=1', + 'default => indices' + ); + + st.end(); + }); + + t.test('stringifies an array with mixed objects and primitives', function (st) { + st.equal( + qs.stringify({ a: [{ b: 1 }, 2, 3] }, { encode: false, arrayFormat: 'indices' }), + 'a[0][b]=1&a[1]=2&a[2]=3', + 'indices => indices' + ); + st.equal( + qs.stringify({ a: [{ b: 1 }, 2, 3] }, { encode: false, arrayFormat: 'brackets' }), + 'a[][b]=1&a[]=2&a[]=3', + 'brackets => brackets' + ); + st.equal( + qs.stringify({ a: [{ b: 1 }, 2, 3] }, { encode: false }), + 'a[0][b]=1&a[1]=2&a[2]=3', + 'default => indices' + ); + + st.end(); + }); + + t.test('stringifies an object inside an array with dots notation', function (st) { + st.equal( + qs.stringify( + { a: [{ b: 'c' }] }, + { allowDots: true, encode: false, arrayFormat: 'indices' } + ), + 'a[0].b=c', + 'indices => indices' + ); + st.equal( + qs.stringify( + { a: [{ b: 'c' }] }, + { allowDots: true, encode: false, arrayFormat: 'brackets' } + ), + 'a[].b=c', + 'brackets => brackets' + ); + st.equal( + qs.stringify( + { a: [{ b: 'c' }] }, + { allowDots: true, encode: false } + ), + 'a[0].b=c', + 'default => indices' + ); + + st.equal( + qs.stringify( + { a: [{ b: { c: [1] } }] }, + { allowDots: true, encode: false, arrayFormat: 'indices' } + ), + 'a[0].b.c[0]=1', + 'indices => indices' + ); + st.equal( + qs.stringify( + { a: [{ b: { c: [1] } }] }, + { allowDots: true, encode: false, arrayFormat: 'brackets' } + ), + 'a[].b.c[]=1', + 'brackets => brackets' + ); + st.equal( + qs.stringify( + { a: [{ b: { c: [1] } }] }, + { allowDots: true, encode: false } + ), + 'a[0].b.c[0]=1', + 'default => indices' + ); + + st.end(); + }); + + t.test('does not omit object keys when indices = false', function (st) { + st.equal(qs.stringify({ a: [{ b: 'c' }] }, { indices: false }), 'a%5Bb%5D=c'); + st.end(); + }); + + t.test('uses indices notation for arrays when indices=true', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { indices: true }), 'a%5B0%5D=b&a%5B1%5D=c'); + st.end(); + }); + + t.test('uses indices notation for arrays when no arrayFormat is specified', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }), 'a%5B0%5D=b&a%5B1%5D=c'); + st.end(); + }); + + t.test('uses indices notation for arrays when no arrayFormat=indices', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'indices' }), 'a%5B0%5D=b&a%5B1%5D=c'); + st.end(); + }); + + t.test('uses repeat notation for arrays when no arrayFormat=repeat', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'repeat' }), 'a=b&a=c'); + st.end(); + }); + + t.test('uses brackets notation for arrays when no arrayFormat=brackets', function (st) { + st.equal(qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'brackets' }), 'a%5B%5D=b&a%5B%5D=c'); + st.end(); + }); + + t.test('stringifies a complicated object', function (st) { + st.equal(qs.stringify({ a: { b: 'c', d: 'e' } }), 'a%5Bb%5D=c&a%5Bd%5D=e'); + st.end(); + }); + + t.test('stringifies an empty value', function (st) { + st.equal(qs.stringify({ a: '' }), 'a='); + st.equal(qs.stringify({ a: null }, { strictNullHandling: true }), 'a'); + + st.equal(qs.stringify({ a: '', b: '' }), 'a=&b='); + st.equal(qs.stringify({ a: null, b: '' }, { strictNullHandling: true }), 'a&b='); + + st.equal(qs.stringify({ a: { b: '' } }), 'a%5Bb%5D='); + st.equal(qs.stringify({ a: { b: null } }, { strictNullHandling: true }), 'a%5Bb%5D'); + st.equal(qs.stringify({ a: { b: null } }, { strictNullHandling: false }), 'a%5Bb%5D='); + + st.end(); + }); + + t.test('stringifies a null object', { skip: !Object.create }, function (st) { + var obj = Object.create(null); + obj.a = 'b'; + st.equal(qs.stringify(obj), 'a=b'); + st.end(); + }); + + t.test('returns an empty string for invalid input', function (st) { + st.equal(qs.stringify(undefined), ''); + st.equal(qs.stringify(false), ''); + st.equal(qs.stringify(null), ''); + st.equal(qs.stringify(''), ''); + st.end(); + }); + + t.test('stringifies an object with a null object as a child', { skip: !Object.create }, function (st) { + var obj = { a: Object.create(null) }; + + obj.a.b = 'c'; + st.equal(qs.stringify(obj), 'a%5Bb%5D=c'); + st.end(); + }); + + t.test('drops keys with a value of undefined', function (st) { + st.equal(qs.stringify({ a: undefined }), ''); + + st.equal(qs.stringify({ a: { b: undefined, c: null } }, { strictNullHandling: true }), 'a%5Bc%5D'); + st.equal(qs.stringify({ a: { b: undefined, c: null } }, { strictNullHandling: false }), 'a%5Bc%5D='); + st.equal(qs.stringify({ a: { b: undefined, c: '' } }), 'a%5Bc%5D='); + st.end(); + }); + + t.test('url encodes values', function (st) { + st.equal(qs.stringify({ a: 'b c' }), 'a=b%20c'); + st.end(); + }); + + t.test('stringifies a date', function (st) { + var now = new Date(); + var str = 'a=' + encodeURIComponent(now.toISOString()); + st.equal(qs.stringify({ a: now }), str); + st.end(); + }); + + t.test('stringifies the weird object from qs', function (st) { + st.equal(qs.stringify({ 'my weird field': '~q1!2"\'w$5&7/z8)?' }), 'my%20weird%20field=~q1%212%22%27w%245%267%2Fz8%29%3F'); + st.end(); + }); + + t.test('skips properties that are part of the object prototype', function (st) { + Object.prototype.crash = 'test'; + st.equal(qs.stringify({ a: 'b' }), 'a=b'); + st.equal(qs.stringify({ a: { b: 'c' } }), 'a%5Bb%5D=c'); + delete Object.prototype.crash; + st.end(); + }); + + t.test('stringifies boolean values', function (st) { + st.equal(qs.stringify({ a: true }), 'a=true'); + st.equal(qs.stringify({ a: { b: true } }), 'a%5Bb%5D=true'); + st.equal(qs.stringify({ b: false }), 'b=false'); + st.equal(qs.stringify({ b: { c: false } }), 'b%5Bc%5D=false'); + st.end(); + }); + + t.test('stringifies buffer values', function (st) { + st.equal(qs.stringify({ a: SaferBuffer.from('test') }), 'a=test'); + st.equal(qs.stringify({ a: { b: SaferBuffer.from('test') } }), 'a%5Bb%5D=test'); + st.end(); + }); + + t.test('stringifies an object using an alternative delimiter', function (st) { + st.equal(qs.stringify({ a: 'b', c: 'd' }, { delimiter: ';' }), 'a=b;c=d'); + st.end(); + }); + + t.test('doesn\'t blow up when Buffer global is missing', function (st) { + var tempBuffer = global.Buffer; + delete global.Buffer; + var result = qs.stringify({ a: 'b', c: 'd' }); + global.Buffer = tempBuffer; + st.equal(result, 'a=b&c=d'); + st.end(); + }); + + t.test('selects properties when filter=array', function (st) { + st.equal(qs.stringify({ a: 'b' }, { filter: ['a'] }), 'a=b'); + st.equal(qs.stringify({ a: 1 }, { filter: [] }), ''); + + st.equal( + qs.stringify( + { a: { b: [1, 2, 3, 4], c: 'd' }, c: 'f' }, + { filter: ['a', 'b', 0, 2], arrayFormat: 'indices' } + ), + 'a%5Bb%5D%5B0%5D=1&a%5Bb%5D%5B2%5D=3', + 'indices => indices' + ); + st.equal( + qs.stringify( + { a: { b: [1, 2, 3, 4], c: 'd' }, c: 'f' }, + { filter: ['a', 'b', 0, 2], arrayFormat: 'brackets' } + ), + 'a%5Bb%5D%5B%5D=1&a%5Bb%5D%5B%5D=3', + 'brackets => brackets' + ); + st.equal( + qs.stringify( + { a: { b: [1, 2, 3, 4], c: 'd' }, c: 'f' }, + { filter: ['a', 'b', 0, 2] } + ), + 'a%5Bb%5D%5B0%5D=1&a%5Bb%5D%5B2%5D=3', + 'default => indices' + ); + + st.end(); + }); + + t.test('supports custom representations when filter=function', function (st) { + var calls = 0; + var obj = { a: 'b', c: 'd', e: { f: new Date(1257894000000) } }; + var filterFunc = function (prefix, value) { + calls += 1; + if (calls === 1) { + st.equal(prefix, '', 'prefix is empty'); + st.equal(value, obj); + } else if (prefix === 'c') { + return void 0; + } else if (value instanceof Date) { + st.equal(prefix, 'e[f]'); + return value.getTime(); + } + return value; + }; + + st.equal(qs.stringify(obj, { filter: filterFunc }), 'a=b&e%5Bf%5D=1257894000000'); + st.equal(calls, 5); + st.end(); + }); + + t.test('can disable uri encoding', function (st) { + st.equal(qs.stringify({ a: 'b' }, { encode: false }), 'a=b'); + st.equal(qs.stringify({ a: { b: 'c' } }, { encode: false }), 'a[b]=c'); + st.equal(qs.stringify({ a: 'b', c: null }, { strictNullHandling: true, encode: false }), 'a=b&c'); + st.end(); + }); + + t.test('can sort the keys', function (st) { + var sort = function (a, b) { + return a.localeCompare(b); + }; + st.equal(qs.stringify({ a: 'c', z: 'y', b: 'f' }, { sort: sort }), 'a=c&b=f&z=y'); + st.equal(qs.stringify({ a: 'c', z: { j: 'a', i: 'b' }, b: 'f' }, { sort: sort }), 'a=c&b=f&z%5Bi%5D=b&z%5Bj%5D=a'); + st.end(); + }); + + t.test('can sort the keys at depth 3 or more too', function (st) { + var sort = function (a, b) { + return a.localeCompare(b); + }; + st.equal( + qs.stringify( + { a: 'a', z: { zj: { zjb: 'zjb', zja: 'zja' }, zi: { zib: 'zib', zia: 'zia' } }, b: 'b' }, + { sort: sort, encode: false } + ), + 'a=a&b=b&z[zi][zia]=zia&z[zi][zib]=zib&z[zj][zja]=zja&z[zj][zjb]=zjb' + ); + st.equal( + qs.stringify( + { a: 'a', z: { zj: { zjb: 'zjb', zja: 'zja' }, zi: { zib: 'zib', zia: 'zia' } }, b: 'b' }, + { sort: null, encode: false } + ), + 'a=a&z[zj][zjb]=zjb&z[zj][zja]=zja&z[zi][zib]=zib&z[zi][zia]=zia&b=b' + ); + st.end(); + }); + + t.test('can stringify with custom encoding', function (st) { + st.equal(qs.stringify({ ç: '大éªåº', '': '' }, { + encoder: function (str) { + if (str.length === 0) { + return ''; + } + var buf = iconv.encode(str, 'shiftjis'); + var result = []; + for (var i = 0; i < buf.length; ++i) { + result.push(buf.readUInt8(i).toString(16)); + } + return '%' + result.join('%'); + } + }), '%8c%a7=%91%e5%8d%e3%95%7b&='); + st.end(); + }); + + t.test('receives the default encoder as a second argument', function (st) { + st.plan(2); + qs.stringify({ a: 1 }, { + encoder: function (str, defaultEncoder) { + st.equal(defaultEncoder, utils.encode); + } + }); + st.end(); + }); + + t.test('throws error with wrong encoder', function (st) { + st['throws'](function () { + qs.stringify({}, { encoder: 'string' }); + }, new TypeError('Encoder has to be a function.')); + st.end(); + }); + + t.test('can use custom encoder for a buffer object', { skip: typeof Buffer === 'undefined' }, function (st) { + st.equal(qs.stringify({ a: SaferBuffer.from([1]) }, { + encoder: function (buffer) { + if (typeof buffer === 'string') { + return buffer; + } + return String.fromCharCode(buffer.readUInt8(0) + 97); + } + }), 'a=b'); + st.end(); + }); + + t.test('serializeDate option', function (st) { + var date = new Date(); + st.equal( + qs.stringify({ a: date }), + 'a=' + date.toISOString().replace(/:/g, '%3A'), + 'default is toISOString' + ); + + var mutatedDate = new Date(); + mutatedDate.toISOString = function () { + throw new SyntaxError(); + }; + st['throws'](function () { + mutatedDate.toISOString(); + }, SyntaxError); + st.equal( + qs.stringify({ a: mutatedDate }), + 'a=' + Date.prototype.toISOString.call(mutatedDate).replace(/:/g, '%3A'), + 'toISOString works even when method is not locally present' + ); + + var specificDate = new Date(6); + st.equal( + qs.stringify( + { a: specificDate }, + { serializeDate: function (d) { return d.getTime() * 7; } } + ), + 'a=42', + 'custom serializeDate function called' + ); + + st.end(); + }); + + t.test('RFC 1738 spaces serialization', function (st) { + st.equal(qs.stringify({ a: 'b c' }, { format: qs.formats.RFC1738 }), 'a=b+c'); + st.equal(qs.stringify({ 'a b': 'c d' }, { format: qs.formats.RFC1738 }), 'a+b=c+d'); + st.end(); + }); + + t.test('RFC 3986 spaces serialization', function (st) { + st.equal(qs.stringify({ a: 'b c' }, { format: qs.formats.RFC3986 }), 'a=b%20c'); + st.equal(qs.stringify({ 'a b': 'c d' }, { format: qs.formats.RFC3986 }), 'a%20b=c%20d'); + st.end(); + }); + + t.test('Backward compatibility to RFC 3986', function (st) { + st.equal(qs.stringify({ a: 'b c' }), 'a=b%20c'); + st.end(); + }); + + t.test('Edge cases and unknown formats', function (st) { + ['UFO1234', false, 1234, null, {}, []].forEach( + function (format) { + st['throws']( + function () { + qs.stringify({ a: 'b c' }, { format: format }); + }, + new TypeError('Unknown format option provided.') + ); + } + ); + st.end(); + }); + + t.test('encodeValuesOnly', function (st) { + st.equal( + qs.stringify( + { a: 'b', c: ['d', 'e=f'], f: [['g'], ['h']] }, + { encodeValuesOnly: true } + ), + 'a=b&c[0]=d&c[1]=e%3Df&f[0][0]=g&f[1][0]=h' + ); + st.equal( + qs.stringify( + { a: 'b', c: ['d', 'e'], f: [['g'], ['h']] } + ), + 'a=b&c%5B0%5D=d&c%5B1%5D=e&f%5B0%5D%5B0%5D=g&f%5B1%5D%5B0%5D=h' + ); + st.end(); + }); + + t.test('encodeValuesOnly - strictNullHandling', function (st) { + st.equal( + qs.stringify( + { a: { b: null } }, + { encodeValuesOnly: true, strictNullHandling: true } + ), + 'a[b]' + ); + st.end(); + }); + + t.test('throws if an invalid charset is specified', function (st) { + st['throws'](function () { + qs.stringify({ a: 'b' }, { charset: 'foobar' }); + }, new TypeError('The charset option must be either utf-8, iso-8859-1, or undefined')); + st.end(); + }); + + t.test('respects a charset of iso-8859-1', function (st) { + st.equal(qs.stringify({ æ: 'æ' }, { charset: 'iso-8859-1' }), '%E6=%E6'); + st.end(); + }); + + t.test('encodes unrepresentable chars as numeric entities in iso-8859-1 mode', function (st) { + st.equal(qs.stringify({ a: 'âº' }, { charset: 'iso-8859-1' }), 'a=%26%239786%3B'); + st.end(); + }); + + t.test('respects an explicit charset of utf-8 (the default)', function (st) { + st.equal(qs.stringify({ a: 'æ' }, { charset: 'utf-8' }), 'a=%C3%A6'); + st.end(); + }); + + t.test('adds the right sentinel when instructed to and the charset is utf-8', function (st) { + st.equal(qs.stringify({ a: 'æ' }, { charsetSentinel: true, charset: 'utf-8' }), 'utf8=%E2%9C%93&a=%C3%A6'); + st.end(); + }); + + t.test('adds the right sentinel when instructed to and the charset is iso-8859-1', function (st) { + st.equal(qs.stringify({ a: 'æ' }, { charsetSentinel: true, charset: 'iso-8859-1' }), 'utf8=%26%2310003%3B&a=%E6'); + st.end(); + }); + + t.test('does not mutate the options argument', function (st) { + var options = {}; + qs.stringify({}, options); + st.deepEqual(options, {}); + st.end(); + }); + + t.test('strictNullHandling works with custom filter', function (st) { + var filter = function (prefix, value) { + return value; + }; + + var options = { strictNullHandling: true, filter: filter }; + st.equal(qs.stringify({ key: null }, options), 'key'); + st.end(); + }); + + t.test('strictNullHandling works with null serializeDate', function (st) { + var serializeDate = function () { + return null; + }; + var options = { strictNullHandling: true, serializeDate: serializeDate }; + var date = new Date(); + st.equal(qs.stringify({ key: date }, options), 'key'); + st.end(); + }); + + t.end(); +}); diff --git a/node_modules/qs/test/utils.js b/node_modules/qs/test/utils.js new file mode 100644 index 0000000..da31ce5 --- /dev/null +++ b/node_modules/qs/test/utils.js @@ -0,0 +1,136 @@ +'use strict'; + +var test = require('tape'); +var inspect = require('object-inspect'); +var SaferBuffer = require('safer-buffer').Buffer; +var forEach = require('for-each'); +var utils = require('../lib/utils'); + +test('merge()', function (t) { + t.deepEqual(utils.merge(null, true), [null, true], 'merges true into null'); + + t.deepEqual(utils.merge(null, [42]), [null, 42], 'merges null into an array'); + + t.deepEqual(utils.merge({ a: 'b' }, { a: 'c' }), { a: ['b', 'c'] }, 'merges two objects with the same key'); + + var oneMerged = utils.merge({ foo: 'bar' }, { foo: { first: '123' } }); + t.deepEqual(oneMerged, { foo: ['bar', { first: '123' }] }, 'merges a standalone and an object into an array'); + + var twoMerged = utils.merge({ foo: ['bar', { first: '123' }] }, { foo: { second: '456' } }); + t.deepEqual(twoMerged, { foo: { 0: 'bar', 1: { first: '123' }, second: '456' } }, 'merges a standalone and two objects into an array'); + + var sandwiched = utils.merge({ foo: ['bar', { first: '123', second: '456' }] }, { foo: 'baz' }); + t.deepEqual(sandwiched, { foo: ['bar', { first: '123', second: '456' }, 'baz'] }, 'merges an object sandwiched by two standalones into an array'); + + var nestedArrays = utils.merge({ foo: ['baz'] }, { foo: ['bar', 'xyzzy'] }); + t.deepEqual(nestedArrays, { foo: ['baz', 'bar', 'xyzzy'] }); + + var noOptionsNonObjectSource = utils.merge({ foo: 'baz' }, 'bar'); + t.deepEqual(noOptionsNonObjectSource, { foo: 'baz', bar: true }); + + t.test( + 'avoids invoking array setters unnecessarily', + { skip: typeof Object.defineProperty !== 'function' }, + function (st) { + var setCount = 0; + var getCount = 0; + var observed = []; + Object.defineProperty(observed, 0, { + get: function () { + getCount += 1; + return { bar: 'baz' }; + }, + set: function () { setCount += 1; } + }); + utils.merge(observed, [null]); + st.equal(setCount, 0); + st.equal(getCount, 1); + observed[0] = observed[0]; // eslint-disable-line no-self-assign + st.equal(setCount, 1); + st.equal(getCount, 2); + st.end(); + } + ); + + t.end(); +}); + +test('assign()', function (t) { + var target = { a: 1, b: 2 }; + var source = { b: 3, c: 4 }; + var result = utils.assign(target, source); + + t.equal(result, target, 'returns the target'); + t.deepEqual(target, { a: 1, b: 3, c: 4 }, 'target and source are merged'); + t.deepEqual(source, { b: 3, c: 4 }, 'source is untouched'); + + t.end(); +}); + +test('combine()', function (t) { + t.test('both arrays', function (st) { + var a = [1]; + var b = [2]; + var combined = utils.combine(a, b); + + st.deepEqual(a, [1], 'a is not mutated'); + st.deepEqual(b, [2], 'b is not mutated'); + st.notEqual(a, combined, 'a !== combined'); + st.notEqual(b, combined, 'b !== combined'); + st.deepEqual(combined, [1, 2], 'combined is a + b'); + + st.end(); + }); + + t.test('one array, one non-array', function (st) { + var aN = 1; + var a = [aN]; + var bN = 2; + var b = [bN]; + + var combinedAnB = utils.combine(aN, b); + st.deepEqual(b, [bN], 'b is not mutated'); + st.notEqual(aN, combinedAnB, 'aN + b !== aN'); + st.notEqual(a, combinedAnB, 'aN + b !== a'); + st.notEqual(bN, combinedAnB, 'aN + b !== bN'); + st.notEqual(b, combinedAnB, 'aN + b !== b'); + st.deepEqual([1, 2], combinedAnB, 'first argument is array-wrapped when not an array'); + + var combinedABn = utils.combine(a, bN); + st.deepEqual(a, [aN], 'a is not mutated'); + st.notEqual(aN, combinedABn, 'a + bN !== aN'); + st.notEqual(a, combinedABn, 'a + bN !== a'); + st.notEqual(bN, combinedABn, 'a + bN !== bN'); + st.notEqual(b, combinedABn, 'a + bN !== b'); + st.deepEqual([1, 2], combinedABn, 'second argument is array-wrapped when not an array'); + + st.end(); + }); + + t.test('neither is an array', function (st) { + var combined = utils.combine(1, 2); + st.notEqual(1, combined, '1 + 2 !== 1'); + st.notEqual(2, combined, '1 + 2 !== 2'); + st.deepEqual([1, 2], combined, 'both arguments are array-wrapped when not an array'); + + st.end(); + }); + + t.end(); +}); + +test('isBuffer()', function (t) { + forEach([null, undefined, true, false, '', 'abc', 42, 0, NaN, {}, [], function () {}, /a/g], function (x) { + t.equal(utils.isBuffer(x), false, inspect(x) + ' is not a buffer'); + }); + + var fakeBuffer = { constructor: Buffer }; + t.equal(utils.isBuffer(fakeBuffer), false, 'fake buffer is not a buffer'); + + var saferBuffer = SaferBuffer.from('abc'); + t.equal(utils.isBuffer(saferBuffer), true, 'SaferBuffer instance is a buffer'); + + var buffer = Buffer.from ? Buffer.from('abc') : new Buffer('abc'); + t.equal(utils.isBuffer(buffer), true, 'real Buffer instance is a buffer'); + t.end(); +}); diff --git a/node_modules/range-parser/HISTORY.md b/node_modules/range-parser/HISTORY.md new file mode 100644 index 0000000..70a973d --- /dev/null +++ b/node_modules/range-parser/HISTORY.md @@ -0,0 +1,56 @@ +1.2.1 / 2019-05-10 +================== + + * Improve error when `str` is not a string + +1.2.0 / 2016-06-01 +================== + + * Add `combine` option to combine overlapping ranges + +1.1.0 / 2016-05-13 +================== + + * Fix incorrectly returning -1 when there is at least one valid range + * perf: remove internal function + +1.0.3 / 2015-10-29 +================== + + * perf: enable strict mode + +1.0.2 / 2014-09-08 +================== + + * Support Node.js 0.6 + +1.0.1 / 2014-09-07 +================== + + * Move repository to jshttp + +1.0.0 / 2013-12-11 +================== + + * Add repository to package.json + * Add MIT license + +0.0.4 / 2012-06-17 +================== + + * Change ret -1 for unsatisfiable and -2 when invalid + +0.0.3 / 2012-06-17 +================== + + * Fix last-byte-pos default to len - 1 + +0.0.2 / 2012-06-14 +================== + + * Add `.type` + +0.0.1 / 2012-06-11 +================== + + * Initial release diff --git a/node_modules/range-parser/LICENSE b/node_modules/range-parser/LICENSE new file mode 100644 index 0000000..3599954 --- /dev/null +++ b/node_modules/range-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2015-2016 Douglas Christopher Wilson <doug@somethingdoug.com + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/range-parser/README.md b/node_modules/range-parser/README.md new file mode 100644 index 0000000..c247e82 --- /dev/null +++ b/node_modules/range-parser/README.md @@ -0,0 +1,84 @@ +# range-parser + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Range header field parser. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install range-parser +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var parseRange = require('range-parser') +``` + +### parseRange(size, header, options) + +Parse the given `header` string where `size` is the maximum size of the resource. +An array of ranges will be returned or negative numbers indicating an error parsing. + + * `-2` signals a malformed header string + * `-1` signals an unsatisfiable range + +<!-- eslint-disable no-undef --> + +```js +// parse header from request +var range = parseRange(size, req.headers.range) + +// the type of the range +if (range.type === 'bytes') { + // the ranges + range.forEach(function (r) { + // do something with r.start and r.end + }) +} +``` + +#### Options + +These properties are accepted in the options object. + +##### combine + +Specifies if overlapping & adjacent ranges should be combined, defaults to `false`. +When `true`, ranges will be combined and returned as if they were specified that +way in the header. + +<!-- eslint-disable no-undef --> + +```js +parseRange(100, 'bytes=50-55,0-10,5-10,56-60', { combine: true }) +// => [ +// { start: 0, end: 10 }, +// { start: 50, end: 60 } +// ] +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/range-parser/master +[coveralls-url]: https://coveralls.io/r/jshttp/range-parser?branch=master +[node-image]: https://badgen.net/npm/node/range-parser +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/range-parser +[npm-url]: https://npmjs.org/package/range-parser +[npm-version-image]: https://badgen.net/npm/v/range-parser +[travis-image]: https://badgen.net/travis/jshttp/range-parser/master +[travis-url]: https://travis-ci.org/jshttp/range-parser diff --git a/node_modules/range-parser/index.js b/node_modules/range-parser/index.js new file mode 100644 index 0000000..b7dc5c0 --- /dev/null +++ b/node_modules/range-parser/index.js @@ -0,0 +1,162 @@ +/*! + * range-parser + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = rangeParser + +/** + * Parse "Range" header `str` relative to the given file `size`. + * + * @param {Number} size + * @param {String} str + * @param {Object} [options] + * @return {Array} + * @public + */ + +function rangeParser (size, str, options) { + if (typeof str !== 'string') { + throw new TypeError('argument str must be a string') + } + + var index = str.indexOf('=') + + if (index === -1) { + return -2 + } + + // split the range string + var arr = str.slice(index + 1).split(',') + var ranges = [] + + // add ranges type + ranges.type = str.slice(0, index) + + // parse all ranges + for (var i = 0; i < arr.length; i++) { + var range = arr[i].split('-') + var start = parseInt(range[0], 10) + var end = parseInt(range[1], 10) + + // -nnn + if (isNaN(start)) { + start = size - end + end = size - 1 + // nnn- + } else if (isNaN(end)) { + end = size - 1 + } + + // limit last-byte-pos to current length + if (end > size - 1) { + end = size - 1 + } + + // invalid or unsatisifiable + if (isNaN(start) || isNaN(end) || start > end || start < 0) { + continue + } + + // add range + ranges.push({ + start: start, + end: end + }) + } + + if (ranges.length < 1) { + // unsatisifiable + return -1 + } + + return options && options.combine + ? combineRanges(ranges) + : ranges +} + +/** + * Combine overlapping & adjacent ranges. + * @private + */ + +function combineRanges (ranges) { + var ordered = ranges.map(mapWithIndex).sort(sortByRangeStart) + + for (var j = 0, i = 1; i < ordered.length; i++) { + var range = ordered[i] + var current = ordered[j] + + if (range.start > current.end + 1) { + // next range + ordered[++j] = range + } else if (range.end > current.end) { + // extend range + current.end = range.end + current.index = Math.min(current.index, range.index) + } + } + + // trim ordered array + ordered.length = j + 1 + + // generate combined range + var combined = ordered.sort(sortByRangeIndex).map(mapWithoutIndex) + + // copy ranges type + combined.type = ranges.type + + return combined +} + +/** + * Map function to add index value to ranges. + * @private + */ + +function mapWithIndex (range, index) { + return { + start: range.start, + end: range.end, + index: index + } +} + +/** + * Map function to remove index value from ranges. + * @private + */ + +function mapWithoutIndex (range) { + return { + start: range.start, + end: range.end + } +} + +/** + * Sort function to sort ranges by index. + * @private + */ + +function sortByRangeIndex (a, b) { + return a.index - b.index +} + +/** + * Sort function to sort ranges by start position. + * @private + */ + +function sortByRangeStart (a, b) { + return a.start - b.start +} diff --git a/node_modules/range-parser/package.json b/node_modules/range-parser/package.json new file mode 100644 index 0000000..3fba829 --- /dev/null +++ b/node_modules/range-parser/package.json @@ -0,0 +1,91 @@ +{ + "_from": "range-parser@~1.2.1", + "_id": "range-parser@1.2.1", + "_inBundle": false, + "_integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==", + "_location": "/range-parser", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "range-parser@~1.2.1", + "name": "range-parser", + "escapedName": "range-parser", + "rawSpec": "~1.2.1", + "saveSpec": null, + "fetchSpec": "~1.2.1" + }, + "_requiredBy": [ + "/express", + "/send" + ], + "_resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "_shasum": "3cf37023d199e1c24d1a55b84800c2f3e6468031", + "_spec": "range-parser@~1.2.1", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + }, + "bugs": { + "url": "https://github.com/jshttp/range-parser/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "James Wyatt Cready", + "email": "wyatt.cready@lanetix.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "deprecated": false, + "description": "Range header field string parser", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "mocha": "6.1.4", + "nyc": "14.1.1" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "homepage": "https://github.com/jshttp/range-parser#readme", + "keywords": [ + "range", + "parser", + "http" + ], + "license": "MIT", + "name": "range-parser", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/range-parser.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test" + }, + "version": "1.2.1" +} diff --git a/node_modules/raw-body/HISTORY.md b/node_modules/raw-body/HISTORY.md new file mode 100644 index 0000000..88c79fc --- /dev/null +++ b/node_modules/raw-body/HISTORY.md @@ -0,0 +1,270 @@ +2.4.0 / 2019-04-17 +================== + + * deps: bytes@3.1.0 + - Add petabyte (`pb`) support + * deps: http-errors@1.7.2 + - Set constructor name when possible + - deps: setprototypeof@1.1.1 + - deps: statuses@'>= 1.5.0 < 2' + * deps: iconv-lite@0.4.24 + - Added encoding MIK + +2.3.3 / 2018-05-08 +================== + + * deps: http-errors@1.6.3 + - deps: depd@~1.1.2 + - deps: setprototypeof@1.1.0 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.23 + - Fix loading encoding with year appended + - Fix deprecation warnings on Node.js 10+ + +2.3.2 / 2017-09-09 +================== + + * deps: iconv-lite@0.4.19 + - Fix ISO-8859-1 regression + - Update Windows-1255 + +2.3.1 / 2017-09-07 +================== + + * deps: bytes@3.0.0 + * deps: http-errors@1.6.2 + - deps: depd@1.1.1 + * perf: skip buffer decoding on overage chunk + +2.3.0 / 2017-08-04 +================== + + * Add TypeScript definitions + * Use `http-errors` for standard emitted errors + * deps: bytes@2.5.0 + * deps: iconv-lite@0.4.18 + - Add support for React Native + - Add a warning if not loaded as utf-8 + - Fix CESU-8 decoding in Node.js 8 + - Improve speed of ISO-8859-1 encoding + +2.2.0 / 2017-01-02 +================== + + * deps: iconv-lite@0.4.15 + - Added encoding MS-31J + - Added encoding MS-932 + - Added encoding MS-936 + - Added encoding MS-949 + - Added encoding MS-950 + - Fix GBK/GB18030 handling of Euro character + +2.1.7 / 2016-06-19 +================== + + * deps: bytes@2.4.0 + * perf: remove double-cleanup on happy path + +2.1.6 / 2016-03-07 +================== + + * deps: bytes@2.3.0 + - Drop partial bytes on all parsed units + - Fix parsing byte string that looks like hex + +2.1.5 / 2015-11-30 +================== + + * deps: bytes@2.2.0 + * deps: iconv-lite@0.4.13 + +2.1.4 / 2015-09-27 +================== + + * Fix masking critical errors from `iconv-lite` + * deps: iconv-lite@0.4.12 + - Fix CESU-8 decoding in Node.js 4.x + +2.1.3 / 2015-09-12 +================== + + * Fix sync callback when attaching data listener causes sync read + - Node.js 0.10 compatibility issue + +2.1.2 / 2015-07-05 +================== + + * Fix error stack traces to skip `makeError` + * deps: iconv-lite@0.4.11 + - Add encoding CESU-8 + +2.1.1 / 2015-06-14 +================== + + * Use `unpipe` module for unpiping requests + +2.1.0 / 2015-05-28 +================== + + * deps: iconv-lite@0.4.10 + - Improved UTF-16 endianness detection + - Leading BOM is now removed when decoding + - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails + +2.0.2 / 2015-05-21 +================== + + * deps: bytes@2.1.0 + - Slight optimizations + +2.0.1 / 2015-05-10 +================== + + * Fix a false-positive when unpiping in Node.js 0.8 + +2.0.0 / 2015-05-08 +================== + + * Return a promise without callback instead of thunk + * deps: bytes@2.0.1 + - units no longer case sensitive when parsing + +1.3.4 / 2015-04-15 +================== + + * Fix hanging callback if request aborts during read + * deps: iconv-lite@0.4.8 + - Add encoding alias UNICODE-1-1-UTF-7 + +1.3.3 / 2015-02-08 +================== + + * deps: iconv-lite@0.4.7 + - Gracefully support enumerables on `Object.prototype` + +1.3.2 / 2015-01-20 +================== + + * deps: iconv-lite@0.4.6 + - Fix rare aliases of single-byte encodings + +1.3.1 / 2014-11-21 +================== + + * deps: iconv-lite@0.4.5 + - Fix Windows-31J and X-SJIS encoding support + +1.3.0 / 2014-07-20 +================== + + * Fully unpipe the stream on error + - Fixes `Cannot switch to old mode now` error on Node.js 0.10+ + +1.2.3 / 2014-07-20 +================== + + * deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + +1.2.2 / 2014-06-19 +================== + + * Send invalid encoding error to callback + +1.2.1 / 2014-06-15 +================== + + * deps: iconv-lite@0.4.3 + - Added encodings UTF-16BE and UTF-16 with BOM + +1.2.0 / 2014-06-13 +================== + + * Passing string as `options` interpreted as encoding + * Support all encodings from `iconv-lite` + +1.1.7 / 2014-06-12 +================== + + * use `string_decoder` module from npm + +1.1.6 / 2014-05-27 +================== + + * check encoding for old streams1 + * support node.js < 0.10.6 + +1.1.5 / 2014-05-14 +================== + + * bump bytes + +1.1.4 / 2014-04-19 +================== + + * allow true as an option + * bump bytes + +1.1.3 / 2014-03-02 +================== + + * fix case when length=null + +1.1.2 / 2013-12-01 +================== + + * be less strict on state.encoding check + +1.1.1 / 2013-11-27 +================== + + * add engines + +1.1.0 / 2013-11-27 +================== + + * add err.statusCode and err.type + * allow for encoding option to be true + * pause the stream instead of dumping on error + * throw if the stream's encoding is set + +1.0.1 / 2013-11-19 +================== + + * dont support streams1, throw if dev set encoding + +1.0.0 / 2013-11-17 +================== + + * rename `expected` option to `length` + +0.2.0 / 2013-11-15 +================== + + * republish + +0.1.1 / 2013-11-15 +================== + + * use bytes + +0.1.0 / 2013-11-11 +================== + + * generator support + +0.0.3 / 2013-10-10 +================== + + * update repo + +0.0.2 / 2013-09-14 +================== + + * dump stream on bad headers + * listen to events after defining received and buffers + +0.0.1 / 2013-09-14 +================== + + * Initial release diff --git a/node_modules/raw-body/LICENSE b/node_modules/raw-body/LICENSE new file mode 100644 index 0000000..d695c8f --- /dev/null +++ b/node_modules/raw-body/LICENSE @@ -0,0 +1,22 @@ +The MIT License (MIT) + +Copyright (c) 2013-2014 Jonathan Ong <me@jongleberry.com> +Copyright (c) 2014-2015 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/raw-body/README.md b/node_modules/raw-body/README.md new file mode 100644 index 0000000..2ce79d2 --- /dev/null +++ b/node_modules/raw-body/README.md @@ -0,0 +1,219 @@ +# raw-body + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] + +Gets the entire buffer of a stream either as a `Buffer` or a string. +Validates the stream's length against an expected length and maximum limit. +Ideal for parsing request bodies. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install raw-body +``` + +### TypeScript + +This module includes a [TypeScript](https://www.typescriptlang.org/) +declaration file to enable auto complete in compatible editors and type +information for TypeScript projects. This module depends on the Node.js +types, so install `@types/node`: + +```sh +$ npm install @types/node +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var getRawBody = require('raw-body') +``` + +### getRawBody(stream, [options], [callback]) + +**Returns a promise if no callback specified and global `Promise` exists.** + +Options: + +- `length` - The length of the stream. + If the contents of the stream do not add up to this length, + an `400` error code is returned. +- `limit` - The byte limit of the body. + This is the number of bytes or any string format supported by + [bytes](https://www.npmjs.com/package/bytes), + for example `1000`, `'500kb'` or `'3mb'`. + If the body ends up being larger than this limit, + a `413` error code is returned. +- `encoding` - The encoding to use to decode the body into a string. + By default, a `Buffer` instance will be returned when no encoding is specified. + Most likely, you want `utf-8`, so setting `encoding` to `true` will decode as `utf-8`. + You can use any type of encoding supported by [iconv-lite](https://www.npmjs.org/package/iconv-lite#readme). + +You can also pass a string in place of options to just specify the encoding. + +If an error occurs, the stream will be paused, everything unpiped, +and you are responsible for correctly disposing the stream. +For HTTP requests, no handling is required if you send a response. +For streams that use file descriptors, you should `stream.destroy()` or `stream.close()` to prevent leaks. + +## Errors + +This module creates errors depending on the error condition during reading. +The error may be an error from the underlying Node.js implementation, but is +otherwise an error created by this module, which has the following attributes: + + * `limit` - the limit in bytes + * `length` and `expected` - the expected length of the stream + * `received` - the received bytes + * `encoding` - the invalid encoding + * `status` and `statusCode` - the corresponding status code for the error + * `type` - the error type + +### Types + +The errors from this module have a `type` property which allows for the progamatic +determination of the type of error returned. + +#### encoding.unsupported + +This error will occur when the `encoding` option is specified, but the value does +not map to an encoding supported by the [iconv-lite](https://www.npmjs.org/package/iconv-lite#readme) +module. + +#### entity.too.large + +This error will occur when the `limit` option is specified, but the stream has +an entity that is larger. + +#### request.aborted + +This error will occur when the request stream is aborted by the client before +reading the body has finished. + +#### request.size.invalid + +This error will occur when the `length` option is specified, but the stream has +emitted more bytes. + +#### stream.encoding.set + +This error will occur when the given stream has an encoding set on it, making it +a decoded stream. The stream should not have an encoding set and is expected to +emit `Buffer` objects. + +## Examples + +### Simple Express example + +```js +var contentType = require('content-type') +var express = require('express') +var getRawBody = require('raw-body') + +var app = express() + +app.use(function (req, res, next) { + getRawBody(req, { + length: req.headers['content-length'], + limit: '1mb', + encoding: contentType.parse(req).parameters.charset + }, function (err, string) { + if (err) return next(err) + req.text = string + next() + }) +}) + +// now access req.text +``` + +### Simple Koa example + +```js +var contentType = require('content-type') +var getRawBody = require('raw-body') +var koa = require('koa') + +var app = koa() + +app.use(function * (next) { + this.text = yield getRawBody(this.req, { + length: this.req.headers['content-length'], + limit: '1mb', + encoding: contentType.parse(this.req).parameters.charset + }) + yield next +}) + +// now access this.text +``` + +### Using as a promise + +To use this library as a promise, simply omit the `callback` and a promise is +returned, provided that a global `Promise` is defined. + +```js +var getRawBody = require('raw-body') +var http = require('http') + +var server = http.createServer(function (req, res) { + getRawBody(req) + .then(function (buf) { + res.statusCode = 200 + res.end(buf.length + ' bytes submitted') + }) + .catch(function (err) { + res.statusCode = 500 + res.end(err.message) + }) +}) + +server.listen(3000) +``` + +### Using with TypeScript + +```ts +import * as getRawBody from 'raw-body'; +import * as http from 'http'; + +const server = http.createServer((req, res) => { + getRawBody(req) + .then((buf) => { + res.statusCode = 200; + res.end(buf.length + ' bytes submitted'); + }) + .catch((err) => { + res.statusCode = err.statusCode; + res.end(err.message); + }); +}); + +server.listen(3000); +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/raw-body.svg +[npm-url]: https://npmjs.org/package/raw-body +[node-version-image]: https://img.shields.io/node/v/raw-body.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/stream-utils/raw-body/master.svg +[travis-url]: https://travis-ci.org/stream-utils/raw-body +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/raw-body/master.svg +[coveralls-url]: https://coveralls.io/r/stream-utils/raw-body?branch=master +[downloads-image]: https://img.shields.io/npm/dm/raw-body.svg +[downloads-url]: https://npmjs.org/package/raw-body diff --git a/node_modules/raw-body/index.d.ts b/node_modules/raw-body/index.d.ts new file mode 100644 index 0000000..dcbbebd --- /dev/null +++ b/node_modules/raw-body/index.d.ts @@ -0,0 +1,87 @@ +import { Readable } from 'stream'; + +declare namespace getRawBody { + export type Encoding = string | true; + + export interface Options { + /** + * The expected length of the stream. + */ + length?: number | string | null; + /** + * The byte limit of the body. This is the number of bytes or any string + * format supported by `bytes`, for example `1000`, `'500kb'` or `'3mb'`. + */ + limit?: number | string | null; + /** + * The encoding to use to decode the body into a string. By default, a + * `Buffer` instance will be returned when no encoding is specified. Most + * likely, you want `utf-8`, so setting encoding to `true` will decode as + * `utf-8`. You can use any type of encoding supported by `iconv-lite`. + */ + encoding?: Encoding | null; + } + + export interface RawBodyError extends Error { + /** + * The limit in bytes. + */ + limit?: number; + /** + * The expected length of the stream. + */ + length?: number; + expected?: number; + /** + * The received bytes. + */ + received?: number; + /** + * The encoding. + */ + encoding?: string; + /** + * The corresponding status code for the error. + */ + status: number; + statusCode: number; + /** + * The error type. + */ + type: string; + } +} + +/** + * Gets the entire buffer of a stream either as a `Buffer` or a string. + * Validates the stream's length against an expected length and maximum + * limit. Ideal for parsing request bodies. + */ +declare function getRawBody( + stream: Readable, + callback: (err: getRawBody.RawBodyError, body: Buffer) => void +): void; + +declare function getRawBody( + stream: Readable, + options: (getRawBody.Options & { encoding: getRawBody.Encoding }) | getRawBody.Encoding, + callback: (err: getRawBody.RawBodyError, body: string) => void +): void; + +declare function getRawBody( + stream: Readable, + options: getRawBody.Options, + callback: (err: getRawBody.RawBodyError, body: Buffer) => void +): void; + +declare function getRawBody( + stream: Readable, + options: (getRawBody.Options & { encoding: getRawBody.Encoding }) | getRawBody.Encoding +): Promise<string>; + +declare function getRawBody( + stream: Readable, + options?: getRawBody.Options +): Promise<Buffer>; + +export = getRawBody; diff --git a/node_modules/raw-body/index.js b/node_modules/raw-body/index.js new file mode 100644 index 0000000..7fe8186 --- /dev/null +++ b/node_modules/raw-body/index.js @@ -0,0 +1,286 @@ +/*! + * raw-body + * Copyright(c) 2013-2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var createError = require('http-errors') +var iconv = require('iconv-lite') +var unpipe = require('unpipe') + +/** + * Module exports. + * @public + */ + +module.exports = getRawBody + +/** + * Module variables. + * @private + */ + +var ICONV_ENCODING_MESSAGE_REGEXP = /^Encoding not recognized: / + +/** + * Get the decoder for a given encoding. + * + * @param {string} encoding + * @private + */ + +function getDecoder (encoding) { + if (!encoding) return null + + try { + return iconv.getDecoder(encoding) + } catch (e) { + // error getting decoder + if (!ICONV_ENCODING_MESSAGE_REGEXP.test(e.message)) throw e + + // the encoding was not found + throw createError(415, 'specified encoding unsupported', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } +} + +/** + * Get the raw body of a stream (typically HTTP). + * + * @param {object} stream + * @param {object|string|function} [options] + * @param {function} [callback] + * @public + */ + +function getRawBody (stream, options, callback) { + var done = callback + var opts = options || {} + + if (options === true || typeof options === 'string') { + // short cut for encoding + opts = { + encoding: options + } + } + + if (typeof options === 'function') { + done = options + opts = {} + } + + // validate callback is a function, if provided + if (done !== undefined && typeof done !== 'function') { + throw new TypeError('argument callback must be a function') + } + + // require the callback without promises + if (!done && !global.Promise) { + throw new TypeError('argument callback is required') + } + + // get encoding + var encoding = opts.encoding !== true + ? opts.encoding + : 'utf-8' + + // convert the limit to an integer + var limit = bytes.parse(opts.limit) + + // convert the expected length to an integer + var length = opts.length != null && !isNaN(opts.length) + ? parseInt(opts.length, 10) + : null + + if (done) { + // classic callback style + return readStream(stream, encoding, length, limit, done) + } + + return new Promise(function executor (resolve, reject) { + readStream(stream, encoding, length, limit, function onRead (err, buf) { + if (err) return reject(err) + resolve(buf) + }) + }) +} + +/** + * Halt a stream. + * + * @param {Object} stream + * @private + */ + +function halt (stream) { + // unpipe everything from the stream + unpipe(stream) + + // pause stream + if (typeof stream.pause === 'function') { + stream.pause() + } +} + +/** + * Read the data from the stream. + * + * @param {object} stream + * @param {string} encoding + * @param {number} length + * @param {number} limit + * @param {function} callback + * @public + */ + +function readStream (stream, encoding, length, limit, callback) { + var complete = false + var sync = true + + // check the length and limit options. + // note: we intentionally leave the stream paused, + // so users should handle the stream themselves. + if (limit !== null && length !== null && length > limit) { + return done(createError(413, 'request entity too large', { + expected: length, + length: length, + limit: limit, + type: 'entity.too.large' + })) + } + + // streams1: assert request encoding is buffer. + // streams2+: assert the stream encoding is buffer. + // stream._decoder: streams1 + // state.encoding: streams2 + // state.decoder: streams2, specifically < 0.10.6 + var state = stream._readableState + if (stream._decoder || (state && (state.encoding || state.decoder))) { + // developer error + return done(createError(500, 'stream encoding should not be set', { + type: 'stream.encoding.set' + })) + } + + var received = 0 + var decoder + + try { + decoder = getDecoder(encoding) + } catch (err) { + return done(err) + } + + var buffer = decoder + ? '' + : [] + + // attach listeners + stream.on('aborted', onAborted) + stream.on('close', cleanup) + stream.on('data', onData) + stream.on('end', onEnd) + stream.on('error', onEnd) + + // mark sync section complete + sync = false + + function done () { + var args = new Array(arguments.length) + + // copy arguments + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i] + } + + // mark complete + complete = true + + if (sync) { + process.nextTick(invokeCallback) + } else { + invokeCallback() + } + + function invokeCallback () { + cleanup() + + if (args[0]) { + // halt the stream on error + halt(stream) + } + + callback.apply(null, args) + } + } + + function onAborted () { + if (complete) return + + done(createError(400, 'request aborted', { + code: 'ECONNABORTED', + expected: length, + length: length, + received: received, + type: 'request.aborted' + })) + } + + function onData (chunk) { + if (complete) return + + received += chunk.length + + if (limit !== null && received > limit) { + done(createError(413, 'request entity too large', { + limit: limit, + received: received, + type: 'entity.too.large' + })) + } else if (decoder) { + buffer += decoder.write(chunk) + } else { + buffer.push(chunk) + } + } + + function onEnd (err) { + if (complete) return + if (err) return done(err) + + if (length !== null && received !== length) { + done(createError(400, 'request size did not match content length', { + expected: length, + length: length, + received: received, + type: 'request.size.invalid' + })) + } else { + var string = decoder + ? buffer + (decoder.end() || '') + : Buffer.concat(buffer) + done(null, string) + } + } + + function cleanup () { + buffer = null + + stream.removeListener('aborted', onAborted) + stream.removeListener('data', onData) + stream.removeListener('end', onEnd) + stream.removeListener('error', onEnd) + stream.removeListener('close', cleanup) + } +} diff --git a/node_modules/raw-body/package.json b/node_modules/raw-body/package.json new file mode 100644 index 0000000..dab8203 --- /dev/null +++ b/node_modules/raw-body/package.json @@ -0,0 +1,90 @@ +{ + "_from": "raw-body@2.4.0", + "_id": "raw-body@2.4.0", + "_inBundle": false, + "_integrity": "sha512-4Oz8DUIwdvoa5qMJelxipzi/iJIi40O5cGV1wNYp5hvZP8ZN0T+jiNkL0QepXs+EsQ9XJ8ipEDoiH70ySUJP3Q==", + "_location": "/raw-body", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "raw-body@2.4.0", + "name": "raw-body", + "escapedName": "raw-body", + "rawSpec": "2.4.0", + "saveSpec": null, + "fetchSpec": "2.4.0" + }, + "_requiredBy": [ + "/body-parser" + ], + "_resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.4.0.tgz", + "_shasum": "a1ce6fb9c9bc356ca52e89256ab59059e13d0332", + "_spec": "raw-body@2.4.0", + "_where": "/home/josuer08/Documents/web/node_modules/body-parser", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + "bugs": { + "url": "https://github.com/stream-utils/raw-body/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Raynos", + "email": "raynos2@gmail.com" + } + ], + "dependencies": { + "bytes": "3.1.0", + "http-errors": "1.7.2", + "iconv-lite": "0.4.24", + "unpipe": "1.0.0" + }, + "deprecated": false, + "description": "Get and validate the raw body of a readable stream.", + "devDependencies": { + "bluebird": "3.5.4", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.16.0", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "6.1.3", + "readable-stream": "2.3.6", + "safe-buffer": "5.1.2" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.d.ts", + "index.js" + ], + "homepage": "https://github.com/stream-utils/raw-body#readme", + "license": "MIT", + "name": "raw-body", + "repository": { + "type": "git", + "url": "git+https://github.com/stream-utils/raw-body.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --trace-deprecation --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --trace-deprecation --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --trace-deprecation --reporter spec --check-leaks test/" + }, + "version": "2.4.0" +} diff --git a/node_modules/safe-buffer/LICENSE b/node_modules/safe-buffer/LICENSE new file mode 100644 index 0000000..0c068ce --- /dev/null +++ b/node_modules/safe-buffer/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Feross Aboukhadijeh + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/safe-buffer/README.md b/node_modules/safe-buffer/README.md new file mode 100644 index 0000000..e9a81af --- /dev/null +++ b/node_modules/safe-buffer/README.md @@ -0,0 +1,584 @@ +# safe-buffer [![travis][travis-image]][travis-url] [![npm][npm-image]][npm-url] [![downloads][downloads-image]][downloads-url] [![javascript style guide][standard-image]][standard-url] + +[travis-image]: https://img.shields.io/travis/feross/safe-buffer/master.svg +[travis-url]: https://travis-ci.org/feross/safe-buffer +[npm-image]: https://img.shields.io/npm/v/safe-buffer.svg +[npm-url]: https://npmjs.org/package/safe-buffer +[downloads-image]: https://img.shields.io/npm/dm/safe-buffer.svg +[downloads-url]: https://npmjs.org/package/safe-buffer +[standard-image]: https://img.shields.io/badge/code_style-standard-brightgreen.svg +[standard-url]: https://standardjs.com + +#### Safer Node.js Buffer API + +**Use the new Node.js Buffer APIs (`Buffer.from`, `Buffer.alloc`, +`Buffer.allocUnsafe`, `Buffer.allocUnsafeSlow`) in all versions of Node.js.** + +**Uses the built-in implementation when available.** + +## install + +``` +npm install safe-buffer +``` + +## usage + +The goal of this package is to provide a safe replacement for the node.js `Buffer`. + +It's a drop-in replacement for `Buffer`. You can use it by adding one `require` line to +the top of your node.js modules: + +```js +var Buffer = require('safe-buffer').Buffer + +// Existing buffer code will continue to work without issues: + +new Buffer('hey', 'utf8') +new Buffer([1, 2, 3], 'utf8') +new Buffer(obj) +new Buffer(16) // create an uninitialized buffer (potentially unsafe) + +// But you can use these new explicit APIs to make clear what you want: + +Buffer.from('hey', 'utf8') // convert from many types to a Buffer +Buffer.alloc(16) // create a zero-filled buffer (safe) +Buffer.allocUnsafe(16) // create an uninitialized buffer (potentially unsafe) +``` + +## api + +### Class Method: Buffer.from(array) +<!-- YAML +added: v3.0.0 +--> + +* `array` {Array} + +Allocates a new `Buffer` using an `array` of octets. + +```js +const buf = Buffer.from([0x62,0x75,0x66,0x66,0x65,0x72]); + // creates a new Buffer containing ASCII bytes + // ['b','u','f','f','e','r'] +``` + +A `TypeError` will be thrown if `array` is not an `Array`. + +### Class Method: Buffer.from(arrayBuffer[, byteOffset[, length]]) +<!-- YAML +added: v5.10.0 +--> + +* `arrayBuffer` {ArrayBuffer} The `.buffer` property of a `TypedArray` or + a `new ArrayBuffer()` +* `byteOffset` {Number} Default: `0` +* `length` {Number} Default: `arrayBuffer.length - byteOffset` + +When passed a reference to the `.buffer` property of a `TypedArray` instance, +the newly created `Buffer` will share the same allocated memory as the +TypedArray. + +```js +const arr = new Uint16Array(2); +arr[0] = 5000; +arr[1] = 4000; + +const buf = Buffer.from(arr.buffer); // shares the memory with arr; + +console.log(buf); + // Prints: <Buffer 88 13 a0 0f> + +// changing the TypedArray changes the Buffer also +arr[1] = 6000; + +console.log(buf); + // Prints: <Buffer 88 13 70 17> +``` + +The optional `byteOffset` and `length` arguments specify a memory range within +the `arrayBuffer` that will be shared by the `Buffer`. + +```js +const ab = new ArrayBuffer(10); +const buf = Buffer.from(ab, 0, 2); +console.log(buf.length); + // Prints: 2 +``` + +A `TypeError` will be thrown if `arrayBuffer` is not an `ArrayBuffer`. + +### Class Method: Buffer.from(buffer) +<!-- YAML +added: v3.0.0 +--> + +* `buffer` {Buffer} + +Copies the passed `buffer` data onto a new `Buffer` instance. + +```js +const buf1 = Buffer.from('buffer'); +const buf2 = Buffer.from(buf1); + +buf1[0] = 0x61; +console.log(buf1.toString()); + // 'auffer' +console.log(buf2.toString()); + // 'buffer' (copy is not changed) +``` + +A `TypeError` will be thrown if `buffer` is not a `Buffer`. + +### Class Method: Buffer.from(str[, encoding]) +<!-- YAML +added: v5.10.0 +--> + +* `str` {String} String to encode. +* `encoding` {String} Encoding to use, Default: `'utf8'` + +Creates a new `Buffer` containing the given JavaScript string `str`. If +provided, the `encoding` parameter identifies the character encoding. +If not provided, `encoding` defaults to `'utf8'`. + +```js +const buf1 = Buffer.from('this is a tést'); +console.log(buf1.toString()); + // prints: this is a tést +console.log(buf1.toString('ascii')); + // prints: this is a tC)st + +const buf2 = Buffer.from('7468697320697320612074c3a97374', 'hex'); +console.log(buf2.toString()); + // prints: this is a tést +``` + +A `TypeError` will be thrown if `str` is not a string. + +### Class Method: Buffer.alloc(size[, fill[, encoding]]) +<!-- YAML +added: v5.10.0 +--> + +* `size` {Number} +* `fill` {Value} Default: `undefined` +* `encoding` {String} Default: `utf8` + +Allocates a new `Buffer` of `size` bytes. If `fill` is `undefined`, the +`Buffer` will be *zero-filled*. + +```js +const buf = Buffer.alloc(5); +console.log(buf); + // <Buffer 00 00 00 00 00> +``` + +The `size` must be less than or equal to the value of +`require('buffer').kMaxLength` (on 64-bit architectures, `kMaxLength` is +`(2^31)-1`). Otherwise, a [`RangeError`][] is thrown. A zero-length Buffer will +be created if a `size` less than or equal to 0 is specified. + +If `fill` is specified, the allocated `Buffer` will be initialized by calling +`buf.fill(fill)`. See [`buf.fill()`][] for more information. + +```js +const buf = Buffer.alloc(5, 'a'); +console.log(buf); + // <Buffer 61 61 61 61 61> +``` + +If both `fill` and `encoding` are specified, the allocated `Buffer` will be +initialized by calling `buf.fill(fill, encoding)`. For example: + +```js +const buf = Buffer.alloc(11, 'aGVsbG8gd29ybGQ=', 'base64'); +console.log(buf); + // <Buffer 68 65 6c 6c 6f 20 77 6f 72 6c 64> +``` + +Calling `Buffer.alloc(size)` can be significantly slower than the alternative +`Buffer.allocUnsafe(size)` but ensures that the newly created `Buffer` instance +contents will *never contain sensitive data*. + +A `TypeError` will be thrown if `size` is not a number. + +### Class Method: Buffer.allocUnsafe(size) +<!-- YAML +added: v5.10.0 +--> + +* `size` {Number} + +Allocates a new *non-zero-filled* `Buffer` of `size` bytes. The `size` must +be less than or equal to the value of `require('buffer').kMaxLength` (on 64-bit +architectures, `kMaxLength` is `(2^31)-1`). Otherwise, a [`RangeError`][] is +thrown. A zero-length Buffer will be created if a `size` less than or equal to +0 is specified. + +The underlying memory for `Buffer` instances created in this way is *not +initialized*. The contents of the newly created `Buffer` are unknown and +*may contain sensitive data*. Use [`buf.fill(0)`][] to initialize such +`Buffer` instances to zeroes. + +```js +const buf = Buffer.allocUnsafe(5); +console.log(buf); + // <Buffer 78 e0 82 02 01> + // (octets will be different, every time) +buf.fill(0); +console.log(buf); + // <Buffer 00 00 00 00 00> +``` + +A `TypeError` will be thrown if `size` is not a number. + +Note that the `Buffer` module pre-allocates an internal `Buffer` instance of +size `Buffer.poolSize` that is used as a pool for the fast allocation of new +`Buffer` instances created using `Buffer.allocUnsafe(size)` (and the deprecated +`new Buffer(size)` constructor) only when `size` is less than or equal to +`Buffer.poolSize >> 1` (floor of `Buffer.poolSize` divided by two). The default +value of `Buffer.poolSize` is `8192` but can be modified. + +Use of this pre-allocated internal memory pool is a key difference between +calling `Buffer.alloc(size, fill)` vs. `Buffer.allocUnsafe(size).fill(fill)`. +Specifically, `Buffer.alloc(size, fill)` will *never* use the internal Buffer +pool, while `Buffer.allocUnsafe(size).fill(fill)` *will* use the internal +Buffer pool if `size` is less than or equal to half `Buffer.poolSize`. The +difference is subtle but can be important when an application requires the +additional performance that `Buffer.allocUnsafe(size)` provides. + +### Class Method: Buffer.allocUnsafeSlow(size) +<!-- YAML +added: v5.10.0 +--> + +* `size` {Number} + +Allocates a new *non-zero-filled* and non-pooled `Buffer` of `size` bytes. The +`size` must be less than or equal to the value of +`require('buffer').kMaxLength` (on 64-bit architectures, `kMaxLength` is +`(2^31)-1`). Otherwise, a [`RangeError`][] is thrown. A zero-length Buffer will +be created if a `size` less than or equal to 0 is specified. + +The underlying memory for `Buffer` instances created in this way is *not +initialized*. The contents of the newly created `Buffer` are unknown and +*may contain sensitive data*. Use [`buf.fill(0)`][] to initialize such +`Buffer` instances to zeroes. + +When using `Buffer.allocUnsafe()` to allocate new `Buffer` instances, +allocations under 4KB are, by default, sliced from a single pre-allocated +`Buffer`. This allows applications to avoid the garbage collection overhead of +creating many individually allocated Buffers. This approach improves both +performance and memory usage by eliminating the need to track and cleanup as +many `Persistent` objects. + +However, in the case where a developer may need to retain a small chunk of +memory from a pool for an indeterminate amount of time, it may be appropriate +to create an un-pooled Buffer instance using `Buffer.allocUnsafeSlow()` then +copy out the relevant bits. + +```js +// need to keep around a few small chunks of memory +const store = []; + +socket.on('readable', () => { + const data = socket.read(); + // allocate for retained data + const sb = Buffer.allocUnsafeSlow(10); + // copy the data into the new allocation + data.copy(sb, 0, 0, 10); + store.push(sb); +}); +``` + +Use of `Buffer.allocUnsafeSlow()` should be used only as a last resort *after* +a developer has observed undue memory retention in their applications. + +A `TypeError` will be thrown if `size` is not a number. + +### All the Rest + +The rest of the `Buffer` API is exactly the same as in node.js. +[See the docs](https://nodejs.org/api/buffer.html). + + +## Related links + +- [Node.js issue: Buffer(number) is unsafe](https://github.com/nodejs/node/issues/4660) +- [Node.js Enhancement Proposal: Buffer.from/Buffer.alloc/Buffer.zalloc/Buffer() soft-deprecate](https://github.com/nodejs/node-eps/pull/4) + +## Why is `Buffer` unsafe? + +Today, the node.js `Buffer` constructor is overloaded to handle many different argument +types like `String`, `Array`, `Object`, `TypedArrayView` (`Uint8Array`, etc.), +`ArrayBuffer`, and also `Number`. + +The API is optimized for convenience: you can throw any type at it, and it will try to do +what you want. + +Because the Buffer constructor is so powerful, you often see code like this: + +```js +// Convert UTF-8 strings to hex +function toHex (str) { + return new Buffer(str).toString('hex') +} +``` + +***But what happens if `toHex` is called with a `Number` argument?*** + +### Remote Memory Disclosure + +If an attacker can make your program call the `Buffer` constructor with a `Number` +argument, then they can make it allocate uninitialized memory from the node.js process. +This could potentially disclose TLS private keys, user data, or database passwords. + +When the `Buffer` constructor is passed a `Number` argument, it returns an +**UNINITIALIZED** block of memory of the specified `size`. When you create a `Buffer` like +this, you **MUST** overwrite the contents before returning it to the user. + +From the [node.js docs](https://nodejs.org/api/buffer.html#buffer_new_buffer_size): + +> `new Buffer(size)` +> +> - `size` Number +> +> The underlying memory for `Buffer` instances created in this way is not initialized. +> **The contents of a newly created `Buffer` are unknown and could contain sensitive +> data.** Use `buf.fill(0)` to initialize a Buffer to zeroes. + +(Emphasis our own.) + +Whenever the programmer intended to create an uninitialized `Buffer` you often see code +like this: + +```js +var buf = new Buffer(16) + +// Immediately overwrite the uninitialized buffer with data from another buffer +for (var i = 0; i < buf.length; i++) { + buf[i] = otherBuf[i] +} +``` + + +### Would this ever be a problem in real code? + +Yes. It's surprisingly common to forget to check the type of your variables in a +dynamically-typed language like JavaScript. + +Usually the consequences of assuming the wrong type is that your program crashes with an +uncaught exception. But the failure mode for forgetting to check the type of arguments to +the `Buffer` constructor is more catastrophic. + +Here's an example of a vulnerable service that takes a JSON payload and converts it to +hex: + +```js +// Take a JSON payload {str: "some string"} and convert it to hex +var server = http.createServer(function (req, res) { + var data = '' + req.setEncoding('utf8') + req.on('data', function (chunk) { + data += chunk + }) + req.on('end', function () { + var body = JSON.parse(data) + res.end(new Buffer(body.str).toString('hex')) + }) +}) + +server.listen(8080) +``` + +In this example, an http client just has to send: + +```json +{ + "str": 1000 +} +``` + +and it will get back 1,000 bytes of uninitialized memory from the server. + +This is a very serious bug. It's similar in severity to the +[the Heartbleed bug](http://heartbleed.com/) that allowed disclosure of OpenSSL process +memory by remote attackers. + + +### Which real-world packages were vulnerable? + +#### [`bittorrent-dht`](https://www.npmjs.com/package/bittorrent-dht) + +[Mathias Buus](https://github.com/mafintosh) and I +([Feross Aboukhadijeh](http://feross.org/)) found this issue in one of our own packages, +[`bittorrent-dht`](https://www.npmjs.com/package/bittorrent-dht). The bug would allow +anyone on the internet to send a series of messages to a user of `bittorrent-dht` and get +them to reveal 20 bytes at a time of uninitialized memory from the node.js process. + +Here's +[the commit](https://github.com/feross/bittorrent-dht/commit/6c7da04025d5633699800a99ec3fbadf70ad35b8) +that fixed it. We released a new fixed version, created a +[Node Security Project disclosure](https://nodesecurity.io/advisories/68), and deprecated all +vulnerable versions on npm so users will get a warning to upgrade to a newer version. + +#### [`ws`](https://www.npmjs.com/package/ws) + +That got us wondering if there were other vulnerable packages. Sure enough, within a short +period of time, we found the same issue in [`ws`](https://www.npmjs.com/package/ws), the +most popular WebSocket implementation in node.js. + +If certain APIs were called with `Number` parameters instead of `String` or `Buffer` as +expected, then uninitialized server memory would be disclosed to the remote peer. + +These were the vulnerable methods: + +```js +socket.send(number) +socket.ping(number) +socket.pong(number) +``` + +Here's a vulnerable socket server with some echo functionality: + +```js +server.on('connection', function (socket) { + socket.on('message', function (message) { + message = JSON.parse(message) + if (message.type === 'echo') { + socket.send(message.data) // send back the user's message + } + }) +}) +``` + +`socket.send(number)` called on the server, will disclose server memory. + +Here's [the release](https://github.com/websockets/ws/releases/tag/1.0.1) where the issue +was fixed, with a more detailed explanation. Props to +[Arnout Kazemier](https://github.com/3rd-Eden) for the quick fix. Here's the +[Node Security Project disclosure](https://nodesecurity.io/advisories/67). + + +### What's the solution? + +It's important that node.js offers a fast way to get memory otherwise performance-critical +applications would needlessly get a lot slower. + +But we need a better way to *signal our intent* as programmers. **When we want +uninitialized memory, we should request it explicitly.** + +Sensitive functionality should not be packed into a developer-friendly API that loosely +accepts many different types. This type of API encourages the lazy practice of passing +variables in without checking the type very carefully. + +#### A new API: `Buffer.allocUnsafe(number)` + +The functionality of creating buffers with uninitialized memory should be part of another +API. We propose `Buffer.allocUnsafe(number)`. This way, it's not part of an API that +frequently gets user input of all sorts of different types passed into it. + +```js +var buf = Buffer.allocUnsafe(16) // careful, uninitialized memory! + +// Immediately overwrite the uninitialized buffer with data from another buffer +for (var i = 0; i < buf.length; i++) { + buf[i] = otherBuf[i] +} +``` + + +### How do we fix node.js core? + +We sent [a PR to node.js core](https://github.com/nodejs/node/pull/4514) (merged as +`semver-major`) which defends against one case: + +```js +var str = 16 +new Buffer(str, 'utf8') +``` + +In this situation, it's implied that the programmer intended the first argument to be a +string, since they passed an encoding as a second argument. Today, node.js will allocate +uninitialized memory in the case of `new Buffer(number, encoding)`, which is probably not +what the programmer intended. + +But this is only a partial solution, since if the programmer does `new Buffer(variable)` +(without an `encoding` parameter) there's no way to know what they intended. If `variable` +is sometimes a number, then uninitialized memory will sometimes be returned. + +### What's the real long-term fix? + +We could deprecate and remove `new Buffer(number)` and use `Buffer.allocUnsafe(number)` when +we need uninitialized memory. But that would break 1000s of packages. + +~~We believe the best solution is to:~~ + +~~1. Change `new Buffer(number)` to return safe, zeroed-out memory~~ + +~~2. Create a new API for creating uninitialized Buffers. We propose: `Buffer.allocUnsafe(number)`~~ + +#### Update + +We now support adding three new APIs: + +- `Buffer.from(value)` - convert from any type to a buffer +- `Buffer.alloc(size)` - create a zero-filled buffer +- `Buffer.allocUnsafe(size)` - create an uninitialized buffer with given size + +This solves the core problem that affected `ws` and `bittorrent-dht` which is +`Buffer(variable)` getting tricked into taking a number argument. + +This way, existing code continues working and the impact on the npm ecosystem will be +minimal. Over time, npm maintainers can migrate performance-critical code to use +`Buffer.allocUnsafe(number)` instead of `new Buffer(number)`. + + +### Conclusion + +We think there's a serious design issue with the `Buffer` API as it exists today. It +promotes insecure software by putting high-risk functionality into a convenient API +with friendly "developer ergonomics". + +This wasn't merely a theoretical exercise because we found the issue in some of the +most popular npm packages. + +Fortunately, there's an easy fix that can be applied today. Use `safe-buffer` in place of +`buffer`. + +```js +var Buffer = require('safe-buffer').Buffer +``` + +Eventually, we hope that node.js core can switch to this new, safer behavior. We believe +the impact on the ecosystem would be minimal since it's not a breaking change. +Well-maintained, popular packages would be updated to use `Buffer.alloc` quickly, while +older, insecure packages would magically become safe from this attack vector. + + +## links + +- [Node.js PR: buffer: throw if both length and enc are passed](https://github.com/nodejs/node/pull/4514) +- [Node Security Project disclosure for `ws`](https://nodesecurity.io/advisories/67) +- [Node Security Project disclosure for`bittorrent-dht`](https://nodesecurity.io/advisories/68) + + +## credit + +The original issues in `bittorrent-dht` +([disclosure](https://nodesecurity.io/advisories/68)) and +`ws` ([disclosure](https://nodesecurity.io/advisories/67)) were discovered by +[Mathias Buus](https://github.com/mafintosh) and +[Feross Aboukhadijeh](http://feross.org/). + +Thanks to [Adam Baldwin](https://github.com/evilpacket) for helping disclose these issues +and for his work running the [Node Security Project](https://nodesecurity.io/). + +Thanks to [John Hiesey](https://github.com/jhiesey) for proofreading this README and +auditing the code. + + +## license + +MIT. Copyright (C) [Feross Aboukhadijeh](http://feross.org) diff --git a/node_modules/safe-buffer/index.d.ts b/node_modules/safe-buffer/index.d.ts new file mode 100644 index 0000000..e9fed80 --- /dev/null +++ b/node_modules/safe-buffer/index.d.ts @@ -0,0 +1,187 @@ +declare module "safe-buffer" { + export class Buffer { + length: number + write(string: string, offset?: number, length?: number, encoding?: string): number; + toString(encoding?: string, start?: number, end?: number): string; + toJSON(): { type: 'Buffer', data: any[] }; + equals(otherBuffer: Buffer): boolean; + compare(otherBuffer: Buffer, targetStart?: number, targetEnd?: number, sourceStart?: number, sourceEnd?: number): number; + copy(targetBuffer: Buffer, targetStart?: number, sourceStart?: number, sourceEnd?: number): number; + slice(start?: number, end?: number): Buffer; + writeUIntLE(value: number, offset: number, byteLength: number, noAssert?: boolean): number; + writeUIntBE(value: number, offset: number, byteLength: number, noAssert?: boolean): number; + writeIntLE(value: number, offset: number, byteLength: number, noAssert?: boolean): number; + writeIntBE(value: number, offset: number, byteLength: number, noAssert?: boolean): number; + readUIntLE(offset: number, byteLength: number, noAssert?: boolean): number; + readUIntBE(offset: number, byteLength: number, noAssert?: boolean): number; + readIntLE(offset: number, byteLength: number, noAssert?: boolean): number; + readIntBE(offset: number, byteLength: number, noAssert?: boolean): number; + readUInt8(offset: number, noAssert?: boolean): number; + readUInt16LE(offset: number, noAssert?: boolean): number; + readUInt16BE(offset: number, noAssert?: boolean): number; + readUInt32LE(offset: number, noAssert?: boolean): number; + readUInt32BE(offset: number, noAssert?: boolean): number; + readInt8(offset: number, noAssert?: boolean): number; + readInt16LE(offset: number, noAssert?: boolean): number; + readInt16BE(offset: number, noAssert?: boolean): number; + readInt32LE(offset: number, noAssert?: boolean): number; + readInt32BE(offset: number, noAssert?: boolean): number; + readFloatLE(offset: number, noAssert?: boolean): number; + readFloatBE(offset: number, noAssert?: boolean): number; + readDoubleLE(offset: number, noAssert?: boolean): number; + readDoubleBE(offset: number, noAssert?: boolean): number; + swap16(): Buffer; + swap32(): Buffer; + swap64(): Buffer; + writeUInt8(value: number, offset: number, noAssert?: boolean): number; + writeUInt16LE(value: number, offset: number, noAssert?: boolean): number; + writeUInt16BE(value: number, offset: number, noAssert?: boolean): number; + writeUInt32LE(value: number, offset: number, noAssert?: boolean): number; + writeUInt32BE(value: number, offset: number, noAssert?: boolean): number; + writeInt8(value: number, offset: number, noAssert?: boolean): number; + writeInt16LE(value: number, offset: number, noAssert?: boolean): number; + writeInt16BE(value: number, offset: number, noAssert?: boolean): number; + writeInt32LE(value: number, offset: number, noAssert?: boolean): number; + writeInt32BE(value: number, offset: number, noAssert?: boolean): number; + writeFloatLE(value: number, offset: number, noAssert?: boolean): number; + writeFloatBE(value: number, offset: number, noAssert?: boolean): number; + writeDoubleLE(value: number, offset: number, noAssert?: boolean): number; + writeDoubleBE(value: number, offset: number, noAssert?: boolean): number; + fill(value: any, offset?: number, end?: number): this; + indexOf(value: string | number | Buffer, byteOffset?: number, encoding?: string): number; + lastIndexOf(value: string | number | Buffer, byteOffset?: number, encoding?: string): number; + includes(value: string | number | Buffer, byteOffset?: number, encoding?: string): boolean; + + /** + * Allocates a new buffer containing the given {str}. + * + * @param str String to store in buffer. + * @param encoding encoding to use, optional. Default is 'utf8' + */ + constructor (str: string, encoding?: string); + /** + * Allocates a new buffer of {size} octets. + * + * @param size count of octets to allocate. + */ + constructor (size: number); + /** + * Allocates a new buffer containing the given {array} of octets. + * + * @param array The octets to store. + */ + constructor (array: Uint8Array); + /** + * Produces a Buffer backed by the same allocated memory as + * the given {ArrayBuffer}. + * + * + * @param arrayBuffer The ArrayBuffer with which to share memory. + */ + constructor (arrayBuffer: ArrayBuffer); + /** + * Allocates a new buffer containing the given {array} of octets. + * + * @param array The octets to store. + */ + constructor (array: any[]); + /** + * Copies the passed {buffer} data onto a new {Buffer} instance. + * + * @param buffer The buffer to copy. + */ + constructor (buffer: Buffer); + prototype: Buffer; + /** + * Allocates a new Buffer using an {array} of octets. + * + * @param array + */ + static from(array: any[]): Buffer; + /** + * When passed a reference to the .buffer property of a TypedArray instance, + * the newly created Buffer will share the same allocated memory as the TypedArray. + * The optional {byteOffset} and {length} arguments specify a memory range + * within the {arrayBuffer} that will be shared by the Buffer. + * + * @param arrayBuffer The .buffer property of a TypedArray or a new ArrayBuffer() + * @param byteOffset + * @param length + */ + static from(arrayBuffer: ArrayBuffer, byteOffset?: number, length?: number): Buffer; + /** + * Copies the passed {buffer} data onto a new Buffer instance. + * + * @param buffer + */ + static from(buffer: Buffer): Buffer; + /** + * Creates a new Buffer containing the given JavaScript string {str}. + * If provided, the {encoding} parameter identifies the character encoding. + * If not provided, {encoding} defaults to 'utf8'. + * + * @param str + */ + static from(str: string, encoding?: string): Buffer; + /** + * Returns true if {obj} is a Buffer + * + * @param obj object to test. + */ + static isBuffer(obj: any): obj is Buffer; + /** + * Returns true if {encoding} is a valid encoding argument. + * Valid string encodings in Node 0.12: 'ascii'|'utf8'|'utf16le'|'ucs2'(alias of 'utf16le')|'base64'|'binary'(deprecated)|'hex' + * + * @param encoding string to test. + */ + static isEncoding(encoding: string): boolean; + /** + * Gives the actual byte length of a string. encoding defaults to 'utf8'. + * This is not the same as String.prototype.length since that returns the number of characters in a string. + * + * @param string string to test. + * @param encoding encoding used to evaluate (defaults to 'utf8') + */ + static byteLength(string: string, encoding?: string): number; + /** + * Returns a buffer which is the result of concatenating all the buffers in the list together. + * + * If the list has no items, or if the totalLength is 0, then it returns a zero-length buffer. + * If the list has exactly one item, then the first item of the list is returned. + * If the list has more than one item, then a new Buffer is created. + * + * @param list An array of Buffer objects to concatenate + * @param totalLength Total length of the buffers when concatenated. + * If totalLength is not provided, it is read from the buffers in the list. However, this adds an additional loop to the function, so it is faster to provide the length explicitly. + */ + static concat(list: Buffer[], totalLength?: number): Buffer; + /** + * The same as buf1.compare(buf2). + */ + static compare(buf1: Buffer, buf2: Buffer): number; + /** + * Allocates a new buffer of {size} octets. + * + * @param size count of octets to allocate. + * @param fill if specified, buffer will be initialized by calling buf.fill(fill). + * If parameter is omitted, buffer will be filled with zeros. + * @param encoding encoding used for call to buf.fill while initalizing + */ + static alloc(size: number, fill?: string | Buffer | number, encoding?: string): Buffer; + /** + * Allocates a new buffer of {size} octets, leaving memory not initialized, so the contents + * of the newly created Buffer are unknown and may contain sensitive data. + * + * @param size count of octets to allocate + */ + static allocUnsafe(size: number): Buffer; + /** + * Allocates a new non-pooled buffer of {size} octets, leaving memory not initialized, so the contents + * of the newly created Buffer are unknown and may contain sensitive data. + * + * @param size count of octets to allocate + */ + static allocUnsafeSlow(size: number): Buffer; + } +} \ No newline at end of file diff --git a/node_modules/safe-buffer/index.js b/node_modules/safe-buffer/index.js new file mode 100644 index 0000000..22438da --- /dev/null +++ b/node_modules/safe-buffer/index.js @@ -0,0 +1,62 @@ +/* eslint-disable node/no-deprecated-api */ +var buffer = require('buffer') +var Buffer = buffer.Buffer + +// alternative to using Object.keys for old browsers +function copyProps (src, dst) { + for (var key in src) { + dst[key] = src[key] + } +} +if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { + module.exports = buffer +} else { + // Copy properties from require('buffer') + copyProps(buffer, exports) + exports.Buffer = SafeBuffer +} + +function SafeBuffer (arg, encodingOrOffset, length) { + return Buffer(arg, encodingOrOffset, length) +} + +// Copy static methods from Buffer +copyProps(Buffer, SafeBuffer) + +SafeBuffer.from = function (arg, encodingOrOffset, length) { + if (typeof arg === 'number') { + throw new TypeError('Argument must not be a number') + } + return Buffer(arg, encodingOrOffset, length) +} + +SafeBuffer.alloc = function (size, fill, encoding) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') + } + var buf = Buffer(size) + if (fill !== undefined) { + if (typeof encoding === 'string') { + buf.fill(fill, encoding) + } else { + buf.fill(fill) + } + } else { + buf.fill(0) + } + return buf +} + +SafeBuffer.allocUnsafe = function (size) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') + } + return Buffer(size) +} + +SafeBuffer.allocUnsafeSlow = function (size) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') + } + return buffer.SlowBuffer(size) +} diff --git a/node_modules/safe-buffer/package.json b/node_modules/safe-buffer/package.json new file mode 100644 index 0000000..6a8eea1 --- /dev/null +++ b/node_modules/safe-buffer/package.json @@ -0,0 +1,63 @@ +{ + "_from": "safe-buffer@5.1.2", + "_id": "safe-buffer@5.1.2", + "_inBundle": false, + "_integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==", + "_location": "/safe-buffer", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "safe-buffer@5.1.2", + "name": "safe-buffer", + "escapedName": "safe-buffer", + "rawSpec": "5.1.2", + "saveSpec": null, + "fetchSpec": "5.1.2" + }, + "_requiredBy": [ + "/content-disposition", + "/express" + ], + "_resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "_shasum": "991ec69d296e0313747d59bdfd2b745c35f8828d", + "_spec": "safe-buffer@5.1.2", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Feross Aboukhadijeh", + "email": "feross@feross.org", + "url": "http://feross.org" + }, + "bugs": { + "url": "https://github.com/feross/safe-buffer/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Safer Node.js Buffer API", + "devDependencies": { + "standard": "*", + "tape": "^4.0.0" + }, + "homepage": "https://github.com/feross/safe-buffer", + "keywords": [ + "buffer", + "buffer allocate", + "node security", + "safe", + "safe-buffer", + "security", + "uninitialized" + ], + "license": "MIT", + "main": "index.js", + "name": "safe-buffer", + "repository": { + "type": "git", + "url": "git://github.com/feross/safe-buffer.git" + }, + "scripts": { + "test": "standard && tape test/*.js" + }, + "types": "index.d.ts", + "version": "5.1.2" +} diff --git a/node_modules/safer-buffer/LICENSE b/node_modules/safer-buffer/LICENSE new file mode 100644 index 0000000..4fe9e6f --- /dev/null +++ b/node_modules/safer-buffer/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2018 Nikita Skovoroda <chalkerx@gmail.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/safer-buffer/Porting-Buffer.md b/node_modules/safer-buffer/Porting-Buffer.md new file mode 100644 index 0000000..68d86ba --- /dev/null +++ b/node_modules/safer-buffer/Porting-Buffer.md @@ -0,0 +1,268 @@ +# Porting to the Buffer.from/Buffer.alloc API + +<a id="overview"></a> +## Overview + +- [Variant 1: Drop support for Node.js ⤠4.4.x and 5.0.0 â 5.9.x.](#variant-1) (*recommended*) +- [Variant 2: Use a polyfill](#variant-2) +- [Variant 3: manual detection, with safeguards](#variant-3) + +### Finding problematic bits of code using grep + +Just run `grep -nrE '[^a-zA-Z](Slow)?Buffer\s*\(' --exclude-dir node_modules`. + +It will find all the potentially unsafe places in your own code (with some considerably unlikely +exceptions). + +### Finding problematic bits of code using Node.js 8 + +If youâre using Node.js ⥠8.0.0 (which is recommended), Node.js exposes multiple options that help with finding the relevant pieces of code: + +- `--trace-warnings` will make Node.js show a stack trace for this warning and other warnings that are printed by Node.js. +- `--trace-deprecation` does the same thing, but only for deprecation warnings. +- `--pending-deprecation` will show more types of deprecation warnings. In particular, it will show the `Buffer()` deprecation warning, even on Node.js 8. + +You can set these flags using an environment variable: + +```console +$ export NODE_OPTIONS='--trace-warnings --pending-deprecation' +$ cat example.js +'use strict'; +const foo = new Buffer('foo'); +$ node example.js +(node:7147) [DEP0005] DeprecationWarning: The Buffer() and new Buffer() constructors are not recommended for use due to security and usability concerns. Please use the new Buffer.alloc(), Buffer.allocUnsafe(), or Buffer.from() construction methods instead. + at showFlaggedDeprecation (buffer.js:127:13) + at new Buffer (buffer.js:148:3) + at Object.<anonymous> (/path/to/example.js:2:13) + [... more stack trace lines ...] +``` + +### Finding problematic bits of code using linters + +Eslint rules [no-buffer-constructor](https://eslint.org/docs/rules/no-buffer-constructor) +or +[node/no-deprecated-api](https://github.com/mysticatea/eslint-plugin-node/blob/master/docs/rules/no-deprecated-api.md) +also find calls to deprecated `Buffer()` API. Those rules are included in some pre-sets. + +There is a drawback, though, that it doesn't always +[work correctly](https://github.com/chalker/safer-buffer#why-not-safe-buffer) when `Buffer` is +overriden e.g. with a polyfill, so recommended is a combination of this and some other method +described above. + +<a id="variant-1"></a> +## Variant 1: Drop support for Node.js ⤠4.4.x and 5.0.0 â 5.9.x. + +This is the recommended solution nowadays that would imply only minimal overhead. + +The Node.js 5.x release line has been unsupported since July 2016, and the Node.js 4.x release line reaches its End of Life in April 2018 (â [Schedule](https://github.com/nodejs/Release#release-schedule)). This means that these versions of Node.js will *not* receive any updates, even in case of security issues, so using these release lines should be avoided, if at all possible. + +What you would do in this case is to convert all `new Buffer()` or `Buffer()` calls to use `Buffer.alloc()` or `Buffer.from()`, in the following way: + +- For `new Buffer(number)`, replace it with `Buffer.alloc(number)`. +- For `new Buffer(string)` (or `new Buffer(string, encoding)`), replace it with `Buffer.from(string)` (or `Buffer.from(string, encoding)`). +- For all other combinations of arguments (these are much rarer), also replace `new Buffer(...arguments)` with `Buffer.from(...arguments)`. + +Note that `Buffer.alloc()` is also _faster_ on the current Node.js versions than +`new Buffer(size).fill(0)`, which is what you would otherwise need to ensure zero-filling. + +Enabling eslint rule [no-buffer-constructor](https://eslint.org/docs/rules/no-buffer-constructor) +or +[node/no-deprecated-api](https://github.com/mysticatea/eslint-plugin-node/blob/master/docs/rules/no-deprecated-api.md) +is recommended to avoid accidential unsafe Buffer API usage. + +There is also a [JSCodeshift codemod](https://github.com/joyeecheung/node-dep-codemod#dep005) +for automatically migrating Buffer constructors to `Buffer.alloc()` or `Buffer.from()`. +Note that it currently only works with cases where the arguments are literals or where the +constructor is invoked with two arguments. + +_If you currently support those older Node.js versions and dropping them would be a semver-major change +for you, or if you support older branches of your packages, consider using [Variant 2](#variant-2) +or [Variant 3](#variant-3) on older branches, so people using those older branches will also receive +the fix. That way, you will eradicate potential issues caused by unguarded Buffer API usage and +your users will not observe a runtime deprecation warning when running your code on Node.js 10._ + +<a id="variant-2"></a> +## Variant 2: Use a polyfill + +Utilize [safer-buffer](https://www.npmjs.com/package/safer-buffer) as a polyfill to support older +Node.js versions. + +You would take exacly the same steps as in [Variant 1](#variant-1), but with a polyfill +`const Buffer = require('safer-buffer').Buffer` in all files where you use the new `Buffer` api. + +Make sure that you do not use old `new Buffer` API â in any files where the line above is added, +using old `new Buffer()` API will _throw_. It will be easy to notice that in CI, though. + +Alternatively, you could use [buffer-from](https://www.npmjs.com/package/buffer-from) and/or +[buffer-alloc](https://www.npmjs.com/package/buffer-alloc) [ponyfills](https://ponyfill.com/) â +those are great, the only downsides being 4 deps in the tree and slightly more code changes to +migrate off them (as you would be using e.g. `Buffer.from` under a different name). If you need only +`Buffer.from` polyfilled â `buffer-from` alone which comes with no extra dependencies. + +_Alternatively, you could use [safe-buffer](https://www.npmjs.com/package/safe-buffer) â it also +provides a polyfill, but takes a different approach which has +[it's drawbacks](https://github.com/chalker/safer-buffer#why-not-safe-buffer). It will allow you +to also use the older `new Buffer()` API in your code, though â but that's arguably a benefit, as +it is problematic, can cause issues in your code, and will start emitting runtime deprecation +warnings starting with Node.js 10._ + +Note that in either case, it is important that you also remove all calls to the old Buffer +API manually â just throwing in `safe-buffer` doesn't fix the problem by itself, it just provides +a polyfill for the new API. I have seen people doing that mistake. + +Enabling eslint rule [no-buffer-constructor](https://eslint.org/docs/rules/no-buffer-constructor) +or +[node/no-deprecated-api](https://github.com/mysticatea/eslint-plugin-node/blob/master/docs/rules/no-deprecated-api.md) +is recommended. + +_Don't forget to drop the polyfill usage once you drop support for Node.js < 4.5.0._ + +<a id="variant-3"></a> +## Variant 3 â manual detection, with safeguards + +This is useful if you create Buffer instances in only a few places (e.g. one), or you have your own +wrapper around them. + +### Buffer(0) + +This special case for creating empty buffers can be safely replaced with `Buffer.concat([])`, which +returns the same result all the way down to Node.js 0.8.x. + +### Buffer(notNumber) + +Before: + +```js +var buf = new Buffer(notNumber, encoding); +``` + +After: + +```js +var buf; +if (Buffer.from && Buffer.from !== Uint8Array.from) { + buf = Buffer.from(notNumber, encoding); +} else { + if (typeof notNumber === 'number') + throw new Error('The "size" argument must be of type number.'); + buf = new Buffer(notNumber, encoding); +} +``` + +`encoding` is optional. + +Note that the `typeof notNumber` before `new Buffer` is required (for cases when `notNumber` argument is not +hard-coded) and _is not caused by the deprecation of Buffer constructor_ â it's exactly _why_ the +Buffer constructor is deprecated. Ecosystem packages lacking this type-check caused numereous +security issues â situations when unsanitized user input could end up in the `Buffer(arg)` create +problems ranging from DoS to leaking sensitive information to the attacker from the process memory. + +When `notNumber` argument is hardcoded (e.g. literal `"abc"` or `[0,1,2]`), the `typeof` check can +be omitted. + +Also note that using TypeScript does not fix this problem for you â when libs written in +`TypeScript` are used from JS, or when user input ends up there â it behaves exactly as pure JS, as +all type checks are translation-time only and are not present in the actual JS code which TS +compiles to. + +### Buffer(number) + +For Node.js 0.10.x (and below) support: + +```js +var buf; +if (Buffer.alloc) { + buf = Buffer.alloc(number); +} else { + buf = new Buffer(number); + buf.fill(0); +} +``` + +Otherwise (Node.js ⥠0.12.x): + +```js +const buf = Buffer.alloc ? Buffer.alloc(number) : new Buffer(number).fill(0); +``` + +## Regarding Buffer.allocUnsafe + +Be extra cautious when using `Buffer.allocUnsafe`: + * Don't use it if you don't have a good reason to + * e.g. you probably won't ever see a performance difference for small buffers, in fact, those + might be even faster with `Buffer.alloc()`, + * if your code is not in the hot code path â you also probably won't notice a difference, + * keep in mind that zero-filling minimizes the potential risks. + * If you use it, make sure that you never return the buffer in a partially-filled state, + * if you are writing to it sequentially â always truncate it to the actuall written length + +Errors in handling buffers allocated with `Buffer.allocUnsafe` could result in various issues, +ranged from undefined behaviour of your code to sensitive data (user input, passwords, certs) +leaking to the remote attacker. + +_Note that the same applies to `new Buffer` usage without zero-filling, depending on the Node.js +version (and lacking type checks also adds DoS to the list of potential problems)._ + +<a id="faq"></a> +## FAQ + +<a id="design-flaws"></a> +### What is wrong with the `Buffer` constructor? + +The `Buffer` constructor could be used to create a buffer in many different ways: + +- `new Buffer(42)` creates a `Buffer` of 42 bytes. Before Node.js 8, this buffer contained + *arbitrary memory* for performance reasons, which could include anything ranging from + program source code to passwords and encryption keys. +- `new Buffer('abc')` creates a `Buffer` that contains the UTF-8-encoded version of + the string `'abc'`. A second argument could specify another encoding: For example, + `new Buffer(string, 'base64')` could be used to convert a Base64 string into the original + sequence of bytes that it represents. +- There are several other combinations of arguments. + +This meant that, in code like `var buffer = new Buffer(foo);`, *it is not possible to tell +what exactly the contents of the generated buffer are* without knowing the type of `foo`. + +Sometimes, the value of `foo` comes from an external source. For example, this function +could be exposed as a service on a web server, converting a UTF-8 string into its Base64 form: + +``` +function stringToBase64(req, res) { + // The request body should have the format of `{ string: 'foobar' }` + const rawBytes = new Buffer(req.body.string) + const encoded = rawBytes.toString('base64') + res.end({ encoded: encoded }) +} +``` + +Note that this code does *not* validate the type of `req.body.string`: + +- `req.body.string` is expected to be a string. If this is the case, all goes well. +- `req.body.string` is controlled by the client that sends the request. +- If `req.body.string` is the *number* `50`, the `rawBytes` would be 50 bytes: + - Before Node.js 8, the content would be uninitialized + - After Node.js 8, the content would be `50` bytes with the value `0` + +Because of the missing type check, an attacker could intentionally send a number +as part of the request. Using this, they can either: + +- Read uninitialized memory. This **will** leak passwords, encryption keys and other + kinds of sensitive information. (Information leak) +- Force the program to allocate a large amount of memory. For example, when specifying + `500000000` as the input value, each request will allocate 500MB of memory. + This can be used to either exhaust the memory available of a program completely + and make it crash, or slow it down significantly. (Denial of Service) + +Both of these scenarios are considered serious security issues in a real-world +web server context. + +when using `Buffer.from(req.body.string)` instead, passing a number will always +throw an exception instead, giving a controlled behaviour that can always be +handled by the program. + +<a id="ecosystem-usage"></a> +### The `Buffer()` constructor has been deprecated for a while. Is this really an issue? + +Surveys of code in the `npm` ecosystem have shown that the `Buffer()` constructor is still +widely used. This includes new code, and overall usage of such code has actually been +*increasing*. diff --git a/node_modules/safer-buffer/Readme.md b/node_modules/safer-buffer/Readme.md new file mode 100644 index 0000000..14b0822 --- /dev/null +++ b/node_modules/safer-buffer/Readme.md @@ -0,0 +1,156 @@ +# safer-buffer [![travis][travis-image]][travis-url] [![npm][npm-image]][npm-url] [![javascript style guide][standard-image]][standard-url] [![Security Responsible Disclosure][secuirty-image]][secuirty-url] + +[travis-image]: https://travis-ci.org/ChALkeR/safer-buffer.svg?branch=master +[travis-url]: https://travis-ci.org/ChALkeR/safer-buffer +[npm-image]: https://img.shields.io/npm/v/safer-buffer.svg +[npm-url]: https://npmjs.org/package/safer-buffer +[standard-image]: https://img.shields.io/badge/code_style-standard-brightgreen.svg +[standard-url]: https://standardjs.com +[secuirty-image]: https://img.shields.io/badge/Security-Responsible%20Disclosure-green.svg +[secuirty-url]: https://github.com/nodejs/security-wg/blob/master/processes/responsible_disclosure_template.md + +Modern Buffer API polyfill without footguns, working on Node.js from 0.8 to current. + +## How to use? + +First, port all `Buffer()` and `new Buffer()` calls to `Buffer.alloc()` and `Buffer.from()` API. + +Then, to achieve compatibility with outdated Node.js versions (`<4.5.0` and 5.x `<5.9.0`), use +`const Buffer = require('safer-buffer').Buffer` in all files where you make calls to the new +Buffer API. _Use `var` instead of `const` if you need that for your Node.js version range support._ + +Also, see the +[porting Buffer](https://github.com/ChALkeR/safer-buffer/blob/master/Porting-Buffer.md) guide. + +## Do I need it? + +Hopefully, not â dropping support for outdated Node.js versions should be fine nowdays, and that +is the recommended path forward. You _do_ need to port to the `Buffer.alloc()` and `Buffer.from()` +though. + +See the [porting guide](https://github.com/ChALkeR/safer-buffer/blob/master/Porting-Buffer.md) +for a better description. + +## Why not [safe-buffer](https://npmjs.com/safe-buffer)? + +_In short: while `safe-buffer` serves as a polyfill for the new API, it allows old API usage and +itself contains footguns._ + +`safe-buffer` could be used safely to get the new API while still keeping support for older +Node.js versions (like this module), but while analyzing ecosystem usage of the old Buffer API +I found out that `safe-buffer` is itself causing problems in some cases. + +For example, consider the following snippet: + +```console +$ cat example.unsafe.js +console.log(Buffer(20)) +$ ./node-v6.13.0-linux-x64/bin/node example.unsafe.js +<Buffer 0a 00 00 00 00 00 00 00 28 13 de 02 00 00 00 00 05 00 00 00> +$ standard example.unsafe.js +standard: Use JavaScript Standard Style (https://standardjs.com) + /home/chalker/repo/safer-buffer/example.unsafe.js:2:13: 'Buffer()' was deprecated since v6. Use 'Buffer.alloc()' or 'Buffer.from()' (use 'https://www.npmjs.com/package/safe-buffer' for '<4.5.0') instead. +``` + +This is allocates and writes to console an uninitialized chunk of memory. +[standard](https://www.npmjs.com/package/standard) linter (among others) catch that and warn people +to avoid using unsafe API. + +Let's now throw in `safe-buffer`! + +```console +$ cat example.safe-buffer.js +const Buffer = require('safe-buffer').Buffer +console.log(Buffer(20)) +$ standard example.safe-buffer.js +$ ./node-v6.13.0-linux-x64/bin/node example.safe-buffer.js +<Buffer 08 00 00 00 00 00 00 00 28 58 01 82 fe 7f 00 00 00 00 00 00> +``` + +See the problem? Adding in `safe-buffer` _magically removes the lint warning_, but the behavior +remains identiÑal to what we had before, and when launched on Node.js 6.x LTS â this dumps out +chunks of uninitialized memory. +_And this code will still emit runtime warnings on Node.js 10.x and above._ + +That was done by design. I first considered changing `safe-buffer`, prohibiting old API usage or +emitting warnings on it, but that significantly diverges from `safe-buffer` design. After some +discussion, it was decided to move my approach into a separate package, and _this is that separate +package_. + +This footgun is not imaginary â I observed top-downloaded packages doing that kind of thing, +«fixing» the lint warning by blindly including `safe-buffer` without any actual changes. + +Also in some cases, even if the API _was_ migrated to use of safe Buffer API â a random pull request +can bring unsafe Buffer API usage back to the codebase by adding new calls â and that could go +unnoticed even if you have a linter prohibiting that (becase of the reason stated above), and even +pass CI. _I also observed that being done in popular packages._ + +Some examples: + * [webdriverio](https://github.com/webdriverio/webdriverio/commit/05cbd3167c12e4930f09ef7cf93b127ba4effae4#diff-124380949022817b90b622871837d56cR31) + (a module with 548 759 downloads/month), + * [websocket-stream](https://github.com/maxogden/websocket-stream/commit/c9312bd24d08271687d76da0fe3c83493871cf61) + (218 288 d/m, fix in [maxogden/websocket-stream#142](https://github.com/maxogden/websocket-stream/pull/142)), + * [node-serialport](https://github.com/node-serialport/node-serialport/commit/e8d9d2b16c664224920ce1c895199b1ce2def48c) + (113 138 d/m, fix in [node-serialport/node-serialport#1510](https://github.com/node-serialport/node-serialport/pull/1510)), + * [karma](https://github.com/karma-runner/karma/commit/3d94b8cf18c695104ca195334dc75ff054c74eec) + (3 973 193 d/m, fix in [karma-runner/karma#2947](https://github.com/karma-runner/karma/pull/2947)), + * [spdy-transport](https://github.com/spdy-http2/spdy-transport/commit/5375ac33f4a62a4f65bcfc2827447d42a5dbe8b1) + (5 970 727 d/m, fix in [spdy-http2/spdy-transport#53](https://github.com/spdy-http2/spdy-transport/pull/53)). + * And there are a lot more over the ecosystem. + +I filed a PR at +[mysticatea/eslint-plugin-node#110](https://github.com/mysticatea/eslint-plugin-node/pull/110) to +partially fix that (for cases when that lint rule is used), but it is a semver-major change for +linter rules and presets, so it would take significant time for that to reach actual setups. +_It also hasn't been released yet (2018-03-20)._ + +Also, `safer-buffer` discourages the usage of `.allocUnsafe()`, which is often done by a mistake. +It still supports it with an explicit concern barier, by placing it under +`require('safer-buffer/dangereous')`. + +## But isn't throwing bad? + +Not really. It's an error that could be noticed and fixed early, instead of causing havoc later like +unguarded `new Buffer()` calls that end up receiving user input can do. + +This package affects only the files where `var Buffer = require('safer-buffer').Buffer` was done, so +it is really simple to keep track of things and make sure that you don't mix old API usage with that. +Also, CI should hint anything that you might have missed. + +New commits, if tested, won't land new usage of unsafe Buffer API this way. +_Node.js 10.x also deals with that by printing a runtime depecation warning._ + +### Would it affect third-party modules? + +No, unless you explicitly do an awful thing like monkey-patching or overriding the built-in `Buffer`. +Don't do that. + +### But I don't want throwing⦠+ +That is also fine! + +Also, it could be better in some cases when you don't comprehensive enough test coverage. + +In that case â just don't override `Buffer` and use +`var SaferBuffer = require('safer-buffer').Buffer` instead. + +That way, everything using `Buffer` natively would still work, but there would be two drawbacks: + +* `Buffer.from`/`Buffer.alloc` won't be polyfilled â use `SaferBuffer.from` and + `SaferBuffer.alloc` instead. +* You are still open to accidentally using the insecure deprecated API â use a linter to catch that. + +Note that using a linter to catch accidential `Buffer` constructor usage in this case is strongly +recommended. `Buffer` is not overriden in this usecase, so linters won't get confused. + +## «Without footguns»? + +Well, it is still possible to do _some_ things with `Buffer` API, e.g. accessing `.buffer` property +on older versions and duping things from there. You shouldn't do that in your code, probabably. + +The intention is to remove the most significant footguns that affect lots of packages in the +ecosystem, and to do it in the proper way. + +Also, this package doesn't protect against security issues affecting some Node.js versions, so for +usage in your own production code, it is still recommended to update to a Node.js version +[supported by upstream](https://github.com/nodejs/release#release-schedule). diff --git a/node_modules/safer-buffer/dangerous.js b/node_modules/safer-buffer/dangerous.js new file mode 100644 index 0000000..ca41fdc --- /dev/null +++ b/node_modules/safer-buffer/dangerous.js @@ -0,0 +1,58 @@ +/* eslint-disable node/no-deprecated-api */ + +'use strict' + +var buffer = require('buffer') +var Buffer = buffer.Buffer +var safer = require('./safer.js') +var Safer = safer.Buffer + +var dangerous = {} + +var key + +for (key in safer) { + if (!safer.hasOwnProperty(key)) continue + dangerous[key] = safer[key] +} + +var Dangereous = dangerous.Buffer = {} + +// Copy Safer API +for (key in Safer) { + if (!Safer.hasOwnProperty(key)) continue + Dangereous[key] = Safer[key] +} + +// Copy those missing unsafe methods, if they are present +for (key in Buffer) { + if (!Buffer.hasOwnProperty(key)) continue + if (Dangereous.hasOwnProperty(key)) continue + Dangereous[key] = Buffer[key] +} + +if (!Dangereous.allocUnsafe) { + Dangereous.allocUnsafe = function (size) { + if (typeof size !== 'number') { + throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) + } + if (size < 0 || size >= 2 * (1 << 30)) { + throw new RangeError('The value "' + size + '" is invalid for option "size"') + } + return Buffer(size) + } +} + +if (!Dangereous.allocUnsafeSlow) { + Dangereous.allocUnsafeSlow = function (size) { + if (typeof size !== 'number') { + throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) + } + if (size < 0 || size >= 2 * (1 << 30)) { + throw new RangeError('The value "' + size + '" is invalid for option "size"') + } + return buffer.SlowBuffer(size) + } +} + +module.exports = dangerous diff --git a/node_modules/safer-buffer/package.json b/node_modules/safer-buffer/package.json new file mode 100644 index 0000000..d93bf77 --- /dev/null +++ b/node_modules/safer-buffer/package.json @@ -0,0 +1,60 @@ +{ + "_from": "safer-buffer@>= 2.1.2 < 3", + "_id": "safer-buffer@2.1.2", + "_inBundle": false, + "_integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==", + "_location": "/safer-buffer", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "safer-buffer@>= 2.1.2 < 3", + "name": "safer-buffer", + "escapedName": "safer-buffer", + "rawSpec": ">= 2.1.2 < 3", + "saveSpec": null, + "fetchSpec": ">= 2.1.2 < 3" + }, + "_requiredBy": [ + "/iconv-lite" + ], + "_resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", + "_shasum": "44fa161b0187b9549dd84bb91802f9bd8385cd6a", + "_spec": "safer-buffer@>= 2.1.2 < 3", + "_where": "/home/josuer08/Documents/web/node_modules/iconv-lite", + "author": { + "name": "Nikita Skovoroda", + "email": "chalkerx@gmail.com", + "url": "https://github.com/ChALkeR" + }, + "bugs": { + "url": "https://github.com/ChALkeR/safer-buffer/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Modern Buffer API polyfill without footguns", + "devDependencies": { + "standard": "^11.0.1", + "tape": "^4.9.0" + }, + "files": [ + "Porting-Buffer.md", + "Readme.md", + "tests.js", + "dangerous.js", + "safer.js" + ], + "homepage": "https://github.com/ChALkeR/safer-buffer#readme", + "license": "MIT", + "main": "safer.js", + "name": "safer-buffer", + "repository": { + "type": "git", + "url": "git+https://github.com/ChALkeR/safer-buffer.git" + }, + "scripts": { + "browserify-test": "browserify --external tape tests.js > browserify-tests.js && tape browserify-tests.js", + "test": "standard && tape tests.js" + }, + "version": "2.1.2" +} diff --git a/node_modules/safer-buffer/safer.js b/node_modules/safer-buffer/safer.js new file mode 100644 index 0000000..37c7e1a --- /dev/null +++ b/node_modules/safer-buffer/safer.js @@ -0,0 +1,77 @@ +/* eslint-disable node/no-deprecated-api */ + +'use strict' + +var buffer = require('buffer') +var Buffer = buffer.Buffer + +var safer = {} + +var key + +for (key in buffer) { + if (!buffer.hasOwnProperty(key)) continue + if (key === 'SlowBuffer' || key === 'Buffer') continue + safer[key] = buffer[key] +} + +var Safer = safer.Buffer = {} +for (key in Buffer) { + if (!Buffer.hasOwnProperty(key)) continue + if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue + Safer[key] = Buffer[key] +} + +safer.Buffer.prototype = Buffer.prototype + +if (!Safer.from || Safer.from === Uint8Array.from) { + Safer.from = function (value, encodingOrOffset, length) { + if (typeof value === 'number') { + throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) + } + if (value && typeof value.length === 'undefined') { + throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) + } + return Buffer(value, encodingOrOffset, length) + } +} + +if (!Safer.alloc) { + Safer.alloc = function (size, fill, encoding) { + if (typeof size !== 'number') { + throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) + } + if (size < 0 || size >= 2 * (1 << 30)) { + throw new RangeError('The value "' + size + '" is invalid for option "size"') + } + var buf = Buffer(size) + if (!fill || fill.length === 0) { + buf.fill(0) + } else if (typeof encoding === 'string') { + buf.fill(fill, encoding) + } else { + buf.fill(fill) + } + return buf + } +} + +if (!safer.kStringMaxLength) { + try { + safer.kStringMaxLength = process.binding('buffer').kStringMaxLength + } catch (e) { + // we can't determine kStringMaxLength in environments where process.binding + // is unsupported, so let's not set it + } +} + +if (!safer.constants) { + safer.constants = { + MAX_LENGTH: safer.kMaxLength + } + if (safer.kStringMaxLength) { + safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength + } +} + +module.exports = safer diff --git a/node_modules/safer-buffer/tests.js b/node_modules/safer-buffer/tests.js new file mode 100644 index 0000000..7ed2777 --- /dev/null +++ b/node_modules/safer-buffer/tests.js @@ -0,0 +1,406 @@ +/* eslint-disable node/no-deprecated-api */ + +'use strict' + +var test = require('tape') + +var buffer = require('buffer') + +var index = require('./') +var safer = require('./safer') +var dangerous = require('./dangerous') + +/* Inheritance tests */ + +test('Default is Safer', function (t) { + t.equal(index, safer) + t.notEqual(safer, dangerous) + t.notEqual(index, dangerous) + t.end() +}) + +test('Is not a function', function (t) { + [index, safer, dangerous].forEach(function (impl) { + t.equal(typeof impl, 'object') + t.equal(typeof impl.Buffer, 'object') + }); + [buffer].forEach(function (impl) { + t.equal(typeof impl, 'object') + t.equal(typeof impl.Buffer, 'function') + }) + t.end() +}) + +test('Constructor throws', function (t) { + [index, safer, dangerous].forEach(function (impl) { + t.throws(function () { impl.Buffer() }) + t.throws(function () { impl.Buffer(0) }) + t.throws(function () { impl.Buffer('a') }) + t.throws(function () { impl.Buffer('a', 'utf-8') }) + t.throws(function () { return new impl.Buffer() }) + t.throws(function () { return new impl.Buffer(0) }) + t.throws(function () { return new impl.Buffer('a') }) + t.throws(function () { return new impl.Buffer('a', 'utf-8') }) + }) + t.end() +}) + +test('Safe methods exist', function (t) { + [index, safer, dangerous].forEach(function (impl) { + t.equal(typeof impl.Buffer.alloc, 'function', 'alloc') + t.equal(typeof impl.Buffer.from, 'function', 'from') + }) + t.end() +}) + +test('Unsafe methods exist only in Dangerous', function (t) { + [index, safer].forEach(function (impl) { + t.equal(typeof impl.Buffer.allocUnsafe, 'undefined') + t.equal(typeof impl.Buffer.allocUnsafeSlow, 'undefined') + }); + [dangerous].forEach(function (impl) { + t.equal(typeof impl.Buffer.allocUnsafe, 'function') + t.equal(typeof impl.Buffer.allocUnsafeSlow, 'function') + }) + t.end() +}) + +test('Generic methods/properties are defined and equal', function (t) { + ['poolSize', 'isBuffer', 'concat', 'byteLength'].forEach(function (method) { + [index, safer, dangerous].forEach(function (impl) { + t.equal(impl.Buffer[method], buffer.Buffer[method], method) + t.notEqual(typeof impl.Buffer[method], 'undefined', method) + }) + }) + t.end() +}) + +test('Built-in buffer static methods/properties are inherited', function (t) { + Object.keys(buffer).forEach(function (method) { + if (method === 'SlowBuffer' || method === 'Buffer') return; + [index, safer, dangerous].forEach(function (impl) { + t.equal(impl[method], buffer[method], method) + t.notEqual(typeof impl[method], 'undefined', method) + }) + }) + t.end() +}) + +test('Built-in Buffer static methods/properties are inherited', function (t) { + Object.keys(buffer.Buffer).forEach(function (method) { + if (method === 'allocUnsafe' || method === 'allocUnsafeSlow') return; + [index, safer, dangerous].forEach(function (impl) { + t.equal(impl.Buffer[method], buffer.Buffer[method], method) + t.notEqual(typeof impl.Buffer[method], 'undefined', method) + }) + }) + t.end() +}) + +test('.prototype property of Buffer is inherited', function (t) { + [index, safer, dangerous].forEach(function (impl) { + t.equal(impl.Buffer.prototype, buffer.Buffer.prototype, 'prototype') + t.notEqual(typeof impl.Buffer.prototype, 'undefined', 'prototype') + }) + t.end() +}) + +test('All Safer methods are present in Dangerous', function (t) { + Object.keys(safer).forEach(function (method) { + if (method === 'Buffer') return; + [index, safer, dangerous].forEach(function (impl) { + t.equal(impl[method], safer[method], method) + if (method !== 'kStringMaxLength') { + t.notEqual(typeof impl[method], 'undefined', method) + } + }) + }) + Object.keys(safer.Buffer).forEach(function (method) { + [index, safer, dangerous].forEach(function (impl) { + t.equal(impl.Buffer[method], safer.Buffer[method], method) + t.notEqual(typeof impl.Buffer[method], 'undefined', method) + }) + }) + t.end() +}) + +test('Safe methods from Dangerous methods are present in Safer', function (t) { + Object.keys(dangerous).forEach(function (method) { + if (method === 'Buffer') return; + [index, safer, dangerous].forEach(function (impl) { + t.equal(impl[method], dangerous[method], method) + if (method !== 'kStringMaxLength') { + t.notEqual(typeof impl[method], 'undefined', method) + } + }) + }) + Object.keys(dangerous.Buffer).forEach(function (method) { + if (method === 'allocUnsafe' || method === 'allocUnsafeSlow') return; + [index, safer, dangerous].forEach(function (impl) { + t.equal(impl.Buffer[method], dangerous.Buffer[method], method) + t.notEqual(typeof impl.Buffer[method], 'undefined', method) + }) + }) + t.end() +}) + +/* Behaviour tests */ + +test('Methods return Buffers', function (t) { + [index, safer, dangerous].forEach(function (impl) { + t.ok(buffer.Buffer.isBuffer(impl.Buffer.alloc(0))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.alloc(0, 10))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.alloc(0, 'a'))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.alloc(10))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.alloc(10, 'x'))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.alloc(9, 'ab'))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.from(''))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.from('string'))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.from('string', 'utf-8'))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.from('b25ldHdvdGhyZWU=', 'base64'))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.from([0, 42, 3]))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.from(new Uint8Array([0, 42, 3])))) + t.ok(buffer.Buffer.isBuffer(impl.Buffer.from([]))) + }); + ['allocUnsafe', 'allocUnsafeSlow'].forEach(function (method) { + t.ok(buffer.Buffer.isBuffer(dangerous.Buffer[method](0))) + t.ok(buffer.Buffer.isBuffer(dangerous.Buffer[method](10))) + }) + t.end() +}) + +test('Constructor is buffer.Buffer', function (t) { + [index, safer, dangerous].forEach(function (impl) { + t.equal(impl.Buffer.alloc(0).constructor, buffer.Buffer) + t.equal(impl.Buffer.alloc(0, 10).constructor, buffer.Buffer) + t.equal(impl.Buffer.alloc(0, 'a').constructor, buffer.Buffer) + t.equal(impl.Buffer.alloc(10).constructor, buffer.Buffer) + t.equal(impl.Buffer.alloc(10, 'x').constructor, buffer.Buffer) + t.equal(impl.Buffer.alloc(9, 'ab').constructor, buffer.Buffer) + t.equal(impl.Buffer.from('').constructor, buffer.Buffer) + t.equal(impl.Buffer.from('string').constructor, buffer.Buffer) + t.equal(impl.Buffer.from('string', 'utf-8').constructor, buffer.Buffer) + t.equal(impl.Buffer.from('b25ldHdvdGhyZWU=', 'base64').constructor, buffer.Buffer) + t.equal(impl.Buffer.from([0, 42, 3]).constructor, buffer.Buffer) + t.equal(impl.Buffer.from(new Uint8Array([0, 42, 3])).constructor, buffer.Buffer) + t.equal(impl.Buffer.from([]).constructor, buffer.Buffer) + }); + [0, 10, 100].forEach(function (arg) { + t.equal(dangerous.Buffer.allocUnsafe(arg).constructor, buffer.Buffer) + t.equal(dangerous.Buffer.allocUnsafeSlow(arg).constructor, buffer.SlowBuffer(0).constructor) + }) + t.end() +}) + +test('Invalid calls throw', function (t) { + [index, safer, dangerous].forEach(function (impl) { + t.throws(function () { impl.Buffer.from(0) }) + t.throws(function () { impl.Buffer.from(10) }) + t.throws(function () { impl.Buffer.from(10, 'utf-8') }) + t.throws(function () { impl.Buffer.from('string', 'invalid encoding') }) + t.throws(function () { impl.Buffer.from(-10) }) + t.throws(function () { impl.Buffer.from(1e90) }) + t.throws(function () { impl.Buffer.from(Infinity) }) + t.throws(function () { impl.Buffer.from(-Infinity) }) + t.throws(function () { impl.Buffer.from(NaN) }) + t.throws(function () { impl.Buffer.from(null) }) + t.throws(function () { impl.Buffer.from(undefined) }) + t.throws(function () { impl.Buffer.from() }) + t.throws(function () { impl.Buffer.from({}) }) + t.throws(function () { impl.Buffer.alloc('') }) + t.throws(function () { impl.Buffer.alloc('string') }) + t.throws(function () { impl.Buffer.alloc('string', 'utf-8') }) + t.throws(function () { impl.Buffer.alloc('b25ldHdvdGhyZWU=', 'base64') }) + t.throws(function () { impl.Buffer.alloc(-10) }) + t.throws(function () { impl.Buffer.alloc(1e90) }) + t.throws(function () { impl.Buffer.alloc(2 * (1 << 30)) }) + t.throws(function () { impl.Buffer.alloc(Infinity) }) + t.throws(function () { impl.Buffer.alloc(-Infinity) }) + t.throws(function () { impl.Buffer.alloc(null) }) + t.throws(function () { impl.Buffer.alloc(undefined) }) + t.throws(function () { impl.Buffer.alloc() }) + t.throws(function () { impl.Buffer.alloc([]) }) + t.throws(function () { impl.Buffer.alloc([0, 42, 3]) }) + t.throws(function () { impl.Buffer.alloc({}) }) + }); + ['allocUnsafe', 'allocUnsafeSlow'].forEach(function (method) { + t.throws(function () { dangerous.Buffer[method]('') }) + t.throws(function () { dangerous.Buffer[method]('string') }) + t.throws(function () { dangerous.Buffer[method]('string', 'utf-8') }) + t.throws(function () { dangerous.Buffer[method](2 * (1 << 30)) }) + t.throws(function () { dangerous.Buffer[method](Infinity) }) + if (dangerous.Buffer[method] === buffer.Buffer.allocUnsafe) { + t.skip('Skipping, older impl of allocUnsafe coerced negative sizes to 0') + } else { + t.throws(function () { dangerous.Buffer[method](-10) }) + t.throws(function () { dangerous.Buffer[method](-1e90) }) + t.throws(function () { dangerous.Buffer[method](-Infinity) }) + } + t.throws(function () { dangerous.Buffer[method](null) }) + t.throws(function () { dangerous.Buffer[method](undefined) }) + t.throws(function () { dangerous.Buffer[method]() }) + t.throws(function () { dangerous.Buffer[method]([]) }) + t.throws(function () { dangerous.Buffer[method]([0, 42, 3]) }) + t.throws(function () { dangerous.Buffer[method]({}) }) + }) + t.end() +}) + +test('Buffers have appropriate lengths', function (t) { + [index, safer, dangerous].forEach(function (impl) { + t.equal(impl.Buffer.alloc(0).length, 0) + t.equal(impl.Buffer.alloc(10).length, 10) + t.equal(impl.Buffer.from('').length, 0) + t.equal(impl.Buffer.from('string').length, 6) + t.equal(impl.Buffer.from('string', 'utf-8').length, 6) + t.equal(impl.Buffer.from('b25ldHdvdGhyZWU=', 'base64').length, 11) + t.equal(impl.Buffer.from([0, 42, 3]).length, 3) + t.equal(impl.Buffer.from(new Uint8Array([0, 42, 3])).length, 3) + t.equal(impl.Buffer.from([]).length, 0) + }); + ['allocUnsafe', 'allocUnsafeSlow'].forEach(function (method) { + t.equal(dangerous.Buffer[method](0).length, 0) + t.equal(dangerous.Buffer[method](10).length, 10) + }) + t.end() +}) + +test('Buffers have appropriate lengths (2)', function (t) { + t.equal(index.Buffer.alloc, safer.Buffer.alloc) + t.equal(index.Buffer.alloc, dangerous.Buffer.alloc) + var ok = true; + [ safer.Buffer.alloc, + dangerous.Buffer.allocUnsafe, + dangerous.Buffer.allocUnsafeSlow + ].forEach(function (method) { + for (var i = 0; i < 1e2; i++) { + var length = Math.round(Math.random() * 1e5) + var buf = method(length) + if (!buffer.Buffer.isBuffer(buf)) ok = false + if (buf.length !== length) ok = false + } + }) + t.ok(ok) + t.end() +}) + +test('.alloc(size) is zero-filled and has correct length', function (t) { + t.equal(index.Buffer.alloc, safer.Buffer.alloc) + t.equal(index.Buffer.alloc, dangerous.Buffer.alloc) + var ok = true + for (var i = 0; i < 1e2; i++) { + var length = Math.round(Math.random() * 2e6) + var buf = index.Buffer.alloc(length) + if (!buffer.Buffer.isBuffer(buf)) ok = false + if (buf.length !== length) ok = false + var j + for (j = 0; j < length; j++) { + if (buf[j] !== 0) ok = false + } + buf.fill(1) + for (j = 0; j < length; j++) { + if (buf[j] !== 1) ok = false + } + } + t.ok(ok) + t.end() +}) + +test('.allocUnsafe / .allocUnsafeSlow are fillable and have correct lengths', function (t) { + ['allocUnsafe', 'allocUnsafeSlow'].forEach(function (method) { + var ok = true + for (var i = 0; i < 1e2; i++) { + var length = Math.round(Math.random() * 2e6) + var buf = dangerous.Buffer[method](length) + if (!buffer.Buffer.isBuffer(buf)) ok = false + if (buf.length !== length) ok = false + buf.fill(0, 0, length) + var j + for (j = 0; j < length; j++) { + if (buf[j] !== 0) ok = false + } + buf.fill(1, 0, length) + for (j = 0; j < length; j++) { + if (buf[j] !== 1) ok = false + } + } + t.ok(ok, method) + }) + t.end() +}) + +test('.alloc(size, fill) is `fill`-filled', function (t) { + t.equal(index.Buffer.alloc, safer.Buffer.alloc) + t.equal(index.Buffer.alloc, dangerous.Buffer.alloc) + var ok = true + for (var i = 0; i < 1e2; i++) { + var length = Math.round(Math.random() * 2e6) + var fill = Math.round(Math.random() * 255) + var buf = index.Buffer.alloc(length, fill) + if (!buffer.Buffer.isBuffer(buf)) ok = false + if (buf.length !== length) ok = false + for (var j = 0; j < length; j++) { + if (buf[j] !== fill) ok = false + } + } + t.ok(ok) + t.end() +}) + +test('.alloc(size, fill) is `fill`-filled', function (t) { + t.equal(index.Buffer.alloc, safer.Buffer.alloc) + t.equal(index.Buffer.alloc, dangerous.Buffer.alloc) + var ok = true + for (var i = 0; i < 1e2; i++) { + var length = Math.round(Math.random() * 2e6) + var fill = Math.round(Math.random() * 255) + var buf = index.Buffer.alloc(length, fill) + if (!buffer.Buffer.isBuffer(buf)) ok = false + if (buf.length !== length) ok = false + for (var j = 0; j < length; j++) { + if (buf[j] !== fill) ok = false + } + } + t.ok(ok) + t.deepEqual(index.Buffer.alloc(9, 'a'), index.Buffer.alloc(9, 97)) + t.notDeepEqual(index.Buffer.alloc(9, 'a'), index.Buffer.alloc(9, 98)) + + var tmp = new buffer.Buffer(2) + tmp.fill('ok') + if (tmp[1] === tmp[0]) { + // Outdated Node.js + t.deepEqual(index.Buffer.alloc(5, 'ok'), index.Buffer.from('ooooo')) + } else { + t.deepEqual(index.Buffer.alloc(5, 'ok'), index.Buffer.from('okoko')) + } + t.notDeepEqual(index.Buffer.alloc(5, 'ok'), index.Buffer.from('kokok')) + + t.end() +}) + +test('safer.Buffer.from returns results same as Buffer constructor', function (t) { + [index, safer, dangerous].forEach(function (impl) { + t.deepEqual(impl.Buffer.from(''), new buffer.Buffer('')) + t.deepEqual(impl.Buffer.from('string'), new buffer.Buffer('string')) + t.deepEqual(impl.Buffer.from('string', 'utf-8'), new buffer.Buffer('string', 'utf-8')) + t.deepEqual(impl.Buffer.from('b25ldHdvdGhyZWU=', 'base64'), new buffer.Buffer('b25ldHdvdGhyZWU=', 'base64')) + t.deepEqual(impl.Buffer.from([0, 42, 3]), new buffer.Buffer([0, 42, 3])) + t.deepEqual(impl.Buffer.from(new Uint8Array([0, 42, 3])), new buffer.Buffer(new Uint8Array([0, 42, 3]))) + t.deepEqual(impl.Buffer.from([]), new buffer.Buffer([])) + }) + t.end() +}) + +test('safer.Buffer.from returns consistent results', function (t) { + [index, safer, dangerous].forEach(function (impl) { + t.deepEqual(impl.Buffer.from(''), impl.Buffer.alloc(0)) + t.deepEqual(impl.Buffer.from([]), impl.Buffer.alloc(0)) + t.deepEqual(impl.Buffer.from(new Uint8Array([])), impl.Buffer.alloc(0)) + t.deepEqual(impl.Buffer.from('string', 'utf-8'), impl.Buffer.from('string')) + t.deepEqual(impl.Buffer.from('string'), impl.Buffer.from([115, 116, 114, 105, 110, 103])) + t.deepEqual(impl.Buffer.from('string'), impl.Buffer.from(impl.Buffer.from('string'))) + t.deepEqual(impl.Buffer.from('b25ldHdvdGhyZWU=', 'base64'), impl.Buffer.from('onetwothree')) + t.notDeepEqual(impl.Buffer.from('b25ldHdvdGhyZWU='), impl.Buffer.from('onetwothree')) + }) + t.end() +}) diff --git a/node_modules/send/HISTORY.md b/node_modules/send/HISTORY.md new file mode 100644 index 0000000..d14ac06 --- /dev/null +++ b/node_modules/send/HISTORY.md @@ -0,0 +1,496 @@ +0.17.1 / 2019-05-10 +=================== + + * Set stricter CSP header in redirect & error responses + * deps: range-parser@~1.2.1 + +0.17.0 / 2019-05-03 +=================== + + * deps: http-errors@~1.7.2 + - Set constructor name when possible + - Use `toidentifier` module to make class names + - deps: depd@~1.1.2 + - deps: setprototypeof@1.1.1 + - deps: statuses@'>= 1.5.0 < 2' + * deps: mime@1.6.0 + - Add extensions for JPEG-2000 images + - Add new `font/*` types from IANA + - Add WASM mapping + - Update `.bdoc` to `application/bdoc` + - Update `.bmp` to `image/bmp` + - Update `.m4a` to `audio/mp4` + - Update `.rtf` to `application/rtf` + - Update `.wav` to `audio/wav` + - Update `.xml` to `application/xml` + - Update generic extensions to `application/octet-stream`: + `.deb`, `.dll`, `.dmg`, `.exe`, `.iso`, `.msi` + - Use mime-score module to resolve extension conflicts + * deps: ms@2.1.1 + - Add `week`/`w` support + - Fix negative number handling + * deps: statuses@~1.5.0 + * perf: remove redundant `path.normalize` call + +0.16.2 / 2018-02-07 +=================== + + * Fix incorrect end tag in default error & redirects + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: encodeurl@~1.0.2 + - Fix encoding `%` as last character + * deps: statuses@~1.4.0 + +0.16.1 / 2017-09-29 +=================== + + * Fix regression in edge-case behavior for empty `path` + +0.16.0 / 2017-09-27 +=================== + + * Add `immutable` option + * Fix missing `</html>` in default error & redirects + * Use instance methods on steam to check for listeners + * deps: mime@1.4.1 + - Add 70 new types for file extensions + - Set charset as "UTF-8" for .js and .json + * perf: improve path validation speed + +0.15.6 / 2017-09-22 +=================== + + * deps: debug@2.6.9 + * perf: improve `If-Match` token parsing + +0.15.5 / 2017-09-20 +=================== + + * deps: etag@~1.8.1 + - perf: replace regular expression with substring + * deps: fresh@0.5.2 + - Fix handling of modified headers with invalid dates + - perf: improve ETag match loop + - perf: improve `If-None-Match` token parsing + +0.15.4 / 2017-08-05 +=================== + + * deps: debug@2.6.8 + * deps: depd@~1.1.1 + - Remove unnecessary `Buffer` loading + * deps: http-errors@~1.6.2 + - deps: depd@1.1.1 + +0.15.3 / 2017-05-16 +=================== + + * deps: debug@2.6.7 + - deps: ms@2.0.0 + * deps: ms@2.0.0 + +0.15.2 / 2017-04-26 +=================== + + * deps: debug@2.6.4 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@0.7.3 + * deps: ms@1.0.0 + +0.15.1 / 2017-03-04 +=================== + + * Fix issue when `Date.parse` does not return `NaN` on invalid date + * Fix strict violation in broken environments + +0.15.0 / 2017-02-25 +=================== + + * Support `If-Match` and `If-Unmodified-Since` headers + * Add `res` and `path` arguments to `directory` event + * Remove usage of `res._headers` private field + - Improves compatibility with Node.js 8 nightly + * Send complete HTML document in redirect & error responses + * Set default CSP header in redirect & error responses + * Use `res.getHeaderNames()` when available + * Use `res.headersSent` when available + * deps: debug@2.6.1 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable set to `3` or higher + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: etag@~1.8.0 + * deps: fresh@0.5.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - perf: delay reading header values until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove duplicate conditional + - perf: remove unnecessary boolean coercions + - perf: skip checking modified time if ETag check failed + - perf: skip parsing `If-None-Match` when no `ETag` header + - perf: use `Date.parse` instead of `new Date` + * deps: http-errors@~1.6.1 + - Make `message` property enumerable for `HttpError`s + - deps: setprototypeof@1.0.3 + +0.14.2 / 2017-01-23 +=================== + + * deps: http-errors@~1.5.1 + - deps: inherits@2.0.3 + - deps: setprototypeof@1.0.2 + - deps: statuses@'>= 1.3.1 < 2' + * deps: ms@0.7.2 + * deps: statuses@~1.3.1 + +0.14.1 / 2016-06-09 +=================== + + * Fix redirect error when `path` contains raw non-URL characters + * Fix redirect when `path` starts with multiple forward slashes + +0.14.0 / 2016-06-06 +=================== + + * Add `acceptRanges` option + * Add `cacheControl` option + * Attempt to combine multiple ranges into single range + * Correctly inherit from `Stream` class + * Fix `Content-Range` header in 416 responses when using `start`/`end` options + * Fix `Content-Range` header missing from default 416 responses + * Ignore non-byte `Range` headers + * deps: http-errors@~1.5.0 + - Add `HttpError` export, for `err instanceof createError.HttpError` + - Support new code `421 Misdirected Request` + - Use `setprototypeof` module to replace `__proto__` setting + - deps: inherits@2.0.1 + - deps: statuses@'>= 1.3.0 < 2' + - perf: enable strict mode + * deps: range-parser@~1.2.0 + - Fix incorrectly returning -1 when there is at least one valid range + - perf: remove internal function + * deps: statuses@~1.3.0 + - Add `421 Misdirected Request` + - perf: enable strict mode + * perf: remove argument reassignment + +0.13.2 / 2016-03-05 +=================== + + * Fix invalid `Content-Type` header when `send.mime.default_type` unset + +0.13.1 / 2016-01-16 +=================== + + * deps: depd@~1.1.0 + - Support web browser loading + - perf: enable strict mode + * deps: destroy@~1.0.4 + - perf: enable strict mode + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + * deps: range-parser@~1.0.3 + - perf: enable strict mode + +0.13.0 / 2015-06-16 +=================== + + * Allow Node.js HTTP server to set `Date` response header + * Fix incorrectly removing `Content-Location` on 304 response + * Improve the default redirect response headers + * Send appropriate headers on default error response + * Use `http-errors` for standard emitted errors + * Use `statuses` instead of `http` module for status messages + * deps: escape-html@1.0.2 + * deps: etag@~1.7.0 + - Improve stat performance by removing hashing + * deps: fresh@0.3.0 + - Add weak `ETag` matching support + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * perf: enable strict mode + * perf: remove unnecessary array allocations + +0.12.3 / 2015-05-13 +=================== + + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: depd@~1.0.1 + * deps: etag@~1.6.0 + - Improve support for JXcore + - Support "fake" stats objects in environments without `fs` + * deps: ms@0.7.1 + - Prevent extraordinarily long inputs + * deps: on-finished@~2.2.1 + +0.12.2 / 2015-03-13 +=================== + + * Throw errors early for invalid `extensions` or `index` options + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + +0.12.1 / 2015-02-17 +=================== + + * Fix regression sending zero-length files + +0.12.0 / 2015-02-16 +=================== + + * Always read the stat size from the file + * Fix mutating passed-in `options` + * deps: mime@1.3.4 + +0.11.1 / 2015-01-20 +=================== + + * Fix `root` path disclosure + +0.11.0 / 2015-01-05 +=================== + + * deps: debug@~2.1.1 + * deps: etag@~1.5.1 + - deps: crc@3.2.1 + * deps: ms@0.7.0 + - Add `milliseconds` + - Add `msecs` + - Add `secs` + - Add `mins` + - Add `hrs` + - Add `yrs` + * deps: on-finished@~2.2.0 + +0.10.1 / 2014-10-22 +=================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + +0.10.0 / 2014-10-15 +=================== + + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + * deps: etag@~1.5.0 + - Improve string performance + - Slightly improve speed for weak ETags over 1KB + +0.9.3 / 2014-09-24 +================== + + * deps: etag@~1.4.0 + - Support "fake" stats objects + +0.9.2 / 2014-09-15 +================== + + * deps: depd@0.4.5 + * deps: etag@~1.3.1 + * deps: range-parser@~1.0.2 + +0.9.1 / 2014-09-07 +================== + + * deps: fresh@0.2.4 + +0.9.0 / 2014-09-07 +================== + + * Add `lastModified` option + * Use `etag` to generate `ETag` header + * deps: debug@~2.0.0 + +0.8.5 / 2014-09-04 +================== + + * Fix malicious path detection for empty string path + +0.8.4 / 2014-09-04 +================== + + * Fix a path traversal issue when using `root` + +0.8.3 / 2014-08-16 +================== + + * deps: destroy@1.0.3 + - renamed from dethroy + * deps: on-finished@2.1.0 + +0.8.2 / 2014-08-14 +================== + + * Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + * deps: dethroy@1.0.2 + +0.8.1 / 2014-08-05 +================== + + * Fix `extensions` behavior when file already has extension + +0.8.0 / 2014-08-05 +================== + + * Add `extensions` option + +0.7.4 / 2014-08-04 +================== + + * Fix serving index files without root dir + +0.7.3 / 2014-07-29 +================== + + * Fix incorrect 403 on Windows and Node.js 0.11 + +0.7.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +0.7.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +0.7.0 / 2014-07-20 +================== + + * Deprecate `hidden` option; use `dotfiles` option + * Add `dotfiles` option + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + +0.6.0 / 2014-07-11 +================== + + * Deprecate `from` option; use `root` option + * Deprecate `send.etag()` -- use `etag` in `options` + * Deprecate `send.hidden()` -- use `hidden` in `options` + * Deprecate `send.index()` -- use `index` in `options` + * Deprecate `send.maxage()` -- use `maxAge` in `options` + * Deprecate `send.root()` -- use `root` in `options` + * Cap `maxAge` value to 1 year + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + +0.5.0 / 2014-06-28 +================== + + * Accept string for `maxAge` (converted by `ms`) + * Add `headers` event + * Include link in default redirect response + * Use `EventEmitter.listenerCount` to count listeners + +0.4.3 / 2014-06-11 +================== + + * Do not throw un-catchable error on file open race condition + * Use `escape-html` for HTML escaping + * deps: debug@1.0.2 + - fix some debugging output colors on node.js 0.8 + * deps: finished@1.2.2 + * deps: fresh@0.2.2 + +0.4.2 / 2014-06-09 +================== + + * fix "event emitter leak" warnings + * deps: debug@1.0.1 + * deps: finished@1.2.1 + +0.4.1 / 2014-06-02 +================== + + * Send `max-age` in `Cache-Control` in correct format + +0.4.0 / 2014-05-27 +================== + + * Calculate ETag with md5 for reduced collisions + * Fix wrong behavior when index file matches directory + * Ignore stream errors after request ends + - Goodbye `EBADF, read` + * Skip directories in index file search + * deps: debug@0.8.1 + +0.3.0 / 2014-04-24 +================== + + * Fix sending files with dots without root set + * Coerce option types + * Accept API options in options object + * Set etags to "weak" + * Include file path in etag + * Make "Can't set headers after they are sent." catchable + * Send full entity-body for multi range requests + * Default directory access to 403 when index disabled + * Support multiple index paths + * Support "If-Range" header + * Control whether to generate etags + * deps: mime@1.2.11 + +0.2.0 / 2014-01-29 +================== + + * update range-parser and fresh + +0.1.4 / 2013-08-11 +================== + + * update fresh + +0.1.3 / 2013-07-08 +================== + + * Revert "Fix fd leak" + +0.1.2 / 2013-07-03 +================== + + * Fix fd leak + +0.1.0 / 2012-08-25 +================== + + * add options parameter to send() that is passed to fs.createReadStream() [kanongil] + +0.0.4 / 2012-08-16 +================== + + * allow custom "Accept-Ranges" definition + +0.0.3 / 2012-07-16 +================== + + * fix normalization of the root directory. Closes #3 + +0.0.2 / 2012-07-09 +================== + + * add passing of req explicitly for now (YUCK) + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/send/LICENSE b/node_modules/send/LICENSE new file mode 100644 index 0000000..4aa69e8 --- /dev/null +++ b/node_modules/send/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012 TJ Holowaychuk +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/send/README.md b/node_modules/send/README.md new file mode 100644 index 0000000..179e8c3 --- /dev/null +++ b/node_modules/send/README.md @@ -0,0 +1,329 @@ +# send + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Send is a library for streaming files from the file system as a http response +supporting partial responses (Ranges), conditional-GET negotiation (If-Match, +If-Unmodified-Since, If-None-Match, If-Modified-Since), high test coverage, +and granular events which may be leveraged to take appropriate actions in your +application or framework. + +Looking to serve up entire folders mapped to URLs? Try [serve-static](https://www.npmjs.org/package/serve-static). + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install send +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var send = require('send') +``` + +### send(req, path, [options]) + +Create a new `SendStream` for the given path to send to a `res`. The `req` is +the Node.js HTTP request and the `path` is a urlencoded path to send (urlencoded, +not the actual file-system path). + +#### Options + +##### acceptRanges + +Enable or disable accepting ranged requests, defaults to true. +Disabling this will not send `Accept-Ranges` and ignore the contents +of the `Range` request header. + +##### cacheControl + +Enable or disable setting `Cache-Control` response header, defaults to +true. Disabling this will ignore the `immutable` and `maxAge` options. + +##### dotfiles + +Set how "dotfiles" are treated when encountered. A dotfile is a file +or directory that begins with a dot ("."). Note this check is done on +the path itself without checking if the path actually exists on the +disk. If `root` is specified, only the dotfiles above the root are +checked (i.e. the root itself can be within a dotfile when when set +to "deny"). + + - `'allow'` No special treatment for dotfiles. + - `'deny'` Send a 403 for any request for a dotfile. + - `'ignore'` Pretend like the dotfile does not exist and 404. + +The default value is _similar_ to `'ignore'`, with the exception that +this default will not ignore the files within a directory that begins +with a dot, for backward-compatibility. + +##### end + +Byte offset at which the stream ends, defaults to the length of the file +minus 1. The end is inclusive in the stream, meaning `end: 3` will include +the 4th byte in the stream. + +##### etag + +Enable or disable etag generation, defaults to true. + +##### extensions + +If a given file doesn't exist, try appending one of the given extensions, +in the given order. By default, this is disabled (set to `false`). An +example value that will serve extension-less HTML files: `['html', 'htm']`. +This is skipped if the requested file already has an extension. + +##### immutable + +Enable or diable the `immutable` directive in the `Cache-Control` response +header, defaults to `false`. If set to `true`, the `maxAge` option should +also be specified to enable caching. The `immutable` directive will prevent +supported clients from making conditional requests during the life of the +`maxAge` option to check if the file has changed. + +##### index + +By default send supports "index.html" files, to disable this +set `false` or to supply a new index pass a string or an array +in preferred order. + +##### lastModified + +Enable or disable `Last-Modified` header, defaults to true. Uses the file +system's last modified value. + +##### maxAge + +Provide a max-age in milliseconds for http caching, defaults to 0. +This can also be a string accepted by the +[ms](https://www.npmjs.org/package/ms#readme) module. + +##### root + +Serve files relative to `path`. + +##### start + +Byte offset at which the stream starts, defaults to 0. The start is inclusive, +meaning `start: 2` will include the 3rd byte in the stream. + +#### Events + +The `SendStream` is an event emitter and will emit the following events: + + - `error` an error occurred `(err)` + - `directory` a directory was requested `(res, path)` + - `file` a file was requested `(path, stat)` + - `headers` the headers are about to be set on a file `(res, path, stat)` + - `stream` file streaming has started `(stream)` + - `end` streaming has completed + +#### .pipe + +The `pipe` method is used to pipe the response into the Node.js HTTP response +object, typically `send(req, path, options).pipe(res)`. + +### .mime + +The `mime` export is the global instance of of the +[`mime` npm module](https://www.npmjs.com/package/mime). + +This is used to configure the MIME types that are associated with file extensions +as well as other options for how to resolve the MIME type of a file (like the +default type to use for an unknown file extension). + +## Error-handling + +By default when no `error` listeners are present an automatic response will be +made, otherwise you have full control over the response, aka you may show a 5xx +page etc. + +## Caching + +It does _not_ perform internal caching, you should use a reverse proxy cache +such as Varnish for this, or those fancy things called CDNs. If your +application is small enough that it would benefit from single-node memory +caching, it's small enough that it does not need caching at all ;). + +## Debugging + +To enable `debug()` instrumentation output export __DEBUG__: + +``` +$ DEBUG=send node app +``` + +## Running tests + +``` +$ npm install +$ npm test +``` + +## Examples + +### Serve a specific file + +This simple example will send a specific file to all requests. + +```js +var http = require('http') +var send = require('send') + +var server = http.createServer(function onRequest (req, res) { + send(req, '/path/to/index.html') + .pipe(res) +}) + +server.listen(3000) +``` + +### Serve all files from a directory + +This simple example will just serve up all the files in a +given directory as the top-level. For example, a request +`GET /foo.txt` will send back `/www/public/foo.txt`. + +```js +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +var server = http.createServer(function onRequest (req, res) { + send(req, parseUrl(req).pathname, { root: '/www/public' }) + .pipe(res) +}) + +server.listen(3000) +``` + +### Custom file types + +```js +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +// Default unknown types to text/plain +send.mime.default_type = 'text/plain' + +// Add a custom type +send.mime.define({ + 'application/x-my-type': ['x-mt', 'x-mtt'] +}) + +var server = http.createServer(function onRequest (req, res) { + send(req, parseUrl(req).pathname, { root: '/www/public' }) + .pipe(res) +}) + +server.listen(3000) +``` + +### Custom directory index view + +This is a example of serving up a structure of directories with a +custom function to render a listing of a directory. + +```js +var http = require('http') +var fs = require('fs') +var parseUrl = require('parseurl') +var send = require('send') + +// Transfer arbitrary files from within /www/example.com/public/* +// with a custom handler for directory listing +var server = http.createServer(function onRequest (req, res) { + send(req, parseUrl(req).pathname, { index: false, root: '/www/public' }) + .once('directory', directory) + .pipe(res) +}) + +server.listen(3000) + +// Custom directory handler +function directory (res, path) { + var stream = this + + // redirect to trailing slash for consistent url + if (!stream.hasTrailingSlash()) { + return stream.redirect(path) + } + + // get directory list + fs.readdir(path, function onReaddir (err, list) { + if (err) return stream.error(err) + + // render an index for the directory + res.setHeader('Content-Type', 'text/plain; charset=UTF-8') + res.end(list.join('\n') + '\n') + }) +} +``` + +### Serving from a root directory with custom error-handling + +```js +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +var server = http.createServer(function onRequest (req, res) { + // your custom error-handling logic: + function error (err) { + res.statusCode = err.status || 500 + res.end(err.message) + } + + // your custom headers + function headers (res, path, stat) { + // serve all files for download + res.setHeader('Content-Disposition', 'attachment') + } + + // your custom directory handling logic: + function redirect () { + res.statusCode = 301 + res.setHeader('Location', req.url + '/') + res.end('Redirecting to ' + req.url + '/') + } + + // transfer arbitrary files from within + // /www/example.com/public/* + send(req, parseUrl(req).pathname, { root: '/www/public' }) + .on('error', error) + .on('directory', redirect) + .on('headers', headers) + .pipe(res) +}) + +server.listen(3000) +``` + +## License + +[MIT](LICENSE) + +[appveyor-image]: https://badgen.net/appveyor/ci/dougwilson/send/master?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/send +[coveralls-image]: https://badgen.net/coveralls/c/github/pillarjs/send/master +[coveralls-url]: https://coveralls.io/r/pillarjs/send?branch=master +[node-image]: https://badgen.net/npm/node/send +[node-url]: https://nodejs.org/en/download/ +[npm-downloads-image]: https://badgen.net/npm/dm/send +[npm-url]: https://npmjs.org/package/send +[npm-version-image]: https://badgen.net/npm/v/send +[travis-image]: https://badgen.net/travis/pillarjs/send/master?label=linux +[travis-url]: https://travis-ci.org/pillarjs/send diff --git a/node_modules/send/index.js b/node_modules/send/index.js new file mode 100644 index 0000000..fca2112 --- /dev/null +++ b/node_modules/send/index.js @@ -0,0 +1,1129 @@ +/*! + * send + * Copyright(c) 2012 TJ Holowaychuk + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var createError = require('http-errors') +var debug = require('debug')('send') +var deprecate = require('depd')('send') +var destroy = require('destroy') +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var etag = require('etag') +var fresh = require('fresh') +var fs = require('fs') +var mime = require('mime') +var ms = require('ms') +var onFinished = require('on-finished') +var parseRange = require('range-parser') +var path = require('path') +var statuses = require('statuses') +var Stream = require('stream') +var util = require('util') + +/** + * Path function references. + * @private + */ + +var extname = path.extname +var join = path.join +var normalize = path.normalize +var resolve = path.resolve +var sep = path.sep + +/** + * Regular expression for identifying a bytes Range header. + * @private + */ + +var BYTES_RANGE_REGEXP = /^ *bytes=/ + +/** + * Maximum value allowed for the max age. + * @private + */ + +var MAX_MAXAGE = 60 * 60 * 24 * 365 * 1000 // 1 year + +/** + * Regular expression to match a path with a directory up component. + * @private + */ + +var UP_PATH_REGEXP = /(?:^|[\\/])\.\.(?:[\\/]|$)/ + +/** + * Module exports. + * @public + */ + +module.exports = send +module.exports.mime = mime + +/** + * Return a `SendStream` for `req` and `path`. + * + * @param {object} req + * @param {string} path + * @param {object} [options] + * @return {SendStream} + * @public + */ + +function send (req, path, options) { + return new SendStream(req, path, options) +} + +/** + * Initialize a `SendStream` with the given `path`. + * + * @param {Request} req + * @param {String} path + * @param {object} [options] + * @private + */ + +function SendStream (req, path, options) { + Stream.call(this) + + var opts = options || {} + + this.options = opts + this.path = path + this.req = req + + this._acceptRanges = opts.acceptRanges !== undefined + ? Boolean(opts.acceptRanges) + : true + + this._cacheControl = opts.cacheControl !== undefined + ? Boolean(opts.cacheControl) + : true + + this._etag = opts.etag !== undefined + ? Boolean(opts.etag) + : true + + this._dotfiles = opts.dotfiles !== undefined + ? opts.dotfiles + : 'ignore' + + if (this._dotfiles !== 'ignore' && this._dotfiles !== 'allow' && this._dotfiles !== 'deny') { + throw new TypeError('dotfiles option must be "allow", "deny", or "ignore"') + } + + this._hidden = Boolean(opts.hidden) + + if (opts.hidden !== undefined) { + deprecate('hidden: use dotfiles: \'' + (this._hidden ? 'allow' : 'ignore') + '\' instead') + } + + // legacy support + if (opts.dotfiles === undefined) { + this._dotfiles = undefined + } + + this._extensions = opts.extensions !== undefined + ? normalizeList(opts.extensions, 'extensions option') + : [] + + this._immutable = opts.immutable !== undefined + ? Boolean(opts.immutable) + : false + + this._index = opts.index !== undefined + ? normalizeList(opts.index, 'index option') + : ['index.html'] + + this._lastModified = opts.lastModified !== undefined + ? Boolean(opts.lastModified) + : true + + this._maxage = opts.maxAge || opts.maxage + this._maxage = typeof this._maxage === 'string' + ? ms(this._maxage) + : Number(this._maxage) + this._maxage = !isNaN(this._maxage) + ? Math.min(Math.max(0, this._maxage), MAX_MAXAGE) + : 0 + + this._root = opts.root + ? resolve(opts.root) + : null + + if (!this._root && opts.from) { + this.from(opts.from) + } +} + +/** + * Inherits from `Stream`. + */ + +util.inherits(SendStream, Stream) + +/** + * Enable or disable etag generation. + * + * @param {Boolean} val + * @return {SendStream} + * @api public + */ + +SendStream.prototype.etag = deprecate.function(function etag (val) { + this._etag = Boolean(val) + debug('etag %s', this._etag) + return this +}, 'send.etag: pass etag as option') + +/** + * Enable or disable "hidden" (dot) files. + * + * @param {Boolean} path + * @return {SendStream} + * @api public + */ + +SendStream.prototype.hidden = deprecate.function(function hidden (val) { + this._hidden = Boolean(val) + this._dotfiles = undefined + debug('hidden %s', this._hidden) + return this +}, 'send.hidden: use dotfiles option') + +/** + * Set index `paths`, set to a falsy + * value to disable index support. + * + * @param {String|Boolean|Array} paths + * @return {SendStream} + * @api public + */ + +SendStream.prototype.index = deprecate.function(function index (paths) { + var index = !paths ? [] : normalizeList(paths, 'paths argument') + debug('index %o', paths) + this._index = index + return this +}, 'send.index: pass index as option') + +/** + * Set root `path`. + * + * @param {String} path + * @return {SendStream} + * @api public + */ + +SendStream.prototype.root = function root (path) { + this._root = resolve(String(path)) + debug('root %s', this._root) + return this +} + +SendStream.prototype.from = deprecate.function(SendStream.prototype.root, + 'send.from: pass root as option') + +SendStream.prototype.root = deprecate.function(SendStream.prototype.root, + 'send.root: pass root as option') + +/** + * Set max-age to `maxAge`. + * + * @param {Number} maxAge + * @return {SendStream} + * @api public + */ + +SendStream.prototype.maxage = deprecate.function(function maxage (maxAge) { + this._maxage = typeof maxAge === 'string' + ? ms(maxAge) + : Number(maxAge) + this._maxage = !isNaN(this._maxage) + ? Math.min(Math.max(0, this._maxage), MAX_MAXAGE) + : 0 + debug('max-age %d', this._maxage) + return this +}, 'send.maxage: pass maxAge as option') + +/** + * Emit error with `status`. + * + * @param {number} status + * @param {Error} [err] + * @private + */ + +SendStream.prototype.error = function error (status, err) { + // emit if listeners instead of responding + if (hasListeners(this, 'error')) { + return this.emit('error', createError(status, err, { + expose: false + })) + } + + var res = this.res + var msg = statuses[status] || String(status) + var doc = createHtmlDocument('Error', escapeHtml(msg)) + + // clear existing headers + clearHeaders(res) + + // add error headers + if (err && err.headers) { + setHeaders(res, err.headers) + } + + // send basic response + res.statusCode = status + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(doc)) + res.setHeader('Content-Security-Policy', "default-src 'none'") + res.setHeader('X-Content-Type-Options', 'nosniff') + res.end(doc) +} + +/** + * Check if the pathname ends with "/". + * + * @return {boolean} + * @private + */ + +SendStream.prototype.hasTrailingSlash = function hasTrailingSlash () { + return this.path[this.path.length - 1] === '/' +} + +/** + * Check if this is a conditional GET request. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isConditionalGET = function isConditionalGET () { + return this.req.headers['if-match'] || + this.req.headers['if-unmodified-since'] || + this.req.headers['if-none-match'] || + this.req.headers['if-modified-since'] +} + +/** + * Check if the request preconditions failed. + * + * @return {boolean} + * @private + */ + +SendStream.prototype.isPreconditionFailure = function isPreconditionFailure () { + var req = this.req + var res = this.res + + // if-match + var match = req.headers['if-match'] + if (match) { + var etag = res.getHeader('ETag') + return !etag || (match !== '*' && parseTokenList(match).every(function (match) { + return match !== etag && match !== 'W/' + etag && 'W/' + match !== etag + })) + } + + // if-unmodified-since + var unmodifiedSince = parseHttpDate(req.headers['if-unmodified-since']) + if (!isNaN(unmodifiedSince)) { + var lastModified = parseHttpDate(res.getHeader('Last-Modified')) + return isNaN(lastModified) || lastModified > unmodifiedSince + } + + return false +} + +/** + * Strip content-* header fields. + * + * @private + */ + +SendStream.prototype.removeContentHeaderFields = function removeContentHeaderFields () { + var res = this.res + var headers = getHeaderNames(res) + + for (var i = 0; i < headers.length; i++) { + var header = headers[i] + if (header.substr(0, 8) === 'content-' && header !== 'content-location') { + res.removeHeader(header) + } + } +} + +/** + * Respond with 304 not modified. + * + * @api private + */ + +SendStream.prototype.notModified = function notModified () { + var res = this.res + debug('not modified') + this.removeContentHeaderFields() + res.statusCode = 304 + res.end() +} + +/** + * Raise error that headers already sent. + * + * @api private + */ + +SendStream.prototype.headersAlreadySent = function headersAlreadySent () { + var err = new Error('Can\'t set headers after they are sent.') + debug('headers already sent') + this.error(500, err) +} + +/** + * Check if the request is cacheable, aka + * responded with 2xx or 304 (see RFC 2616 section 14.2{5,6}). + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isCachable = function isCachable () { + var statusCode = this.res.statusCode + return (statusCode >= 200 && statusCode < 300) || + statusCode === 304 +} + +/** + * Handle stat() error. + * + * @param {Error} error + * @private + */ + +SendStream.prototype.onStatError = function onStatError (error) { + switch (error.code) { + case 'ENAMETOOLONG': + case 'ENOENT': + case 'ENOTDIR': + this.error(404, error) + break + default: + this.error(500, error) + break + } +} + +/** + * Check if the cache is fresh. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isFresh = function isFresh () { + return fresh(this.req.headers, { + 'etag': this.res.getHeader('ETag'), + 'last-modified': this.res.getHeader('Last-Modified') + }) +} + +/** + * Check if the range is fresh. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isRangeFresh = function isRangeFresh () { + var ifRange = this.req.headers['if-range'] + + if (!ifRange) { + return true + } + + // if-range as etag + if (ifRange.indexOf('"') !== -1) { + var etag = this.res.getHeader('ETag') + return Boolean(etag && ifRange.indexOf(etag) !== -1) + } + + // if-range as modified date + var lastModified = this.res.getHeader('Last-Modified') + return parseHttpDate(lastModified) <= parseHttpDate(ifRange) +} + +/** + * Redirect to path. + * + * @param {string} path + * @private + */ + +SendStream.prototype.redirect = function redirect (path) { + var res = this.res + + if (hasListeners(this, 'directory')) { + this.emit('directory', res, path) + return + } + + if (this.hasTrailingSlash()) { + this.error(403) + return + } + + var loc = encodeUrl(collapseLeadingSlashes(this.path + '/')) + var doc = createHtmlDocument('Redirecting', 'Redirecting to <a href="' + escapeHtml(loc) + '">' + + escapeHtml(loc) + '</a>') + + // redirect + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(doc)) + res.setHeader('Content-Security-Policy', "default-src 'none'") + res.setHeader('X-Content-Type-Options', 'nosniff') + res.setHeader('Location', loc) + res.end(doc) +} + +/** + * Pipe to `res. + * + * @param {Stream} res + * @return {Stream} res + * @api public + */ + +SendStream.prototype.pipe = function pipe (res) { + // root path + var root = this._root + + // references + this.res = res + + // decode the path + var path = decode(this.path) + if (path === -1) { + this.error(400) + return res + } + + // null byte(s) + if (~path.indexOf('\0')) { + this.error(400) + return res + } + + var parts + if (root !== null) { + // normalize + if (path) { + path = normalize('.' + sep + path) + } + + // malicious path + if (UP_PATH_REGEXP.test(path)) { + debug('malicious path "%s"', path) + this.error(403) + return res + } + + // explode path parts + parts = path.split(sep) + + // join / normalize from optional root dir + path = normalize(join(root, path)) + } else { + // ".." is malicious without "root" + if (UP_PATH_REGEXP.test(path)) { + debug('malicious path "%s"', path) + this.error(403) + return res + } + + // explode path parts + parts = normalize(path).split(sep) + + // resolve the path + path = resolve(path) + } + + // dotfile handling + if (containsDotFile(parts)) { + var access = this._dotfiles + + // legacy support + if (access === undefined) { + access = parts[parts.length - 1][0] === '.' + ? (this._hidden ? 'allow' : 'ignore') + : 'allow' + } + + debug('%s dotfile "%s"', access, path) + switch (access) { + case 'allow': + break + case 'deny': + this.error(403) + return res + case 'ignore': + default: + this.error(404) + return res + } + } + + // index file support + if (this._index.length && this.hasTrailingSlash()) { + this.sendIndex(path) + return res + } + + this.sendFile(path) + return res +} + +/** + * Transfer `path`. + * + * @param {String} path + * @api public + */ + +SendStream.prototype.send = function send (path, stat) { + var len = stat.size + var options = this.options + var opts = {} + var res = this.res + var req = this.req + var ranges = req.headers.range + var offset = options.start || 0 + + if (headersSent(res)) { + // impossible to send now + this.headersAlreadySent() + return + } + + debug('pipe "%s"', path) + + // set header fields + this.setHeader(path, stat) + + // set content-type + this.type(path) + + // conditional GET support + if (this.isConditionalGET()) { + if (this.isPreconditionFailure()) { + this.error(412) + return + } + + if (this.isCachable() && this.isFresh()) { + this.notModified() + return + } + } + + // adjust len to start/end options + len = Math.max(0, len - offset) + if (options.end !== undefined) { + var bytes = options.end - offset + 1 + if (len > bytes) len = bytes + } + + // Range support + if (this._acceptRanges && BYTES_RANGE_REGEXP.test(ranges)) { + // parse + ranges = parseRange(len, ranges, { + combine: true + }) + + // If-Range support + if (!this.isRangeFresh()) { + debug('range stale') + ranges = -2 + } + + // unsatisfiable + if (ranges === -1) { + debug('range unsatisfiable') + + // Content-Range + res.setHeader('Content-Range', contentRange('bytes', len)) + + // 416 Requested Range Not Satisfiable + return this.error(416, { + headers: { 'Content-Range': res.getHeader('Content-Range') } + }) + } + + // valid (syntactically invalid/multiple ranges are treated as a regular response) + if (ranges !== -2 && ranges.length === 1) { + debug('range %j', ranges) + + // Content-Range + res.statusCode = 206 + res.setHeader('Content-Range', contentRange('bytes', len, ranges[0])) + + // adjust for requested range + offset += ranges[0].start + len = ranges[0].end - ranges[0].start + 1 + } + } + + // clone options + for (var prop in options) { + opts[prop] = options[prop] + } + + // set read options + opts.start = offset + opts.end = Math.max(offset, offset + len - 1) + + // content-length + res.setHeader('Content-Length', len) + + // HEAD support + if (req.method === 'HEAD') { + res.end() + return + } + + this.stream(path, opts) +} + +/** + * Transfer file for `path`. + * + * @param {String} path + * @api private + */ +SendStream.prototype.sendFile = function sendFile (path) { + var i = 0 + var self = this + + debug('stat "%s"', path) + fs.stat(path, function onstat (err, stat) { + if (err && err.code === 'ENOENT' && !extname(path) && path[path.length - 1] !== sep) { + // not found, check extensions + return next(err) + } + if (err) return self.onStatError(err) + if (stat.isDirectory()) return self.redirect(path) + self.emit('file', path, stat) + self.send(path, stat) + }) + + function next (err) { + if (self._extensions.length <= i) { + return err + ? self.onStatError(err) + : self.error(404) + } + + var p = path + '.' + self._extensions[i++] + + debug('stat "%s"', p) + fs.stat(p, function (err, stat) { + if (err) return next(err) + if (stat.isDirectory()) return next() + self.emit('file', p, stat) + self.send(p, stat) + }) + } +} + +/** + * Transfer index for `path`. + * + * @param {String} path + * @api private + */ +SendStream.prototype.sendIndex = function sendIndex (path) { + var i = -1 + var self = this + + function next (err) { + if (++i >= self._index.length) { + if (err) return self.onStatError(err) + return self.error(404) + } + + var p = join(path, self._index[i]) + + debug('stat "%s"', p) + fs.stat(p, function (err, stat) { + if (err) return next(err) + if (stat.isDirectory()) return next() + self.emit('file', p, stat) + self.send(p, stat) + }) + } + + next() +} + +/** + * Stream `path` to the response. + * + * @param {String} path + * @param {Object} options + * @api private + */ + +SendStream.prototype.stream = function stream (path, options) { + // TODO: this is all lame, refactor meeee + var finished = false + var self = this + var res = this.res + + // pipe + var stream = fs.createReadStream(path, options) + this.emit('stream', stream) + stream.pipe(res) + + // response finished, done with the fd + onFinished(res, function onfinished () { + finished = true + destroy(stream) + }) + + // error handling code-smell + stream.on('error', function onerror (err) { + // request already finished + if (finished) return + + // clean up stream + finished = true + destroy(stream) + + // error + self.onStatError(err) + }) + + // end + stream.on('end', function onend () { + self.emit('end') + }) +} + +/** + * Set content-type based on `path` + * if it hasn't been explicitly set. + * + * @param {String} path + * @api private + */ + +SendStream.prototype.type = function type (path) { + var res = this.res + + if (res.getHeader('Content-Type')) return + + var type = mime.lookup(path) + + if (!type) { + debug('no content-type') + return + } + + var charset = mime.charsets.lookup(type) + + debug('content-type %s', type) + res.setHeader('Content-Type', type + (charset ? '; charset=' + charset : '')) +} + +/** + * Set response header fields, most + * fields may be pre-defined. + * + * @param {String} path + * @param {Object} stat + * @api private + */ + +SendStream.prototype.setHeader = function setHeader (path, stat) { + var res = this.res + + this.emit('headers', res, path, stat) + + if (this._acceptRanges && !res.getHeader('Accept-Ranges')) { + debug('accept ranges') + res.setHeader('Accept-Ranges', 'bytes') + } + + if (this._cacheControl && !res.getHeader('Cache-Control')) { + var cacheControl = 'public, max-age=' + Math.floor(this._maxage / 1000) + + if (this._immutable) { + cacheControl += ', immutable' + } + + debug('cache-control %s', cacheControl) + res.setHeader('Cache-Control', cacheControl) + } + + if (this._lastModified && !res.getHeader('Last-Modified')) { + var modified = stat.mtime.toUTCString() + debug('modified %s', modified) + res.setHeader('Last-Modified', modified) + } + + if (this._etag && !res.getHeader('ETag')) { + var val = etag(stat) + debug('etag %s', val) + res.setHeader('ETag', val) + } +} + +/** + * Clear all headers from a response. + * + * @param {object} res + * @private + */ + +function clearHeaders (res) { + var headers = getHeaderNames(res) + + for (var i = 0; i < headers.length; i++) { + res.removeHeader(headers[i]) + } +} + +/** + * Collapse all leading slashes into a single slash + * + * @param {string} str + * @private + */ +function collapseLeadingSlashes (str) { + for (var i = 0; i < str.length; i++) { + if (str[i] !== '/') { + break + } + } + + return i > 1 + ? '/' + str.substr(i) + : str +} + +/** + * Determine if path parts contain a dotfile. + * + * @api private + */ + +function containsDotFile (parts) { + for (var i = 0; i < parts.length; i++) { + var part = parts[i] + if (part.length > 1 && part[0] === '.') { + return true + } + } + + return false +} + +/** + * Create a Content-Range header. + * + * @param {string} type + * @param {number} size + * @param {array} [range] + */ + +function contentRange (type, size, range) { + return type + ' ' + (range ? range.start + '-' + range.end : '*') + '/' + size +} + +/** + * Create a minimal HTML document. + * + * @param {string} title + * @param {string} body + * @private + */ + +function createHtmlDocument (title, body) { + return '<!DOCTYPE html>\n' + + '<html lang="en">\n' + + '<head>\n' + + '<meta charset="utf-8">\n' + + '<title>' + title + '</title>\n' + + '</head>\n' + + '<body>\n' + + '<pre>' + body + '</pre>\n' + + '</body>\n' + + '</html>\n' +} + +/** + * decodeURIComponent. + * + * Allows V8 to only deoptimize this fn instead of all + * of send(). + * + * @param {String} path + * @api private + */ + +function decode (path) { + try { + return decodeURIComponent(path) + } catch (err) { + return -1 + } +} + +/** + * Get the header names on a respnse. + * + * @param {object} res + * @returns {array[string]} + * @private + */ + +function getHeaderNames (res) { + return typeof res.getHeaderNames !== 'function' + ? Object.keys(res._headers || {}) + : res.getHeaderNames() +} + +/** + * Determine if emitter has listeners of a given type. + * + * The way to do this check is done three different ways in Node.js >= 0.8 + * so this consolidates them into a minimal set using instance methods. + * + * @param {EventEmitter} emitter + * @param {string} type + * @returns {boolean} + * @private + */ + +function hasListeners (emitter, type) { + var count = typeof emitter.listenerCount !== 'function' + ? emitter.listeners(type).length + : emitter.listenerCount(type) + + return count > 0 +} + +/** + * Determine if the response headers have been sent. + * + * @param {object} res + * @returns {boolean} + * @private + */ + +function headersSent (res) { + return typeof res.headersSent !== 'boolean' + ? Boolean(res._header) + : res.headersSent +} + +/** + * Normalize the index option into an array. + * + * @param {boolean|string|array} val + * @param {string} name + * @private + */ + +function normalizeList (val, name) { + var list = [].concat(val || []) + + for (var i = 0; i < list.length; i++) { + if (typeof list[i] !== 'string') { + throw new TypeError(name + ' must be array of strings or false') + } + } + + return list +} + +/** + * Parse an HTTP Date into a number. + * + * @param {string} date + * @private + */ + +function parseHttpDate (date) { + var timestamp = date && Date.parse(date) + + return typeof timestamp === 'number' + ? timestamp + : NaN +} + +/** + * Parse a HTTP token list. + * + * @param {string} str + * @private + */ + +function parseTokenList (str) { + var end = 0 + var list = [] + var start = 0 + + // gather tokens + for (var i = 0, len = str.length; i < len; i++) { + switch (str.charCodeAt(i)) { + case 0x20: /* */ + if (start === end) { + start = end = i + 1 + } + break + case 0x2c: /* , */ + list.push(str.substring(start, end)) + start = end = i + 1 + break + default: + end = i + 1 + break + } + } + + // final token + list.push(str.substring(start, end)) + + return list +} + +/** + * Set an object of headers on a response. + * + * @param {object} res + * @param {object} headers + * @private + */ + +function setHeaders (res, headers) { + var keys = Object.keys(headers) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + res.setHeader(key, headers[key]) + } +} diff --git a/node_modules/send/node_modules/ms/index.js b/node_modules/send/node_modules/ms/index.js new file mode 100644 index 0000000..7229750 --- /dev/null +++ b/node_modules/send/node_modules/ms/index.js @@ -0,0 +1,162 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var w = d * 7; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^((?:\d+)?\-?\d?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'weeks': + case 'week': + case 'w': + return n * w; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return Math.round(ms / d) + 'd'; + } + if (msAbs >= h) { + return Math.round(ms / h) + 'h'; + } + if (msAbs >= m) { + return Math.round(ms / m) + 'm'; + } + if (msAbs >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return plural(ms, msAbs, d, 'day'); + } + if (msAbs >= h) { + return plural(ms, msAbs, h, 'hour'); + } + if (msAbs >= m) { + return plural(ms, msAbs, m, 'minute'); + } + if (msAbs >= s) { + return plural(ms, msAbs, s, 'second'); + } + return ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, msAbs, n, name) { + var isPlural = msAbs >= n * 1.5; + return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : ''); +} diff --git a/node_modules/send/node_modules/ms/license.md b/node_modules/send/node_modules/ms/license.md new file mode 100644 index 0000000..69b6125 --- /dev/null +++ b/node_modules/send/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/send/node_modules/ms/package.json b/node_modules/send/node_modules/ms/package.json new file mode 100644 index 0000000..5cd9bd7 --- /dev/null +++ b/node_modules/send/node_modules/ms/package.json @@ -0,0 +1,69 @@ +{ + "_from": "ms@2.1.1", + "_id": "ms@2.1.1", + "_inBundle": false, + "_integrity": "sha512-tgp+dl5cGk28utYktBsrFqA7HKgrhgPsg6Z/EfhWI4gl1Hwq8B/GmY/0oXZ6nF8hDVesS/FpnYaD/kOWhYQvyg==", + "_location": "/send/ms", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ms@2.1.1", + "name": "ms", + "escapedName": "ms", + "rawSpec": "2.1.1", + "saveSpec": null, + "fetchSpec": "2.1.1" + }, + "_requiredBy": [ + "/send" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-2.1.1.tgz", + "_shasum": "30a5864eb3ebb0a66f2ebe6d727af06a09d86e0a", + "_spec": "ms@2.1.1", + "_where": "/home/josuer08/Documents/web/node_modules/send", + "bugs": { + "url": "https://github.com/zeit/ms/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Tiny millisecond conversion utility", + "devDependencies": { + "eslint": "4.12.1", + "expect.js": "0.3.1", + "husky": "0.14.3", + "lint-staged": "5.0.0", + "mocha": "4.0.1" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/zeit/ms#readme", + "license": "MIT", + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "main": "./index", + "name": "ms", + "repository": { + "type": "git", + "url": "git+https://github.com/zeit/ms.git" + }, + "scripts": { + "lint": "eslint lib/* bin/*", + "precommit": "lint-staged", + "test": "mocha tests.js" + }, + "version": "2.1.1" +} diff --git a/node_modules/send/node_modules/ms/readme.md b/node_modules/send/node_modules/ms/readme.md new file mode 100644 index 0000000..bb76729 --- /dev/null +++ b/node_modules/send/node_modules/ms/readme.md @@ -0,0 +1,60 @@ +# ms + +[](https://travis-ci.org/zeit/ms) +[](https://zeit.chat/) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +ms('-3 days') // -259200000 +ms('-1h') // -3600000 +ms('-200') // -200 +``` + +### Convert from Milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(-3 * 60000) // "-3m" +ms(ms('10 hours')) // "10h" +``` + +### Time Format Written-Out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(-3 * 60000, { long: true }) // "-3 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [Node.js](https://nodejs.org) and in the browser +- If a number is supplied to `ms`, a string with a unit is returned +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`) +- If you pass a string with a number and a valid unit, the number of equivalent milliseconds is returned + +## Related Packages + +- [ms.macro](https://github.com/knpwrs/ms.macro) - Run `ms` as a macro at build-time. + +## Caught a Bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, Node.js will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/node_modules/send/package.json b/node_modules/send/package.json new file mode 100644 index 0000000..4a80488 --- /dev/null +++ b/node_modules/send/package.json @@ -0,0 +1,106 @@ +{ + "_from": "send@0.17.1", + "_id": "send@0.17.1", + "_inBundle": false, + "_integrity": "sha512-BsVKsiGcQMFwT8UxypobUKyv7irCNRHk1T0G680vk88yf6LBByGcZJOTJCrTP2xVN6yI+XjPJcNuE3V4fT9sAg==", + "_location": "/send", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "send@0.17.1", + "name": "send", + "escapedName": "send", + "rawSpec": "0.17.1", + "saveSpec": null, + "fetchSpec": "0.17.1" + }, + "_requiredBy": [ + "/express", + "/serve-static" + ], + "_resolved": "https://registry.npmjs.org/send/-/send-0.17.1.tgz", + "_shasum": "c1d8b059f7900f7466dd4938bdc44e11ddb376c8", + "_spec": "send@0.17.1", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "bugs": { + "url": "https://github.com/pillarjs/send/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "James Wyatt Cready", + "email": "jcready@gmail.com" + }, + { + "name": "Jesús Leganés Combarro", + "email": "piranna@gmail.com" + } + ], + "dependencies": { + "debug": "2.6.9", + "depd": "~1.1.2", + "destroy": "~1.0.4", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "fresh": "0.5.2", + "http-errors": "~1.7.2", + "mime": "1.6.0", + "ms": "2.1.1", + "on-finished": "~2.3.0", + "range-parser": "~1.2.1", + "statuses": "~1.5.0" + }, + "deprecated": false, + "description": "Better streaming static file server with Range and conditional-GET support", + "devDependencies": { + "after": "0.8.2", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "6.1.4", + "supertest": "4.0.2" + }, + "engines": { + "node": ">= 0.8.0" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/pillarjs/send#readme", + "keywords": [ + "static", + "file", + "server" + ], + "license": "MIT", + "name": "send", + "repository": { + "type": "git", + "url": "git+https://github.com/pillarjs/send.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --check-leaks --reporter spec --bail", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot" + }, + "version": "0.17.1" +} diff --git a/node_modules/serve-static/HISTORY.md b/node_modules/serve-static/HISTORY.md new file mode 100644 index 0000000..7203e4f --- /dev/null +++ b/node_modules/serve-static/HISTORY.md @@ -0,0 +1,451 @@ +1.14.1 / 2019-05-10 +=================== + + * Set stricter CSP header in redirect response + * deps: send@0.17.1 + - deps: range-parser@~1.2.1 + +1.14.0 / 2019-05-07 +=================== + + * deps: parseurl@~1.3.3 + * deps: send@0.17.0 + - deps: http-errors@~1.7.2 + - deps: mime@1.6.0 + - deps: ms@2.1.1 + - deps: statuses@~1.5.0 + - perf: remove redundant `path.normalize` call + +1.13.2 / 2018-02-07 +=================== + + * Fix incorrect end tag in redirects + * deps: encodeurl@~1.0.2 + - Fix encoding `%` as last character + * deps: send@0.16.2 + - deps: depd@~1.1.2 + - deps: encodeurl@~1.0.2 + - deps: statuses@~1.4.0 + +1.13.1 / 2017-09-29 +=================== + + * Fix regression when `root` is incorrectly set to a file + * deps: send@0.16.1 + +1.13.0 / 2017-09-27 +=================== + + * deps: send@0.16.0 + - Add 70 new types for file extensions + - Add `immutable` option + - Fix missing `</html>` in default error & redirects + - Set charset as "UTF-8" for .js and .json + - Use instance methods on steam to check for listeners + - deps: mime@1.4.1 + - perf: improve path validation speed + +1.12.6 / 2017-09-22 +=================== + + * deps: send@0.15.6 + - deps: debug@2.6.9 + - perf: improve `If-Match` token parsing + * perf: improve slash collapsing + +1.12.5 / 2017-09-21 +=================== + + * deps: parseurl@~1.3.2 + - perf: reduce overhead for full URLs + - perf: unroll the "fast-path" `RegExp` + * deps: send@0.15.5 + - Fix handling of modified headers with invalid dates + - deps: etag@~1.8.1 + - deps: fresh@0.5.2 + +1.12.4 / 2017-08-05 +=================== + + * deps: send@0.15.4 + - deps: debug@2.6.8 + - deps: depd@~1.1.1 + - deps: http-errors@~1.6.2 + +1.12.3 / 2017-05-16 +=================== + + * deps: send@0.15.3 + - deps: debug@2.6.7 + +1.12.2 / 2017-04-26 +=================== + + * deps: send@0.15.2 + - deps: debug@2.6.4 + +1.12.1 / 2017-03-04 +=================== + + * deps: send@0.15.1 + - Fix issue when `Date.parse` does not return `NaN` on invalid date + - Fix strict violation in broken environments + +1.12.0 / 2017-02-25 +=================== + + * Send complete HTML document in redirect response + * Set default CSP header in redirect response + * deps: send@0.15.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - Remove usage of `res._headers` private field + - Support `If-Match` and `If-Unmodified-Since` headers + - Use `res.getHeaderNames()` when available + - Use `res.headersSent` when available + - deps: debug@2.6.1 + - deps: etag@~1.8.0 + - deps: fresh@0.5.0 + - deps: http-errors@~1.6.1 + +1.11.2 / 2017-01-23 +=================== + + * deps: send@0.14.2 + - deps: http-errors@~1.5.1 + - deps: ms@0.7.2 + - deps: statuses@~1.3.1 + +1.11.1 / 2016-06-10 +=================== + + * Fix redirect error when `req.url` contains raw non-URL characters + * deps: send@0.14.1 + +1.11.0 / 2016-06-07 +=================== + + * Use status code 301 for redirects + * deps: send@0.14.0 + - Add `acceptRanges` option + - Add `cacheControl` option + - Attempt to combine multiple ranges into single range + - Correctly inherit from `Stream` class + - Fix `Content-Range` header in 416 responses when using `start`/`end` options + - Fix `Content-Range` header missing from default 416 responses + - Ignore non-byte `Range` headers + - deps: http-errors@~1.5.0 + - deps: range-parser@~1.2.0 + - deps: statuses@~1.3.0 + - perf: remove argument reassignment + +1.10.3 / 2016-05-30 +=================== + + * deps: send@0.13.2 + - Fix invalid `Content-Type` header when `send.mime.default_type` unset + +1.10.2 / 2016-01-19 +=================== + + * deps: parseurl@~1.3.1 + - perf: enable strict mode + +1.10.1 / 2016-01-16 +=================== + + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + * deps: send@0.13.1 + - deps: depd@~1.1.0 + - deps: destroy@~1.0.4 + - deps: escape-html@~1.0.3 + - deps: range-parser@~1.0.3 + +1.10.0 / 2015-06-17 +=================== + + * Add `fallthrough` option + - Allows declaring this middleware is the final destination + - Provides better integration with Express patterns + * Fix reading options from options prototype + * Improve the default redirect response headers + * deps: escape-html@1.0.2 + * deps: send@0.13.0 + - Allow Node.js HTTP server to set `Date` response header + - Fix incorrectly removing `Content-Location` on 304 response + - Improve the default redirect response headers + - Send appropriate headers on default error response + - Use `http-errors` for standard emitted errors + - Use `statuses` instead of `http` module for status messages + - deps: escape-html@1.0.2 + - deps: etag@~1.7.0 + - deps: fresh@0.3.0 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove unnecessary array allocations + * perf: enable strict mode + * perf: remove argument reassignment + +1.9.3 / 2015-05-14 +================== + + * deps: send@0.12.3 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: etag@~1.6.0 + - deps: ms@0.7.1 + - deps: on-finished@~2.2.1 + +1.9.2 / 2015-03-14 +================== + + * deps: send@0.12.2 + - Throw errors early for invalid `extensions` or `index` options + - deps: debug@~2.1.3 + +1.9.1 / 2015-02-17 +================== + + * deps: send@0.12.1 + - Fix regression sending zero-length files + +1.9.0 / 2015-02-16 +================== + + * deps: send@0.12.0 + - Always read the stat size from the file + - Fix mutating passed-in `options` + - deps: mime@1.3.4 + +1.8.1 / 2015-01-20 +================== + + * Fix redirect loop in Node.js 0.11.14 + * deps: send@0.11.1 + - Fix root path disclosure + +1.8.0 / 2015-01-05 +================== + + * deps: send@0.11.0 + - deps: debug@~2.1.1 + - deps: etag@~1.5.1 + - deps: ms@0.7.0 + - deps: on-finished@~2.2.0 + +1.7.2 / 2015-01-02 +================== + + * Fix potential open redirect when mounted at root + +1.7.1 / 2014-10-22 +================== + + * deps: send@0.10.1 + - deps: on-finished@~2.1.1 + +1.7.0 / 2014-10-15 +================== + + * deps: send@0.10.0 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: etag@~1.5.0 + +1.6.5 / 2015-02-04 +================== + + * Fix potential open redirect when mounted at root + - Back-ported from v1.7.2 + +1.6.4 / 2014-10-08 +================== + + * Fix redirect loop when index file serving disabled + +1.6.3 / 2014-09-24 +================== + + * deps: send@0.9.3 + - deps: etag@~1.4.0 + +1.6.2 / 2014-09-15 +================== + + * deps: send@0.9.2 + - deps: depd@0.4.5 + - deps: etag@~1.3.1 + - deps: range-parser@~1.0.2 + +1.6.1 / 2014-09-07 +================== + + * deps: send@0.9.1 + - deps: fresh@0.2.4 + +1.6.0 / 2014-09-07 +================== + + * deps: send@0.9.0 + - Add `lastModified` option + - Use `etag` to generate `ETag` header + - deps: debug@~2.0.0 + +1.5.4 / 2014-09-04 +================== + + * deps: send@0.8.5 + - Fix a path traversal issue when using `root` + - Fix malicious path detection for empty string path + +1.5.3 / 2014-08-17 +================== + + * deps: send@0.8.3 + +1.5.2 / 2014-08-14 +================== + + * deps: send@0.8.2 + - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + +1.5.1 / 2014-08-09 +================== + + * Fix parsing of weird `req.originalUrl` values + * deps: parseurl@~1.3.0 + * deps: utils-merge@1.0.0 + +1.5.0 / 2014-08-05 +================== + + * deps: send@0.8.1 + - Add `extensions` option + +1.4.4 / 2014-08-04 +================== + + * deps: send@0.7.4 + - Fix serving index files without root dir + +1.4.3 / 2014-07-29 +================== + + * deps: send@0.7.3 + - Fix incorrect 403 on Windows and Node.js 0.11 + +1.4.2 / 2014-07-27 +================== + + * deps: send@0.7.2 + - deps: depd@0.4.4 + +1.4.1 / 2014-07-26 +================== + + * deps: send@0.7.1 + - deps: depd@0.4.3 + +1.4.0 / 2014-07-21 +================== + + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * deps: send@0.7.0 + - Add `dotfiles` option + - deps: debug@1.0.4 + - deps: depd@0.4.2 + +1.3.2 / 2014-07-11 +================== + + * deps: send@0.6.0 + - Cap `maxAge` value to 1 year + - deps: debug@1.0.3 + +1.3.1 / 2014-07-09 +================== + + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + +1.3.0 / 2014-06-28 +================== + + * Add `setHeaders` option + * Include HTML link in redirect response + * deps: send@0.5.0 + - Accept string for `maxAge` (converted by `ms`) + +1.2.3 / 2014-06-11 +================== + + * deps: send@0.4.3 + - Do not throw un-catchable error on file open race condition + - Use `escape-html` for HTML escaping + - deps: debug@1.0.2 + - deps: finished@1.2.2 + - deps: fresh@0.2.2 + +1.2.2 / 2014-06-09 +================== + + * deps: send@0.4.2 + - fix "event emitter leak" warnings + - deps: debug@1.0.1 + - deps: finished@1.2.1 + +1.2.1 / 2014-06-02 +================== + + * use `escape-html` for escaping + * deps: send@0.4.1 + - Send `max-age` in `Cache-Control` in correct format + +1.2.0 / 2014-05-29 +================== + + * deps: send@0.4.0 + - Calculate ETag with md5 for reduced collisions + - Fix wrong behavior when index file matches directory + - Ignore stream errors after request ends + - Skip directories in index file search + - deps: debug@0.8.1 + +1.1.0 / 2014-04-24 +================== + + * Accept options directly to `send` module + * deps: send@0.3.0 + +1.0.4 / 2014-04-07 +================== + + * Resolve relative paths at middleware setup + * Use parseurl to parse the URL from request + +1.0.3 / 2014-03-20 +================== + + * Do not rely on connect-like environments + +1.0.2 / 2014-03-06 +================== + + * deps: send@0.2.0 + +1.0.1 / 2014-03-05 +================== + + * Add mime export for back-compat + +1.0.0 / 2014-03-05 +================== + + * Genesis from `connect` diff --git a/node_modules/serve-static/LICENSE b/node_modules/serve-static/LICENSE new file mode 100644 index 0000000..cbe62e8 --- /dev/null +++ b/node_modules/serve-static/LICENSE @@ -0,0 +1,25 @@ +(The MIT License) + +Copyright (c) 2010 Sencha Inc. +Copyright (c) 2011 LearnBoost +Copyright (c) 2011 TJ Holowaychuk +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/serve-static/README.md b/node_modules/serve-static/README.md new file mode 100644 index 0000000..7cce428 --- /dev/null +++ b/node_modules/serve-static/README.md @@ -0,0 +1,259 @@ +# serve-static + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install serve-static +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var serveStatic = require('serve-static') +``` + +### serveStatic(root, options) + +Create a new middleware function to serve files from within a given root +directory. The file to serve will be determined by combining `req.url` +with the provided root directory. When a file is not found, instead of +sending a 404 response, this module will instead call `next()` to move on +to the next middleware, allowing for stacking and fall-backs. + +#### Options + +##### acceptRanges + +Enable or disable accepting ranged requests, defaults to true. +Disabling this will not send `Accept-Ranges` and ignore the contents +of the `Range` request header. + +##### cacheControl + +Enable or disable setting `Cache-Control` response header, defaults to +true. Disabling this will ignore the `immutable` and `maxAge` options. + +##### dotfiles + + Set how "dotfiles" are treated when encountered. A dotfile is a file +or directory that begins with a dot ("."). Note this check is done on +the path itself without checking if the path actually exists on the +disk. If `root` is specified, only the dotfiles above the root are +checked (i.e. the root itself can be within a dotfile when set +to "deny"). + + - `'allow'` No special treatment for dotfiles. + - `'deny'` Deny a request for a dotfile and 403/`next()`. + - `'ignore'` Pretend like the dotfile does not exist and 404/`next()`. + +The default value is similar to `'ignore'`, with the exception that this +default will not ignore the files within a directory that begins with a dot. + +##### etag + +Enable or disable etag generation, defaults to true. + +##### extensions + +Set file extension fallbacks. When set, if a file is not found, the given +extensions will be added to the file name and search for. The first that +exists will be served. Example: `['html', 'htm']`. + +The default value is `false`. + +##### fallthrough + +Set the middleware to have client errors fall-through as just unhandled +requests, otherwise forward a client error. The difference is that client +errors like a bad request or a request to a non-existent file will cause +this middleware to simply `next()` to your next middleware when this value +is `true`. When this value is `false`, these errors (even 404s), will invoke +`next(err)`. + +Typically `true` is desired such that multiple physical directories can be +mapped to the same web address or for routes to fill in non-existent files. + +The value `false` can be used if this middleware is mounted at a path that +is designed to be strictly a single file system directory, which allows for +short-circuiting 404s for less overhead. This middleware will also reply to +all methods. + +The default value is `true`. + +##### immutable + +Enable or disable the `immutable` directive in the `Cache-Control` response +header, defaults to `false`. If set to `true`, the `maxAge` option should +also be specified to enable caching. The `immutable` directive will prevent +supported clients from making conditional requests during the life of the +`maxAge` option to check if the file has changed. + +##### index + +By default this module will send "index.html" files in response to a request +on a directory. To disable this set `false` or to supply a new index pass a +string or an array in preferred order. + +##### lastModified + +Enable or disable `Last-Modified` header, defaults to true. Uses the file +system's last modified value. + +##### maxAge + +Provide a max-age in milliseconds for http caching, defaults to 0. This +can also be a string accepted by the [ms](https://www.npmjs.org/package/ms#readme) +module. + +##### redirect + +Redirect to trailing "/" when the pathname is a dir. Defaults to `true`. + +##### setHeaders + +Function to set custom headers on response. Alterations to the headers need to +occur synchronously. The function is called as `fn(res, path, stat)`, where +the arguments are: + + - `res` the response object + - `path` the file path that is being sent + - `stat` the stat object of the file that is being sent + +## Examples + +### Serve files with vanilla node.js http server + +```js +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +// Serve up public/ftp folder +var serve = serveStatic('public/ftp', { 'index': ['index.html', 'index.htm'] }) + +// Create server +var server = http.createServer(function onRequest (req, res) { + serve(req, res, finalhandler(req, res)) +}) + +// Listen +server.listen(3000) +``` + +### Serve all files as downloads + +```js +var contentDisposition = require('content-disposition') +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +// Serve up public/ftp folder +var serve = serveStatic('public/ftp', { + 'index': false, + 'setHeaders': setHeaders +}) + +// Set header to force download +function setHeaders (res, path) { + res.setHeader('Content-Disposition', contentDisposition(path)) +} + +// Create server +var server = http.createServer(function onRequest (req, res) { + serve(req, res, finalhandler(req, res)) +}) + +// Listen +server.listen(3000) +``` + +### Serving using express + +#### Simple + +This is a simple example of using Express. + +```js +var express = require('express') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic('public/ftp', { 'index': ['default.html', 'default.htm'] })) +app.listen(3000) +``` + +#### Multiple roots + +This example shows a simple way to search through multiple directories. +Files are look for in `public-optimized/` first, then `public/` second as +a fallback. + +```js +var express = require('express') +var path = require('path') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic(path.join(__dirname, 'public-optimized'))) +app.use(serveStatic(path.join(__dirname, 'public'))) +app.listen(3000) +``` + +#### Different settings for paths + +This example shows how to set a different max age depending on the served +file type. In this example, HTML files are not cached, while everything else +is for 1 day. + +```js +var express = require('express') +var path = require('path') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic(path.join(__dirname, 'public'), { + maxAge: '1d', + setHeaders: setCustomCacheControl +})) + +app.listen(3000) + +function setCustomCacheControl (res, path) { + if (serveStatic.mime.lookup(path) === 'text/html') { + // Custom Cache-Control for HTML files + res.setHeader('Cache-Control', 'public, max-age=0') + } +} +``` + +## License + +[MIT](LICENSE) + +[appveyor-image]: https://badgen.net/appveyor/ci/dougwilson/serve-static/master?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/serve-static +[coveralls-image]: https://badgen.net/coveralls/c/github/expressjs/serve-static/master +[coveralls-url]: https://coveralls.io/r/expressjs/serve-static?branch=master +[node-image]: https://badgen.net/npm/node/serve-static +[node-url]: https://nodejs.org/en/download/ +[npm-downloads-image]: https://badgen.net/npm/dm/serve-static +[npm-url]: https://npmjs.org/package/serve-static +[npm-version-image]: https://badgen.net/npm/v/serve-static +[travis-image]: https://badgen.net/travis/expressjs/serve-static/master?label=linux +[travis-url]: https://travis-ci.org/expressjs/serve-static diff --git a/node_modules/serve-static/index.js b/node_modules/serve-static/index.js new file mode 100644 index 0000000..b7d3984 --- /dev/null +++ b/node_modules/serve-static/index.js @@ -0,0 +1,210 @@ +/*! + * serve-static + * Copyright(c) 2010 Sencha Inc. + * Copyright(c) 2011 TJ Holowaychuk + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var parseUrl = require('parseurl') +var resolve = require('path').resolve +var send = require('send') +var url = require('url') + +/** + * Module exports. + * @public + */ + +module.exports = serveStatic +module.exports.mime = send.mime + +/** + * @param {string} root + * @param {object} [options] + * @return {function} + * @public + */ + +function serveStatic (root, options) { + if (!root) { + throw new TypeError('root path required') + } + + if (typeof root !== 'string') { + throw new TypeError('root path must be a string') + } + + // copy options object + var opts = Object.create(options || null) + + // fall-though + var fallthrough = opts.fallthrough !== false + + // default redirect + var redirect = opts.redirect !== false + + // headers listener + var setHeaders = opts.setHeaders + + if (setHeaders && typeof setHeaders !== 'function') { + throw new TypeError('option setHeaders must be function') + } + + // setup options for send + opts.maxage = opts.maxage || opts.maxAge || 0 + opts.root = resolve(root) + + // construct directory listener + var onDirectory = redirect + ? createRedirectDirectoryListener() + : createNotFoundDirectoryListener() + + return function serveStatic (req, res, next) { + if (req.method !== 'GET' && req.method !== 'HEAD') { + if (fallthrough) { + return next() + } + + // method not allowed + res.statusCode = 405 + res.setHeader('Allow', 'GET, HEAD') + res.setHeader('Content-Length', '0') + res.end() + return + } + + var forwardError = !fallthrough + var originalUrl = parseUrl.original(req) + var path = parseUrl(req).pathname + + // make sure redirect occurs at mount + if (path === '/' && originalUrl.pathname.substr(-1) !== '/') { + path = '' + } + + // create send stream + var stream = send(req, path, opts) + + // add directory handler + stream.on('directory', onDirectory) + + // add headers listener + if (setHeaders) { + stream.on('headers', setHeaders) + } + + // add file listener for fallthrough + if (fallthrough) { + stream.on('file', function onFile () { + // once file is determined, always forward error + forwardError = true + }) + } + + // forward errors + stream.on('error', function error (err) { + if (forwardError || !(err.statusCode < 500)) { + next(err) + return + } + + next() + }) + + // pipe + stream.pipe(res) + } +} + +/** + * Collapse all leading slashes into a single slash + * @private + */ +function collapseLeadingSlashes (str) { + for (var i = 0; i < str.length; i++) { + if (str.charCodeAt(i) !== 0x2f /* / */) { + break + } + } + + return i > 1 + ? '/' + str.substr(i) + : str +} + +/** + * Create a minimal HTML document. + * + * @param {string} title + * @param {string} body + * @private + */ + +function createHtmlDocument (title, body) { + return '<!DOCTYPE html>\n' + + '<html lang="en">\n' + + '<head>\n' + + '<meta charset="utf-8">\n' + + '<title>' + title + '</title>\n' + + '</head>\n' + + '<body>\n' + + '<pre>' + body + '</pre>\n' + + '</body>\n' + + '</html>\n' +} + +/** + * Create a directory listener that just 404s. + * @private + */ + +function createNotFoundDirectoryListener () { + return function notFound () { + this.error(404) + } +} + +/** + * Create a directory listener that performs a redirect. + * @private + */ + +function createRedirectDirectoryListener () { + return function redirect (res) { + if (this.hasTrailingSlash()) { + this.error(404) + return + } + + // get original URL + var originalUrl = parseUrl.original(this.req) + + // append trailing slash + originalUrl.path = null + originalUrl.pathname = collapseLeadingSlashes(originalUrl.pathname + '/') + + // reformat the URL + var loc = encodeUrl(url.format(originalUrl)) + var doc = createHtmlDocument('Redirecting', 'Redirecting to <a href="' + escapeHtml(loc) + '">' + + escapeHtml(loc) + '</a>') + + // send redirect response + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(doc)) + res.setHeader('Content-Security-Policy', "default-src 'none'") + res.setHeader('X-Content-Type-Options', 'nosniff') + res.setHeader('Location', loc) + res.end(doc) + } +} diff --git a/node_modules/serve-static/package.json b/node_modules/serve-static/package.json new file mode 100644 index 0000000..6251173 --- /dev/null +++ b/node_modules/serve-static/package.json @@ -0,0 +1,77 @@ +{ + "_from": "serve-static@1.14.1", + "_id": "serve-static@1.14.1", + "_inBundle": false, + "_integrity": "sha512-JMrvUwE54emCYWlTI+hGrGv5I8dEwmco/00EvkzIIsR7MqrHonbD9pO2MOfFnpFntl7ecpZs+3mW+XbQZu9QCg==", + "_location": "/serve-static", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "serve-static@1.14.1", + "name": "serve-static", + "escapedName": "serve-static", + "rawSpec": "1.14.1", + "saveSpec": null, + "fetchSpec": "1.14.1" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.14.1.tgz", + "_shasum": "666e636dc4f010f7ef29970a88a674320898b2f9", + "_spec": "serve-static@1.14.1", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/expressjs/serve-static/issues" + }, + "bundleDependencies": false, + "dependencies": { + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "parseurl": "~1.3.3", + "send": "0.17.1" + }, + "deprecated": false, + "description": "Serve static files", + "devDependencies": { + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "6.1.4", + "safe-buffer": "5.1.2", + "supertest": "4.0.2" + }, + "engines": { + "node": ">= 0.8.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/expressjs/serve-static#readme", + "license": "MIT", + "name": "serve-static", + "repository": { + "type": "git", + "url": "git+https://github.com/expressjs/serve-static.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "version": "node scripts/version-history.js && git add HISTORY.md" + }, + "version": "1.14.1" +} diff --git a/node_modules/setprototypeof/LICENSE b/node_modules/setprototypeof/LICENSE new file mode 100644 index 0000000..61afa2f --- /dev/null +++ b/node_modules/setprototypeof/LICENSE @@ -0,0 +1,13 @@ +Copyright (c) 2015, Wes Todd + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY +SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION +OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN +CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/setprototypeof/README.md b/node_modules/setprototypeof/README.md new file mode 100644 index 0000000..f120044 --- /dev/null +++ b/node_modules/setprototypeof/README.md @@ -0,0 +1,31 @@ +# Polyfill for `Object.setPrototypeOf` + +[](https://npmjs.org/package/setprototypeof) +[](https://npmjs.org/package/setprototypeof) +[](https://github.com/standard/standard) + +A simple cross platform implementation to set the prototype of an instianted object. Supports all modern browsers and at least back to IE8. + +## Usage: + +``` +$ npm install --save setprototypeof +``` + +```javascript +var setPrototypeOf = require('setprototypeof') + +var obj = {} +setPrototypeOf(obj, { + foo: function () { + return 'bar' + } +}) +obj.foo() // bar +``` + +TypeScript is also supported: + +```typescript +import setPrototypeOf = require('setprototypeof') +``` diff --git a/node_modules/setprototypeof/index.d.ts b/node_modules/setprototypeof/index.d.ts new file mode 100644 index 0000000..f108ecd --- /dev/null +++ b/node_modules/setprototypeof/index.d.ts @@ -0,0 +1,2 @@ +declare function setPrototypeOf(o: any, proto: object | null): any; +export = setPrototypeOf; diff --git a/node_modules/setprototypeof/index.js b/node_modules/setprototypeof/index.js new file mode 100644 index 0000000..81fd5d7 --- /dev/null +++ b/node_modules/setprototypeof/index.js @@ -0,0 +1,17 @@ +'use strict' +/* eslint no-proto: 0 */ +module.exports = Object.setPrototypeOf || ({ __proto__: [] } instanceof Array ? setProtoOf : mixinProperties) + +function setProtoOf (obj, proto) { + obj.__proto__ = proto + return obj +} + +function mixinProperties (obj, proto) { + for (var prop in proto) { + if (!obj.hasOwnProperty(prop)) { + obj[prop] = proto[prop] + } + } + return obj +} diff --git a/node_modules/setprototypeof/package.json b/node_modules/setprototypeof/package.json new file mode 100644 index 0000000..4dfda29 --- /dev/null +++ b/node_modules/setprototypeof/package.json @@ -0,0 +1,64 @@ +{ + "_from": "setprototypeof@1.1.1", + "_id": "setprototypeof@1.1.1", + "_inBundle": false, + "_integrity": "sha512-JvdAWfbXeIGaZ9cILp38HntZSFSo3mWg6xGcJJsd+d4aRMOqauag1C63dJfDw7OaMYwEbHMOxEZ1lqVRYP2OAw==", + "_location": "/setprototypeof", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "setprototypeof@1.1.1", + "name": "setprototypeof", + "escapedName": "setprototypeof", + "rawSpec": "1.1.1", + "saveSpec": null, + "fetchSpec": "1.1.1" + }, + "_requiredBy": [ + "/express", + "/http-errors" + ], + "_resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.1.1.tgz", + "_shasum": "7e95acb24aa92f5885e0abef5ba131330d4ae683", + "_spec": "setprototypeof@1.1.1", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Wes Todd" + }, + "bugs": { + "url": "https://github.com/wesleytodd/setprototypeof/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "A small polyfill for Object.setprototypeof", + "devDependencies": { + "mocha": "^5.2.0", + "standard": "^12.0.1" + }, + "homepage": "https://github.com/wesleytodd/setprototypeof", + "keywords": [ + "polyfill", + "object", + "setprototypeof" + ], + "license": "ISC", + "main": "index.js", + "name": "setprototypeof", + "repository": { + "type": "git", + "url": "git+https://github.com/wesleytodd/setprototypeof.git" + }, + "scripts": { + "node010": "NODE_VER=0.10 MOCHA_VER=3 npm run testversion", + "node11": "NODE_VER=11 npm run testversion", + "node4": "NODE_VER=4 npm run testversion", + "node6": "NODE_VER=6 npm run testversion", + "node9": "NODE_VER=9 npm run testversion", + "test": "standard && mocha", + "testallversions": "npm run node010 && npm run node4 && npm run node6 && npm run node9 && npm run node11", + "testversion": "docker run -it --rm -v $(PWD):/usr/src/app -w /usr/src/app node:${NODE_VER} npm install mocha@${MOCHA_VER:-latest} && npm t" + }, + "typings": "index.d.ts", + "version": "1.1.1" +} diff --git a/node_modules/setprototypeof/test/index.js b/node_modules/setprototypeof/test/index.js new file mode 100644 index 0000000..afeb4dd --- /dev/null +++ b/node_modules/setprototypeof/test/index.js @@ -0,0 +1,24 @@ +'use strict' +/* eslint-env mocha */ +/* eslint no-proto: 0 */ +var assert = require('assert') +var setPrototypeOf = require('..') + +describe('setProtoOf(obj, proto)', function () { + it('should merge objects', function () { + var obj = { a: 1, b: 2 } + var proto = { b: 3, c: 4 } + var mergeObj = setPrototypeOf(obj, proto) + + if (Object.getPrototypeOf) { + assert.strictEqual(Object.getPrototypeOf(obj), proto) + } else if ({ __proto__: [] } instanceof Array) { + assert.strictEqual(obj.__proto__, proto) + } else { + assert.strictEqual(obj.a, 1) + assert.strictEqual(obj.b, 2) + assert.strictEqual(obj.c, 4) + } + assert.strictEqual(mergeObj, obj) + }) +}) diff --git a/node_modules/statuses/HISTORY.md b/node_modules/statuses/HISTORY.md new file mode 100644 index 0000000..a1977b2 --- /dev/null +++ b/node_modules/statuses/HISTORY.md @@ -0,0 +1,65 @@ +1.5.0 / 2018-03-27 +================== + + * Add `103 Early Hints` + +1.4.0 / 2017-10-20 +================== + + * Add `STATUS_CODES` export + +1.3.1 / 2016-11-11 +================== + + * Fix return type in JSDoc + +1.3.0 / 2016-05-17 +================== + + * Add `421 Misdirected Request` + * perf: enable strict mode + +1.2.1 / 2015-02-01 +================== + + * Fix message for status 451 + - `451 Unavailable For Legal Reasons` + +1.2.0 / 2014-09-28 +================== + + * Add `208 Already Repored` + * Add `226 IM Used` + * Add `306 (Unused)` + * Add `415 Unable For Legal Reasons` + * Add `508 Loop Detected` + +1.1.1 / 2014-09-24 +================== + + * Add missing 308 to `codes.json` + +1.1.0 / 2014-09-21 +================== + + * Add `codes.json` for universal support + +1.0.4 / 2014-08-20 +================== + + * Package cleanup + +1.0.3 / 2014-06-08 +================== + + * Add 308 to `.redirect` category + +1.0.2 / 2014-03-13 +================== + + * Add `.retry` category + +1.0.1 / 2014-03-12 +================== + + * Initial release diff --git a/node_modules/statuses/LICENSE b/node_modules/statuses/LICENSE new file mode 100644 index 0000000..28a3161 --- /dev/null +++ b/node_modules/statuses/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong <me@jongleberry.com> +Copyright (c) 2016 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/statuses/README.md b/node_modules/statuses/README.md new file mode 100644 index 0000000..0fe5720 --- /dev/null +++ b/node_modules/statuses/README.md @@ -0,0 +1,127 @@ +# Statuses + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP status utility for node. + +This module provides a list of status codes and messages sourced from +a few different projects: + + * The [IANA Status Code Registry](https://www.iana.org/assignments/http-status-codes/http-status-codes.xhtml) + * The [Node.js project](https://nodejs.org/) + * The [NGINX project](https://www.nginx.com/) + * The [Apache HTTP Server project](https://httpd.apache.org/) + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install statuses +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var status = require('statuses') +``` + +### var code = status(Integer || String) + +If `Integer` or `String` is a valid HTTP code or status message, then the +appropriate `code` will be returned. Otherwise, an error will be thrown. + +<!-- eslint-disable no-undef --> + +```js +status(403) // => 403 +status('403') // => 403 +status('forbidden') // => 403 +status('Forbidden') // => 403 +status(306) // throws, as it's not supported by node.js +``` + +### status.STATUS_CODES + +Returns an object which maps status codes to status messages, in +the same format as the +[Node.js http module](https://nodejs.org/dist/latest/docs/api/http.html#http_http_status_codes). + +### status.codes + +Returns an array of all the status codes as `Integer`s. + +### var msg = status[code] + +Map of `code` to `status message`. `undefined` for invalid `code`s. + +<!-- eslint-disable no-undef, no-unused-expressions --> + +```js +status[404] // => 'Not Found' +``` + +### var code = status[msg] + +Map of `status message` to `code`. `msg` can either be title-cased or +lower-cased. `undefined` for invalid `status message`s. + +<!-- eslint-disable no-undef, no-unused-expressions --> + +```js +status['not found'] // => 404 +status['Not Found'] // => 404 +``` + +### status.redirect[code] + +Returns `true` if a status code is a valid redirect status. + +<!-- eslint-disable no-undef, no-unused-expressions --> + +```js +status.redirect[200] // => undefined +status.redirect[301] // => true +``` + +### status.empty[code] + +Returns `true` if a status code expects an empty body. + +<!-- eslint-disable no-undef, no-unused-expressions --> + +```js +status.empty[200] // => undefined +status.empty[204] // => true +status.empty[304] // => true +``` + +### status.retry[code] + +Returns `true` if you should retry the rest. + +<!-- eslint-disable no-undef, no-unused-expressions --> + +```js +status.retry[501] // => undefined +status.retry[503] // => true +``` + +[npm-image]: https://img.shields.io/npm/v/statuses.svg +[npm-url]: https://npmjs.org/package/statuses +[node-version-image]: https://img.shields.io/node/v/statuses.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/jshttp/statuses.svg +[travis-url]: https://travis-ci.org/jshttp/statuses +[coveralls-image]: https://img.shields.io/coveralls/jshttp/statuses.svg +[coveralls-url]: https://coveralls.io/r/jshttp/statuses?branch=master +[downloads-image]: https://img.shields.io/npm/dm/statuses.svg +[downloads-url]: https://npmjs.org/package/statuses diff --git a/node_modules/statuses/codes.json b/node_modules/statuses/codes.json new file mode 100644 index 0000000..a09283a --- /dev/null +++ b/node_modules/statuses/codes.json @@ -0,0 +1,66 @@ +{ + "100": "Continue", + "101": "Switching Protocols", + "102": "Processing", + "103": "Early Hints", + "200": "OK", + "201": "Created", + "202": "Accepted", + "203": "Non-Authoritative Information", + "204": "No Content", + "205": "Reset Content", + "206": "Partial Content", + "207": "Multi-Status", + "208": "Already Reported", + "226": "IM Used", + "300": "Multiple Choices", + "301": "Moved Permanently", + "302": "Found", + "303": "See Other", + "304": "Not Modified", + "305": "Use Proxy", + "306": "(Unused)", + "307": "Temporary Redirect", + "308": "Permanent Redirect", + "400": "Bad Request", + "401": "Unauthorized", + "402": "Payment Required", + "403": "Forbidden", + "404": "Not Found", + "405": "Method Not Allowed", + "406": "Not Acceptable", + "407": "Proxy Authentication Required", + "408": "Request Timeout", + "409": "Conflict", + "410": "Gone", + "411": "Length Required", + "412": "Precondition Failed", + "413": "Payload Too Large", + "414": "URI Too Long", + "415": "Unsupported Media Type", + "416": "Range Not Satisfiable", + "417": "Expectation Failed", + "418": "I'm a teapot", + "421": "Misdirected Request", + "422": "Unprocessable Entity", + "423": "Locked", + "424": "Failed Dependency", + "425": "Unordered Collection", + "426": "Upgrade Required", + "428": "Precondition Required", + "429": "Too Many Requests", + "431": "Request Header Fields Too Large", + "451": "Unavailable For Legal Reasons", + "500": "Internal Server Error", + "501": "Not Implemented", + "502": "Bad Gateway", + "503": "Service Unavailable", + "504": "Gateway Timeout", + "505": "HTTP Version Not Supported", + "506": "Variant Also Negotiates", + "507": "Insufficient Storage", + "508": "Loop Detected", + "509": "Bandwidth Limit Exceeded", + "510": "Not Extended", + "511": "Network Authentication Required" +} diff --git a/node_modules/statuses/index.js b/node_modules/statuses/index.js new file mode 100644 index 0000000..4df469a --- /dev/null +++ b/node_modules/statuses/index.js @@ -0,0 +1,113 @@ +/*! + * statuses + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var codes = require('./codes.json') + +/** + * Module exports. + * @public + */ + +module.exports = status + +// status code to message map +status.STATUS_CODES = codes + +// array of status codes +status.codes = populateStatusesMap(status, codes) + +// status codes for redirects +status.redirect = { + 300: true, + 301: true, + 302: true, + 303: true, + 305: true, + 307: true, + 308: true +} + +// status codes for empty bodies +status.empty = { + 204: true, + 205: true, + 304: true +} + +// status codes for when you should retry the request +status.retry = { + 502: true, + 503: true, + 504: true +} + +/** + * Populate the statuses map for given codes. + * @private + */ + +function populateStatusesMap (statuses, codes) { + var arr = [] + + Object.keys(codes).forEach(function forEachCode (code) { + var message = codes[code] + var status = Number(code) + + // Populate properties + statuses[status] = message + statuses[message] = status + statuses[message.toLowerCase()] = status + + // Add to array + arr.push(status) + }) + + return arr +} + +/** + * Get the status code. + * + * Given a number, this will throw if it is not a known status + * code, otherwise the code will be returned. Given a string, + * the string will be parsed for a number and return the code + * if valid, otherwise will lookup the code assuming this is + * the status message. + * + * @param {string|number} code + * @returns {number} + * @public + */ + +function status (code) { + if (typeof code === 'number') { + if (!status[code]) throw new Error('invalid status code: ' + code) + return code + } + + if (typeof code !== 'string') { + throw new TypeError('code must be a number or string') + } + + // '403' + var n = parseInt(code, 10) + if (!isNaN(n)) { + if (!status[n]) throw new Error('invalid status code: ' + n) + return n + } + + n = status[code.toLowerCase()] + if (!n) throw new Error('invalid status message: "' + code + '"') + return n +} diff --git a/node_modules/statuses/package.json b/node_modules/statuses/package.json new file mode 100644 index 0000000..e170072 --- /dev/null +++ b/node_modules/statuses/package.json @@ -0,0 +1,90 @@ +{ + "_from": "statuses@~1.5.0", + "_id": "statuses@1.5.0", + "_inBundle": false, + "_integrity": "sha1-Fhx9rBd2Wf2YEfQ3cfqZOBR4Yow=", + "_location": "/statuses", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "statuses@~1.5.0", + "name": "statuses", + "escapedName": "statuses", + "rawSpec": "~1.5.0", + "saveSpec": null, + "fetchSpec": "~1.5.0" + }, + "_requiredBy": [ + "/express", + "/finalhandler", + "/http-errors", + "/send" + ], + "_resolved": "https://registry.npmjs.org/statuses/-/statuses-1.5.0.tgz", + "_shasum": "161c7dac177659fd9811f43771fa99381478628c", + "_spec": "statuses@~1.5.0", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/statuses/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "deprecated": false, + "description": "HTTP status utility", + "devDependencies": { + "csv-parse": "1.2.4", + "eslint": "4.19.1", + "eslint-config-standard": "11.0.0", + "eslint-plugin-import": "2.9.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-node": "6.0.1", + "eslint-plugin-promise": "3.7.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5", + "raw-body": "2.3.2", + "stream-to-array": "2.3.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "index.js", + "codes.json", + "LICENSE" + ], + "homepage": "https://github.com/jshttp/statuses#readme", + "keywords": [ + "http", + "status", + "code" + ], + "license": "MIT", + "name": "statuses", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/statuses.git" + }, + "scripts": { + "build": "node scripts/build.js", + "fetch": "node scripts/fetch-apache.js && node scripts/fetch-iana.js && node scripts/fetch-nginx.js && node scripts/fetch-node.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "update": "npm run fetch && npm run build" + }, + "version": "1.5.0" +} diff --git a/node_modules/toidentifier/LICENSE b/node_modules/toidentifier/LICENSE new file mode 100644 index 0000000..de22d15 --- /dev/null +++ b/node_modules/toidentifier/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2016 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/toidentifier/README.md b/node_modules/toidentifier/README.md new file mode 100644 index 0000000..7c8794e --- /dev/null +++ b/node_modules/toidentifier/README.md @@ -0,0 +1,61 @@ +# toidentifier + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][codecov-image]][codecov-url] + +> Convert a string of words to a JavaScript identifier + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install toidentifier +``` + +## Example + +```js +var toIdentifier = require('toidentifier') + +console.log(toIdentifier('Bad Request')) +// => "BadRequest" +``` + +## API + +This CommonJS module exports a single default function: `toIdentifier`. + +### toIdentifier(string) + +Given a string as the argument, it will be transformed according to +the following rules and the new string will be returned: + +1. Split into words separated by space characters (`0x20`). +2. Upper case the first character of each word. +3. Join the words together with no separator. +4. Remove all non-word (`[0-9a-z_]`) characters. + +## License + +[MIT](LICENSE) + +[codecov-image]: https://img.shields.io/codecov/c/github/component/toidentifier.svg +[codecov-url]: https://codecov.io/gh/component/toidentifier +[downloads-image]: https://img.shields.io/npm/dm/toidentifier.svg +[downloads-url]: https://npmjs.org/package/toidentifier +[npm-image]: https://img.shields.io/npm/v/toidentifier.svg +[npm-url]: https://npmjs.org/package/toidentifier +[travis-image]: https://img.shields.io/travis/component/toidentifier/master.svg +[travis-url]: https://travis-ci.org/component/toidentifier + + +## + +[npm]: https://www.npmjs.com/ + +[yarn]: https://yarnpkg.com/ diff --git a/node_modules/toidentifier/index.js b/node_modules/toidentifier/index.js new file mode 100644 index 0000000..bba5411 --- /dev/null +++ b/node_modules/toidentifier/index.js @@ -0,0 +1,30 @@ +/*! + * toidentifier + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module exports. + * @public + */ + +module.exports = toIdentifier + +/** + * Trasform the given string into a JavaScript identifier + * + * @param {string} str + * @returns {string} + * @public + */ + +function toIdentifier (str) { + return str + .split(' ') + .map(function (token) { + return token.slice(0, 1).toUpperCase() + token.slice(1) + }) + .join('') + .replace(/[^ _0-9a-z]/gi, '') +} diff --git a/node_modules/toidentifier/package.json b/node_modules/toidentifier/package.json new file mode 100644 index 0000000..88e5e8f --- /dev/null +++ b/node_modules/toidentifier/package.json @@ -0,0 +1,76 @@ +{ + "_from": "toidentifier@1.0.0", + "_id": "toidentifier@1.0.0", + "_inBundle": false, + "_integrity": "sha512-yaOH/Pk/VEhBWWTlhI+qXxDFXlejDGcQipMlyxda9nthulaxLZUNcUqFxokp0vcYnvteJln5FNQDRrxj3YcbVw==", + "_location": "/toidentifier", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "toidentifier@1.0.0", + "name": "toidentifier", + "escapedName": "toidentifier", + "rawSpec": "1.0.0", + "saveSpec": null, + "fetchSpec": "1.0.0" + }, + "_requiredBy": [ + "/http-errors" + ], + "_resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.0.tgz", + "_shasum": "7e1be3470f1e77948bc43d94a3c8f4d7752ba553", + "_spec": "toidentifier@1.0.0", + "_where": "/home/josuer08/Documents/web/node_modules/http-errors", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/component/toidentifier/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Nick Baugh", + "email": "niftylettuce@gmail.com", + "url": "http://niftylettuce.com/" + } + ], + "deprecated": false, + "description": "Convert a string of words to a JavaScript identifier", + "devDependencies": { + "eslint": "4.19.1", + "eslint-config-standard": "11.0.0", + "eslint-plugin-import": "2.11.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-node": "6.0.1", + "eslint-plugin-promise": "3.7.0", + "eslint-plugin-standard": "3.1.0", + "mocha": "1.21.5", + "nyc": "11.8.0" + }, + "engines": { + "node": ">=0.6" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/component/toidentifier#readme", + "license": "MIT", + "name": "toidentifier", + "repository": { + "type": "git", + "url": "git+https://github.com/component/toidentifier.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "version": "1.0.0" +} diff --git a/node_modules/type-is/HISTORY.md b/node_modules/type-is/HISTORY.md new file mode 100644 index 0000000..8de21f7 --- /dev/null +++ b/node_modules/type-is/HISTORY.md @@ -0,0 +1,259 @@ +1.6.18 / 2019-04-26 +=================== + + * Fix regression passing request object to `typeis.is` + +1.6.17 / 2019-04-25 +=================== + + * deps: mime-types@~2.1.24 + - Add Apple file extensions from IANA + - Add extension `.csl` to `application/vnd.citationstyles.style+xml` + - Add extension `.es` to `application/ecmascript` + - Add extension `.nq` to `application/n-quads` + - Add extension `.nt` to `application/n-triples` + - Add extension `.owl` to `application/rdf+xml` + - Add extensions `.siv` and `.sieve` to `application/sieve` + - Add extensions from IANA for `image/*` types + - Add extensions from IANA for `model/*` types + - Add extensions to HEIC image types + - Add new mime types + - Add `text/mdx` with extension `.mdx` + * perf: prevent internal `throw` on invalid type + +1.6.16 / 2018-02-16 +=================== + + * deps: mime-types@~2.1.18 + - Add `application/raml+yaml` with extension `.raml` + - Add `application/wasm` with extension `.wasm` + - Add `text/shex` with extension `.shex` + - Add extensions for JPEG-2000 images + - Add extensions from IANA for `message/*` types + - Add extension `.mjs` to `application/javascript` + - Add extension `.wadl` to `application/vnd.sun.wadl+xml` + - Add extension `.gz` to `application/gzip` + - Add glTF types and extensions + - Add new mime types + - Update extensions `.md` and `.markdown` to be `text/markdown` + - Update font MIME types + - Update `text/hjson` to registered `application/hjson` + +1.6.15 / 2017-03-31 +=================== + + * deps: mime-types@~2.1.15 + - Add new mime types + +1.6.14 / 2016-11-18 +=================== + + * deps: mime-types@~2.1.13 + - Add new mime types + +1.6.13 / 2016-05-18 +=================== + + * deps: mime-types@~2.1.11 + - Add new mime types + +1.6.12 / 2016-02-28 +=================== + + * deps: mime-types@~2.1.10 + - Add new mime types + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + +1.6.11 / 2016-01-29 +=================== + + * deps: mime-types@~2.1.9 + - Add new mime types + +1.6.10 / 2015-12-01 +=================== + + * deps: mime-types@~2.1.8 + - Add new mime types + +1.6.9 / 2015-09-27 +================== + + * deps: mime-types@~2.1.7 + - Add new mime types + +1.6.8 / 2015-09-04 +================== + + * deps: mime-types@~2.1.6 + - Add new mime types + +1.6.7 / 2015-08-20 +================== + + * Fix type error when given invalid type to match against + * deps: mime-types@~2.1.5 + - Add new mime types + +1.6.6 / 2015-07-31 +================== + + * deps: mime-types@~2.1.4 + - Add new mime types + +1.6.5 / 2015-07-16 +================== + + * deps: mime-types@~2.1.3 + - Add new mime types + +1.6.4 / 2015-07-01 +================== + + * deps: mime-types@~2.1.2 + - Add new mime types + * perf: enable strict mode + * perf: remove argument reassignment + +1.6.3 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - Add new mime types + * perf: reduce try block size + * perf: remove bitwise operations + +1.6.2 / 2015-05-10 +================== + + * deps: mime-types@~2.0.11 + - Add new mime types + +1.6.1 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - Add new mime types + +1.6.0 / 2015-02-12 +================== + + * fix false-positives in `hasBody` `Transfer-Encoding` check + * support wildcard for both type and subtype (`*/*`) + +1.5.7 / 2015-02-09 +================== + + * fix argument reassignment + * deps: mime-types@~2.0.9 + - Add new mime types + +1.5.6 / 2015-01-29 +================== + + * deps: mime-types@~2.0.8 + - Add new mime types + +1.5.5 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - Add new mime types + - Fix missing extensions + - Fix various invalid MIME type entries + - Remove example template MIME types + - deps: mime-db@~1.5.0 + +1.5.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - Add new mime types + - deps: mime-db@~1.3.0 + +1.5.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - Add new mime types + - deps: mime-db@~1.2.0 + +1.5.2 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - Add new mime types + - deps: mime-db@~1.1.0 + +1.5.1 / 2014-09-07 +================== + + * Support Node.js 0.6 + * deps: media-typer@0.3.0 + * deps: mime-types@~2.0.1 + - Support Node.js 0.6 + +1.5.0 / 2014-09-05 +================== + + * fix `hasbody` to be true for `content-length: 0` + +1.4.0 / 2014-09-02 +================== + + * update mime-types + +1.3.2 / 2014-06-24 +================== + + * use `~` range on mime-types + +1.3.1 / 2014-06-19 +================== + + * fix global variable leak + +1.3.0 / 2014-06-19 +================== + + * improve type parsing + + - invalid media type never matches + - media type not case-sensitive + - extra LWS does not affect results + +1.2.2 / 2014-06-19 +================== + + * fix behavior on unknown type argument + +1.2.1 / 2014-06-03 +================== + + * switch dependency from `mime` to `mime-types@1.0.0` + +1.2.0 / 2014-05-11 +================== + + * support suffix matching: + + - `+json` matches `application/vnd+json` + - `*/vnd+json` matches `application/vnd+json` + - `application/*+json` matches `application/vnd+json` + +1.1.0 / 2014-04-12 +================== + + * add non-array values support + * expose internal utilities: + + - `.is()` + - `.hasBody()` + - `.normalize()` + - `.match()` + +1.0.1 / 2014-03-30 +================== + + * add `multipart` as a shorthand diff --git a/node_modules/type-is/LICENSE b/node_modules/type-is/LICENSE new file mode 100644 index 0000000..386b7b6 --- /dev/null +++ b/node_modules/type-is/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong <me@jongleberry.com> +Copyright (c) 2014-2015 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/type-is/README.md b/node_modules/type-is/README.md new file mode 100644 index 0000000..b85ef8f --- /dev/null +++ b/node_modules/type-is/README.md @@ -0,0 +1,170 @@ +# type-is + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Infer the content-type of a request. + +### Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install type-is +``` + +## API + +```js +var http = require('http') +var typeis = require('type-is') + +http.createServer(function (req, res) { + var istext = typeis(req, ['text/*']) + res.end('you ' + (istext ? 'sent' : 'did not send') + ' me text') +}) +``` + +### typeis(request, types) + +Checks if the `request` is one of the `types`. If the request has no body, +even if there is a `Content-Type` header, then `null` is returned. If the +`Content-Type` header is invalid or does not matches any of the `types`, then +`false` is returned. Otherwise, a string of the type that matched is returned. + +The `request` argument is expected to be a Node.js HTTP request. The `types` +argument is an array of type strings. + +Each type in the `types` array can be one of the following: + +- A file extension name such as `json`. This name will be returned if matched. +- A mime type such as `application/json`. +- A mime type with a wildcard such as `*/*` or `*/json` or `application/*`. + The full mime type will be returned if matched. +- A suffix such as `+json`. This can be combined with a wildcard such as + `*/vnd+json` or `application/*+json`. The full mime type will be returned + if matched. + +Some examples to illustrate the inputs and returned value: + +<!-- eslint-disable no-undef --> + +```js +// req.headers.content-type = 'application/json' + +typeis(req, ['json']) // => 'json' +typeis(req, ['html', 'json']) // => 'json' +typeis(req, ['application/*']) // => 'application/json' +typeis(req, ['application/json']) // => 'application/json' + +typeis(req, ['html']) // => false +``` + +### typeis.hasBody(request) + +Returns a Boolean if the given `request` has a body, regardless of the +`Content-Type` header. + +Having a body has no relation to how large the body is (it may be 0 bytes). +This is similar to how file existence works. If a body does exist, then this +indicates that there is data to read from the Node.js request stream. + +<!-- eslint-disable no-undef --> + +```js +if (typeis.hasBody(req)) { + // read the body, since there is one + + req.on('data', function (chunk) { + // ... + }) +} +``` + +### typeis.is(mediaType, types) + +Checks if the `mediaType` is one of the `types`. If the `mediaType` is invalid +or does not matches any of the `types`, then `false` is returned. Otherwise, a +string of the type that matched is returned. + +The `mediaType` argument is expected to be a +[media type](https://tools.ietf.org/html/rfc6838) string. The `types` argument +is an array of type strings. + +Each type in the `types` array can be one of the following: + +- A file extension name such as `json`. This name will be returned if matched. +- A mime type such as `application/json`. +- A mime type with a wildcard such as `*/*` or `*/json` or `application/*`. + The full mime type will be returned if matched. +- A suffix such as `+json`. This can be combined with a wildcard such as + `*/vnd+json` or `application/*+json`. The full mime type will be returned + if matched. + +Some examples to illustrate the inputs and returned value: + +<!-- eslint-disable no-undef --> + +```js +var mediaType = 'application/json' + +typeis.is(mediaType, ['json']) // => 'json' +typeis.is(mediaType, ['html', 'json']) // => 'json' +typeis.is(mediaType, ['application/*']) // => 'application/json' +typeis.is(mediaType, ['application/json']) // => 'application/json' + +typeis.is(mediaType, ['html']) // => false +``` + +## Examples + +### Example body parser + +```js +var express = require('express') +var typeis = require('type-is') + +var app = express() + +app.use(function bodyParser (req, res, next) { + if (!typeis.hasBody(req)) { + return next() + } + + switch (typeis(req, ['urlencoded', 'json', 'multipart'])) { + case 'urlencoded': + // parse urlencoded body + throw new Error('implement urlencoded body parsing') + case 'json': + // parse json body + throw new Error('implement json body parsing') + case 'multipart': + // parse multipart body + throw new Error('implement multipart body parsing') + default: + // 415 error code + res.statusCode = 415 + res.end() + break + } +}) +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/type-is/master +[coveralls-url]: https://coveralls.io/r/jshttp/type-is?branch=master +[node-version-image]: https://badgen.net/npm/node/type-is +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/type-is +[npm-url]: https://npmjs.org/package/type-is +[npm-version-image]: https://badgen.net/npm/v/type-is +[travis-image]: https://badgen.net/travis/jshttp/type-is/master +[travis-url]: https://travis-ci.org/jshttp/type-is diff --git a/node_modules/type-is/index.js b/node_modules/type-is/index.js new file mode 100644 index 0000000..890ad76 --- /dev/null +++ b/node_modules/type-is/index.js @@ -0,0 +1,266 @@ +/*! + * type-is + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var typer = require('media-typer') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = typeofrequest +module.exports.is = typeis +module.exports.hasBody = hasbody +module.exports.normalize = normalize +module.exports.match = mimeMatch + +/** + * Compare a `value` content-type with `types`. + * Each `type` can be an extension like `html`, + * a special shortcut like `multipart` or `urlencoded`, + * or a mime type. + * + * If no types match, `false` is returned. + * Otherwise, the first `type` that matches is returned. + * + * @param {String} value + * @param {Array} types + * @public + */ + +function typeis (value, types_) { + var i + var types = types_ + + // remove parameters and normalize + var val = tryNormalizeType(value) + + // no type or invalid + if (!val) { + return false + } + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length - 1) + for (i = 0; i < types.length; i++) { + types[i] = arguments[i + 1] + } + } + + // no types, return the content type + if (!types || !types.length) { + return val + } + + var type + for (i = 0; i < types.length; i++) { + if (mimeMatch(normalize(type = types[i]), val)) { + return type[0] === '+' || type.indexOf('*') !== -1 + ? val + : type + } + } + + // no matches + return false +} + +/** + * Check if a request has a request body. + * A request with a body __must__ either have `transfer-encoding` + * or `content-length` headers set. + * http://www.w3.org/Protocols/rfc2616/rfc2616-sec4.html#sec4.3 + * + * @param {Object} request + * @return {Boolean} + * @public + */ + +function hasbody (req) { + return req.headers['transfer-encoding'] !== undefined || + !isNaN(req.headers['content-length']) +} + +/** + * Check if the incoming request contains the "Content-Type" + * header field, and it contains any of the give mime `type`s. + * If there is no request body, `null` is returned. + * If there is no content type, `false` is returned. + * Otherwise, it returns the first `type` that matches. + * + * Examples: + * + * // With Content-Type: text/html; charset=utf-8 + * this.is('html'); // => 'html' + * this.is('text/html'); // => 'text/html' + * this.is('text/*', 'application/json'); // => 'text/html' + * + * // When Content-Type is application/json + * this.is('json', 'urlencoded'); // => 'json' + * this.is('application/json'); // => 'application/json' + * this.is('html', 'application/*'); // => 'application/json' + * + * this.is('html'); // => false + * + * @param {String|Array} types... + * @return {String|false|null} + * @public + */ + +function typeofrequest (req, types_) { + var types = types_ + + // no body + if (!hasbody(req)) { + return null + } + + // support flattened arguments + if (arguments.length > 2) { + types = new Array(arguments.length - 1) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i + 1] + } + } + + // request content type + var value = req.headers['content-type'] + + return typeis(value, types) +} + +/** + * Normalize a mime type. + * If it's a shorthand, expand it to a valid mime type. + * + * In general, you probably want: + * + * var type = is(req, ['urlencoded', 'json', 'multipart']); + * + * Then use the appropriate body parsers. + * These three are the most common request body types + * and are thus ensured to work. + * + * @param {String} type + * @private + */ + +function normalize (type) { + if (typeof type !== 'string') { + // invalid type + return false + } + + switch (type) { + case 'urlencoded': + return 'application/x-www-form-urlencoded' + case 'multipart': + return 'multipart/*' + } + + if (type[0] === '+') { + // "+json" -> "*/*+json" expando + return '*/*' + type + } + + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if `expected` mime type + * matches `actual` mime type with + * wildcard and +suffix support. + * + * @param {String} expected + * @param {String} actual + * @return {Boolean} + * @private + */ + +function mimeMatch (expected, actual) { + // invalid type + if (expected === false) { + return false + } + + // split types + var actualParts = actual.split('/') + var expectedParts = expected.split('/') + + // invalid format + if (actualParts.length !== 2 || expectedParts.length !== 2) { + return false + } + + // validate type + if (expectedParts[0] !== '*' && expectedParts[0] !== actualParts[0]) { + return false + } + + // validate suffix wildcard + if (expectedParts[1].substr(0, 2) === '*+') { + return expectedParts[1].length <= actualParts[1].length + 1 && + expectedParts[1].substr(1) === actualParts[1].substr(1 - expectedParts[1].length) + } + + // validate subtype + if (expectedParts[1] !== '*' && expectedParts[1] !== actualParts[1]) { + return false + } + + return true +} + +/** + * Normalize a type and remove parameters. + * + * @param {string} value + * @return {string} + * @private + */ + +function normalizeType (value) { + // parse the type + var type = typer.parse(value) + + // remove the parameters + type.parameters = undefined + + // reformat it + return typer.format(type) +} + +/** + * Try to normalize a type and remove parameters. + * + * @param {string} value + * @return {string} + * @private + */ + +function tryNormalizeType (value) { + if (!value) { + return null + } + + try { + return normalizeType(value) + } catch (err) { + return null + } +} diff --git a/node_modules/type-is/package.json b/node_modules/type-is/package.json new file mode 100644 index 0000000..411e7a2 --- /dev/null +++ b/node_modules/type-is/package.json @@ -0,0 +1,85 @@ +{ + "_from": "type-is@~1.6.18", + "_id": "type-is@1.6.18", + "_inBundle": false, + "_integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==", + "_location": "/type-is", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "type-is@~1.6.18", + "name": "type-is", + "escapedName": "type-is", + "rawSpec": "~1.6.18", + "saveSpec": null, + "fetchSpec": "~1.6.18" + }, + "_requiredBy": [ + "/body-parser", + "/express" + ], + "_resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz", + "_shasum": "4e552cd05df09467dcbc4ef739de89f2cf37c131", + "_spec": "type-is@~1.6.18", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "bugs": { + "url": "https://github.com/jshttp/type-is/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "media-typer": "0.3.0", + "mime-types": "~2.1.24" + }, + "deprecated": false, + "description": "Infer the content-type of a request.", + "devDependencies": { + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "mocha": "6.1.4", + "nyc": "14.0.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/type-is#readme", + "keywords": [ + "content", + "type", + "checking" + ], + "license": "MIT", + "name": "type-is", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/type-is.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test" + }, + "version": "1.6.18" +} diff --git a/node_modules/unpipe/HISTORY.md b/node_modules/unpipe/HISTORY.md new file mode 100644 index 0000000..85e0f8d --- /dev/null +++ b/node_modules/unpipe/HISTORY.md @@ -0,0 +1,4 @@ +1.0.0 / 2015-06-14 +================== + + * Initial release diff --git a/node_modules/unpipe/LICENSE b/node_modules/unpipe/LICENSE new file mode 100644 index 0000000..aed0138 --- /dev/null +++ b/node_modules/unpipe/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/unpipe/README.md b/node_modules/unpipe/README.md new file mode 100644 index 0000000..e536ad2 --- /dev/null +++ b/node_modules/unpipe/README.md @@ -0,0 +1,43 @@ +# unpipe + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Unpipe a stream from all destinations. + +## Installation + +```sh +$ npm install unpipe +``` + +## API + +```js +var unpipe = require('unpipe') +``` + +### unpipe(stream) + +Unpipes all destinations from a given stream. With stream 2+, this is +equivalent to `stream.unpipe()`. When used with streams 1 style streams +(typically Node.js 0.8 and below), this module attempts to undo the +actions done in `stream.pipe(dest)`. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/unpipe.svg +[npm-url]: https://npmjs.org/package/unpipe +[node-image]: https://img.shields.io/node/v/unpipe.svg +[node-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/stream-utils/unpipe.svg +[travis-url]: https://travis-ci.org/stream-utils/unpipe +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/unpipe.svg +[coveralls-url]: https://coveralls.io/r/stream-utils/unpipe?branch=master +[downloads-image]: https://img.shields.io/npm/dm/unpipe.svg +[downloads-url]: https://npmjs.org/package/unpipe diff --git a/node_modules/unpipe/index.js b/node_modules/unpipe/index.js new file mode 100644 index 0000000..15c3d97 --- /dev/null +++ b/node_modules/unpipe/index.js @@ -0,0 +1,69 @@ +/*! + * unpipe + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = unpipe + +/** + * Determine if there are Node.js pipe-like data listeners. + * @private + */ + +function hasPipeDataListeners(stream) { + var listeners = stream.listeners('data') + + for (var i = 0; i < listeners.length; i++) { + if (listeners[i].name === 'ondata') { + return true + } + } + + return false +} + +/** + * Unpipe a stream from all destinations. + * + * @param {object} stream + * @public + */ + +function unpipe(stream) { + if (!stream) { + throw new TypeError('argument stream is required') + } + + if (typeof stream.unpipe === 'function') { + // new-style + stream.unpipe() + return + } + + // Node.js 0.8 hack + if (!hasPipeDataListeners(stream)) { + return + } + + var listener + var listeners = stream.listeners('close') + + for (var i = 0; i < listeners.length; i++) { + listener = listeners[i] + + if (listener.name !== 'cleanup' && listener.name !== 'onclose') { + continue + } + + // invoke the listener + listener.call(stream) + } +} diff --git a/node_modules/unpipe/package.json b/node_modules/unpipe/package.json new file mode 100644 index 0000000..030c9ce --- /dev/null +++ b/node_modules/unpipe/package.json @@ -0,0 +1,63 @@ +{ + "_from": "unpipe@1.0.0", + "_id": "unpipe@1.0.0", + "_inBundle": false, + "_integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=", + "_location": "/unpipe", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "unpipe@1.0.0", + "name": "unpipe", + "escapedName": "unpipe", + "rawSpec": "1.0.0", + "saveSpec": null, + "fetchSpec": "1.0.0" + }, + "_requiredBy": [ + "/finalhandler", + "/raw-body" + ], + "_resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "_shasum": "b2bf4ee8514aae6165b4817829d21b2ef49904ec", + "_spec": "unpipe@1.0.0", + "_where": "/home/josuer08/Documents/web/node_modules/raw-body", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/stream-utils/unpipe/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Unpipe a stream from all destinations", + "devDependencies": { + "istanbul": "0.3.15", + "mocha": "2.2.5", + "readable-stream": "1.1.13" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/stream-utils/unpipe#readme", + "license": "MIT", + "name": "unpipe", + "repository": { + "type": "git", + "url": "git+https://github.com/stream-utils/unpipe.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.0.0" +} diff --git a/node_modules/utils-merge/.npmignore b/node_modules/utils-merge/.npmignore new file mode 100644 index 0000000..3e53844 --- /dev/null +++ b/node_modules/utils-merge/.npmignore @@ -0,0 +1,9 @@ +CONTRIBUTING.md +Makefile +docs/ +examples/ +reports/ +test/ + +.jshintrc +.travis.yml diff --git a/node_modules/utils-merge/LICENSE b/node_modules/utils-merge/LICENSE new file mode 100644 index 0000000..76f6d08 --- /dev/null +++ b/node_modules/utils-merge/LICENSE @@ -0,0 +1,20 @@ +The MIT License (MIT) + +Copyright (c) 2013-2017 Jared Hanson + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/utils-merge/README.md b/node_modules/utils-merge/README.md new file mode 100644 index 0000000..0cb7117 --- /dev/null +++ b/node_modules/utils-merge/README.md @@ -0,0 +1,34 @@ +# utils-merge + +[](https://www.npmjs.com/package/utils-merge) +[](https://travis-ci.org/jaredhanson/utils-merge) +[](https://codeclimate.com/github/jaredhanson/utils-merge) +[](https://coveralls.io/r/jaredhanson/utils-merge) +[](https://david-dm.org/jaredhanson/utils-merge) + + +Merges the properties from a source object into a destination object. + +## Install + +```bash +$ npm install utils-merge +``` + +## Usage + +```javascript +var a = { foo: 'bar' } + , b = { bar: 'baz' }; + +merge(a, b); +// => { foo: 'bar', bar: 'baz' } +``` + +## License + +[The MIT License](http://opensource.org/licenses/MIT) + +Copyright (c) 2013-2017 Jared Hanson <[http://jaredhanson.net/](http://jaredhanson.net/)> + +<a target='_blank' rel='nofollow' href='https://app.codesponsor.io/link/vK9dyjRnnWsMzzJTQ57fRJpH/jaredhanson/utils-merge'> <img alt='Sponsor' width='888' height='68' src='https://app.codesponsor.io/embed/vK9dyjRnnWsMzzJTQ57fRJpH/jaredhanson/utils-merge.svg' /></a> diff --git a/node_modules/utils-merge/index.js b/node_modules/utils-merge/index.js new file mode 100644 index 0000000..4265c69 --- /dev/null +++ b/node_modules/utils-merge/index.js @@ -0,0 +1,23 @@ +/** + * Merge object b with object a. + * + * var a = { foo: 'bar' } + * , b = { bar: 'baz' }; + * + * merge(a, b); + * // => { foo: 'bar', bar: 'baz' } + * + * @param {Object} a + * @param {Object} b + * @return {Object} + * @api public + */ + +exports = module.exports = function(a, b){ + if (a && b) { + for (var key in b) { + a[key] = b[key]; + } + } + return a; +}; diff --git a/node_modules/utils-merge/package.json b/node_modules/utils-merge/package.json new file mode 100644 index 0000000..d265272 --- /dev/null +++ b/node_modules/utils-merge/package.json @@ -0,0 +1,66 @@ +{ + "_from": "utils-merge@1.0.1", + "_id": "utils-merge@1.0.1", + "_inBundle": false, + "_integrity": "sha1-n5VxD1CiZ5R7LMwSR0HBAoQn5xM=", + "_location": "/utils-merge", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "utils-merge@1.0.1", + "name": "utils-merge", + "escapedName": "utils-merge", + "rawSpec": "1.0.1", + "saveSpec": null, + "fetchSpec": "1.0.1" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "_shasum": "9f95710f50a267947b2ccc124741c1028427e713", + "_spec": "utils-merge@1.0.1", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Jared Hanson", + "email": "jaredhanson@gmail.com", + "url": "http://www.jaredhanson.net/" + }, + "bugs": { + "url": "http://github.com/jaredhanson/utils-merge/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "merge() utility function", + "devDependencies": { + "chai": "1.x.x", + "make-node": "0.3.x", + "mocha": "1.x.x" + }, + "engines": { + "node": ">= 0.4.0" + }, + "homepage": "https://github.com/jaredhanson/utils-merge#readme", + "keywords": [ + "util" + ], + "license": "MIT", + "licenses": [ + { + "type": "MIT", + "url": "http://opensource.org/licenses/MIT" + } + ], + "main": "./index", + "name": "utils-merge", + "repository": { + "type": "git", + "url": "git://github.com/jaredhanson/utils-merge.git" + }, + "scripts": { + "test": "mocha --reporter spec --require test/bootstrap/node test/*.test.js" + }, + "version": "1.0.1" +} diff --git a/node_modules/vary/HISTORY.md b/node_modules/vary/HISTORY.md new file mode 100644 index 0000000..f6cbcf7 --- /dev/null +++ b/node_modules/vary/HISTORY.md @@ -0,0 +1,39 @@ +1.1.2 / 2017-09-23 +================== + + * perf: improve header token parsing speed + +1.1.1 / 2017-03-20 +================== + + * perf: hoist regular expression + +1.1.0 / 2015-09-29 +================== + + * Only accept valid field names in the `field` argument + - Ensures the resulting string is a valid HTTP header value + +1.0.1 / 2015-07-08 +================== + + * Fix setting empty header from empty `field` + * perf: enable strict mode + * perf: remove argument reassignments + +1.0.0 / 2014-08-10 +================== + + * Accept valid `Vary` header string as `field` + * Add `vary.append` for low-level string manipulation + * Move to `jshttp` orgainzation + +0.1.0 / 2014-06-05 +================== + + * Support array of fields to set + +0.0.0 / 2014-06-04 +================== + + * Initial release diff --git a/node_modules/vary/LICENSE b/node_modules/vary/LICENSE new file mode 100644 index 0000000..84441fb --- /dev/null +++ b/node_modules/vary/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/vary/README.md b/node_modules/vary/README.md new file mode 100644 index 0000000..cc000b3 --- /dev/null +++ b/node_modules/vary/README.md @@ -0,0 +1,101 @@ +# vary + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Manipulate the HTTP Vary header + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install vary +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var vary = require('vary') +``` + +### vary(res, field) + +Adds the given header `field` to the `Vary` response header of `res`. +This can be a string of a single field, a string of a valid `Vary` +header, or an array of multiple fields. + +This will append the header if not already listed, otherwise leaves +it listed in the current location. + +<!-- eslint-disable no-undef --> + +```js +// Append "Origin" to the Vary header of the response +vary(res, 'Origin') +``` + +### vary.append(header, field) + +Adds the given header `field` to the `Vary` response header string `header`. +This can be a string of a single field, a string of a valid `Vary` header, +or an array of multiple fields. + +This will append the header if not already listed, otherwise leaves +it listed in the current location. The new header string is returned. + +<!-- eslint-disable no-undef --> + +```js +// Get header string appending "Origin" to "Accept, User-Agent" +vary.append('Accept, User-Agent', 'Origin') +``` + +## Examples + +### Updating the Vary header when content is based on it + +```js +var http = require('http') +var vary = require('vary') + +http.createServer(function onRequest (req, res) { + // about to user-agent sniff + vary(res, 'User-Agent') + + var ua = req.headers['user-agent'] || '' + var isMobile = /mobi|android|touch|mini/i.test(ua) + + // serve site, depending on isMobile + res.setHeader('Content-Type', 'text/html') + res.end('You are (probably) ' + (isMobile ? '' : 'not ') + 'a mobile user') +}) +``` + +## Testing + +```sh +$ npm test +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/vary.svg +[npm-url]: https://npmjs.org/package/vary +[node-version-image]: https://img.shields.io/node/v/vary.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/jshttp/vary/master.svg +[travis-url]: https://travis-ci.org/jshttp/vary +[coveralls-image]: https://img.shields.io/coveralls/jshttp/vary/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/vary +[downloads-image]: https://img.shields.io/npm/dm/vary.svg +[downloads-url]: https://npmjs.org/package/vary diff --git a/node_modules/vary/index.js b/node_modules/vary/index.js new file mode 100644 index 0000000..5b5e741 --- /dev/null +++ b/node_modules/vary/index.js @@ -0,0 +1,149 @@ +/*! + * vary + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = vary +module.exports.append = append + +/** + * RegExp to match field-name in RFC 7230 sec 3.2 + * + * field-name = token + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + */ + +var FIELD_NAME_REGEXP = /^[!#$%&'*+\-.^_`|~0-9A-Za-z]+$/ + +/** + * Append a field to a vary header. + * + * @param {String} header + * @param {String|Array} field + * @return {String} + * @public + */ + +function append (header, field) { + if (typeof header !== 'string') { + throw new TypeError('header argument is required') + } + + if (!field) { + throw new TypeError('field argument is required') + } + + // get fields array + var fields = !Array.isArray(field) + ? parse(String(field)) + : field + + // assert on invalid field names + for (var j = 0; j < fields.length; j++) { + if (!FIELD_NAME_REGEXP.test(fields[j])) { + throw new TypeError('field argument contains an invalid header name') + } + } + + // existing, unspecified vary + if (header === '*') { + return header + } + + // enumerate current values + var val = header + var vals = parse(header.toLowerCase()) + + // unspecified vary + if (fields.indexOf('*') !== -1 || vals.indexOf('*') !== -1) { + return '*' + } + + for (var i = 0; i < fields.length; i++) { + var fld = fields[i].toLowerCase() + + // append value (case-preserving) + if (vals.indexOf(fld) === -1) { + vals.push(fld) + val = val + ? val + ', ' + fields[i] + : fields[i] + } + } + + return val +} + +/** + * Parse a vary header into an array. + * + * @param {String} header + * @return {Array} + * @private + */ + +function parse (header) { + var end = 0 + var list = [] + var start = 0 + + // gather tokens + for (var i = 0, len = header.length; i < len; i++) { + switch (header.charCodeAt(i)) { + case 0x20: /* */ + if (start === end) { + start = end = i + 1 + } + break + case 0x2c: /* , */ + list.push(header.substring(start, end)) + start = end = i + 1 + break + default: + end = i + 1 + break + } + } + + // final token + list.push(header.substring(start, end)) + + return list +} + +/** + * Mark that a request is varied on a header field. + * + * @param {Object} res + * @param {String|Array} field + * @public + */ + +function vary (res, field) { + if (!res || !res.getHeader || !res.setHeader) { + // quack quack + throw new TypeError('res argument is required') + } + + // get existing header + var val = res.getHeader('Vary') || '' + var header = Array.isArray(val) + ? val.join(', ') + : String(val) + + // set new header + if ((val = append(header, field))) { + res.setHeader('Vary', val) + } +} diff --git a/node_modules/vary/package.json b/node_modules/vary/package.json new file mode 100644 index 0000000..90ef0bb --- /dev/null +++ b/node_modules/vary/package.json @@ -0,0 +1,78 @@ +{ + "_from": "vary@~1.1.2", + "_id": "vary@1.1.2", + "_inBundle": false, + "_integrity": "sha1-IpnwLG3tMNSllhsLn3RSShj2NPw=", + "_location": "/vary", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "vary@~1.1.2", + "name": "vary", + "escapedName": "vary", + "rawSpec": "~1.1.2", + "saveSpec": null, + "fetchSpec": "~1.1.2" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "_shasum": "2299f02c6ded30d4a5961b0b9f74524a18f634fc", + "_spec": "vary@~1.1.2", + "_where": "/home/josuer08/Documents/web/node_modules/express", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/vary/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Manipulate the HTTP Vary header", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.7.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-node": "5.1.1", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "2.5.3", + "supertest": "1.1.0" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/vary#readme", + "keywords": [ + "http", + "res", + "vary" + ], + "license": "MIT", + "name": "vary", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/vary.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.2" +} diff --git a/package-lock.json b/package-lock.json new file mode 100644 index 0000000..6e969bc --- /dev/null +++ b/package-lock.json @@ -0,0 +1,379 @@ +{ + "name": "web", + "version": "1.0.0", + "lockfileVersion": 1, + "requires": true, + "dependencies": { + "accepts": { + "version": "1.3.7", + "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.7.tgz", + "integrity": "sha512-Il80Qs2WjYlJIBNzNkK6KYqlVMTbZLXgHx2oT0pU/fjRHyEp+PEfEPY0R3WCwAGVOtauxh1hOxNgIf5bv7dQpA==", + "requires": { + "mime-types": "~2.1.24", + "negotiator": "0.6.2" + } + }, + "array-flatten": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=" + }, + "body-parser": { + "version": "1.19.0", + "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.19.0.tgz", + "integrity": "sha512-dhEPs72UPbDnAQJ9ZKMNTP6ptJaionhP5cBb541nXPlW60Jepo9RV/a4fX4XWW9CuFNK22krhrj1+rgzifNCsw==", + "requires": { + "bytes": "3.1.0", + "content-type": "~1.0.4", + "debug": "2.6.9", + "depd": "~1.1.2", + "http-errors": "1.7.2", + "iconv-lite": "0.4.24", + "on-finished": "~2.3.0", + "qs": "6.7.0", + "raw-body": "2.4.0", + "type-is": "~1.6.17" + } + }, + "bytes": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.0.tgz", + "integrity": "sha512-zauLjrfCG+xvoyaqLoV8bLVXXNGC4JqlxFCutSDWA6fJrTo2ZuvLYTqZ7aHBLZSMOopbzwv8f+wZcVzfVTI2Dg==" + }, + "content-disposition": { + "version": "0.5.3", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.3.tgz", + "integrity": "sha512-ExO0774ikEObIAEV9kDo50o+79VCUdEB6n6lzKgGwupcVeRlhrj3qGAfwq8G6uBJjkqLrhT0qEYFcWng8z1z0g==", + "requires": { + "safe-buffer": "5.1.2" + } + }, + "content-type": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.4.tgz", + "integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==" + }, + "cookie": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.4.0.tgz", + "integrity": "sha512-+Hp8fLp57wnUSt0tY0tHEXh4voZRDnoIrZPqlo3DPiI4y9lwg/jqx+1Om94/W6ZaPDOUbnjOt/99w66zk+l1Xg==" + }, + "cookie-signature": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=" + }, + "debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "requires": { + "ms": "2.0.0" + } + }, + "depd": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz", + "integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=" + }, + "destroy": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz", + "integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=" + }, + "ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=" + }, + "ejs": { + "version": "2.6.2", + "resolved": "https://registry.npmjs.org/ejs/-/ejs-2.6.2.tgz", + "integrity": "sha512-PcW2a0tyTuPHz3tWyYqtK6r1fZ3gp+3Sop8Ph+ZYN81Ob5rwmbHEzaqs10N3BEsaGTkh/ooniXK+WwszGlc2+Q==" + }, + "encodeurl": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "integrity": "sha1-rT/0yG7C0CkyL1oCw6mmBslbP1k=" + }, + "escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=" + }, + "etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=" + }, + "express": { + "version": "4.17.1", + "resolved": "https://registry.npmjs.org/express/-/express-4.17.1.tgz", + "integrity": "sha512-mHJ9O79RqluphRrcw2X/GTh3k9tVv8YcoyY4Kkh4WDMUYKRZUq0h1o0w2rrrxBqM7VoeUVqgb27xlEMXTnYt4g==", + "requires": { + "accepts": "~1.3.7", + "array-flatten": "1.1.1", + "body-parser": "1.19.0", + "content-disposition": "0.5.3", + "content-type": "~1.0.4", + "cookie": "0.4.0", + "cookie-signature": "1.0.6", + "debug": "2.6.9", + "depd": "~1.1.2", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "finalhandler": "~1.1.2", + "fresh": "0.5.2", + "merge-descriptors": "1.0.1", + "methods": "~1.1.2", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "path-to-regexp": "0.1.7", + "proxy-addr": "~2.0.5", + "qs": "6.7.0", + "range-parser": "~1.2.1", + "safe-buffer": "5.1.2", + "send": "0.17.1", + "serve-static": "1.14.1", + "setprototypeof": "1.1.1", + "statuses": "~1.5.0", + "type-is": "~1.6.18", + "utils-merge": "1.0.1", + "vary": "~1.1.2" + } + }, + "finalhandler": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.2.tgz", + "integrity": "sha512-aAWcW57uxVNrQZqFXjITpW3sIUQmHGG3qSb9mUah9MgMC4NeWhNOlNjXEYq3HjRAvL6arUviZGGJsBg6z0zsWA==", + "requires": { + "debug": "2.6.9", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "statuses": "~1.5.0", + "unpipe": "~1.0.0" + } + }, + "forwarded": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.2.tgz", + "integrity": "sha1-mMI9qxF1ZXuMBXPozszZGw/xjIQ=" + }, + "fresh": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz", + "integrity": "sha1-PYyt2Q2XZWn6g1qx+OSyOhBWBac=" + }, + "http-errors": { + "version": "1.7.2", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.7.2.tgz", + "integrity": "sha512-uUQBt3H/cSIVfch6i1EuPNy/YsRSOUBXTVfZ+yR7Zjez3qjBz6i9+i4zjNaoqcoFVI4lQJ5plg63TvGfRSDCRg==", + "requires": { + "depd": "~1.1.2", + "inherits": "2.0.3", + "setprototypeof": "1.1.1", + "statuses": ">= 1.5.0 < 2", + "toidentifier": "1.0.0" + } + }, + "iconv-lite": { + "version": "0.4.24", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", + "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", + "requires": { + "safer-buffer": ">= 2.1.2 < 3" + } + }, + "inherits": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz", + "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=" + }, + "ipaddr.js": { + "version": "1.9.0", + "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.0.tgz", + "integrity": "sha512-M4Sjn6N/+O6/IXSJseKqHoFc+5FdGJ22sXqnjTpdZweHK64MzEPAyQZyEU3R/KRv2GLoa7nNtg/C2Ev6m7z+eA==" + }, + "media-typer": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=" + }, + "merge-descriptors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", + "integrity": "sha1-sAqqVW3YtEVoFQ7J0blT8/kMu2E=" + }, + "methods": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "integrity": "sha1-VSmk1nZUE07cxSZmVoNbD4Ua/O4=" + }, + "mime": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz", + "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==" + }, + "mime-db": { + "version": "1.40.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.40.0.tgz", + "integrity": "sha512-jYdeOMPy9vnxEqFRRo6ZvTZ8d9oPb+k18PKoYNYUe2stVEBPPwsln/qWzdbmaIvnhZ9v2P+CuecK+fpUfsV2mA==" + }, + "mime-types": { + "version": "2.1.24", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.24.tgz", + "integrity": "sha512-WaFHS3MCl5fapm3oLxU4eYDw77IQM2ACcxQ9RIxfaC3ooc6PFuBMGZZsYpvoXS5D5QTWPieo1jjLdAm3TBP3cQ==", + "requires": { + "mime-db": "1.40.0" + } + }, + "ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "negotiator": { + "version": "0.6.2", + "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.2.tgz", + "integrity": "sha512-hZXc7K2e+PgeI1eDBe/10Ard4ekbfrrqG8Ep+8Jmf4JID2bNg7NvCPOZN+kfF574pFQI7mum2AUqDidoKqcTOw==" + }, + "on-finished": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz", + "integrity": "sha1-IPEzZIGwg811M3mSoWlxqi2QaUc=", + "requires": { + "ee-first": "1.1.1" + } + }, + "parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==" + }, + "path-to-regexp": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", + "integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=" + }, + "proxy-addr": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.5.tgz", + "integrity": "sha512-t/7RxHXPH6cJtP0pRG6smSr9QJidhB+3kXu0KgXnbGYMgzEnUxRQ4/LDdfOwZEMyIh3/xHb8PX3t+lfL9z+YVQ==", + "requires": { + "forwarded": "~0.1.2", + "ipaddr.js": "1.9.0" + } + }, + "qs": { + "version": "6.7.0", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.7.0.tgz", + "integrity": "sha512-VCdBRNFTX1fyE7Nb6FYoURo/SPe62QCaAyzJvUjwRaIsc+NePBEniHlvxFmmX56+HZphIGtV0XeCirBtpDrTyQ==" + }, + "range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==" + }, + "raw-body": { + "version": "2.4.0", + "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.4.0.tgz", + "integrity": "sha512-4Oz8DUIwdvoa5qMJelxipzi/iJIi40O5cGV1wNYp5hvZP8ZN0T+jiNkL0QepXs+EsQ9XJ8ipEDoiH70ySUJP3Q==", + "requires": { + "bytes": "3.1.0", + "http-errors": "1.7.2", + "iconv-lite": "0.4.24", + "unpipe": "1.0.0" + } + }, + "safe-buffer": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz", + "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==" + }, + "safer-buffer": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", + "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==" + }, + "send": { + "version": "0.17.1", + "resolved": "https://registry.npmjs.org/send/-/send-0.17.1.tgz", + "integrity": "sha512-BsVKsiGcQMFwT8UxypobUKyv7irCNRHk1T0G680vk88yf6LBByGcZJOTJCrTP2xVN6yI+XjPJcNuE3V4fT9sAg==", + "requires": { + "debug": "2.6.9", + "depd": "~1.1.2", + "destroy": "~1.0.4", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "fresh": "0.5.2", + "http-errors": "~1.7.2", + "mime": "1.6.0", + "ms": "2.1.1", + "on-finished": "~2.3.0", + "range-parser": "~1.2.1", + "statuses": "~1.5.0" + }, + "dependencies": { + "ms": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.1.tgz", + "integrity": "sha512-tgp+dl5cGk28utYktBsrFqA7HKgrhgPsg6Z/EfhWI4gl1Hwq8B/GmY/0oXZ6nF8hDVesS/FpnYaD/kOWhYQvyg==" + } + } + }, + "serve-static": { + "version": "1.14.1", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.14.1.tgz", + "integrity": "sha512-JMrvUwE54emCYWlTI+hGrGv5I8dEwmco/00EvkzIIsR7MqrHonbD9pO2MOfFnpFntl7ecpZs+3mW+XbQZu9QCg==", + "requires": { + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "parseurl": "~1.3.3", + "send": "0.17.1" + } + }, + "setprototypeof": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.1.1.tgz", + "integrity": "sha512-JvdAWfbXeIGaZ9cILp38HntZSFSo3mWg6xGcJJsd+d4aRMOqauag1C63dJfDw7OaMYwEbHMOxEZ1lqVRYP2OAw==" + }, + "statuses": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.5.0.tgz", + "integrity": "sha1-Fhx9rBd2Wf2YEfQ3cfqZOBR4Yow=" + }, + "toidentifier": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.0.tgz", + "integrity": "sha512-yaOH/Pk/VEhBWWTlhI+qXxDFXlejDGcQipMlyxda9nthulaxLZUNcUqFxokp0vcYnvteJln5FNQDRrxj3YcbVw==" + }, + "type-is": { + "version": "1.6.18", + "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz", + "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==", + "requires": { + "media-typer": "0.3.0", + "mime-types": "~2.1.24" + } + }, + "unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=" + }, + "utils-merge": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "integrity": "sha1-n5VxD1CiZ5R7LMwSR0HBAoQn5xM=" + }, + "vary": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "integrity": "sha1-IpnwLG3tMNSllhsLn3RSShj2NPw=" + } + } +} diff --git a/package.json b/package.json new file mode 100644 index 0000000..8ec9605 --- /dev/null +++ b/package.json @@ -0,0 +1,17 @@ +{ + "name": "web", + "version": "1.0.0", + "main": "index.js", + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1", + "start": "node src/index.js" + }, + "keywords": [], + "author": "", + "license": "ISC", + "description": "Esta es una web de prueba", + "dependencies": { + "ejs": "^2.6.2", + "express": "^4.17.1" + } +} diff --git a/partials/footer.ejs b/partials/footer.ejs new file mode 100644 index 0000000..33a0e33 --- /dev/null +++ b/partials/footer.ejs @@ -0,0 +1,2 @@ +<!-- views/partials/footer.ejs --> +<p class="text-center text-muted">© Copyright 2019 Virtual Software Defined Network Over RaspberryPi Cluster</p> diff --git a/partials/head.ejs b/partials/head.ejs new file mode 100644 index 0000000..9d76f1e --- /dev/null +++ b/partials/head.ejs @@ -0,0 +1,9 @@ +<!-- views/partials/head.ejs --> +<meta charset="UTF-8"> +<title>VSoRC</title> +<!-- CSS (load bootstrap from a CDN) --> +<link rel="stylesheet" href="https://stackpath.bootstrapcdn.com/bootstrap/4.3.1/css/bootstrap.min.css" integrity="sha384-ggOyR0iXCbMQv3Xipma34MD+dH/1fQ784/j6cY/iJTQUOhcWr7x9JvoRxT2MZw1T" crossorigin="anonymous"> +<script src="https://cdn.plot.ly/plotly-latest.min.js"></script> +<style> + body { padding-bottom:50px; } +</style> diff --git a/partials/header.ejs b/partials/header.ejs new file mode 100644 index 0000000..c851504 --- /dev/null +++ b/partials/header.ejs @@ -0,0 +1,7 @@ + + +<nav class="navbar navbar-dark bg-dark"> + <form class="form-inline"> + <button class="btn btn-outline-success" type="button" onclick="location.href = '/';">VSoRC</button> + </form> +</nav> diff --git a/src/index.js b/src/index.js new file mode 100644 index 0000000..c598b02 --- /dev/null +++ b/src/index.js @@ -0,0 +1,25 @@ +const express = require('express'); // pide express sea requerido +const path = require('path'); // pide que path sea requerido + +// inicializaciones +const app = express(); + +//configuraciones +app.set('port', process.env.PORT || 3000); +app.set('views', path.join(__dirname, 'views')); +app.set('view engine', 'ejs'); + +//intermedio +app.use(express.urlencoded({ + extended: false +})); +app.use(express.json()); +//para que la ruta de estilos sea visible +app.use('/styles', express.static('styles')); +//rutas +app.use(require('./routes/index')); + +//inicia el servidor +app.listen(app.get('port'), () => { + console.log("Servidor escuchando en el puerto", app.get('port')) +}); diff --git a/src/routes/index.js b/src/routes/index.js new file mode 100644 index 0000000..bae8559 --- /dev/null +++ b/src/routes/index.js @@ -0,0 +1,69 @@ +const { + Router +} = require('express'); +const router = new Router(); + +let alumnos = []; + +router.get("/", (req, res) => { + res.render("index", { + alumnos + }) +}); + +router.get("/flex", (req, res) => { + res.render("flex") +}); + +router.get('/web', (req, res) => { + res.render('web') +}); + +router.post('/web', (req, res) => { + let { + nombre, + documento + } = req.body; + let nuevoRegistro = { + nombre, + documento, + fecha: new Date() + }; + alumnos.push(nuevoRegistro); + res.redirect("/"); +}); + +router.get('/free', (req, res) => { + var sys = require('sys') + var exec = require('child_process').exec; + var child; + child = exec("free -b | grep Mem | awk '{print $7}'", function(error, stdout, stderr) { + console.log("free"); + res.send(stdout); + }); +}); + + +router.get('/mpstat', (req, res) => { + var sys = require('sys') + var exec = require('child_process').exec; + var child; + child = exec("mpstat 1 1| grep all | awk '{print $13}'", function(error, stdout, stderr) { + console.log("mpstat"); + res.send(stdout); + }); +}); + + +router.get('/ifstat', (req, res) => { + var sys = require('sys') + var exec = require('child_process').exec; + var child; + child = exec("ifstat -n -b -i wlp2s0 0.3 1 | grep [0-9]$", function(error, stdout, stderr) { + console.log("ifstat"); + res.send(stdout); + }); +}); + + +module.exports = router; diff --git a/src/views/flex.ejs b/src/views/flex.ejs new file mode 100644 index 0000000..0e49d95 --- /dev/null +++ b/src/views/flex.ejs @@ -0,0 +1,196 @@ +<!DOCTYPE html> +<html> + +<head> + <title>Oscar Rodriguez</title> + <meta charset="UTF-8"> + <meta name="viewport" content="width=device-width, initial-scale=1"> + <style> + * { + box-sizing: border-box; + } + + /* Style the body */ + body { + font-family: Helvetica; + margin: 0; + padding: 0; + } + + /* Header/logo Title */ + .header { + position: relative; + width: 100; + height: 50vh; + justify-content: center; + align-items: center; + overflow: hidden; + padding: 60px; + text-align: center; + color: white; + + } + + .header::before { + content: ''; + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 90%; + background: linear-gradient(45deg, #ff0081, #1abc9c); + border-radius: 0 0 70% 70%/0 0 80% 80%; + + } + + .header::after { + content: ''; + position: absolute; + top: 10px; + left: 10px; + width: 100%; + height: 90%; + z-index: -1; + background: linear-gradient(45deg, #ff8156, #1abc9c); + border-radius: 0 0 70% 70%/0 0 80% 80%; + } + + .header h1, + .header img { + position: relative; + z-index: 1; + margin: 0; + max-width: 50rem; + text-align: center; + padding: 0; + } + + .header img { + margin-top: -1em; + width: 20vmax; + clip-path: circle(40% at 50% 50%); + + + } + + /* Style the top navigation bar */ + .navbar { + display: flex; + background-color: #333; + } + + /* Style the navigation bar links */ + .navbar a { + color: white; + padding: 14px 20px; + text-decoration: none; + text-align: center; + } + + /* Change color on hover */ + .navbar a:hover { + background-color: #ddd; + color: black; + } + + /* Column container */ + .row { + display: flex; + flex-wrap: wrap; + } + + /* Create two unequal columns that sits next to each other */ + /* Sidebar/left column */ + .side { + flex: 30%; + background-color: #f1f1f1; + padding: 1.4em; + } + + /* Main column */ + .main { + flex: 70%; + background-color: #deffde; + padding: 1.2em; + } + + /* Fake image, just for this example */ + .fakeimg { + background-color: #aaa; + width: 100%; + padding: 1.2em; + } + + /* Footer */ + .footer { + padding: 20px; + text-align: center; + background: + linear-gradient(45deg, rgba(50, 70, 40, 0.9) 40%, rgba(0, 0, 0, 0)0%, rgba(20, 57, 90, 1) 60%, rgba(0, 0, 0, 0)0%); + } + + /* Responsive layout - when the screen is less than 700px wide, make the two columns stack on top of each other instead of next to each other */ + @media screen and (max-width: 700px) { + + .row, + .navbar { + flex-direction: column; + } + + } + </style> +</head> + +<body> + <!-- Navigation Bar --> + <div class="navbar"> + <a href="#">Link</a> + <a href="#">Link</a> + <a href="#">Link</a> + <a href="#">Link</a> + </div> + + <!-- Header --> + <div class="header"> + <h1>Oscar J. Rodriguez B.</h1> + <img + src="https://scontent-lhr3-1.cdninstagram.com/v/t51.2885-15/e35/57262952_386137918906120_2475495091722910682_n.jpg?_nc_ht=scontent-lhr3-1.cdninstagram.com&se=7&oh=7e906d85b42ba3e63cae32ede44d2361&oe=5DF78AC7&ig_cache_key=MjAyNTAyODcyODQ5Nzk3MTY2Mg%3D%3D.2" + alt=""> + </div> + + <!-- The flexible grid (content) --> + <div class="row"> + <div class="side"> + <h2>About Me</h2> + <h5>Photo of me:</h5> + <div class="fakeimg" style="height:200px;">Image</div> + <p>Some text about me in culpa qui officia deserunt mollit anim..</p> + <h3>More Text</h3> + <p>Lorem ipsum dolor sit ame.</p> + <div class="fakeimg" style="height:60px;">Image</div><br> + <div class="fakeimg" style="height:60px;">Image</div><br> + <div class="fakeimg" style="height:60px;">Image</div> + </div> + <div class="main"> + <h2>TITLE HEADING</h2> + <h5>Title description, Dec 7, 2017</h5> + <div class="fakeimg" style="height:200px;">Image</div> + <p>Some text..</p> + <p>Sunt in culpa qui officia deserunt mollit anim id est laborum consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco.</p> + <br> + <h2>TITLE HEADING</h2> + <h5>Title description, Sep 2, 2017</h5> + <div class="fakeimg" style="height:200px;">Image</div> + <p>Some text..</p> + <p>Sunt in culpa qui officia deserunt mollit anim id est laborum consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco.</p> + </div> + </div> + + <!-- Footer --> + <div class="footer"> + <h2>Footer</h2> + </div> + +</body> + +</html> \ No newline at end of file diff --git a/src/views/index.ejs b/src/views/index.ejs new file mode 100644 index 0000000..7980275 --- /dev/null +++ b/src/views/index.ejs @@ -0,0 +1,170 @@ +<!DOCTYPE html> +<html> + +<head> + <title>SystemStats</title> + <link rel="stylesheet" type="text/css" href="/styles/main.css" /> + <%include ../../partials/head%> +</head> + +<body> + <header> + <%include ../../partials/header%> + </header> + + <div class="realtime"> + <div class="navbar navbar-dark bg-light"><span>Memoria libre en el sistema</span></div> + <div class="wrapper"> + <div id="ram"></div> + <script> + Plotly.plot('ram', [{ + y: [0], + type: 'line' + }], { + paper_bgcolor: 'rgba(0,0,0,0)', + plot_bgcolor: 'rgba(0,0,0,0)' + }, { + responsive: true + }); + + var cnt1 = 0; + + function updatePlot(value) { + + Plotly.extendTraces('ram', { + y: [ + [value] + ] + }, [0]); + cnt1++; + if (cnt1 > 100) { + Plotly.relayout('ram', { + xaxis: { + range: [cnt - 100, cnt] + } + }); + } + } + setInterval(function() { + let xhr = new XMLHttpRequest(); + xhr.open('GET', '/free', true); + //console.log(xhr); //para ver en la consola + xhr.onload = function() { + if (xhr.status == 200) { //can use this.status instead + //console.log(xhr.responseText);// para ver en la consola + updatePlot(xhr.responseText) + } + } + xhr.send(); + }, 2000) + </script> + + </div> + <div class="navbar navbar-dark bg-light"><span>CPU libre en el sistema</span></div> + <div class="wrapper CPU"> + <!-- <div></div> --> + <div id="cpu"></div> + <!-- <div></div> --> + <script type="text/javascript"> + function updatePlot2(value) { + var data = [{ + values: [parseInt(value), 100 - value], + labels: ['idle', 'used'], + type: 'pie' + }]; + var layout = { + height: 400, + width: 500, + paper_bgcolor: 'rgba(0,0,0,0)', + plot_bgcolor: 'rgba(0,0,0,0)' + + } + + Plotly.react('cpu', data, layout, { + responsive: true + }); + } + setInterval(function() { + let xhr = new XMLHttpRequest(); + xhr.open('GET', '/mpstat', true); + //console.log(xhr); //para ver en la consola + xhr.onload = function() { + if (xhr.status == 200) { //can use this.status instead + //console.log(xhr.responseText);// para ver en la consola + updatePlot2(xhr.responseText) + } + } + xhr.send(); + }, 2000) + </script> + </div> + <div class="navbar navbar-dark bg-light"><span>Trafico de la Red</span></div> + <div class="wrapper"> + <div id="trafico"></div> + <script> + Plotly.plot('trafico', [{ + y: [0, 1], + type: 'line', + name: 'in' + }, { + y: [0, 3], + type: 'line', + name: 'out' + }], { + paper_bgcolor: 'rgba(0,0,0,0)', + plot_bgcolor: 'rgba(0,0,0,0)' + }, { + responsive: true + }); + + var cnt2 = 0; + + function updatePlot3(value1) { + Plotly.extendTraces('trafico', { + y: [ + [value1[0]], + [value1[1]] + ] + }, [0, 1]).then(function() { + cnt2++; + }) + + if (cnt2 > 100) { + Plotly.relayout('trafico', { + xaxis: { + range: [cnt2 - 100, cnt2] + } + }); + } + } + setInterval(function() { + let xhr = new XMLHttpRequest(); + xhr.open('GET', '/ifstat', true); + //console.log(xhr); //para ver en la consola + xhr.onload = function() { + if (xhr.status == 200) { //can use this.status instead + // console.log(xhr.responseText); // para ver en la consola + var Response = xhr.responseText.replace(/ +/g, ' '); + Response = Response.split(" "); + // Response = [parseFloat(Response[1]), parseFloat(Response[2])]; + Response = [Response[1], Response[2]]; + console.log(Response); + updatePlot3(Response) + } + } + xhr.send(); + }, 500) + </script> + + </div> + </div> + <div class="viewframe"> + <iframe class="iframea" id="ImportFrame" src="http://localhost:8080"></iframe> + </div> +</body> +<footer> + <%include ../../partials/footer%> +</footer> + + +</html> \ No newline at end of file diff --git a/src/views/web.ejs b/src/views/web.ejs new file mode 100644 index 0000000..c1ec349 --- /dev/null +++ b/src/views/web.ejs @@ -0,0 +1,34 @@ +<!DOCTYPE html> +<html> + +<head> + <title>Register new</title> + <%include ../../partials/head%> +</head> + +<body> + <header> + <%include ../../partials/header%> + </header> + <div id="container" class="container"> + <div class="col-xs-8 col-xs-offset-2"> + <h2 class="text-center">Nuevo registro</h2> + <form method="post" role="form"> + <div class="form-group"> + <label for="nombre">Nombre completo</label> + <input class="form-control" type="text" name="nombre" placeholder="Nombre completo"> + </div> + <div class="form-group"> + <label for="documento">Numero de documento</label> + <input type="text" name="documento" class="form-control" placeholder="Numero de documento"> + </div> + <div class="form-group"> + <button class="btn btn-primary">Registrar</button> + </div> + </form> + </div> + </div> +</body> +<%include ../../partials/footer%> + +</html> \ No newline at end of file diff --git a/styles/main.css b/styles/main.css new file mode 100644 index 0000000..4891d33 --- /dev/null +++ b/styles/main.css @@ -0,0 +1,47 @@ +body { + background: + linear-gradient(238deg, rgba(70, 70, 70, 0.09) 0%, rgba(70, 70, 70, 0.09) 50%, rgba(214, 214, 214, 0.09) 50%, rgba(214, 214, 214, 0.09) 100%), + linear-gradient(126deg, rgba(223, 223, 223, 0.05) 0%, rgba(223, 223, 223, 0.05) 50%, rgba(217, 217, 217, 0.05) 50%, rgba(217, 217, 217, 0.05) 100%), + linear-gradient(152deg, rgba(116, 116, 116, 0.08) 0%, rgba(116, 116, 116, 0.08) 50%, rgba(248, 248, 248, 0.08) 50%, rgba(248, 248, 248, 0.08) 100%), + linear-gradient(225deg, rgba(1, 1, 1, 0.07) 0%, rgba(1, 1, 1, 0.07) 50%, rgba(5, 5, 5, 0.07) 50%, rgba(5, 5, 5, 0.07) 100%), + linear-gradient(194deg, rgba(14, 14, 14, 0.09) 0%, rgba(14, 14, 14, 0.09) 50%, rgba(206, 206, 206, 0.09) 50%, rgba(206, 206, 206, 0.09) 100%), + linear-gradient(100deg, rgba(220, 220, 220, 0.07) 0%, rgba(220, 220, 220, 0.07) 50%, rgba(65, 65, 65, 0.07) 50%, rgba(65, 65, 65, 0.07) 100%), + linear-gradient(190deg, rgba(194, 194, 194, 0.03) 0%, rgba(194, 194, 194, 0.03) 50%, rgba(206, 206, 206, 0.03) 50%, rgba(206, 206, 206, 0.03) 100%), + linear-gradient(320deg, rgba(10, 10, 10, 0.08) 0%, rgba(10, 10, 10, 0.08) 50%, rgba(231, 231, 231, 0.08) 50%, rgba(231, 231, 231, 0.08) 100%), + linear-gradient(90deg, rgb(10, 147, 39), rgb(235, 252, 123)); + display: flex; + flex-direction: column; +} + +.realtime { + /* width: 100vw; + height: auto; + display: flex; + flex-flow: column wrap; + justify-content: space-around; + align-items: stretch; + align-content: stretch; */ +} + +.CPU { + display: flex; + align-items: stretch; + align-content: stretch; + justify-content: space-around; +} +.CPU div{ + flex-shrink:1; +} +.iframea { + display: flex; + width: 100%; + height: 40em; + overflow: auto; + border-radius: 20px; +} +#ram, #cpu, #trafico{ + +} +.navbar{ + width: auto; +} -- 2.25.1